// ==UserScript==
// @name douyu-crx
// @namespace npm/douyu-crx
// @version 1.9
// @author monkey
// @description 斗鱼插件
// @icon https://vitejs.dev/logo.svg
// @match *://*.douyu.com/0*
// @match *://*.douyu.com/1*
// @match *://*.douyu.com/2*
// @match *://*.douyu.com/3*
// @match *://*.douyu.com/4*
// @match *://*.douyu.com/5*
// @match *://*.douyu.com/6*
// @match *://*.douyu.com/7*
// @match *://*.douyu.com/8*
// @match *://*.douyu.com/9*
// @match *://*.douyu.com/topic/*
// @require https://lib.baomitu.com/vue/3.4.35/vue.global.prod.js
// @require data:application/javascript,%3Bwindow.Vue%3DVue%3B
// @require https://lib.baomitu.com/element-plus/2.7.8/index.full.min.js
// @require https://lib.baomitu.com/qs/6.13.0/qs.min.js
// @require https://lib.baomitu.com/vue-demi/0.14.10/index.iife.min.js
// @require https://lib.baomitu.com/pinia/2.2.0/pinia.iife.min.js
// @resource element-plus/dist/index.css https://lib.baomitu.com/element-plus/2.7.8/index.css
// @connect doseeing.com
// @connect douyu.com
// @grant GM_addStyle
// @grant GM_getResourceText
// @grant GM_log
// @grant GM_registerMenuCommand
// @grant GM_xmlhttpRequest
// @grant unsafeWindow
// ==/UserScript==
(e=>{if(typeof GM_addStyle=="function"){GM_addStyle(e);return}const r=document.createElement("style");r.textContent=e,document.head.append(r)})(' @charset "UTF-8";*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }.visible{visibility:visible}.static{position:static}.fixed{position:fixed}.top-0{top:0}.z-\\[10000\\]{z-index:10000}.mb-4{margin-bottom:1rem}.ml-12{margin-left:3rem}.ml-2{margin-left:.5rem}.ml-5{margin-left:1.25rem}.flex{display:flex}.h-16{height:4rem}.h-20{height:5rem}.h-\\[32px\\]{height:32px}.h-\\[58vh\\]{height:58vh}.h-\\[80px\\]{height:80px}.w-16{width:4rem}.w-20{width:5rem}.w-56{width:14rem}.w-\\[32px\\]{width:32px}.w-full{width:100%}.flex-1{flex:1 1 0%}.flex-none{flex:none}.transform{transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.cursor-move{cursor:move}.cursor-pointer{cursor:pointer}.items-start{align-items:flex-start}.items-center{align-items:center}.justify-center{justify-content:center}.justify-between{justify-content:space-between}.rounded-\\[6px\\]{border-radius:6px}.rounded-md{border-radius:.375rem}.rounded-xl{border-radius:.75rem}.p-\\[20px\\]{padding:20px}.pt-\\[5px\\]{padding-top:5px}.text-center{text-align:center}.text-3xl{font-size:1.875rem;line-height:2.25rem}.text-\\[14px\\]{font-size:14px}.text-xl{font-size:1.25rem;line-height:1.75rem}.font-black{font-weight:900}.font-bold{font-weight:700}.text-slate-400{--tw-text-opacity: 1;color:rgb(148 163 184 / var(--tw-text-opacity))}.text-white{--tw-text-opacity: 1;color:rgb(255 255 255 / var(--tw-text-opacity))}:root{--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary-rgb:64,158,255;--el-color-success-rgb:103,194,58;--el-color-warning-rgb:230,162,60;--el-color-danger-rgb:245,108,108;--el-color-error-rgb:245,108,108;--el-color-info-rgb:144,147,153;--el-font-size-extra-large:20px;--el-font-size-large:18px;--el-font-size-medium:16px;--el-font-size-base:14px;--el-font-size-small:13px;--el-font-size-extra-small:12px;--el-font-family:"Helvetica Neue",Helvetica,"PingFang SC","Hiragino Sans GB","Microsoft YaHei","\u5FAE\u8F6F\u96C5\u9ED1",Arial,sans-serif;--el-font-weight-primary:500;--el-font-line-height-primary:24px;--el-index-normal:1;--el-index-top:1000;--el-index-popper:2000;--el-border-radius-base:4px;--el-border-radius-small:2px;--el-border-radius-round:20px;--el-border-radius-circle:100%;--el-transition-duration:.3s;--el-transition-duration-fast:.2s;--el-transition-function-ease-in-out-bezier:cubic-bezier(.645,.045,.355,1);--el-transition-function-fast-bezier:cubic-bezier(.23,1,.32,1);--el-transition-all:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade:opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade:transform var(--el-transition-duration) var(--el-transition-function-fast-bezier),opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear:opacity var(--el-transition-duration-fast) linear;--el-transition-border:border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow:box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color:color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large:40px;--el-component-size:32px;--el-component-size-small:24px;color-scheme:light;--el-color-primary:#409eff;--el-color-primary-light-3:#79bbff;--el-color-primary-light-5:#a0cfff;--el-color-primary-light-7:#c6e2ff;--el-color-primary-light-8:#d9ecff;--el-color-primary-light-9:#ecf5ff;--el-color-primary-dark-2:#337ecc;--el-color-success:#67c23a;--el-color-success-light-3:#95d475;--el-color-success-light-5:#b3e19d;--el-color-success-light-7:#d1edc4;--el-color-success-light-8:#e1f3d8;--el-color-success-light-9:#f0f9eb;--el-color-success-dark-2:#529b2e;--el-color-warning:#e6a23c;--el-color-warning-light-3:#eebe77;--el-color-warning-light-5:#f3d19e;--el-color-warning-light-7:#f8e3c5;--el-color-warning-light-8:#faecd8;--el-color-warning-light-9:#fdf6ec;--el-color-warning-dark-2:#b88230;--el-color-danger:#f56c6c;--el-color-danger-light-3:#f89898;--el-color-danger-light-5:#fab6b6;--el-color-danger-light-7:#fcd3d3;--el-color-danger-light-8:#fde2e2;--el-color-danger-light-9:#fef0f0;--el-color-danger-dark-2:#c45656;--el-color-error:#f56c6c;--el-color-error-light-3:#f89898;--el-color-error-light-5:#fab6b6;--el-color-error-light-7:#fcd3d3;--el-color-error-light-8:#fde2e2;--el-color-error-light-9:#fef0f0;--el-color-error-dark-2:#c45656;--el-color-info:#909399;--el-color-info-light-3:#b1b3b8;--el-color-info-light-5:#c8c9cc;--el-color-info-light-7:#dedfe0;--el-color-info-light-8:#e9e9eb;--el-color-info-light-9:#f4f4f5;--el-color-info-dark-2:#73767a;--el-bg-color:#ffffff;--el-bg-color-page:#f2f3f5;--el-bg-color-overlay:#ffffff;--el-text-color-primary:#303133;--el-text-color-regular:#606266;--el-text-color-secondary:#909399;--el-text-color-placeholder:#a8abb2;--el-text-color-disabled:#c0c4cc;--el-border-color:#dcdfe6;--el-border-color-light:#e4e7ed;--el-border-color-lighter:#ebeef5;--el-border-color-extra-light:#f2f6fc;--el-border-color-dark:#d4d7de;--el-border-color-darker:#cdd0d6;--el-fill-color:#f0f2f5;--el-fill-color-light:#f5f7fa;--el-fill-color-lighter:#fafafa;--el-fill-color-extra-light:#fafcff;--el-fill-color-dark:#ebedf0;--el-fill-color-darker:#e6e8eb;--el-fill-color-blank:#ffffff;--el-box-shadow:0px 12px 32px 4px rgba(0,0,0,.04),0px 8px 20px rgba(0,0,0,.08);--el-box-shadow-light:0px 0px 12px rgba(0,0,0,.12);--el-box-shadow-lighter:0px 0px 6px rgba(0,0,0,.12);--el-box-shadow-dark:0px 16px 48px 16px rgba(0,0,0,.08),0px 12px 32px rgba(0,0,0,.12),0px 8px 16px -8px rgba(0,0,0,.16);--el-disabled-bg-color:var(--el-fill-color-light);--el-disabled-text-color:var(--el-text-color-placeholder);--el-disabled-border-color:var(--el-border-color-light);--el-overlay-color:rgba(0,0,0,.8);--el-overlay-color-light:rgba(0,0,0,.7);--el-overlay-color-lighter:rgba(0,0,0,.5);--el-mask-color:rgba(255,255,255,.9);--el-mask-color-extra-light:rgba(255,255,255,.3);--el-border-width:1px;--el-border-style:solid;--el-border-color-hover:var(--el-text-color-disabled);--el-border:var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey:var(--el-border-color)}.el-icon-loading{animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(1turn)}}.el-icon{--color:inherit;align-items:center;display:inline-flex;height:1em;justify-content:center;line-height:1em;position:relative;width:1em;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}:root{--el-loading-spinner-size:42px;--el-loading-fullscreen-spinner-size:50px}.el-loading-parent--relative{position:relative!important}.el-loading-parent--hidden{overflow:hidden!important}.el-loading-mask{background-color:var(--el-mask-color);bottom:0;left:0;margin:0;position:absolute;right:0;top:0;transition:opacity var(--el-transition-duration);z-index:2000}.el-loading-mask.is-fullscreen{position:fixed}.el-loading-mask.is-fullscreen .el-loading-spinner{margin-top:calc((0px - var(--el-loading-fullscreen-spinner-size))/2)}.el-loading-mask.is-fullscreen .el-loading-spinner .circular{height:var(--el-loading-fullscreen-spinner-size);width:var(--el-loading-fullscreen-spinner-size)}.el-loading-spinner{margin-top:calc((0px - var(--el-loading-spinner-size))/2);position:absolute;text-align:center;top:50%;width:100%}.el-loading-spinner .el-loading-text{color:var(--el-color-primary);font-size:14px;margin:3px 0}.el-loading-spinner .circular{animation:loading-rotate 2s linear infinite;display:inline;height:var(--el-loading-spinner-size);width:var(--el-loading-spinner-size)}.el-loading-spinner .path{animation:loading-dash 1.5s ease-in-out infinite;stroke-dasharray:90,150;stroke-dashoffset:0;stroke-width:2;stroke:var(--el-color-primary);stroke-linecap:round}.el-loading-spinner i{color:var(--el-color-primary)}.el-loading-fade-enter-from,.el-loading-fade-leave-to{opacity:0}@keyframes loading-rotate{to{transform:rotate(1turn)}}@keyframes loading-dash{0%{stroke-dasharray:1,200;stroke-dashoffset:0}50%{stroke-dasharray:90,150;stroke-dashoffset:-40px}to{stroke-dasharray:90,150;stroke-dashoffset:-120px}}:root{--el-popup-modal-bg-color:var(--el-color-black);--el-popup-modal-opacity:.5}.v-modal-enter{animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-out{to{opacity:0}}.v-modal{background:var(--el-popup-modal-bg-color);height:100%;left:0;opacity:var(--el-popup-modal-opacity);position:fixed;top:0;width:100%}.el-popup-parent--hidden{overflow:hidden}.el-dialog{--el-dialog-width:50%;--el-dialog-margin-top:15vh;--el-dialog-bg-color:var(--el-bg-color);--el-dialog-box-shadow:var(--el-box-shadow);--el-dialog-title-font-size:var(--el-font-size-large);--el-dialog-content-font-size:14px;--el-dialog-font-line-height:var(--el-font-line-height-primary);--el-dialog-padding-primary:16px;--el-dialog-border-radius:var(--el-border-radius-small);background:var(--el-dialog-bg-color);border-radius:var(--el-dialog-border-radius);box-shadow:var(--el-dialog-box-shadow);box-sizing:border-box;margin:var(--el-dialog-margin-top,15vh) auto 50px;overflow-wrap:break-word;padding:var(--el-dialog-padding-primary);position:relative;width:var(--el-dialog-width,50%)}.el-dialog:focus{outline:none!important}.el-dialog.is-align-center{margin:auto}.el-dialog.is-fullscreen{--el-dialog-width:100%;--el-dialog-margin-top:0;height:100%;margin-bottom:0;overflow:auto}.el-dialog__wrapper{bottom:0;left:0;margin:0;overflow:auto;position:fixed;right:0;top:0}.el-dialog.is-draggable .el-dialog__header{cursor:move;-webkit-user-select:none;user-select:none}.el-dialog__header{padding-bottom:var(--el-dialog-padding-primary)}.el-dialog__header.show-close{padding-right:calc(var(--el-dialog-padding-primary) + var(--el-message-close-size, 16px))}.el-dialog__headerbtn{background:transparent;border:none;cursor:pointer;font-size:var(--el-message-close-size,16px);height:48px;outline:none;padding:0;position:absolute;right:0;top:0;width:48px}.el-dialog__headerbtn .el-dialog__close{color:var(--el-color-info);font-size:inherit}.el-dialog__headerbtn:focus .el-dialog__close,.el-dialog__headerbtn:hover .el-dialog__close{color:var(--el-color-primary)}.el-dialog__title{color:var(--el-text-color-primary);font-size:var(--el-dialog-title-font-size);line-height:var(--el-dialog-font-line-height)}.el-dialog__body{color:var(--el-text-color-regular);font-size:var(--el-dialog-content-font-size)}.el-dialog__footer{box-sizing:border-box;padding-top:var(--el-dialog-padding-primary);text-align:right}.el-dialog--center{text-align:center}.el-dialog--center .el-dialog__body{text-align:initial}.el-dialog--center .el-dialog__footer{text-align:inherit}.el-overlay-dialog{bottom:0;left:0;overflow:auto;position:fixed;right:0;top:0}.dialog-fade-enter-active{animation:modal-fade-in var(--el-transition-duration)}.dialog-fade-enter-active .el-overlay-dialog{animation:dialog-fade-in var(--el-transition-duration)}.dialog-fade-leave-active{animation:modal-fade-out var(--el-transition-duration)}.dialog-fade-leave-active .el-overlay-dialog{animation:dialog-fade-out var(--el-transition-duration)}@keyframes dialog-fade-in{0%{opacity:0;transform:translate3d(0,-20px,0)}to{opacity:1;transform:translateZ(0)}}@keyframes dialog-fade-out{0%{opacity:1;transform:translateZ(0)}to{opacity:0;transform:translate3d(0,-20px,0)}}@keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}.el-overlay{background-color:var(--el-overlay-color-lighter);bottom:0;height:100%;left:0;overflow:auto;position:fixed;right:0;top:0;z-index:2000}.el-overlay .el-overlay-root{height:0}.el-scrollbar{--el-scrollbar-opacity:.3;--el-scrollbar-bg-color:var(--el-text-color-secondary);--el-scrollbar-hover-opacity:.5;--el-scrollbar-hover-bg-color:var(--el-text-color-secondary);height:100%;overflow:hidden;position:relative}.el-scrollbar__wrap{height:100%;overflow:auto}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{background-color:var(--el-scrollbar-bg-color,var(--el-text-color-secondary));border-radius:inherit;cursor:pointer;display:block;height:0;opacity:var(--el-scrollbar-opacity,.3);position:relative;transition:var(--el-transition-duration) background-color;width:0}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color,var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity,.5)}.el-scrollbar__bar{border-radius:4px;bottom:2px;position:absolute;right:2px;z-index:1}.el-scrollbar__bar.is-vertical{top:2px;width:6px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity .34s ease-out}.el-scrollbar-fade-leave-active{transition:opacity .12s ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}.el-divider{position:relative}.el-divider--horizontal{border-top:1px var(--el-border-color) var(--el-border-style);display:block;height:1px;margin:24px 0;width:100%}.el-divider--vertical{border-left:1px var(--el-border-color) var(--el-border-style);display:inline-block;height:1em;margin:0 8px;position:relative;vertical-align:middle;width:1px}.el-divider__text{background-color:var(--el-bg-color);color:var(--el-text-color-primary);font-size:14px;font-weight:500;padding:0 20px;position:absolute}.el-divider__text.is-left{left:20px;transform:translateY(-50%)}.el-divider__text.is-center{left:50%;transform:translate(-50%) translateY(-50%)}.el-divider__text.is-right{right:20px;transform:translateY(-50%)}.el-date-table{font-size:12px;-webkit-user-select:none;user-select:none}.el-date-table.is-week-mode .el-date-table__row:hover .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table.is-week-mode .el-date-table__row:hover td.available:hover{color:var(--el-datepicker-text-color)}.el-date-table.is-week-mode .el-date-table__row:hover td:first-child .el-date-table-cell{border-bottom-left-radius:15px;border-top-left-radius:15px;margin-left:5px}.el-date-table.is-week-mode .el-date-table__row:hover td:last-child .el-date-table-cell{border-bottom-right-radius:15px;border-top-right-radius:15px;margin-right:5px}.el-date-table.is-week-mode .el-date-table__row.current .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td{box-sizing:border-box;cursor:pointer;height:30px;padding:4px 0;position:relative;text-align:center;width:32px}.el-date-table td .el-date-table-cell{box-sizing:border-box;height:30px;padding:3px 0}.el-date-table td .el-date-table-cell .el-date-table-cell__text{border-radius:50%;display:block;height:24px;left:50%;line-height:24px;margin:0 auto;position:absolute;transform:translate(-50%);width:24px}.el-date-table td.next-month,.el-date-table td.prev-month{color:var(--el-datepicker-off-text-color)}.el-date-table td.today{position:relative}.el-date-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-date-table td.today.end-date .el-date-table-cell__text,.el-date-table td.today.start-date .el-date-table-cell__text{color:#fff}.el-date-table td.available:hover{color:var(--el-datepicker-hover-text-color)}.el-date-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-date-table td.current:not(.disabled) .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);color:#fff}.el-date-table td.current:not(.disabled):focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-date-table td.end-date .el-date-table-cell,.el-date-table td.start-date .el-date-table-cell{color:#fff}.el-date-table td.end-date .el-date-table-cell__text,.el-date-table td.start-date .el-date-table-cell__text{background-color:var(--el-datepicker-active-color)}.el-date-table td.start-date .el-date-table-cell{border-bottom-left-radius:15px;border-top-left-radius:15px;margin-left:5px}.el-date-table td.end-date .el-date-table-cell{border-bottom-right-radius:15px;border-top-right-radius:15px;margin-right:5px}.el-date-table td.disabled .el-date-table-cell{background-color:var(--el-fill-color-light);color:var(--el-text-color-placeholder);cursor:not-allowed;opacity:1}.el-date-table td.selected .el-date-table-cell{border-radius:15px;margin-left:5px;margin-right:5px}.el-date-table td.selected .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);border-radius:15px;color:#fff}.el-date-table td.week{color:var(--el-datepicker-header-text-color);font-size:80%}.el-date-table td:focus{outline:none}.el-date-table th{border-bottom:1px solid var(--el-border-color-lighter);color:var(--el-datepicker-header-text-color);font-weight:400;padding:5px}.el-month-table{border-collapse:collapse;font-size:12px;margin:-1px}.el-month-table td{cursor:pointer;padding:8px 0;position:relative;text-align:center;width:68px}.el-month-table td div{box-sizing:border-box;height:48px;padding:6px 0}.el-month-table td.today .cell{color:var(--el-color-primary);font-weight:700}.el-month-table td.today.end-date .cell,.el-month-table td.today.start-date .cell{color:#fff}.el-month-table td.disabled .cell{background-color:var(--el-fill-color-light);cursor:not-allowed}.el-month-table td.disabled .cell,.el-month-table td.disabled .cell:hover{color:var(--el-text-color-placeholder)}.el-month-table td .cell{border-radius:18px;color:var(--el-datepicker-text-color);display:block;height:36px;left:50%;line-height:36px;margin:0 auto;position:absolute;transform:translate(-50%);width:54px}.el-month-table td .cell:hover{color:var(--el-datepicker-hover-text-color)}.el-month-table td.in-range div{background-color:var(--el-datepicker-inrange-bg-color)}.el-month-table td.in-range div:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-month-table td.end-date div,.el-month-table td.start-date div{color:#fff}.el-month-table td.end-date .cell,.el-month-table td.start-date .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-month-table td.start-date div{border-bottom-left-radius:24px;border-top-left-radius:24px;margin-left:3px}.el-month-table td.end-date div{border-bottom-right-radius:24px;border-top-right-radius:24px;margin-right:3px}.el-month-table td.current:not(.disabled) div{border-radius:24px;margin-left:3px;margin-right:3px}.el-month-table td.current:not(.disabled) .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-month-table td:focus-visible{outline:none}.el-month-table td:focus-visible .cell{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-year-table{border-collapse:collapse;font-size:12px;margin:-1px}.el-year-table .el-icon{color:var(--el-datepicker-icon-color)}.el-year-table td{cursor:pointer;padding:8px 0;position:relative;text-align:center;width:68px}.el-year-table td div{box-sizing:border-box;height:48px;padding:6px 0}.el-year-table td.today .cell{color:var(--el-color-primary);font-weight:700}.el-year-table td.disabled .cell{background-color:var(--el-fill-color-light);cursor:not-allowed}.el-year-table td.disabled .cell,.el-year-table td.disabled .cell:hover{color:var(--el-text-color-placeholder)}.el-year-table td .cell{border-radius:18px;color:var(--el-datepicker-text-color);display:block;height:36px;left:50%;line-height:36px;margin:0 auto;position:absolute;transform:translate(-50%);width:54px}.el-year-table td .cell:hover{color:var(--el-datepicker-hover-text-color)}.el-year-table td.current:not(.disabled) div{border-radius:24px;margin-left:3px;margin-right:3px}.el-year-table td.current:not(.disabled) .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-year-table td:focus-visible{outline:none}.el-year-table td:focus-visible .cell{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-time-spinner.has-seconds .el-time-spinner__wrapper{width:33.3%}.el-time-spinner__wrapper{display:inline-block;max-height:192px;overflow:auto;position:relative;vertical-align:top;width:50%}.el-time-spinner__wrapper.el-scrollbar__wrap:not(.el-scrollbar__wrap--hidden-default){padding-bottom:15px}.el-time-spinner__wrapper.is-arrow{box-sizing:border-box;overflow:hidden;text-align:center}.el-time-spinner__wrapper.is-arrow .el-time-spinner__list{transform:translateY(-32px)}.el-time-spinner__wrapper.is-arrow .el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:default}.el-time-spinner__arrow{color:var(--el-text-color-secondary);cursor:pointer;font-size:12px;height:30px;left:0;line-height:30px;position:absolute;text-align:center;width:100%;z-index:var(--el-index-normal)}.el-time-spinner__arrow:hover{color:var(--el-color-primary)}.el-time-spinner__arrow.arrow-up{top:10px}.el-time-spinner__arrow.arrow-down{bottom:10px}.el-time-spinner__input.el-input{width:70%}.el-time-spinner__input.el-input .el-input__inner,.el-time-spinner__list{padding:0;text-align:center}.el-time-spinner__list{list-style:none;margin:0}.el-time-spinner__list:after,.el-time-spinner__list:before{content:"";display:block;height:80px;width:100%}.el-time-spinner__item{color:var(--el-text-color-regular);font-size:12px;height:32px;line-height:32px}.el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:pointer}.el-time-spinner__item.is-active:not(.is-disabled){color:var(--el-text-color-primary);font-weight:700}.el-time-spinner__item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transform-origin:center top;transition:var(--el-transition-md-fade)}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transform-origin:center bottom;transition:var(--el-transition-md-fade)}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transform-origin:top left;transition:var(--el-transition-md-fade)}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-picker__popper{--el-datepicker-border-color:var(--el-disabled-border-color)}.el-picker__popper.el-popper{background:var(--el-bg-color-overlay);box-shadow:var(--el-box-shadow-light)}.el-picker__popper.el-popper,.el-picker__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-datepicker-border-color)}.el-picker__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-left-color:transparent;border-top-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-bottom-color:transparent;border-left-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-date-editor{--el-date-editor-width:220px;--el-date-editor-monthrange-width:300px;--el-date-editor-daterange-width:350px;--el-date-editor-datetimerange-width:400px;--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;position:relative;text-align:left;vertical-align:middle}.el-date-editor.el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset}.el-date-editor.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-date-editor.el-input,.el-date-editor.el-input__wrapper{height:var(--el-input-height,var(--el-component-size));width:var(--el-date-editor-width)}.el-date-editor--monthrange{--el-date-editor-width:var(--el-date-editor-monthrange-width)}.el-date-editor--daterange,.el-date-editor--timerange{--el-date-editor-width:var(--el-date-editor-daterange-width)}.el-date-editor--datetimerange{--el-date-editor-width:var(--el-date-editor-datetimerange-width)}.el-date-editor--dates .el-input__wrapper{text-overflow:ellipsis;white-space:nowrap}.el-date-editor .clear-icon,.el-date-editor .close-icon{cursor:pointer}.el-date-editor .clear-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__icon{color:var(--el-text-color-placeholder);float:left;font-size:14px;height:inherit}.el-date-editor .el-range__icon svg{vertical-align:middle}.el-date-editor .el-range-input{-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent;border:none;color:var(--el-text-color-regular);display:inline-block;font-size:var(--el-font-size-base);height:30px;line-height:30px;margin:0;outline:none;padding:0;text-align:center;width:39%}.el-date-editor .el-range-input::placeholder{color:var(--el-text-color-placeholder)}.el-date-editor .el-range-separator{align-items:center;color:var(--el-text-color-primary);display:inline-flex;flex:1;font-size:14px;height:100%;justify-content:center;margin:0;overflow-wrap:break-word;padding:0 5px}.el-date-editor .el-range__close-icon{color:var(--el-text-color-placeholder);cursor:pointer;font-size:14px;height:inherit;width:unset}.el-date-editor .el-range__close-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__close-icon svg{vertical-align:middle}.el-date-editor .el-range__close-icon--hidden{opacity:0;visibility:hidden}.el-range-editor.el-input__wrapper{align-items:center;display:inline-flex;padding:0 10px}.el-range-editor.is-active,.el-range-editor.is-active:hover{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-range-editor--large{line-height:var(--el-component-size-large)}.el-range-editor--large.el-input__wrapper{height:var(--el-component-size-large)}.el-range-editor--large .el-range-separator{font-size:14px;line-height:40px}.el-range-editor--large .el-range-input{font-size:14px;height:38px;line-height:38px}.el-range-editor--small{line-height:var(--el-component-size-small)}.el-range-editor--small.el-input__wrapper{height:var(--el-component-size-small)}.el-range-editor--small .el-range-separator{font-size:12px;line-height:24px}.el-range-editor--small .el-range-input{font-size:12px;height:22px;line-height:22px}.el-range-editor.is-disabled{background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled,.el-range-editor.is-disabled:focus,.el-range-editor.is-disabled:hover{border-color:var(--el-disabled-border-color)}.el-range-editor.is-disabled input{background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled input::placeholder{color:var(--el-text-color-placeholder)}.el-range-editor.is-disabled .el-range-separator{color:var(--el-disabled-text-color)}.el-picker-panel{background:var(--el-bg-color-overlay);border-radius:var(--el-border-radius-base);color:var(--el-text-color-regular);line-height:30px}.el-picker-panel .el-time-panel{background-color:var(--el-bg-color-overlay);border:1px solid var(--el-datepicker-border-color);box-shadow:var(--el-box-shadow-light);margin:5px 0}.el-picker-panel__body-wrapper:after,.el-picker-panel__body:after{clear:both;content:"";display:table}.el-picker-panel__content{margin:15px;position:relative}.el-picker-panel__footer{background-color:var(--el-bg-color-overlay);border-top:1px solid var(--el-datepicker-inner-border-color);font-size:0;padding:4px 12px;position:relative;text-align:right}.el-picker-panel__shortcut{background-color:transparent;border:0;color:var(--el-datepicker-text-color);cursor:pointer;display:block;font-size:14px;line-height:28px;outline:none;padding-left:12px;text-align:left;width:100%}.el-picker-panel__shortcut:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__shortcut.active{background-color:#e6f1fe;color:var(--el-datepicker-active-color)}.el-picker-panel__btn{background-color:transparent;border:1px solid var(--el-fill-color-darker);border-radius:2px;color:var(--el-text-color-primary);cursor:pointer;font-size:12px;line-height:24px;outline:none;padding:0 20px}.el-picker-panel__btn[disabled]{color:var(--el-text-color-disabled);cursor:not-allowed}.el-picker-panel__icon-btn{background:transparent;border:0;color:var(--el-datepicker-icon-color);cursor:pointer;font-size:12px;margin-top:8px;outline:none}.el-picker-panel__icon-btn:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn:focus-visible{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn.is-disabled{color:var(--el-text-color-disabled)}.el-picker-panel__icon-btn.is-disabled:hover{cursor:not-allowed}.el-picker-panel__icon-btn .el-icon{cursor:pointer;font-size:inherit}.el-picker-panel__link-btn{vertical-align:middle}.el-picker-panel [slot=sidebar],.el-picker-panel__sidebar{background-color:var(--el-bg-color-overlay);border-right:1px solid var(--el-datepicker-inner-border-color);bottom:0;box-sizing:border-box;overflow:auto;padding-top:6px;position:absolute;top:0;width:110px}.el-picker-panel [slot=sidebar]+.el-picker-panel__body,.el-picker-panel__sidebar+.el-picker-panel__body{margin-left:110px}.el-date-picker{--el-datepicker-text-color:var(--el-text-color-regular);--el-datepicker-off-text-color:var(--el-text-color-placeholder);--el-datepicker-header-text-color:var(--el-text-color-regular);--el-datepicker-icon-color:var(--el-text-color-primary);--el-datepicker-border-color:var(--el-disabled-border-color);--el-datepicker-inner-border-color:var(--el-border-color-light);--el-datepicker-inrange-bg-color:var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color:var(--el-border-color-extra-light);--el-datepicker-active-color:var(--el-color-primary);--el-datepicker-hover-text-color:var(--el-color-primary);width:322px}.el-date-picker.has-sidebar.has-time{width:434px}.el-date-picker.has-sidebar{width:438px}.el-date-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-picker .el-picker-panel__content{width:292px}.el-date-picker table{table-layout:fixed;width:100%}.el-date-picker__editor-wrap{display:table-cell;padding:0 5px;position:relative}.el-date-picker__time-header{border-bottom:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;display:table;font-size:12px;padding:8px 5px 5px;position:relative;width:100%}.el-date-picker__header{margin:12px;text-align:center}.el-date-picker__header--bordered{border-bottom:1px solid var(--el-border-color-lighter);margin-bottom:0;padding-bottom:12px}.el-date-picker__header--bordered+.el-picker-panel__content{margin-top:0}.el-date-picker__header-label{color:var(--el-text-color-regular);cursor:pointer;font-size:16px;font-weight:500;line-height:22px;padding:0 5px;text-align:center}.el-date-picker__header-label:hover{color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label:focus-visible{color:var(--el-datepicker-hover-text-color);outline:none}.el-date-picker__header-label.active{color:var(--el-datepicker-active-color)}.el-date-picker__prev-btn{float:left}.el-date-picker__next-btn{float:right}.el-date-picker__time-wrap{padding:10px;text-align:center}.el-date-picker__time-label{cursor:pointer;float:left;line-height:30px;margin-left:10px}.el-date-picker .el-time-panel{position:absolute}.el-date-range-picker{--el-datepicker-text-color:var(--el-text-color-regular);--el-datepicker-off-text-color:var(--el-text-color-placeholder);--el-datepicker-header-text-color:var(--el-text-color-regular);--el-datepicker-icon-color:var(--el-text-color-primary);--el-datepicker-border-color:var(--el-disabled-border-color);--el-datepicker-inner-border-color:var(--el-border-color-light);--el-datepicker-inrange-bg-color:var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color:var(--el-border-color-extra-light);--el-datepicker-active-color:var(--el-color-primary);--el-datepicker-hover-text-color:var(--el-color-primary);width:646px}.el-date-range-picker.has-sidebar{width:756px}.el-date-range-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-range-picker table{table-layout:fixed;width:100%}.el-date-range-picker .el-picker-panel__body{min-width:513px}.el-date-range-picker .el-picker-panel__content{margin:0}.el-date-range-picker__header{height:28px;position:relative;text-align:center}.el-date-range-picker__header [class*=arrow-left]{float:left}.el-date-range-picker__header [class*=arrow-right]{float:right}.el-date-range-picker__header div{font-size:16px;font-weight:500;margin-right:50px}.el-date-range-picker__content{box-sizing:border-box;float:left;margin:0;padding:16px;width:50%}.el-date-range-picker__content.is-left{border-right:1px solid var(--el-datepicker-inner-border-color)}.el-date-range-picker__content .el-date-range-picker__header div{margin-left:50px;margin-right:50px}.el-date-range-picker__editors-wrap{box-sizing:border-box;display:table-cell}.el-date-range-picker__editors-wrap.is-right{text-align:right}.el-date-range-picker__time-header{border-bottom:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;display:table;font-size:12px;padding:8px 5px 5px;position:relative;width:100%}.el-date-range-picker__time-header>.el-icon-arrow-right{color:var(--el-datepicker-icon-color);display:table-cell;font-size:20px;vertical-align:middle}.el-date-range-picker__time-picker-wrap{display:table-cell;padding:0 5px;position:relative}.el-date-range-picker__time-picker-wrap .el-picker-panel{background:#fff;position:absolute;right:0;top:13px;z-index:1}.el-date-range-picker__time-picker-wrap .el-time-panel{position:absolute}.el-time-range-picker{overflow:visible;width:354px}.el-time-range-picker__content{padding:10px;position:relative;text-align:center;z-index:1}.el-time-range-picker__cell{box-sizing:border-box;display:inline-block;margin:0;padding:4px 7px 7px;width:50%}.el-time-range-picker__header{font-size:14px;margin-bottom:5px;text-align:center}.el-time-range-picker__body{border:1px solid var(--el-datepicker-border-color);border-radius:2px}.el-time-panel{border-radius:2px;box-sizing:content-box;left:0;position:relative;-webkit-user-select:none;user-select:none;width:180px;z-index:var(--el-index-top)}.el-time-panel__content{font-size:0;overflow:hidden;position:relative}.el-time-panel__content:after,.el-time-panel__content:before{box-sizing:border-box;content:"";height:32px;left:0;margin-top:-16px;padding-top:6px;position:absolute;right:0;text-align:left;top:50%;z-index:-1}.el-time-panel__content:after{left:50%;margin-left:12%;margin-right:12%}.el-time-panel__content:before{border-bottom:1px solid var(--el-border-color-light);border-top:1px solid var(--el-border-color-light);margin-left:12%;margin-right:12%;padding-left:50%}.el-time-panel__content.has-seconds:after{left:66.6666666667%}.el-time-panel__content.has-seconds:before{padding-left:33.3333333333%}.el-time-panel__footer{border-top:1px solid var(--el-timepicker-inner-border-color,var(--el-border-color-light));box-sizing:border-box;height:36px;line-height:25px;padding:4px;text-align:right}.el-time-panel__btn{background-color:transparent;border:none;color:var(--el-text-color-primary);cursor:pointer;font-size:12px;line-height:28px;margin:0 5px;outline:none;padding:0 5px}.el-time-panel__btn.confirm{color:var(--el-timepicker-active-color,var(--el-color-primary));font-weight:800}.el-textarea{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;display:inline-block;font-size:var(--el-font-size-base);position:relative;vertical-align:bottom;width:100%}.el-textarea__inner{-webkit-appearance:none;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));display:block;font-family:inherit;font-size:inherit;line-height:1.5;padding:5px 11px;position:relative;resize:vertical;transition:var(--el-transition-box-shadow);width:100%}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-textarea__inner:focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset;outline:none}.el-textarea .el-input__count{background:var(--el-fill-color-blank);bottom:5px;color:var(--el-color-info);font-size:12px;line-height:14px;position:absolute;right:10px}.el-textarea.is-disabled .el-textarea__inner{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset;color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;--el-input-height:var(--el-component-size);box-sizing:border-box;display:inline-flex;font-size:var(--el-font-size-base);line-height:var(--el-input-height);position:relative;vertical-align:middle;width:var(--el-input-width)}.el-input::-webkit-scrollbar{width:6px;z-index:11}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{background:var(--el-text-color-disabled);border-radius:5px;width:6px}.el-input::-webkit-scrollbar-corner,.el-input::-webkit-scrollbar-track{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track-piece{background:var(--el-fill-color-blank);width:6px}.el-input .el-input__clear,.el-input .el-input__password{color:var(--el-input-icon-color);cursor:pointer;font-size:14px}.el-input .el-input__clear:hover,.el-input .el-input__password:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{align-items:center;color:var(--el-color-info);display:inline-flex;font-size:12px;height:100%}.el-input .el-input__count .el-input__count-inner{background:var(--el-fill-color-blank);display:inline-block;line-height:normal;padding-left:8px}.el-input__wrapper{align-items:center;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;cursor:text;display:inline-flex;flex-grow:1;justify-content:center;padding:1px 11px;transform:translateZ(0);transition:var(--el-transition-box-shadow)}.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 32px) - 2px);-webkit-appearance:none;background:none;border:none;box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));flex-grow:1;font-size:inherit;height:var(--el-input-inner-height);line-height:var(--el-input-inner-height);outline:none;padding:0;width:100%}.el-input__inner:focus{outline:none}.el-input__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner[type=password]::-ms-reveal{display:none}.el-input__inner[type=number]{line-height:1}.el-input__prefix{color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:inline-flex;flex-shrink:0;flex-wrap:nowrap;height:100%;pointer-events:none;text-align:center;transition:all var(--el-transition-duration);white-space:nowrap}.el-input__prefix-inner{align-items:center;display:inline-flex;justify-content:center;pointer-events:all}.el-input__prefix-inner>:last-child{margin-right:8px}.el-input__prefix-inner>:first-child,.el-input__prefix-inner>:first-child.el-input__icon{margin-left:0}.el-input__suffix{color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:inline-flex;flex-shrink:0;flex-wrap:nowrap;height:100%;pointer-events:none;text-align:center;transition:all var(--el-transition-duration);white-space:nowrap}.el-input__suffix-inner{align-items:center;display:inline-flex;justify-content:center;pointer-events:all}.el-input__suffix-inner>:first-child{margin-left:8px}.el-input .el-input__icon{align-items:center;display:flex;height:inherit;justify-content:center;line-height:inherit;margin-left:8px;transition:all var(--el-transition-duration)}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-color, ) inset}.el-input.is-disabled{cursor:not-allowed}.el-input.is-disabled .el-input__wrapper{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset}.el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color);-webkit-text-fill-color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--large{--el-input-height:var(--el-component-size-large);font-size:14px}.el-input--large .el-input__wrapper{padding:1px 15px}.el-input--large .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 40px) - 2px)}.el-input--small{--el-input-height:var(--el-component-size-small);font-size:12px}.el-input--small .el-input__wrapper{padding:1px 7px}.el-input--small .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 24px) - 2px)}.el-input-group{align-items:stretch;display:inline-flex;width:100%}.el-input-group__append,.el-input-group__prepend{align-items:center;background-color:var(--el-fill-color-light);border-radius:var(--el-input-border-radius);color:var(--el-color-info);display:inline-flex;justify-content:center;min-height:100%;padding:0 20px;position:relative;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:none}.el-input-group__append .el-button,.el-input-group__append .el-select,.el-input-group__prepend .el-button,.el-input-group__prepend .el-select{display:inline-block;margin:0 -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-select__wrapper,.el-input-group__append div.el-select:hover .el-select__wrapper,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-select__wrapper,.el-input-group__prepend div.el-select:hover .el-select__wrapper{background-color:transparent;border-color:transparent;color:inherit}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-bottom-right-radius:0;border-right:0;border-top-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group__append{border-left:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--prepend>.el-input__wrapper,.el-input-group__append{border-bottom-left-radius:0;border-top-left-radius:0}.el-input-group--prepend .el-input-group__prepend .el-select .el-select__wrapper{border-bottom-right-radius:0;border-top-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group--append>.el-input__wrapper{border-bottom-right-radius:0;border-top-right-radius:0}.el-input-group--append .el-input-group__append .el-select .el-select__wrapper{border-bottom-left-radius:0;border-top-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-hidden{display:none!important}.el-popper{--el-popper-border-radius:var(--el-popover-border-radius,4px);border-radius:var(--el-popper-border-radius);font-size:12px;line-height:20px;min-width:10px;overflow-wrap:break-word;padding:5px 11px;position:absolute;visibility:visible;z-index:2000}.el-popper.is-dark{color:var(--el-bg-color)}.el-popper.is-dark,.el-popper.is-dark .el-popper__arrow:before{background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary)}.el-popper.is-dark .el-popper__arrow:before{right:0}.el-popper.is-light,.el-popper.is-light .el-popper__arrow:before{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow:before{right:0}.el-popper.is-pure{padding:0}.el-popper__arrow,.el-popper__arrow:before{height:10px;position:absolute;width:10px;z-index:-1}.el-popper__arrow:before{background:var(--el-text-color-primary);box-sizing:border-box;content:" ";transform:rotate(45deg)}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow:before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow:before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow:before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow:before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-left-color:transparent!important;border-top-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-bottom-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent!important;border-top-color:transparent!important}.el-button{--el-button-font-weight:var(--el-font-weight-primary);--el-button-border-color:var(--el-border-color);--el-button-bg-color:var(--el-fill-color-blank);--el-button-text-color:var(--el-text-color-regular);--el-button-disabled-text-color:var(--el-disabled-text-color);--el-button-disabled-bg-color:var(--el-fill-color-blank);--el-button-disabled-border-color:var(--el-border-color-light);--el-button-divide-border-color:rgba(255,255,255,.5);--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-9);--el-button-hover-border-color:var(--el-color-primary-light-7);--el-button-active-text-color:var(--el-button-hover-text-color);--el-button-active-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-button-hover-bg-color);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-hover-link-text-color:var(--el-color-info);--el-button-active-color:var(--el-text-color-primary);align-items:center;-webkit-appearance:none;background-color:var(--el-button-bg-color);border:var(--el-border);border-color:var(--el-button-border-color);box-sizing:border-box;color:var(--el-button-text-color);cursor:pointer;display:inline-flex;font-weight:var(--el-button-font-weight);height:32px;justify-content:center;line-height:1;outline:none;text-align:center;transition:.1s;-webkit-user-select:none;user-select:none;vertical-align:middle;white-space:nowrap}.el-button:hover{background-color:var(--el-button-hover-bg-color);border-color:var(--el-button-hover-border-color);color:var(--el-button-hover-text-color);outline:none}.el-button:active{background-color:var(--el-button-active-bg-color);border-color:var(--el-button-active-border-color);color:var(--el-button-active-text-color);outline:none}.el-button:focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button>span{align-items:center;display:inline-flex}.el-button+.el-button{margin-left:12px}.el-button{border-radius:var(--el-border-radius-base);font-size:var(--el-font-size-base)}.el-button,.el-button.is-round{padding:8px 15px}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-fill-color-blank);--el-button-hover-border-color:var(--el-color-primary)}.el-button.is-active{background-color:var(--el-button-active-bg-color);border-color:var(--el-button-active-border-color);color:var(--el-button-active-text-color);outline:none}.el-button.is-disabled,.el-button.is-disabled:hover{background-color:var(--el-button-disabled-bg-color);background-image:none;border-color:var(--el-button-disabled-border-color);color:var(--el-button-disabled-text-color);cursor:not-allowed}.el-button.is-loading{pointer-events:none;position:relative}.el-button.is-loading:before{background-color:var(--el-mask-color-extra-light);border-radius:inherit;bottom:-1px;content:"";left:-1px;pointer-events:none;position:absolute;right:-1px;top:-1px;z-index:1}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{border-radius:50%;padding:8px;width:32px}.el-button.is-text{background-color:transparent;border:0 solid transparent;color:var(--el-button-text-color)}.el-button.is-text.is-disabled{background-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button.is-text:not(.is-disabled):hover{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled):focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button.is-text:not(.is-disabled):active{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled).is-has-bg:hover{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg:active{background-color:var(--el-fill-color-dark)}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button.is-link{background:transparent;border-color:transparent;color:var(--el-button-text-color);height:auto;padding:2px}.el-button.is-link:hover{color:var(--el-button-hover-link-text-color)}.el-button.is-link.is-disabled{background-color:transparent!important;border-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button.is-link:not(.is-disabled):active,.el-button.is-link:not(.is-disabled):hover{background-color:transparent;border-color:transparent}.el-button.is-link:not(.is-disabled):active{color:var(--el-button-active-color)}.el-button--text{background:transparent;border-color:transparent;color:var(--el-color-primary);padding-left:0;padding-right:0}.el-button--text.is-disabled{background-color:transparent!important;border-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button--text:not(.is-disabled):hover{background-color:transparent;border-color:transparent;color:var(--el-color-primary-light-3)}.el-button--text:not(.is-disabled):active{background-color:transparent;border-color:transparent;color:var(--el-color-primary-dark-2)}.el-button__link--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--primary{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-active-color:var(--el-color-primary-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-primary-light-5);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-primary-light-5);--el-button-disabled-border-color:var(--el-color-primary-light-5)}.el-button--primary.is-link,.el-button--primary.is-plain,.el-button--primary.is-text{--el-button-text-color:var(--el-color-primary);--el-button-bg-color:var(--el-color-primary-light-9);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-text-color:var(--el-color-white)}.el-button--primary.is-link.is-disabled,.el-button--primary.is-link.is-disabled:active,.el-button--primary.is-link.is-disabled:focus,.el-button--primary.is-link.is-disabled:hover,.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:hover,.el-button--primary.is-text.is-disabled,.el-button--primary.is-text.is-disabled:active,.el-button--primary.is-text.is-disabled:focus,.el-button--primary.is-text.is-disabled:hover{background-color:var(--el-color-primary-light-9);border-color:var(--el-color-primary-light-8);color:var(--el-color-primary-light-5)}.el-button--success{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-success);--el-button-border-color:var(--el-color-success);--el-button-outline-color:var(--el-color-success-light-5);--el-button-active-color:var(--el-color-success-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-success-light-5);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-success-light-5);--el-button-disabled-border-color:var(--el-color-success-light-5)}.el-button--success.is-link,.el-button--success.is-plain,.el-button--success.is-text{--el-button-text-color:var(--el-color-success);--el-button-bg-color:var(--el-color-success-light-9);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-text-color:var(--el-color-white)}.el-button--success.is-link.is-disabled,.el-button--success.is-link.is-disabled:active,.el-button--success.is-link.is-disabled:focus,.el-button--success.is-link.is-disabled:hover,.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:hover,.el-button--success.is-text.is-disabled,.el-button--success.is-text.is-disabled:active,.el-button--success.is-text.is-disabled:focus,.el-button--success.is-text.is-disabled:hover{background-color:var(--el-color-success-light-9);border-color:var(--el-color-success-light-8);color:var(--el-color-success-light-5)}.el-button--warning{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-warning);--el-button-border-color:var(--el-color-warning);--el-button-outline-color:var(--el-color-warning-light-5);--el-button-active-color:var(--el-color-warning-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-warning-light-5);--el-button-hover-bg-color:var(--el-color-warning-light-3);--el-button-hover-border-color:var(--el-color-warning-light-3);--el-button-active-bg-color:var(--el-color-warning-dark-2);--el-button-active-border-color:var(--el-color-warning-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-warning-light-5);--el-button-disabled-border-color:var(--el-color-warning-light-5)}.el-button--warning.is-link,.el-button--warning.is-plain,.el-button--warning.is-text{--el-button-text-color:var(--el-color-warning);--el-button-bg-color:var(--el-color-warning-light-9);--el-button-border-color:var(--el-color-warning-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-warning);--el-button-hover-border-color:var(--el-color-warning);--el-button-active-text-color:var(--el-color-white)}.el-button--warning.is-link.is-disabled,.el-button--warning.is-link.is-disabled:active,.el-button--warning.is-link.is-disabled:focus,.el-button--warning.is-link.is-disabled:hover,.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:hover,.el-button--warning.is-text.is-disabled,.el-button--warning.is-text.is-disabled:active,.el-button--warning.is-text.is-disabled:focus,.el-button--warning.is-text.is-disabled:hover{background-color:var(--el-color-warning-light-9);border-color:var(--el-color-warning-light-8);color:var(--el-color-warning-light-5)}.el-button--danger{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger);--el-button-outline-color:var(--el-color-danger-light-5);--el-button-active-color:var(--el-color-danger-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-danger-light-5);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-danger-light-5);--el-button-disabled-border-color:var(--el-color-danger-light-5)}.el-button--danger.is-link,.el-button--danger.is-plain,.el-button--danger.is-text{--el-button-text-color:var(--el-color-danger);--el-button-bg-color:var(--el-color-danger-light-9);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-text-color:var(--el-color-white)}.el-button--danger.is-link.is-disabled,.el-button--danger.is-link.is-disabled:active,.el-button--danger.is-link.is-disabled:focus,.el-button--danger.is-link.is-disabled:hover,.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:hover,.el-button--danger.is-text.is-disabled,.el-button--danger.is-text.is-disabled:active,.el-button--danger.is-text.is-disabled:focus,.el-button--danger.is-text.is-disabled:hover{background-color:var(--el-color-danger-light-9);border-color:var(--el-color-danger-light-8);color:var(--el-color-danger-light-5)}.el-button--info{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-info);--el-button-border-color:var(--el-color-info);--el-button-outline-color:var(--el-color-info-light-5);--el-button-active-color:var(--el-color-info-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-info-light-5);--el-button-hover-bg-color:var(--el-color-info-light-3);--el-button-hover-border-color:var(--el-color-info-light-3);--el-button-active-bg-color:var(--el-color-info-dark-2);--el-button-active-border-color:var(--el-color-info-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-info-light-5);--el-button-disabled-border-color:var(--el-color-info-light-5)}.el-button--info.is-link,.el-button--info.is-plain,.el-button--info.is-text{--el-button-text-color:var(--el-color-info);--el-button-bg-color:var(--el-color-info-light-9);--el-button-border-color:var(--el-color-info-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-info);--el-button-hover-border-color:var(--el-color-info);--el-button-active-text-color:var(--el-color-white)}.el-button--info.is-link.is-disabled,.el-button--info.is-link.is-disabled:active,.el-button--info.is-link.is-disabled:focus,.el-button--info.is-link.is-disabled:hover,.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:hover,.el-button--info.is-text.is-disabled,.el-button--info.is-text.is-disabled:active,.el-button--info.is-text.is-disabled:focus,.el-button--info.is-text.is-disabled:hover{background-color:var(--el-color-info-light-9);border-color:var(--el-color-info-light-8);color:var(--el-color-info-light-5)}.el-button--large{--el-button-size:40px;height:var(--el-button-size)}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large{border-radius:var(--el-border-radius-base);font-size:var(--el-font-size-base);padding:12px 19px}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{padding:12px;width:var(--el-button-size)}.el-button--small{--el-button-size:24px;height:var(--el-button-size)}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small{border-radius:calc(var(--el-border-radius-base) - 1px);font-size:12px;padding:5px 11px}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{padding:5px;width:var(--el-button-size)}.el-checkbox-group{font-size:0;line-height:0}.el-checkbox{--el-checkbox-font-size:14px;--el-checkbox-font-weight:var(--el-font-weight-primary);--el-checkbox-text-color:var(--el-text-color-regular);--el-checkbox-input-height:14px;--el-checkbox-input-width:14px;--el-checkbox-border-radius:var(--el-border-radius-small);--el-checkbox-bg-color:var(--el-fill-color-blank);--el-checkbox-input-border:var(--el-border);--el-checkbox-disabled-border-color:var(--el-border-color);--el-checkbox-disabled-input-fill:var(--el-fill-color-light);--el-checkbox-disabled-icon-color:var(--el-text-color-placeholder);--el-checkbox-disabled-checked-input-fill:var(--el-border-color-extra-light);--el-checkbox-disabled-checked-input-border-color:var(--el-border-color);--el-checkbox-disabled-checked-icon-color:var(--el-text-color-placeholder);--el-checkbox-checked-text-color:var(--el-color-primary);--el-checkbox-checked-input-border-color:var(--el-color-primary);--el-checkbox-checked-bg-color:var(--el-color-primary);--el-checkbox-checked-icon-color:var(--el-color-white);--el-checkbox-input-border-color-hover:var(--el-color-primary);align-items:center;color:var(--el-checkbox-text-color);cursor:pointer;display:inline-flex;font-size:var(--el-font-size-base);font-weight:var(--el-checkbox-font-weight);height:var(--el-checkbox-height,32px);margin-right:30px;position:relative;-webkit-user-select:none;user-select:none;white-space:nowrap}.el-checkbox.is-disabled{cursor:not-allowed}.el-checkbox.is-bordered{border:var(--el-border);border-radius:var(--el-border-radius-base);box-sizing:border-box;padding:0 15px 0 9px}.el-checkbox.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-checkbox.is-bordered.is-disabled{border-color:var(--el-border-color-lighter)}.el-checkbox.is-bordered.el-checkbox--large{border-radius:var(--el-border-radius-base);padding:0 19px 0 11px}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__label{font-size:var(--el-font-size-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.is-bordered.el-checkbox--small{border-radius:calc(var(--el-border-radius-base) - 1px);padding:0 11px 0 7px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox input:focus-visible+.el-checkbox__inner{border-radius:var(--el-checkbox-border-radius);outline:2px solid var(--el-checkbox-input-border-color-hover);outline-offset:1px}.el-checkbox__input{cursor:pointer;display:inline-flex;outline:none;position:relative;white-space:nowrap}.el-checkbox__input.is-disabled .el-checkbox__inner{background-color:var(--el-checkbox-disabled-input-fill);border-color:var(--el-checkbox-disabled-border-color);cursor:not-allowed}.el-checkbox__input.is-disabled .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-icon-color);cursor:not-allowed}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-disabled-checked-icon-color);border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled+span.el-checkbox__label{color:var(--el-disabled-text-color);cursor:not-allowed}.el-checkbox__input.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-checked-icon-color);transform:rotate(45deg) scaleY(1)}.el-checkbox__input.is-checked+.el-checkbox__label{color:var(--el-checkbox-checked-text-color)}.el-checkbox__input.is-focus:not(.is-checked) .el-checkbox__original:not(:focus-visible){border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__input.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-checked-icon-color);content:"";display:block;height:2px;left:0;position:absolute;right:0;top:5px;transform:scale(.5)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:after{display:none}.el-checkbox__inner{background-color:var(--el-checkbox-bg-color);border:var(--el-checkbox-input-border);border-radius:var(--el-checkbox-border-radius);box-sizing:border-box;display:inline-block;height:var(--el-checkbox-input-height);position:relative;transition:border-color .25s cubic-bezier(.71,-.46,.29,1.46),background-color .25s cubic-bezier(.71,-.46,.29,1.46),outline .25s cubic-bezier(.71,-.46,.29,1.46);width:var(--el-checkbox-input-width);z-index:var(--el-index-normal)}.el-checkbox__inner:hover{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__inner:after{border:1px solid transparent;border-left:0;border-top:0;box-sizing:content-box;content:"";height:7px;left:4px;position:absolute;top:1px;transform:rotate(45deg) scaleY(0);transform-origin:center;transition:transform .15s ease-in .05s;width:3px}.el-checkbox__original{height:0;margin:0;opacity:0;outline:none;position:absolute;width:0;z-index:-1}.el-checkbox__label{display:inline-block;font-size:var(--el-checkbox-font-size);line-height:1;padding-left:8px}.el-checkbox.el-checkbox--large{height:40px}.el-checkbox.el-checkbox--large .el-checkbox__label{font-size:14px}.el-checkbox.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.el-checkbox--small{height:24px}.el-checkbox.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.el-checkbox--small .el-checkbox__input.is-indeterminate .el-checkbox__inner:before{top:4px}.el-checkbox.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox:last-of-type{margin-right:0}.el-radio-group{align-items:center;display:inline-flex;flex-wrap:wrap;font-size:0}.el-radio-button{--el-radio-button-checked-bg-color:var(--el-color-primary);--el-radio-button-checked-text-color:var(--el-color-white);--el-radio-button-checked-border-color:var(--el-color-primary);--el-radio-button-disabled-checked-fill:var(--el-border-color-extra-light)}.el-radio-button,.el-radio-button__inner{display:inline-block;outline:none;position:relative}.el-radio-button__inner{-webkit-appearance:none;background:var(--el-button-bg-color,var(--el-fill-color-blank));border:var(--el-border);border-left:0;border-radius:0;box-sizing:border-box;color:var(--el-button-text-color,var(--el-text-color-regular));cursor:pointer;font-size:var(--el-font-size-base);font-weight:var(--el-button-font-weight,var(--el-font-weight-primary));line-height:1;margin:0;padding:8px 15px;text-align:center;transition:var(--el-transition-all);-webkit-user-select:none;user-select:none;vertical-align:middle;white-space:nowrap}.el-radio-button__inner.is-round{padding:8px 15px}.el-radio-button__inner:hover{color:var(--el-color-primary)}.el-radio-button__inner [class*=el-icon-]{line-height:.9}.el-radio-button__inner [class*=el-icon-]+span{margin-left:5px}.el-radio-button:first-child .el-radio-button__inner{border-left:var(--el-border);border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);box-shadow:none!important}.el-radio-button.is-active .el-radio-button__original-radio:not(:disabled)+.el-radio-button__inner{background-color:var(--el-radio-button-checked-bg-color,var(--el-color-primary));border-color:var(--el-radio-button-checked-border-color,var(--el-color-primary));box-shadow:-1px 0 0 0 var(--el-radio-button-checked-border-color,var(--el-color-primary));color:var(--el-radio-button-checked-text-color,var(--el-color-white))}.el-radio-button__original-radio{opacity:0;outline:none;position:absolute;z-index:-1}.el-radio-button__original-radio:focus-visible+.el-radio-button__inner{border-left:var(--el-border);border-left-color:var(--el-radio-button-checked-border-color,var(--el-color-primary));border-radius:var(--el-border-radius-base);box-shadow:none;outline:2px solid var(--el-radio-button-checked-border-color);outline-offset:1px;z-index:2}.el-radio-button__original-radio:disabled+.el-radio-button__inner{background-color:var(--el-button-disabled-bg-color,var(--el-fill-color-blank));background-image:none;border-color:var(--el-button-disabled-border-color,var(--el-border-color-light));box-shadow:none;color:var(--el-disabled-text-color);cursor:not-allowed}.el-radio-button__original-radio:disabled:checked+.el-radio-button__inner{background-color:var(--el-radio-button-disabled-checked-fill)}.el-radio-button:last-child .el-radio-button__inner{border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0}.el-radio-button:first-child:last-child .el-radio-button__inner{border-radius:var(--el-border-radius-base)}.el-radio-button--large .el-radio-button__inner{border-radius:0;font-size:var(--el-font-size-base);padding:12px 19px}.el-radio-button--large .el-radio-button__inner.is-round{padding:12px 19px}.el-radio-button--small .el-radio-button__inner{border-radius:0;font-size:12px;padding:5px 11px}.el-radio-button--small .el-radio-button__inner.is-round{padding:5px 11px}.el-drawer{--el-drawer-bg-color:var(--el-dialog-bg-color,var(--el-bg-color));--el-drawer-padding-primary:var(--el-dialog-padding-primary,20px);background-color:var(--el-drawer-bg-color);box-shadow:var(--el-box-shadow-dark);box-sizing:border-box;display:flex;flex-direction:column;overflow:hidden;position:absolute;transition:all var(--el-transition-duration)}.el-drawer .btt,.el-drawer .ltr,.el-drawer .rtl,.el-drawer .ttb{transform:translate(0)}.el-drawer__sr-focus:focus{outline:none!important}.el-drawer__header{align-items:center;color:#72767b;display:flex;margin-bottom:32px;padding:var(--el-drawer-padding-primary);padding-bottom:0}.el-drawer__header>:first-child{flex:1}.el-drawer__title{flex:1;font-size:16px;line-height:inherit;margin:0}.el-drawer__footer{padding:var(--el-drawer-padding-primary);padding-top:10px;text-align:right}.el-drawer__close-btn{background-color:transparent;border:none;color:inherit;cursor:pointer;display:inline-flex;font-size:var(--el-font-size-extra-large);outline:none}.el-drawer__close-btn:focus i,.el-drawer__close-btn:hover i{color:var(--el-color-primary)}.el-drawer__body{flex:1;overflow:auto;padding:var(--el-drawer-padding-primary)}.el-drawer__body>*{box-sizing:border-box}.el-drawer.ltr,.el-drawer.rtl{bottom:0;height:100%;top:0}.el-drawer.btt,.el-drawer.ttb{left:0;right:0;width:100%}.el-drawer.ltr{left:0}.el-drawer.rtl{right:0}.el-drawer.ttb{top:0}.el-drawer.btt{bottom:0}.el-drawer-fade-enter-active,.el-drawer-fade-leave-active{transition:all var(--el-transition-duration)}.el-drawer-fade-enter-active,.el-drawer-fade-enter-from,.el-drawer-fade-enter-to,.el-drawer-fade-leave-active,.el-drawer-fade-leave-from,.el-drawer-fade-leave-to{overflow:hidden!important}.el-drawer-fade-enter-from,.el-drawer-fade-leave-to{opacity:0}.el-drawer-fade-enter-to,.el-drawer-fade-leave-from{opacity:1}.el-drawer-fade-enter-from .rtl,.el-drawer-fade-leave-to .rtl{transform:translate(100%)}.el-drawer-fade-enter-from .ltr,.el-drawer-fade-leave-to .ltr{transform:translate(-100%)}.el-drawer-fade-enter-from .ttb,.el-drawer-fade-leave-to .ttb{transform:translateY(-100%)}.el-drawer-fade-enter-from .btt,.el-drawer-fade-leave-to .btt{transform:translateY(100%)}.button-group[data-v-42544bd5]{background-color:var(--el-color-primary)}.el-switch{--el-switch-on-color:var(--el-color-primary);--el-switch-off-color:var(--el-border-color);align-items:center;display:inline-flex;font-size:14px;height:32px;line-height:20px;position:relative;vertical-align:middle}.el-switch.is-disabled .el-switch__core,.el-switch.is-disabled .el-switch__label{cursor:not-allowed}.el-switch__label{color:var(--el-text-color-primary);cursor:pointer;display:inline-block;font-size:14px;font-weight:500;height:20px;transition:var(--el-transition-duration-fast);vertical-align:middle}.el-switch__label.is-active{color:var(--el-color-primary)}.el-switch__label--left{margin-right:10px}.el-switch__label--right{margin-left:10px}.el-switch__label *{display:inline-block;font-size:14px;line-height:1}.el-switch__label .el-icon{height:inherit}.el-switch__label .el-icon svg{vertical-align:middle}.el-switch__input{height:0;margin:0;opacity:0;position:absolute;width:0}.el-switch__input:focus-visible~.el-switch__core{outline:2px solid var(--el-switch-on-color);outline-offset:1px}.el-switch__core{align-items:center;background:var(--el-switch-off-color);border:1px solid var(--el-switch-border-color,var(--el-switch-off-color));border-radius:10px;box-sizing:border-box;cursor:pointer;display:inline-flex;height:20px;min-width:40px;outline:none;position:relative;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration)}.el-switch__core .el-switch__inner{align-items:center;display:flex;height:16px;justify-content:center;overflow:hidden;padding:0 4px 0 18px;transition:all var(--el-transition-duration);width:100%}.el-switch__core .el-switch__inner .is-icon,.el-switch__core .el-switch__inner .is-text{color:var(--el-color-white);font-size:12px;overflow:hidden;text-overflow:ellipsis;-webkit-user-select:none;user-select:none;white-space:nowrap}.el-switch__core .el-switch__action{align-items:center;background-color:var(--el-color-white);border-radius:var(--el-border-radius-circle);color:var(--el-switch-off-color);display:flex;height:16px;justify-content:center;left:1px;position:absolute;transition:all var(--el-transition-duration);width:16px}.el-switch.is-checked .el-switch__core{background-color:var(--el-switch-on-color);border-color:var(--el-switch-border-color,var(--el-switch-on-color))}.el-switch.is-checked .el-switch__core .el-switch__action{color:var(--el-switch-on-color);left:calc(100% - 17px)}.el-switch.is-checked .el-switch__core .el-switch__inner{padding:0 18px 0 4px}.el-switch.is-disabled{opacity:.6}.el-switch--wide .el-switch__label.el-switch__label--left span{left:10px}.el-switch--wide .el-switch__label.el-switch__label--right span{right:10px}.el-switch .label-fade-enter-from,.el-switch .label-fade-leave-active{opacity:0}.el-switch--large{font-size:14px;height:40px;line-height:24px}.el-switch--large .el-switch__label{font-size:14px;height:24px}.el-switch--large .el-switch__label *{font-size:14px}.el-switch--large .el-switch__core{border-radius:12px;height:24px;min-width:50px}.el-switch--large .el-switch__core .el-switch__inner{height:20px;padding:0 6px 0 22px}.el-switch--large .el-switch__core .el-switch__action{height:20px;width:20px}.el-switch--large.is-checked .el-switch__core .el-switch__action{left:calc(100% - 21px)}.el-switch--large.is-checked .el-switch__core .el-switch__inner{padding:0 22px 0 6px}.el-switch--small{font-size:12px;height:24px;line-height:16px}.el-switch--small .el-switch__label{font-size:12px;height:16px}.el-switch--small .el-switch__label *{font-size:12px}.el-switch--small .el-switch__core{border-radius:8px;height:16px;min-width:30px}.el-switch--small .el-switch__core .el-switch__inner{height:12px;padding:0 2px 0 14px}.el-switch--small .el-switch__core .el-switch__action{height:12px;width:12px}.el-switch--small.is-checked .el-switch__core .el-switch__action{left:calc(100% - 13px)}.el-switch--small.is-checked .el-switch__core .el-switch__inner{padding:0 14px 0 2px}.el-tabs{--el-tabs-header-height:40px}.el-tabs__header{align-items:center;display:flex;justify-content:space-between;margin:0 0 15px;padding:0;position:relative}.el-tabs__header-vertical{flex-direction:column}.el-tabs__active-bar{background-color:var(--el-color-primary);bottom:0;height:2px;left:0;list-style:none;position:absolute;transition:width var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier),transform var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);z-index:1}.el-tabs__new-tab{align-items:center;border:1px solid var(--el-border-color);border-radius:3px;color:var(--el-text-color-primary);cursor:pointer;display:flex;font-size:12px;height:20px;justify-content:center;line-height:20px;margin:10px 0 10px 10px;text-align:center;transition:all .15s;width:20px}.el-tabs__new-tab .is-icon-plus{height:inherit;transform:scale(.8);width:inherit}.el-tabs__new-tab .is-icon-plus svg{vertical-align:middle}.el-tabs__new-tab:hover{color:var(--el-color-primary)}.el-tabs__new-tab-vertical{margin-left:0}.el-tabs__nav-wrap{flex:1 auto;margin-bottom:-1px;overflow:hidden;position:relative}.el-tabs__nav-wrap:after{background-color:var(--el-border-color-light);bottom:0;content:"";height:2px;left:0;position:absolute;width:100%;z-index:var(--el-index-normal)}.el-tabs__nav-wrap.is-scrollable{box-sizing:border-box;padding:0 20px}.el-tabs__nav-scroll{overflow:hidden}.el-tabs__nav-next,.el-tabs__nav-prev{color:var(--el-text-color-secondary);cursor:pointer;font-size:12px;line-height:44px;position:absolute;text-align:center;width:20px}.el-tabs__nav-next{right:0}.el-tabs__nav-prev{left:0}.el-tabs__nav{display:flex;float:left;position:relative;transition:transform var(--el-transition-duration);white-space:nowrap;z-index:calc(var(--el-index-normal) + 1)}.el-tabs__nav.is-stretch{display:flex;min-width:100%}.el-tabs__nav.is-stretch>*{flex:1;text-align:center}.el-tabs__item{align-items:center;box-sizing:border-box;color:var(--el-text-color-primary);display:flex;font-size:var(--el-font-size-base);font-weight:500;height:var(--el-tabs-header-height);justify-content:center;list-style:none;padding:0 20px;position:relative}.el-tabs__item:focus,.el-tabs__item:focus:active{outline:none}.el-tabs__item:focus-visible{border-radius:3px;box-shadow:0 0 2px 2px var(--el-color-primary) inset}.el-tabs__item .is-icon-close{border-radius:50%;margin-left:5px;text-align:center;transition:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier)}.el-tabs__item .is-icon-close:before{display:inline-block;transform:scale(.9)}.el-tabs__item .is-icon-close:hover{background-color:var(--el-text-color-placeholder);color:#fff}.el-tabs__item.is-active,.el-tabs__item:hover{color:var(--el-color-primary)}.el-tabs__item:hover{cursor:pointer}.el-tabs__item.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-tabs__content{overflow:hidden;position:relative}.el-tabs--card>.el-tabs__header{border-bottom:1px solid var(--el-border-color-light);height:var(--el-tabs-header-height)}.el-tabs--card>.el-tabs__header .el-tabs__nav-wrap:after{content:none}.el-tabs--card>.el-tabs__header .el-tabs__nav{border:1px solid var(--el-border-color-light);border-bottom:none;border-radius:4px 4px 0 0;box-sizing:border-box}.el-tabs--card>.el-tabs__header .el-tabs__active-bar{display:none}.el-tabs--card>.el-tabs__header .el-tabs__item .is-icon-close{font-size:12px;height:14px;overflow:hidden;position:relative;right:-2px;transform-origin:100% 50%;width:0}.el-tabs--card>.el-tabs__header .el-tabs__item{border-bottom:1px solid transparent;border-left:1px solid var(--el-border-color-light);transition:color var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier),padding var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier)}.el-tabs--card>.el-tabs__header .el-tabs__item:first-child{border-left:none}.el-tabs--card>.el-tabs__header .el-tabs__item.is-closable:hover{padding-left:13px;padding-right:13px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-closable:hover .is-icon-close{width:14px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active{border-bottom-color:var(--el-bg-color)}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active.is-closable{padding-left:20px;padding-right:20px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active.is-closable .is-icon-close{width:14px}.el-tabs--border-card{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color)}.el-tabs--border-card>.el-tabs__content{padding:15px}.el-tabs--border-card>.el-tabs__header{background-color:var(--el-fill-color-light);border-bottom:1px solid var(--el-border-color-light);margin:0}.el-tabs--border-card>.el-tabs__header .el-tabs__nav-wrap:after{content:none}.el-tabs--border-card>.el-tabs__header .el-tabs__item{border:1px solid transparent;color:var(--el-text-color-secondary);margin-top:-1px;transition:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier)}.el-tabs--border-card>.el-tabs__header .el-tabs__item+.el-tabs__item,.el-tabs--border-card>.el-tabs__header .el-tabs__item:first-child{margin-left:-1px}.el-tabs--border-card>.el-tabs__header .el-tabs__item.is-active{background-color:var(--el-bg-color-overlay);border-left-color:var(--el-border-color);border-right-color:var(--el-border-color);color:var(--el-color-primary)}.el-tabs--border-card>.el-tabs__header .el-tabs__item:not(.is-disabled):hover{color:var(--el-color-primary)}.el-tabs--border-card>.el-tabs__header .el-tabs__item.is-disabled{color:var(--el-disabled-text-color)}.el-tabs--border-card>.el-tabs__header .is-scrollable .el-tabs__item:first-child{margin-left:0}.el-tabs--bottom .el-tabs__item.is-bottom:nth-child(2),.el-tabs--bottom .el-tabs__item.is-top:nth-child(2),.el-tabs--top .el-tabs__item.is-bottom:nth-child(2),.el-tabs--top .el-tabs__item.is-top:nth-child(2){padding-left:0}.el-tabs--bottom .el-tabs__item.is-bottom:last-child,.el-tabs--bottom .el-tabs__item.is-top:last-child,.el-tabs--top .el-tabs__item.is-bottom:last-child,.el-tabs--top .el-tabs__item.is-top:last-child{padding-right:0}.el-tabs--bottom .el-tabs--left>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom .el-tabs--right>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top .el-tabs--left>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top .el-tabs--right>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2){padding-left:20px}.el-tabs--bottom .el-tabs--left>.el-tabs__header .el-tabs__item:nth-child(2):not(.is-active).is-closable:hover,.el-tabs--bottom .el-tabs--right>.el-tabs__header .el-tabs__item:nth-child(2):not(.is-active).is-closable:hover,.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2):not(.is-active).is-closable:hover,.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2):not(.is-active).is-closable:hover,.el-tabs--top .el-tabs--left>.el-tabs__header .el-tabs__item:nth-child(2):not(.is-active).is-closable:hover,.el-tabs--top .el-tabs--right>.el-tabs__header .el-tabs__item:nth-child(2):not(.is-active).is-closable:hover,.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2):not(.is-active).is-closable:hover,.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2):not(.is-active).is-closable:hover{padding-left:13px}.el-tabs--bottom .el-tabs--left>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom .el-tabs--right>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top .el-tabs--left>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top .el-tabs--right>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:last-child{padding-right:20px}.el-tabs--bottom .el-tabs--left>.el-tabs__header .el-tabs__item:last-child:not(.is-active).is-closable:hover,.el-tabs--bottom .el-tabs--right>.el-tabs__header .el-tabs__item:last-child:not(.is-active).is-closable:hover,.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child:not(.is-active).is-closable:hover,.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:last-child:not(.is-active).is-closable:hover,.el-tabs--top .el-tabs--left>.el-tabs__header .el-tabs__item:last-child:not(.is-active).is-closable:hover,.el-tabs--top .el-tabs--right>.el-tabs__header .el-tabs__item:last-child:not(.is-active).is-closable:hover,.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child:not(.is-active).is-closable:hover,.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:last-child:not(.is-active).is-closable:hover{padding-right:13px}.el-tabs--bottom .el-tabs__header.is-bottom{margin-bottom:0;margin-top:10px}.el-tabs--bottom.el-tabs--border-card .el-tabs__header.is-bottom{border-bottom:0;border-top:1px solid var(--el-border-color)}.el-tabs--bottom.el-tabs--border-card .el-tabs__nav-wrap.is-bottom{margin-bottom:0;margin-top:-1px}.el-tabs--bottom.el-tabs--border-card .el-tabs__item.is-bottom:not(.is-active){border:1px solid transparent}.el-tabs--bottom.el-tabs--border-card .el-tabs__item.is-bottom{margin:0 -1px -1px}.el-tabs--left,.el-tabs--right{overflow:hidden}.el-tabs--left .el-tabs__header.is-left,.el-tabs--left .el-tabs__header.is-right,.el-tabs--left .el-tabs__nav-scroll,.el-tabs--left .el-tabs__nav-wrap.is-left,.el-tabs--left .el-tabs__nav-wrap.is-right,.el-tabs--right .el-tabs__header.is-left,.el-tabs--right .el-tabs__header.is-right,.el-tabs--right .el-tabs__nav-scroll,.el-tabs--right .el-tabs__nav-wrap.is-left,.el-tabs--right .el-tabs__nav-wrap.is-right{height:100%}.el-tabs--left .el-tabs__active-bar.is-left,.el-tabs--left .el-tabs__active-bar.is-right,.el-tabs--right .el-tabs__active-bar.is-left,.el-tabs--right .el-tabs__active-bar.is-right{bottom:auto;height:auto;top:0;width:2px}.el-tabs--left .el-tabs__nav-wrap.is-left,.el-tabs--left .el-tabs__nav-wrap.is-right,.el-tabs--right .el-tabs__nav-wrap.is-left,.el-tabs--right .el-tabs__nav-wrap.is-right{margin-bottom:0}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev{cursor:pointer;height:30px;line-height:30px;text-align:center;width:100%}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next i,.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev i,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next i,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev i,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next i,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev i,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next i,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev i{transform:rotate(90deg)}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev{left:auto;top:0}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next{bottom:0;right:auto}.el-tabs--left .el-tabs__nav-wrap.is-left.is-scrollable,.el-tabs--left .el-tabs__nav-wrap.is-right.is-scrollable,.el-tabs--right .el-tabs__nav-wrap.is-left.is-scrollable,.el-tabs--right .el-tabs__nav-wrap.is-right.is-scrollable{padding:30px 0}.el-tabs--left .el-tabs__nav-wrap.is-left:after,.el-tabs--left .el-tabs__nav-wrap.is-right:after,.el-tabs--right .el-tabs__nav-wrap.is-left:after,.el-tabs--right .el-tabs__nav-wrap.is-right:after{bottom:auto;height:100%;top:0;width:2px}.el-tabs--left .el-tabs__nav.is-left,.el-tabs--left .el-tabs__nav.is-right,.el-tabs--right .el-tabs__nav.is-left,.el-tabs--right .el-tabs__nav.is-right{flex-direction:column}.el-tabs--left .el-tabs__item.is-left,.el-tabs--right .el-tabs__item.is-left{justify-content:flex-end}.el-tabs--left .el-tabs__item.is-right,.el-tabs--right .el-tabs__item.is-right{justify-content:flex-start}.el-tabs--left .el-tabs__header.is-left{float:left;margin-bottom:0;margin-right:10px}.el-tabs--left .el-tabs__nav-wrap.is-left{margin-right:-1px}.el-tabs--left .el-tabs__active-bar.is-left,.el-tabs--left .el-tabs__nav-wrap.is-left:after{left:auto;right:0}.el-tabs--left .el-tabs__item.is-left{text-align:right}.el-tabs--left.el-tabs--card .el-tabs__active-bar.is-left{display:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left{border-bottom:none;border-left:none;border-right:1px solid var(--el-border-color-light);border-top:1px solid var(--el-border-color-light);text-align:left}.el-tabs--left.el-tabs--card .el-tabs__item.is-left:first-child{border-right:1px solid var(--el-border-color-light);border-top:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active{border:1px solid var(--el-border-color-light);border-bottom:none;border-left:none;border-right:1px solid #fff}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active:first-child{border-top:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active:last-child{border-bottom:none}.el-tabs--left.el-tabs--card .el-tabs__nav{border-bottom:1px solid var(--el-border-color-light);border-radius:4px 0 0 4px;border-right:none}.el-tabs--left.el-tabs--card .el-tabs__new-tab{float:none}.el-tabs--left.el-tabs--border-card .el-tabs__header.is-left{border-right:1px solid var(--el-border-color)}.el-tabs--left.el-tabs--border-card .el-tabs__item.is-left{border:1px solid transparent;margin:-1px 0 -1px -1px}.el-tabs--left.el-tabs--border-card .el-tabs__item.is-left.is-active{border-color:rgb(209,219,229) transparent}.el-tabs--right .el-tabs__header.is-right{float:right;margin-bottom:0;margin-left:10px}.el-tabs--right .el-tabs__nav-wrap.is-right{margin-left:-1px}.el-tabs--right .el-tabs__nav-wrap.is-right:after{left:0;right:auto}.el-tabs--right .el-tabs__active-bar.is-right{left:0}.el-tabs--right.el-tabs--card .el-tabs__active-bar.is-right{display:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right{border-bottom:none;border-top:1px solid var(--el-border-color-light)}.el-tabs--right.el-tabs--card .el-tabs__item.is-right:first-child{border-left:1px solid var(--el-border-color-light);border-top:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active{border:1px solid var(--el-border-color-light);border-bottom:none;border-left:1px solid #fff;border-right:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active:first-child{border-top:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active:last-child{border-bottom:none}.el-tabs--right.el-tabs--card .el-tabs__nav{border-bottom:1px solid var(--el-border-color-light);border-left:none;border-radius:0 4px 4px 0}.el-tabs--right.el-tabs--border-card .el-tabs__header.is-right{border-left:1px solid var(--el-border-color)}.el-tabs--right.el-tabs--border-card .el-tabs__item.is-right{border:1px solid transparent;margin:-1px -1px -1px 0}.el-tabs--right.el-tabs--border-card .el-tabs__item.is-right.is-active{border-color:rgb(209,219,229) transparent}.slideInLeft-transition,.slideInRight-transition{display:inline-block}.slideInRight-enter{animation:slideInRight-enter var(--el-transition-duration)}.slideInRight-leave{animation:slideInRight-leave var(--el-transition-duration);left:0;position:absolute;right:0}.slideInLeft-enter{animation:slideInLeft-enter var(--el-transition-duration)}.slideInLeft-leave{animation:slideInLeft-leave var(--el-transition-duration);left:0;position:absolute;right:0}@keyframes slideInRight-enter{0%{opacity:0;transform:translate(100%);transform-origin:0 0}to{opacity:1;transform:translate(0);transform-origin:0 0}}@keyframes slideInRight-leave{0%{opacity:1;transform:translate(0);transform-origin:0 0}to{opacity:0;transform:translate(100%);transform-origin:0 0}}@keyframes slideInLeft-enter{0%{opacity:0;transform:translate(-100%);transform-origin:0 0}to{opacity:1;transform:translate(0);transform-origin:0 0}}@keyframes slideInLeft-leave{0%{opacity:1;transform:translate(0);transform-origin:0 0}to{opacity:0;transform:translate(-100%);transform-origin:0 0}}.el-table{--el-table-border-color:var(--el-border-color-lighter);--el-table-border:1px solid var(--el-table-border-color);--el-table-text-color:var(--el-text-color-regular);--el-table-header-text-color:var(--el-text-color-secondary);--el-table-row-hover-bg-color:var(--el-fill-color-light);--el-table-current-row-bg-color:var(--el-color-primary-light-9);--el-table-header-bg-color:var(--el-bg-color);--el-table-fixed-box-shadow:var(--el-box-shadow-light);--el-table-bg-color:var(--el-fill-color-blank);--el-table-tr-bg-color:var(--el-bg-color);--el-table-expanded-cell-bg-color:var(--el-fill-color-blank);--el-table-fixed-left-column:inset 10px 0 10px -10px rgba(0,0,0,.15);--el-table-fixed-right-column:inset -10px 0 10px -10px rgba(0,0,0,.15);--el-table-index:var(--el-index-normal);background-color:var(--el-table-bg-color);box-sizing:border-box;color:var(--el-table-text-color);font-size:14px;height:fit-content;max-width:100%;overflow:hidden;position:relative;width:100%}.el-table__inner-wrapper{display:flex;flex-direction:column;height:100%;position:relative}.el-table__inner-wrapper:before{bottom:0;height:1px;left:0}.el-table tbody:focus-visible{outline:none}.el-table.has-footer.el-table--fluid-height tr:last-child td.el-table__cell,.el-table.has-footer.el-table--scrollable-y tr:last-child td.el-table__cell{border-bottom-color:transparent}.el-table__empty-block{align-items:center;display:flex;justify-content:center;left:0;min-height:60px;position:sticky;text-align:center;width:100%}.el-table__empty-text{color:var(--el-text-color-secondary);line-height:60px;width:50%}.el-table__expand-column .cell{padding:0;text-align:center;-webkit-user-select:none;user-select:none}.el-table__expand-icon{color:var(--el-text-color-regular);cursor:pointer;font-size:12px;height:20px;position:relative;transition:transform var(--el-transition-duration-fast) ease-in-out}.el-table__expand-icon--expanded{transform:rotate(90deg)}.el-table__expand-icon>.el-icon{font-size:12px}.el-table__expanded-cell{background-color:var(--el-table-expanded-cell-bg-color)}.el-table__expanded-cell[class*=cell]{padding:20px 50px}.el-table__expanded-cell:hover{background-color:transparent!important}.el-table__placeholder{display:inline-block;width:20px}.el-table__append-wrapper{overflow:hidden}.el-table--fit{border-bottom:0;border-right:0}.el-table--fit .el-table__cell.gutter{border-right-width:1px}.el-table--fit .el-table__inner-wrapper:before{width:100%}.el-table thead{color:var(--el-table-header-text-color)}.el-table thead th{font-weight:600}.el-table thead.is-group th.el-table__cell{background:var(--el-fill-color-light)}.el-table .el-table__cell{box-sizing:border-box;min-width:0;padding:8px 0;position:relative;text-align:left;text-overflow:ellipsis;vertical-align:middle;z-index:var(--el-table-index)}.el-table .el-table__cell.is-center{text-align:center}.el-table .el-table__cell.is-right{text-align:right}.el-table .el-table__cell.gutter{border-bottom-width:0;border-right-width:0;padding:0;width:15px}.el-table .el-table__cell.is-hidden>*{visibility:hidden}.el-table .cell{box-sizing:border-box;line-height:23px;overflow:hidden;overflow-wrap:break-word;padding:0 12px;text-overflow:ellipsis;white-space:normal}.el-table .cell.el-tooltip{min-width:50px;white-space:nowrap}.el-table--large{font-size:var(--el-font-size-base)}.el-table--large .el-table__cell{padding:12px 0}.el-table--large .cell{padding:0 16px}.el-table--default{font-size:14px}.el-table--default .el-table__cell{padding:8px 0}.el-table--default .cell{padding:0 12px}.el-table--small{font-size:12px}.el-table--small .el-table__cell{padding:4px 0}.el-table--small .cell{padding:0 8px}.el-table tr{background-color:var(--el-table-tr-bg-color)}.el-table tr input[type=checkbox]{margin:0}.el-table td.el-table__cell,.el-table th.el-table__cell.is-leaf{border-bottom:var(--el-table-border)}.el-table th.el-table__cell.is-sortable{cursor:pointer}.el-table th.el-table__cell{background-color:var(--el-table-header-bg-color)}.el-table th.el-table__cell>.cell.highlight{color:var(--el-color-primary)}.el-table th.el-table__cell.required>div:before{background:#ff4d51;border-radius:50%;content:"";display:inline-block;height:8px;margin-right:5px;vertical-align:middle;width:8px}.el-table td.el-table__cell div{box-sizing:border-box}.el-table td.el-table__cell.gutter{width:0}.el-table--border .el-table__inner-wrapper:after,.el-table--border:after,.el-table--border:before,.el-table__inner-wrapper:before{background-color:var(--el-table-border-color);content:"";position:absolute;z-index:calc(var(--el-table-index) + 2)}.el-table--border .el-table__inner-wrapper:after{height:1px;left:0;top:0;width:100%;z-index:calc(var(--el-table-index) + 2)}.el-table--border:before{height:100%;left:0;top:-1px;width:1px}.el-table--border:after{height:100%;right:0;top:-1px;width:1px}.el-table--border .el-table__inner-wrapper{border-bottom:none;border-right:none}.el-table--border .el-table__footer-wrapper{flex-shrink:0;position:relative}.el-table--border .el-table__cell{border-right:var(--el-table-border)}.el-table--border th.el-table__cell.gutter:last-of-type{border-bottom:var(--el-table-border);border-bottom-width:1px}.el-table--border th.el-table__cell{border-bottom:var(--el-table-border)}.el-table--hidden{visibility:hidden}.el-table__body-wrapper,.el-table__footer-wrapper,.el-table__header-wrapper{width:100%}.el-table__body-wrapper tr td.el-table-fixed-column--left,.el-table__body-wrapper tr td.el-table-fixed-column--right,.el-table__body-wrapper tr th.el-table-fixed-column--left,.el-table__body-wrapper tr th.el-table-fixed-column--right,.el-table__footer-wrapper tr td.el-table-fixed-column--left,.el-table__footer-wrapper tr td.el-table-fixed-column--right,.el-table__footer-wrapper tr th.el-table-fixed-column--left,.el-table__footer-wrapper tr th.el-table-fixed-column--right,.el-table__header-wrapper tr td.el-table-fixed-column--left,.el-table__header-wrapper tr td.el-table-fixed-column--right,.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right{background:inherit;position:sticky!important;z-index:calc(var(--el-table-index) + 1)}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column:before{bottom:-1px;box-shadow:none;content:"";overflow-x:hidden;overflow-y:hidden;pointer-events:none;position:absolute;top:0;touch-action:none;width:10px}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column:before{left:-10px}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column:before{box-shadow:none;right:-10px}.el-table__body-wrapper tr td.el-table__fixed-right-patch,.el-table__body-wrapper tr th.el-table__fixed-right-patch,.el-table__footer-wrapper tr td.el-table__fixed-right-patch,.el-table__footer-wrapper tr th.el-table__fixed-right-patch,.el-table__header-wrapper tr td.el-table__fixed-right-patch,.el-table__header-wrapper tr th.el-table__fixed-right-patch{background:#fff;position:sticky!important;right:0;z-index:calc(var(--el-table-index) + 1)}.el-table__header-wrapper{flex-shrink:0}.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table__body,.el-table__footer,.el-table__header{border-collapse:separate;table-layout:fixed}.el-table__header-wrapper{overflow:hidden}.el-table__header-wrapper tbody td.el-table__cell{background-color:var(--el-table-row-hover-bg-color);color:var(--el-table-text-color)}.el-table__footer-wrapper{flex-shrink:0;overflow:hidden}.el-table__footer-wrapper tfoot td.el-table__cell{background-color:var(--el-table-row-hover-bg-color);color:var(--el-table-text-color)}.el-table__body-wrapper .el-table-column--selection>.cell,.el-table__header-wrapper .el-table-column--selection>.cell{align-items:center;display:inline-flex;height:23px}.el-table__body-wrapper .el-table-column--selection .el-checkbox,.el-table__header-wrapper .el-table-column--selection .el-checkbox{height:unset}.el-table.is-scrolling-left .el-table-fixed-column--right.is-first-column:before{box-shadow:var(--el-table-fixed-right-column)}.el-table.is-scrolling-left.el-table--border .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:var(--el-table-border)}.el-table.is-scrolling-left th.el-table-fixed-column--left{background-color:var(--el-table-header-bg-color)}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column:before{box-shadow:var(--el-table-fixed-left-column)}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-right th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-middle .el-table-fixed-column--right.is-first-column:before{box-shadow:var(--el-table-fixed-right-column)}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column:before{box-shadow:var(--el-table-fixed-left-column)}.el-table.is-scrolling-none .el-table-fixed-column--left.is-first-column:before,.el-table.is-scrolling-none .el-table-fixed-column--left.is-last-column:before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-first-column:before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-last-column:before{box-shadow:none}.el-table.is-scrolling-none th.el-table-fixed-column--left,.el-table.is-scrolling-none th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table__body-wrapper{flex:1;overflow:hidden;position:relative}.el-table__body-wrapper .el-scrollbar__bar{z-index:calc(var(--el-table-index) + 2)}.el-table .caret-wrapper{align-items:center;cursor:pointer;display:inline-flex;flex-direction:column;height:14px;overflow:initial;position:relative;vertical-align:middle;width:24px}.el-table .sort-caret{border:5px solid transparent;height:0;left:7px;position:absolute;width:0}.el-table .sort-caret.ascending{border-bottom-color:var(--el-text-color-placeholder);top:-5px}.el-table .sort-caret.descending{border-top-color:var(--el-text-color-placeholder);bottom:-3px}.el-table .ascending .sort-caret.ascending{border-bottom-color:var(--el-color-primary)}.el-table .descending .sort-caret.descending{border-top-color:var(--el-color-primary)}.el-table .hidden-columns{position:absolute;visibility:hidden;z-index:-1}.el-table--striped .el-table__body tr.el-table__row--striped td.el-table__cell{background:var(--el-fill-color-lighter)}.el-table--striped .el-table__body tr.el-table__row--striped.current-row td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table__body tr.hover-row.current-row>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped.current-row>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped>td.el-table__cell,.el-table__body tr.hover-row>td.el-table__cell,.el-table__body tr>td.hover-cell{background-color:var(--el-table-row-hover-bg-color)}.el-table__body tr.current-row>td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table.el-table--scrollable-y .el-table__body-header{position:sticky;top:0;z-index:calc(var(--el-table-index) + 2)}.el-table.el-table--scrollable-y .el-table__body-footer{bottom:0;position:sticky;z-index:calc(var(--el-table-index) + 2)}.el-table__column-resize-proxy{border-left:var(--el-table-border);bottom:0;left:200px;position:absolute;top:0;width:0;z-index:calc(var(--el-table-index) + 9)}.el-table__column-filter-trigger{cursor:pointer;display:inline-block}.el-table__column-filter-trigger i{color:var(--el-color-info);font-size:14px;vertical-align:middle}.el-table__border-left-patch{height:100%;top:0;width:1px}.el-table__border-bottom-patch,.el-table__border-left-patch{background-color:var(--el-table-border-color);left:0;position:absolute;z-index:calc(var(--el-table-index) + 2)}.el-table__border-bottom-patch{height:1px}.el-table__border-right-patch{background-color:var(--el-table-border-color);height:100%;position:absolute;top:0;width:1px;z-index:calc(var(--el-table-index) + 2)}.el-table--enable-row-transition .el-table__body td.el-table__cell{transition:background-color .25s ease}.el-table--enable-row-hover .el-table__body tr:hover>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table [class*=el-table__row--level] .el-table__expand-icon{display:inline-block;height:12px;line-height:12px;margin-right:8px;text-align:center;width:12px}.el-table .el-table.el-table--border .el-table__cell{border-right:var(--el-table-border)}.el-table:not(.el-table--border) .el-table__cell{border-right:none}.el-table:not(.el-table--border)>.el-table__inner-wrapper:after{content:none}.el-input-number{display:inline-flex;line-height:30px;position:relative;width:150px}.el-input-number .el-input__wrapper{padding-left:42px;padding-right:42px}.el-input-number .el-input__inner{-webkit-appearance:none;-moz-appearance:textfield;line-height:1;text-align:center}.el-input-number .el-input__inner::-webkit-inner-spin-button,.el-input-number .el-input__inner::-webkit-outer-spin-button{-webkit-appearance:none;margin:0}.el-input-number__decrease,.el-input-number__increase{align-items:center;background:var(--el-fill-color-light);bottom:1px;color:var(--el-text-color-regular);cursor:pointer;display:flex;font-size:13px;height:auto;justify-content:center;position:absolute;top:1px;-webkit-user-select:none;user-select:none;width:32px;z-index:1}.el-input-number__decrease:hover,.el-input-number__increase:hover{color:var(--el-color-primary)}.el-input-number__decrease:hover~.el-input:not(.is-disabled) .el-input__wrapper,.el-input-number__increase:hover~.el-input:not(.is-disabled) .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-border-color,var(--el-color-primary)) inset}.el-input-number__decrease.is-disabled,.el-input-number__increase.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-input-number__increase{border-left:var(--el-border);border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0;right:1px}.el-input-number__decrease{border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);border-right:var(--el-border);left:1px}.el-input-number.is-disabled .el-input-number__decrease,.el-input-number.is-disabled .el-input-number__increase{border-color:var(--el-disabled-border-color);color:var(--el-disabled-border-color)}.el-input-number.is-disabled .el-input-number__decrease:hover,.el-input-number.is-disabled .el-input-number__increase:hover{color:var(--el-disabled-border-color);cursor:not-allowed}.el-input-number--large{line-height:38px;width:180px}.el-input-number--large .el-input-number__decrease,.el-input-number--large .el-input-number__increase{font-size:14px;width:40px}.el-input-number--large .el-input--large .el-input__wrapper{padding-left:47px;padding-right:47px}.el-input-number--small{line-height:22px;width:120px}.el-input-number--small .el-input-number__decrease,.el-input-number--small .el-input-number__increase{font-size:12px;width:24px}.el-input-number--small .el-input--small .el-input__wrapper{padding-left:31px;padding-right:31px}.el-input-number--small .el-input-number__decrease [class*=el-icon],.el-input-number--small .el-input-number__increase [class*=el-icon]{transform:scale(.9)}.el-input-number.is-without-controls .el-input__wrapper{padding-left:15px;padding-right:15px}.el-input-number.is-controls-right .el-input__wrapper{padding-left:15px;padding-right:42px}.el-input-number.is-controls-right .el-input-number__decrease,.el-input-number.is-controls-right .el-input-number__increase{--el-input-number-controls-height:15px;height:var(--el-input-number-controls-height);line-height:var(--el-input-number-controls-height)}.el-input-number.is-controls-right .el-input-number__decrease [class*=el-icon],.el-input-number.is-controls-right .el-input-number__increase [class*=el-icon]{transform:scale(.8)}.el-input-number.is-controls-right .el-input-number__increase{border-bottom:var(--el-border);border-radius:0 var(--el-border-radius-base) 0 0;bottom:auto;left:auto}.el-input-number.is-controls-right .el-input-number__decrease{border-left:var(--el-border);border-radius:0 0 var(--el-border-radius-base) 0;border-right:none;left:auto;right:1px;top:auto}.el-input-number.is-controls-right[class*=large] [class*=decrease],.el-input-number.is-controls-right[class*=large] [class*=increase]{--el-input-number-controls-height:19px}.el-input-number.is-controls-right[class*=small] [class*=decrease],.el-input-number.is-controls-right[class*=small] [class*=increase]{--el-input-number-controls-height:11px}.el-table-column--selection .cell{padding-left:14px;padding-right:14px}.el-table-filter{background-color:#fff;border:1px solid var(--el-border-color-lighter);border-radius:2px;box-shadow:var(--el-box-shadow-light);box-sizing:border-box}.el-table-filter__list{list-style:none;margin:0;min-width:100px;padding:5px 0}.el-table-filter__list-item{cursor:pointer;font-size:var(--el-font-size-base);line-height:36px;padding:0 10px}.el-table-filter__list-item:hover{background-color:var(--el-color-primary-light-9);color:var(--el-color-primary)}.el-table-filter__list-item.is-active{background-color:var(--el-color-primary);color:#fff}.el-table-filter__content{min-width:100px}.el-table-filter__bottom{border-top:1px solid var(--el-border-color-lighter);padding:8px}.el-table-filter__bottom button{background:transparent;border:none;color:var(--el-text-color-regular);cursor:pointer;font-size:var(--el-font-size-small);padding:0 3px}.el-table-filter__bottom button:hover{color:var(--el-color-primary)}.el-table-filter__bottom button:focus{outline:none}.el-table-filter__bottom button.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-table-filter__wrap{max-height:280px}.el-table-filter__checkbox-group{padding:10px}.el-table-filter__checkbox-group label.el-checkbox{align-items:center;display:flex;height:unset;margin-bottom:12px;margin-left:5px;margin-right:5px}.el-table-filter__checkbox-group .el-checkbox:last-child{margin-bottom:0}.el-tag{--el-tag-font-size:12px;--el-tag-border-radius:4px;--el-tag-border-radius-rounded:9999px;align-items:center;background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);border-radius:var(--el-tag-border-radius);border-style:solid;border-width:1px;box-sizing:border-box;color:var(--el-tag-text-color);display:inline-flex;font-size:var(--el-tag-font-size);height:24px;justify-content:center;line-height:1;padding:0 9px;vertical-align:middle;white-space:nowrap;--el-icon-size:14px}.el-tag,.el-tag.el-tag--primary{--el-tag-bg-color:var(--el-color-primary-light-9);--el-tag-border-color:var(--el-color-primary-light-8);--el-tag-hover-color:var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-bg-color:var(--el-color-success-light-9);--el-tag-border-color:var(--el-color-success-light-8);--el-tag-hover-color:var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-bg-color:var(--el-color-warning-light-9);--el-tag-border-color:var(--el-color-warning-light-8);--el-tag-hover-color:var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-bg-color:var(--el-color-danger-light-9);--el-tag-border-color:var(--el-color-danger-light-8);--el-tag-hover-color:var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-bg-color:var(--el-color-error-light-9);--el-tag-border-color:var(--el-color-error-light-8);--el-tag-hover-color:var(--el-color-error)}.el-tag.el-tag--info{--el-tag-bg-color:var(--el-color-info-light-9);--el-tag-border-color:var(--el-color-info-light-8);--el-tag-hover-color:var(--el-color-info)}.el-tag.is-hit{border-color:var(--el-color-primary)}.el-tag.is-round{border-radius:var(--el-tag-border-radius-rounded)}.el-tag .el-tag__close{color:var(--el-tag-text-color);flex-shrink:0}.el-tag .el-tag__close:hover{background-color:var(--el-tag-hover-color);color:var(--el-color-white)}.el-tag.el-tag--primary{--el-tag-text-color:var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-text-color:var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-text-color:var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-text-color:var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-text-color:var(--el-color-error)}.el-tag.el-tag--info{--el-tag-text-color:var(--el-color-info)}.el-tag .el-icon{border-radius:50%;cursor:pointer;font-size:calc(var(--el-icon-size) - 2px);height:var(--el-icon-size);width:var(--el-icon-size)}.el-tag .el-tag__close{margin-left:6px}.el-tag--dark{--el-tag-text-color:var(--el-color-white)}.el-tag--dark,.el-tag--dark.el-tag--primary{--el-tag-bg-color:var(--el-color-primary);--el-tag-border-color:var(--el-color-primary);--el-tag-hover-color:var(--el-color-primary-light-3)}.el-tag--dark.el-tag--success{--el-tag-bg-color:var(--el-color-success);--el-tag-border-color:var(--el-color-success);--el-tag-hover-color:var(--el-color-success-light-3)}.el-tag--dark.el-tag--warning{--el-tag-bg-color:var(--el-color-warning);--el-tag-border-color:var(--el-color-warning);--el-tag-hover-color:var(--el-color-warning-light-3)}.el-tag--dark.el-tag--danger{--el-tag-bg-color:var(--el-color-danger);--el-tag-border-color:var(--el-color-danger);--el-tag-hover-color:var(--el-color-danger-light-3)}.el-tag--dark.el-tag--error{--el-tag-bg-color:var(--el-color-error);--el-tag-border-color:var(--el-color-error);--el-tag-hover-color:var(--el-color-error-light-3)}.el-tag--dark.el-tag--info{--el-tag-bg-color:var(--el-color-info);--el-tag-border-color:var(--el-color-info);--el-tag-hover-color:var(--el-color-info-light-3)}.el-tag--dark.el-tag--danger,.el-tag--dark.el-tag--error,.el-tag--dark.el-tag--info,.el-tag--dark.el-tag--primary,.el-tag--dark.el-tag--success,.el-tag--dark.el-tag--warning{--el-tag-text-color:var(--el-color-white)}.el-tag--plain,.el-tag--plain.el-tag--primary{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-primary-light-5);--el-tag-hover-color:var(--el-color-primary)}.el-tag--plain.el-tag--success{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-success-light-5);--el-tag-hover-color:var(--el-color-success)}.el-tag--plain.el-tag--warning{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-warning-light-5);--el-tag-hover-color:var(--el-color-warning)}.el-tag--plain.el-tag--danger{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-danger-light-5);--el-tag-hover-color:var(--el-color-danger)}.el-tag--plain.el-tag--error{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-error-light-5);--el-tag-hover-color:var(--el-color-error)}.el-tag--plain.el-tag--info{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-info-light-5);--el-tag-hover-color:var(--el-color-info)}.el-tag.is-closable{padding-right:5px}.el-tag--large{height:32px;padding:0 11px;--el-icon-size:16px}.el-tag--large .el-tag__close{margin-left:8px}.el-tag--large.is-closable{padding-right:7px}.el-tag--small{height:20px;padding:0 7px;--el-icon-size:12px}.el-tag--small .el-tag__close{margin-left:4px}.el-tag--small.is-closable{padding-right:3px}.el-tag--small .el-icon-close{transform:scale(.8)}.el-tag.el-tag--primary.is-hit{border-color:var(--el-color-primary)}.el-tag.el-tag--success.is-hit{border-color:var(--el-color-success)}.el-tag.el-tag--warning.is-hit{border-color:var(--el-color-warning)}.el-tag.el-tag--danger.is-hit{border-color:var(--el-color-danger)}.el-tag.el-tag--error.is-hit{border-color:var(--el-color-error)}.el-tag.el-tag--info.is-hit{border-color:var(--el-color-info)}.el-message{z-index:99999!important} ');
(function (vue, elementPlus, ie, vueDemi, pinia) {
'use strict';
var __defProp = Object.defineProperty;
var __getOwnPropNames = Object.getOwnPropertyNames;
var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __commonJS = (cb, mod) => function __require() {
return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports;
};
var __publicField = (obj, key, value) => __defNormalProp(obj, typeof key !== "symbol" ? key + "" : key, value);
var require_main_001 = __commonJS({
"main-Cg1Ga_1G.js"(exports, module) {
const Se = (e2) => {
const t2 = GM_getResourceText(e2);
return GM_addStyle(t2), t2;
};
Se("element-plus/dist/index.css");
class Ce {
constructor() {
__publicField(this, "isTimeEnd", false);
__publicField(this, "timeLimit", 10 * 1e3);
__publicField(this, "pageEndSelectors", [".ActiviesExpanel-ExpandBtn", ".DyImg-content > img"]);
}
observe() {
setTimeout(() => {
this.isTimeEnd = true;
}, this.timeLimit);
return new Promise((e2) => {
new MutationObserver((t2, n2) => {
const o2 = this.pageEndSelectors.find((e3) => !document.querySelector(e3));
if (!o2 || this.isTimeEnd) {
n2.disconnect();
e2();
}
}).observe(document, { childList: true, subtree: true });
});
}
}
const Ee = (e2, t2, { checkForDefaultPrevented: n2 = true } = {}) => {
const o2 = (o3) => {
const a2 = e2 == null ? void 0 : e2(o3);
if (n2 === false || !a2) {
return t2 == null ? void 0 : t2(o3);
}
};
return o2;
};
var Me = Object.defineProperty;
var Oe = Object.defineProperties;
var _e = Object.getOwnPropertyDescriptors;
var $e = Object.getOwnPropertySymbols;
var Le = Object.prototype.hasOwnProperty;
var Ae = Object.prototype.propertyIsEnumerable;
var De = (e2, t2, n2) => t2 in e2 ? Me(e2, t2, { enumerable: true, configurable: true, writable: true, value: n2 }) : e2[t2] = n2;
var Re = (e2, t2) => {
for (var n2 in t2 || (t2 = {})) if (Le.call(t2, n2)) De(e2, n2, t2[n2]);
if ($e) for (var n2 of $e(t2)) {
if (Ae.call(t2, n2)) De(e2, n2, t2[n2]);
}
return e2;
};
var Te = (e2, t2) => Oe(e2, _e(t2));
function Ne(e2, t2) {
var n2;
const o2 = vueDemi.shallowRef();
vueDemi.watchEffect(() => {
o2.value = e2();
}, Te(Re({}, t2), { flush: (n2 = void 0) != null ? n2 : "sync" }));
return vueDemi.readonly(o2);
}
var Pe;
const Ie = typeof window !== "undefined";
const Ve = (e2) => typeof e2 === "string";
const Be = () => {
};
const Fe = Ie && ((Pe = window == null ? void 0 : window.navigator) == null ? void 0 : Pe.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent);
function je(e2) {
return typeof e2 === "function" ? e2() : vueDemi.unref(e2);
}
function ze(e2) {
return e2;
}
function He(e2) {
if (vueDemi.getCurrentScope()) {
vueDemi.onScopeDispose(e2);
return true;
}
return false;
}
function We(e2, t2 = true) {
if (vueDemi.getCurrentInstance()) vueDemi.onMounted(e2);
else if (t2) e2();
else vueDemi.nextTick(e2);
}
function Ye(e2, t2, n2 = {}) {
const { immediate: o2 = true } = n2;
const a2 = vueDemi.ref(false);
let r2 = null;
function l2() {
if (r2) {
clearTimeout(r2);
r2 = null;
}
}
function s2() {
a2.value = false;
l2();
}
function i2(...n3) {
l2();
a2.value = true;
r2 = setTimeout(() => {
a2.value = false;
r2 = null;
e2(...n3);
}, je(t2));
}
if (o2) {
a2.value = true;
if (Ie) i2();
}
He(s2);
return { isPending: vueDemi.readonly(a2), start: i2, stop: s2 };
}
function Ue(e2) {
var t2;
const n2 = je(e2);
return (t2 = n2 == null ? void 0 : n2.$el) != null ? t2 : n2;
}
const Ke = Ie ? window : void 0;
const qe = Ie ? window.document : void 0;
function Ge(...e2) {
let t2;
let n2;
let o2;
let a2;
if (Ve(e2[0]) || Array.isArray(e2[0])) {
[n2, o2, a2] = e2;
t2 = Ke;
} else {
[t2, n2, o2, a2] = e2;
}
if (!t2) return Be;
if (!Array.isArray(n2)) n2 = [n2];
if (!Array.isArray(o2)) o2 = [o2];
const r2 = [];
const l2 = () => {
r2.forEach((e3) => e3());
r2.length = 0;
};
const s2 = (e3, t3, n3, o3) => {
e3.addEventListener(t3, n3, o3);
return () => e3.removeEventListener(t3, n3, o3);
};
const i2 = vueDemi.watch(() => [Ue(t2), je(a2)], ([e3, t3]) => {
l2();
if (!e3) return;
r2.push(...n2.flatMap((n3) => o2.map((o3) => s2(e3, n3, o3, t3))));
}, { immediate: true, flush: "post" });
const u2 = () => {
i2();
l2();
};
He(u2);
return u2;
}
let Xe = false;
function Ze(e2, t2, n2 = {}) {
const { window: o2 = Ke, ignore: a2 = [], capture: r2 = true, detectIframe: l2 = false } = n2;
if (!o2) return;
if (Fe && !Xe) {
Xe = true;
Array.from(o2.document.body.children).forEach((e3) => e3.addEventListener("click", Be));
}
let s2 = true;
const i2 = (e3) => a2.some((t3) => {
if (typeof t3 === "string") {
return Array.from(o2.document.querySelectorAll(t3)).some((t4) => t4 === e3.target || e3.composedPath().includes(t4));
} else {
const n3 = Ue(t3);
return n3 && (e3.target === n3 || e3.composedPath().includes(n3));
}
});
const u2 = (n3) => {
const o3 = Ue(e2);
if (!o3 || o3 === n3.target || n3.composedPath().includes(o3)) return;
if (n3.detail === 0) s2 = !i2(n3);
if (!s2) {
s2 = true;
return;
}
t2(n3);
};
const c2 = [Ge(o2, "click", u2, { passive: true, capture: r2 }), Ge(o2, "pointerdown", (t3) => {
const n3 = Ue(e2);
if (n3) s2 = !t3.composedPath().includes(n3) && !i2(t3);
}, { passive: true }), l2 && Ge(o2, "blur", (n3) => {
var a3;
const r3 = Ue(e2);
if (((a3 = o2.document.activeElement) == null ? void 0 : a3.tagName) === "IFRAME" && !(r3 == null ? void 0 : r3.contains(o2.document.activeElement))) t2(n3);
})].filter(Boolean);
const d2 = () => c2.forEach((e3) => e3());
return d2;
}
function Je(e2, t2 = false) {
const n2 = vueDemi.ref();
const o2 = () => n2.value = Boolean(e2());
o2();
We(o2, t2);
return n2;
}
const Qe = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
const et = "__vueuse_ssr_handlers__";
Qe[et] = Qe[et] || {};
function tt({ document: e2 = qe } = {}) {
if (!e2) return vueDemi.ref("visible");
const t2 = vueDemi.ref(e2.visibilityState);
Ge(e2, "visibilitychange", () => {
t2.value = e2.visibilityState;
});
return t2;
}
var nt = Object.getOwnPropertySymbols;
var ot = Object.prototype.hasOwnProperty;
var at = Object.prototype.propertyIsEnumerable;
var rt = (e2, t2) => {
var n2 = {};
for (var o2 in e2) if (ot.call(e2, o2) && t2.indexOf(o2) < 0) n2[o2] = e2[o2];
if (e2 != null && nt) for (var o2 of nt(e2)) {
if (t2.indexOf(o2) < 0 && at.call(e2, o2)) n2[o2] = e2[o2];
}
return n2;
};
function lt(e2, t2, n2 = {}) {
const o2 = n2, { window: a2 = Ke } = o2, r2 = rt(o2, ["window"]);
let l2;
const s2 = Je(() => a2 && "ResizeObserver" in a2);
const i2 = () => {
if (l2) {
l2.disconnect();
l2 = void 0;
}
};
const u2 = vueDemi.watch(() => Ue(e2), (e3) => {
i2();
if (s2.value && a2 && e3) {
l2 = new ResizeObserver(t2);
l2.observe(e3, r2);
}
}, { immediate: true, flush: "post" });
const c2 = () => {
i2();
u2();
};
He(c2);
return { isSupported: s2, stop: c2 };
}
var st;
(function(e2) {
e2["UP"] = "UP";
e2["RIGHT"] = "RIGHT";
e2["DOWN"] = "DOWN";
e2["LEFT"] = "LEFT";
e2["NONE"] = "NONE";
})(st || (st = {}));
var it = Object.defineProperty;
var ut = Object.getOwnPropertySymbols;
var ct = Object.prototype.hasOwnProperty;
var dt = Object.prototype.propertyIsEnumerable;
var ft = (e2, t2, n2) => t2 in e2 ? it(e2, t2, { enumerable: true, configurable: true, writable: true, value: n2 }) : e2[t2] = n2;
var pt = (e2, t2) => {
for (var n2 in t2 || (t2 = {})) if (ct.call(t2, n2)) ft(e2, n2, t2[n2]);
if (ut) for (var n2 of ut(t2)) {
if (dt.call(t2, n2)) ft(e2, n2, t2[n2]);
}
return e2;
};
const vt = { easeInSine: [0.12, 0, 0.39, 0], easeOutSine: [0.61, 1, 0.88, 1], easeInOutSine: [0.37, 0, 0.63, 1], easeInQuad: [0.11, 0, 0.5, 0], easeOutQuad: [0.5, 1, 0.89, 1], easeInOutQuad: [0.45, 0, 0.55, 1], easeInCubic: [0.32, 0, 0.67, 0], easeOutCubic: [0.33, 1, 0.68, 1], easeInOutCubic: [0.65, 0, 0.35, 1], easeInQuart: [0.5, 0, 0.75, 0], easeOutQuart: [0.25, 1, 0.5, 1], easeInOutQuart: [0.76, 0, 0.24, 1], easeInQuint: [0.64, 0, 0.78, 0], easeOutQuint: [0.22, 1, 0.36, 1], easeInOutQuint: [0.83, 0, 0.17, 1], easeInExpo: [0.7, 0, 0.84, 0], easeOutExpo: [0.16, 1, 0.3, 1], easeInOutExpo: [0.87, 0, 0.13, 1], easeInCirc: [0.55, 0, 1, 0.45], easeOutCirc: [0, 0.55, 0.45, 1], easeInOutCirc: [0.85, 0, 0.15, 1], easeInBack: [0.36, 0, 0.66, -0.56], easeOutBack: [0.34, 1.56, 0.64, 1], easeInOutBack: [0.68, -0.6, 0.32, 1.6] };
pt({ linear: ze }, vt);
function mt({ window: e2 = Ke } = {}) {
if (!e2) return vueDemi.ref(false);
const t2 = vueDemi.ref(e2.document.hasFocus());
Ge(e2, "blur", () => {
t2.value = false;
});
Ge(e2, "focus", () => {
t2.value = true;
});
return t2;
}
const ht = () => Ie && /firefox/i.test(window.navigator.userAgent);
const bt = () => {
};
const gt = Object.prototype.hasOwnProperty;
const yt = (e2, t2) => gt.call(e2, t2);
const wt = Array.isArray;
const xt = (e2) => Ot(e2) === "[object Date]";
const kt = (e2) => typeof e2 === "function";
const St = (e2) => typeof e2 === "string";
const Ct = (e2) => e2 !== null && typeof e2 === "object";
const Et = (e2) => (Ct(e2) || kt(e2)) && kt(e2.then) && kt(e2.catch);
const Mt = Object.prototype.toString;
const Ot = (e2) => Mt.call(e2);
const _t = (e2) => {
const t2 = /* @__PURE__ */ Object.create(null);
return (n2) => {
const o2 = t2[n2];
return o2 || (t2[n2] = e2(n2));
};
};
const $t = /-(\w)/g;
const Lt = _t((e2) => e2.replace($t, (e3, t2) => t2 ? t2.toUpperCase() : ""));
const At = /\B([A-Z])/g;
const Dt = _t((e2) => e2.replace(At, "-$1").toLowerCase());
const Rt = _t((e2) => e2.charAt(0).toUpperCase() + e2.slice(1));
var Tt = typeof global == "object" && global && global.Object === Object && global;
var Nt = typeof self == "object" && self && self.Object === Object && self;
var Pt = Tt || Nt || Function("return this")();
var It = Pt.Symbol;
var Vt = Object.prototype;
var Bt = Vt.hasOwnProperty;
var Ft = Vt.toString;
var jt = It ? It.toStringTag : void 0;
function zt(e2) {
var t2 = Bt.call(e2, jt), n2 = e2[jt];
try {
e2[jt] = void 0;
var o2 = true;
} catch (e3) {
}
var a2 = Ft.call(e2);
if (o2) {
if (t2) {
e2[jt] = n2;
} else {
delete e2[jt];
}
}
return a2;
}
var Ht = Object.prototype;
var Wt = Ht.toString;
function Yt(e2) {
return Wt.call(e2);
}
var Ut = "[object Null]", Kt = "[object Undefined]";
var qt = It ? It.toStringTag : void 0;
function Gt(e2) {
if (e2 == null) {
return e2 === void 0 ? Kt : Ut;
}
return qt && qt in Object(e2) ? zt(e2) : Yt(e2);
}
function Xt(e2) {
return e2 != null && typeof e2 == "object";
}
var Zt = "[object Symbol]";
function Jt(e2) {
return typeof e2 == "symbol" || Xt(e2) && Gt(e2) == Zt;
}
function Qt(e2, t2) {
var n2 = -1, o2 = e2 == null ? 0 : e2.length, a2 = Array(o2);
while (++n2 < o2) {
a2[n2] = t2(e2[n2], n2, e2);
}
return a2;
}
var en = Array.isArray;
var tn = 1 / 0;
var nn = It ? It.prototype : void 0, on = nn ? nn.toString : void 0;
function an(e2) {
if (typeof e2 == "string") {
return e2;
}
if (en(e2)) {
return Qt(e2, an) + "";
}
if (Jt(e2)) {
return on ? on.call(e2) : "";
}
var t2 = e2 + "";
return t2 == "0" && 1 / e2 == -tn ? "-0" : t2;
}
var rn = /\s/;
function ln(e2) {
var t2 = e2.length;
while (t2-- && rn.test(e2.charAt(t2))) {
}
return t2;
}
var sn = /^\s+/;
function un(e2) {
return e2 ? e2.slice(0, ln(e2) + 1).replace(sn, "") : e2;
}
function cn(e2) {
var t2 = typeof e2;
return e2 != null && (t2 == "object" || t2 == "function");
}
var dn = 0 / 0;
var fn = /^[-+]0x[0-9a-f]+$/i;
var pn = /^0b[01]+$/i;
var vn = /^0o[0-7]+$/i;
var mn = parseInt;
function hn(e2) {
if (typeof e2 == "number") {
return e2;
}
if (Jt(e2)) {
return dn;
}
if (cn(e2)) {
var t2 = typeof e2.valueOf == "function" ? e2.valueOf() : e2;
e2 = cn(t2) ? t2 + "" : t2;
}
if (typeof e2 != "string") {
return e2 === 0 ? e2 : +e2;
}
e2 = un(e2);
var n2 = pn.test(e2);
return n2 || vn.test(e2) ? mn(e2.slice(2), n2 ? 2 : 8) : fn.test(e2) ? dn : +e2;
}
function bn(e2) {
return e2;
}
var gn = "[object AsyncFunction]", yn = "[object Function]", wn = "[object GeneratorFunction]", xn = "[object Proxy]";
function kn(e2) {
if (!cn(e2)) {
return false;
}
var t2 = Gt(e2);
return t2 == yn || t2 == wn || t2 == gn || t2 == xn;
}
var Sn = Pt["__core-js_shared__"];
var Cn = function() {
var e2 = /[^.]+$/.exec(Sn && Sn.keys && Sn.keys.IE_PROTO || "");
return e2 ? "Symbol(src)_1." + e2 : "";
}();
function En(e2) {
return !!Cn && Cn in e2;
}
var Mn = Function.prototype;
var On = Mn.toString;
function _n(e2) {
if (e2 != null) {
try {
return On.call(e2);
} catch (e3) {
}
try {
return e2 + "";
} catch (e3) {
}
}
return "";
}
var $n = /[\\^$.*+?()[\]{}|]/g;
var Ln = /^\[object .+?Constructor\]$/;
var An = Function.prototype, Dn = Object.prototype;
var Rn = An.toString;
var Tn = Dn.hasOwnProperty;
var Nn = RegExp("^" + Rn.call(Tn).replace($n, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$");
function Pn(e2) {
if (!cn(e2) || En(e2)) {
return false;
}
var t2 = kn(e2) ? Nn : Ln;
return t2.test(_n(e2));
}
function In(e2, t2) {
return e2 == null ? void 0 : e2[t2];
}
function Vn(e2, t2) {
var n2 = In(e2, t2);
return Pn(n2) ? n2 : void 0;
}
var Bn = Vn(Pt, "WeakMap");
var Fn = Object.create;
var jn = /* @__PURE__ */ function() {
function e2() {
}
return function(t2) {
if (!cn(t2)) {
return {};
}
if (Fn) {
return Fn(t2);
}
e2.prototype = t2;
var n2 = new e2();
e2.prototype = void 0;
return n2;
};
}();
function zn(e2, t2, n2) {
switch (n2.length) {
case 0:
return e2.call(t2);
case 1:
return e2.call(t2, n2[0]);
case 2:
return e2.call(t2, n2[0], n2[1]);
case 3:
return e2.call(t2, n2[0], n2[1], n2[2]);
}
return e2.apply(t2, n2);
}
function Hn(e2, t2) {
var n2 = -1, o2 = e2.length;
t2 || (t2 = Array(o2));
while (++n2 < o2) {
t2[n2] = e2[n2];
}
return t2;
}
var Wn = 800, Yn = 16;
var Un = Date.now;
function Kn(e2) {
var t2 = 0, n2 = 0;
return function() {
var o2 = Un(), a2 = Yn - (o2 - n2);
n2 = o2;
if (a2 > 0) {
if (++t2 >= Wn) {
return arguments[0];
}
} else {
t2 = 0;
}
return e2.apply(void 0, arguments);
};
}
function qn(e2) {
return function() {
return e2;
};
}
var Gn = function() {
try {
var e2 = Vn(Object, "defineProperty");
e2({}, "", {});
return e2;
} catch (e3) {
}
}();
var Xn = !Gn ? bn : function(e2, t2) {
return Gn(e2, "toString", { configurable: true, enumerable: false, value: qn(t2), writable: true });
};
var Zn = Kn(Xn);
var Jn = 9007199254740991;
var Qn = /^(?:0|[1-9]\d*)$/;
function eo(e2, t2) {
var n2 = typeof e2;
t2 = t2 == null ? Jn : t2;
return !!t2 && (n2 == "number" || n2 != "symbol" && Qn.test(e2)) && (e2 > -1 && e2 % 1 == 0 && e2 < t2);
}
function to(e2, t2, n2) {
if (t2 == "__proto__" && Gn) {
Gn(e2, t2, { configurable: true, enumerable: true, value: n2, writable: true });
} else {
e2[t2] = n2;
}
}
function no(e2, t2) {
return e2 === t2 || e2 !== e2 && t2 !== t2;
}
var oo = Object.prototype;
var ao = oo.hasOwnProperty;
function ro(e2, t2, n2) {
var o2 = e2[t2];
if (!(ao.call(e2, t2) && no(o2, n2)) || n2 === void 0 && !(t2 in e2)) {
to(e2, t2, n2);
}
}
function lo(e2, t2, n2, o2) {
var a2 = !n2;
n2 || (n2 = {});
var r2 = -1, l2 = t2.length;
while (++r2 < l2) {
var s2 = t2[r2];
var i2 = void 0;
if (i2 === void 0) {
i2 = e2[s2];
}
if (a2) {
to(n2, s2, i2);
} else {
ro(n2, s2, i2);
}
}
return n2;
}
var so = Math.max;
function io(e2, t2, n2) {
t2 = so(t2 === void 0 ? e2.length - 1 : t2, 0);
return function() {
var o2 = arguments, a2 = -1, r2 = so(o2.length - t2, 0), l2 = Array(r2);
while (++a2 < r2) {
l2[a2] = o2[t2 + a2];
}
a2 = -1;
var s2 = Array(t2 + 1);
while (++a2 < t2) {
s2[a2] = o2[a2];
}
s2[t2] = n2(l2);
return zn(e2, this, s2);
};
}
function uo(e2, t2) {
return Zn(io(e2, t2, bn), e2 + "");
}
var co = 9007199254740991;
function fo(e2) {
return typeof e2 == "number" && e2 > -1 && e2 % 1 == 0 && e2 <= co;
}
function po(e2) {
return e2 != null && fo(e2.length) && !kn(e2);
}
function vo(e2, t2, n2) {
if (!cn(n2)) {
return false;
}
var o2 = typeof t2;
if (o2 == "number" ? po(n2) && eo(t2, n2.length) : o2 == "string" && t2 in n2) {
return no(n2[t2], e2);
}
return false;
}
function mo(e2) {
return uo(function(t2, n2) {
var o2 = -1, a2 = n2.length, r2 = a2 > 1 ? n2[a2 - 1] : void 0, l2 = a2 > 2 ? n2[2] : void 0;
r2 = e2.length > 3 && typeof r2 == "function" ? (a2--, r2) : void 0;
if (l2 && vo(n2[0], n2[1], l2)) {
r2 = a2 < 3 ? void 0 : r2;
a2 = 1;
}
t2 = Object(t2);
while (++o2 < a2) {
var s2 = n2[o2];
if (s2) {
e2(t2, s2, o2, r2);
}
}
return t2;
});
}
var ho = Object.prototype;
function bo(e2) {
var t2 = e2 && e2.constructor, n2 = typeof t2 == "function" && t2.prototype || ho;
return e2 === n2;
}
function go(e2, t2) {
var n2 = -1, o2 = Array(e2);
while (++n2 < e2) {
o2[n2] = t2(n2);
}
return o2;
}
var yo = "[object Arguments]";
function wo(e2) {
return Xt(e2) && Gt(e2) == yo;
}
var xo = Object.prototype;
var ko = xo.hasOwnProperty;
var So = xo.propertyIsEnumerable;
var Co = wo(/* @__PURE__ */ function() {
return arguments;
}()) ? wo : function(e2) {
return Xt(e2) && ko.call(e2, "callee") && !So.call(e2, "callee");
};
function Eo() {
return false;
}
var Mo = typeof exports == "object" && exports && !exports.nodeType && exports;
var Oo = Mo && typeof module == "object" && module && !module.nodeType && module;
var _o = Oo && Oo.exports === Mo;
var $o = _o ? Pt.Buffer : void 0;
var Lo = $o ? $o.isBuffer : void 0;
var Ao = Lo || Eo;
var Do = "[object Arguments]", Ro = "[object Array]", To = "[object Boolean]", No = "[object Date]", Po = "[object Error]", Io = "[object Function]", Vo = "[object Map]", Bo = "[object Number]", Fo = "[object Object]", jo = "[object RegExp]", zo = "[object Set]", Ho = "[object String]", Wo = "[object WeakMap]";
var Yo = "[object ArrayBuffer]", Uo = "[object DataView]", Ko = "[object Float32Array]", qo = "[object Float64Array]", Go = "[object Int8Array]", Xo = "[object Int16Array]", Zo = "[object Int32Array]", Jo = "[object Uint8Array]", Qo = "[object Uint8ClampedArray]", ea = "[object Uint16Array]", ta = "[object Uint32Array]";
var na = {};
na[Ko] = na[qo] = na[Go] = na[Xo] = na[Zo] = na[Jo] = na[Qo] = na[ea] = na[ta] = true;
na[Do] = na[Ro] = na[Yo] = na[To] = na[Uo] = na[No] = na[Po] = na[Io] = na[Vo] = na[Bo] = na[Fo] = na[jo] = na[zo] = na[Ho] = na[Wo] = false;
function oa(e2) {
return Xt(e2) && fo(e2.length) && !!na[Gt(e2)];
}
function aa(e2) {
return function(t2) {
return e2(t2);
};
}
var ra = typeof exports == "object" && exports && !exports.nodeType && exports;
var la = ra && typeof module == "object" && module && !module.nodeType && module;
var sa = la && la.exports === ra;
var ia = sa && Tt.process;
var ua = function() {
try {
var e2 = la && la.require && la.require("util").types;
if (e2) {
return e2;
}
return ia && ia.binding && ia.binding("util");
} catch (e3) {
}
}();
var ca = ua && ua.isTypedArray;
var da = ca ? aa(ca) : oa;
var fa = Object.prototype;
var pa = fa.hasOwnProperty;
function va(e2, t2) {
var n2 = en(e2), o2 = !n2 && Co(e2), a2 = !n2 && !o2 && Ao(e2), r2 = !n2 && !o2 && !a2 && da(e2), l2 = n2 || o2 || a2 || r2, s2 = l2 ? go(e2.length, String) : [], i2 = s2.length;
for (var u2 in e2) {
if ((t2 || pa.call(e2, u2)) && !(l2 && (u2 == "length" || a2 && (u2 == "offset" || u2 == "parent") || r2 && (u2 == "buffer" || u2 == "byteLength" || u2 == "byteOffset") || eo(u2, i2)))) {
s2.push(u2);
}
}
return s2;
}
function ma(e2, t2) {
return function(n2) {
return e2(t2(n2));
};
}
var ha = ma(Object.keys, Object);
var ba = Object.prototype;
var ga = ba.hasOwnProperty;
function ya(e2) {
if (!bo(e2)) {
return ha(e2);
}
var t2 = [];
for (var n2 in Object(e2)) {
if (ga.call(e2, n2) && n2 != "constructor") {
t2.push(n2);
}
}
return t2;
}
function wa(e2) {
return po(e2) ? va(e2) : ya(e2);
}
function xa(e2) {
var t2 = [];
if (e2 != null) {
for (var n2 in Object(e2)) {
t2.push(n2);
}
}
return t2;
}
var ka = Object.prototype;
var Sa = ka.hasOwnProperty;
function Ca(e2) {
if (!cn(e2)) {
return xa(e2);
}
var t2 = bo(e2), n2 = [];
for (var o2 in e2) {
if (!(o2 == "constructor" && (t2 || !Sa.call(e2, o2)))) {
n2.push(o2);
}
}
return n2;
}
function Ea(e2) {
return po(e2) ? va(e2, true) : Ca(e2);
}
var Ma = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, Oa = /^\w*$/;
function _a(e2, t2) {
if (en(e2)) {
return false;
}
var n2 = typeof e2;
if (n2 == "number" || n2 == "symbol" || n2 == "boolean" || e2 == null || Jt(e2)) {
return true;
}
return Oa.test(e2) || !Ma.test(e2) || t2 != null && e2 in Object(t2);
}
var $a = Vn(Object, "create");
function La() {
this.__data__ = $a ? $a(null) : {};
this.size = 0;
}
function Aa(e2) {
var t2 = this.has(e2) && delete this.__data__[e2];
this.size -= t2 ? 1 : 0;
return t2;
}
var Da = "__lodash_hash_undefined__";
var Ra = Object.prototype;
var Ta = Ra.hasOwnProperty;
function Na(e2) {
var t2 = this.__data__;
if ($a) {
var n2 = t2[e2];
return n2 === Da ? void 0 : n2;
}
return Ta.call(t2, e2) ? t2[e2] : void 0;
}
var Pa = Object.prototype;
var Ia = Pa.hasOwnProperty;
function Va(e2) {
var t2 = this.__data__;
return $a ? t2[e2] !== void 0 : Ia.call(t2, e2);
}
var Ba = "__lodash_hash_undefined__";
function Fa(e2, t2) {
var n2 = this.__data__;
this.size += this.has(e2) ? 0 : 1;
n2[e2] = $a && t2 === void 0 ? Ba : t2;
return this;
}
function ja(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length;
this.clear();
while (++t2 < n2) {
var o2 = e2[t2];
this.set(o2[0], o2[1]);
}
}
ja.prototype.clear = La;
ja.prototype["delete"] = Aa;
ja.prototype.get = Na;
ja.prototype.has = Va;
ja.prototype.set = Fa;
function za() {
this.__data__ = [];
this.size = 0;
}
function Ha(e2, t2) {
var n2 = e2.length;
while (n2--) {
if (no(e2[n2][0], t2)) {
return n2;
}
}
return -1;
}
var Wa = Array.prototype;
var Ya = Wa.splice;
function Ua(e2) {
var t2 = this.__data__, n2 = Ha(t2, e2);
if (n2 < 0) {
return false;
}
var o2 = t2.length - 1;
if (n2 == o2) {
t2.pop();
} else {
Ya.call(t2, n2, 1);
}
--this.size;
return true;
}
function Ka(e2) {
var t2 = this.__data__, n2 = Ha(t2, e2);
return n2 < 0 ? void 0 : t2[n2][1];
}
function qa(e2) {
return Ha(this.__data__, e2) > -1;
}
function Ga(e2, t2) {
var n2 = this.__data__, o2 = Ha(n2, e2);
if (o2 < 0) {
++this.size;
n2.push([e2, t2]);
} else {
n2[o2][1] = t2;
}
return this;
}
function Xa(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length;
this.clear();
while (++t2 < n2) {
var o2 = e2[t2];
this.set(o2[0], o2[1]);
}
}
Xa.prototype.clear = za;
Xa.prototype["delete"] = Ua;
Xa.prototype.get = Ka;
Xa.prototype.has = qa;
Xa.prototype.set = Ga;
var Za = Vn(Pt, "Map");
function Ja() {
this.size = 0;
this.__data__ = { hash: new ja(), map: new (Za || Xa)(), string: new ja() };
}
function Qa(e2) {
var t2 = typeof e2;
return t2 == "string" || t2 == "number" || t2 == "symbol" || t2 == "boolean" ? e2 !== "__proto__" : e2 === null;
}
function er(e2, t2) {
var n2 = e2.__data__;
return Qa(t2) ? n2[typeof t2 == "string" ? "string" : "hash"] : n2.map;
}
function tr(e2) {
var t2 = er(this, e2)["delete"](e2);
this.size -= t2 ? 1 : 0;
return t2;
}
function nr(e2) {
return er(this, e2).get(e2);
}
function or(e2) {
return er(this, e2).has(e2);
}
function ar(e2, t2) {
var n2 = er(this, e2), o2 = n2.size;
n2.set(e2, t2);
this.size += n2.size == o2 ? 0 : 1;
return this;
}
function rr(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length;
this.clear();
while (++t2 < n2) {
var o2 = e2[t2];
this.set(o2[0], o2[1]);
}
}
rr.prototype.clear = Ja;
rr.prototype["delete"] = tr;
rr.prototype.get = nr;
rr.prototype.has = or;
rr.prototype.set = ar;
var lr = "Expected a function";
function sr(e2, t2) {
if (typeof e2 != "function" || t2 != null && typeof t2 != "function") {
throw new TypeError(lr);
}
var n2 = function() {
var o2 = arguments, a2 = t2 ? t2.apply(this, o2) : o2[0], r2 = n2.cache;
if (r2.has(a2)) {
return r2.get(a2);
}
var l2 = e2.apply(this, o2);
n2.cache = r2.set(a2, l2) || r2;
return l2;
};
n2.cache = new (sr.Cache || rr)();
return n2;
}
sr.Cache = rr;
var ir = 500;
function ur(e2) {
var t2 = sr(e2, function(e3) {
if (n2.size === ir) {
n2.clear();
}
return e3;
});
var n2 = t2.cache;
return t2;
}
var cr = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
var dr = /\\(\\)?/g;
var fr = ur(function(e2) {
var t2 = [];
if (e2.charCodeAt(0) === 46) {
t2.push("");
}
e2.replace(cr, function(e3, n2, o2, a2) {
t2.push(o2 ? a2.replace(dr, "$1") : n2 || e3);
});
return t2;
});
function pr(e2) {
return e2 == null ? "" : an(e2);
}
function vr(e2, t2) {
if (en(e2)) {
return e2;
}
return _a(e2, t2) ? [e2] : fr(pr(e2));
}
var mr = 1 / 0;
function hr(e2) {
if (typeof e2 == "string" || Jt(e2)) {
return e2;
}
var t2 = e2 + "";
return t2 == "0" && 1 / e2 == -mr ? "-0" : t2;
}
function br(e2, t2) {
t2 = vr(t2, e2);
var n2 = 0, o2 = t2.length;
while (e2 != null && n2 < o2) {
e2 = e2[hr(t2[n2++])];
}
return n2 && n2 == o2 ? e2 : void 0;
}
function gr(e2, t2, n2) {
var o2 = e2 == null ? void 0 : br(e2, t2);
return o2 === void 0 ? n2 : o2;
}
function yr(e2, t2) {
var n2 = -1, o2 = t2.length, a2 = e2.length;
while (++n2 < o2) {
e2[a2 + n2] = t2[n2];
}
return e2;
}
var wr = It ? It.isConcatSpreadable : void 0;
function xr(e2) {
return en(e2) || Co(e2) || !!(wr && e2 && e2[wr]);
}
function kr(e2, t2, n2, o2, a2) {
var r2 = -1, l2 = e2.length;
n2 || (n2 = xr);
a2 || (a2 = []);
while (++r2 < l2) {
var s2 = e2[r2];
if (n2(s2)) {
{
yr(a2, s2);
}
} else {
a2[a2.length] = s2;
}
}
return a2;
}
function Sr(e2) {
var t2 = e2 == null ? 0 : e2.length;
return t2 ? kr(e2) : [];
}
function Cr(e2) {
return Zn(io(e2, void 0, Sr), e2 + "");
}
var Er = ma(Object.getPrototypeOf, Object);
var Mr = "[object Object]";
var Or = Function.prototype, _r = Object.prototype;
var $r = Or.toString;
var Lr = _r.hasOwnProperty;
var Ar = $r.call(Object);
function Dr(e2) {
if (!Xt(e2) || Gt(e2) != Mr) {
return false;
}
var t2 = Er(e2);
if (t2 === null) {
return true;
}
var n2 = Lr.call(t2, "constructor") && t2.constructor;
return typeof n2 == "function" && n2 instanceof n2 && $r.call(n2) == Ar;
}
function Rr() {
this.__data__ = new Xa();
this.size = 0;
}
function Tr(e2) {
var t2 = this.__data__, n2 = t2["delete"](e2);
this.size = t2.size;
return n2;
}
function Nr(e2) {
return this.__data__.get(e2);
}
function Pr(e2) {
return this.__data__.has(e2);
}
var Ir = 200;
function Vr(e2, t2) {
var n2 = this.__data__;
if (n2 instanceof Xa) {
var o2 = n2.__data__;
if (!Za || o2.length < Ir - 1) {
o2.push([e2, t2]);
this.size = ++n2.size;
return this;
}
n2 = this.__data__ = new rr(o2);
}
n2.set(e2, t2);
this.size = n2.size;
return this;
}
function Br(e2) {
var t2 = this.__data__ = new Xa(e2);
this.size = t2.size;
}
Br.prototype.clear = Rr;
Br.prototype["delete"] = Tr;
Br.prototype.get = Nr;
Br.prototype.has = Pr;
Br.prototype.set = Vr;
var Fr = typeof exports == "object" && exports && !exports.nodeType && exports;
var jr = Fr && typeof module == "object" && module && !module.nodeType && module;
var zr = jr && jr.exports === Fr;
var Hr = zr ? Pt.Buffer : void 0;
Hr ? Hr.allocUnsafe : void 0;
function Wr(e2, t2) {
{
return e2.slice();
}
}
function Yr(e2, t2) {
var n2 = -1, o2 = e2 == null ? 0 : e2.length, a2 = 0, r2 = [];
while (++n2 < o2) {
var l2 = e2[n2];
if (t2(l2, n2, e2)) {
r2[a2++] = l2;
}
}
return r2;
}
function Ur() {
return [];
}
var Kr = Object.prototype;
var qr = Kr.propertyIsEnumerable;
var Gr = Object.getOwnPropertySymbols;
var Xr = !Gr ? Ur : function(e2) {
if (e2 == null) {
return [];
}
e2 = Object(e2);
return Yr(Gr(e2), function(t2) {
return qr.call(e2, t2);
});
};
function Zr(e2, t2, n2) {
var o2 = t2(e2);
return en(e2) ? o2 : yr(o2, n2(e2));
}
function Jr(e2) {
return Zr(e2, wa, Xr);
}
var Qr = Vn(Pt, "DataView");
var el = Vn(Pt, "Promise");
var tl = Vn(Pt, "Set");
var nl = "[object Map]", ol = "[object Object]", al = "[object Promise]", rl = "[object Set]", ll = "[object WeakMap]";
var sl = "[object DataView]";
var il = _n(Qr), ul = _n(Za), cl = _n(el), dl = _n(tl), fl = _n(Bn);
var pl = Gt;
if (Qr && pl(new Qr(new ArrayBuffer(1))) != sl || Za && pl(new Za()) != nl || el && pl(el.resolve()) != al || tl && pl(new tl()) != rl || Bn && pl(new Bn()) != ll) {
pl = function(e2) {
var t2 = Gt(e2), n2 = t2 == ol ? e2.constructor : void 0, o2 = n2 ? _n(n2) : "";
if (o2) {
switch (o2) {
case il:
return sl;
case ul:
return nl;
case cl:
return al;
case dl:
return rl;
case fl:
return ll;
}
}
return t2;
};
}
var vl = Pt.Uint8Array;
function ml(e2) {
var t2 = new e2.constructor(e2.byteLength);
new vl(t2).set(new vl(e2));
return t2;
}
function hl(e2, t2) {
var n2 = ml(e2.buffer);
return new e2.constructor(n2, e2.byteOffset, e2.length);
}
function bl(e2) {
return typeof e2.constructor == "function" && !bo(e2) ? jn(Er(e2)) : {};
}
var gl = "__lodash_hash_undefined__";
function yl(e2) {
this.__data__.set(e2, gl);
return this;
}
function wl(e2) {
return this.__data__.has(e2);
}
function xl(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length;
this.__data__ = new rr();
while (++t2 < n2) {
this.add(e2[t2]);
}
}
xl.prototype.add = xl.prototype.push = yl;
xl.prototype.has = wl;
function kl(e2, t2) {
var n2 = -1, o2 = e2 == null ? 0 : e2.length;
while (++n2 < o2) {
if (t2(e2[n2], n2, e2)) {
return true;
}
}
return false;
}
function Sl(e2, t2) {
return e2.has(t2);
}
var Cl = 1, El = 2;
function Ml(e2, t2, n2, o2, a2, r2) {
var l2 = n2 & Cl, s2 = e2.length, i2 = t2.length;
if (s2 != i2 && !(l2 && i2 > s2)) {
return false;
}
var u2 = r2.get(e2);
var c2 = r2.get(t2);
if (u2 && c2) {
return u2 == t2 && c2 == e2;
}
var d2 = -1, f2 = true, p2 = n2 & El ? new xl() : void 0;
r2.set(e2, t2);
r2.set(t2, e2);
while (++d2 < s2) {
var v2 = e2[d2], m2 = t2[d2];
if (o2) {
var h2 = l2 ? o2(m2, v2, d2, t2, e2, r2) : o2(v2, m2, d2, e2, t2, r2);
}
if (h2 !== void 0) {
if (h2) {
continue;
}
f2 = false;
break;
}
if (p2) {
if (!kl(t2, function(e3, t3) {
if (!Sl(p2, t3) && (v2 === e3 || a2(v2, e3, n2, o2, r2))) {
return p2.push(t3);
}
})) {
f2 = false;
break;
}
} else if (!(v2 === m2 || a2(v2, m2, n2, o2, r2))) {
f2 = false;
break;
}
}
r2["delete"](e2);
r2["delete"](t2);
return f2;
}
function Ol(e2) {
var t2 = -1, n2 = Array(e2.size);
e2.forEach(function(e3, o2) {
n2[++t2] = [o2, e3];
});
return n2;
}
function _l(e2) {
var t2 = -1, n2 = Array(e2.size);
e2.forEach(function(e3) {
n2[++t2] = e3;
});
return n2;
}
var $l = 1, Ll = 2;
var Al = "[object Boolean]", Dl = "[object Date]", Rl = "[object Error]", Tl = "[object Map]", Nl = "[object Number]", Pl = "[object RegExp]", Il = "[object Set]", Vl = "[object String]", Bl = "[object Symbol]";
var Fl = "[object ArrayBuffer]", jl = "[object DataView]";
var zl = It ? It.prototype : void 0, Hl = zl ? zl.valueOf : void 0;
function Wl(e2, t2, n2, o2, a2, r2, l2) {
switch (n2) {
case jl:
if (e2.byteLength != t2.byteLength || e2.byteOffset != t2.byteOffset) {
return false;
}
e2 = e2.buffer;
t2 = t2.buffer;
case Fl:
if (e2.byteLength != t2.byteLength || !r2(new vl(e2), new vl(t2))) {
return false;
}
return true;
case Al:
case Dl:
case Nl:
return no(+e2, +t2);
case Rl:
return e2.name == t2.name && e2.message == t2.message;
case Pl:
case Vl:
return e2 == t2 + "";
case Tl:
var s2 = Ol;
case Il:
var i2 = o2 & $l;
s2 || (s2 = _l);
if (e2.size != t2.size && !i2) {
return false;
}
var u2 = l2.get(e2);
if (u2) {
return u2 == t2;
}
o2 |= Ll;
l2.set(e2, t2);
var c2 = Ml(s2(e2), s2(t2), o2, a2, r2, l2);
l2["delete"](e2);
return c2;
case Bl:
if (Hl) {
return Hl.call(e2) == Hl.call(t2);
}
}
return false;
}
var Yl = 1;
var Ul = Object.prototype;
var Kl = Ul.hasOwnProperty;
function ql(e2, t2, n2, o2, a2, r2) {
var l2 = n2 & Yl, s2 = Jr(e2), i2 = s2.length, u2 = Jr(t2), c2 = u2.length;
if (i2 != c2 && !l2) {
return false;
}
var d2 = i2;
while (d2--) {
var f2 = s2[d2];
if (!(l2 ? f2 in t2 : Kl.call(t2, f2))) {
return false;
}
}
var p2 = r2.get(e2);
var v2 = r2.get(t2);
if (p2 && v2) {
return p2 == t2 && v2 == e2;
}
var m2 = true;
r2.set(e2, t2);
r2.set(t2, e2);
var h2 = l2;
while (++d2 < i2) {
f2 = s2[d2];
var b2 = e2[f2], g2 = t2[f2];
if (o2) {
var y2 = l2 ? o2(g2, b2, f2, t2, e2, r2) : o2(b2, g2, f2, e2, t2, r2);
}
if (!(y2 === void 0 ? b2 === g2 || a2(b2, g2, n2, o2, r2) : y2)) {
m2 = false;
break;
}
h2 || (h2 = f2 == "constructor");
}
if (m2 && !h2) {
var w2 = e2.constructor, x2 = t2.constructor;
if (w2 != x2 && ("constructor" in e2 && "constructor" in t2) && !(typeof w2 == "function" && w2 instanceof w2 && typeof x2 == "function" && x2 instanceof x2)) {
m2 = false;
}
}
r2["delete"](e2);
r2["delete"](t2);
return m2;
}
var Gl = 1;
var Xl = "[object Arguments]", Zl = "[object Array]", Jl = "[object Object]";
var Ql = Object.prototype;
var es = Ql.hasOwnProperty;
function ts(e2, t2, n2, o2, a2, r2) {
var l2 = en(e2), s2 = en(t2), i2 = l2 ? Zl : pl(e2), u2 = s2 ? Zl : pl(t2);
i2 = i2 == Xl ? Jl : i2;
u2 = u2 == Xl ? Jl : u2;
var c2 = i2 == Jl, d2 = u2 == Jl, f2 = i2 == u2;
if (f2 && Ao(e2)) {
if (!Ao(t2)) {
return false;
}
l2 = true;
c2 = false;
}
if (f2 && !c2) {
r2 || (r2 = new Br());
return l2 || da(e2) ? Ml(e2, t2, n2, o2, a2, r2) : Wl(e2, t2, i2, n2, o2, a2, r2);
}
if (!(n2 & Gl)) {
var p2 = c2 && es.call(e2, "__wrapped__"), v2 = d2 && es.call(t2, "__wrapped__");
if (p2 || v2) {
var m2 = p2 ? e2.value() : e2, h2 = v2 ? t2.value() : t2;
r2 || (r2 = new Br());
return a2(m2, h2, n2, o2, r2);
}
}
if (!f2) {
return false;
}
r2 || (r2 = new Br());
return ql(e2, t2, n2, o2, a2, r2);
}
function ns(e2, t2, n2, o2, a2) {
if (e2 === t2) {
return true;
}
if (e2 == null || t2 == null || !Xt(e2) && !Xt(t2)) {
return e2 !== e2 && t2 !== t2;
}
return ts(e2, t2, n2, o2, ns, a2);
}
var os = 1, as = 2;
function rs(e2, t2, n2, o2) {
var a2 = n2.length, r2 = a2;
if (e2 == null) {
return !r2;
}
e2 = Object(e2);
while (a2--) {
var l2 = n2[a2];
if (l2[2] ? l2[1] !== e2[l2[0]] : !(l2[0] in e2)) {
return false;
}
}
while (++a2 < r2) {
l2 = n2[a2];
var s2 = l2[0], i2 = e2[s2], u2 = l2[1];
if (l2[2]) {
if (i2 === void 0 && !(s2 in e2)) {
return false;
}
} else {
var c2 = new Br();
var d2;
if (!(d2 === void 0 ? ns(u2, i2, os | as, o2, c2) : d2)) {
return false;
}
}
}
return true;
}
function ls(e2) {
return e2 === e2 && !cn(e2);
}
function ss(e2) {
var t2 = wa(e2), n2 = t2.length;
while (n2--) {
var o2 = t2[n2], a2 = e2[o2];
t2[n2] = [o2, a2, ls(a2)];
}
return t2;
}
function is(e2, t2) {
return function(n2) {
if (n2 == null) {
return false;
}
return n2[e2] === t2 && (t2 !== void 0 || e2 in Object(n2));
};
}
function us(e2) {
var t2 = ss(e2);
if (t2.length == 1 && t2[0][2]) {
return is(t2[0][0], t2[0][1]);
}
return function(n2) {
return n2 === e2 || rs(n2, e2, t2);
};
}
function cs(e2, t2) {
return e2 != null && t2 in Object(e2);
}
function ds(e2, t2, n2) {
t2 = vr(t2, e2);
var o2 = -1, a2 = t2.length, r2 = false;
while (++o2 < a2) {
var l2 = hr(t2[o2]);
if (!(r2 = e2 != null && n2(e2, l2))) {
break;
}
e2 = e2[l2];
}
if (r2 || ++o2 != a2) {
return r2;
}
a2 = e2 == null ? 0 : e2.length;
return !!a2 && fo(a2) && eo(l2, a2) && (en(e2) || Co(e2));
}
function fs(e2, t2) {
return e2 != null && ds(e2, t2, cs);
}
var ps = 1, vs = 2;
function ms(e2, t2) {
if (_a(e2) && ls(t2)) {
return is(hr(e2), t2);
}
return function(n2) {
var o2 = gr(n2, e2);
return o2 === void 0 && o2 === t2 ? fs(n2, e2) : ns(t2, o2, ps | vs);
};
}
function hs(e2) {
return function(t2) {
return t2 == null ? void 0 : t2[e2];
};
}
function bs(e2) {
return function(t2) {
return br(t2, e2);
};
}
function gs(e2) {
return _a(e2) ? hs(hr(e2)) : bs(e2);
}
function ys(e2) {
if (typeof e2 == "function") {
return e2;
}
if (e2 == null) {
return bn;
}
if (typeof e2 == "object") {
return en(e2) ? ms(e2[0], e2[1]) : us(e2);
}
return gs(e2);
}
function ws(e2) {
return function(e3, t2, n2) {
var o2 = -1, a2 = Object(e3), r2 = n2(e3), l2 = r2.length;
while (l2--) {
var s2 = r2[++o2];
if (t2(a2[s2], s2, a2) === false) {
break;
}
}
return e3;
};
}
var xs = ws();
function ks(e2, t2) {
return e2 && xs(e2, t2, wa);
}
function Ss(e2, t2) {
return function(t3, n2) {
if (t3 == null) {
return t3;
}
if (!po(t3)) {
return e2(t3, n2);
}
var o2 = t3.length, a2 = -1, r2 = Object(t3);
while (++a2 < o2) {
if (n2(r2[a2], a2, r2) === false) {
break;
}
}
return t3;
};
}
var Cs = Ss(ks);
var Es = function() {
return Pt.Date.now();
};
var Ms = "Expected a function";
var Os = Math.max, _s = Math.min;
function $s(e2, t2, n2) {
var o2, a2, r2, l2, s2, i2, u2 = 0, c2 = false, d2 = false, f2 = true;
if (typeof e2 != "function") {
throw new TypeError(Ms);
}
t2 = hn(t2) || 0;
if (cn(n2)) {
c2 = !!n2.leading;
d2 = "maxWait" in n2;
r2 = d2 ? Os(hn(n2.maxWait) || 0, t2) : r2;
f2 = "trailing" in n2 ? !!n2.trailing : f2;
}
function p2(t3) {
var n3 = o2, r3 = a2;
o2 = a2 = void 0;
u2 = t3;
l2 = e2.apply(r3, n3);
return l2;
}
function v2(e3) {
u2 = e3;
s2 = setTimeout(b2, t2);
return c2 ? p2(e3) : l2;
}
function m2(e3) {
var n3 = e3 - i2, o3 = e3 - u2, a3 = t2 - n3;
return d2 ? _s(a3, r2 - o3) : a3;
}
function h2(e3) {
var n3 = e3 - i2, o3 = e3 - u2;
return i2 === void 0 || n3 >= t2 || n3 < 0 || d2 && o3 >= r2;
}
function b2() {
var e3 = Es();
if (h2(e3)) {
return g2(e3);
}
s2 = setTimeout(b2, m2(e3));
}
function g2(e3) {
s2 = void 0;
if (f2 && o2) {
return p2(e3);
}
o2 = a2 = void 0;
return l2;
}
function y2() {
if (s2 !== void 0) {
clearTimeout(s2);
}
u2 = 0;
o2 = i2 = a2 = s2 = void 0;
}
function w2() {
return s2 === void 0 ? l2 : g2(Es());
}
function x2() {
var e3 = Es(), n3 = h2(e3);
o2 = arguments;
a2 = this;
i2 = e3;
if (n3) {
if (s2 === void 0) {
return v2(i2);
}
if (d2) {
clearTimeout(s2);
s2 = setTimeout(b2, t2);
return p2(i2);
}
}
if (s2 === void 0) {
s2 = setTimeout(b2, t2);
}
return l2;
}
x2.cancel = y2;
x2.flush = w2;
return x2;
}
function Ls(e2, t2, n2) {
if (n2 !== void 0 && !no(e2[t2], n2) || n2 === void 0 && !(t2 in e2)) {
to(e2, t2, n2);
}
}
function As(e2) {
return Xt(e2) && po(e2);
}
function Ds(e2, t2) {
if (t2 === "constructor" && typeof e2[t2] === "function") {
return;
}
if (t2 == "__proto__") {
return;
}
return e2[t2];
}
function Rs(e2) {
return lo(e2, Ea(e2));
}
function Ts(e2, t2, n2, o2, a2, r2, l2) {
var s2 = Ds(e2, n2), i2 = Ds(t2, n2), u2 = l2.get(i2);
if (u2) {
Ls(e2, n2, u2);
return;
}
var c2 = r2 ? r2(s2, i2, n2 + "", e2, t2, l2) : void 0;
var d2 = c2 === void 0;
if (d2) {
var f2 = en(i2), p2 = !f2 && Ao(i2), v2 = !f2 && !p2 && da(i2);
c2 = i2;
if (f2 || p2 || v2) {
if (en(s2)) {
c2 = s2;
} else if (As(s2)) {
c2 = Hn(s2);
} else if (p2) {
d2 = false;
c2 = Wr(i2);
} else if (v2) {
d2 = false;
c2 = hl(i2);
} else {
c2 = [];
}
} else if (Dr(i2) || Co(i2)) {
c2 = s2;
if (Co(s2)) {
c2 = Rs(s2);
} else if (!cn(s2) || kn(s2)) {
c2 = bl(i2);
}
} else {
d2 = false;
}
}
if (d2) {
l2.set(i2, c2);
a2(c2, i2, o2, r2, l2);
l2["delete"](i2);
}
Ls(e2, n2, c2);
}
function Ns(e2, t2, n2, o2, a2) {
if (e2 === t2) {
return;
}
xs(t2, function(r2, l2) {
a2 || (a2 = new Br());
if (cn(r2)) {
Ts(e2, t2, l2, n2, Ns, o2, a2);
} else {
var s2 = o2 ? o2(Ds(e2, l2), r2, l2 + "", e2, t2, a2) : void 0;
if (s2 === void 0) {
s2 = r2;
}
Ls(e2, l2, s2);
}
}, Ea);
}
function Ps(e2, t2) {
var n2 = -1, o2 = po(e2) ? Array(e2.length) : [];
Cs(e2, function(e3, a2, r2) {
o2[++n2] = t2(e3, a2, r2);
});
return o2;
}
function Is(e2, t2) {
var n2 = en(e2) ? Qt : Ps;
return n2(e2, ys(t2));
}
function Vs(e2, t2) {
return kr(Is(e2, t2));
}
function Bs(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length, o2 = {};
while (++t2 < n2) {
var a2 = e2[t2];
o2[a2[0]] = a2[1];
}
return o2;
}
function Fs(e2, t2) {
return ns(e2, t2);
}
function js(e2) {
return e2 == null;
}
function zs(e2) {
return e2 === void 0;
}
var Hs = mo(function(e2, t2, n2) {
Ns(e2, t2, n2);
});
function Ws(e2, t2, n2, o2) {
if (!cn(e2)) {
return e2;
}
t2 = vr(t2, e2);
var a2 = -1, r2 = t2.length, l2 = r2 - 1, s2 = e2;
while (s2 != null && ++a2 < r2) {
var i2 = hr(t2[a2]), u2 = n2;
if (i2 === "__proto__" || i2 === "constructor" || i2 === "prototype") {
return e2;
}
if (a2 != l2) {
var c2 = s2[i2];
u2 = void 0;
if (u2 === void 0) {
u2 = cn(c2) ? c2 : eo(t2[a2 + 1]) ? [] : {};
}
}
ro(s2, i2, u2);
s2 = s2[i2];
}
return e2;
}
function Ys(e2, t2, n2) {
var o2 = -1, a2 = t2.length, r2 = {};
while (++o2 < a2) {
var l2 = t2[o2], s2 = br(e2, l2);
if (n2(s2, l2)) {
Ws(r2, vr(l2, e2), s2);
}
}
return r2;
}
function Us(e2, t2) {
return Ys(e2, t2, function(t3, n2) {
return fs(e2, n2);
});
}
var Ks = Cr(function(e2, t2) {
return e2 == null ? {} : Us(e2, t2);
});
function qs(e2, t2, n2) {
return e2 == null ? e2 : Ws(e2, t2, n2);
}
const Gs = (e2) => e2 === void 0;
const Xs = (e2) => typeof e2 === "boolean";
const Zs = (e2) => typeof e2 === "number";
const Js = (e2) => !e2 && e2 !== 0 || wt(e2) && e2.length === 0 || Ct(e2) && !Object.keys(e2).length;
const Qs = (e2) => {
if (typeof Element === "undefined") return false;
return e2 instanceof Element;
};
const ei = (e2) => js(e2);
const ti = (e2) => {
if (!St(e2)) {
return false;
}
return !Number.isNaN(Number(e2));
};
const ni = (e2) => Ie ? window.requestAnimationFrame(e2) : setTimeout(e2, 16);
const oi = (e2) => Rt(e2);
const ai = (e2) => Object.keys(e2);
const ri = (e2, t2, n2) => ({ get value() {
return gr(e2, t2, n2);
}, set value(n3) {
qs(e2, t2, n3);
} });
class li extends Error {
constructor(e2) {
super(e2);
this.name = "ElementPlusError";
}
}
function si(e2, t2) {
throw new li(`[${e2}] ${t2}`);
}
function ii(e2, t2) {
}
const ui = (e2 = "") => e2.split(" ").filter((e3) => !!e3.trim());
const ci = (e2, t2) => {
if (!e2 || !t2) return false;
if (t2.includes(" ")) throw new Error("className should not contain space.");
return e2.classList.contains(t2);
};
const di = (e2, t2) => {
if (!e2 || !t2.trim()) return;
e2.classList.add(...ui(t2));
};
const fi = (e2, t2) => {
if (!e2 || !t2.trim()) return;
e2.classList.remove(...ui(t2));
};
const pi = (e2, t2) => {
var n2;
if (!Ie || !e2 || !t2) return "";
let o2 = Lt(t2);
if (o2 === "float") o2 = "cssFloat";
try {
const t3 = e2.style[o2];
if (t3) return t3;
const a2 = (n2 = document.defaultView) == null ? void 0 : n2.getComputedStyle(e2, "");
return a2 ? a2[o2] : "";
} catch (t3) {
return e2.style[o2];
}
};
function vi(e2, t2 = "px") {
if (!e2) return "";
if (Zs(e2) || ti(e2)) {
return `${e2}${t2}`;
} else if (St(e2)) {
return e2;
}
}
let mi;
const hi = (e2) => {
var t2;
if (!Ie) return 0;
if (mi !== void 0) return mi;
const n2 = document.createElement("div");
n2.className = `${e2}-scrollbar__wrap`;
n2.style.visibility = "hidden";
n2.style.width = "100px";
n2.style.position = "absolute";
n2.style.top = "-9999px";
document.body.appendChild(n2);
const o2 = n2.offsetWidth;
n2.style.overflow = "scroll";
const a2 = document.createElement("div");
a2.style.width = "100%";
n2.appendChild(a2);
const r2 = a2.offsetWidth;
(t2 = n2.parentNode) == null ? void 0 : t2.removeChild(n2);
mi = o2 - r2;
return mi;
};
/*! Element Plus Icons Vue v2.3.1 */
var bi = vue.defineComponent({ name: "ArrowDown", __name: "arrow-down", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M831.872 340.864 512 652.672 192.128 340.864a30.592 30.592 0 0 0-42.752 0 29.12 29.12 0 0 0 0 41.6L489.664 714.24a32 32 0 0 0 44.672 0l340.288-331.712a29.12 29.12 0 0 0 0-41.728 30.592 30.592 0 0 0-42.752 0z" })]));
} });
var gi = bi;
var yi = vue.defineComponent({ name: "ArrowLeft", __name: "arrow-left", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M609.408 149.376 277.76 489.6a32 32 0 0 0 0 44.672l331.648 340.352a29.12 29.12 0 0 0 41.728 0 30.592 30.592 0 0 0 0-42.752L339.264 511.936l311.872-319.872a30.592 30.592 0 0 0 0-42.688 29.12 29.12 0 0 0-41.728 0z" })]));
} });
var wi = yi;
var xi = vue.defineComponent({ name: "ArrowRight", __name: "arrow-right", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M340.864 149.312a30.592 30.592 0 0 0 0 42.752L652.736 512 340.864 831.872a30.592 30.592 0 0 0 0 42.752 29.12 29.12 0 0 0 41.728 0L714.24 534.336a32 32 0 0 0 0-44.672L382.592 149.376a29.12 29.12 0 0 0-41.728 0z" })]));
} });
var ki = xi;
var Si = vue.defineComponent({ name: "ArrowUp", __name: "arrow-up", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m488.832 344.32-339.84 356.672a32 32 0 0 0 0 44.16l.384.384a29.44 29.44 0 0 0 42.688 0l320-335.872 319.872 335.872a29.44 29.44 0 0 0 42.688 0l.384-.384a32 32 0 0 0 0-44.16L535.168 344.32a32 32 0 0 0-46.336 0" })]));
} });
var Ci = Si;
var Ei = vue.defineComponent({ name: "Calendar", __name: "calendar", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M128 384v512h768V192H768v32a32 32 0 1 1-64 0v-32H320v32a32 32 0 0 1-64 0v-32H128v128h768v64zm192-256h384V96a32 32 0 1 1 64 0v32h160a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h160V96a32 32 0 0 1 64 0zm-32 384h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64" })]));
} });
var Mi = Ei;
var Oi = vue.defineComponent({ name: "CircleCheck", __name: "circle-check", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M745.344 361.344a32 32 0 0 1 45.312 45.312l-288 288a32 32 0 0 1-45.312 0l-160-160a32 32 0 1 1 45.312-45.312L480 626.752l265.344-265.408z" })]));
} });
var _i = Oi;
var $i = vue.defineComponent({ name: "CircleClose", __name: "circle-close", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m466.752 512-90.496-90.496a32 32 0 0 1 45.248-45.248L512 466.752l90.496-90.496a32 32 0 1 1 45.248 45.248L557.248 512l90.496 90.496a32 32 0 1 1-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 0 1-45.248-45.248z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" })]));
} });
var Li = $i;
var Ai = vue.defineComponent({ name: "Clock", __name: "clock", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M480 256a32 32 0 0 1 32 32v256a32 32 0 0 1-64 0V288a32 32 0 0 1 32-32" }), vue.createElementVNode("path", { fill: "currentColor", d: "M480 512h256q32 0 32 32t-32 32H480q-32 0-32-32t32-32" })]));
} });
var Di = Ai;
var Ri = vue.defineComponent({ name: "Close", __name: "close", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z" })]));
} });
var Ti = Ri;
var Ni = vue.defineComponent({ name: "DArrowLeft", __name: "d-arrow-left", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M529.408 149.376a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L259.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L197.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224zm256 0a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L515.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L453.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224z" })]));
} });
var Pi = Ni;
var Ii = vue.defineComponent({ name: "DArrowRight", __name: "d-arrow-right", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M452.864 149.312a29.12 29.12 0 0 1 41.728.064L826.24 489.664a32 32 0 0 1 0 44.672L494.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L764.736 512 452.864 192a30.592 30.592 0 0 1 0-42.688m-256 0a29.12 29.12 0 0 1 41.728.064L570.24 489.664a32 32 0 0 1 0 44.672L238.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L508.736 512 196.864 192a30.592 30.592 0 0 1 0-42.688z" })]));
} });
var Vi = Ii;
var Bi = vue.defineComponent({ name: "Hide", __name: "hide", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M876.8 156.8c0-9.6-3.2-16-9.6-22.4-6.4-6.4-12.8-9.6-22.4-9.6-9.6 0-16 3.2-22.4 9.6L736 220.8c-64-32-137.6-51.2-224-60.8-160 16-288 73.6-377.6 176C44.8 438.4 0 496 0 512s48 73.6 134.4 176c22.4 25.6 44.8 48 73.6 67.2l-86.4 89.6c-6.4 6.4-9.6 12.8-9.6 22.4 0 9.6 3.2 16 9.6 22.4 6.4 6.4 12.8 9.6 22.4 9.6 9.6 0 16-3.2 22.4-9.6l704-710.4c3.2-6.4 6.4-12.8 6.4-22.4Zm-646.4 528c-76.8-70.4-128-128-153.6-172.8 28.8-48 80-105.6 153.6-172.8C304 272 400 230.4 512 224c64 3.2 124.8 19.2 176 44.8l-54.4 54.4C598.4 300.8 560 288 512 288c-64 0-115.2 22.4-160 64s-64 96-64 160c0 48 12.8 89.6 35.2 124.8L256 707.2c-9.6-6.4-19.2-16-25.6-22.4Zm140.8-96c-12.8-22.4-19.2-48-19.2-76.8 0-44.8 16-83.2 48-112 32-28.8 67.2-48 112-48 28.8 0 54.4 6.4 73.6 19.2zM889.599 336c-12.8-16-28.8-28.8-41.6-41.6l-48 48c73.6 67.2 124.8 124.8 150.4 169.6-28.8 48-80 105.6-153.6 172.8-73.6 67.2-172.8 108.8-284.8 115.2-51.2-3.2-99.2-12.8-140.8-28.8l-48 48c57.6 22.4 118.4 38.4 188.8 44.8 160-16 288-73.6 377.6-176C979.199 585.6 1024 528 1024 512s-48.001-73.6-134.401-176Z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M511.998 672c-12.8 0-25.6-3.2-38.4-6.4l-51.2 51.2c28.8 12.8 57.6 19.2 89.6 19.2 64 0 115.2-22.4 160-64 41.6-41.6 64-96 64-160 0-32-6.4-64-19.2-89.6l-51.2 51.2c3.2 12.8 6.4 25.6 6.4 38.4 0 44.8-16 83.2-48 112-32 28.8-67.2 48-112 48Z" })]));
} });
var Fi = Bi;
var ji = vue.defineComponent({ name: "Loading", __name: "loading", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32m0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32m448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32m-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32M195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0m-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z" })]));
} });
var zi = ji;
var Hi = vue.defineComponent({ name: "Minus", __name: "minus", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M128 544h768a32 32 0 1 0 0-64H128a32 32 0 0 0 0 64" })]));
} });
var Wi = Hi;
var Yi = vue.defineComponent({ name: "Plus", __name: "plus", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M480 480V128a32 32 0 0 1 64 0v352h352a32 32 0 1 1 0 64H544v352a32 32 0 1 1-64 0V544H128a32 32 0 0 1 0-64z" })]));
} });
var Ui = Yi;
var Ki = vue.defineComponent({ name: "Rank", __name: "rank", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m186.496 544 41.408 41.344a32 32 0 1 1-45.248 45.312l-96-96a32 32 0 0 1 0-45.312l96-96a32 32 0 1 1 45.248 45.312L186.496 480h290.816V186.432l-41.472 41.472a32 32 0 1 1-45.248-45.184l96-96.128a32 32 0 0 1 45.312 0l96 96.064a32 32 0 0 1-45.248 45.184l-41.344-41.28V480H832l-41.344-41.344a32 32 0 0 1 45.248-45.312l96 96a32 32 0 0 1 0 45.312l-96 96a32 32 0 0 1-45.248-45.312L832 544H541.312v293.44l41.344-41.28a32 32 0 1 1 45.248 45.248l-96 96a32 32 0 0 1-45.312 0l-96-96a32 32 0 1 1 45.312-45.248l41.408 41.408V544H186.496z" })]));
} });
var qi = Ki;
var Gi = vue.defineComponent({ name: "Setting", __name: "setting", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M600.704 64a32 32 0 0 1 30.464 22.208l35.2 109.376c14.784 7.232 28.928 15.36 42.432 24.512l112.384-24.192a32 32 0 0 1 34.432 15.36L944.32 364.8a32 32 0 0 1-4.032 37.504l-77.12 85.12a357.12 357.12 0 0 1 0 49.024l77.12 85.248a32 32 0 0 1 4.032 37.504l-88.704 153.6a32 32 0 0 1-34.432 15.296L708.8 803.904c-13.44 9.088-27.648 17.28-42.368 24.512l-35.264 109.376A32 32 0 0 1 600.704 960H423.296a32 32 0 0 1-30.464-22.208L357.696 828.48a351.616 351.616 0 0 1-42.56-24.64l-112.32 24.256a32 32 0 0 1-34.432-15.36L79.68 659.2a32 32 0 0 1 4.032-37.504l77.12-85.248a357.12 357.12 0 0 1 0-48.896l-77.12-85.248A32 32 0 0 1 79.68 364.8l88.704-153.6a32 32 0 0 1 34.432-15.296l112.32 24.256c13.568-9.152 27.776-17.408 42.56-24.64l35.2-109.312A32 32 0 0 1 423.232 64H600.64zm-23.424 64H446.72l-36.352 113.088-24.512 11.968a294.113 294.113 0 0 0-34.816 20.096l-22.656 15.36-116.224-25.088-65.28 113.152 79.68 88.192-1.92 27.136a293.12 293.12 0 0 0 0 40.192l1.92 27.136-79.808 88.192 65.344 113.152 116.224-25.024 22.656 15.296a294.113 294.113 0 0 0 34.816 20.096l24.512 11.968L446.72 896h130.688l36.48-113.152 24.448-11.904a288.282 288.282 0 0 0 34.752-20.096l22.592-15.296 116.288 25.024 65.28-113.152-79.744-88.192 1.92-27.136a293.12 293.12 0 0 0 0-40.256l-1.92-27.136 79.808-88.128-65.344-113.152-116.288 24.96-22.592-15.232a287.616 287.616 0 0 0-34.752-20.096l-24.448-11.904L577.344 128zM512 320a192 192 0 1 1 0 384 192 192 0 0 1 0-384m0 64a128 128 0 1 0 0 256 128 128 0 0 0 0-256" })]));
} });
var Xi = Gi;
var Zi = vue.defineComponent({ name: "View", __name: "view", setup(e2) {
return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352m0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 1 1 0 448 224 224 0 0 1 0-448m0 64a160.192 160.192 0 0 0-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160" })]));
} });
var Ji = Zi;
const Qi = "__epPropKey";
const eu = (e2) => e2;
const tu = (e2) => Ct(e2) && !!e2[Qi];
const nu = (e2, t2) => {
if (!Ct(e2) || tu(e2)) return e2;
const { values: n2, required: o2, default: r2, type: l2, validator: s2 } = e2;
const i2 = n2 || s2 ? (o3) => {
let l3 = false;
let i3 = [];
if (n2) {
i3 = Array.from(n2);
if (yt(e2, "default")) {
i3.push(r2);
}
l3 || (l3 = i3.includes(o3));
}
if (s2) l3 || (l3 = s2(o3));
if (!l3 && i3.length > 0) {
const e3 = [...new Set(i3)].map((e4) => JSON.stringify(e4)).join(", ");
vue.warn(`Invalid prop: validation failed${t2 ? ` for prop "${t2}"` : ""}. Expected one of [${e3}], got value ${JSON.stringify(o3)}.`);
}
return l3;
} : void 0;
const u2 = { type: l2, required: !!o2, validator: i2, [Qi]: true };
if (yt(e2, "default")) u2.default = r2;
return u2;
};
const ou = (e2) => Bs(Object.entries(e2).map(([e3, t2]) => [e3, nu(t2, e3)]));
const au = eu([String, Object, Function]);
const ru = { Close: Ti };
const lu = { validating: zi, success: _i, error: Li };
const su = (e2, t2) => {
e2.install = (n2) => {
for (const o2 of [e2, ...Object.values(t2 != null ? t2 : {})]) {
n2.component(o2.name, o2);
}
};
if (t2) {
for (const [n2, o2] of Object.entries(t2)) {
e2[n2] = o2;
}
}
return e2;
};
const iu = (e2) => {
e2.install = bt;
return e2;
};
const uu = (...e2) => (t2) => {
e2.forEach((e3) => {
if (kt(e3)) {
e3(t2);
} else {
e3.value = t2;
}
});
};
const cu = { tab: "Tab", enter: "Enter", space: "Space", left: "ArrowLeft", up: "ArrowUp", right: "ArrowRight", down: "ArrowDown", esc: "Escape", delete: "Delete", backspace: "Backspace", numpadEnter: "NumpadEnter", pageUp: "PageUp", pageDown: "PageDown", home: "Home", end: "End" };
const du = ["year", "years", "month", "months", "date", "dates", "week", "datetime", "datetimerange", "daterange", "monthrange"];
const fu = "update:modelValue";
const pu = "change";
const vu = "input";
const mu = ["", "default", "small", "large"];
const hu = (e2) => ["", ...mu].includes(e2);
var bu = ((e2) => {
e2[e2["TEXT"] = 1] = "TEXT";
e2[e2["CLASS"] = 2] = "CLASS";
e2[e2["STYLE"] = 4] = "STYLE";
e2[e2["PROPS"] = 8] = "PROPS";
e2[e2["FULL_PROPS"] = 16] = "FULL_PROPS";
e2[e2["HYDRATE_EVENTS"] = 32] = "HYDRATE_EVENTS";
e2[e2["STABLE_FRAGMENT"] = 64] = "STABLE_FRAGMENT";
e2[e2["KEYED_FRAGMENT"] = 128] = "KEYED_FRAGMENT";
e2[e2["UNKEYED_FRAGMENT"] = 256] = "UNKEYED_FRAGMENT";
e2[e2["NEED_PATCH"] = 512] = "NEED_PATCH";
e2[e2["DYNAMIC_SLOTS"] = 1024] = "DYNAMIC_SLOTS";
e2[e2["HOISTED"] = -1] = "HOISTED";
e2[e2["BAIL"] = -2] = "BAIL";
return e2;
})(bu || {});
const gu = (e2) => {
const t2 = wt(e2) ? e2 : [e2];
const n2 = [];
t2.forEach((e3) => {
var t3;
if (wt(e3)) {
n2.push(...gu(e3));
} else if (vue.isVNode(e3) && wt(e3.children)) {
n2.push(...gu(e3.children));
} else {
n2.push(e3);
if (vue.isVNode(e3) && ((t3 = e3.component) == null ? void 0 : t3.subTree)) {
n2.push(...gu(e3.component.subTree));
}
}
});
return n2;
};
const yu = (e2) => {
if (!e2 && e2 !== 0) return [];
return Array.isArray(e2) ? e2 : [e2];
};
const wu = (e2) => /([\uAC00-\uD7AF\u3130-\u318F])+/gi.test(e2);
const xu = (e2) => e2;
const ku = ["class", "style"];
const Su = /^on[A-Z]/;
const Cu = (e2 = {}) => {
const { excludeListeners: t2 = false, excludeKeys: n2 } = e2;
const o2 = vue.computed(() => ((n2 == null ? void 0 : n2.value) || []).concat(ku));
const a2 = vue.getCurrentInstance();
if (!a2) {
return vue.computed(() => ({}));
}
return vue.computed(() => {
var e3;
return Bs(Object.entries((e3 = a2.proxy) == null ? void 0 : e3.$attrs).filter(([e4]) => !o2.value.includes(e4) && !(t2 && Su.test(e4))));
});
};
const Eu = ({ from: e2, replacement: t2, scope: n2, version: o2, ref: a2, type: r2 = "API" }, l2) => {
vue.watch(() => vue.unref(l2), (e3) => {
}, { immediate: true });
};
const Mu = (e2, t2, n2, o2) => {
let a2 = { offsetX: 0, offsetY: 0 };
const r2 = (t3) => {
const n3 = t3.clientX;
const r3 = t3.clientY;
const { offsetX: l3, offsetY: s3 } = a2;
const i2 = e2.value.getBoundingClientRect();
const u2 = i2.left;
const c2 = i2.top;
const d2 = i2.width;
const f2 = i2.height;
const p2 = document.documentElement.clientWidth;
const v2 = document.documentElement.clientHeight;
const m2 = -u2 + l3;
const h2 = -c2 + s3;
const b2 = p2 - u2 - d2 + l3;
const g2 = v2 - c2 - f2 + s3;
const y2 = (t4) => {
let i3 = l3 + t4.clientX - n3;
let u3 = s3 + t4.clientY - r3;
if (!(o2 == null ? void 0 : o2.value)) {
i3 = Math.min(Math.max(i3, m2), b2);
u3 = Math.min(Math.max(u3, h2), g2);
}
a2 = { offsetX: i3, offsetY: u3 };
if (e2.value) {
e2.value.style.transform = `translate(${vi(i3)}, ${vi(u3)})`;
}
};
const w2 = () => {
document.removeEventListener("mousemove", y2);
document.removeEventListener("mouseup", w2);
};
document.addEventListener("mousemove", y2);
document.addEventListener("mouseup", w2);
};
const l2 = () => {
if (t2.value && e2.value) {
t2.value.addEventListener("mousedown", r2);
}
};
const s2 = () => {
if (t2.value && e2.value) {
t2.value.removeEventListener("mousedown", r2);
}
};
vue.onMounted(() => {
vue.watchEffect(() => {
if (n2.value) {
l2();
} else {
s2();
}
});
});
vue.onBeforeUnmount(() => {
s2();
});
};
var Ou = { name: "en", el: { breadcrumb: { label: "Breadcrumb" }, colorpicker: { confirm: "OK", clear: "Clear", defaultLabel: "color picker", description: "current color is {color}. press enter to select a new color." }, datepicker: { now: "Now", today: "Today", cancel: "Cancel", clear: "Clear", confirm: "OK", dateTablePrompt: "Use the arrow keys and enter to select the day of the month", monthTablePrompt: "Use the arrow keys and enter to select the month", yearTablePrompt: "Use the arrow keys and enter to select the year", selectedDate: "Selected date", selectDate: "Select date", selectTime: "Select time", startDate: "Start Date", startTime: "Start Time", endDate: "End Date", endTime: "End Time", prevYear: "Previous Year", nextYear: "Next Year", prevMonth: "Previous Month", nextMonth: "Next Month", year: "", month1: "January", month2: "February", month3: "March", month4: "April", month5: "May", month6: "June", month7: "July", month8: "August", month9: "September", month10: "October", month11: "November", month12: "December", week: "week", weeks: { sun: "Sun", mon: "Mon", tue: "Tue", wed: "Wed", thu: "Thu", fri: "Fri", sat: "Sat" }, weeksFull: { sun: "Sunday", mon: "Monday", tue: "Tuesday", wed: "Wednesday", thu: "Thursday", fri: "Friday", sat: "Saturday" }, months: { jan: "Jan", feb: "Feb", mar: "Mar", apr: "Apr", may: "May", jun: "Jun", jul: "Jul", aug: "Aug", sep: "Sep", oct: "Oct", nov: "Nov", dec: "Dec" } }, inputNumber: { decrease: "decrease number", increase: "increase number" }, select: { loading: "Loading", noMatch: "No matching data", noData: "No data", placeholder: "Select" }, dropdown: { toggleDropdown: "Toggle Dropdown" }, cascader: { noMatch: "No matching data", loading: "Loading", placeholder: "Select", noData: "No data" }, pagination: { goto: "Go to", pagesize: "/page", total: "Total {total}", pageClassifier: "", page: "Page", prev: "Go to previous page", next: "Go to next page", currentPage: "page {pager}", prevPages: "Previous {pager} pages", nextPages: "Next {pager} pages", deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details" }, dialog: { close: "Close this dialog" }, drawer: { close: "Close this dialog" }, messagebox: { title: "Message", confirm: "OK", cancel: "Cancel", error: "Illegal input", close: "Close this dialog" }, upload: { deleteTip: "press delete to remove", delete: "Delete", preview: "Preview", continue: "Continue" }, slider: { defaultLabel: "slider between {min} and {max}", defaultRangeStartLabel: "pick start value", defaultRangeEndLabel: "pick end value" }, table: { emptyText: "No Data", confirmFilter: "Confirm", resetFilter: "Reset", clearFilter: "All", sumText: "Sum" }, tour: { next: "Next", previous: "Previous", finish: "Finish" }, tree: { emptyText: "No Data" }, transfer: { noMatch: "No matching data", noData: "No data", titles: ["List 1", "List 2"], filterPlaceholder: "Enter keyword", noCheckedFormat: "{total} items", hasCheckedFormat: "{checked}/{total} checked" }, image: { error: "FAILED" }, pageHeader: { title: "Back" }, popconfirm: { confirmButtonText: "Yes", cancelButtonText: "No" }, carousel: { leftArrow: "Carousel arrow left", rightArrow: "Carousel arrow right", indicator: "Carousel switch to index {index}" } } };
const _u = (e2) => (t2, n2) => $u(t2, n2, vue.unref(e2));
const $u = (e2, t2, n2) => gr(n2, e2, e2).replace(/\{(\w+)\}/g, (e3, n3) => {
var o2;
return `${(o2 = t2 == null ? void 0 : t2[n3]) != null ? o2 : `{${n3}}`}`;
});
const Lu = (e2) => {
const t2 = vue.computed(() => vue.unref(e2).name);
const n2 = vue.isRef(e2) ? e2 : vue.ref(e2);
return { lang: t2, locale: n2, t: _u(e2) };
};
const Au = Symbol("localeContextKey");
const Du = (e2) => {
const t2 = e2 || vue.inject(Au, vue.ref());
return Lu(vue.computed(() => t2.value || Ou));
};
const Ru = "el";
const Tu = "is-";
const Nu = (e2, t2, n2, o2, a2) => {
let r2 = `${e2}-${t2}`;
if (n2) {
r2 += `-${n2}`;
}
if (o2) {
r2 += `__${o2}`;
}
if (a2) {
r2 += `--${a2}`;
}
return r2;
};
const Pu = Symbol("namespaceContextKey");
const Iu = (e2) => {
const t2 = e2 || (vue.getCurrentInstance() ? vue.inject(Pu, vue.ref(Ru)) : vue.ref(Ru));
const n2 = vue.computed(() => vue.unref(t2) || Ru);
return n2;
};
const Vu = (e2, t2) => {
const n2 = Iu(t2);
const o2 = (t3 = "") => Nu(n2.value, e2, t3, "", "");
const a2 = (t3) => t3 ? Nu(n2.value, e2, "", t3, "") : "";
const r2 = (t3) => t3 ? Nu(n2.value, e2, "", "", t3) : "";
const l2 = (t3, o3) => t3 && o3 ? Nu(n2.value, e2, t3, o3, "") : "";
const s2 = (t3, o3) => t3 && o3 ? Nu(n2.value, e2, "", t3, o3) : "";
const i2 = (t3, o3) => t3 && o3 ? Nu(n2.value, e2, t3, "", o3) : "";
const u2 = (t3, o3, a3) => t3 && o3 && a3 ? Nu(n2.value, e2, t3, o3, a3) : "";
const c2 = (e3, ...t3) => {
const n3 = t3.length >= 1 ? t3[0] : true;
return e3 && n3 ? `${Tu}${e3}` : "";
};
const d2 = (e3) => {
const t3 = {};
for (const o3 in e3) {
if (e3[o3]) {
t3[`--${n2.value}-${o3}`] = e3[o3];
}
}
return t3;
};
const f2 = (t3) => {
const o3 = {};
for (const a3 in t3) {
if (t3[a3]) {
o3[`--${n2.value}-${e2}-${a3}`] = t3[a3];
}
}
return o3;
};
const p2 = (e3) => `--${n2.value}-${e3}`;
const v2 = (t3) => `--${n2.value}-${e2}-${t3}`;
return { namespace: n2, b: o2, e: a2, m: r2, be: l2, em: s2, bm: i2, bem: u2, is: c2, cssVar: d2, cssVarName: p2, cssVarBlock: f2, cssVarBlockName: v2 };
};
const Bu = (e2, t2 = {}) => {
if (!vue.isRef(e2)) {
si("[useLockscreen]", "You need to pass a ref param to this function");
}
const n2 = t2.ns || Vu("popup");
const o2 = vue.computed(() => n2.bm("parent", "hidden"));
if (!Ie || ci(document.body, o2.value)) {
return;
}
let a2 = 0;
let r2 = false;
let s2 = "0";
const u2 = () => {
setTimeout(() => {
fi(document == null ? void 0 : document.body, o2.value);
if (r2 && document) {
document.body.style.width = s2;
}
}, 200);
};
vue.watch(e2, (e3) => {
if (!e3) {
u2();
return;
}
r2 = !ci(document.body, o2.value);
if (r2) {
s2 = document.body.style.width;
}
a2 = hi(n2.namespace.value);
const t3 = document.documentElement.clientHeight < document.body.scrollHeight;
const l2 = pi(document.body, "overflowY");
if (a2 > 0 && (t3 || l2 === "scroll") && r2) {
document.body.style.width = `calc(100% - ${a2}px)`;
}
di(document.body, o2.value);
});
vue.onScopeDispose(() => u2());
};
const Fu = nu({ type: eu(Boolean), default: null });
const ju = nu({ type: eu(Function) });
const zu = (e2) => {
const t2 = `update:${e2}`;
const n2 = `onUpdate:${e2}`;
const o2 = [t2];
const a2 = { [e2]: Fu, [n2]: ju };
const r2 = ({ indicator: o3, toggleReason: a3, shouldHideWhenRouteChanges: r3, shouldProceed: u2, onShow: d2, onHide: f2 }) => {
const p2 = vue.getCurrentInstance();
const { emit: v2 } = p2;
const m2 = p2.props;
const h2 = vue.computed(() => kt(m2[n2]));
const b2 = vue.computed(() => m2[e2] === null);
const g2 = (e3) => {
if (o3.value === true) {
return;
}
o3.value = true;
if (a3) {
a3.value = e3;
}
if (kt(d2)) {
d2(e3);
}
};
const y2 = (e3) => {
if (o3.value === false) {
return;
}
o3.value = false;
if (a3) {
a3.value = e3;
}
if (kt(f2)) {
f2(e3);
}
};
const w2 = (e3) => {
if (m2.disabled === true || kt(u2) && !u2()) return;
const n3 = h2.value && Ie;
if (n3) {
v2(t2, true);
}
if (b2.value || !n3) {
g2(e3);
}
};
const x2 = (e3) => {
if (m2.disabled === true || !Ie) return;
const n3 = h2.value && Ie;
if (n3) {
v2(t2, false);
}
if (b2.value || !n3) {
y2(e3);
}
};
const k2 = (e3) => {
if (!Xs(e3)) return;
if (m2.disabled && e3) {
if (h2.value) {
v2(t2, false);
}
} else if (o3.value !== e3) {
if (e3) {
g2();
} else {
y2();
}
}
};
const S2 = () => {
if (o3.value) {
x2();
} else {
w2();
}
};
vue.watch(() => m2[e2], k2);
if (r3 && p2.appContext.config.globalProperties.$route !== void 0) {
vue.watch(() => ({ ...p2.proxy.$route }), () => {
if (r3.value && o3.value) {
x2();
}
});
}
vue.onMounted(() => {
k2(m2[e2]);
});
return { hide: x2, show: w2, toggle: S2, hasUpdateHandler: h2 };
};
return { useModelToggle: r2, useModelToggleProps: a2, useModelToggleEmits: o2 };
};
const Hu = (e2) => {
const t2 = vue.getCurrentInstance();
return vue.computed(() => {
var n2, o2;
return (o2 = (n2 = t2 == null ? void 0 : t2.proxy) == null ? void 0 : n2.$props) == null ? void 0 : o2[e2];
});
};
var Wu = "top", Yu = "bottom", Uu = "right", Ku = "left", qu = "auto", Gu = [Wu, Yu, Uu, Ku], Xu = "start", Zu = "end", Ju = "clippingParents", Qu = "viewport", ec = "popper", tc = "reference", nc = Gu.reduce(function(e2, t2) {
return e2.concat([t2 + "-" + Xu, t2 + "-" + Zu]);
}, []), oc = [].concat(Gu, [qu]).reduce(function(e2, t2) {
return e2.concat([t2, t2 + "-" + Xu, t2 + "-" + Zu]);
}, []), ac = "beforeRead", rc = "read", lc = "afterRead", sc = "beforeMain", ic = "main", uc = "afterMain", cc = "beforeWrite", dc = "write", fc = "afterWrite", pc = [ac, rc, lc, sc, ic, uc, cc, dc, fc];
function vc(e2) {
return e2 ? (e2.nodeName || "").toLowerCase() : null;
}
function mc(e2) {
if (e2 == null) return window;
if (e2.toString() !== "[object Window]") {
var t2 = e2.ownerDocument;
return t2 && t2.defaultView || window;
}
return e2;
}
function hc(e2) {
var t2 = mc(e2).Element;
return e2 instanceof t2 || e2 instanceof Element;
}
function bc(e2) {
var t2 = mc(e2).HTMLElement;
return e2 instanceof t2 || e2 instanceof HTMLElement;
}
function gc(e2) {
if (typeof ShadowRoot == "undefined") return false;
var t2 = mc(e2).ShadowRoot;
return e2 instanceof t2 || e2 instanceof ShadowRoot;
}
function yc(e2) {
var t2 = e2.state;
Object.keys(t2.elements).forEach(function(e3) {
var n2 = t2.styles[e3] || {}, o2 = t2.attributes[e3] || {}, a2 = t2.elements[e3];
!bc(a2) || !vc(a2) || (Object.assign(a2.style, n2), Object.keys(o2).forEach(function(e4) {
var t3 = o2[e4];
t3 === false ? a2.removeAttribute(e4) : a2.setAttribute(e4, t3 === true ? "" : t3);
}));
});
}
function wc(e2) {
var t2 = e2.state, n2 = { popper: { position: t2.options.strategy, left: "0", top: "0", margin: "0" }, arrow: { position: "absolute" }, reference: {} };
return Object.assign(t2.elements.popper.style, n2.popper), t2.styles = n2, t2.elements.arrow && Object.assign(t2.elements.arrow.style, n2.arrow), function() {
Object.keys(t2.elements).forEach(function(e3) {
var o2 = t2.elements[e3], a2 = t2.attributes[e3] || {}, r2 = Object.keys(t2.styles.hasOwnProperty(e3) ? t2.styles[e3] : n2[e3]), l2 = r2.reduce(function(e4, t3) {
return e4[t3] = "", e4;
}, {});
!bc(o2) || !vc(o2) || (Object.assign(o2.style, l2), Object.keys(a2).forEach(function(e4) {
o2.removeAttribute(e4);
}));
});
};
}
var xc = { name: "applyStyles", enabled: true, phase: "write", fn: yc, effect: wc, requires: ["computeStyles"] };
function kc(e2) {
return e2.split("-")[0];
}
var Sc = Math.max, Cc = Math.min, Ec = Math.round;
function Mc(e2, t2) {
t2 === void 0 && (t2 = false);
var n2 = e2.getBoundingClientRect(), o2 = 1, a2 = 1;
if (bc(e2) && t2) {
var r2 = e2.offsetHeight, l2 = e2.offsetWidth;
l2 > 0 && (o2 = Ec(n2.width) / l2 || 1), r2 > 0 && (a2 = Ec(n2.height) / r2 || 1);
}
return { width: n2.width / o2, height: n2.height / a2, top: n2.top / a2, right: n2.right / o2, bottom: n2.bottom / a2, left: n2.left / o2, x: n2.left / o2, y: n2.top / a2 };
}
function Oc(e2) {
var t2 = Mc(e2), n2 = e2.offsetWidth, o2 = e2.offsetHeight;
return Math.abs(t2.width - n2) <= 1 && (n2 = t2.width), Math.abs(t2.height - o2) <= 1 && (o2 = t2.height), { x: e2.offsetLeft, y: e2.offsetTop, width: n2, height: o2 };
}
function _c(e2, t2) {
var n2 = t2.getRootNode && t2.getRootNode();
if (e2.contains(t2)) return true;
if (n2 && gc(n2)) {
var o2 = t2;
do {
if (o2 && e2.isSameNode(o2)) return true;
o2 = o2.parentNode || o2.host;
} while (o2);
}
return false;
}
function $c(e2) {
return mc(e2).getComputedStyle(e2);
}
function Lc(e2) {
return ["table", "td", "th"].indexOf(vc(e2)) >= 0;
}
function Ac(e2) {
return ((hc(e2) ? e2.ownerDocument : e2.document) || window.document).documentElement;
}
function Dc(e2) {
return vc(e2) === "html" ? e2 : e2.assignedSlot || e2.parentNode || (gc(e2) ? e2.host : null) || Ac(e2);
}
function Rc(e2) {
return !bc(e2) || $c(e2).position === "fixed" ? null : e2.offsetParent;
}
function Tc(e2) {
var t2 = navigator.userAgent.toLowerCase().indexOf("firefox") !== -1, n2 = navigator.userAgent.indexOf("Trident") !== -1;
if (n2 && bc(e2)) {
var o2 = $c(e2);
if (o2.position === "fixed") return null;
}
var a2 = Dc(e2);
for (gc(a2) && (a2 = a2.host); bc(a2) && ["html", "body"].indexOf(vc(a2)) < 0; ) {
var r2 = $c(a2);
if (r2.transform !== "none" || r2.perspective !== "none" || r2.contain === "paint" || ["transform", "perspective"].indexOf(r2.willChange) !== -1 || t2 && r2.willChange === "filter" || t2 && r2.filter && r2.filter !== "none") return a2;
a2 = a2.parentNode;
}
return null;
}
function Nc(e2) {
for (var t2 = mc(e2), n2 = Rc(e2); n2 && Lc(n2) && $c(n2).position === "static"; ) n2 = Rc(n2);
return n2 && (vc(n2) === "html" || vc(n2) === "body" && $c(n2).position === "static") ? t2 : n2 || Tc(e2) || t2;
}
function Pc(e2) {
return ["top", "bottom"].indexOf(e2) >= 0 ? "x" : "y";
}
function Ic(e2, t2, n2) {
return Sc(e2, Cc(t2, n2));
}
function Vc(e2, t2, n2) {
var o2 = Ic(e2, t2, n2);
return o2 > n2 ? n2 : o2;
}
function Bc() {
return { top: 0, right: 0, bottom: 0, left: 0 };
}
function Fc(e2) {
return Object.assign({}, Bc(), e2);
}
function jc(e2, t2) {
return t2.reduce(function(t3, n2) {
return t3[n2] = e2, t3;
}, {});
}
var zc = function(e2, t2) {
return e2 = typeof e2 == "function" ? e2(Object.assign({}, t2.rects, { placement: t2.placement })) : e2, Fc(typeof e2 != "number" ? e2 : jc(e2, Gu));
};
function Hc(e2) {
var t2, n2 = e2.state, o2 = e2.name, a2 = e2.options, r2 = n2.elements.arrow, l2 = n2.modifiersData.popperOffsets, s2 = kc(n2.placement), i2 = Pc(s2), u2 = [Ku, Uu].indexOf(s2) >= 0, c2 = u2 ? "height" : "width";
if (!(!r2 || !l2)) {
var d2 = zc(a2.padding, n2), f2 = Oc(r2), p2 = i2 === "y" ? Wu : Ku, v2 = i2 === "y" ? Yu : Uu, m2 = n2.rects.reference[c2] + n2.rects.reference[i2] - l2[i2] - n2.rects.popper[c2], h2 = l2[i2] - n2.rects.reference[i2], b2 = Nc(r2), g2 = b2 ? i2 === "y" ? b2.clientHeight || 0 : b2.clientWidth || 0 : 0, y2 = m2 / 2 - h2 / 2, w2 = d2[p2], x2 = g2 - f2[c2] - d2[v2], k2 = g2 / 2 - f2[c2] / 2 + y2, S2 = Ic(w2, k2, x2), C2 = i2;
n2.modifiersData[o2] = (t2 = {}, t2[C2] = S2, t2.centerOffset = S2 - k2, t2);
}
}
function Wc(e2) {
var t2 = e2.state, n2 = e2.options, o2 = n2.element, a2 = o2 === void 0 ? "[data-popper-arrow]" : o2;
a2 != null && (typeof a2 == "string" && (a2 = t2.elements.popper.querySelector(a2), !a2) || !_c(t2.elements.popper, a2) || (t2.elements.arrow = a2));
}
var Yc = { name: "arrow", enabled: true, phase: "main", fn: Hc, effect: Wc, requires: ["popperOffsets"], requiresIfExists: ["preventOverflow"] };
function Uc(e2) {
return e2.split("-")[1];
}
var Kc = { top: "auto", right: "auto", bottom: "auto", left: "auto" };
function qc(e2) {
var t2 = e2.x, n2 = e2.y, o2 = window, a2 = o2.devicePixelRatio || 1;
return { x: Ec(t2 * a2) / a2 || 0, y: Ec(n2 * a2) / a2 || 0 };
}
function Gc(e2) {
var t2, n2 = e2.popper, o2 = e2.popperRect, a2 = e2.placement, r2 = e2.variation, l2 = e2.offsets, s2 = e2.position, i2 = e2.gpuAcceleration, u2 = e2.adaptive, c2 = e2.roundOffsets, d2 = e2.isFixed, f2 = l2.x, p2 = f2 === void 0 ? 0 : f2, v2 = l2.y, m2 = v2 === void 0 ? 0 : v2, h2 = typeof c2 == "function" ? c2({ x: p2, y: m2 }) : { x: p2, y: m2 };
p2 = h2.x, m2 = h2.y;
var b2 = l2.hasOwnProperty("x"), g2 = l2.hasOwnProperty("y"), y2 = Ku, w2 = Wu, x2 = window;
if (u2) {
var k2 = Nc(n2), S2 = "clientHeight", C2 = "clientWidth";
if (k2 === mc(n2) && (k2 = Ac(n2), $c(k2).position !== "static" && s2 === "absolute" && (S2 = "scrollHeight", C2 = "scrollWidth")), k2 = k2, a2 === Wu || (a2 === Ku || a2 === Uu) && r2 === Zu) {
w2 = Yu;
var E2 = d2 && k2 === x2 && x2.visualViewport ? x2.visualViewport.height : k2[S2];
m2 -= E2 - o2.height, m2 *= i2 ? 1 : -1;
}
if (a2 === Ku || (a2 === Wu || a2 === Yu) && r2 === Zu) {
y2 = Uu;
var M2 = d2 && k2 === x2 && x2.visualViewport ? x2.visualViewport.width : k2[C2];
p2 -= M2 - o2.width, p2 *= i2 ? 1 : -1;
}
}
var O2 = Object.assign({ position: s2 }, u2 && Kc), _2 = c2 === true ? qc({ x: p2, y: m2 }) : { x: p2, y: m2 };
if (p2 = _2.x, m2 = _2.y, i2) {
var $2;
return Object.assign({}, O2, ($2 = {}, $2[w2] = g2 ? "0" : "", $2[y2] = b2 ? "0" : "", $2.transform = (x2.devicePixelRatio || 1) <= 1 ? "translate(" + p2 + "px, " + m2 + "px)" : "translate3d(" + p2 + "px, " + m2 + "px, 0)", $2));
}
return Object.assign({}, O2, (t2 = {}, t2[w2] = g2 ? m2 + "px" : "", t2[y2] = b2 ? p2 + "px" : "", t2.transform = "", t2));
}
function Xc(e2) {
var t2 = e2.state, n2 = e2.options, o2 = n2.gpuAcceleration, a2 = o2 === void 0 ? true : o2, r2 = n2.adaptive, l2 = r2 === void 0 ? true : r2, s2 = n2.roundOffsets, i2 = s2 === void 0 ? true : s2, u2 = { placement: kc(t2.placement), variation: Uc(t2.placement), popper: t2.elements.popper, popperRect: t2.rects.popper, gpuAcceleration: a2, isFixed: t2.options.strategy === "fixed" };
t2.modifiersData.popperOffsets != null && (t2.styles.popper = Object.assign({}, t2.styles.popper, Gc(Object.assign({}, u2, { offsets: t2.modifiersData.popperOffsets, position: t2.options.strategy, adaptive: l2, roundOffsets: i2 })))), t2.modifiersData.arrow != null && (t2.styles.arrow = Object.assign({}, t2.styles.arrow, Gc(Object.assign({}, u2, { offsets: t2.modifiersData.arrow, position: "absolute", adaptive: false, roundOffsets: i2 })))), t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-placement": t2.placement });
}
var Zc = { name: "computeStyles", enabled: true, phase: "beforeWrite", fn: Xc, data: {} }, Jc = { passive: true };
function Qc(e2) {
var t2 = e2.state, n2 = e2.instance, o2 = e2.options, a2 = o2.scroll, r2 = a2 === void 0 ? true : a2, l2 = o2.resize, s2 = l2 === void 0 ? true : l2, i2 = mc(t2.elements.popper), u2 = [].concat(t2.scrollParents.reference, t2.scrollParents.popper);
return r2 && u2.forEach(function(e3) {
e3.addEventListener("scroll", n2.update, Jc);
}), s2 && i2.addEventListener("resize", n2.update, Jc), function() {
r2 && u2.forEach(function(e3) {
e3.removeEventListener("scroll", n2.update, Jc);
}), s2 && i2.removeEventListener("resize", n2.update, Jc);
};
}
var ed = { name: "eventListeners", enabled: true, phase: "write", fn: function() {
}, effect: Qc, data: {} }, td = { left: "right", right: "left", bottom: "top", top: "bottom" };
function nd(e2) {
return e2.replace(/left|right|bottom|top/g, function(e3) {
return td[e3];
});
}
var od = { start: "end", end: "start" };
function ad(e2) {
return e2.replace(/start|end/g, function(e3) {
return od[e3];
});
}
function rd(e2) {
var t2 = mc(e2), n2 = t2.pageXOffset, o2 = t2.pageYOffset;
return { scrollLeft: n2, scrollTop: o2 };
}
function ld(e2) {
return Mc(Ac(e2)).left + rd(e2).scrollLeft;
}
function sd(e2) {
var t2 = mc(e2), n2 = Ac(e2), o2 = t2.visualViewport, a2 = n2.clientWidth, r2 = n2.clientHeight, l2 = 0, s2 = 0;
return o2 && (a2 = o2.width, r2 = o2.height, /^((?!chrome|android).)*safari/i.test(navigator.userAgent) || (l2 = o2.offsetLeft, s2 = o2.offsetTop)), { width: a2, height: r2, x: l2 + ld(e2), y: s2 };
}
function id(e2) {
var t2, n2 = Ac(e2), o2 = rd(e2), a2 = (t2 = e2.ownerDocument) == null ? void 0 : t2.body, r2 = Sc(n2.scrollWidth, n2.clientWidth, a2 ? a2.scrollWidth : 0, a2 ? a2.clientWidth : 0), l2 = Sc(n2.scrollHeight, n2.clientHeight, a2 ? a2.scrollHeight : 0, a2 ? a2.clientHeight : 0), s2 = -o2.scrollLeft + ld(e2), i2 = -o2.scrollTop;
return $c(a2 || n2).direction === "rtl" && (s2 += Sc(n2.clientWidth, a2 ? a2.clientWidth : 0) - r2), { width: r2, height: l2, x: s2, y: i2 };
}
function ud(e2) {
var t2 = $c(e2), n2 = t2.overflow, o2 = t2.overflowX, a2 = t2.overflowY;
return /auto|scroll|overlay|hidden/.test(n2 + a2 + o2);
}
function cd(e2) {
return ["html", "body", "#document"].indexOf(vc(e2)) >= 0 ? e2.ownerDocument.body : bc(e2) && ud(e2) ? e2 : cd(Dc(e2));
}
function dd(e2, t2) {
var n2;
t2 === void 0 && (t2 = []);
var o2 = cd(e2), a2 = o2 === ((n2 = e2.ownerDocument) == null ? void 0 : n2.body), r2 = mc(o2), l2 = a2 ? [r2].concat(r2.visualViewport || [], ud(o2) ? o2 : []) : o2, s2 = t2.concat(l2);
return a2 ? s2 : s2.concat(dd(Dc(l2)));
}
function fd(e2) {
return Object.assign({}, e2, { left: e2.x, top: e2.y, right: e2.x + e2.width, bottom: e2.y + e2.height });
}
function pd(e2) {
var t2 = Mc(e2);
return t2.top = t2.top + e2.clientTop, t2.left = t2.left + e2.clientLeft, t2.bottom = t2.top + e2.clientHeight, t2.right = t2.left + e2.clientWidth, t2.width = e2.clientWidth, t2.height = e2.clientHeight, t2.x = t2.left, t2.y = t2.top, t2;
}
function vd(e2, t2) {
return t2 === Qu ? fd(sd(e2)) : hc(t2) ? pd(t2) : fd(id(Ac(e2)));
}
function md(e2) {
var t2 = dd(Dc(e2)), n2 = ["absolute", "fixed"].indexOf($c(e2).position) >= 0, o2 = n2 && bc(e2) ? Nc(e2) : e2;
return hc(o2) ? t2.filter(function(e3) {
return hc(e3) && _c(e3, o2) && vc(e3) !== "body";
}) : [];
}
function hd(e2, t2, n2) {
var o2 = t2 === "clippingParents" ? md(e2) : [].concat(t2), a2 = [].concat(o2, [n2]), r2 = a2[0], l2 = a2.reduce(function(t3, n3) {
var o3 = vd(e2, n3);
return t3.top = Sc(o3.top, t3.top), t3.right = Cc(o3.right, t3.right), t3.bottom = Cc(o3.bottom, t3.bottom), t3.left = Sc(o3.left, t3.left), t3;
}, vd(e2, r2));
return l2.width = l2.right - l2.left, l2.height = l2.bottom - l2.top, l2.x = l2.left, l2.y = l2.top, l2;
}
function bd(e2) {
var t2 = e2.reference, n2 = e2.element, o2 = e2.placement, a2 = o2 ? kc(o2) : null, r2 = o2 ? Uc(o2) : null, l2 = t2.x + t2.width / 2 - n2.width / 2, s2 = t2.y + t2.height / 2 - n2.height / 2, i2;
switch (a2) {
case Wu:
i2 = { x: l2, y: t2.y - n2.height };
break;
case Yu:
i2 = { x: l2, y: t2.y + t2.height };
break;
case Uu:
i2 = { x: t2.x + t2.width, y: s2 };
break;
case Ku:
i2 = { x: t2.x - n2.width, y: s2 };
break;
default:
i2 = { x: t2.x, y: t2.y };
}
var u2 = a2 ? Pc(a2) : null;
if (u2 != null) {
var c2 = u2 === "y" ? "height" : "width";
switch (r2) {
case Xu:
i2[u2] = i2[u2] - (t2[c2] / 2 - n2[c2] / 2);
break;
case Zu:
i2[u2] = i2[u2] + (t2[c2] / 2 - n2[c2] / 2);
break;
}
}
return i2;
}
function gd(e2, t2) {
t2 === void 0 && (t2 = {});
var n2 = t2, o2 = n2.placement, a2 = o2 === void 0 ? e2.placement : o2, r2 = n2.boundary, l2 = r2 === void 0 ? Ju : r2, s2 = n2.rootBoundary, i2 = s2 === void 0 ? Qu : s2, u2 = n2.elementContext, c2 = u2 === void 0 ? ec : u2, d2 = n2.altBoundary, f2 = d2 === void 0 ? false : d2, p2 = n2.padding, v2 = p2 === void 0 ? 0 : p2, m2 = Fc(typeof v2 != "number" ? v2 : jc(v2, Gu)), h2 = c2 === ec ? tc : ec, b2 = e2.rects.popper, g2 = e2.elements[f2 ? h2 : c2], y2 = hd(hc(g2) ? g2 : g2.contextElement || Ac(e2.elements.popper), l2, i2), w2 = Mc(e2.elements.reference), x2 = bd({ reference: w2, element: b2, strategy: "absolute", placement: a2 }), k2 = fd(Object.assign({}, b2, x2)), S2 = c2 === ec ? k2 : w2, C2 = { top: y2.top - S2.top + m2.top, bottom: S2.bottom - y2.bottom + m2.bottom, left: y2.left - S2.left + m2.left, right: S2.right - y2.right + m2.right }, E2 = e2.modifiersData.offset;
if (c2 === ec && E2) {
var M2 = E2[a2];
Object.keys(C2).forEach(function(e3) {
var t3 = [Uu, Yu].indexOf(e3) >= 0 ? 1 : -1, n3 = [Wu, Yu].indexOf(e3) >= 0 ? "y" : "x";
C2[e3] += M2[n3] * t3;
});
}
return C2;
}
function yd(e2, t2) {
t2 === void 0 && (t2 = {});
var n2 = t2, o2 = n2.placement, a2 = n2.boundary, r2 = n2.rootBoundary, l2 = n2.padding, s2 = n2.flipVariations, i2 = n2.allowedAutoPlacements, u2 = i2 === void 0 ? oc : i2, c2 = Uc(o2), d2 = c2 ? s2 ? nc : nc.filter(function(e3) {
return Uc(e3) === c2;
}) : Gu, f2 = d2.filter(function(e3) {
return u2.indexOf(e3) >= 0;
});
f2.length === 0 && (f2 = d2);
var p2 = f2.reduce(function(t3, n3) {
return t3[n3] = gd(e2, { placement: n3, boundary: a2, rootBoundary: r2, padding: l2 })[kc(n3)], t3;
}, {});
return Object.keys(p2).sort(function(e3, t3) {
return p2[e3] - p2[t3];
});
}
function wd(e2) {
if (kc(e2) === qu) return [];
var t2 = nd(e2);
return [ad(e2), t2, ad(t2)];
}
function xd(e2) {
var t2 = e2.state, n2 = e2.options, o2 = e2.name;
if (!t2.modifiersData[o2]._skip) {
for (var a2 = n2.mainAxis, r2 = a2 === void 0 ? true : a2, l2 = n2.altAxis, s2 = l2 === void 0 ? true : l2, i2 = n2.fallbackPlacements, u2 = n2.padding, c2 = n2.boundary, d2 = n2.rootBoundary, f2 = n2.altBoundary, p2 = n2.flipVariations, v2 = p2 === void 0 ? true : p2, m2 = n2.allowedAutoPlacements, h2 = t2.options.placement, b2 = kc(h2), g2 = b2 === h2, y2 = i2 || (g2 || !v2 ? [nd(h2)] : wd(h2)), w2 = [h2].concat(y2).reduce(function(e3, n3) {
return e3.concat(kc(n3) === qu ? yd(t2, { placement: n3, boundary: c2, rootBoundary: d2, padding: u2, flipVariations: v2, allowedAutoPlacements: m2 }) : n3);
}, []), x2 = t2.rects.reference, k2 = t2.rects.popper, S2 = /* @__PURE__ */ new Map(), C2 = true, E2 = w2[0], M2 = 0; M2 < w2.length; M2++) {
var O2 = w2[M2], _2 = kc(O2), $2 = Uc(O2) === Xu, L2 = [Wu, Yu].indexOf(_2) >= 0, A2 = L2 ? "width" : "height", D2 = gd(t2, { placement: O2, boundary: c2, rootBoundary: d2, altBoundary: f2, padding: u2 }), R2 = L2 ? $2 ? Uu : Ku : $2 ? Yu : Wu;
x2[A2] > k2[A2] && (R2 = nd(R2));
var T2 = nd(R2), N2 = [];
if (r2 && N2.push(D2[_2] <= 0), s2 && N2.push(D2[R2] <= 0, D2[T2] <= 0), N2.every(function(e3) {
return e3;
})) {
E2 = O2, C2 = false;
break;
}
S2.set(O2, N2);
}
if (C2) for (var P2 = v2 ? 3 : 1, I2 = function(e3) {
var t3 = w2.find(function(t4) {
var n3 = S2.get(t4);
if (n3) return n3.slice(0, e3).every(function(e4) {
return e4;
});
});
if (t3) return E2 = t3, "break";
}, V2 = P2; V2 > 0; V2--) {
var B2 = I2(V2);
if (B2 === "break") break;
}
t2.placement !== E2 && (t2.modifiersData[o2]._skip = true, t2.placement = E2, t2.reset = true);
}
}
var kd = { name: "flip", enabled: true, phase: "main", fn: xd, requiresIfExists: ["offset"], data: { _skip: false } };
function Sd(e2, t2, n2) {
return n2 === void 0 && (n2 = { x: 0, y: 0 }), { top: e2.top - t2.height - n2.y, right: e2.right - t2.width + n2.x, bottom: e2.bottom - t2.height + n2.y, left: e2.left - t2.width - n2.x };
}
function Cd(e2) {
return [Wu, Uu, Yu, Ku].some(function(t2) {
return e2[t2] >= 0;
});
}
function Ed(e2) {
var t2 = e2.state, n2 = e2.name, o2 = t2.rects.reference, a2 = t2.rects.popper, r2 = t2.modifiersData.preventOverflow, l2 = gd(t2, { elementContext: "reference" }), s2 = gd(t2, { altBoundary: true }), i2 = Sd(l2, o2), u2 = Sd(s2, a2, r2), c2 = Cd(i2), d2 = Cd(u2);
t2.modifiersData[n2] = { referenceClippingOffsets: i2, popperEscapeOffsets: u2, isReferenceHidden: c2, hasPopperEscaped: d2 }, t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-reference-hidden": c2, "data-popper-escaped": d2 });
}
var Md = { name: "hide", enabled: true, phase: "main", requiresIfExists: ["preventOverflow"], fn: Ed };
function Od(e2, t2, n2) {
var o2 = kc(e2), a2 = [Ku, Wu].indexOf(o2) >= 0 ? -1 : 1, r2 = typeof n2 == "function" ? n2(Object.assign({}, t2, { placement: e2 })) : n2, l2 = r2[0], s2 = r2[1];
return l2 = l2 || 0, s2 = (s2 || 0) * a2, [Ku, Uu].indexOf(o2) >= 0 ? { x: s2, y: l2 } : { x: l2, y: s2 };
}
function _d(e2) {
var t2 = e2.state, n2 = e2.options, o2 = e2.name, a2 = n2.offset, r2 = a2 === void 0 ? [0, 0] : a2, l2 = oc.reduce(function(e3, n3) {
return e3[n3] = Od(n3, t2.rects, r2), e3;
}, {}), s2 = l2[t2.placement], i2 = s2.x, u2 = s2.y;
t2.modifiersData.popperOffsets != null && (t2.modifiersData.popperOffsets.x += i2, t2.modifiersData.popperOffsets.y += u2), t2.modifiersData[o2] = l2;
}
var $d = { name: "offset", enabled: true, phase: "main", requires: ["popperOffsets"], fn: _d };
function Ld(e2) {
var t2 = e2.state, n2 = e2.name;
t2.modifiersData[n2] = bd({ reference: t2.rects.reference, element: t2.rects.popper, strategy: "absolute", placement: t2.placement });
}
var Ad = { name: "popperOffsets", enabled: true, phase: "read", fn: Ld, data: {} };
function Dd(e2) {
return e2 === "x" ? "y" : "x";
}
function Rd(e2) {
var t2 = e2.state, n2 = e2.options, o2 = e2.name, a2 = n2.mainAxis, r2 = a2 === void 0 ? true : a2, l2 = n2.altAxis, s2 = l2 === void 0 ? false : l2, i2 = n2.boundary, u2 = n2.rootBoundary, c2 = n2.altBoundary, d2 = n2.padding, f2 = n2.tether, p2 = f2 === void 0 ? true : f2, v2 = n2.tetherOffset, m2 = v2 === void 0 ? 0 : v2, h2 = gd(t2, { boundary: i2, rootBoundary: u2, padding: d2, altBoundary: c2 }), b2 = kc(t2.placement), g2 = Uc(t2.placement), y2 = !g2, w2 = Pc(b2), x2 = Dd(w2), k2 = t2.modifiersData.popperOffsets, S2 = t2.rects.reference, C2 = t2.rects.popper, E2 = typeof m2 == "function" ? m2(Object.assign({}, t2.rects, { placement: t2.placement })) : m2, M2 = typeof E2 == "number" ? { mainAxis: E2, altAxis: E2 } : Object.assign({ mainAxis: 0, altAxis: 0 }, E2), O2 = t2.modifiersData.offset ? t2.modifiersData.offset[t2.placement] : null, _2 = { x: 0, y: 0 };
if (k2) {
if (r2) {
var $2, L2 = w2 === "y" ? Wu : Ku, A2 = w2 === "y" ? Yu : Uu, D2 = w2 === "y" ? "height" : "width", R2 = k2[w2], T2 = R2 + h2[L2], N2 = R2 - h2[A2], P2 = p2 ? -C2[D2] / 2 : 0, I2 = g2 === Xu ? S2[D2] : C2[D2], V2 = g2 === Xu ? -C2[D2] : -S2[D2], B2 = t2.elements.arrow, F2 = p2 && B2 ? Oc(B2) : { width: 0, height: 0 }, j2 = t2.modifiersData["arrow#persistent"] ? t2.modifiersData["arrow#persistent"].padding : Bc(), z2 = j2[L2], H2 = j2[A2], W2 = Ic(0, S2[D2], F2[D2]), Y2 = y2 ? S2[D2] / 2 - P2 - W2 - z2 - M2.mainAxis : I2 - W2 - z2 - M2.mainAxis, U2 = y2 ? -S2[D2] / 2 + P2 + W2 + H2 + M2.mainAxis : V2 + W2 + H2 + M2.mainAxis, K2 = t2.elements.arrow && Nc(t2.elements.arrow), q2 = K2 ? w2 === "y" ? K2.clientTop || 0 : K2.clientLeft || 0 : 0, G2 = ($2 = O2 == null ? void 0 : O2[w2]) != null ? $2 : 0, X2 = R2 + Y2 - G2 - q2, Z2 = R2 + U2 - G2, J2 = Ic(p2 ? Cc(T2, X2) : T2, R2, p2 ? Sc(N2, Z2) : N2);
k2[w2] = J2, _2[w2] = J2 - R2;
}
if (s2) {
var Q2, ee2 = w2 === "x" ? Wu : Ku, te2 = w2 === "x" ? Yu : Uu, ne2 = k2[x2], oe2 = x2 === "y" ? "height" : "width", ae2 = ne2 + h2[ee2], re2 = ne2 - h2[te2], le2 = [Wu, Ku].indexOf(b2) !== -1, se2 = (Q2 = O2 == null ? void 0 : O2[x2]) != null ? Q2 : 0, ie2 = le2 ? ae2 : ne2 - S2[oe2] - C2[oe2] - se2 + M2.altAxis, ue2 = le2 ? ne2 + S2[oe2] + C2[oe2] - se2 - M2.altAxis : re2, ce2 = p2 && le2 ? Vc(ie2, ne2, ue2) : Ic(p2 ? ie2 : ae2, ne2, p2 ? ue2 : re2);
k2[x2] = ce2, _2[x2] = ce2 - ne2;
}
t2.modifiersData[o2] = _2;
}
}
var Td = { name: "preventOverflow", enabled: true, phase: "main", fn: Rd, requiresIfExists: ["offset"] };
function Nd(e2) {
return { scrollLeft: e2.scrollLeft, scrollTop: e2.scrollTop };
}
function Pd(e2) {
return e2 === mc(e2) || !bc(e2) ? rd(e2) : Nd(e2);
}
function Id(e2) {
var t2 = e2.getBoundingClientRect(), n2 = Ec(t2.width) / e2.offsetWidth || 1, o2 = Ec(t2.height) / e2.offsetHeight || 1;
return n2 !== 1 || o2 !== 1;
}
function Vd(e2, t2, n2) {
n2 === void 0 && (n2 = false);
var o2 = bc(t2), a2 = bc(t2) && Id(t2), r2 = Ac(t2), l2 = Mc(e2, a2), s2 = { scrollLeft: 0, scrollTop: 0 }, i2 = { x: 0, y: 0 };
return (o2 || !o2 && !n2) && ((vc(t2) !== "body" || ud(r2)) && (s2 = Pd(t2)), bc(t2) ? (i2 = Mc(t2, true), i2.x += t2.clientLeft, i2.y += t2.clientTop) : r2 && (i2.x = ld(r2))), { x: l2.left + s2.scrollLeft - i2.x, y: l2.top + s2.scrollTop - i2.y, width: l2.width, height: l2.height };
}
function Bd(e2) {
var t2 = /* @__PURE__ */ new Map(), n2 = /* @__PURE__ */ new Set(), o2 = [];
e2.forEach(function(e3) {
t2.set(e3.name, e3);
});
function a2(e3) {
n2.add(e3.name);
var r2 = [].concat(e3.requires || [], e3.requiresIfExists || []);
r2.forEach(function(e4) {
if (!n2.has(e4)) {
var o3 = t2.get(e4);
o3 && a2(o3);
}
}), o2.push(e3);
}
return e2.forEach(function(e3) {
n2.has(e3.name) || a2(e3);
}), o2;
}
function Fd(e2) {
var t2 = Bd(e2);
return pc.reduce(function(e3, n2) {
return e3.concat(t2.filter(function(e4) {
return e4.phase === n2;
}));
}, []);
}
function jd(e2) {
var t2;
return function() {
return t2 || (t2 = new Promise(function(n2) {
Promise.resolve().then(function() {
t2 = void 0, n2(e2());
});
})), t2;
};
}
function zd(e2) {
var t2 = e2.reduce(function(e3, t3) {
var n2 = e3[t3.name];
return e3[t3.name] = n2 ? Object.assign({}, n2, t3, { options: Object.assign({}, n2.options, t3.options), data: Object.assign({}, n2.data, t3.data) }) : t3, e3;
}, {});
return Object.keys(t2).map(function(e3) {
return t2[e3];
});
}
var Hd = { placement: "bottom", modifiers: [], strategy: "absolute" };
function Wd() {
for (var e2 = arguments.length, t2 = new Array(e2), n2 = 0; n2 < e2; n2++) t2[n2] = arguments[n2];
return !t2.some(function(e3) {
return !(e3 && typeof e3.getBoundingClientRect == "function");
});
}
function Yd(e2) {
e2 === void 0 && (e2 = {});
var t2 = e2, n2 = t2.defaultModifiers, o2 = n2 === void 0 ? [] : n2, a2 = t2.defaultOptions, r2 = a2 === void 0 ? Hd : a2;
return function(e3, t3, n3) {
n3 === void 0 && (n3 = r2);
var a3 = { placement: "bottom", orderedModifiers: [], options: Object.assign({}, Hd, r2), modifiersData: {}, elements: { reference: e3, popper: t3 }, attributes: {}, styles: {} }, l2 = [], s2 = false, i2 = { state: a3, setOptions: function(n4) {
var l3 = typeof n4 == "function" ? n4(a3.options) : n4;
c2(), a3.options = Object.assign({}, r2, a3.options, l3), a3.scrollParents = { reference: hc(e3) ? dd(e3) : e3.contextElement ? dd(e3.contextElement) : [], popper: dd(t3) };
var s3 = Fd(zd([].concat(o2, a3.options.modifiers)));
return a3.orderedModifiers = s3.filter(function(e4) {
return e4.enabled;
}), u2(), i2.update();
}, forceUpdate: function() {
if (!s2) {
var e4 = a3.elements, t4 = e4.reference, n4 = e4.popper;
if (Wd(t4, n4)) {
a3.rects = { reference: Vd(t4, Nc(n4), a3.options.strategy === "fixed"), popper: Oc(n4) }, a3.reset = false, a3.placement = a3.options.placement, a3.orderedModifiers.forEach(function(e5) {
return a3.modifiersData[e5.name] = Object.assign({}, e5.data);
});
for (var o3 = 0; o3 < a3.orderedModifiers.length; o3++) {
if (a3.reset === true) {
a3.reset = false, o3 = -1;
continue;
}
var r3 = a3.orderedModifiers[o3], l3 = r3.fn, u3 = r3.options, c3 = u3 === void 0 ? {} : u3, d2 = r3.name;
typeof l3 == "function" && (a3 = l3({ state: a3, options: c3, name: d2, instance: i2 }) || a3);
}
}
}
}, update: jd(function() {
return new Promise(function(e4) {
i2.forceUpdate(), e4(a3);
});
}), destroy: function() {
c2(), s2 = true;
} };
if (!Wd(e3, t3)) return i2;
i2.setOptions(n3).then(function(e4) {
!s2 && n3.onFirstUpdate && n3.onFirstUpdate(e4);
});
function u2() {
a3.orderedModifiers.forEach(function(e4) {
var t4 = e4.name, n4 = e4.options, o3 = n4 === void 0 ? {} : n4, r3 = e4.effect;
if (typeof r3 == "function") {
var s3 = r3({ state: a3, name: t4, instance: i2, options: o3 }), u3 = function() {
};
l2.push(s3 || u3);
}
});
}
function c2() {
l2.forEach(function(e4) {
return e4();
}), l2 = [];
}
return i2;
};
}
Yd();
var Ud = [ed, Ad, Zc, xc];
Yd({ defaultModifiers: Ud });
var Kd = [ed, Ad, Zc, xc, $d, kd, Td, Yc, Md], qd = Yd({ defaultModifiers: Kd });
const Gd = (e2, t2, n2 = {}) => {
const o2 = { name: "updateState", enabled: true, phase: "write", fn: ({ state: e3 }) => {
const t3 = Xd(e3);
Object.assign(s2.value, t3);
}, requires: ["computeStyles"] };
const a2 = vue.computed(() => {
const { onFirstUpdate: e3, placement: t3, strategy: a3, modifiers: r3 } = vue.unref(n2);
return { onFirstUpdate: e3, placement: t3 || "bottom", strategy: a3 || "absolute", modifiers: [...r3 || [], o2, { name: "applyStyles", enabled: false }] };
});
const r2 = vue.shallowRef();
const s2 = vue.ref({ styles: { popper: { position: vue.unref(a2).strategy, left: "0", top: "0" }, arrow: { position: "absolute" } }, attributes: {} });
const c2 = () => {
if (!r2.value) return;
r2.value.destroy();
r2.value = void 0;
};
vue.watch(a2, (e3) => {
const t3 = vue.unref(r2);
if (t3) {
t3.setOptions(e3);
}
}, { deep: true });
vue.watch([e2, t2], ([e3, t3]) => {
c2();
if (!e3 || !t3) return;
r2.value = qd(e3, t3, vue.unref(a2));
});
vue.onBeforeUnmount(() => {
c2();
});
return { state: vue.computed(() => {
var e3;
return { ...((e3 = vue.unref(r2)) == null ? void 0 : e3.state) || {} };
}), styles: vue.computed(() => vue.unref(s2).styles), attributes: vue.computed(() => vue.unref(s2).attributes), update: () => {
var e3;
return (e3 = vue.unref(r2)) == null ? void 0 : e3.update();
}, forceUpdate: () => {
var e3;
return (e3 = vue.unref(r2)) == null ? void 0 : e3.forceUpdate();
}, instanceRef: vue.computed(() => vue.unref(r2)) };
};
function Xd(e2) {
const t2 = Object.keys(e2.elements);
const n2 = Bs(t2.map((t3) => [t3, e2.styles[t3] || {}]));
const o2 = Bs(t2.map((t3) => [t3, e2.attributes[t3]]));
return { styles: n2, attributes: o2 };
}
const Zd = (e2) => {
if (!e2) {
return { onClick: bt, onMousedown: bt, onMouseup: bt };
}
let t2 = false;
let n2 = false;
const o2 = (o3) => {
if (t2 && n2) {
e2(o3);
}
t2 = n2 = false;
};
const a2 = (e3) => {
t2 = e3.target === e3.currentTarget;
};
const r2 = (e3) => {
n2 = e3.target === e3.currentTarget;
};
return { onClick: o2, onMousedown: a2, onMouseup: r2 };
};
function Jd() {
let e2;
const t2 = (t3, o2) => {
n2();
e2 = window.setTimeout(t3, o2);
};
const n2 = () => window.clearTimeout(e2);
He(() => n2());
return { registerTimeout: t2, cancelTimeout: n2 };
}
const Qd = { prefix: Math.floor(Math.random() * 1e4), current: 0 };
const ef = Symbol("elIdInjection");
const tf = () => vue.getCurrentInstance() ? vue.inject(ef, Qd) : Qd;
const nf = (e2) => {
const t2 = tf();
const n2 = Iu();
const o2 = vue.computed(() => vue.unref(e2) || `${n2.value}-id-${t2.prefix}-${t2.current++}`);
return o2;
};
let of = [];
const af = (e2) => {
const t2 = e2;
if (t2.key === cu.esc) {
of.forEach((e3) => e3(t2));
}
};
const rf = (e2) => {
vue.onMounted(() => {
if (of.length === 0) {
document.addEventListener("keydown", af);
}
if (Ie) of.push(e2);
});
vue.onBeforeUnmount(() => {
of = of.filter((t2) => t2 !== e2);
if (of.length === 0) {
if (Ie) document.removeEventListener("keydown", af);
}
});
};
let lf;
const sf = () => {
const e2 = Iu();
const t2 = tf();
const n2 = vue.computed(() => `${e2.value}-popper-container-${t2.prefix}`);
const o2 = vue.computed(() => `#${n2.value}`);
return { id: n2, selector: o2 };
};
const uf = (e2) => {
const t2 = document.createElement("div");
t2.id = e2;
document.body.appendChild(t2);
return t2;
};
const cf = () => {
const { id: e2, selector: t2 } = sf();
vue.onBeforeMount(() => {
if (!Ie) return;
if (!lf && !document.body.querySelector(t2.value)) {
lf = uf(e2.value);
}
});
return { id: e2, selector: t2 };
};
const df = ou({ showAfter: { type: Number, default: 0 }, hideAfter: { type: Number, default: 200 }, autoClose: { type: Number, default: 0 } });
const ff = ({ showAfter: e2, hideAfter: t2, autoClose: n2, open: o2, close: a2 }) => {
const { registerTimeout: r2 } = Jd();
const { registerTimeout: l2, cancelTimeout: s2 } = Jd();
const i2 = (t3) => {
r2(() => {
o2(t3);
const e3 = vue.unref(n2);
if (Zs(e3) && e3 > 0) {
l2(() => {
a2(t3);
}, e3);
}
}, vue.unref(e2));
};
const c2 = (e3) => {
s2();
r2(() => {
a2(e3);
}, vue.unref(t2));
};
return { onOpen: i2, onClose: c2 };
};
const pf = Symbol("elForwardRef");
const vf = (e2) => {
const t2 = (t3) => {
e2.value = t3;
};
vue.provide(pf, { setForwardRef: t2 });
};
const mf = (e2) => ({ mounted(t2) {
e2(t2);
}, updated(t2) {
e2(t2);
}, unmounted() {
e2(null);
} });
const hf = { current: 0 };
const bf = vue.ref(0);
const gf = 2e3;
const yf = Symbol("elZIndexContextKey");
const wf = Symbol("zIndexContextKey");
const xf = (e2) => {
const t2 = vue.getCurrentInstance() ? vue.inject(yf, hf) : hf;
const n2 = e2 || (vue.getCurrentInstance() ? vue.inject(wf, void 0) : void 0);
const o2 = vue.computed(() => {
const e3 = vue.unref(n2);
return Zs(e3) ? e3 : gf;
});
const a2 = vue.computed(() => o2.value + bf.value);
const r2 = () => {
t2.current++;
bf.value = t2.current;
return a2.value;
};
if (!Ie && !vue.inject(yf)) ;
return { initialZIndex: o2, currentZIndex: a2, nextZIndex: r2 };
};
function kf(e2) {
const t2 = vue.ref();
function n2() {
if (e2.value == void 0) return;
const { selectionStart: n3, selectionEnd: o3, value: a2 } = e2.value;
if (n3 == null || o3 == null) return;
const r2 = a2.slice(0, Math.max(0, n3));
const l2 = a2.slice(Math.max(0, o3));
t2.value = { selectionStart: n3, selectionEnd: o3, value: a2, beforeTxt: r2, afterTxt: l2 };
}
function o2() {
if (e2.value == void 0 || t2.value == void 0) return;
const { value: n3 } = e2.value;
const { beforeTxt: o3, afterTxt: a2, selectionStart: r2 } = t2.value;
if (o3 == void 0 || a2 == void 0 || r2 == void 0) return;
let l2 = n3.length;
if (n3.endsWith(a2)) {
l2 = n3.length - a2.length;
} else if (n3.startsWith(o3)) {
l2 = o3.length;
} else {
const e3 = o3[r2 - 1];
const t3 = n3.indexOf(e3, r2 - 1);
if (t3 !== -1) {
l2 = t3 + 1;
}
}
e2.value.setSelectionRange(l2, l2);
}
return [n2, o2];
}
const Sf = (e2, t2, n2) => {
const o2 = gu(e2.subTree).filter((e3) => {
var n3;
return vue.isVNode(e3) && ((n3 = e3.type) == null ? void 0 : n3.name) === t2 && !!e3.component;
});
const a2 = o2.map((e3) => e3.component.uid);
return a2.map((e3) => n2[e3]).filter((e3) => !!e3);
};
const Cf = (e2, t2) => {
const n2 = {};
const o2 = vue.shallowRef([]);
const a2 = (a3) => {
n2[a3.uid] = a3;
o2.value = Sf(e2, t2, n2);
};
const r2 = (e3) => {
delete n2[e3];
o2.value = o2.value.filter((t3) => t3.uid !== e3);
};
return { children: o2, addChild: a2, removeChild: r2 };
};
const Ef = nu({ type: String, values: mu, required: false });
const Mf = Symbol("size");
const Of = () => {
const e2 = vue.inject(Mf, {});
return vue.computed(() => vue.unref(e2.size) || "");
};
function _f(e2, { afterFocus: t2, beforeBlur: n2, afterBlur: o2 } = {}) {
const a2 = vue.getCurrentInstance();
const { emit: r2 } = a2;
const l2 = vue.shallowRef();
const u2 = vue.ref(false);
const c2 = (e3) => {
if (u2.value) return;
u2.value = true;
r2("focus", e3);
t2 == null ? void 0 : t2();
};
const d2 = (e3) => {
var t3;
const a3 = kt(n2) ? n2(e3) : false;
if (a3 || e3.relatedTarget && ((t3 = l2.value) == null ? void 0 : t3.contains(e3.relatedTarget))) return;
u2.value = false;
r2("blur", e3);
o2 == null ? void 0 : o2();
};
const f2 = () => {
var t3;
(t3 = e2.value) == null ? void 0 : t3.focus();
};
vue.watch(l2, (e3) => {
if (e3) {
e3.setAttribute("tabindex", "-1");
}
});
Ge(l2, "click", f2);
return { wrapperRef: l2, isFocused: u2, handleFocus: c2, handleBlur: d2 };
}
const $f = Symbol("emptyValuesContextKey");
const Lf = ["", void 0, null];
const Af = ou({ emptyValues: Array, valueOnClear: { type: [String, Number, Boolean, Function], default: void 0, validator: (e2) => kt(e2) ? !e2() : !e2 } });
const Df = (e2, t2) => {
const n2 = vue.getCurrentInstance() ? vue.inject($f, vue.ref({})) : vue.ref({});
const o2 = vue.computed(() => e2.emptyValues || n2.value.emptyValues || Lf);
const a2 = vue.computed(() => {
if (kt(e2.valueOnClear)) {
return e2.valueOnClear();
} else if (e2.valueOnClear !== void 0) {
return e2.valueOnClear;
} else if (kt(n2.value.valueOnClear)) {
return n2.value.valueOnClear();
} else if (n2.value.valueOnClear !== void 0) {
return n2.value.valueOnClear;
}
return t2;
});
const r2 = (e3) => o2.value.includes(e3);
if (!o2.value.includes(a2.value)) ;
return { emptyValues: o2, valueOnClear: a2, isEmptyValue: r2 };
};
const Rf = ou({ ariaLabel: String, ariaOrientation: { type: String, values: ["horizontal", "vertical", "undefined"] }, ariaControls: String });
const Tf = (e2) => Ks(Rf, e2);
const Nf = Symbol();
const Pf = vue.ref();
function If(e2, t2 = void 0) {
const n2 = vue.getCurrentInstance() ? vue.inject(Nf, Pf) : Pf;
if (e2) {
return vue.computed(() => {
var o2, a2;
return (a2 = (o2 = n2.value) == null ? void 0 : o2[e2]) != null ? a2 : t2;
});
} else {
return n2;
}
}
function Vf(e2, t2) {
const n2 = If();
const o2 = Vu(e2, vue.computed(() => {
var e3;
return ((e3 = n2.value) == null ? void 0 : e3.namespace) || Ru;
}));
const a2 = Du(vue.computed(() => {
var e3;
return (e3 = n2.value) == null ? void 0 : e3.locale;
}));
const r2 = xf(vue.computed(() => {
var e3;
return ((e3 = n2.value) == null ? void 0 : e3.zIndex) || gf;
}));
const s2 = vue.computed(() => {
var e3;
return vue.unref(t2) || ((e3 = n2.value) == null ? void 0 : e3.size) || "";
});
Bf(vue.computed(() => vue.unref(n2) || {}));
return { ns: o2, locale: a2, zIndex: r2, size: s2 };
}
const Bf = (e2, t2, n2 = false) => {
var o2;
const a2 = !!vue.getCurrentInstance();
const r2 = a2 ? If() : void 0;
const i2 = (o2 = void 0) != null ? o2 : a2 ? vue.provide : void 0;
if (!i2) {
return;
}
const c2 = vue.computed(() => {
const t3 = vue.unref(e2);
if (!(r2 == null ? void 0 : r2.value)) return t3;
return Ff(r2.value, t3);
});
i2(Nf, c2);
i2(Au, vue.computed(() => c2.value.locale));
i2(Pu, vue.computed(() => c2.value.namespace));
i2(wf, vue.computed(() => c2.value.zIndex));
i2(Mf, { size: vue.computed(() => c2.value.size || "") });
i2($f, vue.computed(() => ({ emptyValues: c2.value.emptyValues, valueOnClear: c2.value.valueOnClear })));
if (n2 || !Pf.value) {
Pf.value = c2.value;
}
return c2;
};
const Ff = (e2, t2) => {
const n2 = [.../* @__PURE__ */ new Set([...ai(e2), ...ai(t2)])];
const o2 = {};
for (const a2 of n2) {
o2[a2] = t2[a2] !== void 0 ? t2[a2] : e2[a2];
}
return o2;
};
var jf = (e2, t2) => {
const n2 = e2.__vccOpts || e2;
for (const [e3, o2] of t2) {
n2[e3] = o2;
}
return n2;
};
const zf = ou({ size: { type: eu([Number, String]) }, color: { type: String } });
const Hf = vue.defineComponent({ name: "ElIcon", inheritAttrs: false });
const Wf = vue.defineComponent({ ...Hf, props: zf, setup(e2) {
const o2 = e2;
const a2 = Vu("icon");
const r2 = vue.computed(() => {
const { size: e3, color: t2 } = o2;
if (!e3 && !t2) return {};
return { fontSize: Gs(e3) ? void 0 : vi(e3), "--color": t2 };
});
return (e3, o3) => (vue.openBlock(), vue.createElementBlock("i", vue.mergeProps({ class: vue.unref(a2).b(), style: vue.unref(r2) }, e3.$attrs), [vue.renderSlot(e3.$slots, "default")], 16));
} });
var Yf = jf(Wf, [["__file", "icon.vue"]]);
const Uf = su(Yf);
const Kf = Symbol("formContextKey");
const qf = Symbol("formItemContextKey");
const Gf = (e2, t2 = {}) => {
const n2 = vue.ref(void 0);
const o2 = t2.prop ? n2 : Hu("size");
const a2 = t2.global ? n2 : Of();
const r2 = t2.form ? { size: void 0 } : vue.inject(Kf, void 0);
const s2 = t2.formItem ? { size: void 0 } : vue.inject(qf, void 0);
return vue.computed(() => o2.value || vue.unref(e2) || (s2 == null ? void 0 : s2.size) || (r2 == null ? void 0 : r2.size) || a2.value || "");
};
const Xf = (e2) => {
const t2 = Hu("disabled");
const n2 = vue.inject(Kf, void 0);
return vue.computed(() => t2.value || vue.unref(e2) || (n2 == null ? void 0 : n2.disabled) || false);
};
const Zf = () => {
const e2 = vue.inject(Kf, void 0);
const t2 = vue.inject(qf, void 0);
return { form: e2, formItem: t2 };
};
const Jf = (e2, { formItemContext: t2, disableIdGeneration: n2, disableIdManagement: o2 }) => {
if (!n2) {
n2 = vue.ref(false);
}
if (!o2) {
o2 = vue.ref(false);
}
const a2 = vue.ref();
let r2 = void 0;
const s2 = vue.computed(() => {
var n3;
return !!(!(e2.label || e2.ariaLabel) && t2 && t2.inputIds && ((n3 = t2.inputIds) == null ? void 0 : n3.length) <= 1);
});
vue.onMounted(() => {
r2 = vue.watch([vue.toRef(e2, "id"), n2], ([e3, n3]) => {
const r3 = e3 != null ? e3 : !n3 ? nf().value : void 0;
if (r3 !== a2.value) {
if (t2 == null ? void 0 : t2.removeInputId) {
a2.value && t2.removeInputId(a2.value);
if (!(o2 == null ? void 0 : o2.value) && !n3 && r3) {
t2.addInputId(r3);
}
}
a2.value = r3;
}
}, { immediate: true });
});
vue.onUnmounted(() => {
r2 && r2();
if (t2 == null ? void 0 : t2.removeInputId) {
a2.value && t2.removeInputId(a2.value);
}
});
return { isLabeledByFormItem: s2, inputId: a2 };
};
let Qf = void 0;
const ep = `
height:0 !important;
visibility:hidden !important;
${ht() ? "" : "overflow:hidden !important;"}
position:absolute !important;
z-index:-1000 !important;
top:0 !important;
right:0 !important;
`;
const tp = ["letter-spacing", "line-height", "padding-top", "padding-bottom", "font-family", "font-weight", "font-size", "text-rendering", "text-transform", "width", "text-indent", "padding-left", "padding-right", "border-width", "box-sizing"];
function np(e2) {
const t2 = window.getComputedStyle(e2);
const n2 = t2.getPropertyValue("box-sizing");
const o2 = Number.parseFloat(t2.getPropertyValue("padding-bottom")) + Number.parseFloat(t2.getPropertyValue("padding-top"));
const a2 = Number.parseFloat(t2.getPropertyValue("border-bottom-width")) + Number.parseFloat(t2.getPropertyValue("border-top-width"));
const r2 = tp.map((e3) => `${e3}:${t2.getPropertyValue(e3)}`).join(";");
return { contextStyle: r2, paddingSize: o2, borderSize: a2, boxSizing: n2 };
}
function op(e2, t2 = 1, n2) {
var o2;
if (!Qf) {
Qf = document.createElement("textarea");
document.body.appendChild(Qf);
}
const { paddingSize: a2, borderSize: r2, boxSizing: l2, contextStyle: s2 } = np(e2);
Qf.setAttribute("style", `${s2};${ep}`);
Qf.value = e2.value || e2.placeholder || "";
let i2 = Qf.scrollHeight;
const u2 = {};
if (l2 === "border-box") {
i2 = i2 + r2;
} else if (l2 === "content-box") {
i2 = i2 - a2;
}
Qf.value = "";
const c2 = Qf.scrollHeight - a2;
if (Zs(t2)) {
let e3 = c2 * t2;
if (l2 === "border-box") {
e3 = e3 + a2 + r2;
}
i2 = Math.max(e3, i2);
u2.minHeight = `${e3}px`;
}
if (Zs(n2)) {
let e3 = c2 * n2;
if (l2 === "border-box") {
e3 = e3 + a2 + r2;
}
i2 = Math.min(e3, i2);
}
u2.height = `${i2}px`;
(o2 = Qf.parentNode) == null ? void 0 : o2.removeChild(Qf);
Qf = void 0;
return u2;
}
const ap = ou({ id: { type: String, default: void 0 }, size: Ef, disabled: Boolean, modelValue: { type: eu([String, Number, Object]), default: "" }, maxlength: { type: [String, Number] }, minlength: { type: [String, Number] }, type: { type: String, default: "text" }, resize: { type: String, values: ["none", "both", "horizontal", "vertical"] }, autosize: { type: eu([Boolean, Object]), default: false }, autocomplete: { type: String, default: "off" }, formatter: { type: Function }, parser: { type: Function }, placeholder: { type: String }, form: { type: String }, readonly: Boolean, clearable: Boolean, showPassword: Boolean, showWordLimit: Boolean, suffixIcon: { type: au }, prefixIcon: { type: au }, containerRole: { type: String, default: void 0 }, label: { type: String, default: void 0 }, tabindex: { type: [String, Number], default: 0 }, validateEvent: { type: Boolean, default: true }, inputStyle: { type: eu([Object, Array, String]), default: () => xu({}) }, autofocus: Boolean, rows: { type: Number, default: 2 }, ...Tf(["ariaLabel"]) });
const rp = { [fu]: (e2) => St(e2), input: (e2) => St(e2), change: (e2) => St(e2), focus: (e2) => e2 instanceof FocusEvent, blur: (e2) => e2 instanceof FocusEvent, clear: () => true, mouseleave: (e2) => e2 instanceof MouseEvent, mouseenter: (e2) => e2 instanceof MouseEvent, keydown: (e2) => e2 instanceof Event, compositionstart: (e2) => e2 instanceof CompositionEvent, compositionupdate: (e2) => e2 instanceof CompositionEvent, compositionend: (e2) => e2 instanceof CompositionEvent };
const lp = ["role"];
const sp = ["id", "minlength", "maxlength", "type", "disabled", "readonly", "autocomplete", "tabindex", "aria-label", "placeholder", "form", "autofocus"];
const ip = ["id", "minlength", "maxlength", "tabindex", "disabled", "readonly", "autocomplete", "aria-label", "placeholder", "form", "autofocus", "rows"];
const up = vue.defineComponent({ name: "ElInput", inheritAttrs: false });
const cp = vue.defineComponent({ ...up, props: ap, emits: rp, setup(e2, { expose: a2, emit: r2 }) {
const s2 = e2;
const d2 = vue.useAttrs();
const f2 = vue.useSlots();
const p2 = vue.computed(() => {
const e3 = {};
if (s2.containerRole === "combobox") {
e3["aria-haspopup"] = d2["aria-haspopup"];
e3["aria-owns"] = d2["aria-owns"];
e3["aria-expanded"] = d2["aria-expanded"];
}
return e3;
});
const m2 = vue.computed(() => [s2.type === "textarea" ? j2.b() : F2.b(), F2.m(V2.value), F2.is("disabled", B2.value), F2.is("exceed", de2.value), { [F2.b("group")]: f2.prepend || f2.append, [F2.m("prefix")]: f2.prefix || s2.prefixIcon, [F2.m("suffix")]: f2.suffix || s2.suffixIcon || s2.clearable || s2.showPassword, [F2.bm("suffix", "password-clear")]: se2.value && ie2.value, [F2.b("hidden")]: s2.type === "hidden" }, d2.class]);
const h2 = vue.computed(() => [F2.e("wrapper"), F2.is("focus", Z2.value)]);
const g2 = Cu({ excludeKeys: vue.computed(() => Object.keys(p2.value)) });
const { form: y2, formItem: S2 } = Zf();
const { inputId: I2 } = Jf(s2, { formItemContext: S2 });
const V2 = Gf();
const B2 = Xf();
const F2 = Vu("input");
const j2 = Vu("textarea");
const z2 = vue.shallowRef();
const H2 = vue.shallowRef();
const W2 = vue.ref(false);
const Y2 = vue.ref(false);
const U2 = vue.ref(false);
const K2 = vue.ref();
const q2 = vue.shallowRef(s2.inputStyle);
const G2 = vue.computed(() => z2.value || H2.value);
const { wrapperRef: X2, isFocused: Z2, handleFocus: J2, handleBlur: Q2 } = _f(G2, { afterBlur() {
var e3;
if (s2.validateEvent) {
(e3 = S2 == null ? void 0 : S2.validate) == null ? void 0 : e3.call(S2, "blur").catch((e4) => ii());
}
} });
const ee2 = vue.computed(() => {
var e3;
return (e3 = y2 == null ? void 0 : y2.statusIcon) != null ? e3 : false;
});
const te2 = vue.computed(() => (S2 == null ? void 0 : S2.validateState) || "");
const ne2 = vue.computed(() => te2.value && lu[te2.value]);
const oe2 = vue.computed(() => U2.value ? Ji : Fi);
const ae2 = vue.computed(() => [d2.style]);
const re2 = vue.computed(() => [s2.inputStyle, q2.value, { resize: s2.resize }]);
const le2 = vue.computed(() => js(s2.modelValue) ? "" : String(s2.modelValue));
const se2 = vue.computed(() => s2.clearable && !B2.value && !s2.readonly && !!le2.value && (Z2.value || W2.value));
const ie2 = vue.computed(() => s2.showPassword && !B2.value && !s2.readonly && !!le2.value && (!!le2.value || Z2.value));
const ue2 = vue.computed(() => s2.showWordLimit && !!s2.maxlength && (s2.type === "text" || s2.type === "textarea") && !B2.value && !s2.readonly && !s2.showPassword);
const ce2 = vue.computed(() => le2.value.length);
const de2 = vue.computed(() => !!ue2.value && ce2.value > Number(s2.maxlength));
const fe2 = vue.computed(() => !!f2.suffix || !!s2.suffixIcon || se2.value || s2.showPassword || ue2.value || !!te2.value && ee2.value);
const [pe2, ve2] = kf(z2);
lt(H2, (e3) => {
be2();
if (!ue2.value || s2.resize !== "both") return;
const t2 = e3[0];
const { width: n2 } = t2.contentRect;
K2.value = { right: `calc(100% - ${n2 + 15 + 6}px)` };
});
const me2 = () => {
const { type: e3, autosize: t2 } = s2;
if (!Ie || e3 !== "textarea" || !H2.value) return;
if (t2) {
const e4 = Ct(t2) ? t2.minRows : void 0;
const n2 = Ct(t2) ? t2.maxRows : void 0;
const o2 = op(H2.value, e4, n2);
q2.value = { overflowY: "hidden", ...o2 };
vue.nextTick(() => {
H2.value.offsetHeight;
q2.value = o2;
});
} else {
q2.value = { minHeight: op(H2.value).minHeight };
}
};
const he2 = (e3) => {
let t2 = false;
return () => {
var n2;
if (t2 || !s2.autosize) return;
const o2 = ((n2 = H2.value) == null ? void 0 : n2.offsetParent) === null;
if (!o2) {
e3();
t2 = true;
}
};
};
const be2 = he2(me2);
const ge2 = () => {
const e3 = G2.value;
const t2 = s2.formatter ? s2.formatter(le2.value) : le2.value;
if (!e3 || e3.value === t2) return;
e3.value = t2;
};
const ye2 = async (e3) => {
pe2();
let { value: t2 } = e3.target;
if (s2.formatter) {
t2 = s2.parser ? s2.parser(t2) : t2;
}
if (Y2.value) return;
if (t2 === le2.value) {
ge2();
return;
}
r2(fu, t2);
r2("input", t2);
await vue.nextTick();
ge2();
ve2();
};
const we2 = (e3) => {
r2("change", e3.target.value);
};
const xe2 = (e3) => {
r2("compositionstart", e3);
Y2.value = true;
};
const ke2 = (e3) => {
var t2;
r2("compositionupdate", e3);
const n2 = (t2 = e3.target) == null ? void 0 : t2.value;
const o2 = n2[n2.length - 1] || "";
Y2.value = !wu(o2);
};
const Se2 = (e3) => {
r2("compositionend", e3);
if (Y2.value) {
Y2.value = false;
ye2(e3);
}
};
const Ce2 = () => {
U2.value = !U2.value;
Ee2();
};
const Ee2 = async () => {
var e3;
await vue.nextTick();
(e3 = G2.value) == null ? void 0 : e3.focus();
};
const Me2 = () => {
var e3;
return (e3 = G2.value) == null ? void 0 : e3.blur();
};
const Oe2 = (e3) => {
W2.value = false;
r2("mouseleave", e3);
};
const _e2 = (e3) => {
W2.value = true;
r2("mouseenter", e3);
};
const $e2 = (e3) => {
r2("keydown", e3);
};
const Le2 = () => {
var e3;
(e3 = G2.value) == null ? void 0 : e3.select();
};
const Ae2 = () => {
r2(fu, "");
r2("change", "");
r2("clear");
r2("input", "");
};
vue.watch(() => s2.modelValue, () => {
var e3;
vue.nextTick(() => me2());
if (s2.validateEvent) {
(e3 = S2 == null ? void 0 : S2.validate) == null ? void 0 : e3.call(S2, "change").catch((e4) => ii());
}
});
vue.watch(le2, () => ge2());
vue.watch(() => s2.type, async () => {
await vue.nextTick();
ge2();
me2();
});
vue.onMounted(() => {
if (!s2.formatter && s2.parser) ;
ge2();
vue.nextTick(me2);
});
Eu({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-input", ref: "https://element-plus.org/en-US/component/input.html" }, vue.computed(() => !!s2.label));
a2({ input: z2, textarea: H2, ref: G2, textareaStyle: re2, autosize: vue.toRef(s2, "autosize"), focus: Ee2, blur: Me2, select: Le2, clear: Ae2, resizeTextarea: me2 });
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", vue.mergeProps(vue.unref(p2), { class: [vue.unref(m2), { [vue.unref(F2).bm("group", "append")]: e3.$slots.append, [vue.unref(F2).bm("group", "prepend")]: e3.$slots.prepend }], style: vue.unref(ae2), role: e3.containerRole, onMouseenter: _e2, onMouseleave: Oe2 }), [vue.createCommentVNode(" input "), e3.type !== "textarea" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createCommentVNode(" prepend slot "), e3.$slots.prepend ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(F2).be("group", "prepend")) }, [vue.renderSlot(e3.$slots, "prepend")], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { ref_key: "wrapperRef", ref: X2, class: vue.normalizeClass(vue.unref(h2)) }, [vue.createCommentVNode(" prefix slot "), e3.$slots.prefix || e3.prefixIcon ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(F2).e("prefix")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(F2).e("prefix-inner")) }, [vue.renderSlot(e3.$slots, "prefix"), e3.prefixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0, class: vue.normalizeClass(vue.unref(F2).e("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.prefixIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 2)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", vue.mergeProps({ id: vue.unref(I2), ref_key: "input", ref: z2, class: vue.unref(F2).e("inner") }, vue.unref(g2), { minlength: e3.minlength, maxlength: e3.maxlength, type: e3.showPassword ? U2.value ? "text" : "password" : e3.type, disabled: vue.unref(B2), readonly: e3.readonly, autocomplete: e3.autocomplete, tabindex: e3.tabindex, "aria-label": e3.label || e3.ariaLabel, placeholder: e3.placeholder, style: e3.inputStyle, form: e3.form, autofocus: e3.autofocus, onCompositionstart: xe2, onCompositionupdate: ke2, onCompositionend: Se2, onInput: ye2, onFocus: a3[0] || (a3[0] = (...e4) => vue.unref(J2) && vue.unref(J2)(...e4)), onBlur: a3[1] || (a3[1] = (...e4) => vue.unref(Q2) && vue.unref(Q2)(...e4)), onChange: we2, onKeydown: $e2 }), null, 16, sp), vue.createCommentVNode(" suffix slot "), vue.unref(fe2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(F2).e("suffix")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(F2).e("suffix-inner")) }, [!vue.unref(se2) || !vue.unref(ie2) || !vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.renderSlot(e3.$slots, "suffix"), e3.suffixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0, class: vue.normalizeClass(vue.unref(F2).e("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.suffixIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 64)) : vue.createCommentVNode("v-if", true), vue.unref(se2) ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 1, class: vue.normalizeClass([vue.unref(F2).e("icon"), vue.unref(F2).e("clear")]), onMousedown: vue.withModifiers(vue.unref(bt), ["prevent"]), onClick: Ae2 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Li))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.unref(ie2) ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 2, class: vue.normalizeClass([vue.unref(F2).e("icon"), vue.unref(F2).e("password")]), onClick: Ce2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(oe2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 3, class: vue.normalizeClass(vue.unref(F2).e("count")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(F2).e("count-inner")) }, vue.toDisplayString(vue.unref(ce2)) + " / " + vue.toDisplayString(e3.maxlength), 3)], 2)) : vue.createCommentVNode("v-if", true), vue.unref(te2) && vue.unref(ne2) && vue.unref(ee2) ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 4, class: vue.normalizeClass([vue.unref(F2).e("icon"), vue.unref(F2).e("validateIcon"), vue.unref(F2).is("loading", vue.unref(te2) === "validating")]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ne2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 2)], 2)) : vue.createCommentVNode("v-if", true)], 2), vue.createCommentVNode(" append slot "), e3.$slots.append ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass(vue.unref(F2).be("group", "append")) }, [vue.renderSlot(e3.$slots, "append")], 2)) : vue.createCommentVNode("v-if", true)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createCommentVNode(" textarea "), vue.createElementVNode("textarea", vue.mergeProps({ id: vue.unref(I2), ref_key: "textarea", ref: H2, class: [vue.unref(j2).e("inner"), vue.unref(F2).is("focus", vue.unref(Z2))] }, vue.unref(g2), { minlength: e3.minlength, maxlength: e3.maxlength, tabindex: e3.tabindex, disabled: vue.unref(B2), readonly: e3.readonly, autocomplete: e3.autocomplete, style: vue.unref(re2), "aria-label": e3.label || e3.ariaLabel, placeholder: e3.placeholder, form: e3.form, autofocus: e3.autofocus, rows: e3.rows, onCompositionstart: xe2, onCompositionupdate: ke2, onCompositionend: Se2, onInput: ye2, onFocus: a3[2] || (a3[2] = (...e4) => vue.unref(J2) && vue.unref(J2)(...e4)), onBlur: a3[3] || (a3[3] = (...e4) => vue.unref(Q2) && vue.unref(Q2)(...e4)), onChange: we2, onKeydown: $e2 }), null, 16, ip), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, style: vue.normalizeStyle(K2.value), class: vue.normalizeClass(vue.unref(F2).e("count")) }, vue.toDisplayString(vue.unref(ce2)) + " / " + vue.toDisplayString(e3.maxlength), 7)) : vue.createCommentVNode("v-if", true)], 64))], 16, lp));
} });
var dp = jf(cp, [["__file", "input.vue"]]);
const fp = su(dp);
const pp = 4;
const vp = { vertical: { offset: "offsetHeight", scroll: "scrollTop", scrollSize: "scrollHeight", size: "height", key: "vertical", axis: "Y", client: "clientY", direction: "top" }, horizontal: { offset: "offsetWidth", scroll: "scrollLeft", scrollSize: "scrollWidth", size: "width", key: "horizontal", axis: "X", client: "clientX", direction: "left" } };
const mp = ({ move: e2, size: t2, bar: n2 }) => ({ [n2.size]: t2, transform: `translate${n2.axis}(${e2}%)` });
const hp = Symbol("scrollbarContextKey");
const bp = ou({ vertical: Boolean, size: String, move: Number, ratio: { type: Number, required: true }, always: Boolean });
const gp = "Thumb";
const yp = vue.defineComponent({ __name: "thumb", props: bp, setup(e2) {
const n2 = e2;
const a2 = vue.inject(hp);
const r2 = Vu("scrollbar");
if (!a2) si(gp, "can not inject scrollbar context");
const s2 = vue.ref();
const i2 = vue.ref();
const c2 = vue.ref({});
const d2 = vue.ref(false);
let m2 = false;
let h2 = false;
let b2 = Ie ? document.onselectstart : null;
const g2 = vue.computed(() => vp[n2.vertical ? "vertical" : "horizontal"]);
const y2 = vue.computed(() => mp({ size: n2.size, move: n2.move, bar: g2.value }));
const w2 = vue.computed(() => s2.value[g2.value.offset] ** 2 / a2.wrapElement[g2.value.scrollSize] / n2.ratio / i2.value[g2.value.offset]);
const x2 = (e3) => {
var t2;
e3.stopPropagation();
if (e3.ctrlKey || [1, 2].includes(e3.button)) return;
(t2 = window.getSelection()) == null ? void 0 : t2.removeAllRanges();
C2(e3);
const n3 = e3.currentTarget;
if (!n3) return;
c2.value[g2.value.axis] = n3[g2.value.offset] - (e3[g2.value.client] - n3.getBoundingClientRect()[g2.value.direction]);
};
const S2 = (e3) => {
if (!i2.value || !s2.value || !a2.wrapElement) return;
const t2 = Math.abs(e3.target.getBoundingClientRect()[g2.value.direction] - e3[g2.value.client]);
const n3 = i2.value[g2.value.offset] / 2;
const o2 = (t2 - n3) * 100 * w2.value / s2.value[g2.value.offset];
a2.wrapElement[g2.value.scroll] = o2 * a2.wrapElement[g2.value.scrollSize] / 100;
};
const C2 = (e3) => {
e3.stopImmediatePropagation();
m2 = true;
document.addEventListener("mousemove", E2);
document.addEventListener("mouseup", M2);
b2 = document.onselectstart;
document.onselectstart = () => false;
};
const E2 = (e3) => {
if (!s2.value || !i2.value) return;
if (m2 === false) return;
const t2 = c2.value[g2.value.axis];
if (!t2) return;
const n3 = (s2.value.getBoundingClientRect()[g2.value.direction] - e3[g2.value.client]) * -1;
const o2 = i2.value[g2.value.offset] - t2;
const r3 = (n3 - o2) * 100 * w2.value / s2.value[g2.value.offset];
a2.wrapElement[g2.value.scroll] = r3 * a2.wrapElement[g2.value.scrollSize] / 100;
};
const M2 = () => {
m2 = false;
c2.value[g2.value.axis] = 0;
document.removeEventListener("mousemove", E2);
document.removeEventListener("mouseup", M2);
D2();
if (h2) d2.value = false;
};
const O2 = () => {
h2 = false;
d2.value = !!n2.size;
};
const _2 = () => {
h2 = true;
d2.value = m2;
};
vue.onBeforeUnmount(() => {
D2();
document.removeEventListener("mouseup", M2);
});
const D2 = () => {
if (document.onselectstart !== b2) document.onselectstart = b2;
};
Ge(vue.toRef(a2, "scrollbarElement"), "mousemove", O2);
Ge(vue.toRef(a2, "scrollbarElement"), "mouseleave", _2);
return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(r2).b("fade"), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createElementVNode("div", { ref_key: "instance", ref: s2, class: vue.normalizeClass([vue.unref(r2).e("bar"), vue.unref(r2).is(vue.unref(g2).key)]), onMousedown: S2 }, [vue.createElementVNode("div", { ref_key: "thumb", ref: i2, class: vue.normalizeClass(vue.unref(r2).e("thumb")), style: vue.normalizeStyle(vue.unref(y2)), onMousedown: x2 }, null, 38)], 34), [[vue.vShow, e3.always || d2.value]])]), _: 1 }, 8, ["name"]));
} });
var wp = jf(yp, [["__file", "thumb.vue"]]);
const xp = ou({ always: { type: Boolean, default: true }, minSize: { type: Number, required: true } });
const kp = vue.defineComponent({ __name: "bar", props: xp, setup(e2, { expose: o2 }) {
const a2 = e2;
const r2 = vue.inject(hp);
const l2 = vue.ref(0);
const s2 = vue.ref(0);
const i2 = vue.ref("");
const u2 = vue.ref("");
const c2 = vue.ref(1);
const d2 = vue.ref(1);
const f2 = (e3) => {
if (e3) {
const t2 = e3.offsetHeight - pp;
const n2 = e3.offsetWidth - pp;
s2.value = e3.scrollTop * 100 / t2 * c2.value;
l2.value = e3.scrollLeft * 100 / n2 * d2.value;
}
};
const m2 = () => {
const e3 = r2 == null ? void 0 : r2.wrapElement;
if (!e3) return;
const t2 = e3.offsetHeight - pp;
const n2 = e3.offsetWidth - pp;
const o3 = t2 ** 2 / e3.scrollHeight;
const l3 = n2 ** 2 / e3.scrollWidth;
const s3 = Math.max(o3, a2.minSize);
const f3 = Math.max(l3, a2.minSize);
c2.value = o3 / (t2 - o3) / (s3 / (t2 - s3));
d2.value = l3 / (n2 - l3) / (f3 / (n2 - f3));
u2.value = s3 + pp < t2 ? `${s3}px` : "";
i2.value = f3 + pp < n2 ? `${f3}px` : "";
};
o2({ handleScroll: f2, update: m2 });
return (e3, o3) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [vue.createVNode(wp, { move: l2.value, ratio: d2.value, size: i2.value, always: e3.always }, null, 8, ["move", "ratio", "size", "always"]), vue.createVNode(wp, { move: s2.value, ratio: c2.value, size: u2.value, vertical: "", always: e3.always }, null, 8, ["move", "ratio", "size", "always"])], 64));
} });
var Sp = jf(kp, [["__file", "bar.vue"]]);
const Cp = ou({ height: { type: [String, Number], default: "" }, maxHeight: { type: [String, Number], default: "" }, native: { type: Boolean, default: false }, wrapStyle: { type: eu([String, Object, Array]), default: "" }, wrapClass: { type: [String, Array], default: "" }, viewClass: { type: [String, Array], default: "" }, viewStyle: { type: [String, Array, Object], default: "" }, noresize: Boolean, tag: { type: String, default: "div" }, always: Boolean, minSize: { type: Number, default: 20 }, id: String, role: String, ...Tf(["ariaLabel", "ariaOrientation"]) });
const Ep = { scroll: ({ scrollTop: e2, scrollLeft: t2 }) => [e2, t2].every(Zs) };
const Mp = "ElScrollbar";
const Op = vue.defineComponent({ name: Mp });
const _p = vue.defineComponent({ ...Op, props: Cp, emits: Ep, setup(e2, { expose: a2, emit: r2 }) {
const s2 = e2;
const d2 = Vu("scrollbar");
let f2 = void 0;
let p2 = void 0;
const m2 = vue.ref();
const h2 = vue.ref();
const b2 = vue.ref();
const g2 = vue.ref();
const w2 = vue.computed(() => {
const e3 = {};
if (s2.height) e3.height = vi(s2.height);
if (s2.maxHeight) e3.maxHeight = vi(s2.maxHeight);
return [s2.wrapStyle, e3];
});
const k2 = vue.computed(() => [s2.wrapClass, d2.e("wrap"), { [d2.em("wrap", "hidden-default")]: !s2.native }]);
const S2 = vue.computed(() => [d2.e("view"), s2.viewClass]);
const C2 = () => {
var e3;
if (h2.value) {
(e3 = g2.value) == null ? void 0 : e3.handleScroll(h2.value);
r2("scroll", { scrollTop: h2.value.scrollTop, scrollLeft: h2.value.scrollLeft });
}
};
function E2(e3, t2) {
if (Ct(e3)) {
h2.value.scrollTo(e3);
} else if (Zs(e3) && Zs(t2)) {
h2.value.scrollTo(e3, t2);
}
}
const _2 = (e3) => {
if (!Zs(e3)) {
return;
}
h2.value.scrollTop = e3;
};
const R2 = (e3) => {
if (!Zs(e3)) {
return;
}
h2.value.scrollLeft = e3;
};
const T2 = () => {
var e3;
(e3 = g2.value) == null ? void 0 : e3.update();
};
vue.watch(() => s2.noresize, (e3) => {
if (e3) {
f2 == null ? void 0 : f2();
p2 == null ? void 0 : p2();
} else {
({ stop: f2 } = lt(b2, T2));
p2 = Ge("resize", T2);
}
}, { immediate: true });
vue.watch(() => [s2.maxHeight, s2.height], () => {
if (!s2.native) vue.nextTick(() => {
var e3;
T2();
if (h2.value) {
(e3 = g2.value) == null ? void 0 : e3.handleScroll(h2.value);
}
});
});
vue.provide(hp, vue.reactive({ scrollbarElement: m2, wrapElement: h2 }));
vue.onMounted(() => {
if (!s2.native) vue.nextTick(() => {
T2();
});
});
vue.onUpdated(() => T2());
a2({ wrapRef: h2, update: T2, scrollTo: E2, setScrollTop: _2, setScrollLeft: R2, handleScroll: C2 });
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { ref_key: "scrollbarRef", ref: m2, class: vue.normalizeClass(vue.unref(d2).b()) }, [vue.createElementVNode("div", { ref_key: "wrapRef", ref: h2, class: vue.normalizeClass(vue.unref(k2)), style: vue.normalizeStyle(vue.unref(w2)), onScroll: C2 }, [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), { id: e3.id, ref_key: "resizeRef", ref: b2, class: vue.normalizeClass(vue.unref(S2)), style: vue.normalizeStyle(e3.viewStyle), role: e3.role, "aria-label": e3.ariaLabel, "aria-orientation": e3.ariaOrientation }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "style", "role", "aria-label", "aria-orientation"]))], 38), !e3.native ? (vue.openBlock(), vue.createBlock(Sp, { key: 0, ref_key: "barRef", ref: g2, always: e3.always, "min-size": e3.minSize }, null, 8, ["always", "min-size"])) : vue.createCommentVNode("v-if", true)], 2));
} });
var $p = jf(_p, [["__file", "scrollbar.vue"]]);
const Lp = su($p);
const Ap = Symbol("popper");
const Dp = Symbol("popperContent");
const Rp = ["dialog", "grid", "group", "listbox", "menu", "navigation", "tooltip", "tree"];
const Tp = ou({ role: { type: String, values: Rp, default: "tooltip" } });
const Np = vue.defineComponent({ name: "ElPopper", inheritAttrs: false });
const Pp = vue.defineComponent({ ...Np, props: Tp, setup(e2, { expose: t2 }) {
const n2 = e2;
const o2 = vue.ref();
const a2 = vue.ref();
const r2 = vue.ref();
const s2 = vue.ref();
const i2 = vue.computed(() => n2.role);
const u2 = { triggerRef: o2, popperInstanceRef: a2, contentRef: r2, referenceRef: s2, role: i2 };
t2(u2);
vue.provide(Ap, u2);
return (e3, t3) => vue.renderSlot(e3.$slots, "default");
} });
var Ip = jf(Pp, [["__file", "popper.vue"]]);
const Vp = ou({ arrowOffset: { type: Number, default: 5 } });
const Bp = vue.defineComponent({ name: "ElPopperArrow", inheritAttrs: false });
const Fp = vue.defineComponent({ ...Bp, props: Vp, setup(e2, { expose: o2 }) {
const a2 = e2;
const r2 = Vu("popper");
const { arrowOffset: l2, arrowRef: s2, arrowStyle: c2 } = vue.inject(Dp, void 0);
vue.watch(() => a2.arrowOffset, (e3) => {
l2.value = e3;
});
vue.onBeforeUnmount(() => {
s2.value = void 0;
});
o2({ arrowRef: s2 });
return (e3, o3) => (vue.openBlock(), vue.createElementBlock("span", { ref_key: "arrowRef", ref: s2, class: vue.normalizeClass(vue.unref(r2).e("arrow")), style: vue.normalizeStyle(vue.unref(c2)), "data-popper-arrow": "" }, null, 6));
} });
var jp = jf(Fp, [["__file", "arrow.vue"]]);
const zp = "ElOnlyChild";
const Hp = vue.defineComponent({ name: zp, setup(e2, { slots: t2, attrs: n2 }) {
var o2;
const a2 = vue.inject(pf);
const r2 = mf((o2 = a2 == null ? void 0 : a2.setForwardRef) != null ? o2 : bt);
return () => {
var e3;
const o3 = (e3 = t2.default) == null ? void 0 : e3.call(t2, n2);
if (!o3) return null;
if (o3.length > 1) {
return null;
}
const a3 = Wp(o3);
if (!a3) {
return null;
}
return vue.withDirectives(vue.cloneVNode(a3, n2), [[r2]]);
};
} });
function Wp(e2) {
if (!e2) return null;
const t2 = e2;
for (const e3 of t2) {
if (Ct(e3)) {
switch (e3.type) {
case vue.Comment:
continue;
case vue.Text:
case "svg":
return Yp(e3);
case vue.Fragment:
return Wp(e3.children);
default:
return e3;
}
}
return Yp(e3);
}
return null;
}
function Yp(e2) {
const t2 = Vu("only-child");
return vue.createVNode("span", { class: t2.e("content") }, [e2]);
}
const Up = ou({ virtualRef: { type: eu(Object) }, virtualTriggering: Boolean, onMouseenter: { type: eu(Function) }, onMouseleave: { type: eu(Function) }, onClick: { type: eu(Function) }, onKeydown: { type: eu(Function) }, onFocus: { type: eu(Function) }, onBlur: { type: eu(Function) }, onContextmenu: { type: eu(Function) }, id: String, open: Boolean });
const Kp = vue.defineComponent({ name: "ElPopperTrigger", inheritAttrs: false });
const qp = vue.defineComponent({ ...Kp, props: Up, setup(e2, { expose: n2 }) {
const o2 = e2;
const { role: a2, triggerRef: r2 } = vue.inject(Ap, void 0);
vf(r2);
const s2 = vue.computed(() => v2.value ? o2.id : void 0);
const d2 = vue.computed(() => {
if (a2 && a2.value === "tooltip") {
return o2.open && o2.id ? o2.id : void 0;
}
return void 0;
});
const v2 = vue.computed(() => {
if (a2 && a2.value !== "tooltip") {
return a2.value;
}
return void 0;
});
const m2 = vue.computed(() => v2.value ? `${o2.open}` : void 0);
let h2 = void 0;
vue.onMounted(() => {
vue.watch(() => o2.virtualRef, (e3) => {
if (e3) {
r2.value = Ue(e3);
}
}, { immediate: true });
vue.watch(r2, (e3, t2) => {
h2 == null ? void 0 : h2();
h2 = void 0;
if (Qs(e3)) {
["onMouseenter", "onMouseleave", "onClick", "onKeydown", "onFocus", "onBlur", "onContextmenu"].forEach((n3) => {
var a3;
const r3 = o2[n3];
if (r3) {
e3.addEventListener(n3.slice(2).toLowerCase(), r3);
(a3 = t2 == null ? void 0 : t2.removeEventListener) == null ? void 0 : a3.call(t2, n3.slice(2).toLowerCase(), r3);
}
});
h2 = vue.watch([s2, d2, v2, m2], (t3) => {
["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((n3, o3) => {
js(t3[o3]) ? e3.removeAttribute(n3) : e3.setAttribute(n3, t3[o3]);
});
}, { immediate: true });
}
if (Qs(t2)) {
["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((e4) => t2.removeAttribute(e4));
}
}, { immediate: true });
});
vue.onBeforeUnmount(() => {
h2 == null ? void 0 : h2();
h2 = void 0;
});
n2({ triggerRef: r2 });
return (e3, n3) => !e3.virtualTriggering ? (vue.openBlock(), vue.createBlock(vue.unref(Hp), vue.mergeProps({ key: 0 }, e3.$attrs, { "aria-controls": vue.unref(s2), "aria-describedby": vue.unref(d2), "aria-expanded": vue.unref(m2), "aria-haspopup": vue.unref(v2) }), { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 16, ["aria-controls", "aria-describedby", "aria-expanded", "aria-haspopup"])) : vue.createCommentVNode("v-if", true);
} });
var Gp = jf(qp, [["__file", "trigger.vue"]]);
const Xp = "focus-trap.focus-after-trapped";
const Zp = "focus-trap.focus-after-released";
const Jp = "focus-trap.focusout-prevented";
const Qp = { cancelable: true, bubbles: false };
const ev = { cancelable: true, bubbles: false };
const tv = "focusAfterTrapped";
const nv = "focusAfterReleased";
const ov = Symbol("elFocusTrap");
const av = vue.ref();
const rv = vue.ref(0);
const lv = vue.ref(0);
let sv = 0;
const iv = (e2) => {
const t2 = [];
const n2 = document.createTreeWalker(e2, NodeFilter.SHOW_ELEMENT, { acceptNode: (e3) => {
const t3 = e3.tagName === "INPUT" && e3.type === "hidden";
if (e3.disabled || e3.hidden || t3) return NodeFilter.FILTER_SKIP;
return e3.tabIndex >= 0 || e3 === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP;
} });
while (n2.nextNode()) t2.push(n2.currentNode);
return t2;
};
const uv = (e2, t2) => {
for (const n2 of e2) {
if (!cv(n2, t2)) return n2;
}
};
const cv = (e2, t2) => {
if (getComputedStyle(e2).visibility === "hidden") return true;
while (e2) {
if (t2 && e2 === t2) return false;
if (getComputedStyle(e2).display === "none") return true;
e2 = e2.parentElement;
}
return false;
};
const dv = (e2) => {
const t2 = iv(e2);
const n2 = uv(t2, e2);
const o2 = uv(t2.reverse(), e2);
return [n2, o2];
};
const fv = (e2) => e2 instanceof HTMLInputElement && "select" in e2;
const pv = (e2, t2) => {
if (e2 && e2.focus) {
const n2 = document.activeElement;
e2.focus({ preventScroll: true });
lv.value = window.performance.now();
if (e2 !== n2 && fv(e2) && t2) {
e2.select();
}
}
};
function vv(e2, t2) {
const n2 = [...e2];
const o2 = e2.indexOf(t2);
if (o2 !== -1) {
n2.splice(o2, 1);
}
return n2;
}
const mv = () => {
let e2 = [];
const t2 = (t3) => {
const n3 = e2[0];
if (n3 && t3 !== n3) {
n3.pause();
}
e2 = vv(e2, t3);
e2.unshift(t3);
};
const n2 = (t3) => {
var n3, o2;
e2 = vv(e2, t3);
(o2 = (n3 = e2[0]) == null ? void 0 : n3.resume) == null ? void 0 : o2.call(n3);
};
return { push: t2, remove: n2 };
};
const hv = (e2, t2 = false) => {
const n2 = document.activeElement;
for (const o2 of e2) {
pv(o2, t2);
if (document.activeElement !== n2) return;
}
};
const bv = mv();
const gv = () => rv.value > lv.value;
const yv = () => {
av.value = "pointer";
rv.value = window.performance.now();
};
const wv = () => {
av.value = "keyboard";
rv.value = window.performance.now();
};
const xv = () => {
vue.onMounted(() => {
if (sv === 0) {
document.addEventListener("mousedown", yv);
document.addEventListener("touchstart", yv);
document.addEventListener("keydown", wv);
}
sv++;
});
vue.onBeforeUnmount(() => {
sv--;
if (sv <= 0) {
document.removeEventListener("mousedown", yv);
document.removeEventListener("touchstart", yv);
document.removeEventListener("keydown", wv);
}
});
return { focusReason: av, lastUserFocusTimestamp: rv, lastAutomatedFocusTimestamp: lv };
};
const kv = (e2) => new CustomEvent(Jp, { ...ev, detail: e2 });
const Sv = vue.defineComponent({ name: "ElFocusTrap", inheritAttrs: false, props: { loop: Boolean, trapped: Boolean, focusTrapEl: Object, focusStartEl: { type: [Object, String], default: "first" } }, emits: [tv, nv, "focusin", "focusout", "focusout-prevented", "release-requested"], setup(e2, { emit: t2 }) {
const n2 = vue.ref();
let o2;
let a2;
const { focusReason: r2 } = xv();
rf((n3) => {
if (e2.trapped && !l2.paused) {
t2("release-requested", n3);
}
});
const l2 = { paused: false, pause() {
this.paused = true;
}, resume() {
this.paused = false;
} };
const s2 = (n3) => {
if (!e2.loop && !e2.trapped) return;
if (l2.paused) return;
const { key: o3, altKey: a3, ctrlKey: s3, metaKey: i2, currentTarget: u2, shiftKey: c2 } = n3;
const { loop: d3 } = e2;
const f2 = o3 === cu.tab && !a3 && !s3 && !i2;
const p3 = document.activeElement;
if (f2 && p3) {
const e3 = u2;
const [o4, a4] = dv(e3);
const l3 = o4 && a4;
if (!l3) {
if (p3 === e3) {
const e4 = kv({ focusReason: r2.value });
t2("focusout-prevented", e4);
if (!e4.defaultPrevented) {
n3.preventDefault();
}
}
} else {
if (!c2 && p3 === a4) {
const e4 = kv({ focusReason: r2.value });
t2("focusout-prevented", e4);
if (!e4.defaultPrevented) {
n3.preventDefault();
if (d3) pv(o4, true);
}
} else if (c2 && [o4, e3].includes(p3)) {
const e4 = kv({ focusReason: r2.value });
t2("focusout-prevented", e4);
if (!e4.defaultPrevented) {
n3.preventDefault();
if (d3) pv(a4, true);
}
}
}
}
};
vue.provide(ov, { focusTrapRef: n2, onKeydown: s2 });
vue.watch(() => e2.focusTrapEl, (e3) => {
if (e3) {
n2.value = e3;
}
}, { immediate: true });
vue.watch([n2], ([e3], [t3]) => {
if (e3) {
e3.addEventListener("keydown", s2);
e3.addEventListener("focusin", m2);
e3.addEventListener("focusout", h2);
}
if (t3) {
t3.removeEventListener("keydown", s2);
t3.removeEventListener("focusin", m2);
t3.removeEventListener("focusout", h2);
}
});
const d2 = (e3) => {
t2(tv, e3);
};
const p2 = (e3) => t2(nv, e3);
const m2 = (r3) => {
const s3 = vue.unref(n2);
if (!s3) return;
const i2 = r3.target;
const c2 = r3.relatedTarget;
const d3 = i2 && s3.contains(i2);
if (!e2.trapped) {
const e3 = c2 && s3.contains(c2);
if (!e3) {
o2 = c2;
}
}
if (d3) t2("focusin", r3);
if (l2.paused) return;
if (e2.trapped) {
if (d3) {
a2 = i2;
} else {
pv(a2, true);
}
}
};
const h2 = (o3) => {
const s3 = vue.unref(n2);
if (l2.paused || !s3) return;
if (e2.trapped) {
const n3 = o3.relatedTarget;
if (!js(n3) && !s3.contains(n3)) {
setTimeout(() => {
if (!l2.paused && e2.trapped) {
const e3 = kv({ focusReason: r2.value });
t2("focusout-prevented", e3);
if (!e3.defaultPrevented) {
pv(a2, true);
}
}
}, 0);
}
} else {
const e3 = o3.target;
const n3 = e3 && s3.contains(e3);
if (!n3) t2("focusout", o3);
}
};
async function b2() {
await vue.nextTick();
const t3 = vue.unref(n2);
if (t3) {
bv.push(l2);
const n3 = t3.contains(document.activeElement) ? o2 : document.activeElement;
o2 = n3;
const a3 = t3.contains(n3);
if (!a3) {
const o3 = new Event(Xp, Qp);
t3.addEventListener(Xp, d2);
t3.dispatchEvent(o3);
if (!o3.defaultPrevented) {
vue.nextTick(() => {
let o4 = e2.focusStartEl;
if (!St(o4)) {
pv(o4);
if (document.activeElement !== o4) {
o4 = "first";
}
}
if (o4 === "first") {
hv(iv(t3), true);
}
if (document.activeElement === n3 || o4 === "container") {
pv(t3);
}
});
}
}
}
}
function g2() {
const e3 = vue.unref(n2);
if (e3) {
e3.removeEventListener(Xp, d2);
const t3 = new CustomEvent(Zp, { ...Qp, detail: { focusReason: r2.value } });
e3.addEventListener(Zp, p2);
e3.dispatchEvent(t3);
if (!t3.defaultPrevented && (r2.value == "keyboard" || !gv() || e3.contains(document.activeElement))) {
pv(o2 != null ? o2 : document.body);
}
e3.removeEventListener(Zp, p2);
bv.remove(l2);
}
}
vue.onMounted(() => {
if (e2.trapped) {
b2();
}
vue.watch(() => e2.trapped, (e3) => {
if (e3) {
b2();
} else {
g2();
}
});
});
vue.onBeforeUnmount(() => {
if (e2.trapped) {
g2();
}
});
return { onKeydown: s2 };
} });
function Cv(e2, t2, n2, o2, a2, r2) {
return vue.renderSlot(e2.$slots, "default", { handleKeydown: e2.onKeydown });
}
var Ev = jf(Sv, [["render", Cv], ["__file", "focus-trap.vue"]]);
const Mv = ["fixed", "absolute"];
const Ov = ou({ boundariesPadding: { type: Number, default: 0 }, fallbackPlacements: { type: eu(Array), default: void 0 }, gpuAcceleration: { type: Boolean, default: true }, offset: { type: Number, default: 12 }, placement: { type: String, values: oc, default: "bottom" }, popperOptions: { type: eu(Object), default: () => ({}) }, strategy: { type: String, values: Mv, default: "absolute" } });
const _v = ou({ ...Ov, id: String, style: { type: eu([String, Array, Object]) }, className: { type: eu([String, Array, Object]) }, effect: { type: eu(String), default: "dark" }, visible: Boolean, enterable: { type: Boolean, default: true }, pure: Boolean, focusOnShow: { type: Boolean, default: false }, trapping: { type: Boolean, default: false }, popperClass: { type: eu([String, Array, Object]) }, popperStyle: { type: eu([String, Array, Object]) }, referenceEl: { type: eu(Object) }, triggerTargetEl: { type: eu(Object) }, stopPopperMouseEvent: { type: Boolean, default: true }, virtualTriggering: Boolean, zIndex: Number, ...Tf(["ariaLabel"]) });
const $v = { mouseenter: (e2) => e2 instanceof MouseEvent, mouseleave: (e2) => e2 instanceof MouseEvent, focus: () => true, blur: () => true, close: () => true };
const Lv = (e2, t2 = []) => {
const { placement: n2, strategy: o2, popperOptions: a2 } = e2;
const r2 = { placement: n2, strategy: o2, ...a2, modifiers: [...Dv(e2), ...t2] };
Rv(r2, a2 == null ? void 0 : a2.modifiers);
return r2;
};
const Av = (e2) => {
if (!Ie) return;
return Ue(e2);
};
function Dv(e2) {
const { offset: t2, gpuAcceleration: n2, fallbackPlacements: o2 } = e2;
return [{ name: "offset", options: { offset: [0, t2 != null ? t2 : 12] } }, { name: "preventOverflow", options: { padding: { top: 2, bottom: 2, left: 5, right: 5 } } }, { name: "flip", options: { padding: 5, fallbackPlacements: o2 } }, { name: "computeStyles", options: { gpuAcceleration: n2 } }];
}
function Rv(e2, t2) {
if (t2) {
e2.modifiers = [...e2.modifiers, ...t2 != null ? t2 : []];
}
}
const Tv = 0;
const Nv = (e2) => {
const { popperInstanceRef: t2, contentRef: n2, triggerRef: o2, role: a2 } = vue.inject(Ap, void 0);
const r2 = vue.ref();
const s2 = vue.ref();
const d2 = vue.computed(() => ({ name: "eventListeners", enabled: !!e2.visible }));
const f2 = vue.computed(() => {
var e3;
const t3 = vue.unref(r2);
const n3 = (e3 = vue.unref(s2)) != null ? e3 : Tv;
return { name: "arrow", enabled: !zs(t3), options: { element: t3, padding: n3 } };
});
const m2 = vue.computed(() => ({ onFirstUpdate: () => {
w2();
}, ...Lv(e2, [vue.unref(f2), vue.unref(d2)]) }));
const h2 = vue.computed(() => Av(e2.referenceEl) || vue.unref(o2));
const { attributes: b2, state: g2, styles: y2, update: w2, forceUpdate: x2, instanceRef: k2 } = Gd(h2, n2, m2);
vue.watch(k2, (e3) => t2.value = e3);
vue.onMounted(() => {
vue.watch(() => {
var e3;
return (e3 = vue.unref(h2)) == null ? void 0 : e3.getBoundingClientRect();
}, () => {
w2();
});
});
return { attributes: b2, arrowRef: r2, contentRef: n2, instanceRef: k2, state: g2, styles: y2, role: a2, forceUpdate: x2, update: w2 };
};
const Pv = (e2, { attributes: t2, styles: n2, role: o2 }) => {
const { nextZIndex: a2 } = xf();
const r2 = Vu("popper");
const s2 = vue.computed(() => vue.unref(t2).popper);
const i2 = vue.ref(Zs(e2.zIndex) ? e2.zIndex : a2());
const c2 = vue.computed(() => [r2.b(), r2.is("pure", e2.pure), r2.is(e2.effect), e2.popperClass]);
const d2 = vue.computed(() => [{ zIndex: vue.unref(i2) }, vue.unref(n2).popper, e2.popperStyle || {}]);
const f2 = vue.computed(() => o2.value === "dialog" ? "false" : void 0);
const p2 = vue.computed(() => vue.unref(n2).arrow || {});
const m2 = () => {
i2.value = Zs(e2.zIndex) ? e2.zIndex : a2();
};
return { ariaModal: f2, arrowStyle: p2, contentAttrs: s2, contentClass: c2, contentStyle: d2, contentZIndex: i2, updateZIndex: m2 };
};
const Iv = (e2, t2) => {
const n2 = vue.ref(false);
const o2 = vue.ref();
const a2 = () => {
t2("focus");
};
const r2 = (e3) => {
var n3;
if (((n3 = e3.detail) == null ? void 0 : n3.focusReason) !== "pointer") {
o2.value = "first";
t2("blur");
}
};
const l2 = (t3) => {
if (e2.visible && !n2.value) {
if (t3.target) {
o2.value = t3.target;
}
n2.value = true;
}
};
const s2 = (t3) => {
if (!e2.trapping) {
if (t3.detail.focusReason === "pointer") {
t3.preventDefault();
}
n2.value = false;
}
};
const i2 = () => {
n2.value = false;
t2("close");
};
return { focusStartRef: o2, trapped: n2, onFocusAfterReleased: r2, onFocusAfterTrapped: a2, onFocusInTrap: l2, onFocusoutPrevented: s2, onReleaseRequested: i2 };
};
const Vv = vue.defineComponent({ name: "ElPopperContent" });
const Bv = vue.defineComponent({ ...Vv, props: _v, emits: $v, setup(e2, { expose: o2, emit: a2 }) {
const r2 = e2;
const { focusStartRef: l2, trapped: s2, onFocusAfterReleased: d2, onFocusAfterTrapped: m2, onFocusInTrap: h2, onFocusoutPrevented: b2, onReleaseRequested: g2 } = Iv(r2, a2);
const { attributes: k2, arrowRef: S2, contentRef: C2, styles: E2, instanceRef: M2, role: O2, update: _2 } = Nv(r2);
const { ariaModal: $2, arrowStyle: L2, contentAttrs: D2, contentClass: R2, contentStyle: N2, updateZIndex: P2 } = Pv(r2, { styles: E2, attributes: k2, role: O2 });
const I2 = vue.inject(qf, void 0);
const V2 = vue.ref();
vue.provide(Dp, { arrowStyle: L2, arrowRef: S2, arrowOffset: V2 });
if (I2) {
vue.provide(qf, { ...I2, addInputId: bt, removeInputId: bt });
}
let B2 = void 0;
const F2 = (e3 = true) => {
_2();
e3 && P2();
};
const j2 = () => {
F2(false);
if (r2.visible && r2.focusOnShow) {
s2.value = true;
} else if (r2.visible === false) {
s2.value = false;
}
};
vue.onMounted(() => {
vue.watch(() => r2.triggerTargetEl, (e3, t2) => {
B2 == null ? void 0 : B2();
B2 = void 0;
const n2 = vue.unref(e3 || C2.value);
const o3 = vue.unref(t2 || C2.value);
if (Qs(n2)) {
B2 = vue.watch([O2, () => r2.ariaLabel, $2, () => r2.id], (e4) => {
["role", "aria-label", "aria-modal", "id"].forEach((t3, o4) => {
js(e4[o4]) ? n2.removeAttribute(t3) : n2.setAttribute(t3, e4[o4]);
});
}, { immediate: true });
}
if (o3 !== n2 && Qs(o3)) {
["role", "aria-label", "aria-modal", "id"].forEach((e4) => {
o3.removeAttribute(e4);
});
}
}, { immediate: true });
vue.watch(() => r2.visible, j2, { immediate: true });
});
vue.onBeforeUnmount(() => {
B2 == null ? void 0 : B2();
B2 = void 0;
});
o2({ popperContentRef: C2, popperInstanceRef: M2, updatePopper: F2, contentStyle: N2 });
return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", vue.mergeProps({ ref_key: "contentRef", ref: C2 }, vue.unref(D2), { style: vue.unref(N2), class: vue.unref(R2), tabindex: "-1", onMouseenter: o3[0] || (o3[0] = (t2) => e3.$emit("mouseenter", t2)), onMouseleave: o3[1] || (o3[1] = (t2) => e3.$emit("mouseleave", t2)) }), [vue.createVNode(vue.unref(Ev), { trapped: vue.unref(s2), "trap-on-focus-in": true, "focus-trap-el": vue.unref(C2), "focus-start-el": vue.unref(l2), onFocusAfterTrapped: vue.unref(m2), onFocusAfterReleased: vue.unref(d2), onFocusin: vue.unref(h2), onFocusoutPrevented: vue.unref(b2), onReleaseRequested: vue.unref(g2) }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusin", "onFocusoutPrevented", "onReleaseRequested"])], 16));
} });
var Fv = jf(Bv, [["__file", "content.vue"]]);
const jv = su(Ip);
const zv = Symbol("elTooltip");
const Hv = ou({ ...df, ..._v, appendTo: { type: eu([String, Object]) }, content: { type: String, default: "" }, rawContent: Boolean, persistent: Boolean, visible: { type: eu(Boolean), default: null }, transition: String, teleported: { type: Boolean, default: true }, disabled: Boolean, ...Tf(["ariaLabel"]) });
const Wv = ou({ ...Up, disabled: Boolean, trigger: { type: eu([String, Array]), default: "hover" }, triggerKeys: { type: eu(Array), default: () => [cu.enter, cu.space] } });
const { useModelToggleProps: Yv, useModelToggleEmits: Uv, useModelToggle: Kv } = zu("visible");
const qv = ou({ ...Tp, ...Yv, ...Hv, ...Wv, ...Vp, showArrow: { type: Boolean, default: true } });
const Gv = [...Uv, "before-show", "before-hide", "show", "hide", "open", "close"];
const Xv = (e2, t2) => {
if (wt(e2)) {
return e2.includes(t2);
}
return e2 === t2;
};
const Zv = (e2, t2, n2) => (o2) => {
Xv(vue.unref(e2), t2) && n2(o2);
};
const Jv = vue.defineComponent({ name: "ElTooltipTrigger" });
const Qv = vue.defineComponent({ ...Jv, props: Wv, setup(e2, { expose: n2 }) {
const o2 = e2;
const a2 = Vu("tooltip");
const { controlled: r2, id: l2, open: s2, onOpen: i2, onClose: c2, onToggle: d2 } = vue.inject(zv, void 0);
const f2 = vue.ref(null);
const m2 = () => {
if (vue.unref(r2) || o2.disabled) {
return true;
}
};
const h2 = vue.toRef(o2, "trigger");
const b2 = Ee(m2, Zv(h2, "hover", i2));
const g2 = Ee(m2, Zv(h2, "hover", c2));
const y2 = Ee(m2, Zv(h2, "click", (e3) => {
if (e3.button === 0) {
d2(e3);
}
}));
const w2 = Ee(m2, Zv(h2, "focus", i2));
const S2 = Ee(m2, Zv(h2, "focus", c2));
const C2 = Ee(m2, Zv(h2, "contextmenu", (e3) => {
e3.preventDefault();
d2(e3);
}));
const E2 = Ee(m2, (e3) => {
const { code: t2 } = e3;
if (o2.triggerKeys.includes(t2)) {
e3.preventDefault();
d2(e3);
}
});
n2({ triggerRef: f2 });
return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.unref(Gp), { id: vue.unref(l2), "virtual-ref": e3.virtualRef, open: vue.unref(s2), "virtual-triggering": e3.virtualTriggering, class: vue.normalizeClass(vue.unref(a2).e("trigger")), onBlur: vue.unref(S2), onClick: vue.unref(y2), onContextmenu: vue.unref(C2), onFocus: vue.unref(w2), onMouseenter: vue.unref(b2), onMouseleave: vue.unref(g2), onKeydown: vue.unref(E2) }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "virtual-ref", "open", "virtual-triggering", "class", "onBlur", "onClick", "onContextmenu", "onFocus", "onMouseenter", "onMouseleave", "onKeydown"]));
} });
var em = jf(Qv, [["__file", "trigger.vue"]]);
const tm = vue.defineComponent({ name: "ElTooltipContent", inheritAttrs: false });
const nm = vue.defineComponent({ ...tm, props: Hv, setup(e2, { expose: n2 }) {
const o2 = e2;
const { selector: a2 } = sf();
const r2 = Vu("tooltip");
const s2 = vue.ref(null);
const c2 = vue.ref(false);
const { controlled: d2, id: m2, open: h2, trigger: b2, onClose: g2, onOpen: y2, onShow: k2, onHide: S2, onBeforeShow: C2, onBeforeHide: E2 } = vue.inject(zv, void 0);
const M2 = vue.computed(() => o2.transition || `${r2.namespace.value}-fade-in-linear`);
const _2 = vue.computed(() => o2.persistent);
vue.onBeforeUnmount(() => {
c2.value = true;
});
const $2 = vue.computed(() => vue.unref(_2) ? true : vue.unref(h2));
const D2 = vue.computed(() => o2.disabled ? false : vue.unref(h2));
const R2 = vue.computed(() => o2.appendTo || a2.value);
const N2 = vue.computed(() => {
var e3;
return (e3 = o2.style) != null ? e3 : {};
});
const P2 = vue.computed(() => !vue.unref(h2));
const F2 = () => {
S2();
};
const j2 = () => {
if (vue.unref(d2)) return true;
};
const z2 = Ee(j2, () => {
if (o2.enterable && vue.unref(b2) === "hover") {
y2();
}
});
const H2 = Ee(j2, () => {
if (vue.unref(b2) === "hover") {
g2();
}
});
const W2 = () => {
var e3, t2;
(t2 = (e3 = s2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3);
C2 == null ? void 0 : C2();
};
const U2 = () => {
E2 == null ? void 0 : E2();
};
const K2 = () => {
k2();
G2 = Ze(vue.computed(() => {
var e3;
return (e3 = s2.value) == null ? void 0 : e3.popperContentRef;
}), () => {
if (vue.unref(d2)) return;
const e3 = vue.unref(b2);
if (e3 !== "hover") {
g2();
}
});
};
const q2 = () => {
if (!o2.virtualTriggering) {
g2();
}
};
let G2;
vue.watch(() => vue.unref(h2), (e3) => {
if (!e3) {
G2 == null ? void 0 : G2();
}
}, { flush: "post" });
vue.watch(() => o2.content, () => {
var e3, t2;
(t2 = (e3 = s2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3);
});
n2({ contentRef: s2 });
return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { disabled: !e3.teleported, to: vue.unref(R2) }, [vue.createVNode(vue.Transition, { name: vue.unref(M2), onAfterLeave: F2, onBeforeEnter: W2, onAfterEnter: K2, onBeforeLeave: U2 }, { default: vue.withCtx(() => [vue.unref($2) ? vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(Fv), vue.mergeProps({ key: 0, id: vue.unref(m2), ref_key: "contentRef", ref: s2 }, e3.$attrs, { "aria-label": e3.ariaLabel, "aria-hidden": vue.unref(P2), "boundaries-padding": e3.boundariesPadding, "fallback-placements": e3.fallbackPlacements, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, placement: e3.placement, "popper-options": e3.popperOptions, strategy: e3.strategy, effect: e3.effect, enterable: e3.enterable, pure: e3.pure, "popper-class": e3.popperClass, "popper-style": [e3.popperStyle, vue.unref(N2)], "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, visible: vue.unref(D2), "z-index": e3.zIndex, onMouseenter: vue.unref(z2), onMouseleave: vue.unref(H2), onBlur: q2, onClose: vue.unref(g2) }), { default: vue.withCtx(() => [!c2.value ? vue.renderSlot(e3.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true)]), _: 3 }, 16, ["id", "aria-label", "aria-hidden", "boundaries-padding", "fallback-placements", "gpu-acceleration", "offset", "placement", "popper-options", "strategy", "effect", "enterable", "pure", "popper-class", "popper-style", "reference-el", "trigger-target-el", "visible", "z-index", "onMouseenter", "onMouseleave", "onClose"])), [[vue.vShow, vue.unref(D2)]]) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["name"])], 8, ["disabled", "to"]));
} });
var om = jf(nm, [["__file", "content.vue"]]);
const am = ["innerHTML"];
const rm = { key: 1 };
const lm = vue.defineComponent({ name: "ElTooltip" });
const sm = vue.defineComponent({ ...lm, props: qv, emits: Gv, setup(e2, { expose: o2, emit: a2 }) {
const r2 = e2;
cf();
const s2 = nf();
const c2 = vue.ref();
const d2 = vue.ref();
const f2 = () => {
var e3;
const t2 = vue.unref(c2);
if (t2) {
(e3 = t2.popperInstanceRef) == null ? void 0 : e3.update();
}
};
const p2 = vue.ref(false);
const m2 = vue.ref();
const { show: h2, hide: b2, hasUpdateHandler: g2 } = Kv({ indicator: p2, toggleReason: m2 });
const { onOpen: w2, onClose: S2 } = ff({ showAfter: vue.toRef(r2, "showAfter"), hideAfter: vue.toRef(r2, "hideAfter"), autoClose: vue.toRef(r2, "autoClose"), open: h2, close: b2 });
const C2 = vue.computed(() => Xs(r2.visible) && !g2.value);
vue.provide(zv, { controlled: C2, id: s2, open: vue.readonly(p2), trigger: vue.toRef(r2, "trigger"), onOpen: (e3) => {
w2(e3);
}, onClose: (e3) => {
S2(e3);
}, onToggle: (e3) => {
if (vue.unref(p2)) {
S2(e3);
} else {
w2(e3);
}
}, onShow: () => {
a2("show", m2.value);
}, onHide: () => {
a2("hide", m2.value);
}, onBeforeShow: () => {
a2("before-show", m2.value);
}, onBeforeHide: () => {
a2("before-hide", m2.value);
}, updatePopper: f2 });
vue.watch(() => r2.disabled, (e3) => {
if (e3 && p2.value) {
p2.value = false;
}
});
const E2 = (e3) => {
var t2, n2;
const o3 = (n2 = (t2 = d2.value) == null ? void 0 : t2.contentRef) == null ? void 0 : n2.popperContentRef;
const a3 = (e3 == null ? void 0 : e3.relatedTarget) || document.activeElement;
return o3 && o3.contains(a3);
};
vue.onDeactivated(() => p2.value && b2());
o2({ popperRef: c2, contentRef: d2, isFocusInsideContent: E2, updatePopper: f2, onOpen: w2, onClose: S2, hide: b2 });
return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.unref(jv), { ref_key: "popperRef", ref: c2, role: e3.role }, { default: vue.withCtx(() => [vue.createVNode(em, { disabled: e3.disabled, trigger: e3.trigger, "trigger-keys": e3.triggerKeys, "virtual-ref": e3.virtualRef, "virtual-triggering": e3.virtualTriggering }, { default: vue.withCtx(() => [e3.$slots.default ? vue.renderSlot(e3.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["disabled", "trigger", "trigger-keys", "virtual-ref", "virtual-triggering"]), vue.createVNode(om, { ref_key: "contentRef", ref: d2, "aria-label": e3.ariaLabel, "boundaries-padding": e3.boundariesPadding, content: e3.content, disabled: e3.disabled, effect: e3.effect, enterable: e3.enterable, "fallback-placements": e3.fallbackPlacements, "hide-after": e3.hideAfter, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, persistent: e3.persistent, "popper-class": e3.popperClass, "popper-style": e3.popperStyle, placement: e3.placement, "popper-options": e3.popperOptions, pure: e3.pure, "raw-content": e3.rawContent, "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, "show-after": e3.showAfter, strategy: e3.strategy, teleported: e3.teleported, transition: e3.transition, "virtual-triggering": e3.virtualTriggering, "z-index": e3.zIndex, "append-to": e3.appendTo }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "content", {}, () => [e3.rawContent ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, innerHTML: e3.content }, null, 8, am)) : (vue.openBlock(), vue.createElementBlock("span", rm, vue.toDisplayString(e3.content), 1))]), e3.showArrow ? (vue.openBlock(), vue.createBlock(vue.unref(jp), { key: 0, "arrow-offset": e3.arrowOffset }, null, 8, ["arrow-offset"])) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["aria-label", "boundaries-padding", "content", "disabled", "effect", "enterable", "fallback-placements", "hide-after", "gpu-acceleration", "offset", "persistent", "popper-class", "popper-style", "placement", "popper-options", "pure", "raw-content", "reference-el", "trigger-target-el", "show-after", "strategy", "teleported", "transition", "virtual-triggering", "z-index", "append-to"])]), _: 3 }, 8, ["role"]));
} });
var im = jf(sm, [["__file", "tooltip.vue"]]);
const um = su(im);
const cm = Symbol("buttonGroupContextKey");
const dm = (e2, t2) => {
Eu({ from: "type.text", replacement: "link", version: "3.0.0", scope: "props", ref: "https://element-plus.org/en-US/component/button.html#button-attributes" }, vue.computed(() => e2.type === "text"));
const n2 = vue.inject(cm, void 0);
const o2 = If("button");
const { form: a2 } = Zf();
const r2 = Gf(vue.computed(() => n2 == null ? void 0 : n2.size));
const s2 = Xf();
const i2 = vue.ref();
const u2 = vue.useSlots();
const c2 = vue.computed(() => e2.type || (n2 == null ? void 0 : n2.type) || "");
const d2 = vue.computed(() => {
var t3, n3, a3;
return (a3 = (n3 = e2.autoInsertSpace) != null ? n3 : (t3 = o2.value) == null ? void 0 : t3.autoInsertSpace) != null ? a3 : false;
});
const f2 = vue.computed(() => {
if (e2.tag === "button") {
return { ariaDisabled: s2.value || e2.loading, disabled: s2.value || e2.loading, autofocus: e2.autofocus, type: e2.nativeType };
}
return {};
});
const m2 = vue.computed(() => {
var e3;
const t3 = (e3 = u2.default) == null ? void 0 : e3.call(u2);
if (d2.value && (t3 == null ? void 0 : t3.length) === 1) {
const e4 = t3[0];
if ((e4 == null ? void 0 : e4.type) === vue.Text) {
const t4 = e4.children;
return new RegExp("^\\p{Unified_Ideograph}{2}$", "u").test(t4.trim());
}
}
return false;
});
const h2 = (n3) => {
if (e2.nativeType === "reset") {
a2 == null ? void 0 : a2.resetFields();
}
t2("click", n3);
};
return { _disabled: s2, _size: r2, _type: c2, _ref: i2, _props: f2, shouldAddSpace: m2, handleClick: h2 };
};
const fm = ["default", "primary", "success", "warning", "info", "danger", "text", ""];
const pm = ["button", "submit", "reset"];
const vm = ou({ size: Ef, disabled: Boolean, type: { type: String, values: fm, default: "" }, icon: { type: au }, nativeType: { type: String, values: pm, default: "button" }, loading: Boolean, loadingIcon: { type: au, default: () => zi }, plain: Boolean, text: Boolean, link: Boolean, bg: Boolean, autofocus: Boolean, round: Boolean, circle: Boolean, color: String, dark: Boolean, autoInsertSpace: { type: Boolean, default: void 0 }, tag: { type: eu([String, Object]), default: "button" } });
const mm = { click: (e2) => e2 instanceof MouseEvent };
function hm(e2, t2) {
if (gm(e2)) {
e2 = "100%";
}
var n2 = ym(e2);
e2 = t2 === 360 ? e2 : Math.min(t2, Math.max(0, parseFloat(e2)));
if (n2) {
e2 = parseInt(String(e2 * t2), 10) / 100;
}
if (Math.abs(e2 - t2) < 1e-6) {
return 1;
}
if (t2 === 360) {
e2 = (e2 < 0 ? e2 % t2 + t2 : e2 % t2) / parseFloat(String(t2));
} else {
e2 = e2 % t2 / parseFloat(String(t2));
}
return e2;
}
function bm(e2) {
return Math.min(1, Math.max(0, e2));
}
function gm(e2) {
return typeof e2 === "string" && e2.indexOf(".") !== -1 && parseFloat(e2) === 1;
}
function ym(e2) {
return typeof e2 === "string" && e2.indexOf("%") !== -1;
}
function wm(e2) {
e2 = parseFloat(e2);
if (isNaN(e2) || e2 < 0 || e2 > 1) {
e2 = 1;
}
return e2;
}
function xm(e2) {
if (e2 <= 1) {
return "".concat(Number(e2) * 100, "%");
}
return e2;
}
function km(e2) {
return e2.length === 1 ? "0" + e2 : String(e2);
}
function Sm(e2, t2, n2) {
return { r: hm(e2, 255) * 255, g: hm(t2, 255) * 255, b: hm(n2, 255) * 255 };
}
function Cm(e2, t2, n2) {
e2 = hm(e2, 255);
t2 = hm(t2, 255);
n2 = hm(n2, 255);
var o2 = Math.max(e2, t2, n2);
var a2 = Math.min(e2, t2, n2);
var r2 = 0;
var l2 = 0;
var s2 = (o2 + a2) / 2;
if (o2 === a2) {
l2 = 0;
r2 = 0;
} else {
var i2 = o2 - a2;
l2 = s2 > 0.5 ? i2 / (2 - o2 - a2) : i2 / (o2 + a2);
switch (o2) {
case e2:
r2 = (t2 - n2) / i2 + (t2 < n2 ? 6 : 0);
break;
case t2:
r2 = (n2 - e2) / i2 + 2;
break;
case n2:
r2 = (e2 - t2) / i2 + 4;
break;
}
r2 /= 6;
}
return { h: r2, s: l2, l: s2 };
}
function Em(e2, t2, n2) {
if (n2 < 0) {
n2 += 1;
}
if (n2 > 1) {
n2 -= 1;
}
if (n2 < 1 / 6) {
return e2 + (t2 - e2) * (6 * n2);
}
if (n2 < 1 / 2) {
return t2;
}
if (n2 < 2 / 3) {
return e2 + (t2 - e2) * (2 / 3 - n2) * 6;
}
return e2;
}
function Mm(e2, t2, n2) {
var o2;
var a2;
var r2;
e2 = hm(e2, 360);
t2 = hm(t2, 100);
n2 = hm(n2, 100);
if (t2 === 0) {
a2 = n2;
r2 = n2;
o2 = n2;
} else {
var l2 = n2 < 0.5 ? n2 * (1 + t2) : n2 + t2 - n2 * t2;
var s2 = 2 * n2 - l2;
o2 = Em(s2, l2, e2 + 1 / 3);
a2 = Em(s2, l2, e2);
r2 = Em(s2, l2, e2 - 1 / 3);
}
return { r: o2 * 255, g: a2 * 255, b: r2 * 255 };
}
function Om(e2, t2, n2) {
e2 = hm(e2, 255);
t2 = hm(t2, 255);
n2 = hm(n2, 255);
var o2 = Math.max(e2, t2, n2);
var a2 = Math.min(e2, t2, n2);
var r2 = 0;
var l2 = o2;
var s2 = o2 - a2;
var i2 = o2 === 0 ? 0 : s2 / o2;
if (o2 === a2) {
r2 = 0;
} else {
switch (o2) {
case e2:
r2 = (t2 - n2) / s2 + (t2 < n2 ? 6 : 0);
break;
case t2:
r2 = (n2 - e2) / s2 + 2;
break;
case n2:
r2 = (e2 - t2) / s2 + 4;
break;
}
r2 /= 6;
}
return { h: r2, s: i2, v: l2 };
}
function _m(e2, t2, n2) {
e2 = hm(e2, 360) * 6;
t2 = hm(t2, 100);
n2 = hm(n2, 100);
var o2 = Math.floor(e2);
var a2 = e2 - o2;
var r2 = n2 * (1 - t2);
var l2 = n2 * (1 - a2 * t2);
var s2 = n2 * (1 - (1 - a2) * t2);
var i2 = o2 % 6;
var u2 = [n2, l2, r2, r2, s2, n2][i2];
var c2 = [s2, n2, n2, l2, r2, r2][i2];
var d2 = [r2, r2, s2, n2, n2, l2][i2];
return { r: u2 * 255, g: c2 * 255, b: d2 * 255 };
}
function $m(e2, t2, n2, o2) {
var a2 = [km(Math.round(e2).toString(16)), km(Math.round(t2).toString(16)), km(Math.round(n2).toString(16))];
if (o2 && a2[0].startsWith(a2[0].charAt(1)) && a2[1].startsWith(a2[1].charAt(1)) && a2[2].startsWith(a2[2].charAt(1))) {
return a2[0].charAt(0) + a2[1].charAt(0) + a2[2].charAt(0);
}
return a2.join("");
}
function Lm(e2, t2, n2, o2, a2) {
var r2 = [km(Math.round(e2).toString(16)), km(Math.round(t2).toString(16)), km(Math.round(n2).toString(16)), km(Am(o2))];
if (a2 && r2[0].startsWith(r2[0].charAt(1)) && r2[1].startsWith(r2[1].charAt(1)) && r2[2].startsWith(r2[2].charAt(1)) && r2[3].startsWith(r2[3].charAt(1))) {
return r2[0].charAt(0) + r2[1].charAt(0) + r2[2].charAt(0) + r2[3].charAt(0);
}
return r2.join("");
}
function Am(e2) {
return Math.round(parseFloat(e2) * 255).toString(16);
}
function Dm(e2) {
return Rm(e2) / 255;
}
function Rm(e2) {
return parseInt(e2, 16);
}
function Tm(e2) {
return { r: e2 >> 16, g: (e2 & 65280) >> 8, b: e2 & 255 };
}
var Nm = { aliceblue: "#f0f8ff", antiquewhite: "#faebd7", aqua: "#00ffff", aquamarine: "#7fffd4", azure: "#f0ffff", beige: "#f5f5dc", bisque: "#ffe4c4", black: "#000000", blanchedalmond: "#ffebcd", blue: "#0000ff", blueviolet: "#8a2be2", brown: "#a52a2a", burlywood: "#deb887", cadetblue: "#5f9ea0", chartreuse: "#7fff00", chocolate: "#d2691e", coral: "#ff7f50", cornflowerblue: "#6495ed", cornsilk: "#fff8dc", crimson: "#dc143c", cyan: "#00ffff", darkblue: "#00008b", darkcyan: "#008b8b", darkgoldenrod: "#b8860b", darkgray: "#a9a9a9", darkgreen: "#006400", darkgrey: "#a9a9a9", darkkhaki: "#bdb76b", darkmagenta: "#8b008b", darkolivegreen: "#556b2f", darkorange: "#ff8c00", darkorchid: "#9932cc", darkred: "#8b0000", darksalmon: "#e9967a", darkseagreen: "#8fbc8f", darkslateblue: "#483d8b", darkslategray: "#2f4f4f", darkslategrey: "#2f4f4f", darkturquoise: "#00ced1", darkviolet: "#9400d3", deeppink: "#ff1493", deepskyblue: "#00bfff", dimgray: "#696969", dimgrey: "#696969", dodgerblue: "#1e90ff", firebrick: "#b22222", floralwhite: "#fffaf0", forestgreen: "#228b22", fuchsia: "#ff00ff", gainsboro: "#dcdcdc", ghostwhite: "#f8f8ff", goldenrod: "#daa520", gold: "#ffd700", gray: "#808080", green: "#008000", greenyellow: "#adff2f", grey: "#808080", honeydew: "#f0fff0", hotpink: "#ff69b4", indianred: "#cd5c5c", indigo: "#4b0082", ivory: "#fffff0", khaki: "#f0e68c", lavenderblush: "#fff0f5", lavender: "#e6e6fa", lawngreen: "#7cfc00", lemonchiffon: "#fffacd", lightblue: "#add8e6", lightcoral: "#f08080", lightcyan: "#e0ffff", lightgoldenrodyellow: "#fafad2", lightgray: "#d3d3d3", lightgreen: "#90ee90", lightgrey: "#d3d3d3", lightpink: "#ffb6c1", lightsalmon: "#ffa07a", lightseagreen: "#20b2aa", lightskyblue: "#87cefa", lightslategray: "#778899", lightslategrey: "#778899", lightsteelblue: "#b0c4de", lightyellow: "#ffffe0", lime: "#00ff00", limegreen: "#32cd32", linen: "#faf0e6", magenta: "#ff00ff", maroon: "#800000", mediumaquamarine: "#66cdaa", mediumblue: "#0000cd", mediumorchid: "#ba55d3", mediumpurple: "#9370db", mediumseagreen: "#3cb371", mediumslateblue: "#7b68ee", mediumspringgreen: "#00fa9a", mediumturquoise: "#48d1cc", mediumvioletred: "#c71585", midnightblue: "#191970", mintcream: "#f5fffa", mistyrose: "#ffe4e1", moccasin: "#ffe4b5", navajowhite: "#ffdead", navy: "#000080", oldlace: "#fdf5e6", olive: "#808000", olivedrab: "#6b8e23", orange: "#ffa500", orangered: "#ff4500", orchid: "#da70d6", palegoldenrod: "#eee8aa", palegreen: "#98fb98", paleturquoise: "#afeeee", palevioletred: "#db7093", papayawhip: "#ffefd5", peachpuff: "#ffdab9", peru: "#cd853f", pink: "#ffc0cb", plum: "#dda0dd", powderblue: "#b0e0e6", purple: "#800080", rebeccapurple: "#663399", red: "#ff0000", rosybrown: "#bc8f8f", royalblue: "#4169e1", saddlebrown: "#8b4513", salmon: "#fa8072", sandybrown: "#f4a460", seagreen: "#2e8b57", seashell: "#fff5ee", sienna: "#a0522d", silver: "#c0c0c0", skyblue: "#87ceeb", slateblue: "#6a5acd", slategray: "#708090", slategrey: "#708090", snow: "#fffafa", springgreen: "#00ff7f", steelblue: "#4682b4", tan: "#d2b48c", teal: "#008080", thistle: "#d8bfd8", tomato: "#ff6347", turquoise: "#40e0d0", violet: "#ee82ee", wheat: "#f5deb3", white: "#ffffff", whitesmoke: "#f5f5f5", yellow: "#ffff00", yellowgreen: "#9acd32" };
function Pm(e2) {
var t2 = { r: 0, g: 0, b: 0 };
var n2 = 1;
var o2 = null;
var a2 = null;
var r2 = null;
var l2 = false;
var s2 = false;
if (typeof e2 === "string") {
e2 = Hm(e2);
}
if (typeof e2 === "object") {
if (Wm(e2.r) && Wm(e2.g) && Wm(e2.b)) {
t2 = Sm(e2.r, e2.g, e2.b);
l2 = true;
s2 = String(e2.r).substr(-1) === "%" ? "prgb" : "rgb";
} else if (Wm(e2.h) && Wm(e2.s) && Wm(e2.v)) {
o2 = xm(e2.s);
a2 = xm(e2.v);
t2 = _m(e2.h, o2, a2);
l2 = true;
s2 = "hsv";
} else if (Wm(e2.h) && Wm(e2.s) && Wm(e2.l)) {
o2 = xm(e2.s);
r2 = xm(e2.l);
t2 = Mm(e2.h, o2, r2);
l2 = true;
s2 = "hsl";
}
if (Object.prototype.hasOwnProperty.call(e2, "a")) {
n2 = e2.a;
}
}
n2 = wm(n2);
return { ok: l2, format: e2.format || s2, r: Math.min(255, Math.max(t2.r, 0)), g: Math.min(255, Math.max(t2.g, 0)), b: Math.min(255, Math.max(t2.b, 0)), a: n2 };
}
var Im = "[-\\+]?\\d+%?";
var Vm = "[-\\+]?\\d*\\.\\d+%?";
var Bm = "(?:".concat(Vm, ")|(?:").concat(Im, ")");
var Fm = "[\\s|\\(]+(".concat(Bm, ")[,|\\s]+(").concat(Bm, ")[,|\\s]+(").concat(Bm, ")\\s*\\)?");
var jm = "[\\s|\\(]+(".concat(Bm, ")[,|\\s]+(").concat(Bm, ")[,|\\s]+(").concat(Bm, ")[,|\\s]+(").concat(Bm, ")\\s*\\)?");
var zm = { CSS_UNIT: new RegExp(Bm), rgb: new RegExp("rgb" + Fm), rgba: new RegExp("rgba" + jm), hsl: new RegExp("hsl" + Fm), hsla: new RegExp("hsla" + jm), hsv: new RegExp("hsv" + Fm), hsva: new RegExp("hsva" + jm), hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/, hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/ };
function Hm(e2) {
e2 = e2.trim().toLowerCase();
if (e2.length === 0) {
return false;
}
var t2 = false;
if (Nm[e2]) {
e2 = Nm[e2];
t2 = true;
} else if (e2 === "transparent") {
return { r: 0, g: 0, b: 0, a: 0, format: "name" };
}
var n2 = zm.rgb.exec(e2);
if (n2) {
return { r: n2[1], g: n2[2], b: n2[3] };
}
n2 = zm.rgba.exec(e2);
if (n2) {
return { r: n2[1], g: n2[2], b: n2[3], a: n2[4] };
}
n2 = zm.hsl.exec(e2);
if (n2) {
return { h: n2[1], s: n2[2], l: n2[3] };
}
n2 = zm.hsla.exec(e2);
if (n2) {
return { h: n2[1], s: n2[2], l: n2[3], a: n2[4] };
}
n2 = zm.hsv.exec(e2);
if (n2) {
return { h: n2[1], s: n2[2], v: n2[3] };
}
n2 = zm.hsva.exec(e2);
if (n2) {
return { h: n2[1], s: n2[2], v: n2[3], a: n2[4] };
}
n2 = zm.hex8.exec(e2);
if (n2) {
return { r: Rm(n2[1]), g: Rm(n2[2]), b: Rm(n2[3]), a: Dm(n2[4]), format: t2 ? "name" : "hex8" };
}
n2 = zm.hex6.exec(e2);
if (n2) {
return { r: Rm(n2[1]), g: Rm(n2[2]), b: Rm(n2[3]), format: t2 ? "name" : "hex" };
}
n2 = zm.hex4.exec(e2);
if (n2) {
return { r: Rm(n2[1] + n2[1]), g: Rm(n2[2] + n2[2]), b: Rm(n2[3] + n2[3]), a: Dm(n2[4] + n2[4]), format: t2 ? "name" : "hex8" };
}
n2 = zm.hex3.exec(e2);
if (n2) {
return { r: Rm(n2[1] + n2[1]), g: Rm(n2[2] + n2[2]), b: Rm(n2[3] + n2[3]), format: t2 ? "name" : "hex" };
}
return false;
}
function Wm(e2) {
return Boolean(zm.CSS_UNIT.exec(String(e2)));
}
var Ym = function() {
function e2(t2, n2) {
if (t2 === void 0) {
t2 = "";
}
if (n2 === void 0) {
n2 = {};
}
var o2;
if (t2 instanceof e2) {
return t2;
}
if (typeof t2 === "number") {
t2 = Tm(t2);
}
this.originalInput = t2;
var a2 = Pm(t2);
this.originalInput = t2;
this.r = a2.r;
this.g = a2.g;
this.b = a2.b;
this.a = a2.a;
this.roundA = Math.round(100 * this.a) / 100;
this.format = (o2 = n2.format) !== null && o2 !== void 0 ? o2 : a2.format;
this.gradientType = n2.gradientType;
if (this.r < 1) {
this.r = Math.round(this.r);
}
if (this.g < 1) {
this.g = Math.round(this.g);
}
if (this.b < 1) {
this.b = Math.round(this.b);
}
this.isValid = a2.ok;
}
e2.prototype.isDark = function() {
return this.getBrightness() < 128;
};
e2.prototype.isLight = function() {
return !this.isDark();
};
e2.prototype.getBrightness = function() {
var e3 = this.toRgb();
return (e3.r * 299 + e3.g * 587 + e3.b * 114) / 1e3;
};
e2.prototype.getLuminance = function() {
var e3 = this.toRgb();
var t2;
var n2;
var o2;
var a2 = e3.r / 255;
var r2 = e3.g / 255;
var l2 = e3.b / 255;
if (a2 <= 0.03928) {
t2 = a2 / 12.92;
} else {
t2 = Math.pow((a2 + 0.055) / 1.055, 2.4);
}
if (r2 <= 0.03928) {
n2 = r2 / 12.92;
} else {
n2 = Math.pow((r2 + 0.055) / 1.055, 2.4);
}
if (l2 <= 0.03928) {
o2 = l2 / 12.92;
} else {
o2 = Math.pow((l2 + 0.055) / 1.055, 2.4);
}
return 0.2126 * t2 + 0.7152 * n2 + 0.0722 * o2;
};
e2.prototype.getAlpha = function() {
return this.a;
};
e2.prototype.setAlpha = function(e3) {
this.a = wm(e3);
this.roundA = Math.round(100 * this.a) / 100;
return this;
};
e2.prototype.isMonochrome = function() {
var e3 = this.toHsl().s;
return e3 === 0;
};
e2.prototype.toHsv = function() {
var e3 = Om(this.r, this.g, this.b);
return { h: e3.h * 360, s: e3.s, v: e3.v, a: this.a };
};
e2.prototype.toHsvString = function() {
var e3 = Om(this.r, this.g, this.b);
var t2 = Math.round(e3.h * 360);
var n2 = Math.round(e3.s * 100);
var o2 = Math.round(e3.v * 100);
return this.a === 1 ? "hsv(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%)") : "hsva(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%, ").concat(this.roundA, ")");
};
e2.prototype.toHsl = function() {
var e3 = Cm(this.r, this.g, this.b);
return { h: e3.h * 360, s: e3.s, l: e3.l, a: this.a };
};
e2.prototype.toHslString = function() {
var e3 = Cm(this.r, this.g, this.b);
var t2 = Math.round(e3.h * 360);
var n2 = Math.round(e3.s * 100);
var o2 = Math.round(e3.l * 100);
return this.a === 1 ? "hsl(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%)") : "hsla(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%, ").concat(this.roundA, ")");
};
e2.prototype.toHex = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return $m(this.r, this.g, this.b, e3);
};
e2.prototype.toHexString = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return "#" + this.toHex(e3);
};
e2.prototype.toHex8 = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return Lm(this.r, this.g, this.b, this.a, e3);
};
e2.prototype.toHex8String = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return "#" + this.toHex8(e3);
};
e2.prototype.toHexShortString = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return this.a === 1 ? this.toHexString(e3) : this.toHex8String(e3);
};
e2.prototype.toRgb = function() {
return { r: Math.round(this.r), g: Math.round(this.g), b: Math.round(this.b), a: this.a };
};
e2.prototype.toRgbString = function() {
var e3 = Math.round(this.r);
var t2 = Math.round(this.g);
var n2 = Math.round(this.b);
return this.a === 1 ? "rgb(".concat(e3, ", ").concat(t2, ", ").concat(n2, ")") : "rgba(".concat(e3, ", ").concat(t2, ", ").concat(n2, ", ").concat(this.roundA, ")");
};
e2.prototype.toPercentageRgb = function() {
var e3 = function(e4) {
return "".concat(Math.round(hm(e4, 255) * 100), "%");
};
return { r: e3(this.r), g: e3(this.g), b: e3(this.b), a: this.a };
};
e2.prototype.toPercentageRgbString = function() {
var e3 = function(e4) {
return Math.round(hm(e4, 255) * 100);
};
return this.a === 1 ? "rgb(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%)") : "rgba(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%, ").concat(this.roundA, ")");
};
e2.prototype.toName = function() {
if (this.a === 0) {
return "transparent";
}
if (this.a < 1) {
return false;
}
var e3 = "#" + $m(this.r, this.g, this.b, false);
for (var t2 = 0, n2 = Object.entries(Nm); t2 < n2.length; t2++) {
var o2 = n2[t2], a2 = o2[0], r2 = o2[1];
if (e3 === r2) {
return a2;
}
}
return false;
};
e2.prototype.toString = function(e3) {
var t2 = Boolean(e3);
e3 = e3 !== null && e3 !== void 0 ? e3 : this.format;
var n2 = false;
var o2 = this.a < 1 && this.a >= 0;
var a2 = !t2 && o2 && (e3.startsWith("hex") || e3 === "name");
if (a2) {
if (e3 === "name" && this.a === 0) {
return this.toName();
}
return this.toRgbString();
}
if (e3 === "rgb") {
n2 = this.toRgbString();
}
if (e3 === "prgb") {
n2 = this.toPercentageRgbString();
}
if (e3 === "hex" || e3 === "hex6") {
n2 = this.toHexString();
}
if (e3 === "hex3") {
n2 = this.toHexString(true);
}
if (e3 === "hex4") {
n2 = this.toHex8String(true);
}
if (e3 === "hex8") {
n2 = this.toHex8String();
}
if (e3 === "name") {
n2 = this.toName();
}
if (e3 === "hsl") {
n2 = this.toHslString();
}
if (e3 === "hsv") {
n2 = this.toHsvString();
}
return n2 || this.toHexString();
};
e2.prototype.toNumber = function() {
return (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b);
};
e2.prototype.clone = function() {
return new e2(this.toString());
};
e2.prototype.lighten = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toHsl();
n2.l += t2 / 100;
n2.l = bm(n2.l);
return new e2(n2);
};
e2.prototype.brighten = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toRgb();
n2.r = Math.max(0, Math.min(255, n2.r - Math.round(255 * -(t2 / 100))));
n2.g = Math.max(0, Math.min(255, n2.g - Math.round(255 * -(t2 / 100))));
n2.b = Math.max(0, Math.min(255, n2.b - Math.round(255 * -(t2 / 100))));
return new e2(n2);
};
e2.prototype.darken = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toHsl();
n2.l -= t2 / 100;
n2.l = bm(n2.l);
return new e2(n2);
};
e2.prototype.tint = function(e3) {
if (e3 === void 0) {
e3 = 10;
}
return this.mix("white", e3);
};
e2.prototype.shade = function(e3) {
if (e3 === void 0) {
e3 = 10;
}
return this.mix("black", e3);
};
e2.prototype.desaturate = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toHsl();
n2.s -= t2 / 100;
n2.s = bm(n2.s);
return new e2(n2);
};
e2.prototype.saturate = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toHsl();
n2.s += t2 / 100;
n2.s = bm(n2.s);
return new e2(n2);
};
e2.prototype.greyscale = function() {
return this.desaturate(100);
};
e2.prototype.spin = function(t2) {
var n2 = this.toHsl();
var o2 = (n2.h + t2) % 360;
n2.h = o2 < 0 ? 360 + o2 : o2;
return new e2(n2);
};
e2.prototype.mix = function(t2, n2) {
if (n2 === void 0) {
n2 = 50;
}
var o2 = this.toRgb();
var a2 = new e2(t2).toRgb();
var r2 = n2 / 100;
var l2 = { r: (a2.r - o2.r) * r2 + o2.r, g: (a2.g - o2.g) * r2 + o2.g, b: (a2.b - o2.b) * r2 + o2.b, a: (a2.a - o2.a) * r2 + o2.a };
return new e2(l2);
};
e2.prototype.analogous = function(t2, n2) {
if (t2 === void 0) {
t2 = 6;
}
if (n2 === void 0) {
n2 = 30;
}
var o2 = this.toHsl();
var a2 = 360 / n2;
var r2 = [this];
for (o2.h = (o2.h - (a2 * t2 >> 1) + 720) % 360; --t2; ) {
o2.h = (o2.h + a2) % 360;
r2.push(new e2(o2));
}
return r2;
};
e2.prototype.complement = function() {
var t2 = this.toHsl();
t2.h = (t2.h + 180) % 360;
return new e2(t2);
};
e2.prototype.monochromatic = function(t2) {
if (t2 === void 0) {
t2 = 6;
}
var n2 = this.toHsv();
var o2 = n2.h;
var a2 = n2.s;
var r2 = n2.v;
var l2 = [];
var s2 = 1 / t2;
while (t2--) {
l2.push(new e2({ h: o2, s: a2, v: r2 }));
r2 = (r2 + s2) % 1;
}
return l2;
};
e2.prototype.splitcomplement = function() {
var t2 = this.toHsl();
var n2 = t2.h;
return [this, new e2({ h: (n2 + 72) % 360, s: t2.s, l: t2.l }), new e2({ h: (n2 + 216) % 360, s: t2.s, l: t2.l })];
};
e2.prototype.onBackground = function(t2) {
var n2 = this.toRgb();
var o2 = new e2(t2).toRgb();
var a2 = n2.a + o2.a * (1 - n2.a);
return new e2({ r: (n2.r * n2.a + o2.r * o2.a * (1 - n2.a)) / a2, g: (n2.g * n2.a + o2.g * o2.a * (1 - n2.a)) / a2, b: (n2.b * n2.a + o2.b * o2.a * (1 - n2.a)) / a2, a: a2 });
};
e2.prototype.triad = function() {
return this.polyad(3);
};
e2.prototype.tetrad = function() {
return this.polyad(4);
};
e2.prototype.polyad = function(t2) {
var n2 = this.toHsl();
var o2 = n2.h;
var a2 = [this];
var r2 = 360 / t2;
for (var l2 = 1; l2 < t2; l2++) {
a2.push(new e2({ h: (o2 + l2 * r2) % 360, s: n2.s, l: n2.l }));
}
return a2;
};
e2.prototype.equals = function(t2) {
return this.toRgbString() === new e2(t2).toRgbString();
};
return e2;
}();
function Um(e2, t2 = 20) {
return e2.mix("#141414", t2).toString();
}
function Km(e2) {
const t2 = Xf();
const n2 = Vu("button");
return vue.computed(() => {
let o2 = {};
let a2 = e2.color;
if (a2) {
const r2 = a2.match(/var\((.*?)\)/);
if (r2) {
a2 = window.getComputedStyle(window.document.documentElement).getPropertyValue(r2[1]);
}
const l2 = new Ym(a2);
const s2 = e2.dark ? l2.tint(20).toString() : Um(l2, 20);
if (e2.plain) {
o2 = n2.cssVarBlock({ "bg-color": e2.dark ? Um(l2, 90) : l2.tint(90).toString(), "text-color": a2, "border-color": e2.dark ? Um(l2, 50) : l2.tint(50).toString(), "hover-text-color": `var(${n2.cssVarName("color-white")})`, "hover-bg-color": a2, "hover-border-color": a2, "active-bg-color": s2, "active-text-color": `var(${n2.cssVarName("color-white")})`, "active-border-color": s2 });
if (t2.value) {
o2[n2.cssVarBlockName("disabled-bg-color")] = e2.dark ? Um(l2, 90) : l2.tint(90).toString();
o2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? Um(l2, 50) : l2.tint(50).toString();
o2[n2.cssVarBlockName("disabled-border-color")] = e2.dark ? Um(l2, 80) : l2.tint(80).toString();
}
} else {
const r3 = e2.dark ? Um(l2, 30) : l2.tint(30).toString();
const i2 = l2.isDark() ? `var(${n2.cssVarName("color-white")})` : `var(${n2.cssVarName("color-black")})`;
o2 = n2.cssVarBlock({ "bg-color": a2, "text-color": i2, "border-color": a2, "hover-bg-color": r3, "hover-text-color": i2, "hover-border-color": r3, "active-bg-color": s2, "active-border-color": s2 });
if (t2.value) {
const t3 = e2.dark ? Um(l2, 50) : l2.tint(50).toString();
o2[n2.cssVarBlockName("disabled-bg-color")] = t3;
o2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? "rgba(255, 255, 255, 0.5)" : `var(${n2.cssVarName("color-white")})`;
o2[n2.cssVarBlockName("disabled-border-color")] = t3;
}
}
}
return o2;
});
}
const qm = vue.defineComponent({ name: "ElButton" });
const Gm = vue.defineComponent({ ...qm, props: vm, emits: mm, setup(e2, { expose: o2, emit: a2 }) {
const r2 = e2;
const s2 = Km(r2);
const i2 = Vu("button");
const { _ref: c2, _size: d2, _type: f2, _disabled: p2, _props: v2, shouldAddSpace: m2, handleClick: h2 } = dm(r2, a2);
const b2 = vue.computed(() => [i2.b(), i2.m(f2.value), i2.m(d2.value), i2.is("disabled", p2.value), i2.is("loading", r2.loading), i2.is("plain", r2.plain), i2.is("round", r2.round), i2.is("circle", r2.circle), i2.is("text", r2.text), i2.is("link", r2.link), i2.is("has-bg", r2.bg)]);
o2({ ref: c2, size: d2, type: f2, disabled: p2, shouldAddSpace: m2 });
return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), vue.mergeProps({ ref_key: "_ref", ref: c2 }, vue.unref(v2), { class: vue.unref(b2), style: vue.unref(s2), onClick: vue.unref(h2) }), { default: vue.withCtx(() => [e3.loading ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [e3.$slots.loading ? vue.renderSlot(e3.$slots, "loading", { key: 0 }) : (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 1, class: vue.normalizeClass(vue.unref(i2).is("loading")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.loadingIcon)))]), _: 1 }, 8, ["class"]))], 64)) : e3.icon || e3.$slots.icon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 1 }, { default: vue.withCtx(() => [e3.icon ? (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.icon), { key: 0 })) : vue.renderSlot(e3.$slots, "icon", { key: 1 })]), _: 3 })) : vue.createCommentVNode("v-if", true), e3.$slots.default ? (vue.openBlock(), vue.createElementBlock("span", { key: 2, class: vue.normalizeClass({ [vue.unref(i2).em("text", "expand")]: vue.unref(m2) }) }, [vue.renderSlot(e3.$slots, "default")], 2)) : vue.createCommentVNode("v-if", true)]), _: 3 }, 16, ["class", "style", "onClick"]));
} });
var Xm = jf(Gm, [["__file", "button.vue"]]);
const Zm = { size: vm.size, type: vm.type };
const Jm = vue.defineComponent({ name: "ElButtonGroup" });
const Qm = vue.defineComponent({ ...Jm, props: Zm, setup(e2) {
const o2 = e2;
vue.provide(cm, vue.reactive({ size: vue.toRef(o2, "size"), type: vue.toRef(o2, "type") }));
const a2 = Vu("button");
return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(vue.unref(a2).b("group")) }, [vue.renderSlot(e3.$slots, "default")], 2));
} });
var eh = jf(Qm, [["__file", "button-group.vue"]]);
const th = su(Xm, { ButtonGroup: eh });
iu(eh);
var nh = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
function oh(e2) {
return e2 && e2.__esModule && Object.prototype.hasOwnProperty.call(e2, "default") ? e2["default"] : e2;
}
var ah = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
var e3 = 1e3, t3 = 6e4, n2 = 36e5, o2 = "millisecond", a2 = "second", r2 = "minute", l2 = "hour", s2 = "day", i2 = "week", u2 = "month", c2 = "quarter", d2 = "year", f2 = "date", p2 = "Invalid Date", v2 = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, m2 = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, h2 = { name: "en", weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), ordinal: function(e4) {
var t4 = ["th", "st", "nd", "rd"], n3 = e4 % 100;
return "[" + e4 + (t4[(n3 - 20) % 10] || t4[n3] || t4[0]) + "]";
} }, b2 = function(e4, t4, n3) {
var o3 = String(e4);
return !o3 || o3.length >= t4 ? e4 : "" + Array(t4 + 1 - o3.length).join(n3) + e4;
}, g2 = { s: b2, z: function(e4) {
var t4 = -e4.utcOffset(), n3 = Math.abs(t4), o3 = Math.floor(n3 / 60), a3 = n3 % 60;
return (t4 <= 0 ? "+" : "-") + b2(o3, 2, "0") + ":" + b2(a3, 2, "0");
}, m: function e4(t4, n3) {
if (t4.date() < n3.date()) return -e4(n3, t4);
var o3 = 12 * (n3.year() - t4.year()) + (n3.month() - t4.month()), a3 = t4.clone().add(o3, u2), r3 = n3 - a3 < 0, l3 = t4.clone().add(o3 + (r3 ? -1 : 1), u2);
return +(-(o3 + (n3 - a3) / (r3 ? a3 - l3 : l3 - a3)) || 0);
}, a: function(e4) {
return e4 < 0 ? Math.ceil(e4) || 0 : Math.floor(e4);
}, p: function(e4) {
return { M: u2, y: d2, w: i2, d: s2, D: f2, h: l2, m: r2, s: a2, ms: o2, Q: c2 }[e4] || String(e4 || "").toLowerCase().replace(/s$/, "");
}, u: function(e4) {
return void 0 === e4;
} }, y2 = "en", w2 = {};
w2[y2] = h2;
var x2 = "$isDayjsObject", k2 = function(e4) {
return e4 instanceof M2 || !(!e4 || !e4[x2]);
}, S2 = function e4(t4, n3, o3) {
var a3;
if (!t4) return y2;
if ("string" == typeof t4) {
var r3 = t4.toLowerCase();
w2[r3] && (a3 = r3), n3 && (w2[r3] = n3, a3 = r3);
var l3 = t4.split("-");
if (!a3 && l3.length > 1) return e4(l3[0]);
} else {
var s3 = t4.name;
w2[s3] = t4, a3 = s3;
}
return !o3 && a3 && (y2 = a3), a3 || !o3 && y2;
}, C2 = function(e4, t4) {
if (k2(e4)) return e4.clone();
var n3 = "object" == typeof t4 ? t4 : {};
return n3.date = e4, n3.args = arguments, new M2(n3);
}, E2 = g2;
E2.l = S2, E2.i = k2, E2.w = function(e4, t4) {
return C2(e4, { locale: t4.$L, utc: t4.$u, x: t4.$x, $offset: t4.$offset });
};
var M2 = function() {
function h3(e4) {
this.$L = S2(e4.locale, null, true), this.parse(e4), this.$x = this.$x || e4.x || {}, this[x2] = true;
}
var b3 = h3.prototype;
return b3.parse = function(e4) {
this.$d = function(e5) {
var t4 = e5.date, n3 = e5.utc;
if (null === t4) return /* @__PURE__ */ new Date(NaN);
if (E2.u(t4)) return /* @__PURE__ */ new Date();
if (t4 instanceof Date) return new Date(t4);
if ("string" == typeof t4 && !/Z$/i.test(t4)) {
var o3 = t4.match(v2);
if (o3) {
var a3 = o3[2] - 1 || 0, r3 = (o3[7] || "0").substring(0, 3);
return n3 ? new Date(Date.UTC(o3[1], a3, o3[3] || 1, o3[4] || 0, o3[5] || 0, o3[6] || 0, r3)) : new Date(o3[1], a3, o3[3] || 1, o3[4] || 0, o3[5] || 0, o3[6] || 0, r3);
}
}
return new Date(t4);
}(e4), this.init();
}, b3.init = function() {
var e4 = this.$d;
this.$y = e4.getFullYear(), this.$M = e4.getMonth(), this.$D = e4.getDate(), this.$W = e4.getDay(), this.$H = e4.getHours(), this.$m = e4.getMinutes(), this.$s = e4.getSeconds(), this.$ms = e4.getMilliseconds();
}, b3.$utils = function() {
return E2;
}, b3.isValid = function() {
return !(this.$d.toString() === p2);
}, b3.isSame = function(e4, t4) {
var n3 = C2(e4);
return this.startOf(t4) <= n3 && n3 <= this.endOf(t4);
}, b3.isAfter = function(e4, t4) {
return C2(e4) < this.startOf(t4);
}, b3.isBefore = function(e4, t4) {
return this.endOf(t4) < C2(e4);
}, b3.$g = function(e4, t4, n3) {
return E2.u(e4) ? this[t4] : this.set(n3, e4);
}, b3.unix = function() {
return Math.floor(this.valueOf() / 1e3);
}, b3.valueOf = function() {
return this.$d.getTime();
}, b3.startOf = function(e4, t4) {
var n3 = this, o3 = !!E2.u(t4) || t4, c3 = E2.p(e4), p3 = function(e5, t5) {
var a3 = E2.w(n3.$u ? Date.UTC(n3.$y, t5, e5) : new Date(n3.$y, t5, e5), n3);
return o3 ? a3 : a3.endOf(s2);
}, v3 = function(e5, t5) {
return E2.w(n3.toDate()[e5].apply(n3.toDate("s"), (o3 ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(t5)), n3);
}, m3 = this.$W, h4 = this.$M, b4 = this.$D, g3 = "set" + (this.$u ? "UTC" : "");
switch (c3) {
case d2:
return o3 ? p3(1, 0) : p3(31, 11);
case u2:
return o3 ? p3(1, h4) : p3(0, h4 + 1);
case i2:
var y3 = this.$locale().weekStart || 0, w3 = (m3 < y3 ? m3 + 7 : m3) - y3;
return p3(o3 ? b4 - w3 : b4 + (6 - w3), h4);
case s2:
case f2:
return v3(g3 + "Hours", 0);
case l2:
return v3(g3 + "Minutes", 1);
case r2:
return v3(g3 + "Seconds", 2);
case a2:
return v3(g3 + "Milliseconds", 3);
default:
return this.clone();
}
}, b3.endOf = function(e4) {
return this.startOf(e4, false);
}, b3.$set = function(e4, t4) {
var n3, i3 = E2.p(e4), c3 = "set" + (this.$u ? "UTC" : ""), p3 = (n3 = {}, n3[s2] = c3 + "Date", n3[f2] = c3 + "Date", n3[u2] = c3 + "Month", n3[d2] = c3 + "FullYear", n3[l2] = c3 + "Hours", n3[r2] = c3 + "Minutes", n3[a2] = c3 + "Seconds", n3[o2] = c3 + "Milliseconds", n3)[i3], v3 = i3 === s2 ? this.$D + (t4 - this.$W) : t4;
if (i3 === u2 || i3 === d2) {
var m3 = this.clone().set(f2, 1);
m3.$d[p3](v3), m3.init(), this.$d = m3.set(f2, Math.min(this.$D, m3.daysInMonth())).$d;
} else p3 && this.$d[p3](v3);
return this.init(), this;
}, b3.set = function(e4, t4) {
return this.clone().$set(e4, t4);
}, b3.get = function(e4) {
return this[E2.p(e4)]();
}, b3.add = function(o3, c3) {
var f3, p3 = this;
o3 = Number(o3);
var v3 = E2.p(c3), m3 = function(e4) {
var t4 = C2(p3);
return E2.w(t4.date(t4.date() + Math.round(e4 * o3)), p3);
};
if (v3 === u2) return this.set(u2, this.$M + o3);
if (v3 === d2) return this.set(d2, this.$y + o3);
if (v3 === s2) return m3(1);
if (v3 === i2) return m3(7);
var h4 = (f3 = {}, f3[r2] = t3, f3[l2] = n2, f3[a2] = e3, f3)[v3] || 1, b4 = this.$d.getTime() + o3 * h4;
return E2.w(b4, this);
}, b3.subtract = function(e4, t4) {
return this.add(-1 * e4, t4);
}, b3.format = function(e4) {
var t4 = this, n3 = this.$locale();
if (!this.isValid()) return n3.invalidDate || p2;
var o3 = e4 || "YYYY-MM-DDTHH:mm:ssZ", a3 = E2.z(this), r3 = this.$H, l3 = this.$m, s3 = this.$M, i3 = n3.weekdays, u3 = n3.months, c3 = n3.meridiem, d3 = function(e5, n4, a4, r4) {
return e5 && (e5[n4] || e5(t4, o3)) || a4[n4].slice(0, r4);
}, f3 = function(e5) {
return E2.s(r3 % 12 || 12, e5, "0");
}, v3 = c3 || function(e5, t5, n4) {
var o4 = e5 < 12 ? "AM" : "PM";
return n4 ? o4.toLowerCase() : o4;
};
return o3.replace(m2, function(e5, o4) {
return o4 || function(e6) {
switch (e6) {
case "YY":
return String(t4.$y).slice(-2);
case "YYYY":
return E2.s(t4.$y, 4, "0");
case "M":
return s3 + 1;
case "MM":
return E2.s(s3 + 1, 2, "0");
case "MMM":
return d3(n3.monthsShort, s3, u3, 3);
case "MMMM":
return d3(u3, s3);
case "D":
return t4.$D;
case "DD":
return E2.s(t4.$D, 2, "0");
case "d":
return String(t4.$W);
case "dd":
return d3(n3.weekdaysMin, t4.$W, i3, 2);
case "ddd":
return d3(n3.weekdaysShort, t4.$W, i3, 3);
case "dddd":
return i3[t4.$W];
case "H":
return String(r3);
case "HH":
return E2.s(r3, 2, "0");
case "h":
return f3(1);
case "hh":
return f3(2);
case "a":
return v3(r3, l3, true);
case "A":
return v3(r3, l3, false);
case "m":
return String(l3);
case "mm":
return E2.s(l3, 2, "0");
case "s":
return String(t4.$s);
case "ss":
return E2.s(t4.$s, 2, "0");
case "SSS":
return E2.s(t4.$ms, 3, "0");
case "Z":
return a3;
}
return null;
}(e5) || a3.replace(":", "");
});
}, b3.utcOffset = function() {
return 15 * -Math.round(this.$d.getTimezoneOffset() / 15);
}, b3.diff = function(o3, f3, p3) {
var v3, m3 = this, h4 = E2.p(f3), b4 = C2(o3), g3 = (b4.utcOffset() - this.utcOffset()) * t3, y3 = this - b4, w3 = function() {
return E2.m(m3, b4);
};
switch (h4) {
case d2:
v3 = w3() / 12;
break;
case u2:
v3 = w3();
break;
case c2:
v3 = w3() / 3;
break;
case i2:
v3 = (y3 - g3) / 6048e5;
break;
case s2:
v3 = (y3 - g3) / 864e5;
break;
case l2:
v3 = y3 / n2;
break;
case r2:
v3 = y3 / t3;
break;
case a2:
v3 = y3 / e3;
break;
default:
v3 = y3;
}
return p3 ? v3 : E2.a(v3);
}, b3.daysInMonth = function() {
return this.endOf(u2).$D;
}, b3.$locale = function() {
return w2[this.$L];
}, b3.locale = function(e4, t4) {
if (!e4) return this.$L;
var n3 = this.clone(), o3 = S2(e4, t4, true);
return o3 && (n3.$L = o3), n3;
}, b3.clone = function() {
return E2.w(this.$d, this);
}, b3.toDate = function() {
return new Date(this.valueOf());
}, b3.toJSON = function() {
return this.isValid() ? this.toISOString() : null;
}, b3.toISOString = function() {
return this.$d.toISOString();
}, b3.toString = function() {
return this.$d.toUTCString();
}, h3;
}(), O2 = M2.prototype;
return C2.prototype = O2, [["$ms", o2], ["$s", a2], ["$m", r2], ["$H", l2], ["$W", s2], ["$M", u2], ["$y", d2], ["$D", f2]].forEach(function(e4) {
O2[e4[1]] = function(t4) {
return this.$g(t4, e4[0], e4[1]);
};
}), C2.extend = function(e4, t4) {
return e4.$i || (e4(t4, M2, C2), e4.$i = true), C2;
}, C2.locale = S2, C2.isDayjs = k2, C2.unix = function(e4) {
return C2(1e3 * e4);
}, C2.en = w2[y2], C2.Ls = w2, C2.p = {}, C2;
});
})(ah);
var rh = ah.exports;
const lh = oh(rh);
var sh = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
var e3 = { LTS: "h:mm:ss A", LT: "h:mm A", L: "MM/DD/YYYY", LL: "MMMM D, YYYY", LLL: "MMMM D, YYYY h:mm A", LLLL: "dddd, MMMM D, YYYY h:mm A" }, t3 = /(\[[^[]*\])|([-_:/.,()\s]+)|(A|a|YYYY|YY?|MM?M?M?|Do|DD?|hh?|HH?|mm?|ss?|S{1,3}|z|ZZ?)/g, n2 = /\d\d/, o2 = /\d\d?/, a2 = /\d*[^-_:/,()\s\d]+/, r2 = {}, l2 = function(e4) {
return (e4 = +e4) + (e4 > 68 ? 1900 : 2e3);
};
var s2 = function(e4) {
return function(t4) {
this[e4] = +t4;
};
}, i2 = [/[+-]\d\d:?(\d\d)?|Z/, function(e4) {
(this.zone || (this.zone = {})).offset = function(e5) {
if (!e5) return 0;
if ("Z" === e5) return 0;
var t4 = e5.match(/([+-]|\d\d)/g), n3 = 60 * t4[1] + (+t4[2] || 0);
return 0 === n3 ? 0 : "+" === t4[0] ? -n3 : n3;
}(e4);
}], u2 = function(e4) {
var t4 = r2[e4];
return t4 && (t4.indexOf ? t4 : t4.s.concat(t4.f));
}, c2 = function(e4, t4) {
var n3, o3 = r2.meridiem;
if (o3) {
for (var a3 = 1; a3 <= 24; a3 += 1) if (e4.indexOf(o3(a3, 0, t4)) > -1) {
n3 = a3 > 12;
break;
}
} else n3 = e4 === (t4 ? "pm" : "PM");
return n3;
}, d2 = { A: [a2, function(e4) {
this.afternoon = c2(e4, false);
}], a: [a2, function(e4) {
this.afternoon = c2(e4, true);
}], S: [/\d/, function(e4) {
this.milliseconds = 100 * +e4;
}], SS: [n2, function(e4) {
this.milliseconds = 10 * +e4;
}], SSS: [/\d{3}/, function(e4) {
this.milliseconds = +e4;
}], s: [o2, s2("seconds")], ss: [o2, s2("seconds")], m: [o2, s2("minutes")], mm: [o2, s2("minutes")], H: [o2, s2("hours")], h: [o2, s2("hours")], HH: [o2, s2("hours")], hh: [o2, s2("hours")], D: [o2, s2("day")], DD: [n2, s2("day")], Do: [a2, function(e4) {
var t4 = r2.ordinal, n3 = e4.match(/\d+/);
if (this.day = n3[0], t4) for (var o3 = 1; o3 <= 31; o3 += 1) t4(o3).replace(/\[|\]/g, "") === e4 && (this.day = o3);
}], M: [o2, s2("month")], MM: [n2, s2("month")], MMM: [a2, function(e4) {
var t4 = u2("months"), n3 = (u2("monthsShort") || t4.map(function(e5) {
return e5.slice(0, 3);
})).indexOf(e4) + 1;
if (n3 < 1) throw new Error();
this.month = n3 % 12 || n3;
}], MMMM: [a2, function(e4) {
var t4 = u2("months").indexOf(e4) + 1;
if (t4 < 1) throw new Error();
this.month = t4 % 12 || t4;
}], Y: [/[+-]?\d+/, s2("year")], YY: [n2, function(e4) {
this.year = l2(e4);
}], YYYY: [/\d{4}/, s2("year")], Z: i2, ZZ: i2 };
function f2(n3) {
var o3, a3;
o3 = n3, a3 = r2 && r2.formats;
for (var l3 = (n3 = o3.replace(/(\[[^\]]+])|(LTS?|l{1,4}|L{1,4})/g, function(t4, n4, o4) {
var r3 = o4 && o4.toUpperCase();
return n4 || a3[o4] || e3[o4] || a3[r3].replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e4, t5, n5) {
return t5 || n5.slice(1);
});
})).match(t3), s3 = l3.length, i3 = 0; i3 < s3; i3 += 1) {
var u3 = l3[i3], c3 = d2[u3], f3 = c3 && c3[0], p2 = c3 && c3[1];
l3[i3] = p2 ? { regex: f3, parser: p2 } : u3.replace(/^\[|\]$/g, "");
}
return function(e4) {
for (var t4 = {}, n4 = 0, o4 = 0; n4 < s3; n4 += 1) {
var a4 = l3[n4];
if ("string" == typeof a4) o4 += a4.length;
else {
var r3 = a4.regex, i4 = a4.parser, u4 = e4.slice(o4), c4 = r3.exec(u4)[0];
i4.call(t4, c4), e4 = e4.replace(c4, "");
}
}
return function(e5) {
var t5 = e5.afternoon;
if (void 0 !== t5) {
var n5 = e5.hours;
t5 ? n5 < 12 && (e5.hours += 12) : 12 === n5 && (e5.hours = 0), delete e5.afternoon;
}
}(t4), t4;
};
}
return function(e4, t4, n3) {
n3.p.customParseFormat = true, e4 && e4.parseTwoDigitYear && (l2 = e4.parseTwoDigitYear);
var o3 = t4.prototype, a3 = o3.parse;
o3.parse = function(e5) {
var t5 = e5.date, o4 = e5.utc, l3 = e5.args;
this.$u = o4;
var s3 = l3[1];
if ("string" == typeof s3) {
var i3 = true === l3[2], u3 = true === l3[3], c3 = i3 || u3, d3 = l3[2];
u3 && (d3 = l3[2]), r2 = this.$locale(), !i3 && d3 && (r2 = n3.Ls[d3]), this.$d = function(e6, t6, n4) {
try {
if (["x", "X"].indexOf(t6) > -1) return new Date(("X" === t6 ? 1e3 : 1) * e6);
var o5 = f2(t6)(e6), a4 = o5.year, r3 = o5.month, l4 = o5.day, s4 = o5.hours, i4 = o5.minutes, u4 = o5.seconds, c4 = o5.milliseconds, d4 = o5.zone, p3 = /* @__PURE__ */ new Date(), v3 = l4 || (a4 || r3 ? 1 : p3.getDate()), m3 = a4 || p3.getFullYear(), h2 = 0;
a4 && !r3 || (h2 = r3 > 0 ? r3 - 1 : p3.getMonth());
var b2 = s4 || 0, g2 = i4 || 0, y2 = u4 || 0, w2 = c4 || 0;
return d4 ? new Date(Date.UTC(m3, h2, v3, b2, g2, y2, w2 + 60 * d4.offset * 1e3)) : n4 ? new Date(Date.UTC(m3, h2, v3, b2, g2, y2, w2)) : new Date(m3, h2, v3, b2, g2, y2, w2);
} catch (e7) {
return /* @__PURE__ */ new Date("");
}
}(t5, s3, o4), this.init(), d3 && true !== d3 && (this.$L = this.locale(d3).$L), c3 && t5 != this.format(s3) && (this.$d = /* @__PURE__ */ new Date("")), r2 = {};
} else if (s3 instanceof Array) for (var p2 = s3.length, v2 = 1; v2 <= p2; v2 += 1) {
l3[1] = s3[v2 - 1];
var m2 = n3.apply(this, l3);
if (m2.isValid()) {
this.$d = m2.$d, this.$L = m2.$L, this.init();
break;
}
v2 === p2 && (this.$d = /* @__PURE__ */ new Date(""));
}
else a3.call(this, e5);
};
};
});
})(sh);
var ih = sh.exports;
const uh = oh(ih);
const ch = ["hours", "minutes", "seconds"];
const dh = "HH:mm:ss";
const fh = "YYYY-MM-DD";
const ph = { date: fh, dates: fh, week: "gggg[w]ww", year: "YYYY", years: "YYYY", month: "YYYY-MM", months: "YYYY-MM", datetime: `${fh} ${dh}`, monthrange: "YYYY-MM", daterange: fh, datetimerange: `${fh} ${dh}` };
const vh = (e2, t2) => [e2 > 0 ? e2 - 1 : void 0, e2, e2 < t2 ? e2 + 1 : void 0];
const mh = (e2) => Array.from(Array.from({ length: e2 }).keys());
const hh = (e2) => e2.replace(/\W?m{1,2}|\W?ZZ/g, "").replace(/\W?h{1,2}|\W?s{1,3}|\W?a/gi, "").trim();
const bh = (e2) => e2.replace(/\W?D{1,2}|\W?Do|\W?d{1,4}|\W?M{1,4}|\W?Y{2,4}/g, "").trim();
const gh = function(e2, t2) {
const n2 = xt(e2);
const o2 = xt(t2);
if (n2 && o2) {
return e2.getTime() === t2.getTime();
}
if (!n2 && !o2) {
return e2 === t2;
}
return false;
};
const yh = function(e2, t2) {
const n2 = wt(e2);
const o2 = wt(t2);
if (n2 && o2) {
if (e2.length !== t2.length) {
return false;
}
return e2.every((e3, n3) => gh(e3, t2[n3]));
}
if (!n2 && !o2) {
return gh(e2, t2);
}
return false;
};
const wh = function(e2, t2, n2) {
const o2 = Js(t2) || t2 === "x" ? lh(e2).locale(n2) : lh(e2, t2).locale(n2);
return o2.isValid() ? o2 : void 0;
};
const xh = function(e2, t2, n2) {
if (Js(t2)) return e2;
if (t2 === "x") return +e2;
return lh(e2).locale(n2).format(t2);
};
const kh = (e2, t2) => {
var n2;
const o2 = [];
const a2 = t2 == null ? void 0 : t2();
for (let t3 = 0; t3 < e2; t3++) {
o2.push((n2 = a2 == null ? void 0 : a2.includes(t3)) != null ? n2 : false);
}
return o2;
};
const Sh = ou({ disabledHours: { type: eu(Function) }, disabledMinutes: { type: eu(Function) }, disabledSeconds: { type: eu(Function) } });
const Ch = ou({ visible: Boolean, actualVisible: { type: Boolean, default: void 0 }, format: { type: String, default: "" } });
const Eh = ou({ id: { type: eu([Array, String]) }, name: { type: eu([Array, String]), default: "" }, popperClass: { type: String, default: "" }, format: String, valueFormat: String, dateFormat: String, timeFormat: String, type: { type: String, default: "" }, clearable: { type: Boolean, default: true }, clearIcon: { type: eu([String, Object]), default: Li }, editable: { type: Boolean, default: true }, prefixIcon: { type: eu([String, Object]), default: "" }, size: Ef, readonly: Boolean, disabled: Boolean, placeholder: { type: String, default: "" }, popperOptions: { type: eu(Object), default: () => ({}) }, modelValue: { type: eu([Date, Array, String, Number]), default: "" }, rangeSeparator: { type: String, default: "-" }, startPlaceholder: String, endPlaceholder: String, defaultValue: { type: eu([Date, Array]) }, defaultTime: { type: eu([Date, Array]) }, isRange: Boolean, ...Sh, disabledDate: { type: Function }, cellClassName: { type: Function }, shortcuts: { type: Array, default: () => [] }, arrowControl: Boolean, label: { type: String, default: void 0 }, tabindex: { type: eu([String, Number]), default: 0 }, validateEvent: { type: Boolean, default: true }, unlinkPanels: Boolean, ...Af, ...Tf(["ariaLabel"]) });
const Mh = ["id", "name", "placeholder", "value", "disabled", "readonly"];
const Oh = ["id", "name", "placeholder", "value", "disabled", "readonly"];
const _h = vue.defineComponent({ name: "Picker" });
const $h = vue.defineComponent({ ..._h, props: Eh, emits: ["update:modelValue", "change", "focus", "blur", "clear", "calendar-change", "panel-change", "visible-change", "keydown"], setup(e2, { expose: a2, emit: r2 }) {
const s2 = e2;
const c2 = vue.useAttrs();
const { lang: d2 } = Du();
const f2 = Vu("date");
const m2 = Vu("input");
const h2 = Vu("range");
const { form: b2, formItem: g2 } = Zf();
const k2 = vue.inject("ElPopperOptions", {});
const { valueOnClear: S2 } = Df(s2, null);
const E2 = vue.ref();
const _2 = vue.ref();
const T2 = vue.ref(false);
const I2 = vue.ref(false);
const V2 = vue.ref(null);
let B2 = false;
let F2 = false;
const j2 = vue.computed(() => [f2.b("editor"), f2.bm("editor", s2.type), m2.e("wrapper"), f2.is("disabled", le2.value), f2.is("active", T2.value), h2.b("editor"), Se2 ? h2.bm("editor", Se2.value) : "", c2.class]);
const z2 = vue.computed(() => [m2.e("icon"), h2.e("close-icon"), !me2.value ? h2.e("close-icon--hidden") : ""]);
vue.watch(T2, (e3) => {
if (!e3) {
Me2.value = null;
vue.nextTick(() => {
H2(s2.modelValue);
});
} else {
vue.nextTick(() => {
if (e3) {
V2.value = s2.modelValue;
}
});
}
});
const H2 = (e3, t2) => {
if (t2 || !yh(e3, V2.value)) {
r2("change", e3);
s2.validateEvent && (g2 == null ? void 0 : g2.validate("change").catch((e4) => ii()));
}
};
const W2 = (e3) => {
if (!yh(s2.modelValue, e3)) {
let t2;
if (wt(e3)) {
t2 = e3.map((e4) => xh(e4, s2.valueFormat, d2.value));
} else if (e3) {
t2 = xh(e3, s2.valueFormat, d2.value);
}
r2("update:modelValue", e3 ? t2 : e3, d2.value);
}
};
const Y2 = (e3) => {
r2("keydown", e3);
};
const U2 = vue.computed(() => {
if (_2.value) {
const e3 = ke2.value ? _2.value : _2.value.$el;
return Array.from(e3.querySelectorAll("input"));
}
return [];
});
const K2 = (e3, t2, n2) => {
const o2 = U2.value;
if (!o2.length) return;
if (!n2 || n2 === "min") {
o2[0].setSelectionRange(e3, t2);
o2[0].focus();
} else if (n2 === "max") {
o2[1].setSelectionRange(e3, t2);
o2[1].focus();
}
};
const q2 = () => {
ne2(true, true);
vue.nextTick(() => {
F2 = false;
});
};
const G2 = (e3 = "", t2 = false) => {
if (!t2) {
F2 = true;
}
T2.value = t2;
let n2;
if (wt(e3)) {
n2 = e3.map((e4) => e4.toDate());
} else {
n2 = e3 ? e3.toDate() : e3;
}
Me2.value = null;
W2(n2);
};
const X2 = () => {
I2.value = true;
};
const Z2 = () => {
r2("visible-change", true);
};
const J2 = (e3) => {
if ((e3 == null ? void 0 : e3.key) === cu.esc) {
ne2(true, true);
}
};
const Q2 = () => {
I2.value = false;
T2.value = false;
F2 = false;
r2("visible-change", false);
};
const ee2 = () => {
T2.value = true;
};
const te2 = () => {
T2.value = false;
};
const ne2 = (e3 = true, t2 = false) => {
F2 = t2;
const [n2, o2] = vue.unref(U2);
let a3 = n2;
if (!e3 && ke2.value) {
a3 = o2;
}
if (a3) {
a3.focus();
}
};
const oe2 = (e3) => {
if (s2.readonly || le2.value || T2.value || F2) {
return;
}
T2.value = true;
r2("focus", e3);
};
let ae2 = void 0;
const re2 = (e3) => {
const t2 = async () => {
setTimeout(() => {
var n2;
if (ae2 === t2) {
if (!(((n2 = E2.value) == null ? void 0 : n2.isFocusInsideContent()) && !B2) && U2.value.filter((e4) => e4.contains(document.activeElement)).length === 0) {
Oe2();
T2.value = false;
r2("blur", e3);
s2.validateEvent && (g2 == null ? void 0 : g2.validate("blur").catch((e4) => ii()));
}
B2 = false;
}
}, 0);
};
ae2 = t2;
t2();
};
const le2 = vue.computed(() => s2.disabled || (b2 == null ? void 0 : b2.disabled));
const se2 = vue.computed(() => {
let e3;
if (be2.value) {
if (Ie2.value.getDefaultValue) {
e3 = Ie2.value.getDefaultValue();
}
} else {
if (wt(s2.modelValue)) {
e3 = s2.modelValue.map((e4) => wh(e4, s2.valueFormat, d2.value));
} else {
e3 = wh(s2.modelValue, s2.valueFormat, d2.value);
}
}
if (Ie2.value.getRangeAvailableTime) {
const t2 = Ie2.value.getRangeAvailableTime(e3);
if (!Fs(t2, e3)) {
e3 = t2;
W2(wt(e3) ? e3.map((e4) => e4.toDate()) : e3.toDate());
}
}
if (wt(e3) && e3.some((e4) => !e4)) {
e3 = [];
}
return e3;
});
const ie2 = vue.computed(() => {
if (!Ie2.value.panelReady) return "";
const e3 = $e2(se2.value);
if (wt(Me2.value)) {
return [Me2.value[0] || e3 && e3[0] || "", Me2.value[1] || e3 && e3[1] || ""];
} else if (Me2.value !== null) {
return Me2.value;
}
if (!ce2.value && be2.value) return "";
if (!T2.value && be2.value) return "";
if (e3) {
return de2.value || fe2.value || pe2.value ? e3.join(", ") : e3;
}
return "";
});
const ue2 = vue.computed(() => s2.type.includes("time"));
const ce2 = vue.computed(() => s2.type.startsWith("time"));
const de2 = vue.computed(() => s2.type === "dates");
const fe2 = vue.computed(() => s2.type === "months");
const pe2 = vue.computed(() => s2.type === "years");
const ve2 = vue.computed(() => s2.prefixIcon || (ue2.value ? Di : Mi));
const me2 = vue.ref(false);
const he2 = (e3) => {
if (s2.readonly || le2.value) return;
if (me2.value) {
e3.stopPropagation();
q2();
W2(S2.value);
H2(S2.value, true);
me2.value = false;
T2.value = false;
Ie2.value.handleClear && Ie2.value.handleClear();
}
r2("clear");
};
const be2 = vue.computed(() => {
const { modelValue: e3 } = s2;
return !e3 || wt(e3) && !e3.filter(Boolean).length;
});
const ge2 = async (e3) => {
var t2;
if (s2.readonly || le2.value) return;
if (((t2 = e3.target) == null ? void 0 : t2.tagName) !== "INPUT" || U2.value.includes(document.activeElement)) {
T2.value = true;
}
};
const ye2 = () => {
if (s2.readonly || le2.value) return;
if (!be2.value && s2.clearable) {
me2.value = true;
}
};
const we2 = () => {
me2.value = false;
};
const xe2 = (e3) => {
var t2;
if (s2.readonly || le2.value) return;
if (((t2 = e3.touches[0].target) == null ? void 0 : t2.tagName) !== "INPUT" || U2.value.includes(document.activeElement)) {
T2.value = true;
}
};
const ke2 = vue.computed(() => s2.type.includes("range"));
const Se2 = Gf();
const Ce2 = vue.computed(() => {
var e3, t2;
return (t2 = (e3 = vue.unref(E2)) == null ? void 0 : e3.popperRef) == null ? void 0 : t2.contentRef;
});
const Ee2 = vue.computed(() => {
var e3;
if (vue.unref(ke2)) {
return vue.unref(_2);
}
return (e3 = vue.unref(_2)) == null ? void 0 : e3.$el;
});
Ze(Ee2, (e3) => {
const t2 = vue.unref(Ce2);
const n2 = vue.unref(Ee2);
if (t2 && (e3.target === t2 || e3.composedPath().includes(t2)) || e3.target === n2 || e3.composedPath().includes(n2)) return;
T2.value = false;
});
const Me2 = vue.ref(null);
const Oe2 = () => {
if (Me2.value) {
const e3 = _e2(ie2.value);
if (e3) {
if (Le2(e3)) {
W2(wt(e3) ? e3.map((e4) => e4.toDate()) : e3.toDate());
Me2.value = null;
}
}
}
if (Me2.value === "") {
W2(S2.value);
H2(S2.value);
Me2.value = null;
}
};
const _e2 = (e3) => {
if (!e3) return null;
return Ie2.value.parseUserInput(e3);
};
const $e2 = (e3) => {
if (!e3) return null;
return Ie2.value.formatToString(e3);
};
const Le2 = (e3) => Ie2.value.isValidValue(e3);
const Ae2 = async (e3) => {
if (s2.readonly || le2.value) return;
const { code: t2 } = e3;
Y2(e3);
if (t2 === cu.esc) {
if (T2.value === true) {
T2.value = false;
e3.preventDefault();
e3.stopPropagation();
}
return;
}
if (t2 === cu.down) {
if (Ie2.value.handleFocusPicker) {
e3.preventDefault();
e3.stopPropagation();
}
if (T2.value === false) {
T2.value = true;
await vue.nextTick();
}
if (Ie2.value.handleFocusPicker) {
Ie2.value.handleFocusPicker();
return;
}
}
if (t2 === cu.tab) {
B2 = true;
return;
}
if (t2 === cu.enter || t2 === cu.numpadEnter) {
if (Me2.value === null || Me2.value === "" || Le2(_e2(ie2.value))) {
Oe2();
T2.value = false;
}
e3.stopPropagation();
return;
}
if (Me2.value) {
e3.stopPropagation();
return;
}
if (Ie2.value.handleKeydownInput) {
Ie2.value.handleKeydownInput(e3);
}
};
const De2 = (e3) => {
Me2.value = e3;
if (!T2.value) {
T2.value = true;
}
};
const Re2 = (e3) => {
const t2 = e3.target;
if (Me2.value) {
Me2.value = [t2.value, Me2.value[1]];
} else {
Me2.value = [t2.value, null];
}
};
const Te2 = (e3) => {
const t2 = e3.target;
if (Me2.value) {
Me2.value = [Me2.value[0], t2.value];
} else {
Me2.value = [null, t2.value];
}
};
const Ne2 = () => {
var e3;
const t2 = Me2.value;
const n2 = _e2(t2 && t2[0]);
const o2 = vue.unref(se2);
if (n2 && n2.isValid()) {
Me2.value = [$e2(n2), ((e3 = ie2.value) == null ? void 0 : e3[1]) || null];
const t3 = [n2, o2 && (o2[1] || null)];
if (Le2(t3)) {
W2(t3);
Me2.value = null;
}
}
};
const Pe2 = () => {
var e3;
const t2 = vue.unref(Me2);
const n2 = _e2(t2 && t2[1]);
const o2 = vue.unref(se2);
if (n2 && n2.isValid()) {
Me2.value = [((e3 = vue.unref(ie2)) == null ? void 0 : e3[0]) || null, $e2(n2)];
const t3 = [o2 && o2[0], n2];
if (Le2(t3)) {
W2(t3);
Me2.value = null;
}
}
};
const Ie2 = vue.ref({});
const Ve2 = (e3) => {
Ie2.value[e3[0]] = e3[1];
Ie2.value.panelReady = true;
};
const Be2 = (e3) => {
r2("calendar-change", e3);
};
const Fe2 = (e3, t2, n2) => {
r2("panel-change", e3, t2, n2);
};
vue.provide("EP_PICKER_BASE", { props: s2 });
Eu({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-time-picker", ref: "https://element-plus.org/en-US/component/time-picker.html" }, vue.computed(() => !!s2.label));
a2({ focus: ne2, handleFocusInput: oe2, handleBlurInput: re2, handleOpen: ee2, handleClose: te2, onPick: G2 });
return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.unref(um), vue.mergeProps({ ref_key: "refPopper", ref: E2, visible: T2.value, effect: "light", pure: "", trigger: "click" }, e3.$attrs, { role: "dialog", teleported: "", transition: `${vue.unref(f2).namespace.value}-zoom-in-top`, "popper-class": [`${vue.unref(f2).namespace.value}-picker__popper`, e3.popperClass], "popper-options": vue.unref(k2), "fallback-placements": ["bottom", "top", "right", "left"], "gpu-acceleration": false, "stop-popper-mouse-event": false, "hide-after": 0, persistent: "", onBeforeShow: X2, onShow: Z2, onHide: Q2 }), { default: vue.withCtx(() => [!vue.unref(ke2) ? (vue.openBlock(), vue.createBlock(vue.unref(fp), { key: 0, id: e3.id, ref_key: "inputRef", ref: _2, "container-role": "combobox", "model-value": vue.unref(ie2), name: e3.name, size: vue.unref(Se2), disabled: vue.unref(le2), placeholder: e3.placeholder, class: vue.normalizeClass([vue.unref(f2).b("editor"), vue.unref(f2).bm("editor", e3.type), e3.$attrs.class]), style: vue.normalizeStyle(e3.$attrs.style), readonly: !e3.editable || e3.readonly || vue.unref(de2) || vue.unref(fe2) || vue.unref(pe2) || e3.type === "week", "aria-label": e3.label || e3.ariaLabel, tabindex: e3.tabindex, "validate-event": false, onInput: De2, onFocus: oe2, onBlur: re2, onKeydown: Ae2, onChange: Oe2, onMousedown: ge2, onMouseenter: ye2, onMouseleave: we2, onTouchstartPassive: xe2, onClick: a3[0] || (a3[0] = vue.withModifiers(() => {
}, ["stop"])) }, { prefix: vue.withCtx(() => [vue.unref(ve2) ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0, class: vue.normalizeClass(vue.unref(m2).e("icon")), onMousedown: vue.withModifiers(ge2, ["prevent"]), onTouchstartPassive: xe2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ve2))))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true)]), suffix: vue.withCtx(() => [me2.value && e3.clearIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0, class: vue.normalizeClass(`${vue.unref(m2).e("icon")} clear-icon`), onClick: vue.withModifiers(he2, ["stop"]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.clearIcon)))]), _: 1 }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true)]), _: 1 }, 8, ["id", "model-value", "name", "size", "disabled", "placeholder", "class", "style", "readonly", "aria-label", "tabindex", "onKeydown"])) : (vue.openBlock(), vue.createElementBlock("div", { key: 1, ref_key: "inputRef", ref: _2, class: vue.normalizeClass(vue.unref(j2)), style: vue.normalizeStyle(e3.$attrs.style), onClick: oe2, onMouseenter: ye2, onMouseleave: we2, onTouchstartPassive: xe2, onKeydown: Ae2 }, [vue.unref(ve2) ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0, class: vue.normalizeClass([vue.unref(m2).e("icon"), vue.unref(h2).e("icon")]), onMousedown: vue.withModifiers(ge2, ["prevent"]), onTouchstartPassive: xe2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ve2))))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", { id: e3.id && e3.id[0], autocomplete: "off", name: e3.name && e3.name[0], placeholder: e3.startPlaceholder, value: vue.unref(ie2) && vue.unref(ie2)[0], disabled: vue.unref(le2), readonly: !e3.editable || e3.readonly, class: vue.normalizeClass(vue.unref(h2).b("input")), onMousedown: ge2, onInput: Re2, onChange: Ne2, onFocus: oe2, onBlur: re2 }, null, 42, Mh), vue.renderSlot(e3.$slots, "range-separator", {}, () => [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(h2).b("separator")) }, vue.toDisplayString(e3.rangeSeparator), 3)]), vue.createElementVNode("input", { id: e3.id && e3.id[1], autocomplete: "off", name: e3.name && e3.name[1], placeholder: e3.endPlaceholder, value: vue.unref(ie2) && vue.unref(ie2)[1], disabled: vue.unref(le2), readonly: !e3.editable || e3.readonly, class: vue.normalizeClass(vue.unref(h2).b("input")), onMousedown: ge2, onFocus: oe2, onBlur: re2, onInput: Te2, onChange: Pe2 }, null, 42, Oh), e3.clearIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 1, class: vue.normalizeClass(vue.unref(z2)), onClick: he2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.clearIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 38))]), content: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default", { visible: T2.value, actualVisible: I2.value, parsedValue: vue.unref(se2), format: e3.format, dateFormat: e3.dateFormat, timeFormat: e3.timeFormat, unlinkPanels: e3.unlinkPanels, type: e3.type, defaultValue: e3.defaultValue, onPick: G2, onSelectRange: K2, onSetPickerOption: Ve2, onCalendarChange: Be2, onPanelChange: Fe2, onKeydown: J2, onMousedown: a3[1] || (a3[1] = vue.withModifiers(() => {
}, ["stop"])) })]), _: 3 }, 16, ["visible", "transition", "popper-class", "popper-options"]));
} });
var Lh = jf($h, [["__file", "picker.vue"]]);
const Ah = ou({ ...Ch, datetimeRole: String, parsedValue: { type: eu(Object) } });
const Dh = ({ getAvailableHours: e2, getAvailableMinutes: t2, getAvailableSeconds: n2 }) => {
const o2 = (o3, a3, r3, l2) => {
const s2 = { hour: e2, minute: t2, second: n2 };
let i2 = o3;
["hour", "minute", "second"].forEach((e3) => {
if (s2[e3]) {
let t3;
const n3 = s2[e3];
switch (e3) {
case "minute": {
t3 = n3(i2.hour(), a3, l2);
break;
}
case "second": {
t3 = n3(i2.hour(), i2.minute(), a3, l2);
break;
}
default: {
t3 = n3(a3, l2);
break;
}
}
if ((t3 == null ? void 0 : t3.length) && !t3.includes(i2[e3]())) {
const n4 = r3 ? 0 : t3.length - 1;
i2 = i2[e3](t3[n4]);
}
}
});
return i2;
};
const a2 = {};
const r2 = ([e3, t3]) => {
a2[e3] = t3;
};
return { timePickerOptions: a2, getAvailableTime: o2, onSetOption: r2 };
};
const Rh = (e2) => {
const t2 = (e3, t3) => e3 || t3;
const n2 = (e3) => e3 !== true;
return e2.map(t2).filter(n2);
};
const Th = (e2, t2, n2) => {
const o2 = (t3, n3) => kh(24, e2 && (() => e2 == null ? void 0 : e2(t3, n3)));
const a2 = (e3, n3, o3) => kh(60, t2 && (() => t2 == null ? void 0 : t2(e3, n3, o3)));
const r2 = (e3, t3, o3, a3) => kh(60, n2 && (() => n2 == null ? void 0 : n2(e3, t3, o3, a3)));
return { getHoursList: o2, getMinutesList: a2, getSecondsList: r2 };
};
const Nh = (e2, t2, n2) => {
const { getHoursList: o2, getMinutesList: a2, getSecondsList: r2 } = Th(e2, t2, n2);
const l2 = (e3, t3) => Rh(o2(e3, t3));
const s2 = (e3, t3, n3) => Rh(a2(e3, t3, n3));
const i2 = (e3, t3, n3, o3) => Rh(r2(e3, t3, n3, o3));
return { getAvailableHours: l2, getAvailableMinutes: s2, getAvailableSeconds: i2 };
};
const Ph = (e2) => {
const t2 = vue.ref(e2.parsedValue);
vue.watch(() => e2.visible, (n2) => {
if (!n2) {
t2.value = e2.parsedValue;
}
});
return t2;
};
const Ih = /* @__PURE__ */ new Map();
let Vh;
if (Ie) {
document.addEventListener("mousedown", (e2) => Vh = e2);
document.addEventListener("mouseup", (e2) => {
for (const t2 of Ih.values()) {
for (const { documentHandler: n2 } of t2) {
n2(e2, Vh);
}
}
});
}
function Bh(e2, t2) {
let n2 = [];
if (Array.isArray(t2.arg)) {
n2 = t2.arg;
} else if (Qs(t2.arg)) {
n2.push(t2.arg);
}
return function(o2, a2) {
const r2 = t2.instance.popperRef;
const l2 = o2.target;
const s2 = a2 == null ? void 0 : a2.target;
const i2 = !t2 || !t2.instance;
const u2 = !l2 || !s2;
const c2 = e2.contains(l2) || e2.contains(s2);
const d2 = e2 === l2;
const f2 = n2.length && n2.some((e3) => e3 == null ? void 0 : e3.contains(l2)) || n2.length && n2.includes(s2);
const p2 = r2 && (r2.contains(l2) || r2.contains(s2));
if (i2 || u2 || c2 || d2 || f2 || p2) {
return;
}
t2.value(o2, a2);
};
}
const Fh = { beforeMount(e2, t2) {
if (!Ih.has(e2)) {
Ih.set(e2, []);
}
Ih.get(e2).push({ documentHandler: Bh(e2, t2), bindingFn: t2.value });
}, updated(e2, t2) {
if (!Ih.has(e2)) {
Ih.set(e2, []);
}
const n2 = Ih.get(e2);
const o2 = n2.findIndex((e3) => e3.bindingFn === t2.oldValue);
const a2 = { documentHandler: Bh(e2, t2), bindingFn: t2.value };
if (o2 >= 0) {
n2.splice(o2, 1, a2);
} else {
n2.push(a2);
}
}, unmounted(e2) {
Ih.delete(e2);
} };
const jh = 100;
const zh = 600;
const Hh = { beforeMount(e2, t2) {
const n2 = t2.value;
const { interval: o2 = jh, delay: a2 = zh } = kt(n2) ? {} : n2;
let r2;
let l2;
const s2 = () => kt(n2) ? n2() : n2.handler();
const i2 = () => {
if (l2) {
clearTimeout(l2);
l2 = void 0;
}
if (r2) {
clearInterval(r2);
r2 = void 0;
}
};
e2.addEventListener("mousedown", (e3) => {
if (e3.button !== 0) return;
i2();
s2();
document.addEventListener("mouseup", () => i2(), { once: true });
l2 = setTimeout(() => {
r2 = setInterval(() => {
s2();
}, o2);
}, a2);
});
} };
var Wh = false, Yh, Uh, Kh, qh, Gh, Xh, Zh, Jh, Qh, eb, tb, nb, ob, ab, rb;
function lb() {
if (!Wh) {
Wh = true;
var e2 = navigator.userAgent, t2 = /(?:MSIE.(\d+\.\d+))|(?:(?:Firefox|GranParadiso|Iceweasel).(\d+\.\d+))|(?:Opera(?:.+Version.|.)(\d+\.\d+))|(?:AppleWebKit.(\d+(?:\.\d+)?))|(?:Trident\/\d+\.\d+.*rv:(\d+\.\d+))/.exec(e2), n2 = /(Mac OS X)|(Windows)|(Linux)/.exec(e2);
if (nb = /\b(iPhone|iP[ao]d)/.exec(e2), ob = /\b(iP[ao]d)/.exec(e2), eb = /Android/i.exec(e2), ab = /FBAN\/\w+;/i.exec(e2), rb = /Mobile/i.exec(e2), tb = !!/Win64/.exec(e2), t2) {
Yh = t2[1] ? parseFloat(t2[1]) : t2[5] ? parseFloat(t2[5]) : NaN, Yh && document && document.documentMode && (Yh = document.documentMode);
var o2 = /(?:Trident\/(\d+.\d+))/.exec(e2);
Xh = o2 ? parseFloat(o2[1]) + 4 : Yh, Uh = t2[2] ? parseFloat(t2[2]) : NaN, Kh = t2[3] ? parseFloat(t2[3]) : NaN, qh = t2[4] ? parseFloat(t2[4]) : NaN, qh ? (t2 = /(?:Chrome\/(\d+\.\d+))/.exec(e2), Gh = t2 && t2[1] ? parseFloat(t2[1]) : NaN) : Gh = NaN;
} else Yh = Uh = Kh = Gh = qh = NaN;
if (n2) {
if (n2[1]) {
var a2 = /(?:Mac OS X (\d+(?:[._]\d+)?))/.exec(e2);
Zh = a2 ? parseFloat(a2[1].replace("_", ".")) : true;
} else Zh = false;
Jh = !!n2[2], Qh = !!n2[3];
} else Zh = Jh = Qh = false;
}
}
var sb = { ie: function() {
return lb() || Yh;
}, ieCompatibilityMode: function() {
return lb() || Xh > Yh;
}, ie64: function() {
return sb.ie() && tb;
}, firefox: function() {
return lb() || Uh;
}, opera: function() {
return lb() || Kh;
}, webkit: function() {
return lb() || qh;
}, safari: function() {
return sb.webkit();
}, chrome: function() {
return lb() || Gh;
}, windows: function() {
return lb() || Jh;
}, osx: function() {
return lb() || Zh;
}, linux: function() {
return lb() || Qh;
}, iphone: function() {
return lb() || nb;
}, mobile: function() {
return lb() || nb || ob || eb || rb;
}, nativeApp: function() {
return lb() || ab;
}, android: function() {
return lb() || eb;
}, ipad: function() {
return lb() || ob;
} }, ib = sb;
var ub = !!(typeof window < "u" && window.document && window.document.createElement), cb = { canUseDOM: ub, canUseWorkers: typeof Worker < "u", canUseEventListeners: ub && !!(window.addEventListener || window.attachEvent), canUseViewport: ub && !!window.screen, isInWorker: !ub }, db = cb;
var fb;
db.canUseDOM && (fb = document.implementation && document.implementation.hasFeature && document.implementation.hasFeature("", "") !== true);
function pb(e2, t2) {
if (!db.canUseDOM || t2 && !("addEventListener" in document)) return false;
var n2 = "on" + e2, o2 = n2 in document;
if (!o2) {
var a2 = document.createElement("div");
a2.setAttribute(n2, "return;"), o2 = typeof a2[n2] == "function";
}
return !o2 && fb && e2 === "wheel" && (o2 = document.implementation.hasFeature("Events.wheel", "3.0")), o2;
}
var vb = pb;
var mb = 10, hb = 40, bb = 800;
function gb(e2) {
var t2 = 0, n2 = 0, o2 = 0, a2 = 0;
return "detail" in e2 && (n2 = e2.detail), "wheelDelta" in e2 && (n2 = -e2.wheelDelta / 120), "wheelDeltaY" in e2 && (n2 = -e2.wheelDeltaY / 120), "wheelDeltaX" in e2 && (t2 = -e2.wheelDeltaX / 120), "axis" in e2 && e2.axis === e2.HORIZONTAL_AXIS && (t2 = n2, n2 = 0), o2 = t2 * mb, a2 = n2 * mb, "deltaY" in e2 && (a2 = e2.deltaY), "deltaX" in e2 && (o2 = e2.deltaX), (o2 || a2) && e2.deltaMode && (e2.deltaMode == 1 ? (o2 *= hb, a2 *= hb) : (o2 *= bb, a2 *= bb)), o2 && !t2 && (t2 = o2 < 1 ? -1 : 1), a2 && !n2 && (n2 = a2 < 1 ? -1 : 1), { spinX: t2, spinY: n2, pixelX: o2, pixelY: a2 };
}
gb.getEventType = function() {
return ib.firefox() ? "DOMMouseScroll" : vb("wheel") ? "wheel" : "mousewheel";
};
var yb = gb;
/**
* Checks if an event is supported in the current execution environment.
*
* NOTE: This will not work correctly for non-generic events such as `change`,
* `reset`, `load`, `error`, and `select`.
*
* Borrows from Modernizr.
*
* @param {string} eventNameSuffix Event name, e.g. "click".
* @param {?boolean} capture Check if the capture phase is supported.
* @return {boolean} True if the event is supported.
* @internal
* @license Modernizr 3.0.0pre (Custom Build) | MIT
*/
const wb = function(e2, t2) {
if (e2 && e2.addEventListener) {
const n2 = function(e3) {
const n3 = yb(e3);
t2 && Reflect.apply(t2, this, [e3, n3]);
};
e2.addEventListener("wheel", n2, { passive: true });
}
};
const xb = { beforeMount(e2, t2) {
wb(e2, t2.value);
} };
const kb = ou({ role: { type: String, required: true }, spinnerDate: { type: eu(Object), required: true }, showSeconds: { type: Boolean, default: true }, arrowControl: Boolean, amPmMode: { type: eu(String), default: "" }, ...Sh });
const Sb = ["onClick"];
const Cb = ["onMouseenter"];
const Eb = vue.defineComponent({ __name: "basic-time-spinner", props: kb, emits: ["change", "select-range", "set-option"], setup(e2, { emit: a2 }) {
const r2 = e2;
const s2 = Vu("time");
const { getHoursList: d2, getMinutesList: f2, getSecondsList: p2 } = Th(r2.disabledHours, r2.disabledMinutes, r2.disabledSeconds);
let m2 = false;
const h2 = vue.ref();
const b2 = vue.ref();
const g2 = vue.ref();
const y2 = vue.ref();
const w2 = { hours: b2, minutes: g2, seconds: y2 };
const x2 = vue.computed(() => r2.showSeconds ? ch : ch.slice(0, 2));
const k2 = vue.computed(() => {
const { spinnerDate: e3 } = r2;
const t2 = e3.hour();
const n2 = e3.minute();
const o2 = e3.second();
return { hours: t2, minutes: n2, seconds: o2 };
});
const S2 = vue.computed(() => {
const { hours: e3, minutes: t2 } = vue.unref(k2);
return { hours: d2(r2.role), minutes: f2(e3, r2.role), seconds: p2(e3, t2, r2.role) };
});
const C2 = vue.computed(() => {
const { hours: e3, minutes: t2, seconds: n2 } = vue.unref(k2);
return { hours: vh(e3, 23), minutes: vh(t2, 59), seconds: vh(n2, 59) };
});
const E2 = $s((e3) => {
m2 = false;
P2(e3);
}, 200);
const D2 = (e3) => {
const t2 = !!r2.amPmMode;
if (!t2) return "";
const n2 = r2.amPmMode === "A";
let o2 = e3 < 12 ? " am" : " pm";
if (n2) o2 = o2.toUpperCase();
return o2;
};
const R2 = (e3) => {
let t2;
switch (e3) {
case "hours":
t2 = [0, 2];
break;
case "minutes":
t2 = [3, 5];
break;
case "seconds":
t2 = [6, 8];
break;
}
const [n2, o2] = t2;
a2("select-range", n2, o2);
h2.value = e3;
};
const P2 = (e3) => {
F2(e3, vue.unref(k2)[e3]);
};
const I2 = () => {
P2("hours");
P2("minutes");
P2("seconds");
};
const B2 = (e3) => e3.querySelector(`.${s2.namespace.value}-scrollbar__wrap`);
const F2 = (e3, t2) => {
if (r2.arrowControl) return;
const n2 = vue.unref(w2[e3]);
if (n2 && n2.$el) {
B2(n2.$el).scrollTop = Math.max(0, t2 * j2(e3));
}
};
const j2 = (e3) => {
const t2 = vue.unref(w2[e3]);
const n2 = t2 == null ? void 0 : t2.$el.querySelector("li");
if (n2) {
return Number.parseFloat(pi(n2, "height")) || 0;
}
return 0;
};
const z2 = () => {
W2(1);
};
const H2 = () => {
W2(-1);
};
const W2 = (e3) => {
if (!h2.value) {
R2("hours");
}
const t2 = h2.value;
const n2 = vue.unref(k2)[t2];
const o2 = h2.value === "hours" ? 24 : 60;
const a3 = Y2(t2, n2, e3, o2);
U2(t2, a3);
F2(t2, a3);
vue.nextTick(() => R2(t2));
};
const Y2 = (e3, t2, n2, o2) => {
let a3 = (t2 + n2 + o2) % o2;
const r3 = vue.unref(S2)[e3];
while (r3[a3] && a3 !== t2) {
a3 = (a3 + n2 + o2) % o2;
}
return a3;
};
const U2 = (e3, t2) => {
const n2 = vue.unref(S2)[e3];
const o2 = n2[t2];
if (o2) return;
const { hours: l2, minutes: s3, seconds: i2 } = vue.unref(k2);
let c2;
switch (e3) {
case "hours":
c2 = r2.spinnerDate.hour(t2).minute(s3).second(i2);
break;
case "minutes":
c2 = r2.spinnerDate.hour(l2).minute(t2).second(i2);
break;
case "seconds":
c2 = r2.spinnerDate.hour(l2).minute(s3).second(t2);
break;
}
a2("change", c2);
};
const K2 = (e3, { value: t2, disabled: n2 }) => {
if (!n2) {
U2(e3, t2);
R2(e3);
F2(e3, t2);
}
};
const X2 = (e3) => {
m2 = true;
E2(e3);
const t2 = Math.min(Math.round((B2(vue.unref(w2[e3]).$el).scrollTop - (Z2(e3) * 0.5 - 10) / j2(e3) + 3) / j2(e3)), e3 === "hours" ? 23 : 59);
U2(e3, t2);
};
const Z2 = (e3) => vue.unref(w2[e3]).$el.offsetHeight;
const J2 = () => {
const e3 = (e4) => {
const t2 = vue.unref(w2[e4]);
if (t2 && t2.$el) {
B2(t2.$el).onscroll = () => {
X2(e4);
};
}
};
e3("hours");
e3("minutes");
e3("seconds");
};
vue.onMounted(() => {
vue.nextTick(() => {
!r2.arrowControl && J2();
I2();
if (r2.role === "start") R2("hours");
});
});
const Q2 = (e3, t2) => {
w2[t2].value = e3;
};
a2("set-option", [`${r2.role}_scrollDown`, W2]);
a2("set-option", [`${r2.role}_emitSelectRange`, R2]);
vue.watch(() => r2.spinnerDate, () => {
if (m2) return;
I2();
});
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(s2).b("spinner"), { "has-seconds": e3.showSeconds }]) }, [!e3.arrowControl ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 0 }, vue.renderList(vue.unref(x2), (o2) => (vue.openBlock(), vue.createBlock(vue.unref(Lp), { key: o2, ref_for: true, ref: (e4) => Q2(e4, o2), class: vue.normalizeClass(vue.unref(s2).be("spinner", "wrapper")), "wrap-style": "max-height: inherit;", "view-class": vue.unref(s2).be("spinner", "list"), noresize: "", tag: "ul", onMouseenter: (e4) => R2(o2), onMousemove: (e4) => P2(o2) }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(S2)[o2], (a4, r3) => (vue.openBlock(), vue.createElementBlock("li", { key: r3, class: vue.normalizeClass([vue.unref(s2).be("spinner", "item"), vue.unref(s2).is("active", r3 === vue.unref(k2)[o2]), vue.unref(s2).is("disabled", a4)]), onClick: (e4) => K2(o2, { value: r3, disabled: a4 }) }, [o2 === "hours" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(("0" + (e3.amPmMode ? r3 % 12 || 12 : r3)).slice(-2)) + vue.toDisplayString(D2(r3)), 1)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createTextVNode(vue.toDisplayString(("0" + r3).slice(-2)), 1)], 64))], 10, Sb))), 128))]), _: 2 }, 1032, ["class", "view-class", "onMouseenter", "onMousemove"]))), 128)) : vue.createCommentVNode("v-if", true), e3.arrowControl ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 1 }, vue.renderList(vue.unref(x2), (a4) => (vue.openBlock(), vue.createElementBlock("div", { key: a4, class: vue.normalizeClass([vue.unref(s2).be("spinner", "wrapper"), vue.unref(s2).is("arrow")]), onMouseenter: (e4) => R2(a4) }, [vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(Uf), { class: vue.normalizeClass(["arrow-up", vue.unref(s2).be("spinner", "arrow")]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ci))]), _: 1 }, 8, ["class"])), [[vue.unref(Hh), H2]]), vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(Uf), { class: vue.normalizeClass(["arrow-down", vue.unref(s2).be("spinner", "arrow")]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(gi))]), _: 1 }, 8, ["class"])), [[vue.unref(Hh), z2]]), vue.createElementVNode("ul", { class: vue.normalizeClass(vue.unref(s2).be("spinner", "list")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(C2)[a4], (o2, r3) => (vue.openBlock(), vue.createElementBlock("li", { key: r3, class: vue.normalizeClass([vue.unref(s2).be("spinner", "item"), vue.unref(s2).is("active", o2 === vue.unref(k2)[a4]), vue.unref(s2).is("disabled", vue.unref(S2)[a4][o2])]) }, [typeof o2 === "number" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [a4 === "hours" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(("0" + (e3.amPmMode ? o2 % 12 || 12 : o2)).slice(-2)) + vue.toDisplayString(D2(o2)), 1)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createTextVNode(vue.toDisplayString(("0" + o2).slice(-2)), 1)], 64))], 64)) : vue.createCommentVNode("v-if", true)], 2))), 128))], 2)], 42, Cb))), 128)) : vue.createCommentVNode("v-if", true)], 2));
} });
var Mb = jf(Eb, [["__file", "basic-time-spinner.vue"]]);
const Ob = vue.defineComponent({ __name: "panel-time-pick", props: Ah, emits: ["pick", "select-range", "set-picker-option"], setup(e2, { emit: a2 }) {
const r2 = e2;
const s2 = vue.inject("EP_PICKER_BASE");
const { arrowControl: i2, disabledHours: c2, disabledMinutes: d2, disabledSeconds: f2, defaultValue: m2 } = s2.props;
const { getAvailableHours: h2, getAvailableMinutes: b2, getAvailableSeconds: g2 } = Nh(c2, d2, f2);
const y2 = Vu("time");
const { t: w2, lang: x2 } = Du();
const k2 = vue.ref([0, 2]);
const S2 = Ph(r2);
const C2 = vue.computed(() => Gs(r2.actualVisible) ? `${y2.namespace.value}-zoom-in-top` : "");
const E2 = vue.computed(() => r2.format.includes("ss"));
const M2 = vue.computed(() => {
if (r2.format.includes("A")) return "A";
if (r2.format.includes("a")) return "a";
return "";
});
const _2 = (e3) => {
const t2 = lh(e3).locale(x2.value);
const n2 = W2(t2);
return t2.isSame(n2);
};
const D2 = () => {
a2("pick", S2.value, false);
};
const R2 = (e3 = false, t2 = false) => {
if (t2) return;
a2("pick", r2.parsedValue, e3);
};
const P2 = (e3) => {
if (!r2.visible) {
return;
}
const t2 = W2(e3).millisecond(0);
a2("pick", t2, true);
};
const V2 = (e3, t2) => {
a2("select-range", e3, t2);
k2.value = [e3, t2];
};
const B2 = (e3) => {
const t2 = [0, 3].concat(E2.value ? [6] : []);
const n2 = ["hours", "minutes"].concat(E2.value ? ["seconds"] : []);
const o2 = t2.indexOf(k2.value[0]);
const a3 = (o2 + e3 + t2.length) % t2.length;
j2["start_emitSelectRange"](n2[a3]);
};
const F2 = (e3) => {
const t2 = e3.code;
const { left: n2, right: o2, up: a3, down: r3 } = cu;
if ([n2, o2].includes(t2)) {
const o3 = t2 === n2 ? -1 : 1;
B2(o3);
e3.preventDefault();
return;
}
if ([a3, r3].includes(t2)) {
const n3 = t2 === a3 ? -1 : 1;
j2["start_scrollDown"](n3);
e3.preventDefault();
return;
}
};
const { timePickerOptions: j2, onSetOption: z2, getAvailableTime: H2 } = Dh({ getAvailableHours: h2, getAvailableMinutes: b2, getAvailableSeconds: g2 });
const W2 = (e3) => H2(e3, r2.datetimeRole || "", true);
const Y2 = (e3) => {
if (!e3) return null;
return lh(e3, r2.format).locale(x2.value);
};
const U2 = (e3) => {
if (!e3) return null;
return e3.format(r2.format);
};
const K2 = () => lh(m2).locale(x2.value);
a2("set-picker-option", ["isValidValue", _2]);
a2("set-picker-option", ["formatToString", U2]);
a2("set-picker-option", ["parseUserInput", Y2]);
a2("set-picker-option", ["handleKeydownInput", F2]);
a2("set-picker-option", ["getRangeAvailableTime", W2]);
a2("set-picker-option", ["getDefaultValue", K2]);
return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(C2) }, { default: vue.withCtx(() => [e3.actualVisible || e3.visible ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(y2).b("panel")) }, [vue.createElementVNode("div", { class: vue.normalizeClass([vue.unref(y2).be("panel", "content"), { "has-seconds": vue.unref(E2) }]) }, [vue.createVNode(Mb, { ref: "spinner", role: e3.datetimeRole || "start", "arrow-control": vue.unref(i2), "show-seconds": vue.unref(E2), "am-pm-mode": vue.unref(M2), "spinner-date": e3.parsedValue, "disabled-hours": vue.unref(c2), "disabled-minutes": vue.unref(d2), "disabled-seconds": vue.unref(f2), onChange: P2, onSetOption: vue.unref(z2), onSelectRange: V2 }, null, 8, ["role", "arrow-control", "show-seconds", "am-pm-mode", "spinner-date", "disabled-hours", "disabled-minutes", "disabled-seconds", "onSetOption"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(y2).be("panel", "footer")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(y2).be("panel", "btn"), "cancel"]), onClick: D2 }, vue.toDisplayString(vue.unref(w2)("el.datepicker.cancel")), 3), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(y2).be("panel", "btn"), "confirm"]), onClick: a3[0] || (a3[0] = (e4) => R2()) }, vue.toDisplayString(vue.unref(w2)("el.datepicker.confirm")), 3)], 2)], 2)) : vue.createCommentVNode("v-if", true)]), _: 1 }, 8, ["name"]));
} });
var _b = jf(Ob, [["__file", "panel-time-pick.vue"]]);
var $b = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
return function(e3, t3, n2) {
var o2 = t3.prototype, a2 = function(e4) {
return e4 && (e4.indexOf ? e4 : e4.s);
}, r2 = function(e4, t4, n3, o3, r3) {
var l3 = e4.name ? e4 : e4.$locale(), s3 = a2(l3[t4]), i3 = a2(l3[n3]), u2 = s3 || i3.map(function(e5) {
return e5.slice(0, o3);
});
if (!r3) return u2;
var c2 = l3.weekStart;
return u2.map(function(e5, t5) {
return u2[(t5 + (c2 || 0)) % 7];
});
}, l2 = function() {
return n2.Ls[n2.locale()];
}, s2 = function(e4, t4) {
return e4.formats[t4] || function(e5) {
return e5.replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e6, t5, n3) {
return t5 || n3.slice(1);
});
}(e4.formats[t4.toUpperCase()]);
}, i2 = function() {
var e4 = this;
return { months: function(t4) {
return t4 ? t4.format("MMMM") : r2(e4, "months");
}, monthsShort: function(t4) {
return t4 ? t4.format("MMM") : r2(e4, "monthsShort", "months", 3);
}, firstDayOfWeek: function() {
return e4.$locale().weekStart || 0;
}, weekdays: function(t4) {
return t4 ? t4.format("dddd") : r2(e4, "weekdays");
}, weekdaysMin: function(t4) {
return t4 ? t4.format("dd") : r2(e4, "weekdaysMin", "weekdays", 2);
}, weekdaysShort: function(t4) {
return t4 ? t4.format("ddd") : r2(e4, "weekdaysShort", "weekdays", 3);
}, longDateFormat: function(t4) {
return s2(e4.$locale(), t4);
}, meridiem: this.$locale().meridiem, ordinal: this.$locale().ordinal };
};
o2.localeData = function() {
return i2.bind(this)();
}, n2.localeData = function() {
var e4 = l2();
return { firstDayOfWeek: function() {
return e4.weekStart || 0;
}, weekdays: function() {
return n2.weekdays();
}, weekdaysShort: function() {
return n2.weekdaysShort();
}, weekdaysMin: function() {
return n2.weekdaysMin();
}, months: function() {
return n2.months();
}, monthsShort: function() {
return n2.monthsShort();
}, longDateFormat: function(t4) {
return s2(e4, t4);
}, meridiem: e4.meridiem, ordinal: e4.ordinal };
}, n2.months = function() {
return r2(l2(), "months");
}, n2.monthsShort = function() {
return r2(l2(), "monthsShort", "months", 3);
}, n2.weekdays = function(e4) {
return r2(l2(), "weekdays", null, null, e4);
}, n2.weekdaysShort = function(e4) {
return r2(l2(), "weekdaysShort", "weekdays", 3, e4);
}, n2.weekdaysMin = function(e4) {
return r2(l2(), "weekdaysMin", "weekdays", 2, e4);
};
};
});
})($b);
var Lb = $b.exports;
const Ab = oh(Lb);
const Db = { modelValue: { type: [Number, String, Boolean], default: void 0 }, label: { type: [String, Boolean, Number, Object], default: void 0 }, value: { type: [String, Boolean, Number, Object], default: void 0 }, indeterminate: Boolean, disabled: Boolean, checked: Boolean, name: { type: String, default: void 0 }, trueValue: { type: [String, Number], default: void 0 }, falseValue: { type: [String, Number], default: void 0 }, trueLabel: { type: [String, Number], default: void 0 }, falseLabel: { type: [String, Number], default: void 0 }, id: { type: String, default: void 0 }, controls: { type: String, default: void 0 }, border: Boolean, size: Ef, tabindex: [String, Number], validateEvent: { type: Boolean, default: true }, ...Tf(["ariaControls"]) };
const Rb = { [fu]: (e2) => St(e2) || Zs(e2) || Xs(e2), change: (e2) => St(e2) || Zs(e2) || Xs(e2) };
const Tb = Symbol("checkboxGroupContextKey");
const Nb = ({ model: e2, isChecked: t2 }) => {
const n2 = vue.inject(Tb, void 0);
const o2 = vue.computed(() => {
var o3, a3;
const r2 = (o3 = n2 == null ? void 0 : n2.max) == null ? void 0 : o3.value;
const l2 = (a3 = n2 == null ? void 0 : n2.min) == null ? void 0 : a3.value;
return !Gs(r2) && e2.value.length >= r2 && !t2.value || !Gs(l2) && e2.value.length <= l2 && t2.value;
});
const a2 = Xf(vue.computed(() => (n2 == null ? void 0 : n2.disabled.value) || o2.value));
return { isDisabled: a2, isLimitDisabled: o2 };
};
const Pb = (e2, { model: t2, isLimitExceeded: n2, hasOwnLabel: o2, isDisabled: a2, isLabeledByFormItem: r2 }) => {
const u2 = vue.inject(Tb, void 0);
const { formItem: c2 } = Zf();
const { emit: d2 } = vue.getCurrentInstance();
function f2(t3) {
var n3, o3, a3, r3;
return [true, e2.trueValue, e2.trueLabel].includes(t3) ? (o3 = (n3 = e2.trueValue) != null ? n3 : e2.trueLabel) != null ? o3 : true : (r3 = (a3 = e2.falseValue) != null ? a3 : e2.falseLabel) != null ? r3 : false;
}
function v2(e3, t3) {
d2("change", f2(e3), t3);
}
function m2(e3) {
if (n2.value) return;
const t3 = e3.target;
d2("change", f2(t3.checked), e3);
}
async function h2(l2) {
if (n2.value) return;
if (!o2.value && !a2.value && r2.value) {
const n3 = l2.composedPath();
const o3 = n3.some((e3) => e3.tagName === "LABEL");
if (!o3) {
t2.value = f2([false, e2.falseValue, e2.falseLabel].includes(t2.value));
await vue.nextTick();
v2(t2.value, l2);
}
}
}
const b2 = vue.computed(() => (u2 == null ? void 0 : u2.validateEvent) || e2.validateEvent);
vue.watch(() => e2.modelValue, () => {
if (b2.value) {
c2 == null ? void 0 : c2.validate("change").catch((e3) => ii());
}
});
return { handleChange: m2, onClickRoot: h2 };
};
const Ib = (e2) => {
const t2 = vue.ref(false);
const { emit: n2 } = vue.getCurrentInstance();
const o2 = vue.inject(Tb, void 0);
const a2 = vue.computed(() => Gs(o2) === false);
const r2 = vue.ref(false);
const i2 = vue.computed({ get() {
var n3, r3;
return a2.value ? (n3 = o2 == null ? void 0 : o2.modelValue) == null ? void 0 : n3.value : (r3 = e2.modelValue) != null ? r3 : t2.value;
}, set(e3) {
var l2, s2;
if (a2.value && wt(e3)) {
r2.value = ((l2 = o2 == null ? void 0 : o2.max) == null ? void 0 : l2.value) !== void 0 && e3.length > (o2 == null ? void 0 : o2.max.value) && e3.length > i2.value.length;
r2.value === false && ((s2 = o2 == null ? void 0 : o2.changeEvent) == null ? void 0 : s2.call(o2, e3));
} else {
n2(fu, e3);
t2.value = e3;
}
} });
return { model: i2, isGroup: a2, isLimitExceeded: r2 };
};
const Vb = (e2, t2, { model: n2 }) => {
const o2 = vue.inject(Tb, void 0);
const a2 = vue.ref(false);
const r2 = vue.computed(() => {
if (!ei(e2.value)) {
return e2.value;
}
return e2.label;
});
const s2 = vue.computed(() => {
const t3 = n2.value;
if (Xs(t3)) {
return t3;
} else if (wt(t3)) {
if (Ct(r2.value)) {
return t3.map(vue.toRaw).some((e3) => Fs(e3, r2.value));
} else {
return t3.map(vue.toRaw).includes(r2.value);
}
} else if (t3 !== null && t3 !== void 0) {
return t3 === e2.trueValue || t3 === e2.trueLabel;
} else {
return !!t3;
}
});
const i2 = Gf(vue.computed(() => {
var e3;
return (e3 = o2 == null ? void 0 : o2.size) == null ? void 0 : e3.value;
}), { prop: true });
const u2 = Gf(vue.computed(() => {
var e3;
return (e3 = o2 == null ? void 0 : o2.size) == null ? void 0 : e3.value;
}));
const c2 = vue.computed(() => !!t2.default || !ei(r2.value));
return { checkboxButtonSize: i2, isChecked: s2, isFocused: a2, checkboxSize: u2, hasOwnLabel: c2, actualValue: r2 };
};
const Bb = (e2, t2) => {
const { formItem: n2 } = Zf();
const { model: o2, isGroup: a2, isLimitExceeded: r2 } = Ib(e2);
const { isFocused: s2, isChecked: i2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, actualValue: f2 } = Vb(e2, t2, { model: o2 });
const { isDisabled: p2 } = Nb({ model: o2, isChecked: i2 });
const { inputId: v2, isLabeledByFormItem: m2 } = Jf(e2, { formItemContext: n2, disableIdGeneration: d2, disableIdManagement: a2 });
const { handleChange: h2, onClickRoot: b2 } = Pb(e2, { model: o2, isLimitExceeded: r2, hasOwnLabel: d2, isDisabled: p2, isLabeledByFormItem: m2 });
const g2 = () => {
function t3() {
var t4, n3;
if (wt(o2.value) && !o2.value.includes(f2.value)) {
o2.value.push(f2.value);
} else {
o2.value = (n3 = (t4 = e2.trueValue) != null ? t4 : e2.trueLabel) != null ? n3 : true;
}
}
e2.checked && t3();
};
g2();
Eu({ from: "controls", replacement: "aria-controls", version: "2.8.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.controls));
Eu({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => a2.value && ei(e2.value)));
Eu({ from: "true-label", replacement: "true-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.trueLabel));
Eu({ from: "false-label", replacement: "false-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.falseLabel));
return { inputId: v2, isLabeledByFormItem: m2, isChecked: i2, isDisabled: p2, isFocused: s2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, model: o2, actualValue: f2, handleChange: h2, onClickRoot: b2 };
};
const Fb = ["id", "indeterminate", "name", "tabindex", "disabled", "true-value", "false-value"];
const jb = ["id", "indeterminate", "disabled", "value", "name", "tabindex"];
const zb = vue.defineComponent({ name: "ElCheckbox" });
const Hb = vue.defineComponent({ ...zb, props: Db, emits: Rb, setup(e2) {
const a2 = e2;
const r2 = vue.useSlots();
const { inputId: s2, isLabeledByFormItem: i2, isChecked: c2, isDisabled: d2, isFocused: f2, checkboxSize: p2, hasOwnLabel: v2, model: h2, actualValue: b2, handleChange: g2, onClickRoot: y2 } = Bb(a2, r2);
const w2 = Vu("checkbox");
const k2 = vue.computed(() => [w2.b(), w2.m(p2.value), w2.is("disabled", d2.value), w2.is("bordered", a2.border), w2.is("checked", c2.value)]);
const S2 = vue.computed(() => [w2.e("input"), w2.is("disabled", d2.value), w2.is("checked", c2.value), w2.is("indeterminate", a2.indeterminate), w2.is("focus", f2.value)]);
return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(!vue.unref(v2) && vue.unref(i2) ? "span" : "label"), { class: vue.normalizeClass(vue.unref(k2)), "aria-controls": e3.indeterminate ? e3.controls || e3.ariaControls : null, onClick: vue.unref(y2) }, { default: vue.withCtx(() => {
var r3, l2;
return [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(S2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 0, id: vue.unref(s2), "onUpdate:modelValue": a3[0] || (a3[0] = (e4) => vue.isRef(h2) ? h2.value = e4 : null), class: vue.normalizeClass(vue.unref(w2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(d2), "true-value": (r3 = e3.trueValue) != null ? r3 : e3.trueLabel, "false-value": (l2 = e3.falseValue) != null ? l2 : e3.falseLabel, onChange: a3[1] || (a3[1] = (...e4) => vue.unref(g2) && vue.unref(g2)(...e4)), onFocus: a3[2] || (a3[2] = (e4) => f2.value = true), onBlur: a3[3] || (a3[3] = (e4) => f2.value = false), onClick: a3[4] || (a3[4] = vue.withModifiers(() => {
}, ["stop"])) }, null, 42, Fb)), [[vue.vModelCheckbox, vue.unref(h2)]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 1, id: vue.unref(s2), "onUpdate:modelValue": a3[5] || (a3[5] = (e4) => vue.isRef(h2) ? h2.value = e4 : null), class: vue.normalizeClass(vue.unref(w2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, disabled: vue.unref(d2), value: vue.unref(b2), name: e3.name, tabindex: e3.tabindex, onChange: a3[6] || (a3[6] = (...e4) => vue.unref(g2) && vue.unref(g2)(...e4)), onFocus: a3[7] || (a3[7] = (e4) => f2.value = true), onBlur: a3[8] || (a3[8] = (e4) => f2.value = false), onClick: a3[9] || (a3[9] = vue.withModifiers(() => {
}, ["stop"])) }, null, 42, jb)), [[vue.vModelCheckbox, vue.unref(h2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(w2).e("inner")) }, null, 2)], 2), vue.unref(v2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(w2).e("label")) }, [vue.renderSlot(e3.$slots, "default"), !e3.$slots.default ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(e3.label), 1)], 64)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true)];
}), _: 3 }, 8, ["class", "aria-controls", "onClick"]));
} });
var Wb = jf(Hb, [["__file", "checkbox.vue"]]);
const Yb = ["name", "tabindex", "disabled", "true-value", "false-value"];
const Ub = ["name", "tabindex", "disabled", "value"];
const Kb = vue.defineComponent({ name: "ElCheckboxButton" });
const qb = vue.defineComponent({ ...Kb, props: Db, emits: Rb, setup(e2) {
const o2 = e2;
const a2 = vue.useSlots();
const { isFocused: r2, isChecked: s2, isDisabled: i2, checkboxButtonSize: c2, model: d2, actualValue: f2, handleChange: v2 } = Bb(o2, a2);
const h2 = vue.inject(Tb, void 0);
const b2 = Vu("checkbox");
const g2 = vue.computed(() => {
var e3, t2, n2, o3;
const a3 = (t2 = (e3 = h2 == null ? void 0 : h2.fill) == null ? void 0 : e3.value) != null ? t2 : "";
return { backgroundColor: a3, borderColor: a3, color: (o3 = (n2 = h2 == null ? void 0 : h2.textColor) == null ? void 0 : n2.value) != null ? o3 : "", boxShadow: a3 ? `-1px 0 0 0 ${a3}` : void 0 };
});
const y2 = vue.computed(() => [b2.b("button"), b2.bm("button", c2.value), b2.is("disabled", i2.value), b2.is("checked", s2.value), b2.is("focus", r2.value)]);
return (e3, o3) => {
var a3, l2;
return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass(vue.unref(y2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 0, "onUpdate:modelValue": o3[0] || (o3[0] = (e4) => vue.isRef(d2) ? d2.value = e4 : null), class: vue.normalizeClass(vue.unref(b2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(i2), "true-value": (a3 = e3.trueValue) != null ? a3 : e3.trueLabel, "false-value": (l2 = e3.falseValue) != null ? l2 : e3.falseLabel, onChange: o3[1] || (o3[1] = (...e4) => vue.unref(v2) && vue.unref(v2)(...e4)), onFocus: o3[2] || (o3[2] = (e4) => r2.value = true), onBlur: o3[3] || (o3[3] = (e4) => r2.value = false), onClick: o3[4] || (o3[4] = vue.withModifiers(() => {
}, ["stop"])) }, null, 42, Yb)), [[vue.vModelCheckbox, vue.unref(d2)]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 1, "onUpdate:modelValue": o3[5] || (o3[5] = (e4) => vue.isRef(d2) ? d2.value = e4 : null), class: vue.normalizeClass(vue.unref(b2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(i2), value: vue.unref(f2), onChange: o3[6] || (o3[6] = (...e4) => vue.unref(v2) && vue.unref(v2)(...e4)), onFocus: o3[7] || (o3[7] = (e4) => r2.value = true), onBlur: o3[8] || (o3[8] = (e4) => r2.value = false), onClick: o3[9] || (o3[9] = vue.withModifiers(() => {
}, ["stop"])) }, null, 42, Ub)), [[vue.vModelCheckbox, vue.unref(d2)]]), e3.$slots.default || e3.label ? (vue.openBlock(), vue.createElementBlock("span", { key: 2, class: vue.normalizeClass(vue.unref(b2).be("button", "inner")), style: vue.normalizeStyle(vue.unref(s2) ? vue.unref(g2) : void 0) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 6)) : vue.createCommentVNode("v-if", true)], 2);
};
} });
var Gb = jf(qb, [["__file", "checkbox-button.vue"]]);
const Xb = ou({ modelValue: { type: eu(Array), default: () => [] }, disabled: Boolean, min: Number, max: Number, size: Ef, label: String, fill: String, textColor: String, tag: { type: String, default: "div" }, validateEvent: { type: Boolean, default: true }, ...Tf(["ariaLabel"]) });
const Zb = { [fu]: (e2) => wt(e2), change: (e2) => wt(e2) };
const Jb = vue.defineComponent({ name: "ElCheckboxGroup" });
const Qb = vue.defineComponent({ ...Jb, props: Xb, emits: Zb, setup(e2, { emit: n2 }) {
const o2 = e2;
const a2 = Vu("checkbox");
const { formItem: r2 } = Zf();
const { inputId: s2, isLabeledByFormItem: c2 } = Jf(o2, { formItemContext: r2 });
const d2 = async (e3) => {
n2(fu, e3);
await vue.nextTick();
n2("change", e3);
};
const f2 = vue.computed({ get() {
return o2.modelValue;
}, set(e3) {
d2(e3);
} });
vue.provide(Tb, { ...Ks(vue.toRefs(o2), ["size", "min", "max", "disabled", "validateEvent", "fill", "textColor"]), modelValue: f2, changeEvent: d2 });
Eu({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-checkbox-group", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!o2.label));
vue.watch(() => o2.modelValue, () => {
if (o2.validateEvent) {
r2 == null ? void 0 : r2.validate("change").catch((e3) => ii());
}
});
return (e3, n3) => {
var o3;
return vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), { id: vue.unref(s2), class: vue.normalizeClass(vue.unref(a2).b("group")), role: "group", "aria-label": !vue.unref(c2) ? e3.label || e3.ariaLabel || "checkbox-group" : void 0, "aria-labelledby": vue.unref(c2) ? (o3 = vue.unref(r2)) == null ? void 0 : o3.labelId : void 0 }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "aria-label", "aria-labelledby"]);
};
} });
var eg = jf(Qb, [["__file", "checkbox-group.vue"]]);
const tg = su(Wb, { CheckboxButton: Gb, CheckboxGroup: eg });
iu(Gb);
const ng = iu(eg);
const og = ou({ modelValue: { type: [String, Number, Boolean], default: void 0 }, size: Ef, disabled: Boolean, label: { type: [String, Number, Boolean], default: void 0 }, value: { type: [String, Number, Boolean], default: void 0 }, name: { type: String, default: void 0 } });
const ag = ou({ ...og, border: Boolean });
const rg = { [fu]: (e2) => St(e2) || Zs(e2) || Xs(e2), [pu]: (e2) => St(e2) || Zs(e2) || Xs(e2) };
const lg = Symbol("radioGroupKey");
const sg = (e2, t2) => {
const n2 = vue.ref();
const o2 = vue.inject(lg, void 0);
const a2 = vue.computed(() => !!o2);
const r2 = vue.computed(() => {
if (!ei(e2.value)) {
return e2.value;
}
return e2.label;
});
const s2 = vue.computed({ get() {
return a2.value ? o2.modelValue : e2.modelValue;
}, set(l2) {
if (a2.value) {
o2.changeEvent(l2);
} else {
t2 && t2(fu, l2);
}
n2.value.checked = e2.modelValue === r2.value;
} });
const i2 = Gf(vue.computed(() => o2 == null ? void 0 : o2.size));
const u2 = Xf(vue.computed(() => o2 == null ? void 0 : o2.disabled));
const c2 = vue.ref(false);
const d2 = vue.computed(() => u2.value || a2.value && s2.value !== r2.value ? -1 : 0);
Eu({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-radio", ref: "https://element-plus.org/en-US/component/radio.html" }, vue.computed(() => a2.value && ei(e2.value)));
return { radioRef: n2, isGroup: a2, radioGroup: o2, focus: c2, size: i2, disabled: u2, tabIndex: d2, modelValue: s2, actualValue: r2 };
};
const ig = ["value", "name", "disabled"];
const ug = vue.defineComponent({ name: "ElRadio" });
const cg = vue.defineComponent({ ...ug, props: ag, emits: rg, setup(e2, { emit: a2 }) {
const r2 = e2;
const l2 = Vu("radio");
const { radioRef: s2, radioGroup: i2, focus: c2, size: d2, disabled: f2, modelValue: p2, actualValue: v2 } = sg(r2, a2);
function h2() {
vue.nextTick(() => a2("change", p2.value));
}
return (e3, a3) => {
var r3;
return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass([vue.unref(l2).b(), vue.unref(l2).is("disabled", vue.unref(f2)), vue.unref(l2).is("focus", vue.unref(c2)), vue.unref(l2).is("bordered", e3.border), vue.unref(l2).is("checked", vue.unref(p2) === vue.unref(v2)), vue.unref(l2).m(vue.unref(d2))]) }, [vue.createElementVNode("span", { class: vue.normalizeClass([vue.unref(l2).e("input"), vue.unref(l2).is("disabled", vue.unref(f2)), vue.unref(l2).is("checked", vue.unref(p2) === vue.unref(v2))]) }, [vue.withDirectives(vue.createElementVNode("input", { ref_key: "radioRef", ref: s2, "onUpdate:modelValue": a3[0] || (a3[0] = (e4) => vue.isRef(p2) ? p2.value = e4 : null), class: vue.normalizeClass(vue.unref(l2).e("original")), value: vue.unref(v2), name: e3.name || ((r3 = vue.unref(i2)) == null ? void 0 : r3.name), disabled: vue.unref(f2), type: "radio", onFocus: a3[1] || (a3[1] = (e4) => c2.value = true), onBlur: a3[2] || (a3[2] = (e4) => c2.value = false), onChange: h2, onClick: a3[3] || (a3[3] = vue.withModifiers(() => {
}, ["stop"])) }, null, 42, ig), [[vue.vModelRadio, vue.unref(p2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).e("inner")) }, null, 2)], 2), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).e("label")), onKeydown: a3[4] || (a3[4] = vue.withModifiers(() => {
}, ["stop"])) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 34)], 2);
};
} });
var dg = jf(cg, [["__file", "radio.vue"]]);
const fg = ou({ ...og });
const pg = ["value", "name", "disabled"];
const vg = vue.defineComponent({ name: "ElRadioButton" });
const mg = vue.defineComponent({ ...vg, props: fg, setup(e2) {
const a2 = e2;
const r2 = Vu("radio");
const { radioRef: s2, focus: i2, size: c2, disabled: d2, modelValue: f2, radioGroup: p2, actualValue: v2 } = sg(a2);
const h2 = vue.computed(() => ({ backgroundColor: (p2 == null ? void 0 : p2.fill) || "", borderColor: (p2 == null ? void 0 : p2.fill) || "", boxShadow: (p2 == null ? void 0 : p2.fill) ? `-1px 0 0 0 ${p2.fill}` : "", color: (p2 == null ? void 0 : p2.textColor) || "" }));
return (e3, a3) => {
var l2;
return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass([vue.unref(r2).b("button"), vue.unref(r2).is("active", vue.unref(f2) === vue.unref(v2)), vue.unref(r2).is("disabled", vue.unref(d2)), vue.unref(r2).is("focus", vue.unref(i2)), vue.unref(r2).bm("button", vue.unref(c2))]) }, [vue.withDirectives(vue.createElementVNode("input", { ref_key: "radioRef", ref: s2, "onUpdate:modelValue": a3[0] || (a3[0] = (e4) => vue.isRef(f2) ? f2.value = e4 : null), class: vue.normalizeClass(vue.unref(r2).be("button", "original-radio")), value: vue.unref(v2), type: "radio", name: e3.name || ((l2 = vue.unref(p2)) == null ? void 0 : l2.name), disabled: vue.unref(d2), onFocus: a3[1] || (a3[1] = (e4) => i2.value = true), onBlur: a3[2] || (a3[2] = (e4) => i2.value = false), onClick: a3[3] || (a3[3] = vue.withModifiers(() => {
}, ["stop"])) }, null, 42, pg), [[vue.vModelRadio, vue.unref(f2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(r2).be("button", "inner")), style: vue.normalizeStyle(vue.unref(f2) === vue.unref(v2) ? vue.unref(h2) : {}), onKeydown: a3[4] || (a3[4] = vue.withModifiers(() => {
}, ["stop"])) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 38)], 2);
};
} });
var hg = jf(mg, [["__file", "radio-button.vue"]]);
const bg = ou({ id: { type: String, default: void 0 }, size: Ef, disabled: Boolean, modelValue: { type: [String, Number, Boolean], default: void 0 }, fill: { type: String, default: "" }, label: { type: String, default: void 0 }, textColor: { type: String, default: "" }, name: { type: String, default: void 0 }, validateEvent: { type: Boolean, default: true }, ...Tf(["ariaLabel"]) });
const gg = rg;
const yg = ["id", "aria-label", "aria-labelledby"];
const wg = vue.defineComponent({ name: "ElRadioGroup" });
const xg = vue.defineComponent({ ...wg, props: bg, emits: gg, setup(e2, { emit: o2 }) {
const a2 = e2;
const r2 = Vu("radio");
const s2 = nf();
const d2 = vue.ref();
const { formItem: f2 } = Zf();
const { inputId: p2, isLabeledByFormItem: m2 } = Jf(a2, { formItemContext: f2 });
const h2 = (e3) => {
o2(fu, e3);
vue.nextTick(() => o2("change", e3));
};
vue.onMounted(() => {
const e3 = d2.value.querySelectorAll("[type=radio]");
const t2 = e3[0];
if (!Array.from(e3).some((e4) => e4.checked) && t2) {
t2.tabIndex = 0;
}
});
const b2 = vue.computed(() => a2.name || s2.value);
vue.provide(lg, vue.reactive({ ...vue.toRefs(a2), changeEvent: h2, name: b2 }));
vue.watch(() => a2.modelValue, () => {
if (a2.validateEvent) {
f2 == null ? void 0 : f2.validate("change").catch((e3) => ii());
}
});
Eu({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-radio-group", ref: "https://element-plus.org/en-US/component/radio.html" }, vue.computed(() => !!a2.label));
return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { id: vue.unref(p2), ref_key: "radioGroupRef", ref: d2, class: vue.normalizeClass(vue.unref(r2).b("group")), role: "radiogroup", "aria-label": !vue.unref(m2) ? e3.label || e3.ariaLabel || "radio-group" : void 0, "aria-labelledby": vue.unref(m2) ? vue.unref(f2).labelId : void 0 }, [vue.renderSlot(e3.$slots, "default")], 10, yg));
} });
var kg = jf(xg, [["__file", "radio-group.vue"]]);
su(dg, { RadioButton: hg, RadioGroup: kg });
const Sg = iu(kg);
const Cg = iu(hg);
var Eg = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
return function(e3, t3) {
var n2 = t3.prototype, o2 = n2.format;
n2.format = function(e4) {
var t4 = this, n3 = this.$locale();
if (!this.isValid()) return o2.bind(this)(e4);
var a2 = this.$utils(), r2 = (e4 || "YYYY-MM-DDTHH:mm:ssZ").replace(/\[([^\]]+)]|Q|wo|ww|w|WW|W|zzz|z|gggg|GGGG|Do|X|x|k{1,2}|S/g, function(e5) {
switch (e5) {
case "Q":
return Math.ceil((t4.$M + 1) / 3);
case "Do":
return n3.ordinal(t4.$D);
case "gggg":
return t4.weekYear();
case "GGGG":
return t4.isoWeekYear();
case "wo":
return n3.ordinal(t4.week(), "W");
case "w":
case "ww":
return a2.s(t4.week(), "w" === e5 ? 1 : 2, "0");
case "W":
case "WW":
return a2.s(t4.isoWeek(), "W" === e5 ? 1 : 2, "0");
case "k":
case "kk":
return a2.s(String(0 === t4.$H ? 24 : t4.$H), "k" === e5 ? 1 : 2, "0");
case "X":
return Math.floor(t4.$d.getTime() / 1e3);
case "x":
return t4.$d.getTime();
case "z":
return "[" + t4.offsetName() + "]";
case "zzz":
return "[" + t4.offsetName("long") + "]";
default:
return e5;
}
});
return o2.bind(this)(r2);
};
};
});
})(Eg);
var Mg = Eg.exports;
const Og = oh(Mg);
var _g = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
var e3 = "week", t3 = "year";
return function(n2, o2, a2) {
var r2 = o2.prototype;
r2.week = function(n3) {
if (void 0 === n3 && (n3 = null), null !== n3) return this.add(7 * (n3 - this.week()), "day");
var o3 = this.$locale().yearStart || 1;
if (11 === this.month() && this.date() > 25) {
var r3 = a2(this).startOf(t3).add(1, t3).date(o3), l2 = a2(this).endOf(e3);
if (r3.isBefore(l2)) return 1;
}
var s2 = a2(this).startOf(t3).date(o3).startOf(e3).subtract(1, "millisecond"), i2 = this.diff(s2, e3, true);
return i2 < 0 ? a2(this).startOf("week").week() : Math.ceil(i2);
}, r2.weeks = function(e4) {
return void 0 === e4 && (e4 = null), this.week(e4);
};
};
});
})(_g);
var $g = _g.exports;
const Lg = oh($g);
var Ag = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
return function(e3, t3) {
t3.prototype.weekYear = function() {
var e4 = this.month(), t4 = this.week(), n2 = this.year();
return 1 === t4 && 11 === e4 ? n2 + 1 : 0 === e4 && t4 >= 52 ? n2 - 1 : n2;
};
};
});
})(Ag);
var Dg = Ag.exports;
const Rg = oh(Dg);
var Tg = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
return function(e3, t3, n2) {
t3.prototype.dayOfYear = function(e4) {
var t4 = Math.round((n2(this).startOf("day") - n2(this).startOf("year")) / 864e5) + 1;
return null == e4 ? t4 : this.add(e4 - t4, "day");
};
};
});
})(Tg);
var Ng = Tg.exports;
const Pg = oh(Ng);
var Ig = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
return function(e3, t3) {
t3.prototype.isSameOrAfter = function(e4, t4) {
return this.isSame(e4, t4) || this.isAfter(e4, t4);
};
};
});
})(Ig);
var Vg = Ig.exports;
const Bg = oh(Vg);
var Fg = { exports: {} };
(function(e2, t2) {
!function(t3, n2) {
e2.exports = n2();
}(nh, function() {
return function(e3, t3) {
t3.prototype.isSameOrBefore = function(e4, t4) {
return this.isSame(e4, t4) || this.isBefore(e4, t4);
};
};
});
})(Fg);
var jg = Fg.exports;
const zg = oh(jg);
const Hg = Symbol();
const Wg = ou({ ...Eh, type: { type: eu(String), default: "date" } });
const Yg = ["date", "dates", "year", "years", "month", "months", "week", "range"];
const Ug = ou({ disabledDate: { type: eu(Function) }, date: { type: eu(Object), required: true }, minDate: { type: eu(Object) }, maxDate: { type: eu(Object) }, parsedValue: { type: eu([Object, Array]) }, rangeState: { type: eu(Object), default: () => ({ endDate: null, selecting: false }) } });
const Kg = ou({ type: { type: eu(String), required: true, values: du }, dateFormat: String, timeFormat: String });
const qg = ou({ unlinkPanels: Boolean, parsedValue: { type: eu(Array) } });
const Gg = (e2) => ({ type: String, values: Yg, default: e2 });
const Xg = ou({ ...Kg, parsedValue: { type: eu([Object, Array]) }, visible: { type: Boolean }, format: { type: String, default: "" } });
const Zg = ou({ ...Ug, cellClassName: { type: eu(Function) }, showWeekNumber: Boolean, selectionMode: Gg("date") });
const Jg = ["changerange", "pick", "select"];
const Qg = (e2) => {
if (!wt(e2)) return false;
const [t2, n2] = e2;
return lh.isDayjs(t2) && lh.isDayjs(n2) && t2.isSameOrBefore(n2);
};
const ey = (e2, { lang: t2, unit: n2, unlinkPanels: o2 }) => {
let a2;
if (wt(e2)) {
let [a3, r2] = e2.map((e3) => lh(e3).locale(t2));
if (!o2) {
r2 = a3.add(1, n2);
}
return [a3, r2];
} else if (e2) {
a2 = lh(e2);
} else {
a2 = lh();
}
a2 = a2.locale(t2);
return [a2, a2.add(1, n2)];
};
const ty = (e2, t2, { columnIndexOffset: n2, startDate: o2, nextEndDate: a2, now: r2, unit: l2, relativeDateGetter: s2, setCellMetadata: i2, setRowMetadata: u2 }) => {
for (let c2 = 0; c2 < e2.row; c2++) {
const d2 = t2[c2];
for (let t3 = 0; t3 < e2.column; t3++) {
let u3 = d2[t3 + n2];
if (!u3) {
u3 = { row: c2, column: t3, type: "normal", inRange: false, start: false, end: false };
}
const f2 = c2 * e2.column + t3;
const p2 = s2(f2);
u3.dayjs = p2;
u3.date = p2.toDate();
u3.timestamp = p2.valueOf();
u3.type = "normal";
u3.inRange = !!(o2 && p2.isSameOrAfter(o2, l2) && a2 && p2.isSameOrBefore(a2, l2)) || !!(o2 && p2.isSameOrBefore(o2, l2) && a2 && p2.isSameOrAfter(a2, l2));
if (o2 == null ? void 0 : o2.isSameOrAfter(a2)) {
u3.start = !!a2 && p2.isSame(a2, l2);
u3.end = o2 && p2.isSame(o2, l2);
} else {
u3.start = !!o2 && p2.isSame(o2, l2);
u3.end = !!a2 && p2.isSame(a2, l2);
}
const v2 = p2.isSame(r2, l2);
if (v2) {
u3.type = "today";
}
i2 == null ? void 0 : i2(u3, { rowIndex: c2, columnIndex: t3 });
d2[t3 + n2] = u3;
}
u2 == null ? void 0 : u2(d2);
}
};
const ny = (e2 = "") => ["normal", "today"].includes(e2);
const oy = (e2, t2) => {
const { lang: n2 } = Du();
const o2 = vue.ref();
const a2 = vue.ref();
const r2 = vue.ref();
const s2 = vue.ref();
const c2 = vue.ref([[], [], [], [], [], []]);
let d2 = false;
const f2 = e2.date.$locale().weekStart || 7;
const p2 = e2.date.locale("en").localeData().weekdaysShort().map((e3) => e3.toLowerCase());
const m2 = vue.computed(() => f2 > 3 ? 7 - f2 : -f2);
const h2 = vue.computed(() => {
const t3 = e2.date.startOf("month");
return t3.subtract(t3.day() || 7, "day");
});
const b2 = vue.computed(() => p2.concat(p2).slice(f2, f2 + 7));
const g2 = vue.computed(() => Sr(vue.unref(C2)).some((e3) => e3.isCurrent));
const y2 = vue.computed(() => {
const t3 = e2.date.startOf("month");
const n3 = t3.day() || 7;
const o3 = t3.daysInMonth();
const a3 = t3.subtract(1, "month").daysInMonth();
return { startOfMonthDay: n3, dateCountOfMonth: o3, dateCountOfLastMonth: a3 };
});
const w2 = vue.computed(() => e2.selectionMode === "dates" ? yu(e2.parsedValue) : []);
const x2 = (e3, { count: t3, rowIndex: n3, columnIndex: o3 }) => {
const { startOfMonthDay: a3, dateCountOfMonth: r3, dateCountOfLastMonth: l2 } = vue.unref(y2);
const s3 = vue.unref(m2);
if (n3 >= 0 && n3 <= 1) {
const r4 = a3 + s3 < 0 ? 7 + a3 + s3 : a3 + s3;
if (o3 + n3 * 7 >= r4) {
e3.text = t3;
return true;
} else {
e3.text = l2 - (r4 - o3 % 7) + 1 + n3 * 7;
e3.type = "prev-month";
}
} else {
if (t3 <= r3) {
e3.text = t3;
} else {
e3.text = t3 - r3;
e3.type = "next-month";
}
return true;
}
return false;
};
const k2 = (t3, { columnIndex: n3, rowIndex: o3 }, a3) => {
const { disabledDate: r3, cellClassName: l2 } = e2;
const s3 = vue.unref(w2);
const i2 = x2(t3, { count: a3, rowIndex: o3, columnIndex: n3 });
const c3 = t3.dayjs.toDate();
t3.selected = s3.find((e3) => e3.isSame(t3.dayjs, "day"));
t3.isSelected = !!t3.selected;
t3.isCurrent = O2(t3);
t3.disabled = r3 == null ? void 0 : r3(c3);
t3.customClass = l2 == null ? void 0 : l2(c3);
return i2;
};
const S2 = (t3) => {
if (e2.selectionMode === "week") {
const [n3, o3] = e2.showWeekNumber ? [1, 7] : [0, 6];
const a3 = B2(t3[n3 + 1]);
t3[n3].inRange = a3;
t3[n3].start = a3;
t3[o3].inRange = a3;
t3[o3].end = a3;
}
};
const C2 = vue.computed(() => {
const { minDate: t3, maxDate: o3, rangeState: a3, showWeekNumber: r3 } = e2;
const l2 = vue.unref(m2);
const s3 = vue.unref(c2);
const i2 = "day";
let d3 = 1;
if (r3) {
for (let e3 = 0; e3 < 6; e3++) {
if (!s3[e3][0]) {
s3[e3][0] = { type: "week", text: vue.unref(h2).add(e3 * 7 + 1, i2).week() };
}
}
}
ty({ row: 6, column: 7 }, s3, { startDate: t3, columnIndexOffset: r3 ? 1 : 0, nextEndDate: a3.endDate || o3 || a3.selecting && t3 || null, now: lh().locale(vue.unref(n2)).startOf(i2), unit: i2, relativeDateGetter: (e3) => vue.unref(h2).add(e3 - l2, i2), setCellMetadata: (...e3) => {
if (k2(...e3, d3)) {
d3 += 1;
}
}, setRowMetadata: S2 });
return s3;
});
vue.watch(() => e2.date, async () => {
var e3;
if ((e3 = vue.unref(o2)) == null ? void 0 : e3.contains(document.activeElement)) {
await vue.nextTick();
await E2();
}
});
const E2 = async () => {
var e3;
return (e3 = vue.unref(a2)) == null ? void 0 : e3.focus();
};
const O2 = (t3) => e2.selectionMode === "date" && ny(t3.type) && _2(t3, e2.parsedValue);
const _2 = (t3, o3) => {
if (!o3) return false;
return lh(o3).locale(vue.unref(n2)).isSame(e2.date.date(Number(t3.text)), "day");
};
const $2 = (t3, n3) => {
const o3 = t3 * 7 + (n3 - (e2.showWeekNumber ? 1 : 0)) - vue.unref(m2);
return vue.unref(h2).add(o3, "day");
};
const L2 = (n3) => {
var o3;
if (!e2.rangeState.selecting) return;
let a3 = n3.target;
if (a3.tagName === "SPAN") {
a3 = (o3 = a3.parentNode) == null ? void 0 : o3.parentNode;
}
if (a3.tagName === "DIV") {
a3 = a3.parentNode;
}
if (a3.tagName !== "TD") return;
const l2 = a3.parentNode.rowIndex - 1;
const i2 = a3.cellIndex;
if (vue.unref(C2)[l2][i2].disabled) return;
if (l2 !== vue.unref(r2) || i2 !== vue.unref(s2)) {
r2.value = l2;
s2.value = i2;
t2("changerange", { selecting: true, endDate: $2(l2, i2) });
}
};
const A2 = (e3) => !vue.unref(g2) && (e3 == null ? void 0 : e3.text) === 1 && e3.type === "normal" || e3.isCurrent;
const D2 = (t3) => {
if (d2 || vue.unref(g2) || e2.selectionMode !== "date") return;
V2(t3, true);
};
const R2 = (e3) => {
const t3 = e3.target.closest("td");
if (!t3) return;
d2 = true;
};
const T2 = (e3) => {
const t3 = e3.target.closest("td");
if (!t3) return;
d2 = false;
};
const N2 = (n3) => {
if (!e2.rangeState.selecting || !e2.minDate) {
t2("pick", { minDate: n3, maxDate: null });
t2("select", true);
} else {
if (n3 >= e2.minDate) {
t2("pick", { minDate: e2.minDate, maxDate: n3 });
} else {
t2("pick", { minDate: n3, maxDate: e2.minDate });
}
t2("select", false);
}
};
const P2 = (e3) => {
const n3 = e3.week();
const o3 = `${e3.year()}w${n3}`;
t2("pick", { year: e3.year(), week: n3, value: o3, date: e3.startOf("week") });
};
const I2 = (n3, o3) => {
const a3 = o3 ? yu(e2.parsedValue).filter((e3) => (e3 == null ? void 0 : e3.valueOf()) !== n3.valueOf()) : yu(e2.parsedValue).concat([n3]);
t2("pick", a3);
};
const V2 = (n3, o3 = false) => {
const a3 = n3.target.closest("td");
if (!a3) return;
const r3 = a3.parentNode.rowIndex - 1;
const l2 = a3.cellIndex;
const s3 = vue.unref(C2)[r3][l2];
if (s3.disabled || s3.type === "week") return;
const i2 = $2(r3, l2);
switch (e2.selectionMode) {
case "range": {
N2(i2);
break;
}
case "date": {
t2("pick", i2, o3);
break;
}
case "week": {
P2(i2);
break;
}
case "dates": {
I2(i2, !!s3.selected);
break;
}
}
};
const B2 = (t3) => {
if (e2.selectionMode !== "week") return false;
let n3 = e2.date.startOf("day");
if (t3.type === "prev-month") {
n3 = n3.subtract(1, "month");
}
if (t3.type === "next-month") {
n3 = n3.add(1, "month");
}
n3 = n3.date(Number.parseInt(t3.text, 10));
if (e2.parsedValue && !Array.isArray(e2.parsedValue)) {
const t4 = (e2.parsedValue.day() - f2 + 7) % 7 - 1;
const o3 = e2.parsedValue.subtract(t4, "day");
return o3.isSame(n3, "day");
}
return false;
};
return { WEEKS: b2, rows: C2, tbodyRef: o2, currentCellRef: a2, focus: E2, isCurrent: O2, isWeekActive: B2, isSelectedCell: A2, handlePickDate: V2, handleMouseUp: T2, handleMouseDown: R2, handleMouseMove: L2, handleFocus: D2 };
};
const ay = (e2, { isCurrent: t2, isWeekActive: n2 }) => {
const o2 = Vu("date-table");
const { t: a2 } = Du();
const r2 = vue.computed(() => [o2.b(), { "is-week-mode": e2.selectionMode === "week" }]);
const s2 = vue.computed(() => a2("el.datepicker.dateTablePrompt"));
const i2 = vue.computed(() => a2("el.datepicker.week"));
const u2 = (n3) => {
const o3 = [];
if (ny(n3.type) && !n3.disabled) {
o3.push("available");
if (n3.type === "today") {
o3.push("today");
}
} else {
o3.push(n3.type);
}
if (t2(n3)) {
o3.push("current");
}
if (n3.inRange && (ny(n3.type) || e2.selectionMode === "week")) {
o3.push("in-range");
if (n3.start) {
o3.push("start-date");
}
if (n3.end) {
o3.push("end-date");
}
}
if (n3.disabled) {
o3.push("disabled");
}
if (n3.selected) {
o3.push("selected");
}
if (n3.customClass) {
o3.push(n3.customClass);
}
return o3.join(" ");
};
const c2 = (e3) => [o2.e("row"), { current: n2(e3) }];
return { tableKls: r2, tableLabel: s2, weekLabel: i2, getCellClasses: u2, getRowKls: c2, t: a2 };
};
const ry = ou({ cell: { type: eu(Object) } });
var ly = vue.defineComponent({ name: "ElDatePickerCell", props: ry, setup(e2) {
const t2 = Vu("date-table-cell");
const { slots: n2 } = vue.inject(Hg);
return () => {
const { cell: o2 } = e2;
return vue.renderSlot(n2, "default", { ...o2 }, () => [vue.createVNode("div", { class: t2.b() }, [vue.createVNode("span", { class: t2.e("text") }, [o2 == null ? void 0 : o2.text])])]);
};
} });
const sy = ["aria-label"];
const iy = { key: 0, scope: "col" };
const uy = ["aria-label"];
const cy = ["aria-current", "aria-selected", "tabindex"];
const dy = vue.defineComponent({ __name: "basic-date-table", props: Zg, emits: Jg, setup(e2, { expose: a2, emit: r2 }) {
const l2 = e2;
const { WEEKS: s2, rows: i2, tbodyRef: c2, currentCellRef: d2, focus: f2, isCurrent: p2, isWeekActive: v2, isSelectedCell: m2, handlePickDate: h2, handleMouseUp: b2, handleMouseDown: g2, handleMouseMove: y2, handleFocus: w2 } = oy(l2, r2);
const { tableLabel: x2, tableKls: k2, weekLabel: S2, getCellClasses: C2, getRowKls: E2, t: M2 } = ay(l2, { isCurrent: p2, isWeekActive: v2 });
a2({ focus: f2 });
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("table", { "aria-label": vue.unref(x2), class: vue.normalizeClass(vue.unref(k2)), cellspacing: "0", cellpadding: "0", role: "grid", onClick: a3[1] || (a3[1] = (...e4) => vue.unref(h2) && vue.unref(h2)(...e4)), onMousemove: a3[2] || (a3[2] = (...e4) => vue.unref(y2) && vue.unref(y2)(...e4)), onMousedown: a3[3] || (a3[3] = vue.withModifiers((...e4) => vue.unref(g2) && vue.unref(g2)(...e4), ["prevent"])), onMouseup: a3[4] || (a3[4] = (...e4) => vue.unref(b2) && vue.unref(b2)(...e4)) }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: c2 }, [vue.createElementVNode("tr", null, [e3.showWeekNumber ? (vue.openBlock(), vue.createElementBlock("th", iy, vue.toDisplayString(vue.unref(S2)), 1)) : vue.createCommentVNode("v-if", true), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(s2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("th", { key: o2, "aria-label": vue.unref(M2)("el.datepicker.weeksFull." + e4), scope: "col" }, vue.toDisplayString(vue.unref(M2)("el.datepicker.weeks." + e4)), 9, uy))), 128))]), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(i2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("tr", { key: o2, class: vue.normalizeClass(vue.unref(E2)(e4[1])) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, r3) => (vue.openBlock(), vue.createElementBlock("td", { key: `${o2}.${r3}`, ref_for: true, ref: (t2) => vue.unref(m2)(e5) && (d2.value = t2), class: vue.normalizeClass(vue.unref(C2)(e5)), "aria-current": e5.isCurrent ? "date" : void 0, "aria-selected": e5.isCurrent, tabindex: vue.unref(m2)(e5) ? 0 : -1, onFocus: a3[0] || (a3[0] = (...e6) => vue.unref(w2) && vue.unref(w2)(...e6)) }, [vue.createVNode(vue.unref(ly), { cell: e5 }, null, 8, ["cell"])], 42, cy))), 128))], 2))), 128))], 512)], 42, sy));
} });
var fy = jf(dy, [["__file", "basic-date-table.vue"]]);
const py = ou({ ...Ug, selectionMode: Gg("month") });
const vy = ["aria-label"];
const my = ["aria-selected", "aria-label", "tabindex", "onKeydown"];
const hy = { class: "cell" };
const by = vue.defineComponent({ __name: "basic-month-table", props: py, emits: ["changerange", "pick", "select"], setup(e2, { expose: a2, emit: r2 }) {
const s2 = e2;
const c2 = (e3, t2, n2) => {
const o2 = lh().locale(n2).startOf("month").month(t2).year(e3);
const a3 = o2.daysInMonth();
return mh(a3).map((e4) => o2.add(e4, "day").toDate());
};
const d2 = Vu("month-table");
const { t: f2, lang: p2 } = Du();
const m2 = vue.ref();
const h2 = vue.ref();
const b2 = vue.ref(s2.date.locale("en").localeData().monthsShort().map((e3) => e3.toLowerCase()));
const g2 = vue.ref([[], [], []]);
const y2 = vue.ref();
const w2 = vue.ref();
const x2 = vue.computed(() => {
var e3, t2;
const n2 = g2.value;
const o2 = lh().locale(p2.value).startOf("month");
for (let a3 = 0; a3 < 3; a3++) {
const r3 = n2[a3];
for (let n3 = 0; n3 < 4; n3++) {
const l2 = r3[n3] || (r3[n3] = { row: a3, column: n3, type: "normal", inRange: false, start: false, end: false, text: -1, disabled: false });
l2.type = "normal";
const i2 = a3 * 4 + n3;
const u2 = s2.date.startOf("year").month(i2);
const c3 = s2.rangeState.endDate || s2.maxDate || s2.rangeState.selecting && s2.minDate || null;
l2.inRange = !!(s2.minDate && u2.isSameOrAfter(s2.minDate, "month") && c3 && u2.isSameOrBefore(c3, "month")) || !!(s2.minDate && u2.isSameOrBefore(s2.minDate, "month") && c3 && u2.isSameOrAfter(c3, "month"));
if ((e3 = s2.minDate) == null ? void 0 : e3.isSameOrAfter(c3)) {
l2.start = !!(c3 && u2.isSame(c3, "month"));
l2.end = s2.minDate && u2.isSame(s2.minDate, "month");
} else {
l2.start = !!(s2.minDate && u2.isSame(s2.minDate, "month"));
l2.end = !!(c3 && u2.isSame(c3, "month"));
}
const d3 = o2.isSame(u2);
if (d3) {
l2.type = "today";
}
l2.text = i2;
l2.disabled = ((t2 = s2.disabledDate) == null ? void 0 : t2.call(s2, u2.toDate())) || false;
}
}
return n2;
});
const k2 = () => {
var e3;
(e3 = h2.value) == null ? void 0 : e3.focus();
};
const S2 = (e3) => {
const t2 = {};
const n2 = s2.date.year();
const o2 = /* @__PURE__ */ new Date();
const a3 = e3.text;
t2.disabled = s2.disabledDate ? c2(n2, a3, p2.value).every(s2.disabledDate) : false;
t2.current = yu(s2.parsedValue).findIndex((e4) => lh.isDayjs(e4) && e4.year() === n2 && e4.month() === a3) >= 0;
t2.today = o2.getFullYear() === n2 && o2.getMonth() === a3;
if (e3.inRange) {
t2["in-range"] = true;
if (e3.start) {
t2["start-date"] = true;
}
if (e3.end) {
t2["end-date"] = true;
}
}
return t2;
};
const C2 = (e3) => {
const t2 = s2.date.year();
const n2 = e3.text;
return yu(s2.date).findIndex((e4) => e4.year() === t2 && e4.month() === n2) >= 0;
};
const E2 = (e3) => {
var t2;
if (!s2.rangeState.selecting) return;
let n2 = e3.target;
if (n2.tagName === "SPAN") {
n2 = (t2 = n2.parentNode) == null ? void 0 : t2.parentNode;
}
if (n2.tagName === "DIV") {
n2 = n2.parentNode;
}
if (n2.tagName !== "TD") return;
const o2 = n2.parentNode.rowIndex;
const a3 = n2.cellIndex;
if (x2.value[o2][a3].disabled) return;
if (o2 !== y2.value || a3 !== w2.value) {
y2.value = o2;
w2.value = a3;
r2("changerange", { selecting: true, endDate: s2.date.startOf("year").month(o2 * 4 + a3) });
}
};
const O2 = (e3) => {
var t2;
const n2 = (t2 = e3.target) == null ? void 0 : t2.closest("td");
if ((n2 == null ? void 0 : n2.tagName) !== "TD") return;
if (ci(n2, "disabled")) return;
const o2 = n2.cellIndex;
const a3 = n2.parentNode.rowIndex;
const l2 = a3 * 4 + o2;
const i2 = s2.date.startOf("year").month(l2);
if (s2.selectionMode === "months") {
if (e3.type === "keydown") {
r2("pick", yu(s2.parsedValue), false);
return;
}
const t3 = s2.date.startOf("month").month(l2);
const o3 = ci(n2, "current") ? yu(s2.parsedValue).filter((e4) => Number(e4) !== Number(t3)) : yu(s2.parsedValue).concat([lh(t3)]);
r2("pick", o3);
} else if (s2.selectionMode === "range") {
if (!s2.rangeState.selecting) {
r2("pick", { minDate: i2, maxDate: null });
r2("select", true);
} else {
if (s2.minDate && i2 >= s2.minDate) {
r2("pick", { minDate: s2.minDate, maxDate: i2 });
} else {
r2("pick", { minDate: i2, maxDate: s2.minDate });
}
r2("select", false);
}
} else {
r2("pick", l2);
}
};
vue.watch(() => s2.date, async () => {
var e3, t2;
if ((e3 = m2.value) == null ? void 0 : e3.contains(document.activeElement)) {
await vue.nextTick();
(t2 = h2.value) == null ? void 0 : t2.focus();
}
});
a2({ focus: k2 });
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("table", { role: "grid", "aria-label": vue.unref(f2)("el.datepicker.monthTablePrompt"), class: vue.normalizeClass(vue.unref(d2).b()), onClick: O2, onMousemove: E2 }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: m2 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(x2), (e4, a4) => (vue.openBlock(), vue.createElementBlock("tr", { key: a4 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, a5) => (vue.openBlock(), vue.createElementBlock("td", { key: a5, ref_for: true, ref: (t2) => C2(e5) && (h2.value = t2), class: vue.normalizeClass(S2(e5)), "aria-selected": `${C2(e5)}`, "aria-label": vue.unref(f2)(`el.datepicker.month${+e5.text + 1}`), tabindex: C2(e5) ? 0 : -1, onKeydown: [vue.withKeys(vue.withModifiers(O2, ["prevent", "stop"]), ["space"]), vue.withKeys(vue.withModifiers(O2, ["prevent", "stop"]), ["enter"])] }, [vue.createElementVNode("div", null, [vue.createElementVNode("span", hy, vue.toDisplayString(vue.unref(f2)("el.datepicker.months." + b2.value[e5.text])), 1)])], 42, my))), 128))]))), 128))], 512)], 42, vy));
} });
var gy = jf(by, [["__file", "basic-month-table.vue"]]);
const { date: yy, disabledDate: wy, parsedValue: xy } = Ug;
const ky = ou({ date: yy, disabledDate: wy, parsedValue: xy, selectionMode: Gg("year") });
const Sy = ["aria-label"];
const Cy = ["aria-selected", "tabindex", "onKeydown"];
const Ey = { class: "cell" };
const My = { key: 1 };
const Oy = vue.defineComponent({ __name: "basic-year-table", props: ky, emits: ["pick"], setup(e2, { expose: a2, emit: r2 }) {
const s2 = e2;
const c2 = (e3, t2) => {
const n2 = lh(String(e3)).locale(t2).startOf("year");
const o2 = n2.endOf("year");
const a3 = o2.dayOfYear();
return mh(a3).map((e4) => n2.add(e4, "day").toDate());
};
const d2 = Vu("year-table");
const { t: f2, lang: p2 } = Du();
const m2 = vue.ref();
const h2 = vue.ref();
const b2 = vue.computed(() => Math.floor(s2.date.year() / 10) * 10);
const g2 = () => {
var e3;
(e3 = h2.value) == null ? void 0 : e3.focus();
};
const y2 = (e3) => {
const t2 = {};
const n2 = lh().locale(p2.value);
t2.disabled = s2.disabledDate ? c2(e3, p2.value).every(s2.disabledDate) : false;
t2.current = yu(s2.parsedValue).findIndex((t3) => t3.year() === e3) >= 0;
t2.today = n2.year() === e3;
return t2;
};
const w2 = (e3) => e3 === b2.value && s2.date.year() < b2.value && s2.date.year() > b2.value + 9 || yu(s2.date).findIndex((t2) => t2.year() === e3) >= 0 || yu(s2.parsedValue).findIndex((t2) => (t2 == null ? void 0 : t2.year()) === e3) >= 0;
const x2 = (e3) => {
const t2 = e3.target;
const n2 = t2.closest("td");
if (n2 && n2.textContent) {
if (ci(n2, "disabled")) return;
const t3 = n2.textContent || n2.innerText;
if (s2.selectionMode === "years") {
if (e3.type === "keydown") {
r2("pick", yu(s2.parsedValue), false);
return;
}
const o2 = ci(n2, "current") ? yu(s2.parsedValue).filter((e4) => (e4 == null ? void 0 : e4.year()) !== Number(t3)) : yu(s2.parsedValue).concat([lh(t3)]);
r2("pick", o2);
} else {
r2("pick", Number(t3));
}
}
};
vue.watch(() => s2.date, async () => {
var e3, t2;
if ((e3 = m2.value) == null ? void 0 : e3.contains(document.activeElement)) {
await vue.nextTick();
(t2 = h2.value) == null ? void 0 : t2.focus();
}
});
a2({ focus: g2 });
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("table", { role: "grid", "aria-label": vue.unref(f2)("el.datepicker.yearTablePrompt"), class: vue.normalizeClass(vue.unref(d2).b()), onClick: x2 }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: m2 }, [(vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(3, (e4, a4) => vue.createElementVNode("tr", { key: a4 }, [(vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(4, (e5, r3) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: a4 + "_" + r3 }, [a4 * 4 + r3 < 10 ? (vue.openBlock(), vue.createElementBlock("td", { key: 0, ref_for: true, ref: (e6) => w2(vue.unref(b2) + a4 * 4 + r3) && (h2.value = e6), class: vue.normalizeClass(["available", y2(vue.unref(b2) + a4 * 4 + r3)]), "aria-selected": `${w2(vue.unref(b2) + a4 * 4 + r3)}`, tabindex: w2(vue.unref(b2) + a4 * 4 + r3) ? 0 : -1, onKeydown: [vue.withKeys(vue.withModifiers(x2, ["prevent", "stop"]), ["space"]), vue.withKeys(vue.withModifiers(x2, ["prevent", "stop"]), ["enter"])] }, [vue.createElementVNode("div", null, [vue.createElementVNode("span", Ey, vue.toDisplayString(vue.unref(b2) + a4 * 4 + r3), 1)])], 42, Cy)) : (vue.openBlock(), vue.createElementBlock("td", My))], 64))), 64))])), 64))], 512)], 10, Sy));
} });
var _y = jf(Oy, [["__file", "basic-year-table.vue"]]);
const $y = ["onClick"];
const Ly = ["aria-label"];
const Ay = ["aria-label"];
const Dy = ["aria-label"];
const Ry = ["aria-label"];
const Ty = vue.defineComponent({ __name: "panel-date-pick", props: Xg, emits: ["pick", "set-picker-option", "panel-change"], setup(e2, { emit: a2 }) {
const r2 = e2;
const s2 = (e3, t2, n2) => true;
const c2 = Vu("picker-panel");
const d2 = Vu("date-picker");
const f2 = vue.useAttrs();
const m2 = vue.useSlots();
const { t: h2, lang: b2 } = Du();
const g2 = vue.inject("EP_PICKER_BASE");
const y2 = vue.inject(zv);
const { shortcuts: w2, disabledDate: S2, cellClassName: D2, defaultTime: R2 } = g2.props;
const P2 = vue.toRef(g2.props, "defaultValue");
const I2 = vue.ref();
const F2 = vue.ref(lh().locale(b2.value));
const j2 = vue.ref(false);
let z2 = false;
const H2 = vue.computed(() => lh(R2).locale(b2.value));
const W2 = vue.computed(() => F2.value.month());
const Y2 = vue.computed(() => F2.value.year());
const U2 = vue.ref([]);
const K2 = vue.ref(null);
const X2 = vue.ref(null);
const Z2 = (e3) => U2.value.length > 0 ? s2(e3, U2.value, r2.format || "HH:mm:ss") : true;
const J2 = (e3) => {
if (R2 && !ke2.value && !j2.value && !z2) {
return H2.value.year(e3.year()).month(e3.month()).date(e3.date());
}
if (ve2.value) return e3.millisecond(0);
return e3.startOf("day");
};
const Q2 = (e3, ...t2) => {
if (!e3) {
a2("pick", e3, ...t2);
} else if (wt(e3)) {
const n2 = e3.map(J2);
a2("pick", n2, ...t2);
} else {
a2("pick", J2(e3), ...t2);
}
K2.value = null;
X2.value = null;
j2.value = false;
z2 = false;
};
const te2 = async (e3, t2) => {
if (se2.value === "date") {
e3 = e3;
let n2 = r2.parsedValue ? r2.parsedValue.year(e3.year()).month(e3.month()).date(e3.date()) : e3;
if (!Z2(n2)) {
n2 = U2.value[0][0].year(e3.year()).month(e3.month()).date(e3.date());
}
F2.value = n2;
Q2(n2, ve2.value || t2);
if (r2.type === "datetime") {
await vue.nextTick();
Ne2();
}
} else if (se2.value === "week") {
Q2(e3.date);
} else if (se2.value === "dates") {
Q2(e3, true);
}
};
const ne2 = (e3) => {
const t2 = e3 ? "add" : "subtract";
F2.value = F2.value[t2](1, "month");
Ve2("month");
};
const oe2 = (e3) => {
const t2 = F2.value;
const n2 = e3 ? "add" : "subtract";
F2.value = ae2.value === "year" ? t2[n2](10, "year") : t2[n2](1, "year");
Ve2("year");
};
const ae2 = vue.ref("date");
const re2 = vue.computed(() => {
const e3 = h2("el.datepicker.year");
if (ae2.value === "year") {
const t2 = Math.floor(Y2.value / 10) * 10;
if (e3) {
return `${t2} ${e3} - ${t2 + 9} ${e3}`;
}
return `${t2} - ${t2 + 9}`;
}
return `${Y2.value} ${e3}`;
});
const le2 = (e3) => {
const t2 = kt(e3.value) ? e3.value() : e3.value;
if (t2) {
z2 = true;
Q2(lh(t2).locale(b2.value));
return;
}
if (e3.onClick) {
e3.onClick({ attrs: f2, slots: m2, emit: a2 });
}
};
const se2 = vue.computed(() => {
const { type: e3 } = r2;
if (["week", "month", "months", "year", "years", "dates"].includes(e3)) return e3;
return "date";
});
const ie2 = vue.computed(() => se2.value === "dates" || se2.value === "months" || se2.value === "years");
const ue2 = vue.computed(() => se2.value === "date" ? ae2.value : se2.value);
const ce2 = vue.computed(() => !!w2.length);
const de2 = async (e3, t2) => {
if (se2.value === "month") {
F2.value = F2.value.startOf("month").month(e3);
Q2(F2.value, false);
} else if (se2.value === "months") {
Q2(e3, t2 != null ? t2 : true);
} else {
F2.value = F2.value.startOf("month").month(e3);
ae2.value = "date";
if (["month", "year", "date", "week"].includes(se2.value)) {
Q2(F2.value, true);
await vue.nextTick();
Ne2();
}
}
Ve2("month");
};
const fe2 = async (e3, t2) => {
if (se2.value === "year") {
F2.value = F2.value.startOf("year").year(e3);
Q2(F2.value, false);
} else if (se2.value === "years") {
Q2(e3, t2 != null ? t2 : true);
} else {
F2.value = F2.value.year(e3);
ae2.value = "month";
if (["month", "year", "date", "week"].includes(se2.value)) {
Q2(F2.value, true);
await vue.nextTick();
Ne2();
}
}
Ve2("year");
};
const pe2 = async (e3) => {
ae2.value = e3;
await vue.nextTick();
Ne2();
};
const ve2 = vue.computed(() => r2.type === "datetime" || r2.type === "datetimerange");
const me2 = vue.computed(() => {
const e3 = ve2.value || se2.value === "dates";
const t2 = se2.value === "years";
const n2 = se2.value === "months";
const o2 = ae2.value === "date";
const a3 = ae2.value === "year";
const r3 = ae2.value === "month";
return e3 && o2 || t2 && a3 || n2 && r3;
});
const he2 = vue.computed(() => {
if (!S2) return false;
if (!r2.parsedValue) return true;
if (wt(r2.parsedValue)) {
return S2(r2.parsedValue[0].toDate());
}
return S2(r2.parsedValue.toDate());
});
const be2 = () => {
if (ie2.value) {
Q2(r2.parsedValue);
} else {
let e3 = r2.parsedValue;
if (!e3) {
const t2 = lh(R2).locale(b2.value);
const n2 = Te2();
e3 = t2.year(n2.year()).month(n2.month()).date(n2.date());
}
F2.value = e3;
Q2(e3);
}
};
const ge2 = vue.computed(() => {
if (!S2) return false;
return S2(lh().locale(b2.value).toDate());
});
const ye2 = () => {
const e3 = lh().locale(b2.value);
const t2 = e3.toDate();
j2.value = true;
if ((!S2 || !S2(t2)) && Z2(t2)) {
F2.value = lh().locale(b2.value);
Q2(F2.value);
}
};
const we2 = vue.computed(() => r2.timeFormat || bh(r2.format));
const xe2 = vue.computed(() => r2.dateFormat || hh(r2.format));
const ke2 = vue.computed(() => {
if (X2.value) return X2.value;
if (!r2.parsedValue && !P2.value) return;
return (r2.parsedValue || F2.value).format(we2.value);
});
const Se2 = vue.computed(() => {
if (K2.value) return K2.value;
if (!r2.parsedValue && !P2.value) return;
return (r2.parsedValue || F2.value).format(xe2.value);
});
const Ce2 = vue.ref(false);
const Ee2 = () => {
Ce2.value = true;
};
const Me2 = () => {
Ce2.value = false;
};
const Oe2 = (e3) => ({ hour: e3.hour(), minute: e3.minute(), second: e3.second(), year: e3.year(), month: e3.month(), date: e3.date() });
const _e2 = (e3, t2, n2) => {
const { hour: o2, minute: a3, second: l2 } = Oe2(e3);
const s3 = r2.parsedValue ? r2.parsedValue.hour(o2).minute(a3).second(l2) : e3;
F2.value = s3;
Q2(F2.value, true);
if (!n2) {
Ce2.value = t2;
}
};
const $e2 = (e3) => {
const t2 = lh(e3, we2.value).locale(b2.value);
if (t2.isValid() && Z2(t2)) {
const { year: e4, month: n2, date: o2 } = Oe2(F2.value);
F2.value = t2.year(e4).month(n2).date(o2);
X2.value = null;
Ce2.value = false;
Q2(F2.value, true);
}
};
const Le2 = (e3) => {
const t2 = lh(e3, xe2.value).locale(b2.value);
if (t2.isValid()) {
if (S2 && S2(t2.toDate())) {
return;
}
const { hour: e4, minute: n2, second: o2 } = Oe2(F2.value);
F2.value = t2.hour(e4).minute(n2).second(o2);
K2.value = null;
Q2(F2.value, true);
}
};
const Ae2 = (e3) => lh.isDayjs(e3) && e3.isValid() && (S2 ? !S2(e3.toDate()) : true);
const De2 = (e3) => wt(e3) ? e3.map((e4) => e4.format(r2.format)) : e3.format(r2.format);
const Re2 = (e3) => lh(e3, r2.format).locale(b2.value);
const Te2 = () => {
const e3 = lh(P2.value).locale(b2.value);
if (!P2.value) {
const e4 = H2.value;
return lh().hour(e4.hour()).minute(e4.minute()).second(e4.second()).locale(b2.value);
}
return e3;
};
const Ne2 = async () => {
var e3;
if (["week", "month", "year", "date"].includes(se2.value)) {
(e3 = I2.value) == null ? void 0 : e3.focus();
if (se2.value === "week") {
Ie2(cu.down);
}
}
};
const Pe2 = (e3) => {
const { code: t2 } = e3;
const n2 = [cu.up, cu.down, cu.left, cu.right, cu.home, cu.end, cu.pageUp, cu.pageDown];
if (n2.includes(t2)) {
Ie2(t2);
e3.stopPropagation();
e3.preventDefault();
}
if ([cu.enter, cu.space, cu.numpadEnter].includes(t2) && K2.value === null && X2.value === null) {
e3.preventDefault();
Q2(F2.value, false);
}
};
const Ie2 = (e3) => {
var t2;
const { up: n2, down: o2, left: r3, right: l2, home: s3, end: i2, pageUp: u2, pageDown: c3 } = cu;
const d3 = { year: { [n2]: -4, [o2]: 4, [r3]: -1, [l2]: 1, offset: (e4, t3) => e4.setFullYear(e4.getFullYear() + t3) }, month: { [n2]: -4, [o2]: 4, [r3]: -1, [l2]: 1, offset: (e4, t3) => e4.setMonth(e4.getMonth() + t3) }, week: { [n2]: -1, [o2]: 1, [r3]: -1, [l2]: 1, offset: (e4, t3) => e4.setDate(e4.getDate() + t3 * 7) }, date: { [n2]: -7, [o2]: 7, [r3]: -1, [l2]: 1, [s3]: (e4) => -e4.getDay(), [i2]: (e4) => -e4.getDay() + 6, [u2]: (e4) => -new Date(e4.getFullYear(), e4.getMonth(), 0).getDate(), [c3]: (e4) => new Date(e4.getFullYear(), e4.getMonth() + 1, 0).getDate(), offset: (e4, t3) => e4.setDate(e4.getDate() + t3) } };
const f3 = F2.value.toDate();
while (Math.abs(F2.value.diff(f3, "year", true)) < 1) {
const n3 = d3[ue2.value];
if (!n3) return;
n3.offset(f3, kt(n3[e3]) ? n3[e3](f3) : (t2 = n3[e3]) != null ? t2 : 0);
if (S2 && S2(f3)) {
break;
}
const o3 = lh(f3).locale(b2.value);
F2.value = o3;
a2("pick", o3, true);
break;
}
};
const Ve2 = (e3) => {
a2("panel-change", F2.value.toDate(), e3, ae2.value);
};
vue.watch(() => se2.value, (e3) => {
if (["month", "year"].includes(e3)) {
ae2.value = e3;
return;
} else if (e3 === "years") {
ae2.value = "year";
return;
} else if (e3 === "months") {
ae2.value = "month";
return;
}
ae2.value = "date";
}, { immediate: true });
vue.watch(() => ae2.value, () => {
y2 == null ? void 0 : y2.updatePopper();
});
vue.watch(() => P2.value, (e3) => {
if (e3) {
F2.value = Te2();
}
}, { immediate: true });
vue.watch(() => r2.parsedValue, (e3) => {
if (e3) {
if (ie2.value) return;
if (Array.isArray(e3)) return;
F2.value = e3;
} else {
F2.value = Te2();
}
}, { immediate: true });
a2("set-picker-option", ["isValidValue", Ae2]);
a2("set-picker-option", ["formatToString", De2]);
a2("set-picker-option", ["parseUserInput", Re2]);
a2("set-picker-option", ["handleFocusPicker", Ne2]);
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(c2).b(), vue.unref(d2).b(), { "has-sidebar": e3.$slots.sidebar || vue.unref(ce2), "has-time": vue.unref(ve2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(c2).e("sidebar")) }), vue.unref(ce2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(c2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(w2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("button", { key: o2, type: "button", class: vue.normalizeClass(vue.unref(c2).e("shortcut")), onClick: (t2) => le2(e4) }, vue.toDisplayString(e4.text), 11, $y))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("body")) }, [vue.unref(ve2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("time-header")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("editor-wrap")) }, [vue.createVNode(vue.unref(fp), { placeholder: vue.unref(h2)("el.datepicker.selectDate"), "model-value": vue.unref(Se2), size: "small", "validate-event": false, onInput: a3[0] || (a3[0] = (e4) => K2.value = e4), onChange: Le2 }, null, 8, ["placeholder", "model-value"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(d2).e("editor-wrap")) }, [vue.createVNode(vue.unref(fp), { placeholder: vue.unref(h2)("el.datepicker.selectTime"), "model-value": vue.unref(ke2), size: "small", "validate-event": false, onFocus: Ee2, onInput: a3[1] || (a3[1] = (e4) => X2.value = e4), onChange: $e2 }, null, 8, ["placeholder", "model-value"]), vue.createVNode(vue.unref(_b), { visible: Ce2.value, format: vue.unref(we2), "parsed-value": F2.value, onPick: _e2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(Fh), Me2]])], 2)) : vue.createCommentVNode("v-if", true), vue.withDirectives(vue.createElementVNode("div", { class: vue.normalizeClass([vue.unref(d2).e("header"), (ae2.value === "year" || ae2.value === "month") && vue.unref(d2).e("header--bordered")]) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("prev-btn")) }, [vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.prevYear`), class: vue.normalizeClass(["d-arrow-left", vue.unref(c2).e("icon-btn")]), onClick: a3[2] || (a3[2] = (e4) => oe2(false)) }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Pi))]), _: 1 })], 10, Ly), vue.withDirectives(vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.prevMonth`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "arrow-left"]), onClick: a3[3] || (a3[3] = (e4) => ne2(false)) }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(wi))]), _: 1 })], 10, Ay), [[vue.vShow, ae2.value === "date"]])], 2), vue.createElementVNode("span", { role: "button", class: vue.normalizeClass(vue.unref(d2).e("header-label")), "aria-live": "polite", tabindex: "0", onKeydown: a3[4] || (a3[4] = vue.withKeys((e4) => pe2("year"), ["enter"])), onClick: a3[5] || (a3[5] = (e4) => pe2("year")) }, vue.toDisplayString(vue.unref(re2)), 35), vue.withDirectives(vue.createElementVNode("span", { role: "button", "aria-live": "polite", tabindex: "0", class: vue.normalizeClass([vue.unref(d2).e("header-label"), { active: ae2.value === "month" }]), onKeydown: a3[6] || (a3[6] = vue.withKeys((e4) => pe2("month"), ["enter"])), onClick: a3[7] || (a3[7] = (e4) => pe2("month")) }, vue.toDisplayString(vue.unref(h2)(`el.datepicker.month${vue.unref(W2) + 1}`)), 35), [[vue.vShow, ae2.value === "date"]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("next-btn")) }, [vue.withDirectives(vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.nextMonth`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "arrow-right"]), onClick: a3[8] || (a3[8] = (e4) => ne2(true)) }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ki))]), _: 1 })], 10, Dy), [[vue.vShow, ae2.value === "date"]]), vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.nextYear`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "d-arrow-right"]), onClick: a3[9] || (a3[9] = (e4) => oe2(true)) }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })], 10, Ry)], 2)], 2), [[vue.vShow, ae2.value !== "time"]]), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("content")), onKeydown: Pe2 }, [ae2.value === "date" ? (vue.openBlock(), vue.createBlock(fy, { key: 0, ref_key: "currentViewRef", ref: I2, "selection-mode": vue.unref(se2), date: F2.value, "parsed-value": e3.parsedValue, "disabled-date": vue.unref(S2), "cell-class-name": vue.unref(D2), onPick: te2 }, null, 8, ["selection-mode", "date", "parsed-value", "disabled-date", "cell-class-name"])) : vue.createCommentVNode("v-if", true), ae2.value === "year" ? (vue.openBlock(), vue.createBlock(_y, { key: 1, ref_key: "currentViewRef", ref: I2, "selection-mode": vue.unref(se2), date: F2.value, "disabled-date": vue.unref(S2), "parsed-value": e3.parsedValue, onPick: fe2 }, null, 8, ["selection-mode", "date", "disabled-date", "parsed-value"])) : vue.createCommentVNode("v-if", true), ae2.value === "month" ? (vue.openBlock(), vue.createBlock(gy, { key: 2, ref_key: "currentViewRef", ref: I2, "selection-mode": vue.unref(se2), date: F2.value, "parsed-value": e3.parsedValue, "disabled-date": vue.unref(S2), onPick: de2 }, null, 8, ["selection-mode", "date", "parsed-value", "disabled-date"])) : vue.createCommentVNode("v-if", true)], 34)], 2)], 2), vue.withDirectives(vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("footer")) }, [vue.withDirectives(vue.createVNode(vue.unref(th), { text: "", size: "small", class: vue.normalizeClass(vue.unref(c2).e("link-btn")), disabled: vue.unref(ge2), onClick: ye2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(h2)("el.datepicker.now")), 1)]), _: 1 }, 8, ["class", "disabled"]), [[vue.vShow, !vue.unref(ie2)]]), vue.createVNode(vue.unref(th), { plain: "", size: "small", class: vue.normalizeClass(vue.unref(c2).e("link-btn")), disabled: vue.unref(he2), onClick: be2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(h2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled"])], 2), [[vue.vShow, vue.unref(me2)]])], 2));
} });
var Ny = jf(Ty, [["__file", "panel-date-pick.vue"]]);
const Py = ou({ ...Kg, ...qg });
const Iy = (e2) => {
const { emit: t2 } = vue.getCurrentInstance();
const n2 = vue.useAttrs();
const o2 = vue.useSlots();
const a2 = (a3) => {
const r2 = kt(a3.value) ? a3.value() : a3.value;
if (r2) {
t2("pick", [lh(r2[0]).locale(e2.value), lh(r2[1]).locale(e2.value)]);
return;
}
if (a3.onClick) {
a3.onClick({ attrs: n2, slots: o2, emit: t2 });
}
};
return a2;
};
const Vy = (e2, { defaultValue: t2, leftDate: n2, rightDate: o2, unit: a2, onParsedValueChanged: r2 }) => {
const { emit: l2 } = vue.getCurrentInstance();
const { pickerNs: c2 } = vue.inject(Hg);
const d2 = Vu("date-range-picker");
const { t: f2, lang: m2 } = Du();
const h2 = Iy(m2);
const b2 = vue.ref();
const g2 = vue.ref();
const y2 = vue.ref({ endDate: null, selecting: false });
const w2 = (e3) => {
y2.value = e3;
};
const x2 = (e3 = false) => {
const t3 = vue.unref(b2);
const n3 = vue.unref(g2);
if (Qg([t3, n3])) {
l2("pick", [t3, n3], e3);
}
};
const k2 = (e3) => {
y2.value.selecting = e3;
if (!e3) {
y2.value.endDate = null;
}
};
const S2 = () => {
const [r3, l3] = ey(vue.unref(t2), { lang: vue.unref(m2), unit: a2, unlinkPanels: e2.unlinkPanels });
b2.value = void 0;
g2.value = void 0;
n2.value = r3;
o2.value = l3;
};
vue.watch(t2, (e3) => {
if (e3) {
S2();
}
}, { immediate: true });
vue.watch(() => e2.parsedValue, (e3) => {
if (wt(e3) && e3.length === 2) {
const [t3, o3] = e3;
b2.value = t3;
n2.value = t3;
g2.value = o3;
r2(vue.unref(b2), vue.unref(g2));
} else {
S2();
}
}, { immediate: true });
return { minDate: b2, maxDate: g2, rangeState: y2, lang: m2, ppNs: c2, drpNs: d2, handleChangeRange: w2, handleRangeConfirm: x2, handleShortcutClick: h2, onSelect: k2, t: f2 };
};
const By = ["onClick"];
const Fy = ["aria-label"];
const jy = ["aria-label"];
const zy = ["disabled", "aria-label"];
const Hy = ["disabled", "aria-label"];
const Wy = ["disabled", "aria-label"];
const Yy = ["disabled", "aria-label"];
const Uy = ["aria-label"];
const Ky = ["aria-label"];
const qy = "month";
const Gy = vue.defineComponent({ __name: "panel-date-range", props: Py, emits: ["pick", "set-picker-option", "calendar-change", "panel-change"], setup(e2, { emit: a2 }) {
const r2 = e2;
const s2 = vue.inject("EP_PICKER_BASE");
const { disabledDate: i2, cellClassName: c2, defaultTime: d2, clearable: f2 } = s2.props;
const m2 = vue.toRef(s2.props, "format");
const h2 = vue.toRef(s2.props, "shortcuts");
const b2 = vue.toRef(s2.props, "defaultValue");
const { lang: g2 } = Du();
const y2 = vue.ref(lh().locale(g2.value));
const w2 = vue.ref(lh().locale(g2.value).add(1, qy));
const { minDate: S2, maxDate: C2, rangeState: E2, ppNs: M2, drpNs: D2, handleChangeRange: R2, handleRangeConfirm: P2, handleShortcutClick: I2, onSelect: B2, t: F2 } = Vy(r2, { defaultValue: b2, leftDate: y2, rightDate: w2, unit: qy, onParsedValueChanged: Re2 });
const j2 = vue.ref({ min: null, max: null });
const z2 = vue.ref({ min: null, max: null });
const H2 = vue.computed(() => `${y2.value.year()} ${F2("el.datepicker.year")} ${F2(`el.datepicker.month${y2.value.month() + 1}`)}`);
const W2 = vue.computed(() => `${w2.value.year()} ${F2("el.datepicker.year")} ${F2(`el.datepicker.month${w2.value.month() + 1}`)}`);
const Y2 = vue.computed(() => y2.value.year());
const U2 = vue.computed(() => y2.value.month());
const K2 = vue.computed(() => w2.value.year());
const X2 = vue.computed(() => w2.value.month());
const Z2 = vue.computed(() => !!h2.value.length);
const J2 = vue.computed(() => {
if (j2.value.min !== null) return j2.value.min;
if (S2.value) return S2.value.format(oe2.value);
return "";
});
const Q2 = vue.computed(() => {
if (j2.value.max !== null) return j2.value.max;
if (C2.value || S2.value) return (C2.value || S2.value).format(oe2.value);
return "";
});
const ee2 = vue.computed(() => {
if (z2.value.min !== null) return z2.value.min;
if (S2.value) return S2.value.format(ne2.value);
return "";
});
const te2 = vue.computed(() => {
if (z2.value.max !== null) return z2.value.max;
if (C2.value || S2.value) return (C2.value || S2.value).format(ne2.value);
return "";
});
const ne2 = vue.computed(() => r2.timeFormat || bh(m2.value));
const oe2 = vue.computed(() => r2.dateFormat || hh(m2.value));
const ae2 = (e3) => Qg(e3) && (i2 ? !i2(e3[0].toDate()) && !i2(e3[1].toDate()) : true);
const re2 = () => {
y2.value = y2.value.subtract(1, "year");
if (!r2.unlinkPanels) {
w2.value = y2.value.add(1, "month");
}
pe2("year");
};
const le2 = () => {
y2.value = y2.value.subtract(1, "month");
if (!r2.unlinkPanels) {
w2.value = y2.value.add(1, "month");
}
pe2("month");
};
const se2 = () => {
if (!r2.unlinkPanels) {
y2.value = y2.value.add(1, "year");
w2.value = y2.value.add(1, "month");
} else {
w2.value = w2.value.add(1, "year");
}
pe2("year");
};
const ie2 = () => {
if (!r2.unlinkPanels) {
y2.value = y2.value.add(1, "month");
w2.value = y2.value.add(1, "month");
} else {
w2.value = w2.value.add(1, "month");
}
pe2("month");
};
const ue2 = () => {
y2.value = y2.value.add(1, "year");
pe2("year");
};
const ce2 = () => {
y2.value = y2.value.add(1, "month");
pe2("month");
};
const de2 = () => {
w2.value = w2.value.subtract(1, "year");
pe2("year");
};
const fe2 = () => {
w2.value = w2.value.subtract(1, "month");
pe2("month");
};
const pe2 = (e3) => {
a2("panel-change", [y2.value.toDate(), w2.value.toDate()], e3);
};
const ve2 = vue.computed(() => {
const e3 = (U2.value + 1) % 12;
const t2 = U2.value + 1 >= 12 ? 1 : 0;
return r2.unlinkPanels && new Date(Y2.value + t2, e3) < new Date(K2.value, X2.value);
});
const me2 = vue.computed(() => r2.unlinkPanels && K2.value * 12 + X2.value - (Y2.value * 12 + U2.value + 1) >= 12);
const he2 = vue.computed(() => !(S2.value && C2.value && !E2.value.selecting && Qg([S2.value, C2.value])));
const be2 = vue.computed(() => r2.type === "datetime" || r2.type === "datetimerange");
const ge2 = (e3, t2) => {
if (!e3) return;
if (d2) {
const n2 = lh(d2[t2] || d2).locale(g2.value);
return n2.year(e3.year()).month(e3.month()).date(e3.date());
}
return e3;
};
const ye2 = (e3, t2 = true) => {
const n2 = e3.minDate;
const o2 = e3.maxDate;
const r3 = ge2(n2, 0);
const l2 = ge2(o2, 1);
if (C2.value === l2 && S2.value === r3) {
return;
}
a2("calendar-change", [n2.toDate(), o2 && o2.toDate()]);
C2.value = l2;
S2.value = r3;
if (!t2 || be2.value) return;
P2();
};
const we2 = vue.ref(false);
const xe2 = vue.ref(false);
const ke2 = () => {
we2.value = false;
};
const Se2 = () => {
xe2.value = false;
};
const Ce2 = (e3, t2) => {
j2.value[t2] = e3;
const n2 = lh(e3, oe2.value).locale(g2.value);
if (n2.isValid()) {
if (i2 && i2(n2.toDate())) {
return;
}
if (t2 === "min") {
y2.value = n2;
S2.value = (S2.value || y2.value).year(n2.year()).month(n2.month()).date(n2.date());
if (!r2.unlinkPanels && (!C2.value || C2.value.isBefore(S2.value))) {
w2.value = n2.add(1, "month");
C2.value = S2.value.add(1, "month");
}
} else {
w2.value = n2;
C2.value = (C2.value || w2.value).year(n2.year()).month(n2.month()).date(n2.date());
if (!r2.unlinkPanels && (!S2.value || S2.value.isAfter(C2.value))) {
y2.value = n2.subtract(1, "month");
S2.value = C2.value.subtract(1, "month");
}
}
}
};
const Ee2 = (e3, t2) => {
j2.value[t2] = null;
};
const Me2 = (e3, t2) => {
z2.value[t2] = e3;
const n2 = lh(e3, ne2.value).locale(g2.value);
if (n2.isValid()) {
if (t2 === "min") {
we2.value = true;
S2.value = (S2.value || y2.value).hour(n2.hour()).minute(n2.minute()).second(n2.second());
} else {
xe2.value = true;
C2.value = (C2.value || w2.value).hour(n2.hour()).minute(n2.minute()).second(n2.second());
w2.value = C2.value;
}
}
};
const Oe2 = (e3, t2) => {
z2.value[t2] = null;
if (t2 === "min") {
y2.value = S2.value;
we2.value = false;
if (!C2.value || C2.value.isBefore(S2.value)) {
C2.value = S2.value;
}
} else {
w2.value = C2.value;
xe2.value = false;
if (C2.value && C2.value.isBefore(S2.value)) {
S2.value = C2.value;
}
}
};
const _e2 = (e3, t2, n2) => {
if (z2.value.min) return;
if (e3) {
y2.value = e3;
S2.value = (S2.value || y2.value).hour(e3.hour()).minute(e3.minute()).second(e3.second());
}
if (!n2) {
we2.value = t2;
}
if (!C2.value || C2.value.isBefore(S2.value)) {
C2.value = S2.value;
w2.value = e3;
}
};
const $e2 = (e3, t2, n2) => {
if (z2.value.max) return;
if (e3) {
w2.value = e3;
C2.value = (C2.value || w2.value).hour(e3.hour()).minute(e3.minute()).second(e3.second());
}
if (!n2) {
xe2.value = t2;
}
if (C2.value && C2.value.isBefore(S2.value)) {
S2.value = C2.value;
}
};
const Le2 = () => {
y2.value = ey(vue.unref(b2), { lang: vue.unref(g2), unit: "month", unlinkPanels: r2.unlinkPanels })[0];
w2.value = y2.value.add(1, "month");
C2.value = void 0;
S2.value = void 0;
a2("pick", null);
};
const Ae2 = (e3) => wt(e3) ? e3.map((e4) => e4.format(m2.value)) : e3.format(m2.value);
const De2 = (e3) => wt(e3) ? e3.map((e4) => lh(e4, m2.value).locale(g2.value)) : lh(e3, m2.value).locale(g2.value);
function Re2(e3, t2) {
if (r2.unlinkPanels && t2) {
const n2 = (e3 == null ? void 0 : e3.year()) || 0;
const o2 = (e3 == null ? void 0 : e3.month()) || 0;
const a3 = t2.year();
const r3 = t2.month();
w2.value = n2 === a3 && o2 === r3 ? t2.add(1, qy) : t2;
} else {
w2.value = y2.value.add(1, qy);
if (t2) {
w2.value = w2.value.hour(t2.hour()).minute(t2.minute()).second(t2.second());
}
}
}
a2("set-picker-option", ["isValidValue", ae2]);
a2("set-picker-option", ["parseUserInput", De2]);
a2("set-picker-option", ["formatToString", Ae2]);
a2("set-picker-option", ["handleClear", Le2]);
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(M2).b(), vue.unref(D2).b(), { "has-sidebar": e3.$slots.sidebar || vue.unref(Z2), "has-time": vue.unref(be2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(M2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(M2).e("sidebar")) }), vue.unref(Z2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(M2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(h2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("button", { key: o2, type: "button", class: vue.normalizeClass(vue.unref(M2).e("shortcut")), onClick: (t2) => vue.unref(I2)(e4) }, vue.toDisplayString(e4.text), 11, By))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(M2).e("body")) }, [vue.unref(be2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(D2).e("time-header")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(D2).e("editors-wrap")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(D2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(fp), { size: "small", disabled: vue.unref(E2).selecting, placeholder: vue.unref(F2)("el.datepicker.startDate"), class: vue.normalizeClass(vue.unref(D2).e("editor")), "model-value": vue.unref(J2), "validate-event": false, onInput: a3[0] || (a3[0] = (e4) => Ce2(e4, "min")), onChange: a3[1] || (a3[1] = (e4) => Ee2(e4, "min")) }, null, 8, ["disabled", "placeholder", "class", "model-value"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(D2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(fp), { size: "small", class: vue.normalizeClass(vue.unref(D2).e("editor")), disabled: vue.unref(E2).selecting, placeholder: vue.unref(F2)("el.datepicker.startTime"), "model-value": vue.unref(ee2), "validate-event": false, onFocus: a3[2] || (a3[2] = (e4) => we2.value = true), onInput: a3[3] || (a3[3] = (e4) => Me2(e4, "min")), onChange: a3[4] || (a3[4] = (e4) => Oe2(e4, "min")) }, null, 8, ["class", "disabled", "placeholder", "model-value"]), vue.createVNode(vue.unref(_b), { visible: we2.value, format: vue.unref(ne2), "datetime-role": "start", "parsed-value": y2.value, onPick: _e2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(Fh), ke2]])], 2), vue.createElementVNode("span", null, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ki))]), _: 1 })]), vue.createElementVNode("span", { class: vue.normalizeClass([vue.unref(D2).e("editors-wrap"), "is-right"]) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(D2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(fp), { size: "small", class: vue.normalizeClass(vue.unref(D2).e("editor")), disabled: vue.unref(E2).selecting, placeholder: vue.unref(F2)("el.datepicker.endDate"), "model-value": vue.unref(Q2), readonly: !vue.unref(S2), "validate-event": false, onInput: a3[5] || (a3[5] = (e4) => Ce2(e4, "max")), onChange: a3[6] || (a3[6] = (e4) => Ee2(e4, "max")) }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(D2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(fp), { size: "small", class: vue.normalizeClass(vue.unref(D2).e("editor")), disabled: vue.unref(E2).selecting, placeholder: vue.unref(F2)("el.datepicker.endTime"), "model-value": vue.unref(te2), readonly: !vue.unref(S2), "validate-event": false, onFocus: a3[7] || (a3[7] = (e4) => vue.unref(S2) && (xe2.value = true)), onInput: a3[8] || (a3[8] = (e4) => Me2(e4, "max")), onChange: a3[9] || (a3[9] = (e4) => Oe2(e4, "max")) }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly"]), vue.createVNode(vue.unref(_b), { "datetime-role": "end", visible: xe2.value, format: vue.unref(ne2), "parsed-value": w2.value, onPick: $e2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(Fh), Se2]])], 2)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(M2).e("content"), vue.unref(D2).e("content")], "is-left"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(D2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(M2).e("icon-btn"), "d-arrow-left"]), "aria-label": vue.unref(F2)(`el.datepicker.prevYear`), onClick: re2 }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Pi))]), _: 1 })], 10, Fy), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(M2).e("icon-btn"), "arrow-left"]), "aria-label": vue.unref(F2)(`el.datepicker.prevMonth`), onClick: le2 }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(wi))]), _: 1 })], 10, jy), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(me2), class: vue.normalizeClass([[vue.unref(M2).e("icon-btn"), { "is-disabled": !vue.unref(me2) }], "d-arrow-right"]), "aria-label": vue.unref(F2)(`el.datepicker.nextYear`), onClick: ue2 }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })], 10, zy)) : vue.createCommentVNode("v-if", true), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 1, type: "button", disabled: !vue.unref(ve2), class: vue.normalizeClass([[vue.unref(M2).e("icon-btn"), { "is-disabled": !vue.unref(ve2) }], "arrow-right"]), "aria-label": vue.unref(F2)(`el.datepicker.nextMonth`), onClick: ce2 }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ki))]), _: 1 })], 10, Hy)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(H2)), 1)], 2), vue.createVNode(fy, { "selection-mode": "range", date: y2.value, "min-date": vue.unref(S2), "max-date": vue.unref(C2), "range-state": vue.unref(E2), "disabled-date": vue.unref(i2), "cell-class-name": vue.unref(c2), onChangerange: vue.unref(R2), onPick: ye2, onSelect: vue.unref(B2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(M2).e("content"), vue.unref(D2).e("content")], "is-right"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(D2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(me2), class: vue.normalizeClass([[vue.unref(M2).e("icon-btn"), { "is-disabled": !vue.unref(me2) }], "d-arrow-left"]), "aria-label": vue.unref(F2)(`el.datepicker.prevYear`), onClick: de2 }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Pi))]), _: 1 })], 10, Wy)) : vue.createCommentVNode("v-if", true), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 1, type: "button", disabled: !vue.unref(ve2), class: vue.normalizeClass([[vue.unref(M2).e("icon-btn"), { "is-disabled": !vue.unref(ve2) }], "arrow-left"]), "aria-label": vue.unref(F2)(`el.datepicker.prevMonth`), onClick: fe2 }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(wi))]), _: 1 })], 10, Yy)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(F2)(`el.datepicker.nextYear`), class: vue.normalizeClass([vue.unref(M2).e("icon-btn"), "d-arrow-right"]), onClick: se2 }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })], 10, Uy), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(M2).e("icon-btn"), "arrow-right"]), "aria-label": vue.unref(F2)(`el.datepicker.nextMonth`), onClick: ie2 }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ki))]), _: 1 })], 10, Ky), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(W2)), 1)], 2), vue.createVNode(fy, { "selection-mode": "range", date: w2.value, "min-date": vue.unref(S2), "max-date": vue.unref(C2), "range-state": vue.unref(E2), "disabled-date": vue.unref(i2), "cell-class-name": vue.unref(c2), onChangerange: vue.unref(R2), onPick: ye2, onSelect: vue.unref(B2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2)], 2)], 2), vue.unref(be2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(M2).e("footer")) }, [vue.unref(f2) ? (vue.openBlock(), vue.createBlock(vue.unref(th), { key: 0, text: "", size: "small", class: vue.normalizeClass(vue.unref(M2).e("link-btn")), onClick: Le2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(F2)("el.datepicker.clear")), 1)]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.createVNode(vue.unref(th), { plain: "", size: "small", class: vue.normalizeClass(vue.unref(M2).e("link-btn")), disabled: vue.unref(he2), onClick: a3[10] || (a3[10] = (e4) => vue.unref(P2)(false)) }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(F2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled"])], 2)) : vue.createCommentVNode("v-if", true)], 2));
} });
var Xy = jf(Gy, [["__file", "panel-date-range.vue"]]);
const Zy = ou({ ...qg });
const Jy = ["pick", "set-picker-option", "calendar-change"];
const Qy = ({ unlinkPanels: e2, leftDate: t2, rightDate: n2 }) => {
const { t: o2 } = Du();
const a2 = () => {
t2.value = t2.value.subtract(1, "year");
if (!e2.value) {
n2.value = n2.value.subtract(1, "year");
}
};
const r2 = () => {
if (!e2.value) {
t2.value = t2.value.add(1, "year");
}
n2.value = n2.value.add(1, "year");
};
const s2 = () => {
t2.value = t2.value.add(1, "year");
};
const i2 = () => {
n2.value = n2.value.subtract(1, "year");
};
const u2 = vue.computed(() => `${t2.value.year()} ${o2("el.datepicker.year")}`);
const c2 = vue.computed(() => `${n2.value.year()} ${o2("el.datepicker.year")}`);
const d2 = vue.computed(() => t2.value.year());
const f2 = vue.computed(() => n2.value.year() === t2.value.year() ? t2.value.year() + 1 : n2.value.year());
return { leftPrevYear: a2, rightNextYear: r2, leftNextYear: s2, rightPrevYear: i2, leftLabel: u2, rightLabel: c2, leftYear: d2, rightYear: f2 };
};
const ew = ["onClick"];
const tw = ["disabled"];
const nw = ["disabled"];
const ow = "year";
const aw = vue.defineComponent({ name: "DatePickerMonthRange" });
const rw = vue.defineComponent({ ...aw, props: Zy, emits: Jy, setup(e2, { emit: a2 }) {
const r2 = e2;
const { lang: s2 } = Du();
const i2 = vue.inject("EP_PICKER_BASE");
const { shortcuts: c2, disabledDate: d2 } = i2.props;
const f2 = vue.toRef(i2.props, "format");
const m2 = vue.toRef(i2.props, "defaultValue");
const h2 = vue.ref(lh().locale(s2.value));
const b2 = vue.ref(lh().locale(s2.value).add(1, ow));
const { minDate: g2, maxDate: y2, rangeState: w2, ppNs: S2, drpNs: C2, handleChangeRange: E2, handleRangeConfirm: M2, handleShortcutClick: L2, onSelect: D2 } = Vy(r2, { defaultValue: m2, leftDate: h2, rightDate: b2, unit: ow, onParsedValueChanged: K2 });
const R2 = vue.computed(() => !!c2.length);
const { leftPrevYear: P2, rightNextYear: I2, leftNextYear: V2, rightPrevYear: B2, leftLabel: F2, rightLabel: j2, leftYear: z2, rightYear: H2 } = Qy({ unlinkPanels: vue.toRef(r2, "unlinkPanels"), leftDate: h2, rightDate: b2 });
const W2 = vue.computed(() => r2.unlinkPanels && H2.value > z2.value + 1);
const Y2 = (e3, t2 = true) => {
const n2 = e3.minDate;
const o2 = e3.maxDate;
if (y2.value === o2 && g2.value === n2) {
return;
}
a2("calendar-change", [n2.toDate(), o2 && o2.toDate()]);
y2.value = o2;
g2.value = n2;
if (!t2) return;
M2();
};
const U2 = (e3) => e3.map((e4) => e4.format(f2.value));
function K2(e3, t2) {
if (r2.unlinkPanels && t2) {
const n2 = (e3 == null ? void 0 : e3.year()) || 0;
const o2 = t2.year();
b2.value = n2 === o2 ? t2.add(1, ow) : t2;
} else {
b2.value = h2.value.add(1, ow);
}
}
a2("set-picker-option", ["formatToString", U2]);
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(S2).b(), vue.unref(C2).b(), { "has-sidebar": Boolean(e3.$slots.sidebar) || vue.unref(R2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(S2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(S2).e("sidebar")) }), vue.unref(R2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(S2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(c2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("button", { key: o2, type: "button", class: vue.normalizeClass(vue.unref(S2).e("shortcut")), onClick: (t2) => vue.unref(L2)(e4) }, vue.toDisplayString(e4.text), 11, ew))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(S2).e("body")) }, [vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(S2).e("content"), vue.unref(C2).e("content")], "is-left"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(C2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(S2).e("icon-btn"), "d-arrow-left"]), onClick: a3[0] || (a3[0] = (...e4) => vue.unref(P2) && vue.unref(P2)(...e4)) }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Pi))]), _: 1 })], 2), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(W2), class: vue.normalizeClass([[vue.unref(S2).e("icon-btn"), { [vue.unref(S2).is("disabled")]: !vue.unref(W2) }], "d-arrow-right"]), onClick: a3[1] || (a3[1] = (...e4) => vue.unref(V2) && vue.unref(V2)(...e4)) }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })], 10, tw)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(F2)), 1)], 2), vue.createVNode(gy, { "selection-mode": "range", date: h2.value, "min-date": vue.unref(g2), "max-date": vue.unref(y2), "range-state": vue.unref(w2), "disabled-date": vue.unref(d2), onChangerange: vue.unref(E2), onPick: Y2, onSelect: vue.unref(D2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(S2).e("content"), vue.unref(C2).e("content")], "is-right"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(C2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(W2), class: vue.normalizeClass([[vue.unref(S2).e("icon-btn"), { "is-disabled": !vue.unref(W2) }], "d-arrow-left"]), onClick: a3[2] || (a3[2] = (...e4) => vue.unref(B2) && vue.unref(B2)(...e4)) }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Pi))]), _: 1 })], 10, nw)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(S2).e("icon-btn"), "d-arrow-right"]), onClick: a3[3] || (a3[3] = (...e4) => vue.unref(I2) && vue.unref(I2)(...e4)) }, [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })], 2), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(j2)), 1)], 2), vue.createVNode(gy, { "selection-mode": "range", date: b2.value, "min-date": vue.unref(g2), "max-date": vue.unref(y2), "range-state": vue.unref(w2), "disabled-date": vue.unref(d2), onChangerange: vue.unref(E2), onPick: Y2, onSelect: vue.unref(D2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2)], 2)], 2)], 2));
} });
var lw = jf(rw, [["__file", "panel-month-range.vue"]]);
const sw = function(e2) {
switch (e2) {
case "daterange":
case "datetimerange": {
return Xy;
}
case "monthrange": {
return lw;
}
default: {
return Ny;
}
}
};
lh.extend(Ab);
lh.extend(Og);
lh.extend(uh);
lh.extend(Lg);
lh.extend(Rg);
lh.extend(Pg);
lh.extend(Bg);
lh.extend(zg);
var iw = vue.defineComponent({ name: "ElDatePicker", install: null, props: Wg, emits: ["update:modelValue"], setup(e2, { expose: t2, emit: n2, slots: o2 }) {
const a2 = Vu("picker-panel");
vue.provide("ElPopperOptions", vue.reactive(vue.toRef(e2, "popperOptions")));
vue.provide(Hg, { slots: o2, pickerNs: a2 });
const r2 = vue.ref();
const l2 = { focus: (e3 = true) => {
var t3;
(t3 = r2.value) == null ? void 0 : t3.focus(e3);
}, handleOpen: () => {
var e3;
(e3 = r2.value) == null ? void 0 : e3.handleOpen();
}, handleClose: () => {
var e3;
(e3 = r2.value) == null ? void 0 : e3.handleClose();
} };
t2(l2);
const s2 = (e3) => {
n2("update:modelValue", e3);
};
return () => {
var t3;
const n3 = (t3 = e2.format) != null ? t3 : ph[e2.type] || fh;
const a3 = sw(e2.type);
return vue.createVNode(Lh, vue.mergeProps(e2, { format: n3, type: e2.type, ref: r2, "onUpdate:modelValue": s2 }), { default: (e3) => vue.createVNode(a3, e3, null), "range-separator": o2["range-separator"] });
};
} });
const uw = iw;
uw.install = (e2) => {
e2.component(uw.name, uw);
};
const cw = uw;
const dw = ou({ mask: { type: Boolean, default: true }, customMaskEvent: Boolean, overlayClass: { type: eu([String, Array, Object]) }, zIndex: { type: eu([String, Number]) } });
const fw = { click: (e2) => e2 instanceof MouseEvent };
const pw = "overlay";
var vw = vue.defineComponent({ name: "ElOverlay", props: dw, emits: fw, setup(e2, { slots: t2, emit: n2 }) {
const o2 = Vu(pw);
const a2 = (e3) => {
n2("click", e3);
};
const { onClick: r2, onMousedown: l2, onMouseup: s2 } = Zd(e2.customMaskEvent ? void 0 : a2);
return () => e2.mask ? vue.createVNode("div", { class: [o2.b(), e2.overlayClass], style: { zIndex: e2.zIndex }, onClick: r2, onMousedown: l2, onMouseup: s2 }, [vue.renderSlot(t2, "default")], bu.STYLE | bu.CLASS | bu.PROPS, ["onClick", "onMouseup", "onMousedown"]) : vue.h("div", { class: e2.overlayClass, style: { zIndex: e2.zIndex, position: "fixed", top: "0px", right: "0px", bottom: "0px", left: "0px" } }, [vue.renderSlot(t2, "default")]);
} });
const mw = vw;
const hw = Symbol("dialogInjectionKey");
const bw = ou({ center: Boolean, alignCenter: Boolean, closeIcon: { type: au }, draggable: Boolean, overflow: Boolean, fullscreen: Boolean, showClose: { type: Boolean, default: true }, title: { type: String, default: "" }, ariaLevel: { type: String, default: "2" } });
const gw = { close: () => true };
const yw = ["aria-level"];
const ww = ["aria-label"];
const xw = ["id"];
const kw = vue.defineComponent({ name: "ElDialogContent" });
const Sw = vue.defineComponent({ ...kw, props: bw, emits: gw, setup(e2) {
const a2 = e2;
const { t: r2 } = Du();
const { Close: s2 } = ru;
const { dialogRef: i2, headerRef: c2, bodyId: d2, ns: f2, style: v2 } = vue.inject(hw);
const { focusTrapRef: m2 } = vue.inject(ov);
const h2 = vue.computed(() => [f2.b(), f2.is("fullscreen", a2.fullscreen), f2.is("draggable", a2.draggable), f2.is("align-center", a2.alignCenter), { [f2.m("center")]: a2.center }]);
const b2 = uu(m2, i2);
const g2 = vue.computed(() => a2.draggable);
const y2 = vue.computed(() => a2.overflow);
Mu(i2, c2, g2, y2);
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { ref: vue.unref(b2), class: vue.normalizeClass(vue.unref(h2)), style: vue.normalizeStyle(vue.unref(v2)), tabindex: "-1" }, [vue.createElementVNode("header", { ref_key: "headerRef", ref: c2, class: vue.normalizeClass([vue.unref(f2).e("header"), { "show-close": e3.showClose }]) }, [vue.renderSlot(e3.$slots, "header", {}, () => [vue.createElementVNode("span", { role: "heading", "aria-level": e3.ariaLevel, class: vue.normalizeClass(vue.unref(f2).e("title")) }, vue.toDisplayString(e3.title), 11, yw)]), e3.showClose ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, "aria-label": vue.unref(r2)("el.dialog.close"), class: vue.normalizeClass(vue.unref(f2).e("headerbtn")), type: "button", onClick: a3[0] || (a3[0] = (t2) => e3.$emit("close")) }, [vue.createVNode(vue.unref(Uf), { class: vue.normalizeClass(vue.unref(f2).e("close")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.closeIcon || vue.unref(s2))))]), _: 1 }, 8, ["class"])], 10, ww)) : vue.createCommentVNode("v-if", true)], 2), vue.createElementVNode("div", { id: vue.unref(d2), class: vue.normalizeClass(vue.unref(f2).e("body")) }, [vue.renderSlot(e3.$slots, "default")], 10, xw), e3.$slots.footer ? (vue.openBlock(), vue.createElementBlock("footer", { key: 0, class: vue.normalizeClass(vue.unref(f2).e("footer")) }, [vue.renderSlot(e3.$slots, "footer")], 2)) : vue.createCommentVNode("v-if", true)], 6));
} });
var Cw = jf(Sw, [["__file", "dialog-content.vue"]]);
const Ew = ou({ ...bw, appendToBody: Boolean, appendTo: { type: eu(String), default: "body" }, beforeClose: { type: eu(Function) }, destroyOnClose: Boolean, closeOnClickModal: { type: Boolean, default: true }, closeOnPressEscape: { type: Boolean, default: true }, lockScroll: { type: Boolean, default: true }, modal: { type: Boolean, default: true }, openDelay: { type: Number, default: 0 }, closeDelay: { type: Number, default: 0 }, top: { type: String }, modelValue: Boolean, modalClass: String, width: { type: [String, Number] }, zIndex: { type: Number }, trapFocus: Boolean, headerAriaLevel: { type: String, default: "2" } });
const Mw = { open: () => true, opened: () => true, close: () => true, closed: () => true, [fu]: (e2) => Xs(e2), openAutoFocus: () => true, closeAutoFocus: () => true };
const Ow = (e2, t2) => {
var n2;
const o2 = vue.getCurrentInstance();
const a2 = o2.emit;
const { nextZIndex: r2 } = xf();
let u2 = "";
const d2 = nf();
const f2 = nf();
const p2 = vue.ref(false);
const m2 = vue.ref(false);
const h2 = vue.ref(false);
const b2 = vue.ref((n2 = e2.zIndex) != null ? n2 : r2());
let g2 = void 0;
let y2 = void 0;
const w2 = If("namespace", Ru);
const x2 = vue.computed(() => {
const t3 = {};
const n3 = `--${w2.value}-dialog`;
if (!e2.fullscreen) {
if (e2.top) {
t3[`${n3}-margin-top`] = e2.top;
}
if (e2.width) {
t3[`${n3}-width`] = vi(e2.width);
}
}
return t3;
});
const k2 = vue.computed(() => {
if (e2.alignCenter) {
return { display: "flex" };
}
return {};
});
function S2() {
a2("opened");
}
function C2() {
a2("closed");
a2(fu, false);
if (e2.destroyOnClose) {
h2.value = false;
}
}
function E2() {
a2("close");
}
function O2() {
y2 == null ? void 0 : y2();
g2 == null ? void 0 : g2();
if (e2.openDelay && e2.openDelay > 0) {
({ stop: g2 } = Ye(() => A2(), e2.openDelay));
} else {
A2();
}
}
function _2() {
g2 == null ? void 0 : g2();
y2 == null ? void 0 : y2();
if (e2.closeDelay && e2.closeDelay > 0) {
({ stop: y2 } = Ye(() => D2(), e2.closeDelay));
} else {
D2();
}
}
function $2() {
function t3(e3) {
if (e3) return;
m2.value = true;
p2.value = false;
}
if (e2.beforeClose) {
e2.beforeClose(t3);
} else {
_2();
}
}
function L2() {
if (e2.closeOnClickModal) {
$2();
}
}
function A2() {
if (!Ie) return;
p2.value = true;
}
function D2() {
p2.value = false;
}
function R2() {
a2("openAutoFocus");
}
function T2() {
a2("closeAutoFocus");
}
function N2(e3) {
var t3;
if (((t3 = e3.detail) == null ? void 0 : t3.focusReason) === "pointer") {
e3.preventDefault();
}
}
if (e2.lockScroll) {
Bu(p2);
}
function P2() {
if (e2.closeOnPressEscape) {
$2();
}
}
vue.watch(() => e2.modelValue, (n3) => {
if (n3) {
m2.value = false;
O2();
h2.value = true;
b2.value = zs(e2.zIndex) ? r2() : b2.value++;
vue.nextTick(() => {
a2("open");
if (t2.value) {
t2.value.scrollTop = 0;
}
});
} else {
if (p2.value) {
_2();
}
}
});
vue.watch(() => e2.fullscreen, (e3) => {
if (!t2.value) return;
if (e3) {
u2 = t2.value.style.transform;
t2.value.style.transform = "";
} else {
t2.value.style.transform = u2;
}
});
vue.onMounted(() => {
if (e2.modelValue) {
p2.value = true;
h2.value = true;
O2();
}
});
return { afterEnter: S2, afterLeave: C2, beforeLeave: E2, handleClose: $2, onModalClick: L2, close: _2, doClose: D2, onOpenAutoFocus: R2, onCloseAutoFocus: T2, onCloseRequested: P2, onFocusoutPrevented: N2, titleId: d2, bodyId: f2, closed: m2, style: x2, overlayDialogStyle: k2, rendered: h2, visible: p2, zIndex: b2 };
};
const _w = ["aria-label", "aria-labelledby", "aria-describedby"];
const $w = vue.defineComponent({ name: "ElDialog", inheritAttrs: false });
const Lw = vue.defineComponent({ ...$w, props: Ew, emits: Mw, setup(e2, { expose: n2 }) {
const a2 = e2;
const r2 = vue.useSlots();
Eu({ scope: "el-dialog", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/dialog.html#slots" }, vue.computed(() => !!r2.title));
const s2 = Vu("dialog");
const i2 = vue.ref();
const c2 = vue.ref();
const d2 = vue.ref();
const { visible: f2, titleId: p2, bodyId: m2, style: h2, overlayDialogStyle: b2, rendered: g2, zIndex: k2, afterEnter: S2, afterLeave: C2, beforeLeave: M2, handleClose: _2, onModalClick: D2, onOpenAutoFocus: R2, onCloseAutoFocus: N2, onCloseRequested: F2, onFocusoutPrevented: j2 } = Ow(a2, i2);
vue.provide(hw, { dialogRef: i2, headerRef: c2, bodyId: m2, ns: s2, rendered: g2, style: h2 });
const z2 = Zd(D2);
const H2 = vue.computed(() => a2.draggable && !a2.fullscreen);
n2({ visible: f2, dialogContentRef: d2 });
return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { to: e3.appendTo, disabled: e3.appendTo !== "body" ? false : !e3.appendToBody }, [vue.createVNode(vue.Transition, { name: "dialog-fade", onAfterEnter: vue.unref(S2), onAfterLeave: vue.unref(C2), onBeforeLeave: vue.unref(M2), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode(vue.unref(mw), { "custom-mask-event": "", mask: e3.modal, "overlay-class": e3.modalClass, "z-index": vue.unref(k2) }, { default: vue.withCtx(() => [vue.createElementVNode("div", { role: "dialog", "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? vue.unref(p2) : void 0, "aria-describedby": vue.unref(m2), class: vue.normalizeClass(`${vue.unref(s2).namespace.value}-overlay-dialog`), style: vue.normalizeStyle(vue.unref(b2)), onClick: n3[0] || (n3[0] = (...e4) => vue.unref(z2).onClick && vue.unref(z2).onClick(...e4)), onMousedown: n3[1] || (n3[1] = (...e4) => vue.unref(z2).onMousedown && vue.unref(z2).onMousedown(...e4)), onMouseup: n3[2] || (n3[2] = (...e4) => vue.unref(z2).onMouseup && vue.unref(z2).onMouseup(...e4)) }, [vue.createVNode(vue.unref(Ev), { loop: "", trapped: vue.unref(f2), "focus-start-el": "container", onFocusAfterTrapped: vue.unref(R2), onFocusAfterReleased: vue.unref(N2), onFocusoutPrevented: vue.unref(j2), onReleaseRequested: vue.unref(F2) }, { default: vue.withCtx(() => [vue.unref(g2) ? (vue.openBlock(), vue.createBlock(Cw, vue.mergeProps({ key: 0, ref_key: "dialogContentRef", ref: d2 }, e3.$attrs, { center: e3.center, "align-center": e3.alignCenter, "close-icon": e3.closeIcon, draggable: vue.unref(H2), overflow: e3.overflow, fullscreen: e3.fullscreen, "show-close": e3.showClose, title: e3.title, "aria-level": e3.headerAriaLevel, onClose: vue.unref(_2) }), vue.createSlots({ header: vue.withCtx(() => [!e3.$slots.title ? vue.renderSlot(e3.$slots, "header", { key: 0, close: vue.unref(_2), titleId: vue.unref(p2), titleClass: vue.unref(s2).e("title") }) : vue.renderSlot(e3.$slots, "title", { key: 1 })]), default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 2 }, [e3.$slots.footer ? { name: "footer", fn: vue.withCtx(() => [vue.renderSlot(e3.$slots, "footer")]) } : void 0]), 1040, ["center", "align-center", "close-icon", "draggable", "overflow", "fullscreen", "show-close", "title", "aria-level", "onClose"])) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["trapped", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])], 46, _w)]), _: 3 }, 8, ["mask", "overlay-class", "z-index"]), [[vue.vShow, vue.unref(f2)]])]), _: 3 }, 8, ["onAfterEnter", "onAfterLeave", "onBeforeLeave"])], 8, ["to", "disabled"]));
} });
var Aw = jf(Lw, [["__file", "dialog.vue"]]);
const Dw = su(Aw);
const Rw = ou({ direction: { type: String, values: ["horizontal", "vertical"], default: "horizontal" }, contentPosition: { type: String, values: ["left", "center", "right"], default: "center" }, borderStyle: { type: eu(String), default: "solid" } });
const Tw = vue.defineComponent({ name: "ElDivider" });
const Nw = vue.defineComponent({ ...Tw, props: Rw, setup(e2) {
const o2 = e2;
const a2 = Vu("divider");
const r2 = vue.computed(() => a2.cssVar({ "border-style": o2.borderStyle }));
return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(a2).b(), vue.unref(a2).m(e3.direction)]), style: vue.normalizeStyle(vue.unref(r2)), role: "separator" }, [e3.$slots.default && e3.direction !== "vertical" ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass([vue.unref(a2).e("text"), vue.unref(a2).is(e3.contentPosition)]) }, [vue.renderSlot(e3.$slots, "default")], 2)) : vue.createCommentVNode("v-if", true)], 6));
} });
var Pw = jf(Nw, [["__file", "divider.vue"]]);
const Iw = su(Pw);
const Vw = ou({ ...Ew, direction: { type: String, default: "rtl", values: ["ltr", "rtl", "ttb", "btt"] }, size: { type: [String, Number], default: "30%" }, withHeader: { type: Boolean, default: true }, modalFade: { type: Boolean, default: true }, headerAriaLevel: { type: String, default: "2" } });
const Bw = Mw;
const Fw = ["aria-label", "aria-labelledby", "aria-describedby"];
const jw = ["id", "aria-level"];
const zw = ["aria-label"];
const Hw = ["id"];
const Ww = vue.defineComponent({ name: "ElDrawer", inheritAttrs: false });
const Yw = vue.defineComponent({ ...Ww, props: Vw, emits: Bw, setup(e2, { expose: a2 }) {
const r2 = e2;
const s2 = vue.useSlots();
Eu({ scope: "el-drawer", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/drawer.html#slots" }, vue.computed(() => !!s2.title));
const i2 = vue.ref();
const c2 = vue.ref();
const d2 = Vu("drawer");
const { t: f2 } = Du();
const { afterEnter: p2, afterLeave: m2, beforeLeave: h2, visible: b2, rendered: g2, titleId: y2, bodyId: k2, zIndex: S2, onModalClick: C2, onOpenAutoFocus: M2, onCloseAutoFocus: _2, onFocusoutPrevented: D2, onCloseRequested: P2, handleClose: F2 } = Ow(r2, i2);
const j2 = vue.computed(() => r2.direction === "rtl" || r2.direction === "ltr");
const z2 = vue.computed(() => vi(r2.size));
a2({ handleClose: F2, afterEnter: p2, afterLeave: m2 });
return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { to: "body", disabled: !e3.appendToBody }, [vue.createVNode(vue.Transition, { name: vue.unref(d2).b("fade"), onAfterEnter: vue.unref(p2), onAfterLeave: vue.unref(m2), onBeforeLeave: vue.unref(h2), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode(vue.unref(mw), { mask: e3.modal, "overlay-class": e3.modalClass, "z-index": vue.unref(S2), onClick: vue.unref(C2) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ev), { loop: "", trapped: vue.unref(b2), "focus-trap-el": i2.value, "focus-start-el": c2.value, onFocusAfterTrapped: vue.unref(M2), onFocusAfterReleased: vue.unref(_2), onFocusoutPrevented: vue.unref(D2), onReleaseRequested: vue.unref(P2) }, { default: vue.withCtx(() => [vue.createElementVNode("div", vue.mergeProps({ ref_key: "drawerRef", ref: i2, "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? vue.unref(y2) : void 0, "aria-describedby": vue.unref(k2) }, e3.$attrs, { class: [vue.unref(d2).b(), e3.direction, vue.unref(b2) && "open"], style: vue.unref(j2) ? "width: " + vue.unref(z2) : "height: " + vue.unref(z2), role: "dialog", onClick: a3[1] || (a3[1] = vue.withModifiers(() => {
}, ["stop"])) }), [vue.createElementVNode("span", { ref_key: "focusStartRef", ref: c2, class: vue.normalizeClass(vue.unref(d2).e("sr-focus")), tabindex: "-1" }, null, 2), e3.withHeader ? (vue.openBlock(), vue.createElementBlock("header", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("header")) }, [!e3.$slots.title ? vue.renderSlot(e3.$slots, "header", { key: 0, close: vue.unref(F2), titleId: vue.unref(y2), titleClass: vue.unref(d2).e("title") }, () => [!e3.$slots.title ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, id: vue.unref(y2), role: "heading", "aria-level": e3.headerAriaLevel, class: vue.normalizeClass(vue.unref(d2).e("title")) }, vue.toDisplayString(e3.title), 11, jw)) : vue.createCommentVNode("v-if", true)]) : vue.renderSlot(e3.$slots, "title", { key: 1 }, () => [vue.createCommentVNode(" DEPRECATED SLOT ")]), e3.showClose ? (vue.openBlock(), vue.createElementBlock("button", { key: 2, "aria-label": vue.unref(f2)("el.drawer.close"), class: vue.normalizeClass(vue.unref(d2).e("close-btn")), type: "button", onClick: a3[0] || (a3[0] = (...e4) => vue.unref(F2) && vue.unref(F2)(...e4)) }, [vue.createVNode(vue.unref(Uf), { class: vue.normalizeClass(vue.unref(d2).e("close")) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ti))]), _: 1 }, 8, ["class"])], 10, zw)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.unref(g2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, id: vue.unref(k2), class: vue.normalizeClass(vue.unref(d2).e("body")) }, [vue.renderSlot(e3.$slots, "default")], 10, Hw)) : vue.createCommentVNode("v-if", true), e3.$slots.footer ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass(vue.unref(d2).e("footer")) }, [vue.renderSlot(e3.$slots, "footer")], 2)) : vue.createCommentVNode("v-if", true)], 16, Fw)]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])]), _: 3 }, 8, ["mask", "overlay-class", "z-index", "onClick"]), [[vue.vShow, vue.unref(b2)]])]), _: 3 }, 8, ["name", "onAfterEnter", "onAfterLeave", "onBeforeLeave"])], 8, ["disabled"]));
} });
var Uw = jf(Yw, [["__file", "drawer.vue"]]);
const Kw = su(Uw);
const qw = ou({ id: { type: String, default: void 0 }, step: { type: Number, default: 1 }, stepStrictly: Boolean, max: { type: Number, default: Number.POSITIVE_INFINITY }, min: { type: Number, default: Number.NEGATIVE_INFINITY }, modelValue: Number, readonly: Boolean, disabled: Boolean, size: Ef, controls: { type: Boolean, default: true }, controlsPosition: { type: String, default: "", values: ["", "right"] }, valueOnClear: { type: [String, Number, null], validator: (e2) => e2 === null || Zs(e2) || ["min", "max"].includes(e2), default: null }, name: String, label: String, placeholder: String, precision: { type: Number, validator: (e2) => e2 >= 0 && e2 === Number.parseInt(`${e2}`, 10) }, validateEvent: { type: Boolean, default: true }, ...Tf(["ariaLabel"]) });
const Gw = { [pu]: (e2, t2) => t2 !== e2, blur: (e2) => e2 instanceof FocusEvent, focus: (e2) => e2 instanceof FocusEvent, [vu]: (e2) => Zs(e2) || js(e2), [fu]: (e2) => Zs(e2) || js(e2) };
const Xw = ["aria-label", "onKeydown"];
const Zw = ["aria-label", "onKeydown"];
const Jw = vue.defineComponent({ name: "ElInputNumber" });
const Qw = vue.defineComponent({ ...Jw, props: qw, emits: Gw, setup(e2, { expose: o2, emit: a2 }) {
const r2 = e2;
const { t: s2 } = Du();
const d2 = Vu("input-number");
const f2 = vue.ref();
const p2 = vue.reactive({ currentValue: r2.modelValue, userInput: null });
const { formItem: m2 } = Zf();
const h2 = vue.computed(() => Zs(r2.modelValue) && r2.modelValue <= r2.min);
const b2 = vue.computed(() => Zs(r2.modelValue) && r2.modelValue >= r2.max);
const g2 = vue.computed(() => {
const e3 = E2(r2.step);
if (!Gs(r2.precision)) {
if (e3 > r2.precision) ;
return r2.precision;
} else {
return Math.max(E2(r2.modelValue), e3);
}
});
const y2 = vue.computed(() => r2.controls && r2.controlsPosition === "right");
const w2 = Gf();
const k2 = Xf();
const S2 = vue.computed(() => {
if (p2.userInput !== null) {
return p2.userInput;
}
let e3 = p2.currentValue;
if (js(e3)) return "";
if (Zs(e3)) {
if (Number.isNaN(e3)) return "";
if (!Gs(r2.precision)) {
e3 = e3.toFixed(r2.precision);
}
}
return e3;
});
const C2 = (e3, t2) => {
if (Gs(t2)) t2 = g2.value;
if (t2 === 0) return Math.round(e3);
let n2 = String(e3);
const o3 = n2.indexOf(".");
if (o3 === -1) return e3;
const a3 = n2.replace(".", "").split("");
const r3 = a3[o3 + t2];
if (!r3) return e3;
const l2 = n2.length;
if (n2.charAt(l2 - 1) === "5") {
n2 = `${n2.slice(0, Math.max(0, l2 - 1))}6`;
}
return Number.parseFloat(Number(n2).toFixed(t2));
};
const E2 = (e3) => {
if (js(e3)) return 0;
const t2 = e3.toString();
const n2 = t2.indexOf(".");
let o3 = 0;
if (n2 !== -1) {
o3 = t2.length - n2 - 1;
}
return o3;
};
const M2 = (e3, t2 = 1) => {
if (!Zs(e3)) return p2.currentValue;
return C2(e3 + r2.step * t2);
};
const _2 = () => {
if (r2.readonly || k2.value || b2.value) return;
const e3 = Number(S2.value) || 0;
const t2 = M2(e3);
P2(t2);
a2(vu, p2.currentValue);
U2();
};
const D2 = () => {
if (r2.readonly || k2.value || h2.value) return;
const e3 = Number(S2.value) || 0;
const t2 = M2(e3, -1);
P2(t2);
a2(vu, p2.currentValue);
U2();
};
const N2 = (e3, t2) => {
const { max: n2, min: o3, step: l2, precision: s3, stepStrictly: i2, valueOnClear: u2 } = r2;
if (n2 < o3) {
si("InputNumber", "min should not be greater than max.");
}
let c2 = Number(e3);
if (js(e3) || Number.isNaN(c2)) {
return null;
}
if (e3 === "") {
if (u2 === null) {
return null;
}
c2 = St(u2) ? { min: o3, max: n2 }[u2] : u2;
}
if (i2) {
c2 = C2(Math.round(c2 / l2) * l2, s3);
}
if (!Gs(s3)) {
c2 = C2(c2, s3);
}
if (c2 > n2 || c2 < o3) {
c2 = c2 > n2 ? n2 : o3;
t2 && a2(fu, c2);
}
return c2;
};
const P2 = (e3, t2 = true) => {
var n2;
const o3 = p2.currentValue;
const l2 = N2(e3);
if (!t2) {
a2(fu, l2);
return;
}
if (o3 === l2 && e3) return;
p2.userInput = null;
a2(fu, l2);
if (o3 !== l2) {
a2(pu, l2, o3);
}
if (r2.validateEvent) {
(n2 = m2 == null ? void 0 : m2.validate) == null ? void 0 : n2.call(m2, "change").catch((e4) => ii());
}
p2.currentValue = l2;
};
const I2 = (e3) => {
p2.userInput = e3;
const t2 = e3 === "" ? null : Number(e3);
a2(vu, t2);
P2(t2, false);
};
const B2 = (e3) => {
const t2 = e3 !== "" ? Number(e3) : "";
if (Zs(t2) && !Number.isNaN(t2) || e3 === "") {
P2(t2);
}
U2();
p2.userInput = null;
};
const z2 = () => {
var e3, t2;
(t2 = (e3 = f2.value) == null ? void 0 : e3.focus) == null ? void 0 : t2.call(e3);
};
const H2 = () => {
var e3, t2;
(t2 = (e3 = f2.value) == null ? void 0 : e3.blur) == null ? void 0 : t2.call(e3);
};
const W2 = (e3) => {
a2("focus", e3);
};
const Y2 = (e3) => {
var t2;
p2.userInput = null;
a2("blur", e3);
if (r2.validateEvent) {
(t2 = m2 == null ? void 0 : m2.validate) == null ? void 0 : t2.call(m2, "blur").catch((e4) => ii());
}
};
const U2 = () => {
if (p2.currentValue !== r2.modelValue) {
p2.currentValue = r2.modelValue;
}
};
const K2 = (e3) => {
if (document.activeElement === e3.target) e3.preventDefault();
};
vue.watch(() => r2.modelValue, (e3, t2) => {
const n2 = N2(e3, true);
if (p2.userInput === null && n2 !== t2) {
p2.currentValue = n2;
}
}, { immediate: true });
vue.onMounted(() => {
var e3;
const { min: t2, max: n2, modelValue: o3 } = r2;
const l2 = (e3 = f2.value) == null ? void 0 : e3.input;
l2.setAttribute("role", "spinbutton");
if (Number.isFinite(n2)) {
l2.setAttribute("aria-valuemax", String(n2));
} else {
l2.removeAttribute("aria-valuemax");
}
if (Number.isFinite(t2)) {
l2.setAttribute("aria-valuemin", String(t2));
} else {
l2.removeAttribute("aria-valuemin");
}
l2.setAttribute("aria-valuenow", p2.currentValue || p2.currentValue === 0 ? String(p2.currentValue) : "");
l2.setAttribute("aria-disabled", String(k2.value));
if (!Zs(o3) && o3 != null) {
let e4 = Number(o3);
if (Number.isNaN(e4)) {
e4 = null;
}
a2(fu, e4);
}
l2.addEventListener("wheel", K2, { passive: false });
});
vue.onUpdated(() => {
var e3, t2;
const n2 = (e3 = f2.value) == null ? void 0 : e3.input;
n2 == null ? void 0 : n2.setAttribute("aria-valuenow", `${(t2 = p2.currentValue) != null ? t2 : ""}`);
});
Eu({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-input-number", ref: "https://element-plus.org/en-US/component/input-number.html" }, vue.computed(() => !!r2.label));
o2({ focus: z2, blur: H2 });
return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(d2).b(), vue.unref(d2).m(vue.unref(w2)), vue.unref(d2).is("disabled", vue.unref(k2)), vue.unref(d2).is("without-controls", !e3.controls), vue.unref(d2).is("controls-right", vue.unref(y2))]), onDragstart: o3[0] || (o3[0] = vue.withModifiers(() => {
}, ["prevent"])) }, [e3.controls ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { key: 0, role: "button", "aria-label": vue.unref(s2)("el.inputNumber.decrease"), class: vue.normalizeClass([vue.unref(d2).e("decrease"), vue.unref(d2).is("disabled", vue.unref(h2))]), onKeydown: vue.withKeys(D2, ["enter"]) }, [vue.renderSlot(e3.$slots, "decrease-icon", {}, () => [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.unref(y2) ? (vue.openBlock(), vue.createBlock(vue.unref(gi), { key: 0 })) : (vue.openBlock(), vue.createBlock(vue.unref(Wi), { key: 1 }))]), _: 1 })])], 42, Xw)), [[vue.unref(Hh), D2]]) : vue.createCommentVNode("v-if", true), e3.controls ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { key: 1, role: "button", "aria-label": vue.unref(s2)("el.inputNumber.increase"), class: vue.normalizeClass([vue.unref(d2).e("increase"), vue.unref(d2).is("disabled", vue.unref(b2))]), onKeydown: vue.withKeys(_2, ["enter"]) }, [vue.renderSlot(e3.$slots, "increase-icon", {}, () => [vue.createVNode(vue.unref(Uf), null, { default: vue.withCtx(() => [vue.unref(y2) ? (vue.openBlock(), vue.createBlock(vue.unref(Ci), { key: 0 })) : (vue.openBlock(), vue.createBlock(vue.unref(Ui), { key: 1 }))]), _: 1 })])], 42, Zw)), [[vue.unref(Hh), _2]]) : vue.createCommentVNode("v-if", true), vue.createVNode(vue.unref(fp), { id: e3.id, ref_key: "input", ref: f2, type: "number", step: e3.step, "model-value": vue.unref(S2), placeholder: e3.placeholder, readonly: e3.readonly, disabled: vue.unref(k2), size: vue.unref(w2), max: e3.max, min: e3.min, name: e3.name, "aria-label": e3.label || e3.ariaLabel, "validate-event": false, onKeydown: [vue.withKeys(vue.withModifiers(_2, ["prevent"]), ["up"]), vue.withKeys(vue.withModifiers(D2, ["prevent"]), ["down"])], onBlur: Y2, onFocus: W2, onInput: I2, onChange: B2 }, null, 8, ["id", "step", "model-value", "placeholder", "readonly", "disabled", "size", "max", "min", "name", "aria-label", "onKeydown"])], 34));
} });
var ex = jf(Qw, [["__file", "input-number.vue"]]);
const tx = su(ex);
const nx = ou({ modelValue: { type: [Boolean, String, Number], default: false }, disabled: Boolean, loading: Boolean, size: { type: String, validator: hu }, width: { type: [String, Number], default: "" }, inlinePrompt: Boolean, inactiveActionIcon: { type: au }, activeActionIcon: { type: au }, activeIcon: { type: au }, inactiveIcon: { type: au }, activeText: { type: String, default: "" }, inactiveText: { type: String, default: "" }, activeValue: { type: [Boolean, String, Number], default: true }, inactiveValue: { type: [Boolean, String, Number], default: false }, name: { type: String, default: "" }, validateEvent: { type: Boolean, default: true }, beforeChange: { type: eu(Function) }, id: String, tabindex: { type: [String, Number] }, label: { type: String, default: void 0 }, ...Tf(["ariaLabel"]) });
const ox = { [fu]: (e2) => Xs(e2) || St(e2) || Zs(e2), [pu]: (e2) => Xs(e2) || St(e2) || Zs(e2), [vu]: (e2) => Xs(e2) || St(e2) || Zs(e2) };
const ax = ["onClick"];
const rx = ["id", "aria-checked", "aria-disabled", "aria-label", "name", "true-value", "false-value", "disabled", "tabindex", "onKeydown"];
const lx = ["aria-hidden"];
const sx = ["aria-hidden"];
const ix = ["aria-hidden"];
const ux = "ElSwitch";
const cx = vue.defineComponent({ name: ux });
const dx = vue.defineComponent({ ...cx, props: nx, emits: ox, setup(e2, { expose: a2, emit: r2 }) {
const s2 = e2;
const { formItem: d2 } = Zf();
const f2 = Gf();
const p2 = Vu("switch");
const { inputId: m2 } = Jf(s2, { formItemContext: d2 });
const h2 = Xf(vue.computed(() => s2.loading));
const b2 = vue.ref(s2.modelValue !== false);
const g2 = vue.ref();
const y2 = vue.ref();
const w2 = vue.computed(() => [p2.b(), p2.m(f2.value), p2.is("disabled", h2.value), p2.is("checked", _2.value)]);
const k2 = vue.computed(() => [p2.e("label"), p2.em("label", "left"), p2.is("active", !_2.value)]);
const S2 = vue.computed(() => [p2.e("label"), p2.em("label", "right"), p2.is("active", _2.value)]);
const C2 = vue.computed(() => ({ width: vi(s2.width) }));
vue.watch(() => s2.modelValue, () => {
b2.value = true;
});
const E2 = vue.computed(() => b2.value ? s2.modelValue : false);
const _2 = vue.computed(() => E2.value === s2.activeValue);
if (![s2.activeValue, s2.inactiveValue].includes(E2.value)) {
r2(fu, s2.inactiveValue);
r2(pu, s2.inactiveValue);
r2(vu, s2.inactiveValue);
}
vue.watch(_2, (e3) => {
var t2;
g2.value.checked = e3;
if (s2.validateEvent) {
(t2 = d2 == null ? void 0 : d2.validate) == null ? void 0 : t2.call(d2, "change").catch((e4) => ii());
}
});
const I2 = () => {
const e3 = _2.value ? s2.inactiveValue : s2.activeValue;
r2(fu, e3);
r2(pu, e3);
r2(vu, e3);
vue.nextTick(() => {
g2.value.checked = _2.value;
});
};
const V2 = () => {
if (h2.value) return;
const { beforeChange: e3 } = s2;
if (!e3) {
I2();
return;
}
const t2 = e3();
const n2 = [Et(t2), Xs(t2)].includes(true);
if (!n2) {
si(ux, "beforeChange must return type `Promise<boolean>` or `boolean`");
}
if (Et(t2)) {
t2.then((e4) => {
if (e4) {
I2();
}
}).catch((e4) => {
});
} else if (t2) {
I2();
}
};
const B2 = () => {
var e3, t2;
(t2 = (e3 = g2.value) == null ? void 0 : e3.focus) == null ? void 0 : t2.call(e3);
};
vue.onMounted(() => {
g2.value.checked = _2.value;
});
Eu({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-switch", ref: "https://element-plus.org/en-US/component/switch.html" }, vue.computed(() => !!s2.label));
a2({ focus: B2, checked: _2 });
return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(vue.unref(w2)), onClick: vue.withModifiers(V2, ["prevent"]) }, [vue.createElementVNode("input", { id: vue.unref(m2), ref_key: "input", ref: g2, class: vue.normalizeClass(vue.unref(p2).e("input")), type: "checkbox", role: "switch", "aria-checked": vue.unref(_2), "aria-disabled": vue.unref(h2), "aria-label": e3.label || e3.ariaLabel, name: e3.name, "true-value": e3.activeValue, "false-value": e3.inactiveValue, disabled: vue.unref(h2), tabindex: e3.tabindex, onChange: I2, onKeydown: vue.withKeys(V2, ["enter"]) }, null, 42, rx), !e3.inlinePrompt && (e3.inactiveIcon || e3.inactiveText) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(k2)) }, [e3.inactiveIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.inactiveIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true), !e3.inactiveIcon && e3.inactiveText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, "aria-hidden": vue.unref(_2) }, vue.toDisplayString(e3.inactiveText), 9, lx)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("span", { ref_key: "core", ref: y2, class: vue.normalizeClass(vue.unref(p2).e("core")), style: vue.normalizeStyle(vue.unref(C2)) }, [e3.inlinePrompt ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(p2).e("inner")) }, [e3.activeIcon || e3.inactiveIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0, class: vue.normalizeClass(vue.unref(p2).is("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(_2) ? e3.activeIcon : e3.inactiveIcon)))]), _: 1 }, 8, ["class"])) : e3.activeText || e3.inactiveText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(p2).is("text")), "aria-hidden": !vue.unref(_2) }, vue.toDisplayString(vue.unref(_2) ? e3.activeText : e3.inactiveText), 11, sx)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(p2).e("action")) }, [e3.loading ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0, class: vue.normalizeClass(vue.unref(p2).is("loading")) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(zi))]), _: 1 }, 8, ["class"])) : vue.unref(_2) ? vue.renderSlot(e3.$slots, "active-action", { key: 1 }, () => [e3.activeActionIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.activeActionIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true)]) : !vue.unref(_2) ? vue.renderSlot(e3.$slots, "inactive-action", { key: 2 }, () => [e3.inactiveActionIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.inactiveActionIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true)]) : vue.createCommentVNode("v-if", true)], 2)], 6), !e3.inlinePrompt && (e3.activeIcon || e3.activeText) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(S2)) }, [e3.activeIcon ? (vue.openBlock(), vue.createBlock(vue.unref(Uf), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.activeIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true), !e3.activeIcon && e3.activeText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, "aria-hidden": !vue.unref(_2) }, vue.toDisplayString(e3.activeText), 9, ix)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true)], 10, ax));
} });
var fx = jf(dx, [["__file", "switch.vue"]]);
const px = su(fx);
const vx = function(e2) {
var t2;
return (t2 = e2.target) == null ? void 0 : t2.closest("td");
};
const mx = function(e2, t2, n2, o2, a2) {
if (!t2 && !o2 && (!a2 || Array.isArray(a2) && !a2.length)) {
return e2;
}
if (typeof n2 === "string") {
n2 = n2 === "descending" ? -1 : 1;
} else {
n2 = n2 && n2 < 0 ? -1 : 1;
}
const r2 = o2 ? null : function(n3, o3) {
if (a2) {
if (!Array.isArray(a2)) {
a2 = [a2];
}
return a2.map((t3) => {
if (typeof t3 === "string") {
return gr(n3, t3);
} else {
return t3(n3, o3, e2);
}
});
}
if (t2 !== "$key") {
if (Ct(n3) && "$value" in n3) n3 = n3.$value;
}
return [Ct(n3) ? gr(n3, t2) : n3];
};
const l2 = function(e3, t3) {
if (o2) {
return o2(e3.value, t3.value);
}
for (let n3 = 0, o3 = e3.key.length; n3 < o3; n3++) {
if (e3.key[n3] < t3.key[n3]) {
return -1;
}
if (e3.key[n3] > t3.key[n3]) {
return 1;
}
}
return 0;
};
return e2.map((e3, t3) => ({ value: e3, index: t3, key: r2 ? r2(e3, t3) : null })).sort((e3, t3) => {
let o3 = l2(e3, t3);
if (!o3) {
o3 = e3.index - t3.index;
}
return o3 * +n2;
}).map((e3) => e3.value);
};
const hx = function(e2, t2) {
let n2 = null;
e2.columns.forEach((e3) => {
if (e3.id === t2) {
n2 = e3;
}
});
return n2;
};
const bx = function(e2, t2) {
let n2 = null;
for (let o2 = 0; o2 < e2.columns.length; o2++) {
const a2 = e2.columns[o2];
if (a2.columnKey === t2) {
n2 = a2;
break;
}
}
if (!n2) si("ElTable", `No column matching with column-key: ${t2}`);
return n2;
};
const gx = function(e2, t2, n2) {
const o2 = (t2.className || "").match(new RegExp(`${n2}-table_[^\\s]+`, "gm"));
if (o2) {
return hx(e2, o2[0]);
}
return null;
};
const yx = (e2, t2) => {
if (!e2) throw new Error("Row is required when get row identity");
if (typeof t2 === "string") {
if (!t2.includes(".")) {
return `${e2[t2]}`;
}
const n2 = t2.split(".");
let o2 = e2;
for (const e3 of n2) {
o2 = o2[e3];
}
return `${o2}`;
} else if (typeof t2 === "function") {
return t2.call(null, e2);
}
};
const wx = function(e2, t2) {
const n2 = {};
(e2 || []).forEach((e3, o2) => {
n2[yx(e3, t2)] = { row: e3, index: o2 };
});
return n2;
};
function xx(e2, t2) {
const n2 = {};
let o2;
for (o2 in e2) {
n2[o2] = e2[o2];
}
for (o2 in t2) {
if (yt(t2, o2)) {
const e3 = t2[o2];
if (typeof e3 !== "undefined") {
n2[o2] = e3;
}
}
}
return n2;
}
function kx(e2) {
if (e2 === "") return e2;
if (e2 !== void 0) {
e2 = Number.parseInt(e2, 10);
if (Number.isNaN(e2)) {
e2 = "";
}
}
return e2;
}
function Sx(e2) {
if (e2 === "") return e2;
if (e2 !== void 0) {
e2 = kx(e2);
if (Number.isNaN(e2)) {
e2 = 80;
}
}
return e2;
}
function Cx(e2) {
if (typeof e2 === "number") {
return e2;
}
if (typeof e2 === "string") {
if (/^\d+(?:px)?$/.test(e2)) {
return Number.parseInt(e2, 10);
} else {
return e2;
}
}
return null;
}
function Ex(...e2) {
if (e2.length === 0) {
return (e3) => e3;
}
if (e2.length === 1) {
return e2[0];
}
return e2.reduce((e3, t2) => (...n2) => e3(t2(...n2)));
}
function Mx(e2, t2, n2) {
let o2 = false;
const a2 = e2.indexOf(t2);
const r2 = a2 !== -1;
const l2 = (l3) => {
if (l3 === "add") {
e2.push(t2);
} else {
e2.splice(a2, 1);
}
o2 = true;
if (wt(t2.children)) {
t2.children.forEach((t3) => {
Mx(e2, t3, n2 != null ? n2 : !r2);
});
}
};
if (Xs(n2)) {
if (n2 && !r2) {
l2("add");
} else if (!n2 && r2) {
l2("remove");
}
} else {
r2 ? l2("remove") : l2("add");
}
return o2;
}
function Ox(e2, t2, n2 = "children", o2 = "hasChildren") {
const a2 = (e3) => !(Array.isArray(e3) && e3.length);
function r2(e3, l2, s2) {
t2(e3, l2, s2);
l2.forEach((e4) => {
if (e4[o2]) {
t2(e4, null, s2 + 1);
return;
}
const l3 = e4[n2];
if (!a2(l3)) {
r2(e4, l3, s2 + 1);
}
});
}
e2.forEach((e3) => {
if (e3[o2]) {
t2(e3, null, 0);
return;
}
const l2 = e3[n2];
if (!a2(l2)) {
r2(e3, l2, 0);
}
});
}
let _x = null;
function $x(e2, t2, n2, o2) {
if ((_x == null ? void 0 : _x.trigger) === n2) {
return;
}
_x == null ? void 0 : _x();
const a2 = o2 == null ? void 0 : o2.refs.tableWrapper;
const r2 = a2 == null ? void 0 : a2.dataset.prefix;
const l2 = { strategy: "fixed", ...e2.popperOptions };
const s2 = vue.createVNode(um, { content: t2, virtualTriggering: true, virtualRef: n2, appendTo: a2, placement: "top", transition: "none", offset: 0, hideAfter: 0, ...e2, popperOptions: l2, onHide: () => {
_x == null ? void 0 : _x();
} });
s2.appContext = { ...o2.appContext, ...o2 };
const i2 = document.createElement("div");
vue.render(s2, i2);
s2.component.exposed.onOpen();
const u2 = a2 == null ? void 0 : a2.querySelector(`.${r2}-scrollbar__wrap`);
_x = () => {
vue.render(null, i2);
u2 == null ? void 0 : u2.removeEventListener("scroll", _x);
_x = null;
};
_x.trigger = n2;
u2 == null ? void 0 : u2.addEventListener("scroll", _x);
}
function Lx(e2) {
if (e2.children) {
return Vs(e2.children, Lx);
} else {
return [e2];
}
}
function Ax(e2, t2) {
return e2 + t2.colSpan;
}
const Dx = (e2, t2, n2, o2) => {
let a2 = 0;
let r2 = e2;
const l2 = n2.states.columns.value;
if (o2) {
const t3 = Lx(o2[e2]);
const n3 = l2.slice(0, l2.indexOf(t3[0]));
a2 = n3.reduce(Ax, 0);
r2 = a2 + t3.reduce(Ax, 0) - 1;
} else {
a2 = e2;
}
let s2;
switch (t2) {
case "left":
if (r2 < n2.states.fixedLeafColumnsLength.value) {
s2 = "left";
}
break;
case "right":
if (a2 >= l2.length - n2.states.rightFixedLeafColumnsLength.value) {
s2 = "right";
}
break;
default:
if (r2 < n2.states.fixedLeafColumnsLength.value) {
s2 = "left";
} else if (a2 >= l2.length - n2.states.rightFixedLeafColumnsLength.value) {
s2 = "right";
}
}
return s2 ? { direction: s2, start: a2, after: r2 } : {};
};
const Rx = (e2, t2, n2, o2, a2, r2 = 0) => {
const l2 = [];
const { direction: s2, start: i2, after: u2 } = Dx(t2, n2, o2, a2);
if (s2) {
const t3 = s2 === "left";
l2.push(`${e2}-fixed-column--${s2}`);
if (t3 && u2 + r2 === o2.states.fixedLeafColumnsLength.value - 1) {
l2.push("is-last-column");
} else if (!t3 && i2 - r2 === o2.states.columns.value.length - o2.states.rightFixedLeafColumnsLength.value) {
l2.push("is-first-column");
}
}
return l2;
};
function Tx(e2, t2) {
return e2 + (t2.realWidth === null || Number.isNaN(t2.realWidth) ? Number(t2.width) : t2.realWidth);
}
const Nx = (e2, t2, n2, o2) => {
const { direction: a2, start: r2 = 0, after: l2 = 0 } = Dx(e2, t2, n2, o2);
if (!a2) {
return;
}
const s2 = {};
const i2 = a2 === "left";
const u2 = n2.states.columns.value;
if (i2) {
s2.left = u2.slice(0, r2).reduce(Tx, 0);
} else {
s2.right = u2.slice(l2 + 1).reverse().reduce(Tx, 0);
}
return s2;
};
const Px = (e2, t2) => {
if (!e2) return;
if (!Number.isNaN(e2[t2])) {
e2[t2] = `${e2[t2]}px`;
}
};
function Ix(e2) {
const t2 = vue.getCurrentInstance();
const n2 = vue.ref(false);
const o2 = vue.ref([]);
const a2 = () => {
const t3 = e2.data.value || [];
const a3 = e2.rowKey.value;
if (n2.value) {
o2.value = t3.slice();
} else if (a3) {
const e3 = wx(o2.value, a3);
o2.value = t3.reduce((t4, n3) => {
const o3 = yx(n3, a3);
const r3 = e3[o3];
if (r3) {
t4.push(n3);
}
return t4;
}, []);
} else {
o2.value = [];
}
};
const r2 = (e3, n3) => {
const a3 = Mx(o2.value, e3, n3);
if (a3) {
t2.emit("expand-change", e3, o2.value.slice());
}
};
const l2 = (n3) => {
t2.store.assertRowKey();
const a3 = e2.data.value || [];
const r3 = e2.rowKey.value;
const l3 = wx(a3, r3);
o2.value = n3.reduce((e3, t3) => {
const n4 = l3[t3];
if (n4) {
e3.push(n4.row);
}
return e3;
}, []);
};
const i2 = (t3) => {
const n3 = e2.rowKey.value;
if (n3) {
const e3 = wx(o2.value, n3);
return !!e3[yx(t3, n3)];
}
return o2.value.includes(t3);
};
return { updateExpandRows: a2, toggleRowExpansion: r2, setExpandRowKeys: l2, isRowExpanded: i2, states: { expandRows: o2, defaultExpandAll: n2 } };
}
function Vx(e2) {
const t2 = vue.getCurrentInstance();
const n2 = vue.ref(null);
const o2 = vue.ref(null);
const a2 = (e3) => {
t2.store.assertRowKey();
n2.value = e3;
l2(e3);
};
const r2 = () => {
n2.value = null;
};
const l2 = (n3) => {
const { data: a3, rowKey: r3 } = e2;
let l3 = null;
if (r3.value) {
l3 = (vue.unref(a3) || []).find((e3) => yx(e3, r3.value) === n3);
}
o2.value = l3;
t2.emit("current-change", o2.value, null);
};
const i2 = (e3) => {
const n3 = o2.value;
if (e3 && e3 !== n3) {
o2.value = e3;
t2.emit("current-change", o2.value, n3);
return;
}
if (!e3 && n3) {
o2.value = null;
t2.emit("current-change", null, n3);
}
};
const c2 = () => {
const a3 = e2.rowKey.value;
const s2 = e2.data.value || [];
const i3 = o2.value;
if (!s2.includes(i3) && i3) {
if (a3) {
const e3 = yx(i3, a3);
l2(e3);
} else {
o2.value = null;
}
if (o2.value === null) {
t2.emit("current-change", null, i3);
}
} else if (n2.value) {
l2(n2.value);
r2();
}
};
return { setCurrentRowKey: a2, restoreCurrentRowKey: r2, setCurrentRowByKey: l2, updateCurrentRow: i2, updateCurrentRowData: c2, states: { _currentRowKey: n2, currentRow: o2 } };
}
function Bx(e2) {
const t2 = vue.ref([]);
const n2 = vue.ref({});
const o2 = vue.ref(16);
const a2 = vue.ref(false);
const r2 = vue.ref({});
const c2 = vue.ref("hasChildren");
const d2 = vue.ref("children");
const f2 = vue.getCurrentInstance();
const p2 = vue.computed(() => {
if (!e2.rowKey.value) return {};
const t3 = e2.data.value || [];
return h2(t3);
});
const m2 = vue.computed(() => {
const t3 = e2.rowKey.value;
const n3 = Object.keys(r2.value);
const o3 = {};
if (!n3.length) return o3;
n3.forEach((e3) => {
if (r2.value[e3].length) {
const n4 = { children: [] };
r2.value[e3].forEach((e4) => {
const a3 = yx(e4, t3);
n4.children.push(a3);
if (e4[c2.value] && !o3[a3]) {
o3[a3] = { children: [] };
}
});
o3[e3] = n4;
}
});
return o3;
});
const h2 = (t3) => {
const n3 = e2.rowKey.value;
const o3 = {};
Ox(t3, (e3, t4, r3) => {
const l2 = yx(e3, n3);
if (Array.isArray(t4)) {
o3[l2] = { children: t4.map((e4) => yx(e4, n3)), level: r3 };
} else if (a2.value) {
o3[l2] = { children: [], lazy: true, level: r3 };
}
}, d2.value, c2.value);
return o3;
};
const b2 = (e3 = false, o3 = ((e4) => (e4 = f2.store) == null ? void 0 : e4.states.defaultExpandAll.value)()) => {
var r3;
const l2 = p2.value;
const s2 = m2.value;
const i2 = Object.keys(l2);
const c3 = {};
if (i2.length) {
const r4 = vue.unref(n2);
const d3 = [];
const f3 = (n3, a3) => {
if (e3) {
if (t2.value) {
return o3 || t2.value.includes(a3);
} else {
return !!(o3 || (n3 == null ? void 0 : n3.expanded));
}
} else {
const e4 = o3 || t2.value && t2.value.includes(a3);
return !!((n3 == null ? void 0 : n3.expanded) || e4);
}
};
i2.forEach((e4) => {
const t3 = r4[e4];
const n3 = { ...l2[e4] };
n3.expanded = f3(t3, e4);
if (n3.lazy) {
const { loaded: o4 = false, loading: a3 = false } = t3 || {};
n3.loaded = !!o4;
n3.loading = !!a3;
d3.push(e4);
}
c3[e4] = n3;
});
const p3 = Object.keys(s2);
if (a2.value && p3.length && d3.length) {
p3.forEach((e4) => {
const t3 = r4[e4];
const n3 = s2[e4].children;
if (d3.includes(e4)) {
if (c3[e4].children.length !== 0) {
throw new Error("[ElTable]children must be an empty array.");
}
c3[e4].children = n3;
} else {
const { loaded: o4 = false, loading: a3 = false } = t3 || {};
c3[e4] = { lazy: true, loaded: !!o4, loading: !!a3, expanded: f3(t3, e4), children: n3, level: "" };
}
});
}
}
n2.value = c3;
(r3 = f2.store) == null ? void 0 : r3.updateTableScrollY();
};
vue.watch(() => t2.value, () => {
b2(true);
});
vue.watch(() => p2.value, () => {
b2();
});
vue.watch(() => m2.value, () => {
b2();
});
const g2 = (e3) => {
t2.value = e3;
b2();
};
const y2 = (t3, o3) => {
f2.store.assertRowKey();
const a3 = e2.rowKey.value;
const r3 = yx(t3, a3);
const l2 = r3 && n2.value[r3];
if (r3 && l2 && "expanded" in l2) {
const e3 = l2.expanded;
o3 = typeof o3 === "undefined" ? !l2.expanded : o3;
n2.value[r3].expanded = o3;
if (e3 !== o3) {
f2.emit("expand-change", t3, o3);
}
f2.store.updateTableScrollY();
}
};
const w2 = (t3) => {
f2.store.assertRowKey();
const o3 = e2.rowKey.value;
const r3 = yx(t3, o3);
const l2 = n2.value[r3];
if (a2.value && l2 && "loaded" in l2 && !l2.loaded) {
x2(t3, r3, l2);
} else {
y2(t3, void 0);
}
};
const x2 = (e3, t3, o3) => {
const { load: a3 } = f2.props;
if (a3 && !n2.value[t3].loaded) {
n2.value[t3].loading = true;
a3(e3, o3, (o4) => {
if (!Array.isArray(o4)) {
throw new TypeError("[ElTable] data must be an array");
}
n2.value[t3].loading = false;
n2.value[t3].loaded = true;
n2.value[t3].expanded = true;
if (o4.length) {
r2.value[t3] = o4;
}
f2.emit("expand-change", e3, true);
});
}
};
return { loadData: x2, loadOrToggle: w2, toggleTreeExpansion: y2, updateTreeExpandKeys: g2, updateTreeData: b2, normalize: h2, states: { expandRowKeys: t2, treeData: n2, indent: o2, lazy: a2, lazyTreeNodeMap: r2, lazyColumnIdentifier: c2, childrenColumnName: d2 } };
}
const Fx = (e2, t2) => {
const n2 = t2.sortingColumn;
if (!n2 || typeof n2.sortable === "string") {
return e2;
}
return mx(e2, t2.sortProp, t2.sortOrder, n2.sortMethod, n2.sortBy);
};
const jx = (e2) => {
const t2 = [];
e2.forEach((e3) => {
if (e3.children && e3.children.length > 0) {
t2.push.apply(t2, jx(e3.children));
} else {
t2.push(e3);
}
});
return t2;
};
function zx() {
var e2;
const t2 = vue.getCurrentInstance();
const { size: n2 } = vue.toRefs((e2 = t2.proxy) == null ? void 0 : e2.$props);
const o2 = vue.ref(null);
const a2 = vue.ref([]);
const r2 = vue.ref([]);
const l2 = vue.ref(false);
const c2 = vue.ref([]);
const d2 = vue.ref([]);
const f2 = vue.ref([]);
const p2 = vue.ref([]);
const m2 = vue.ref([]);
const h2 = vue.ref([]);
const b2 = vue.ref([]);
const g2 = vue.ref([]);
const y2 = [];
const w2 = vue.ref(0);
const x2 = vue.ref(0);
const k2 = vue.ref(0);
const S2 = vue.ref(false);
const C2 = vue.ref([]);
const E2 = vue.ref(false);
const M2 = vue.ref(false);
const O2 = vue.ref(null);
const _2 = vue.ref({});
const $2 = vue.ref(null);
const L2 = vue.ref(null);
const A2 = vue.ref(null);
const D2 = vue.ref(null);
const R2 = vue.ref(null);
vue.watch(a2, () => t2.state && I2(false), { deep: true });
const T2 = () => {
if (!o2.value) throw new Error("[ElTable] prop row-key is required");
};
const N2 = (e3) => {
var t3;
(t3 = e3.children) == null ? void 0 : t3.forEach((t4) => {
t4.fixed = e3.fixed;
N2(t4);
});
};
const P2 = () => {
c2.value.forEach((e4) => {
N2(e4);
});
p2.value = c2.value.filter((e4) => e4.fixed === true || e4.fixed === "left");
m2.value = c2.value.filter((e4) => e4.fixed === "right");
if (p2.value.length > 0 && c2.value[0] && c2.value[0].type === "selection" && !c2.value[0].fixed) {
c2.value[0].fixed = true;
p2.value.unshift(c2.value[0]);
}
const e3 = c2.value.filter((e4) => !e4.fixed);
d2.value = [].concat(p2.value).concat(e3).concat(m2.value);
const t3 = jx(e3);
const n3 = jx(p2.value);
const o3 = jx(m2.value);
w2.value = t3.length;
x2.value = n3.length;
k2.value = o3.length;
f2.value = [].concat(n3).concat(t3).concat(o3);
l2.value = p2.value.length > 0 || m2.value.length > 0;
};
const I2 = (e3, n3 = false) => {
if (e3) {
P2();
}
if (n3) {
t2.state.doLayout();
} else {
t2.state.debouncedUpdateLayout();
}
};
const V2 = (e3) => C2.value.includes(e3);
const B2 = () => {
S2.value = false;
const e3 = C2.value;
C2.value = [];
if (e3.length) {
t2.emit("selection-change", []);
}
};
const F2 = () => {
let e3;
if (o2.value) {
e3 = [];
const t3 = wx(C2.value, o2.value);
const n3 = wx(a2.value, o2.value);
for (const o3 in t3) {
if (yt(t3, o3) && !n3[o3]) {
e3.push(t3[o3].row);
}
}
} else {
e3 = C2.value.filter((e4) => !a2.value.includes(e4));
}
if (e3.length) {
const n3 = C2.value.filter((t3) => !e3.includes(t3));
C2.value = n3;
t2.emit("selection-change", n3.slice());
}
};
const j2 = () => (C2.value || []).slice();
const z2 = (e3, n3 = void 0, o3 = true) => {
const a3 = Mx(C2.value, e3, n3);
if (a3) {
const n4 = (C2.value || []).slice();
if (o3) {
t2.emit("select", n4, e3);
}
t2.emit("selection-change", n4);
}
};
const H2 = () => {
var e3, n3;
const o3 = M2.value ? !S2.value : !(S2.value || C2.value.length);
S2.value = o3;
let r3 = false;
let l3 = 0;
const s2 = (n3 = (e3 = t2 == null ? void 0 : t2.store) == null ? void 0 : e3.states) == null ? void 0 : n3.rowKey.value;
a2.value.forEach((e4, t3) => {
const n4 = t3 + l3;
if (O2.value) {
if (O2.value.call(null, e4, n4) && Mx(C2.value, e4, o3)) {
r3 = true;
}
} else {
if (Mx(C2.value, e4, o3)) {
r3 = true;
}
}
l3 += U2(yx(e4, s2));
});
if (r3) {
t2.emit("selection-change", C2.value ? C2.value.slice() : []);
}
t2.emit("select-all", (C2.value || []).slice());
};
const W2 = () => {
const e3 = wx(C2.value, o2.value);
a2.value.forEach((t3) => {
const n3 = yx(t3, o2.value);
const a3 = e3[n3];
if (a3) {
C2.value[a3.index] = t3;
}
});
};
const Y2 = () => {
var e3, n3, r3;
if (((e3 = a2.value) == null ? void 0 : e3.length) === 0) {
S2.value = false;
return;
}
let l3;
if (o2.value) {
l3 = wx(C2.value, o2.value);
}
const s2 = function(e4) {
if (l3) {
return !!l3[yx(e4, o2.value)];
} else {
return C2.value.includes(e4);
}
};
let i2 = true;
let u2 = 0;
let c3 = 0;
for (let e4 = 0, o3 = (a2.value || []).length; e4 < o3; e4++) {
const o4 = (r3 = (n3 = t2 == null ? void 0 : t2.store) == null ? void 0 : n3.states) == null ? void 0 : r3.rowKey.value;
const l4 = e4 + c3;
const d3 = a2.value[e4];
const f3 = O2.value && O2.value.call(null, d3, l4);
if (!s2(d3)) {
if (!O2.value || f3) {
i2 = false;
break;
}
} else {
u2++;
}
c3 += U2(yx(d3, o4));
}
if (u2 === 0) i2 = false;
S2.value = i2;
};
const U2 = (e3) => {
var n3;
if (!t2 || !t2.store) return 0;
const { treeData: o3 } = t2.store.states;
let a3 = 0;
const r3 = (n3 = o3.value[e3]) == null ? void 0 : n3.children;
if (r3) {
a3 += r3.length;
r3.forEach((e4) => {
a3 += U2(e4);
});
}
return a3;
};
const K2 = (e3, t3) => {
if (!Array.isArray(e3)) {
e3 = [e3];
}
const n3 = {};
e3.forEach((e4) => {
_2.value[e4.id] = t3;
n3[e4.columnKey || e4.id] = t3;
});
return n3;
};
const q2 = (e3, t3, n3) => {
if (L2.value && L2.value !== e3) {
L2.value.order = null;
}
L2.value = e3;
A2.value = t3;
D2.value = n3;
};
const G2 = () => {
let e3 = vue.unref(r2);
Object.keys(_2.value).forEach((t3) => {
const n3 = _2.value[t3];
if (!n3 || n3.length === 0) return;
const o3 = hx({ columns: f2.value }, t3);
if (o3 && o3.filterMethod) {
e3 = e3.filter((e4) => n3.some((t4) => o3.filterMethod.call(null, t4, e4, o3)));
}
});
$2.value = e3;
};
const X2 = () => {
a2.value = Fx($2.value, { sortingColumn: L2.value, sortProp: A2.value, sortOrder: D2.value });
};
const Z2 = (e3 = void 0) => {
if (!(e3 && e3.filter)) {
G2();
}
X2();
};
const Q2 = (e3) => {
const { tableHeaderRef: n3 } = t2.refs;
if (!n3) return;
const o3 = Object.assign({}, n3.filterPanels);
const a3 = Object.keys(o3);
if (!a3.length) return;
if (typeof e3 === "string") {
e3 = [e3];
}
if (Array.isArray(e3)) {
const n4 = e3.map((e4) => bx({ columns: f2.value }, e4));
a3.forEach((e4) => {
const t3 = n4.find((t4) => t4.id === e4);
if (t3) {
t3.filteredValue = [];
}
});
t2.store.commit("filterChange", { column: n4, values: [], silent: true, multi: true });
} else {
a3.forEach((e4) => {
const t3 = f2.value.find((t4) => t4.id === e4);
if (t3) {
t3.filteredValue = [];
}
});
_2.value = {};
t2.store.commit("filterChange", { column: {}, values: [], silent: true });
}
};
const ee2 = () => {
if (!L2.value) return;
q2(null, null, null);
t2.store.commit("changeSortCondition", { silent: true });
};
const { setExpandRowKeys: te2, toggleRowExpansion: ne2, updateExpandRows: oe2, states: ae2, isRowExpanded: re2 } = Ix({ data: a2, rowKey: o2 });
const { updateTreeExpandKeys: le2, toggleTreeExpansion: se2, updateTreeData: ie2, loadOrToggle: ue2, states: ce2 } = Bx({ data: a2, rowKey: o2 });
const { updateCurrentRowData: de2, updateCurrentRow: fe2, setCurrentRowKey: pe2, states: ve2 } = Vx({ data: a2, rowKey: o2 });
const me2 = (e3) => {
te2(e3);
le2(e3);
};
const he2 = (e3, t3) => {
const n3 = f2.value.some(({ type: e4 }) => e4 === "expand");
if (n3) {
ne2(e3, t3);
} else {
se2(e3, t3);
}
};
return { assertRowKey: T2, updateColumns: P2, scheduleLayout: I2, isSelected: V2, clearSelection: B2, cleanSelection: F2, getSelectionRows: j2, toggleRowSelection: z2, _toggleAllSelection: H2, toggleAllSelection: null, updateSelectionByRowKey: W2, updateAllSelected: Y2, updateFilters: K2, updateCurrentRow: fe2, updateSort: q2, execFilter: G2, execSort: X2, execQuery: Z2, clearFilter: Q2, clearSort: ee2, toggleRowExpansion: ne2, setExpandRowKeysAdapter: me2, setCurrentRowKey: pe2, toggleRowExpansionAdapter: he2, isRowExpanded: re2, updateExpandRows: oe2, updateCurrentRowData: de2, loadOrToggle: ue2, updateTreeData: ie2, states: { tableSize: n2, rowKey: o2, data: a2, _data: r2, isComplex: l2, _columns: c2, originColumns: d2, columns: f2, fixedColumns: p2, rightFixedColumns: m2, leafColumns: h2, fixedLeafColumns: b2, rightFixedLeafColumns: g2, updateOrderFns: y2, leafColumnsLength: w2, fixedLeafColumnsLength: x2, rightFixedLeafColumnsLength: k2, isAllSelected: S2, selection: C2, reserveSelection: E2, selectOnIndeterminate: M2, selectable: O2, filters: _2, filteredData: $2, sortingColumn: L2, sortProp: A2, sortOrder: D2, hoverRow: R2, ...ae2, ...ce2, ...ve2 } };
}
function Hx(e2, t2) {
return e2.map((e3) => {
var n2;
if (e3.id === t2.id) {
return t2;
} else if ((n2 = e3.children) == null ? void 0 : n2.length) {
e3.children = Hx(e3.children, t2);
}
return e3;
});
}
function Wx(e2) {
e2.forEach((e3) => {
var t2, n2;
e3.no = (t2 = e3.getColumnIndex) == null ? void 0 : t2.call(e3);
if ((n2 = e3.children) == null ? void 0 : n2.length) {
Wx(e3.children);
}
});
e2.sort((e3, t2) => e3.no - t2.no);
}
function Yx() {
const e2 = vue.getCurrentInstance();
const t2 = zx();
const n2 = Vu("table");
const o2 = { setData(t3, n3) {
const o3 = vue.unref(t3._data) !== n3;
t3.data.value = n3;
t3._data.value = n3;
e2.store.execQuery();
e2.store.updateCurrentRowData();
e2.store.updateExpandRows();
e2.store.updateTreeData(e2.store.states.defaultExpandAll.value);
if (vue.unref(t3.reserveSelection)) {
e2.store.assertRowKey();
e2.store.updateSelectionByRowKey();
} else {
if (o3) {
e2.store.clearSelection();
} else {
e2.store.cleanSelection();
}
}
e2.store.updateAllSelected();
if (e2.$ready) {
e2.store.scheduleLayout();
}
}, insertColumn(t3, n3, o3, a3) {
const r3 = vue.unref(t3._columns);
let l2 = [];
if (!o3) {
r3.push(n3);
l2 = r3;
} else {
if (o3 && !o3.children) {
o3.children = [];
}
o3.children.push(n3);
l2 = Hx(r3, o3);
}
Wx(l2);
t3._columns.value = l2;
t3.updateOrderFns.push(a3);
if (n3.type === "selection") {
t3.selectable.value = n3.selectable;
t3.reserveSelection.value = n3.reserveSelection;
}
if (e2.$ready) {
e2.store.updateColumns();
e2.store.scheduleLayout();
}
}, updateColumnOrder(t3, n3) {
var o3;
const a3 = (o3 = n3.getColumnIndex) == null ? void 0 : o3.call(n3);
if (a3 === n3.no) return;
Wx(t3._columns.value);
if (e2.$ready) {
e2.store.updateColumns();
}
}, removeColumn(t3, n3, o3, a3) {
const r3 = vue.unref(t3._columns) || [];
if (o3) {
o3.children.splice(o3.children.findIndex((e3) => e3.id === n3.id), 1);
vue.nextTick(() => {
var e3;
if (((e3 = o3.children) == null ? void 0 : e3.length) === 0) {
delete o3.children;
}
});
t3._columns.value = Hx(r3, o3);
} else {
const e3 = r3.indexOf(n3);
if (e3 > -1) {
r3.splice(e3, 1);
t3._columns.value = r3;
}
}
const l2 = t3.updateOrderFns.indexOf(a3);
l2 > -1 && t3.updateOrderFns.splice(l2, 1);
if (e2.$ready) {
e2.store.updateColumns();
e2.store.scheduleLayout();
}
}, sort(t3, n3) {
const { prop: o3, order: a3, init: r3 } = n3;
if (o3) {
const n4 = vue.unref(t3.columns).find((e3) => e3.property === o3);
if (n4) {
n4.order = a3;
e2.store.updateSort(n4, o3, a3);
e2.store.commit("changeSortCondition", { init: r3 });
}
}
}, changeSortCondition(t3, n3) {
const { sortingColumn: o3, sortProp: a3, sortOrder: r3 } = t3;
const l2 = vue.unref(o3), s2 = vue.unref(a3), i2 = vue.unref(r3);
if (i2 === null) {
t3.sortingColumn.value = null;
t3.sortProp.value = null;
}
const c2 = { filter: true };
e2.store.execQuery(c2);
if (!n3 || !(n3.silent || n3.init)) {
e2.emit("sort-change", { column: l2, prop: s2, order: i2 });
}
e2.store.updateTableScrollY();
}, filterChange(t3, n3) {
const { column: o3, values: a3, silent: r3 } = n3;
const l2 = e2.store.updateFilters(o3, a3);
e2.store.execQuery();
if (!r3) {
e2.emit("filter-change", l2);
}
e2.store.updateTableScrollY();
}, toggleAllSelection() {
e2.store.toggleAllSelection();
}, rowSelectedChanged(t3, n3) {
e2.store.toggleRowSelection(n3);
e2.store.updateAllSelected();
}, setHoverRow(e3, t3) {
e3.hoverRow.value = t3;
}, setCurrentRow(t3, n3) {
e2.store.updateCurrentRow(n3);
} };
const a2 = function(t3, ...n3) {
const o3 = e2.store.mutations;
if (o3[t3]) {
o3[t3].apply(e2, [e2.store.states].concat(n3));
} else {
throw new Error(`Action not found: ${t3}`);
}
};
const r2 = function() {
vue.nextTick(() => e2.layout.updateScrollY.apply(e2.layout));
};
return { ns: n2, ...t2, mutations: o2, commit: a2, updateTableScrollY: r2 };
}
const Ux = { rowKey: "rowKey", defaultExpandAll: "defaultExpandAll", selectOnIndeterminate: "selectOnIndeterminate", indent: "indent", lazy: "lazy", data: "data", ["treeProps.hasChildren"]: { key: "lazyColumnIdentifier", default: "hasChildren" }, ["treeProps.children"]: { key: "childrenColumnName", default: "children" } };
function Kx(e2, t2) {
if (!e2) {
throw new Error("Table is required.");
}
const n2 = Yx();
n2.toggleAllSelection = $s(n2._toggleAllSelection, 10);
Object.keys(Ux).forEach((e3) => {
Gx(Xx(t2, e3), e3, n2);
});
qx(n2, t2);
return n2;
}
function qx(e2, t2) {
Object.keys(Ux).forEach((n2) => {
vue.watch(() => Xx(t2, n2), (t3) => {
Gx(t3, n2, e2);
});
});
}
function Gx(e2, t2, n2) {
let o2 = e2;
let a2 = Ux[t2];
if (typeof Ux[t2] === "object") {
a2 = a2.key;
o2 = o2 || Ux[t2].default;
}
n2.states[a2].value = o2;
}
function Xx(e2, t2) {
if (t2.includes(".")) {
const n2 = t2.split(".");
let o2 = e2;
n2.forEach((e3) => {
o2 = o2[e3];
});
return o2;
} else {
return e2[t2];
}
}
class Zx {
constructor(e2) {
this.observers = [];
this.table = null;
this.store = null;
this.columns = [];
this.fit = true;
this.showHeader = true;
this.height = vue.ref(null);
this.scrollX = vue.ref(false);
this.scrollY = vue.ref(false);
this.bodyWidth = vue.ref(null);
this.fixedWidth = vue.ref(null);
this.rightFixedWidth = vue.ref(null);
this.gutterWidth = 0;
for (const t2 in e2) {
if (yt(e2, t2)) {
if (vue.isRef(this[t2])) {
this[t2].value = e2[t2];
} else {
this[t2] = e2[t2];
}
}
}
if (!this.table) {
throw new Error("Table is required for Table Layout");
}
if (!this.store) {
throw new Error("Store is required for Table Layout");
}
}
updateScrollY() {
const e2 = this.height.value;
if (e2 === null) return false;
const t2 = this.table.refs.scrollBarRef;
if (this.table.vnode.el && (t2 == null ? void 0 : t2.wrapRef)) {
let e3 = true;
const n2 = this.scrollY.value;
e3 = t2.wrapRef.scrollHeight > t2.wrapRef.clientHeight;
this.scrollY.value = e3;
return n2 !== e3;
}
return false;
}
setHeight(e2, t2 = "height") {
if (!Ie) return;
const n2 = this.table.vnode.el;
e2 = Cx(e2);
this.height.value = Number(e2);
if (!n2 && (e2 || e2 === 0)) return vue.nextTick(() => this.setHeight(e2, t2));
if (typeof e2 === "number") {
n2.style[t2] = `${e2}px`;
this.updateElsHeight();
} else if (typeof e2 === "string") {
n2.style[t2] = e2;
this.updateElsHeight();
}
}
setMaxHeight(e2) {
this.setHeight(e2, "max-height");
}
getFlattenColumns() {
const e2 = [];
const t2 = this.table.store.states.columns.value;
t2.forEach((t3) => {
if (t3.isColumnGroup) {
e2.push.apply(e2, t3.columns);
} else {
e2.push(t3);
}
});
return e2;
}
updateElsHeight() {
this.updateScrollY();
this.notifyObservers("scrollable");
}
headerDisplayNone(e2) {
if (!e2) return true;
let t2 = e2;
while (t2.tagName !== "DIV") {
if (getComputedStyle(t2).display === "none") {
return true;
}
t2 = t2.parentElement;
}
return false;
}
updateColumnsWidth() {
if (!Ie) return;
const e2 = this.fit;
const t2 = this.table.vnode.el.clientWidth;
let n2 = 0;
const o2 = this.getFlattenColumns();
const a2 = o2.filter((e3) => typeof e3.width !== "number");
o2.forEach((e3) => {
if (typeof e3.width === "number" && e3.realWidth) e3.realWidth = null;
});
if (a2.length > 0 && e2) {
o2.forEach((e3) => {
n2 += Number(e3.width || e3.minWidth || 80);
});
if (n2 <= t2) {
this.scrollX.value = false;
const e3 = t2 - n2;
if (a2.length === 1) {
a2[0].realWidth = Number(a2[0].minWidth || 80) + e3;
} else {
const t3 = a2.reduce((e4, t4) => e4 + Number(t4.minWidth || 80), 0);
const n3 = e3 / t3;
let o3 = 0;
a2.forEach((e4, t4) => {
if (t4 === 0) return;
const a3 = Math.floor(Number(e4.minWidth || 80) * n3);
o3 += a3;
e4.realWidth = Number(e4.minWidth || 80) + a3;
});
a2[0].realWidth = Number(a2[0].minWidth || 80) + e3 - o3;
}
} else {
this.scrollX.value = true;
a2.forEach((e3) => {
e3.realWidth = Number(e3.minWidth);
});
}
this.bodyWidth.value = Math.max(n2, t2);
this.table.state.resizeState.value.width = this.bodyWidth.value;
} else {
o2.forEach((e3) => {
if (!e3.width && !e3.minWidth) {
e3.realWidth = 80;
} else {
e3.realWidth = Number(e3.width || e3.minWidth);
}
n2 += e3.realWidth;
});
this.scrollX.value = n2 > t2;
this.bodyWidth.value = n2;
}
const r2 = this.store.states.fixedColumns.value;
if (r2.length > 0) {
let e3 = 0;
r2.forEach((t3) => {
e3 += Number(t3.realWidth || t3.width);
});
this.fixedWidth.value = e3;
}
const l2 = this.store.states.rightFixedColumns.value;
if (l2.length > 0) {
let e3 = 0;
l2.forEach((t3) => {
e3 += Number(t3.realWidth || t3.width);
});
this.rightFixedWidth.value = e3;
}
this.notifyObservers("columns");
}
addObserver(e2) {
this.observers.push(e2);
}
removeObserver(e2) {
const t2 = this.observers.indexOf(e2);
if (t2 !== -1) {
this.observers.splice(t2, 1);
}
}
notifyObservers(e2) {
const t2 = this.observers;
t2.forEach((t3) => {
var n2, o2;
switch (e2) {
case "columns":
(n2 = t3.state) == null ? void 0 : n2.onColumnsChange(this);
break;
case "scrollable":
(o2 = t3.state) == null ? void 0 : o2.onScrollableChange(this);
break;
default:
throw new Error(`Table Layout don't have event ${e2}.`);
}
});
}
}
const { CheckboxGroup: Jx } = tg;
const Qx = vue.defineComponent({ name: "ElTableFilterPanel", components: { ElCheckbox: tg, ElCheckboxGroup: Jx, ElScrollbar: Lp, ElTooltip: um, ElIcon: Uf, ArrowDown: gi, ArrowUp: Ci }, directives: { ClickOutside: Fh }, props: { placement: { type: String, default: "bottom-start" }, store: { type: Object }, column: { type: Object }, upDataColumn: { type: Function } }, setup(e2) {
const t2 = vue.getCurrentInstance();
const { t: n2 } = Du();
const o2 = Vu("table-filter");
const a2 = t2 == null ? void 0 : t2.parent;
if (!a2.filterPanels.value[e2.column.id]) {
a2.filterPanels.value[e2.column.id] = t2;
}
const r2 = vue.ref(false);
const u2 = vue.ref(null);
const c2 = vue.computed(() => e2.column && e2.column.filters);
const d2 = vue.computed(() => {
if (e2.column.filterClassName) {
return `${o2.b()} ${e2.column.filterClassName}`;
}
return o2.b();
});
const f2 = vue.computed({ get: () => {
var t3;
return (((t3 = e2.column) == null ? void 0 : t3.filteredValue) || [])[0];
}, set: (e3) => {
if (p2.value) {
if (typeof e3 !== "undefined" && e3 !== null) {
p2.value.splice(0, 1, e3);
} else {
p2.value.splice(0, 1);
}
}
} });
const p2 = vue.computed({ get() {
if (e2.column) {
return e2.column.filteredValue || [];
}
return [];
}, set(t3) {
if (e2.column) {
e2.upDataColumn("filteredValue", t3);
}
} });
const m2 = vue.computed(() => {
if (e2.column) {
return e2.column.filterMultiple;
}
return true;
});
const h2 = (e3) => e3.value === f2.value;
const b2 = () => {
r2.value = false;
};
const g2 = (e3) => {
e3.stopPropagation();
r2.value = !r2.value;
};
const y2 = () => {
r2.value = false;
};
const w2 = () => {
S2(p2.value);
b2();
};
const x2 = () => {
p2.value = [];
S2(p2.value);
b2();
};
const k2 = (e3) => {
f2.value = e3;
if (typeof e3 !== "undefined" && e3 !== null) {
S2(p2.value);
} else {
S2([]);
}
b2();
};
const S2 = (t3) => {
e2.store.commit("filterChange", { column: e2.column, values: t3 });
e2.store.updateAllSelected();
};
vue.watch(r2, (t3) => {
if (e2.column) {
e2.upDataColumn("filterOpened", t3);
}
}, { immediate: true });
const C2 = vue.computed(() => {
var e3, t3;
return (t3 = (e3 = u2.value) == null ? void 0 : e3.popperRef) == null ? void 0 : t3.contentRef;
});
return { tooltipVisible: r2, multiple: m2, filterClassName: d2, filteredValue: p2, filterValue: f2, filters: c2, handleConfirm: w2, handleReset: x2, handleSelect: k2, isActive: h2, t: n2, ns: o2, showFilterPanel: g2, hideFilterPanel: y2, popperPaneRef: C2, tooltip: u2 };
} });
const ek = { key: 0 };
const tk = ["disabled"];
const nk = ["label", "onClick"];
function ok(e2, a2, r2, l2, s2, i2) {
const u2 = vue.resolveComponent("el-checkbox");
const c2 = vue.resolveComponent("el-checkbox-group");
const d2 = vue.resolveComponent("el-scrollbar");
const f2 = vue.resolveComponent("arrow-up");
const p2 = vue.resolveComponent("arrow-down");
const v2 = vue.resolveComponent("el-icon");
const m2 = vue.resolveComponent("el-tooltip");
const h2 = vue.resolveDirective("click-outside");
return vue.openBlock(), vue.createBlock(m2, { ref: "tooltip", visible: e2.tooltipVisible, offset: 0, placement: e2.placement, "show-arrow": false, "stop-popper-mouse-event": false, teleported: "", effect: "light", pure: "", "popper-class": e2.filterClassName, persistent: "" }, { content: vue.withCtx(() => [e2.multiple ? (vue.openBlock(), vue.createElementBlock("div", ek, [vue.createElementVNode("div", { class: vue.normalizeClass(e2.ns.e("content")) }, [vue.createVNode(d2, { "wrap-class": e2.ns.e("wrap") }, { default: vue.withCtx(() => [vue.createVNode(c2, { modelValue: e2.filteredValue, "onUpdate:modelValue": a2[0] || (a2[0] = (t2) => e2.filteredValue = t2), class: vue.normalizeClass(e2.ns.e("checkbox-group")) }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e2.filters, (e3) => (vue.openBlock(), vue.createBlock(u2, { key: e3.value, value: e3.value }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(e3.text), 1)]), _: 2 }, 1032, ["value"]))), 128))]), _: 1 }, 8, ["modelValue", "class"])]), _: 1 }, 8, ["wrap-class"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass(e2.ns.e("bottom")) }, [vue.createElementVNode("button", { class: vue.normalizeClass({ [e2.ns.is("disabled")]: e2.filteredValue.length === 0 }), disabled: e2.filteredValue.length === 0, type: "button", onClick: a2[1] || (a2[1] = (...t2) => e2.handleConfirm && e2.handleConfirm(...t2)) }, vue.toDisplayString(e2.t("el.table.confirmFilter")), 11, tk), vue.createElementVNode("button", { type: "button", onClick: a2[2] || (a2[2] = (...t2) => e2.handleReset && e2.handleReset(...t2)) }, vue.toDisplayString(e2.t("el.table.resetFilter")), 1)], 2)])) : (vue.openBlock(), vue.createElementBlock("ul", { key: 1, class: vue.normalizeClass(e2.ns.e("list")) }, [vue.createElementVNode("li", { class: vue.normalizeClass([e2.ns.e("list-item"), { [e2.ns.is("active")]: e2.filterValue === void 0 || e2.filterValue === null }]), onClick: a2[3] || (a2[3] = (t2) => e2.handleSelect(null)) }, vue.toDisplayString(e2.t("el.table.clearFilter")), 3), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e2.filters, (o2) => (vue.openBlock(), vue.createElementBlock("li", { key: o2.value, class: vue.normalizeClass([e2.ns.e("list-item"), e2.ns.is("active", e2.isActive(o2))]), label: o2.value, onClick: (t2) => e2.handleSelect(o2.value) }, vue.toDisplayString(o2.text), 11, nk))), 128))], 2))]), default: vue.withCtx(() => [vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass([`${e2.ns.namespace.value}-table__column-filter-trigger`, `${e2.ns.namespace.value}-none-outline`]), onClick: a2[4] || (a2[4] = (...t2) => e2.showFilterPanel && e2.showFilterPanel(...t2)) }, [vue.createVNode(v2, null, { default: vue.withCtx(() => [vue.renderSlot(e2.$slots, "filter-icon", {}, () => [e2.column.filterOpened ? (vue.openBlock(), vue.createBlock(f2, { key: 0 })) : (vue.openBlock(), vue.createBlock(p2, { key: 1 }))])]), _: 3 })], 2)), [[h2, e2.hideFilterPanel, e2.popperPaneRef]])]), _: 3 }, 8, ["visible", "placement", "popper-class"]);
}
var ak = jf(Qx, [["render", ok], ["__file", "filter-panel.vue"]]);
function rk(e2) {
const t2 = vue.getCurrentInstance();
vue.onBeforeMount(() => {
n2.value.addObserver(t2);
});
vue.onMounted(() => {
o2(n2.value);
a2(n2.value);
});
vue.onUpdated(() => {
o2(n2.value);
a2(n2.value);
});
vue.onUnmounted(() => {
n2.value.removeObserver(t2);
});
const n2 = vue.computed(() => {
const t3 = e2.layout;
if (!t3) {
throw new Error("Can not find table layout.");
}
return t3;
});
const o2 = (t3) => {
var n3;
const o3 = ((n3 = e2.vnode.el) == null ? void 0 : n3.querySelectorAll("colgroup > col")) || [];
if (!o3.length) return;
const a3 = t3.getFlattenColumns();
const r2 = {};
a3.forEach((e3) => {
r2[e3.id] = e3;
});
for (let e3 = 0, t4 = o3.length; e3 < t4; e3++) {
const t5 = o3[e3];
const n4 = t5.getAttribute("name");
const a4 = r2[n4];
if (a4) {
t5.setAttribute("width", a4.realWidth || a4.width);
}
}
};
const a2 = (t3) => {
var n3, o3;
const a3 = ((n3 = e2.vnode.el) == null ? void 0 : n3.querySelectorAll("colgroup > col[name=gutter]")) || [];
for (let e3 = 0, n4 = a3.length; e3 < n4; e3++) {
const n5 = a3[e3];
n5.setAttribute("width", t3.scrollY.value ? t3.gutterWidth : "0");
}
const r2 = ((o3 = e2.vnode.el) == null ? void 0 : o3.querySelectorAll("th.gutter")) || [];
for (let e3 = 0, n4 = r2.length; e3 < n4; e3++) {
const n5 = r2[e3];
n5.style.width = t3.scrollY.value ? `${t3.gutterWidth}px` : "0";
n5.style.display = t3.scrollY.value ? "" : "none";
}
};
return { tableLayout: n2.value, onColumnsChange: o2, onScrollableChange: a2 };
}
const lk = Symbol("ElTable");
function sk(e2, t2) {
const n2 = vue.getCurrentInstance();
const o2 = vue.inject(lk);
const a2 = (e3) => {
e3.stopPropagation();
return;
};
const r2 = (e3, t3) => {
if (!t3.filters && t3.sortable) {
b2(e3, t3, false);
} else if (t3.filterable && !t3.sortable) {
a2(e3);
}
o2 == null ? void 0 : o2.emit("header-click", t3, e3);
};
const l2 = (e3, t3) => {
o2 == null ? void 0 : o2.emit("header-contextmenu", t3, e3);
};
const i2 = vue.ref(null);
const u2 = vue.ref(false);
const c2 = vue.ref({});
const d2 = (a3, r3) => {
if (!Ie) return;
if (r3.children && r3.children.length > 0) return;
if (i2.value && e2.border) {
u2.value = true;
const l3 = o2;
t2("set-drag-visible", true);
const s2 = l3 == null ? void 0 : l3.vnode.el;
const d3 = s2.getBoundingClientRect().left;
const f3 = n2.vnode.el.querySelector(`th.${r3.id}`);
const p2 = f3.getBoundingClientRect();
const v2 = p2.left - d3 + 30;
di(f3, "noclick");
c2.value = { startMouseLeft: a3.clientX, startLeft: p2.right - d3, startColumnLeft: p2.left - d3, tableLeft: d3 };
const m3 = l3 == null ? void 0 : l3.refs.resizeProxy;
m3.style.left = `${c2.value.startLeft}px`;
document.onselectstart = function() {
return false;
};
document.ondragstart = function() {
return false;
};
const h3 = (e3) => {
const t3 = e3.clientX - c2.value.startMouseLeft;
const n3 = c2.value.startLeft + t3;
m3.style.left = `${Math.max(v2, n3)}px`;
};
const b3 = () => {
if (u2.value) {
const { startColumnLeft: n3, startLeft: o3 } = c2.value;
const s3 = Number.parseInt(m3.style.left, 10);
const d4 = s3 - n3;
r3.width = r3.realWidth = d4;
l3 == null ? void 0 : l3.emit("header-dragend", r3.width, o3 - n3, r3, a3);
requestAnimationFrame(() => {
e2.store.scheduleLayout(false, true);
});
document.body.style.cursor = "";
u2.value = false;
i2.value = null;
c2.value = {};
t2("set-drag-visible", false);
}
document.removeEventListener("mousemove", h3);
document.removeEventListener("mouseup", b3);
document.onselectstart = null;
document.ondragstart = null;
setTimeout(() => {
fi(f3, "noclick");
}, 0);
};
document.addEventListener("mousemove", h3);
document.addEventListener("mouseup", b3);
}
};
const f2 = (t3, n3) => {
if (n3.children && n3.children.length > 0) return;
const o3 = t3.target;
if (!Qs(o3)) {
return;
}
const a3 = o3 == null ? void 0 : o3.closest("th");
if (!n3 || !n3.resizable) return;
if (!u2.value && e2.border) {
const e3 = a3.getBoundingClientRect();
const o4 = document.body.style;
if (e3.width > 12 && e3.right - t3.pageX < 8) {
o4.cursor = "col-resize";
if (ci(a3, "is-sortable")) {
a3.style.cursor = "col-resize";
}
i2.value = n3;
} else if (!u2.value) {
o4.cursor = "";
if (ci(a3, "is-sortable")) {
a3.style.cursor = "pointer";
}
i2.value = null;
}
}
};
const m2 = () => {
if (!Ie) return;
document.body.style.cursor = "";
};
const h2 = ({ order: e3, sortOrders: t3 }) => {
if (e3 === "") return t3[0];
const n3 = t3.indexOf(e3 || null);
return t3[n3 > t3.length - 2 ? 0 : n3 + 1];
};
const b2 = (t3, n3, a3) => {
var r3;
t3.stopPropagation();
const l3 = n3.order === a3 ? null : a3 || h2(n3);
const s2 = (r3 = t3.target) == null ? void 0 : r3.closest("th");
if (s2) {
if (ci(s2, "noclick")) {
fi(s2, "noclick");
return;
}
}
if (!n3.sortable) return;
const i3 = e2.store.states;
let u3 = i3.sortProp.value;
let c3;
const d3 = i3.sortingColumn.value;
if (d3 !== n3 || d3 === n3 && d3.order === null) {
if (d3) {
d3.order = null;
}
i3.sortingColumn.value = n3;
u3 = n3.property;
}
if (!l3) {
c3 = n3.order = null;
} else {
c3 = n3.order = l3;
}
i3.sortProp.value = u3;
i3.sortOrder.value = c3;
o2 == null ? void 0 : o2.store.commit("changeSortCondition");
};
return { handleHeaderClick: r2, handleHeaderContextMenu: l2, handleMouseDown: d2, handleMouseMove: f2, handleMouseOut: m2, handleSortClick: b2, handleFilterClick: a2 };
}
function ik(e2) {
const t2 = vue.inject(lk);
const n2 = Vu("table");
const o2 = (e3) => {
const n3 = t2 == null ? void 0 : t2.props.headerRowStyle;
if (typeof n3 === "function") {
return n3.call(null, { rowIndex: e3 });
}
return n3;
};
const a2 = (e3) => {
const n3 = [];
const o3 = t2 == null ? void 0 : t2.props.headerRowClassName;
if (typeof o3 === "string") {
n3.push(o3);
} else if (typeof o3 === "function") {
n3.push(o3.call(null, { rowIndex: e3 }));
}
return n3.join(" ");
};
const r2 = (n3, o3, a3, r3) => {
var l3;
let s2 = (l3 = t2 == null ? void 0 : t2.props.headerCellStyle) != null ? l3 : {};
if (typeof s2 === "function") {
s2 = s2.call(null, { rowIndex: n3, columnIndex: o3, row: a3, column: r3 });
}
const i2 = Nx(o3, r3.fixed, e2.store, a3);
Px(i2, "left");
Px(i2, "right");
return Object.assign({}, s2, i2);
};
const l2 = (o3, a3, r3, l3) => {
const s2 = Rx(n2.b(), a3, l3.fixed, e2.store, r3);
const i2 = [l3.id, l3.order, l3.headerAlign, l3.className, l3.labelClassName, ...s2];
if (!l3.children) {
i2.push("is-leaf");
}
if (l3.sortable) {
i2.push("is-sortable");
}
const u2 = t2 == null ? void 0 : t2.props.headerCellClassName;
if (typeof u2 === "string") {
i2.push(u2);
} else if (typeof u2 === "function") {
i2.push(u2.call(null, { rowIndex: o3, columnIndex: a3, row: r3, column: l3 }));
}
i2.push(n2.e("cell"));
return i2.filter((e3) => Boolean(e3)).join(" ");
};
return { getHeaderRowStyle: o2, getHeaderRowClass: a2, getHeaderCellStyle: r2, getHeaderCellClass: l2 };
}
const uk = (e2) => {
const t2 = [];
e2.forEach((e3) => {
if (e3.children) {
t2.push(e3);
t2.push.apply(t2, uk(e3.children));
} else {
t2.push(e3);
}
});
return t2;
};
const ck = (e2) => {
let t2 = 1;
const n2 = (e3, o3) => {
if (o3) {
e3.level = o3.level + 1;
if (t2 < e3.level) {
t2 = e3.level;
}
}
if (e3.children) {
let t3 = 0;
e3.children.forEach((o4) => {
n2(o4, e3);
t3 += o4.colSpan;
});
e3.colSpan = t3;
} else {
e3.colSpan = 1;
}
};
e2.forEach((e3) => {
e3.level = 1;
n2(e3, void 0);
});
const o2 = [];
for (let e3 = 0; e3 < t2; e3++) {
o2.push([]);
}
const a2 = uk(e2);
a2.forEach((e3) => {
if (!e3.children) {
e3.rowSpan = t2 - e3.level + 1;
} else {
e3.rowSpan = 1;
e3.children.forEach((e4) => e4.isSubColumn = true);
}
o2[e3.level - 1].push(e3);
});
return o2;
};
function dk(e2) {
const t2 = vue.inject(lk);
const n2 = vue.computed(() => ck(e2.store.states.originColumns.value));
const o2 = vue.computed(() => {
const e3 = n2.value.length > 1;
if (e3 && t2) {
t2.state.isGroup.value = true;
}
return e3;
});
const a2 = (e3) => {
e3.stopPropagation();
t2 == null ? void 0 : t2.store.commit("toggleAllSelection");
};
return { isGroup: o2, toggleAllSelection: a2, columnRows: n2 };
}
var fk = vue.defineComponent({ name: "ElTableHeader", components: { ElCheckbox: tg }, props: { fixed: { type: String, default: "" }, store: { required: true, type: Object }, border: Boolean, defaultSort: { type: Object, default: () => ({ prop: "", order: "" }) } }, setup(e2, { emit: t2 }) {
const n2 = vue.getCurrentInstance();
const o2 = vue.inject(lk);
const a2 = Vu("table");
const r2 = vue.ref({});
const { onColumnsChange: l2, onScrollableChange: i2 } = rk(o2);
vue.onMounted(async () => {
await vue.nextTick();
await vue.nextTick();
const { prop: t3, order: n3 } = e2.defaultSort;
o2 == null ? void 0 : o2.store.commit("sort", { prop: t3, order: n3, init: true });
});
const { handleHeaderClick: u2, handleHeaderContextMenu: d2, handleMouseDown: f2, handleMouseMove: m2, handleMouseOut: h2, handleSortClick: b2, handleFilterClick: g2 } = sk(e2, t2);
const { getHeaderRowStyle: y2, getHeaderRowClass: w2, getHeaderCellStyle: x2, getHeaderCellClass: k2 } = ik(e2);
const { isGroup: S2, toggleAllSelection: C2, columnRows: E2 } = dk(e2);
n2.state = { onColumnsChange: l2, onScrollableChange: i2 };
n2.filterPanels = r2;
return { ns: a2, filterPanels: r2, onColumnsChange: l2, onScrollableChange: i2, columnRows: E2, getHeaderRowClass: w2, getHeaderRowStyle: y2, getHeaderCellClass: k2, getHeaderCellStyle: x2, handleHeaderClick: u2, handleHeaderContextMenu: d2, handleMouseDown: f2, handleMouseMove: m2, handleMouseOut: h2, handleSortClick: b2, handleFilterClick: g2, isGroup: S2, toggleAllSelection: C2 };
}, render() {
const { ns: e2, isGroup: t2, columnRows: n2, getHeaderCellStyle: o2, getHeaderCellClass: a2, getHeaderRowClass: r2, getHeaderRowStyle: l2, handleHeaderClick: s2, handleHeaderContextMenu: i2, handleMouseDown: u2, handleMouseMove: c2, handleSortClick: d2, handleMouseOut: f2, store: p2, $parent: v2 } = this;
let m2 = 1;
return vue.h("thead", { class: { [e2.is("group")]: t2 } }, n2.map((e3, t3) => vue.h("tr", { class: r2(t3), key: t3, style: l2(t3) }, e3.map((n3, r3) => {
if (n3.rowSpan > m2) {
m2 = n3.rowSpan;
}
return vue.h("th", { class: a2(t3, r3, e3, n3), colspan: n3.colSpan, key: `${n3.id}-thead`, rowspan: n3.rowSpan, style: o2(t3, r3, e3, n3), onClick: (e4) => {
if (e4.currentTarget.classList.contains("noclick")) {
return;
}
s2(e4, n3);
}, onContextmenu: (e4) => i2(e4, n3), onMousedown: (e4) => u2(e4, n3), onMousemove: (e4) => c2(e4, n3), onMouseout: f2 }, [vue.h("div", { class: ["cell", n3.filteredValue && n3.filteredValue.length > 0 ? "highlight" : ""] }, [n3.renderHeader ? n3.renderHeader({ column: n3, $index: r3, store: p2, _self: v2 }) : n3.label, n3.sortable && vue.h("span", { onClick: (e4) => d2(e4, n3), class: "caret-wrapper" }, [vue.h("i", { onClick: (e4) => d2(e4, n3, "ascending"), class: "sort-caret ascending" }), vue.h("i", { onClick: (e4) => d2(e4, n3, "descending"), class: "sort-caret descending" })]), n3.filterable && vue.h(ak, { store: p2, placement: n3.filterPlacement || "bottom-start", column: n3, upDataColumn: (e4, t4) => {
n3[e4] = t4;
} }, { "filter-icon": () => n3.renderFilterIcon ? n3.renderFilterIcon({ filterOpened: n3.filterOpened }) : null })])]);
}))));
} });
function pk(e2, t2, n2 = 0.01) {
return e2 - t2 > n2;
}
function vk(e2) {
const t2 = vue.inject(lk);
const n2 = vue.ref("");
const o2 = vue.ref(vue.h("div"));
const a2 = (n3, o3, a3) => {
var r3;
const l3 = t2;
const s3 = vx(n3);
let i3;
const u3 = (r3 = l3 == null ? void 0 : l3.vnode.el) == null ? void 0 : r3.dataset.prefix;
if (s3) {
i3 = gx({ columns: e2.store.states.columns.value }, s3, u3);
if (i3) {
l3 == null ? void 0 : l3.emit(`cell-${a3}`, o3, i3, s3, n3);
}
}
l3 == null ? void 0 : l3.emit(`row-${a3}`, o3, i3, n3);
};
const r2 = (e3, t3) => {
a2(e3, t3, "dblclick");
};
const l2 = (t3, n3) => {
e2.store.commit("setCurrentRow", n3);
a2(t3, n3, "click");
};
const s2 = (e3, t3) => {
a2(e3, t3, "contextmenu");
};
const i2 = $s((t3) => {
e2.store.commit("setHoverRow", t3);
}, 30);
const u2 = $s(() => {
e2.store.commit("setHoverRow", null);
}, 30);
const c2 = (e3) => {
const t3 = window.getComputedStyle(e3, null);
const n3 = Number.parseInt(t3.paddingLeft, 10) || 0;
const o3 = Number.parseInt(t3.paddingRight, 10) || 0;
const a3 = Number.parseInt(t3.paddingTop, 10) || 0;
const r3 = Number.parseInt(t3.paddingBottom, 10) || 0;
return { left: n3, right: o3, top: a3, bottom: r3 };
};
const d2 = (e3, t3, n3) => {
let o3 = t3.target.parentNode;
while (e3 > 1) {
o3 = o3 == null ? void 0 : o3.nextSibling;
if (!o3 || o3.nodeName !== "TR") break;
n3(o3, "hover-row hover-fixed-row");
e3--;
}
};
const f2 = (n3, o3, a3) => {
var r3;
const l3 = t2;
const s3 = vx(n3);
const i3 = (r3 = l3 == null ? void 0 : l3.vnode.el) == null ? void 0 : r3.dataset.prefix;
if (s3) {
const t3 = gx({ columns: e2.store.states.columns.value }, s3, i3);
if (s3.rowSpan > 1) {
d2(s3.rowSpan, n3, di);
}
const a4 = l3.hoverState = { cell: s3, column: t3, row: o3 };
l3 == null ? void 0 : l3.emit("cell-mouse-enter", a4.row, a4.column, a4.cell, n3);
}
if (!a3) {
return;
}
const u3 = n3.target.querySelector(".cell");
if (!(ci(u3, `${i3}-tooltip`) && u3.childNodes.length)) {
return;
}
const f3 = document.createRange();
f3.setStart(u3, 0);
f3.setEnd(u3, u3.childNodes.length);
let { width: p2, height: v2 } = f3.getBoundingClientRect();
const m3 = p2 - Math.floor(p2);
const { width: h2, height: b2 } = u3.getBoundingClientRect();
if (m3 < 1e-3) {
p2 = Math.floor(p2);
}
const g2 = v2 - Math.floor(v2);
if (g2 < 1e-3) {
v2 = Math.floor(v2);
}
const { top: y2, left: w2, right: x2, bottom: k2 } = c2(u3);
const S2 = w2 + x2;
const C2 = y2 + k2;
if (pk(p2 + S2, h2) || pk(v2 + C2, b2) || pk(u3.scrollWidth, h2)) {
$x(a3, s3.innerText || s3.textContent, s3, l3);
}
};
const m2 = (e3) => {
const n3 = vx(e3);
if (!n3) return;
if (n3.rowSpan > 1) {
d2(n3.rowSpan, e3, fi);
}
const o3 = t2 == null ? void 0 : t2.hoverState;
t2 == null ? void 0 : t2.emit("cell-mouse-leave", o3 == null ? void 0 : o3.row, o3 == null ? void 0 : o3.column, o3 == null ? void 0 : o3.cell, e3);
};
return { handleDoubleClick: r2, handleClick: l2, handleContextMenu: s2, handleMouseEnter: i2, handleMouseLeave: u2, handleCellMouseEnter: f2, handleCellMouseLeave: m2, tooltipContent: n2, tooltipTrigger: o2 };
}
function mk(e2) {
const t2 = vue.inject(lk);
const n2 = Vu("table");
const o2 = (e3, n3) => {
const o3 = t2 == null ? void 0 : t2.props.rowStyle;
if (typeof o3 === "function") {
return o3.call(null, { row: e3, rowIndex: n3 });
}
return o3 || null;
};
const a2 = (o3, a3) => {
const r3 = [n2.e("row")];
if ((t2 == null ? void 0 : t2.props.highlightCurrentRow) && o3 === e2.store.states.currentRow.value) {
r3.push("current-row");
}
if (e2.stripe && a3 % 2 === 1) {
r3.push(n2.em("row", "striped"));
}
const l3 = t2 == null ? void 0 : t2.props.rowClassName;
if (typeof l3 === "string") {
r3.push(l3);
} else if (typeof l3 === "function") {
r3.push(l3.call(null, { row: o3, rowIndex: a3 }));
}
return r3;
};
const r2 = (n3, o3, a3, r3) => {
const l3 = t2 == null ? void 0 : t2.props.cellStyle;
let s3 = l3 != null ? l3 : {};
if (typeof l3 === "function") {
s3 = l3.call(null, { rowIndex: n3, columnIndex: o3, row: a3, column: r3 });
}
const i3 = Nx(o3, e2 == null ? void 0 : e2.fixed, e2.store);
Px(i3, "left");
Px(i3, "right");
return Object.assign({}, s3, i3);
};
const l2 = (o3, a3, r3, l3, s3) => {
const i3 = Rx(n2.b(), a3, e2 == null ? void 0 : e2.fixed, e2.store, void 0, s3);
const u2 = [l3.id, l3.align, l3.className, ...i3];
const c2 = t2 == null ? void 0 : t2.props.cellClassName;
if (typeof c2 === "string") {
u2.push(c2);
} else if (typeof c2 === "function") {
u2.push(c2.call(null, { rowIndex: o3, columnIndex: a3, row: r3, column: l3 }));
}
u2.push(n2.e("cell"));
return u2.filter((e3) => Boolean(e3)).join(" ");
};
const s2 = (e3, n3, o3, a3) => {
let r3 = 1;
let l3 = 1;
const s3 = t2 == null ? void 0 : t2.props.spanMethod;
if (typeof s3 === "function") {
const t3 = s3({ row: e3, column: n3, rowIndex: o3, columnIndex: a3 });
if (Array.isArray(t3)) {
r3 = t3[0];
l3 = t3[1];
} else if (typeof t3 === "object") {
r3 = t3.rowspan;
l3 = t3.colspan;
}
}
return { rowspan: r3, colspan: l3 };
};
const i2 = (e3, t3, n3) => {
if (t3 < 1) {
return e3[n3].realWidth;
}
const o3 = e3.map(({ realWidth: e4, width: t4 }) => e4 || t4).slice(n3, n3 + t3);
return Number(o3.reduce((e4, t4) => Number(e4) + Number(t4), -1));
};
return { getRowStyle: o2, getRowClass: a2, getCellStyle: r2, getCellClass: l2, getSpan: s2, getColspanRealWidth: i2 };
}
function hk(e2) {
const t2 = vue.inject(lk);
const n2 = Vu("table");
const { handleDoubleClick: o2, handleClick: a2, handleContextMenu: r2, handleMouseEnter: s2, handleMouseLeave: i2, handleCellMouseEnter: u2, handleCellMouseLeave: c2, tooltipContent: d2, tooltipTrigger: f2 } = vk(e2);
const { getRowStyle: v2, getRowClass: m2, getCellStyle: h2, getCellClass: b2, getSpan: g2, getColspanRealWidth: y2 } = mk(e2);
const w2 = vue.computed(() => e2.store.states.columns.value.findIndex(({ type: e3 }) => e3 === "default"));
const x2 = (e3, n3) => {
const o3 = t2.props.rowKey;
if (o3) {
return yx(e3, o3);
}
return n3;
};
const k2 = (l2, d3, f3, p2 = false) => {
const { tooltipEffect: k3, tooltipOptions: C3, store: E2 } = e2;
const { indent: M2, columns: O2 } = E2.states;
const _2 = m2(l2, d3);
let $2 = true;
if (f3) {
_2.push(n2.em("row", `level-${f3.level}`));
$2 = f3.display;
}
const L2 = $2 ? null : { display: "none" };
return vue.h("tr", { style: [L2, v2(l2, d3)], class: _2, key: x2(l2, d3), onDblclick: (e3) => o2(e3, l2), onClick: (e3) => a2(e3, l2), onContextmenu: (e3) => r2(e3, l2), onMouseenter: () => s2(d3), onMouseleave: i2 }, O2.value.map((n3, o3) => {
const { rowspan: a3, colspan: r3 } = g2(l2, n3, d3, o3);
if (!a3 || !r3) {
return null;
}
const s3 = Object.assign({}, n3);
s3.realWidth = y2(O2.value, r3, o3);
const i3 = { store: e2.store, _self: e2.context || t2, column: s3, row: l2, $index: d3, cellIndex: o3, expanded: p2 };
if (o3 === w2.value && f3) {
i3.treeNode = { indent: f3.level * M2.value, level: f3.level };
if (typeof f3.expanded === "boolean") {
i3.treeNode.expanded = f3.expanded;
if ("loading" in f3) {
i3.treeNode.loading = f3.loading;
}
if ("noLazyChildren" in f3) {
i3.treeNode.noLazyChildren = f3.noLazyChildren;
}
}
}
const v3 = `${x2(l2, d3)},${o3}`;
const m3 = s3.columnKey || s3.rawColumnKey || "";
const E3 = S2(o3, n3, i3);
const _3 = n3.showOverflowTooltip && Hs({ effect: k3 }, C3, n3.showOverflowTooltip);
return vue.h("td", { style: h2(d3, o3, l2, n3), class: b2(d3, o3, l2, n3, r3 - 1), key: `${m3}${v3}`, rowspan: a3, colspan: r3, onMouseenter: (e3) => u2(e3, l2, _3), onMouseleave: c2 }, [E3]);
}));
};
const S2 = (e3, t3, n3) => t3.renderCell(n3);
const C2 = (o3, a3) => {
const r3 = e2.store;
const { isRowExpanded: l2, assertRowKey: s3 } = r3;
const { treeData: i3, lazyTreeNodeMap: u3, childrenColumnName: c3, rowKey: d3 } = r3.states;
const f3 = r3.states.columns.value;
const p2 = f3.some(({ type: e3 }) => e3 === "expand");
if (p2) {
const e3 = l2(o3);
const s4 = k2(o3, a3, void 0, e3);
const i4 = t2.renderExpanded;
if (e3) {
if (!i4) {
console.error("[Element Error]renderExpanded is required.");
return s4;
}
return [[s4, vue.h("tr", { key: `expanded-row__${s4.key}` }, [vue.h("td", { colspan: f3.length, class: `${n2.e("cell")} ${n2.e("expanded-cell")}` }, [i4({ row: o3, $index: a3, store: r3, expanded: e3 })])])]];
} else {
return [[s4]];
}
} else if (Object.keys(i3.value).length) {
s3();
const e3 = yx(o3, d3.value);
let t3 = i3.value[e3];
let n3 = null;
if (t3) {
n3 = { expanded: t3.expanded, level: t3.level, display: true };
if (typeof t3.lazy === "boolean") {
if (typeof t3.loaded === "boolean" && t3.loaded) {
n3.noLazyChildren = !(t3.children && t3.children.length);
}
n3.loading = t3.loading;
}
}
const r4 = [k2(o3, a3, n3)];
if (t3) {
let n4 = 0;
const l3 = (e4, o4) => {
if (!(e4 && e4.length && o4)) return;
e4.forEach((e5) => {
const s5 = { display: o4.display && o4.expanded, level: o4.level + 1, expanded: false, noLazyChildren: false, loading: false };
const f4 = yx(e5, d3.value);
if (f4 === void 0 || f4 === null) {
throw new Error("For nested data item, row-key is required.");
}
t3 = { ...i3.value[f4] };
if (t3) {
s5.expanded = t3.expanded;
t3.level = t3.level || s5.level;
t3.display = !!(t3.expanded && s5.display);
if (typeof t3.lazy === "boolean") {
if (typeof t3.loaded === "boolean" && t3.loaded) {
s5.noLazyChildren = !(t3.children && t3.children.length);
}
s5.loading = t3.loading;
}
}
n4++;
r4.push(k2(e5, a3 + n4, s5));
if (t3) {
const n5 = u3.value[f4] || e5[c3.value];
l3(n5, t3);
}
});
};
t3.display = true;
const s4 = u3.value[e3] || o3[c3.value];
l3(s4, t3);
}
return r4;
} else {
return k2(o3, a3, void 0);
}
};
return { wrappedRowRender: C2, tooltipContent: d2, tooltipTrigger: f2 };
}
const bk = { store: { required: true, type: Object }, stripe: Boolean, tooltipEffect: String, tooltipOptions: { type: Object }, context: { default: () => ({}), type: Object }, rowClassName: [String, Function], rowStyle: [Object, Function], fixed: { type: String, default: "" }, highlight: Boolean };
var gk = vue.defineComponent({ name: "ElTableBody", props: bk, setup(e2) {
const t2 = vue.getCurrentInstance();
const n2 = vue.inject(lk);
const o2 = Vu("table");
const { wrappedRowRender: a2, tooltipContent: r2, tooltipTrigger: l2 } = hk(e2);
const { onColumnsChange: u2, onScrollableChange: c2 } = rk(n2);
const d2 = [];
vue.watch(e2.store.states.hoverRow, (n3, a3) => {
var r3;
const l3 = t2 == null ? void 0 : t2.vnode.el;
const s2 = Array.from((l3 == null ? void 0 : l3.children) || []).filter((e3) => e3 == null ? void 0 : e3.classList.contains(`${o2.e("row")}`));
let i2 = n3;
const u3 = (r3 = s2[i2]) == null ? void 0 : r3.childNodes;
if (u3 == null ? void 0 : u3.length) {
let e3 = 0;
const t3 = Array.from(u3).reduce((t4, n4, o3) => {
var a4, r4;
if (((a4 = u3[o3]) == null ? void 0 : a4.colSpan) > 1) {
e3 = (r4 = u3[o3]) == null ? void 0 : r4.colSpan;
}
if (n4.nodeName !== "TD" && e3 === 0) {
t4.push(o3);
}
e3 > 0 && e3--;
return t4;
}, []);
t3.forEach((e4) => {
var t4;
i2 = n3;
while (i2 > 0) {
const n4 = (t4 = s2[i2 - 1]) == null ? void 0 : t4.childNodes;
if (n4[e4] && n4[e4].nodeName === "TD" && n4[e4].rowSpan > 1) {
di(n4[e4], "hover-cell");
d2.push(n4[e4]);
break;
}
i2--;
}
});
} else {
d2.forEach((e3) => fi(e3, "hover-cell"));
d2.length = 0;
}
if (!e2.store.states.isComplex.value || !Ie) return;
ni(() => {
const e3 = s2[a3];
const t3 = s2[n3];
if (e3 && !e3.classList.contains("hover-fixed-row")) {
fi(e3, "hover-row");
}
if (t3) {
di(t3, "hover-row");
}
});
});
vue.onUnmounted(() => {
var e3;
(e3 = _x) == null ? void 0 : e3();
});
return { ns: o2, onColumnsChange: u2, onScrollableChange: c2, wrappedRowRender: a2, tooltipContent: r2, tooltipTrigger: l2 };
}, render() {
const { wrappedRowRender: e2, store: t2 } = this;
const n2 = t2.states.data.value || [];
return vue.h("tbody", { tabIndex: -1 }, [n2.reduce((t3, n3) => t3.concat(e2(n3, t3.length)), [])]);
} });
function yk() {
const e2 = vue.inject(lk);
const t2 = e2 == null ? void 0 : e2.store;
const n2 = vue.computed(() => t2.states.fixedLeafColumnsLength.value);
const o2 = vue.computed(() => t2.states.rightFixedColumns.value.length);
const a2 = vue.computed(() => t2.states.columns.value.length);
const r2 = vue.computed(() => t2.states.fixedColumns.value.length);
const s2 = vue.computed(() => t2.states.rightFixedColumns.value.length);
return { leftFixedLeafCount: n2, rightFixedLeafCount: o2, columnsCount: a2, leftFixedCount: r2, rightFixedCount: s2, columns: t2.states.columns };
}
function wk(e2) {
const { columns: t2 } = yk();
const n2 = Vu("table");
const o2 = (t3, o3) => {
const a3 = t3[o3];
const r2 = [n2.e("cell"), a3.id, a3.align, a3.labelClassName, ...Rx(n2.b(), o3, a3.fixed, e2.store)];
if (a3.className) {
r2.push(a3.className);
}
if (!a3.children) {
r2.push(n2.is("leaf"));
}
return r2;
};
const a2 = (t3, n3) => {
const o3 = Nx(n3, t3.fixed, e2.store);
Px(o3, "left");
Px(o3, "right");
return o3;
};
return { getCellClasses: o2, getCellStyles: a2, columns: t2 };
}
var xk = vue.defineComponent({ name: "ElTableFooter", props: { fixed: { type: String, default: "" }, store: { required: true, type: Object }, summaryMethod: Function, sumText: String, border: Boolean, defaultSort: { type: Object, default: () => ({ prop: "", order: "" }) } }, setup(e2) {
const { getCellClasses: t2, getCellStyles: n2, columns: o2 } = wk(e2);
const a2 = Vu("table");
return { ns: a2, getCellClasses: t2, getCellStyles: n2, columns: o2 };
}, render() {
const { columns: e2, getCellStyles: t2, getCellClasses: n2, summaryMethod: o2, sumText: a2 } = this;
const r2 = this.store.states.data.value;
let l2 = [];
if (o2) {
l2 = o2({ columns: e2, data: r2 });
} else {
e2.forEach((e3, t3) => {
if (t3 === 0) {
l2[t3] = a2;
return;
}
const n3 = r2.map((t4) => Number(t4[e3.property]));
const o3 = [];
let s2 = true;
n3.forEach((e4) => {
if (!Number.isNaN(+e4)) {
s2 = false;
const t4 = `${e4}`.split(".")[1];
o3.push(t4 ? t4.length : 0);
}
});
const i2 = Math.max.apply(null, o3);
if (!s2) {
l2[t3] = n3.reduce((e4, t4) => {
const n4 = Number(t4);
if (!Number.isNaN(+n4)) {
return Number.parseFloat((e4 + t4).toFixed(Math.min(i2, 20)));
} else {
return e4;
}
}, 0);
} else {
l2[t3] = "";
}
});
}
return vue.h(vue.h("tfoot", [vue.h("tr", {}, [...e2.map((o3, a3) => vue.h("td", { key: a3, colspan: o3.colSpan, rowspan: o3.rowSpan, class: n2(e2, a3), style: t2(o3, a3) }, [vue.h("div", { class: ["cell", o3.labelClassName] }, [l2[a3]])]))])]));
} });
function kk(e2) {
const t2 = (t3) => {
e2.commit("setCurrentRow", t3);
};
const n2 = () => e2.getSelectionRows();
const o2 = (t3, n3) => {
e2.toggleRowSelection(t3, n3, false);
e2.updateAllSelected();
};
const a2 = () => {
e2.clearSelection();
};
const r2 = (t3) => {
e2.clearFilter(t3);
};
const l2 = () => {
e2.commit("toggleAllSelection");
};
const s2 = (t3, n3) => {
e2.toggleRowExpansionAdapter(t3, n3);
};
const i2 = () => {
e2.clearSort();
};
const u2 = (t3, n3) => {
e2.commit("sort", { prop: t3, order: n3 });
};
return { setCurrentRow: t2, getSelectionRows: n2, toggleRowSelection: o2, clearSelection: a2, clearFilter: r2, toggleAllSelection: l2, toggleRowExpansion: s2, clearSort: i2, sort: u2 };
}
function Sk(e2, t2, n2, o2) {
const a2 = vue.ref(false);
const r2 = vue.ref(null);
const s2 = vue.ref(false);
const f2 = (e3) => {
s2.value = e3;
};
const p2 = vue.ref({ width: null, height: null, headerHeight: null });
const m2 = vue.ref(false);
const h2 = { display: "inline-block", verticalAlign: "middle" };
const b2 = vue.ref();
const g2 = vue.ref(0);
const y2 = vue.ref(0);
const w2 = vue.ref(0);
const x2 = vue.ref(0);
const k2 = vue.ref(0);
vue.watchEffect(() => {
t2.setHeight(e2.height);
});
vue.watchEffect(() => {
t2.setMaxHeight(e2.maxHeight);
});
vue.watch(() => [e2.currentRowKey, n2.states.rowKey], ([e3, t3]) => {
if (!vue.unref(t3) || !vue.unref(e3)) return;
n2.setCurrentRowKey(`${e3}`);
}, { immediate: true });
vue.watch(() => e2.data, (e3) => {
o2.store.commit("setData", e3);
}, { immediate: true, deep: true });
vue.watchEffect(() => {
if (e2.expandRowKeys) {
n2.setExpandRowKeysAdapter(e2.expandRowKeys);
}
});
const S2 = () => {
o2.store.commit("setHoverRow", null);
if (o2.hoverState) o2.hoverState = null;
};
const C2 = (e3, t3) => {
const { pixelX: n3, pixelY: a3 } = t3;
if (Math.abs(n3) >= Math.abs(a3)) {
o2.refs.bodyWrapper.scrollLeft += t3.pixelX / 5;
}
};
const E2 = vue.computed(() => e2.height || e2.maxHeight || n2.states.fixedColumns.value.length > 0 || n2.states.rightFixedColumns.value.length > 0);
const O2 = vue.computed(() => ({ width: t2.bodyWidth.value ? `${t2.bodyWidth.value}px` : "" }));
const _2 = () => {
if (E2.value) {
t2.updateElsHeight();
}
t2.updateColumnsWidth();
requestAnimationFrame(D2);
};
vue.onMounted(async () => {
await vue.nextTick();
n2.updateColumns();
R2();
requestAnimationFrame(_2);
const t3 = o2.vnode.el;
const a3 = o2.refs.headerWrapper;
if (e2.flexible && t3 && t3.parentElement) {
t3.parentElement.style.minWidth = "0";
}
p2.value = { width: b2.value = t3.offsetWidth, height: t3.offsetHeight, headerHeight: e2.showHeader && a3 ? a3.offsetHeight : null };
n2.states.columns.value.forEach((e3) => {
if (e3.filteredValue && e3.filteredValue.length) {
o2.store.commit("filterChange", { column: e3, values: e3.filteredValue, silent: true });
}
});
o2.$ready = true;
});
const $2 = (e3, n3) => {
if (!e3) return;
const o3 = Array.from(e3.classList).filter((e4) => !e4.startsWith("is-scrolling-"));
o3.push(t2.scrollX.value ? n3 : "is-scrolling-none");
e3.className = o3.join(" ");
};
const L2 = (e3) => {
const { tableWrapper: t3 } = o2.refs;
$2(t3, e3);
};
const A2 = (e3) => {
const { tableWrapper: t3 } = o2.refs;
return !!(t3 && t3.classList.contains(e3));
};
const D2 = function() {
if (!o2.refs.scrollBarRef) return;
if (!t2.scrollX.value) {
const e4 = "is-scrolling-none";
if (!A2(e4)) {
L2(e4);
}
return;
}
const e3 = o2.refs.scrollBarRef.wrapRef;
if (!e3) return;
const { scrollLeft: n3, offsetWidth: a3, scrollWidth: r3 } = e3;
const { headerWrapper: l2, footerWrapper: s3 } = o2.refs;
if (l2) l2.scrollLeft = n3;
if (s3) s3.scrollLeft = n3;
const i2 = r3 - a3 - 1;
if (n3 >= i2) {
L2("is-scrolling-right");
} else if (n3 === 0) {
L2("is-scrolling-left");
} else {
L2("is-scrolling-middle");
}
};
const R2 = () => {
if (!o2.refs.scrollBarRef) return;
if (o2.refs.scrollBarRef.wrapRef) {
Ge(o2.refs.scrollBarRef.wrapRef, "scroll", D2, { passive: true });
}
if (e2.fit) {
lt(o2.vnode.el, T2);
} else {
Ge(window, "resize", T2);
}
lt(o2.refs.bodyWrapper, () => {
var e3, t3;
T2();
(t3 = (e3 = o2.refs) == null ? void 0 : e3.scrollBarRef) == null ? void 0 : t3.update();
});
};
const T2 = () => {
var t3, n3, a3, r3;
const l2 = o2.vnode.el;
if (!o2.$ready || !l2) return;
let s3 = false;
const { width: i2, height: u2, headerHeight: c2 } = p2.value;
const d2 = b2.value = l2.offsetWidth;
if (i2 !== d2) {
s3 = true;
}
const f3 = l2.offsetHeight;
if ((e2.height || E2.value) && u2 !== f3) {
s3 = true;
}
const v2 = e2.tableLayout === "fixed" ? o2.refs.headerWrapper : (t3 = o2.refs.tableHeaderRef) == null ? void 0 : t3.$el;
if (e2.showHeader && (v2 == null ? void 0 : v2.offsetHeight) !== c2) {
s3 = true;
}
g2.value = ((n3 = o2.refs.tableWrapper) == null ? void 0 : n3.scrollHeight) || 0;
w2.value = (v2 == null ? void 0 : v2.scrollHeight) || 0;
x2.value = ((a3 = o2.refs.footerWrapper) == null ? void 0 : a3.offsetHeight) || 0;
k2.value = ((r3 = o2.refs.appendWrapper) == null ? void 0 : r3.offsetHeight) || 0;
y2.value = g2.value - w2.value - x2.value - k2.value;
if (s3) {
p2.value = { width: d2, height: f3, headerHeight: e2.showHeader && (v2 == null ? void 0 : v2.offsetHeight) || 0 };
_2();
}
};
const N2 = Gf();
const P2 = vue.computed(() => {
const { bodyWidth: e3, scrollY: n3, gutterWidth: o3 } = t2;
return e3.value ? `${e3.value - (n3.value ? o3 : 0)}px` : "";
});
const I2 = vue.computed(() => {
if (e2.maxHeight) return "fixed";
return e2.tableLayout;
});
const V2 = vue.computed(() => {
if (e2.data && e2.data.length) return null;
let t3 = "100%";
if (e2.height && y2.value) {
t3 = `${y2.value}px`;
}
const n3 = b2.value;
return { width: n3 ? `${n3}px` : "", height: t3 };
});
const B2 = vue.computed(() => {
if (e2.height) {
return { height: !Number.isNaN(Number(e2.height)) ? `${e2.height}px` : e2.height };
}
if (e2.maxHeight) {
return { maxHeight: !Number.isNaN(Number(e2.maxHeight)) ? `${e2.maxHeight}px` : e2.maxHeight };
}
return {};
});
const F2 = vue.computed(() => {
if (e2.height) {
return { height: "100%" };
}
if (e2.maxHeight) {
if (!Number.isNaN(Number(e2.maxHeight))) {
return { maxHeight: `${e2.maxHeight - w2.value - x2.value}px` };
} else {
return { maxHeight: `calc(${e2.maxHeight} - ${w2.value + x2.value}px)` };
}
}
return {};
});
const j2 = (e3, t3) => {
const n3 = o2.refs.bodyWrapper;
if (Math.abs(t3.spinY) > 0) {
const o3 = n3.scrollTop;
if (t3.pixelY < 0 && o3 !== 0) {
e3.preventDefault();
}
if (t3.pixelY > 0 && n3.scrollHeight - n3.clientHeight > o3) {
e3.preventDefault();
}
n3.scrollTop += Math.ceil(t3.pixelY / 5);
} else {
n3.scrollLeft += Math.ceil(t3.pixelX / 5);
}
};
return { isHidden: a2, renderExpanded: r2, setDragVisible: f2, isGroup: m2, handleMouseLeave: S2, handleHeaderFooterMousewheel: C2, tableSize: N2, emptyBlockStyle: V2, handleFixedMousewheel: j2, resizeProxyVisible: s2, bodyWidth: P2, resizeState: p2, doLayout: _2, tableBodyStyles: O2, tableLayout: I2, scrollbarViewStyle: h2, tableInnerStyle: B2, scrollbarStyle: F2 };
}
function Ck(e2) {
const t2 = vue.ref();
const n2 = () => {
const n3 = e2.vnode.el;
const o2 = n3.querySelector(".hidden-columns");
const a2 = { childList: true, subtree: true };
const r2 = e2.store.states.updateOrderFns;
t2.value = new MutationObserver(() => {
r2.forEach((e3) => e3());
});
t2.value.observe(o2, a2);
};
vue.onMounted(() => {
n2();
});
vue.onUnmounted(() => {
var e3;
(e3 = t2.value) == null ? void 0 : e3.disconnect();
});
}
var Ek = { data: { type: Array, default: () => [] }, size: Ef, width: [String, Number], height: [String, Number], maxHeight: [String, Number], fit: { type: Boolean, default: true }, stripe: Boolean, border: Boolean, rowKey: [String, Function], showHeader: { type: Boolean, default: true }, showSummary: Boolean, sumText: String, summaryMethod: Function, rowClassName: [String, Function], rowStyle: [Object, Function], cellClassName: [String, Function], cellStyle: [Object, Function], headerRowClassName: [String, Function], headerRowStyle: [Object, Function], headerCellClassName: [String, Function], headerCellStyle: [Object, Function], highlightCurrentRow: Boolean, currentRowKey: [String, Number], emptyText: String, expandRowKeys: Array, defaultExpandAll: Boolean, defaultSort: Object, tooltipEffect: String, tooltipOptions: Object, spanMethod: Function, selectOnIndeterminate: { type: Boolean, default: true }, indent: { type: Number, default: 16 }, treeProps: { type: Object, default: () => ({ hasChildren: "hasChildren", children: "children" }) }, lazy: Boolean, load: Function, style: { type: Object, default: () => ({}) }, className: { type: String, default: "" }, tableLayout: { type: String, default: "fixed" }, scrollbarAlwaysOn: Boolean, flexible: Boolean, showOverflowTooltip: [Boolean, Object] };
function Mk(e2) {
const t2 = e2.tableLayout === "auto";
let n2 = e2.columns || [];
if (t2) {
if (n2.every((e3) => e3.width === void 0)) {
n2 = [];
}
}
const o2 = (n3) => {
const o3 = { key: `${e2.tableLayout}_${n3.id}`, style: {}, name: void 0 };
if (t2) {
o3.style = { width: `${n3.width}px` };
} else {
o3.name = n3.id;
}
return o3;
};
return vue.h("colgroup", {}, n2.map((e3) => vue.h("col", o2(e3))));
}
Mk.props = ["columns", "tableLayout"];
const Ok = () => {
const e2 = vue.ref();
const t2 = (t3, n3) => {
const o3 = e2.value;
if (o3) {
o3.scrollTo(t3, n3);
}
};
const n2 = (t3, n3) => {
const o3 = e2.value;
if (o3 && Zs(n3) && ["Top", "Left"].includes(t3)) {
o3[`setScroll${t3}`](n3);
}
};
const o2 = (e3) => n2("Top", e3);
const a2 = (e3) => n2("Left", e3);
return { scrollBarRef: e2, scrollTo: t2, setScrollTop: o2, setScrollLeft: a2 };
};
let _k = 1;
const $k = vue.defineComponent({ name: "ElTable", directives: { Mousewheel: xb }, components: { TableHeader: fk, TableBody: gk, TableFooter: xk, ElScrollbar: Lp, hColgroup: Mk }, props: Ek, emits: ["select", "select-all", "selection-change", "cell-mouse-enter", "cell-mouse-leave", "cell-contextmenu", "cell-click", "cell-dblclick", "row-click", "row-contextmenu", "row-dblclick", "header-click", "header-contextmenu", "sort-change", "filter-change", "current-change", "header-dragend", "expand-change"], setup(e2) {
const { t: t2 } = Du();
const n2 = Vu("table");
const o2 = vue.getCurrentInstance();
vue.provide(lk, o2);
const a2 = Kx(o2, e2);
o2.store = a2;
const r2 = new Zx({ store: o2.store, table: o2, fit: e2.fit, showHeader: e2.showHeader });
o2.layout = r2;
const i2 = vue.computed(() => (a2.states.data.value || []).length === 0);
const { setCurrentRow: u2, getSelectionRows: c2, toggleRowSelection: d2, clearSelection: f2, clearFilter: p2, toggleAllSelection: v2, toggleRowExpansion: m2, clearSort: h2, sort: b2 } = kk(a2);
const { isHidden: g2, renderExpanded: w2, setDragVisible: x2, isGroup: k2, handleMouseLeave: S2, handleHeaderFooterMousewheel: C2, tableSize: E2, emptyBlockStyle: M2, handleFixedMousewheel: O2, resizeProxyVisible: _2, bodyWidth: $2, resizeState: L2, doLayout: A2, tableBodyStyles: D2, tableLayout: R2, scrollbarViewStyle: T2, tableInnerStyle: N2, scrollbarStyle: P2 } = Sk(e2, r2, a2, o2);
const { scrollBarRef: I2, scrollTo: V2, setScrollLeft: B2, setScrollTop: F2 } = Ok();
const j2 = $s(A2, 50);
const z2 = `${n2.namespace.value}-table_${_k++}`;
o2.tableId = z2;
o2.state = { isGroup: k2, resizeState: L2, doLayout: A2, debouncedUpdateLayout: j2 };
const H2 = vue.computed(() => e2.sumText || t2("el.table.sumText"));
const W2 = vue.computed(() => e2.emptyText || t2("el.table.emptyText"));
const Y2 = vue.computed(() => ck(a2.states.originColumns.value)[0]);
Ck(o2);
return { ns: n2, layout: r2, store: a2, columns: Y2, handleHeaderFooterMousewheel: C2, handleMouseLeave: S2, tableId: z2, tableSize: E2, isHidden: g2, isEmpty: i2, renderExpanded: w2, resizeProxyVisible: _2, resizeState: L2, isGroup: k2, bodyWidth: $2, tableBodyStyles: D2, emptyBlockStyle: M2, debouncedUpdateLayout: j2, handleFixedMousewheel: O2, setCurrentRow: u2, getSelectionRows: c2, toggleRowSelection: d2, clearSelection: f2, clearFilter: p2, toggleAllSelection: v2, toggleRowExpansion: m2, clearSort: h2, doLayout: A2, sort: b2, t: t2, setDragVisible: x2, context: o2, computedSumText: H2, computedEmptyText: W2, tableLayout: R2, scrollbarViewStyle: T2, tableInnerStyle: N2, scrollbarStyle: P2, scrollBarRef: I2, scrollTo: V2, setScrollLeft: B2, setScrollTop: F2 };
} });
const Lk = ["data-prefix"];
const Ak = { ref: "hiddenColumns", class: "hidden-columns" };
function Dk(e2, a2, r2, l2, s2, i2) {
const u2 = vue.resolveComponent("hColgroup");
const c2 = vue.resolveComponent("table-header");
const d2 = vue.resolveComponent("table-body");
const f2 = vue.resolveComponent("table-footer");
const p2 = vue.resolveComponent("el-scrollbar");
const v2 = vue.resolveDirective("mousewheel");
return vue.openBlock(), vue.createElementBlock("div", { ref: "tableWrapper", class: vue.normalizeClass([{ [e2.ns.m("fit")]: e2.fit, [e2.ns.m("striped")]: e2.stripe, [e2.ns.m("border")]: e2.border || e2.isGroup, [e2.ns.m("hidden")]: e2.isHidden, [e2.ns.m("group")]: e2.isGroup, [e2.ns.m("fluid-height")]: e2.maxHeight, [e2.ns.m("scrollable-x")]: e2.layout.scrollX.value, [e2.ns.m("scrollable-y")]: e2.layout.scrollY.value, [e2.ns.m("enable-row-hover")]: !e2.store.states.isComplex.value, [e2.ns.m("enable-row-transition")]: (e2.store.states.data.value || []).length !== 0 && (e2.store.states.data.value || []).length < 100, "has-footer": e2.showSummary }, e2.ns.m(e2.tableSize), e2.className, e2.ns.b(), e2.ns.m(`layout-${e2.tableLayout}`)]), style: vue.normalizeStyle(e2.style), "data-prefix": e2.ns.namespace.value, onMouseleave: a2[0] || (a2[0] = (...t2) => e2.handleMouseLeave && e2.handleMouseLeave(...t2)) }, [vue.createElementVNode("div", { class: vue.normalizeClass(e2.ns.e("inner-wrapper")), style: vue.normalizeStyle(e2.tableInnerStyle) }, [vue.createElementVNode("div", Ak, [vue.renderSlot(e2.$slots, "default")], 512), e2.showHeader && e2.tableLayout === "fixed" ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", { key: 0, ref: "headerWrapper", class: vue.normalizeClass(e2.ns.e("header-wrapper")) }, [vue.createElementVNode("table", { ref: "tableHeader", class: vue.normalizeClass(e2.ns.e("header")), style: vue.normalizeStyle(e2.tableBodyStyles), border: "0", cellpadding: "0", cellspacing: "0" }, [vue.createVNode(u2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), vue.createVNode(c2, { ref: "tableHeaderRef", border: e2.border, "default-sort": e2.defaultSort, store: e2.store, onSetDragVisible: e2.setDragVisible }, null, 8, ["border", "default-sort", "store", "onSetDragVisible"])], 6)], 2)), [[v2, e2.handleHeaderFooterMousewheel]]) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { ref: "bodyWrapper", class: vue.normalizeClass(e2.ns.e("body-wrapper")) }, [vue.createVNode(p2, { ref: "scrollBarRef", "view-style": e2.scrollbarViewStyle, "wrap-style": e2.scrollbarStyle, always: e2.scrollbarAlwaysOn }, { default: vue.withCtx(() => [vue.createElementVNode("table", { ref: "tableBody", class: vue.normalizeClass(e2.ns.e("body")), cellspacing: "0", cellpadding: "0", border: "0", style: vue.normalizeStyle({ width: e2.bodyWidth, tableLayout: e2.tableLayout }) }, [vue.createVNode(u2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), e2.showHeader && e2.tableLayout === "auto" ? (vue.openBlock(), vue.createBlock(c2, { key: 0, ref: "tableHeaderRef", class: vue.normalizeClass(e2.ns.e("body-header")), border: e2.border, "default-sort": e2.defaultSort, store: e2.store, onSetDragVisible: e2.setDragVisible }, null, 8, ["class", "border", "default-sort", "store", "onSetDragVisible"])) : vue.createCommentVNode("v-if", true), vue.createVNode(d2, { context: e2.context, highlight: e2.highlightCurrentRow, "row-class-name": e2.rowClassName, "tooltip-effect": e2.tooltipEffect, "tooltip-options": e2.tooltipOptions, "row-style": e2.rowStyle, store: e2.store, stripe: e2.stripe }, null, 8, ["context", "highlight", "row-class-name", "tooltip-effect", "tooltip-options", "row-style", "store", "stripe"]), e2.showSummary && e2.tableLayout === "auto" ? (vue.openBlock(), vue.createBlock(f2, { key: 1, class: vue.normalizeClass(e2.ns.e("body-footer")), border: e2.border, "default-sort": e2.defaultSort, store: e2.store, "sum-text": e2.computedSumText, "summary-method": e2.summaryMethod }, null, 8, ["class", "border", "default-sort", "store", "sum-text", "summary-method"])) : vue.createCommentVNode("v-if", true)], 6), e2.isEmpty ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, ref: "emptyBlock", style: vue.normalizeStyle(e2.emptyBlockStyle), class: vue.normalizeClass(e2.ns.e("empty-block")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(e2.ns.e("empty-text")) }, [vue.renderSlot(e2.$slots, "empty", {}, () => [vue.createTextVNode(vue.toDisplayString(e2.computedEmptyText), 1)])], 2)], 6)) : vue.createCommentVNode("v-if", true), e2.$slots.append ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, ref: "appendWrapper", class: vue.normalizeClass(e2.ns.e("append-wrapper")) }, [vue.renderSlot(e2.$slots, "append")], 2)) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["view-style", "wrap-style", "always"])], 2), e2.showSummary && e2.tableLayout === "fixed" ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", { key: 1, ref: "footerWrapper", class: vue.normalizeClass(e2.ns.e("footer-wrapper")) }, [vue.createElementVNode("table", { class: vue.normalizeClass(e2.ns.e("footer")), cellspacing: "0", cellpadding: "0", border: "0", style: vue.normalizeStyle(e2.tableBodyStyles) }, [vue.createVNode(u2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), vue.createVNode(f2, { border: e2.border, "default-sort": e2.defaultSort, store: e2.store, "sum-text": e2.computedSumText, "summary-method": e2.summaryMethod }, null, 8, ["border", "default-sort", "store", "sum-text", "summary-method"])], 6)], 2)), [[vue.vShow, !e2.isEmpty], [v2, e2.handleHeaderFooterMousewheel]]) : vue.createCommentVNode("v-if", true), e2.border || e2.isGroup ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass(e2.ns.e("border-left-patch")) }, null, 2)) : vue.createCommentVNode("v-if", true)], 6), vue.withDirectives(vue.createElementVNode("div", { ref: "resizeProxy", class: vue.normalizeClass(e2.ns.e("column-resize-proxy")) }, null, 2), [[vue.vShow, e2.resizeProxyVisible]])], 46, Lk);
}
var Rk = jf($k, [["render", Dk], ["__file", "table.vue"]]);
const Tk = { selection: "table-column--selection", expand: "table__expand-column" };
const Nk = { default: { order: "" }, selection: { width: 48, minWidth: 48, realWidth: 48, order: "" }, expand: { width: 48, minWidth: 48, realWidth: 48, order: "" }, index: { width: 48, minWidth: 48, realWidth: 48, order: "" } };
const Pk = (e2) => Tk[e2] || "";
const Ik = { selection: { renderHeader({ store: e2, column: t2 }) {
function n2() {
return e2.states.data.value && e2.states.data.value.length === 0;
}
return vue.h(tg, { disabled: n2(), size: e2.states.tableSize.value, indeterminate: e2.states.selection.value.length > 0 && !e2.states.isAllSelected.value, "onUpdate:modelValue": e2.toggleAllSelection, modelValue: e2.states.isAllSelected.value, ariaLabel: t2.label });
}, renderCell({ row: e2, column: t2, store: n2, $index: o2 }) {
return vue.h(tg, { disabled: t2.selectable ? !t2.selectable.call(null, e2, o2) : false, size: n2.states.tableSize.value, onChange: () => {
n2.commit("rowSelectedChanged", e2);
}, onClick: (e3) => e3.stopPropagation(), modelValue: n2.isSelected(e2), ariaLabel: t2.label });
}, sortable: false, resizable: false }, index: { renderHeader({ column: e2 }) {
return e2.label || "#";
}, renderCell({ column: e2, $index: t2 }) {
let n2 = t2 + 1;
const o2 = e2.index;
if (typeof o2 === "number") {
n2 = t2 + o2;
} else if (typeof o2 === "function") {
n2 = o2(t2);
}
return vue.h("div", {}, [n2]);
}, sortable: false }, expand: { renderHeader({ column: e2 }) {
return e2.label || "";
}, renderCell({ row: e2, store: t2, expanded: n2 }) {
const { ns: o2 } = t2;
const a2 = [o2.e("expand-icon")];
if (n2) {
a2.push(o2.em("expand-icon", "expanded"));
}
const r2 = function(n3) {
n3.stopPropagation();
t2.toggleRowExpansion(e2);
};
return vue.h("div", { class: a2, onClick: r2 }, { default: () => [vue.h(Uf, null, { default: () => [vue.h(ki)] })] });
}, sortable: false, resizable: false } };
function Vk({ row: e2, column: t2, $index: n2 }) {
var o2;
const a2 = t2.property;
const r2 = a2 && ri(e2, a2).value;
if (t2 && t2.formatter) {
return t2.formatter(e2, t2, r2, n2);
}
return ((o2 = r2 == null ? void 0 : r2.toString) == null ? void 0 : o2.call(r2)) || "";
}
function Bk({ row: e2, treeNode: t2, store: n2 }, o2 = false) {
const { ns: a2 } = n2;
if (!t2) {
if (o2) {
return [vue.h("span", { class: a2.e("placeholder") })];
}
return null;
}
const r2 = [];
const l2 = function(o3) {
o3.stopPropagation();
if (t2.loading) {
return;
}
n2.loadOrToggle(e2);
};
if (t2.indent) {
r2.push(vue.h("span", { class: a2.e("indent"), style: { "padding-left": `${t2.indent}px` } }));
}
if (typeof t2.expanded === "boolean" && !t2.noLazyChildren) {
const e3 = [a2.e("expand-icon"), t2.expanded ? a2.em("expand-icon", "expanded") : ""];
let n3 = ki;
if (t2.loading) {
n3 = zi;
}
r2.push(vue.h("div", { class: e3, onClick: l2 }, { default: () => [vue.h(Uf, { class: { [a2.is("loading")]: t2.loading } }, { default: () => [vue.h(n3)] })] }));
} else {
r2.push(vue.h("span", { class: a2.e("placeholder") }));
}
return r2;
}
function Fk(e2, t2) {
return e2.reduce((e3, t3) => {
e3[t3] = t3;
return e3;
}, t2);
}
function jk(e2, t2) {
const n2 = vue.getCurrentInstance();
const o2 = () => {
const o3 = ["fixed"];
const a3 = { realWidth: "width", realMinWidth: "minWidth" };
const r2 = Fk(o3, a3);
Object.keys(r2).forEach((o4) => {
const r3 = a3[o4];
if (yt(t2, r3)) {
vue.watch(() => t2[r3], (t3) => {
let a4 = t3;
if (r3 === "width" && o4 === "realWidth") {
a4 = kx(t3);
}
if (r3 === "minWidth" && o4 === "realMinWidth") {
a4 = Sx(t3);
}
n2.columnConfig.value[r3] = a4;
n2.columnConfig.value[o4] = a4;
const l2 = r3 === "fixed";
e2.value.store.scheduleLayout(l2);
});
}
});
};
const a2 = () => {
const e3 = ["label", "filters", "filterMultiple", "filteredValue", "sortable", "index", "formatter", "className", "labelClassName", "filterClassName", "showOverflowTooltip"];
const o3 = { property: "prop", align: "realAlign", headerAlign: "realHeaderAlign" };
const a3 = Fk(e3, o3);
Object.keys(a3).forEach((e4) => {
const a4 = o3[e4];
if (yt(t2, a4)) {
vue.watch(() => t2[a4], (t3) => {
n2.columnConfig.value[e4] = t3;
});
}
});
};
return { registerComplexWatchers: o2, registerNormalWatchers: a2 };
}
function zk(e2, t2, n2) {
const o2 = vue.getCurrentInstance();
const a2 = vue.ref("");
const r2 = vue.ref(false);
const i2 = vue.ref();
const c2 = vue.ref();
const f2 = Vu("table");
vue.watchEffect(() => {
i2.value = e2.align ? `is-${e2.align}` : null;
i2.value;
});
vue.watchEffect(() => {
c2.value = e2.headerAlign ? `is-${e2.headerAlign}` : i2.value;
c2.value;
});
const p2 = vue.computed(() => {
let e3 = o2.vnode.vParent || o2.parent;
while (e3 && !e3.tableId && !e3.columnId) {
e3 = e3.vnode.vParent || e3.parent;
}
return e3;
});
const m2 = vue.computed(() => {
const { store: e3 } = o2.parent;
if (!e3) return false;
const { treeData: t3 } = e3.states;
const n3 = t3.value;
return n3 && Object.keys(n3).length > 0;
});
const h2 = vue.ref(kx(e2.width));
const b2 = vue.ref(Sx(e2.minWidth));
const g2 = (e3) => {
if (h2.value) e3.width = h2.value;
if (b2.value) {
e3.minWidth = b2.value;
}
if (!h2.value && b2.value) {
e3.width = void 0;
}
if (!e3.minWidth) {
e3.minWidth = 80;
}
e3.realWidth = Number(e3.width === void 0 ? e3.minWidth : e3.width);
return e3;
};
const y2 = (e3) => {
const t3 = e3.type;
const n3 = Ik[t3] || {};
Object.keys(n3).forEach((t4) => {
const o4 = n3[t4];
if (t4 !== "className" && o4 !== void 0) {
e3[t4] = o4;
}
});
const o3 = Pk(t3);
if (o3) {
const t4 = `${vue.unref(f2.namespace)}-${o3}`;
e3.className = e3.className ? `${e3.className} ${t4}` : t4;
}
return e3;
};
const w2 = (e3) => {
if (Array.isArray(e3)) {
e3.forEach((e4) => t3(e4));
} else {
t3(e3);
}
function t3(e4) {
var t4;
if (((t4 = e4 == null ? void 0 : e4.type) == null ? void 0 : t4.name) === "ElTableColumn") {
e4.vParent = o2;
}
}
};
const k2 = (a3) => {
if (e2.renderHeader) ;
else if (a3.type !== "selection") {
a3.renderHeader = (e3) => {
o2.columnConfig.value["label"];
return vue.renderSlot(t2, "header", e3, () => [a3.label]);
};
}
if (t2["filter-icon"]) {
a3.renderFilterIcon = (e3) => vue.renderSlot(t2, "filter-icon", e3);
}
let r3 = a3.renderCell;
if (a3.type === "expand") {
a3.renderCell = (e3) => vue.h("div", { class: "cell" }, [r3(e3)]);
n2.value.renderExpanded = (e3) => t2.default ? t2.default(e3) : t2.default;
} else {
r3 = r3 || Vk;
a3.renderCell = (e3) => {
let o3 = null;
if (t2.default) {
const n3 = t2.default(e3);
o3 = n3.some((e4) => e4.type !== vue.Comment) ? n3 : r3(e3);
} else {
o3 = r3(e3);
}
const { columns: l2 } = n2.value.store.states;
const s2 = l2.value.findIndex((e4) => e4.type === "default");
const i3 = m2.value && e3.cellIndex === s2;
const c3 = Bk(e3, i3);
const d2 = { class: "cell", style: {} };
if (a3.showOverflowTooltip) {
d2.class = `${d2.class} ${vue.unref(f2.namespace)}-tooltip`;
d2.style = { width: `${(e3.column.realWidth || Number(e3.column.width)) - 1}px` };
}
w2(o3);
return vue.h("div", d2, [c3, o3]);
};
}
return a3;
};
const S2 = (...t3) => t3.reduce((t4, n3) => {
if (Array.isArray(n3)) {
n3.forEach((n4) => {
t4[n4] = e2[n4];
});
}
return t4;
}, {});
const C2 = (e3, t3) => Array.prototype.indexOf.call(e3, t3);
const E2 = () => {
n2.value.store.commit("updateColumnOrder", o2.columnConfig.value);
};
return { columnId: a2, realAlign: i2, isSubColumn: r2, realHeaderAlign: c2, columnOrTableParent: p2, setColumnWidth: g2, setColumnForcedProps: y2, setColumnRenders: k2, getPropsData: S2, getColumnElIndex: C2, updateColumnOrder: E2 };
}
var Hk = { type: { type: String, default: "default" }, label: String, className: String, labelClassName: String, property: String, prop: String, width: { type: [String, Number], default: "" }, minWidth: { type: [String, Number], default: "" }, renderHeader: Function, sortable: { type: [Boolean, String], default: false }, sortMethod: Function, sortBy: [String, Function, Array], resizable: { type: Boolean, default: true }, columnKey: String, align: String, headerAlign: String, showOverflowTooltip: { type: [Boolean, Object], default: void 0 }, fixed: [Boolean, String], formatter: Function, selectable: Function, reserveSelection: Boolean, filterMethod: Function, filteredValue: Array, filters: Array, filterPlacement: String, filterMultiple: { type: Boolean, default: true }, filterClassName: String, index: [Number, Function], sortOrders: { type: Array, default: () => ["ascending", "descending", null], validator: (e2) => e2.every((e3) => ["ascending", "descending", null].includes(e3)) } };
let Wk = 1;
var Yk = vue.defineComponent({ name: "ElTableColumn", components: { ElCheckbox: tg }, props: Hk, setup(e2, { slots: t2 }) {
const n2 = vue.getCurrentInstance();
const o2 = vue.ref({});
const a2 = vue.computed(() => {
let e3 = n2.parent;
while (e3 && !e3.tableId) {
e3 = e3.parent;
}
return e3;
});
const { registerNormalWatchers: r2, registerComplexWatchers: i2 } = jk(a2, e2);
const { columnId: u2, isSubColumn: d2, realHeaderAlign: p2, columnOrTableParent: m2, setColumnWidth: h2, setColumnForcedProps: b2, setColumnRenders: y2, getPropsData: w2, getColumnElIndex: x2, realAlign: k2, updateColumnOrder: S2 } = zk(e2, t2, a2);
const C2 = m2.value;
u2.value = `${C2.tableId || C2.columnId}_column_${Wk++}`;
vue.onBeforeMount(() => {
d2.value = a2.value !== C2;
const t3 = e2.type || "default";
const l2 = e2.sortable === "" ? true : e2.sortable;
const s2 = Gs(e2.showOverflowTooltip) ? C2.props.showOverflowTooltip : e2.showOverflowTooltip;
const c2 = { ...Nk[t3], id: u2.value, type: t3, property: e2.prop || e2.property, align: k2, headerAlign: p2, showOverflowTooltip: s2, filterable: e2.filters || e2.filterMethod, filteredValue: [], filterPlacement: "", filterClassName: "", isColumnGroup: false, isSubColumn: false, filterOpened: false, sortable: l2, index: e2.index, rawColumnKey: n2.vnode.key };
const f2 = ["columnKey", "label", "className", "labelClassName", "type", "renderHeader", "formatter", "fixed", "resizable"];
const v2 = ["sortMethod", "sortBy", "sortOrders"];
const m3 = ["selectable", "reserveSelection"];
const g2 = ["filterMethod", "filters", "filterMultiple", "filterOpened", "filteredValue", "filterPlacement", "filterClassName"];
let x3 = w2(f2, v2, m3, g2);
x3 = xx(c2, x3);
const S3 = Ex(y2, h2, b2);
x3 = S3(x3);
o2.value = x3;
r2();
i2();
});
vue.onMounted(() => {
var e3;
const t3 = m2.value;
const r3 = d2.value ? t3.vnode.el.children : (e3 = t3.refs.hiddenColumns) == null ? void 0 : e3.children;
const l2 = () => x2(r3 || [], n2.vnode.el);
o2.value.getColumnIndex = l2;
const s2 = l2();
s2 > -1 && a2.value.store.commit("insertColumn", o2.value, d2.value ? t3.columnConfig.value : null, S2);
});
vue.onBeforeUnmount(() => {
const e3 = o2.value.getColumnIndex();
e3 > -1 && a2.value.store.commit("removeColumn", o2.value, d2.value ? C2.columnConfig.value : null, S2);
});
n2.columnId = u2.value;
n2.columnConfig = o2;
return;
}, render() {
var e2, t2, n2;
try {
const o2 = (t2 = (e2 = this.$slots).default) == null ? void 0 : t2.call(e2, { row: {}, column: {}, $index: -1 });
const a2 = [];
if (Array.isArray(o2)) {
for (const e3 of o2) {
if (((n2 = e3.type) == null ? void 0 : n2.name) === "ElTableColumn" || e3.shapeFlag & 2) {
a2.push(e3);
} else if (e3.type === vue.Fragment && Array.isArray(e3.children)) {
e3.children.forEach((e4) => {
if ((e4 == null ? void 0 : e4.patchFlag) !== 1024 && !St(e4 == null ? void 0 : e4.children)) {
a2.push(e4);
}
});
}
}
}
const r2 = vue.h("div", a2);
return r2;
} catch (e3) {
return vue.h("div", []);
}
} });
const Uk = su(Rk, { TableColumn: Yk });
const Kk = iu(Yk);
const qk = Symbol("tabsRootContextKey");
const Gk = ou({ tabs: { type: eu(Array), default: () => xu([]) } });
const Xk = "ElTabBar";
const Zk = vue.defineComponent({ name: Xk });
const Jk = vue.defineComponent({ ...Zk, props: Gk, setup(e2, { expose: o2 }) {
const a2 = e2;
const r2 = vue.getCurrentInstance();
const l2 = vue.inject(qk);
if (!l2) si(Xk, "<el-tabs><el-tab-bar /></el-tabs>");
const c2 = Vu("tabs");
const d2 = vue.ref();
const f2 = vue.ref();
const m2 = () => {
let e3 = 0;
let t2 = 0;
const n2 = ["top", "bottom"].includes(l2.props.tabPosition) ? "width" : "height";
const o3 = n2 === "width" ? "x" : "y";
const s2 = o3 === "x" ? "left" : "top";
a2.tabs.every((o4) => {
var a3, l3;
const i2 = (l3 = (a3 = r2.parent) == null ? void 0 : a3.refs) == null ? void 0 : l3[`tab-${o4.uid}`];
if (!i2) return false;
if (!o4.active) {
return true;
}
e3 = i2[`offset${oi(s2)}`];
t2 = i2[`client${oi(n2)}`];
const u2 = window.getComputedStyle(i2);
if (n2 === "width") {
t2 -= Number.parseFloat(u2.paddingLeft) + Number.parseFloat(u2.paddingRight);
e3 += Number.parseFloat(u2.paddingLeft);
}
return false;
});
return { [n2]: `${t2}px`, transform: `translate${oi(o3)}(${e3}px)` };
};
const h2 = () => f2.value = m2();
vue.watch(() => a2.tabs, async () => {
await vue.nextTick();
h2();
}, { immediate: true });
lt(d2, () => h2());
o2({ ref: d2, update: h2 });
return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { ref_key: "barRef", ref: d2, class: vue.normalizeClass([vue.unref(c2).e("active-bar"), vue.unref(c2).is(vue.unref(l2).props.tabPosition)]), style: vue.normalizeStyle(f2.value) }, null, 6));
} });
var Qk = jf(Jk, [["__file", "tab-bar.vue"]]);
const eS = ou({ panes: { type: eu(Array), default: () => xu([]) }, currentName: { type: [String, Number], default: "" }, editable: Boolean, type: { type: String, values: ["card", "border-card", ""], default: "" }, stretch: Boolean });
const tS = { tabClick: (e2, t2, n2) => n2 instanceof Event, tabRemove: (e2, t2) => t2 instanceof Event };
const nS = "ElTabNav";
const oS = vue.defineComponent({ name: nS, props: eS, emits: tS, setup(e2, { expose: t2, emit: n2 }) {
const o2 = vue.getCurrentInstance();
const a2 = vue.inject(qk);
if (!a2) si(nS, `<el-tabs><tab-nav /></el-tabs>`);
const r2 = Vu("tabs");
const u2 = tt();
const d2 = mt();
const f2 = vue.ref();
const m2 = vue.ref();
const h2 = vue.ref();
const b2 = vue.ref();
const g2 = vue.ref(false);
const y2 = vue.ref(0);
const w2 = vue.ref(false);
const x2 = vue.ref(true);
const k2 = vue.computed(() => ["top", "bottom"].includes(a2.props.tabPosition) ? "width" : "height");
const S2 = vue.computed(() => {
const e3 = k2.value === "width" ? "X" : "Y";
return { transform: `translate${e3}(-${y2.value}px)` };
});
const C2 = () => {
if (!f2.value) return;
const e3 = f2.value[`offset${oi(k2.value)}`];
const t3 = y2.value;
if (!t3) return;
const n3 = t3 > e3 ? t3 - e3 : 0;
y2.value = n3;
};
const E2 = () => {
if (!f2.value || !m2.value) return;
const e3 = m2.value[`offset${oi(k2.value)}`];
const t3 = f2.value[`offset${oi(k2.value)}`];
const n3 = y2.value;
if (e3 - n3 <= t3) return;
const o3 = e3 - n3 > t3 * 2 ? n3 + t3 : e3 - t3;
y2.value = o3;
};
const O2 = async () => {
const e3 = m2.value;
if (!g2.value || !h2.value || !f2.value || !e3) return;
await vue.nextTick();
const t3 = h2.value.querySelector(".is-active");
if (!t3) return;
const n3 = f2.value;
const o3 = ["top", "bottom"].includes(a2.props.tabPosition);
const r3 = t3.getBoundingClientRect();
const l2 = n3.getBoundingClientRect();
const s2 = o3 ? e3.offsetWidth - l2.width : e3.offsetHeight - l2.height;
const i2 = y2.value;
let u3 = i2;
if (o3) {
if (r3.left < l2.left) {
u3 = i2 - (l2.left - r3.left);
}
if (r3.right > l2.right) {
u3 = i2 + r3.right - l2.right;
}
} else {
if (r3.top < l2.top) {
u3 = i2 - (l2.top - r3.top);
}
if (r3.bottom > l2.bottom) {
u3 = i2 + (r3.bottom - l2.bottom);
}
}
u3 = Math.max(u3, 0);
y2.value = Math.min(u3, s2);
};
const _2 = () => {
var t3;
if (!m2.value || !f2.value) return;
e2.stretch && ((t3 = b2.value) == null ? void 0 : t3.update());
const n3 = m2.value[`offset${oi(k2.value)}`];
const o3 = f2.value[`offset${oi(k2.value)}`];
const a3 = y2.value;
if (o3 < n3) {
g2.value = g2.value || {};
g2.value.prev = a3;
g2.value.next = a3 + o3 < n3;
if (n3 - a3 < o3) {
y2.value = n3 - o3;
}
} else {
g2.value = false;
if (a3 > 0) {
y2.value = 0;
}
}
};
const $2 = (e3) => {
const t3 = e3.code;
const { up: n3, down: o3, left: a3, right: r3 } = cu;
if (![n3, o3, a3, r3].includes(t3)) return;
const l2 = Array.from(e3.currentTarget.querySelectorAll("[role=tab]:not(.is-disabled)"));
const s2 = l2.indexOf(e3.target);
let i2;
if (t3 === a3 || t3 === n3) {
if (s2 === 0) {
i2 = l2.length - 1;
} else {
i2 = s2 - 1;
}
} else {
if (s2 < l2.length - 1) {
i2 = s2 + 1;
} else {
i2 = 0;
}
}
l2[i2].focus({ preventScroll: true });
l2[i2].click();
L2();
};
const L2 = () => {
if (x2.value) w2.value = true;
};
const A2 = () => w2.value = false;
vue.watch(u2, (e3) => {
if (e3 === "hidden") {
x2.value = false;
} else if (e3 === "visible") {
setTimeout(() => x2.value = true, 50);
}
});
vue.watch(d2, (e3) => {
if (e3) {
setTimeout(() => x2.value = true, 50);
} else {
x2.value = false;
}
});
lt(h2, _2);
vue.onMounted(() => setTimeout(() => O2(), 0));
vue.onUpdated(() => _2());
t2({ scrollToActiveTab: O2, removeFocus: A2 });
vue.watch(() => e2.panes, () => o2.update(), { flush: "post", deep: true });
return () => {
const t3 = g2.value ? [vue.createVNode("span", { class: [r2.e("nav-prev"), r2.is("disabled", !g2.value.prev)], onClick: C2 }, [vue.createVNode(Uf, null, { default: () => [vue.createVNode(wi, null, null)] })]), vue.createVNode("span", { class: [r2.e("nav-next"), r2.is("disabled", !g2.value.next)], onClick: E2 }, [vue.createVNode(Uf, null, { default: () => [vue.createVNode(ki, null, null)] })])] : null;
const o3 = e2.panes.map((t4, o4) => {
var l2, s2, i2, u3;
const c2 = t4.uid;
const d3 = t4.props.disabled;
const f3 = (s2 = (l2 = t4.props.name) != null ? l2 : t4.index) != null ? s2 : `${o4}`;
const p2 = !d3 && (t4.isClosable || e2.editable);
t4.index = `${o4}`;
const v2 = p2 ? vue.createVNode(Uf, { class: "is-icon-close", onClick: (e3) => n2("tabRemove", t4, e3) }, { default: () => [vue.createVNode(Ti, null, null)] }) : null;
const m3 = ((u3 = (i2 = t4.slots).label) == null ? void 0 : u3.call(i2)) || t4.props.label;
const h3 = !d3 && t4.active ? 0 : -1;
return vue.createVNode("div", { ref: `tab-${c2}`, class: [r2.e("item"), r2.is(a2.props.tabPosition), r2.is("active", t4.active), r2.is("disabled", d3), r2.is("closable", p2), r2.is("focus", w2.value)], id: `tab-${f3}`, key: `tab-${c2}`, "aria-controls": `pane-${f3}`, role: "tab", "aria-selected": t4.active, tabindex: h3, onFocus: () => L2(), onBlur: () => A2(), onClick: (e3) => {
A2();
n2("tabClick", t4, f3, e3);
}, onKeydown: (e3) => {
if (p2 && (e3.code === cu.delete || e3.code === cu.backspace)) {
n2("tabRemove", t4, e3);
}
} }, [...[m3, v2]]);
});
return vue.createVNode("div", { ref: h2, class: [r2.e("nav-wrap"), r2.is("scrollable", !!g2.value), r2.is(a2.props.tabPosition)] }, [t3, vue.createVNode("div", { class: r2.e("nav-scroll"), ref: f2 }, [vue.createVNode("div", { class: [r2.e("nav"), r2.is(a2.props.tabPosition), r2.is("stretch", e2.stretch && ["top", "bottom"].includes(a2.props.tabPosition))], ref: m2, style: S2.value, role: "tablist", onKeydown: $2 }, [...[!e2.type ? vue.createVNode(Qk, { ref: b2, tabs: [...e2.panes] }, null) : null, o3]])])]);
};
} });
const aS = ou({ type: { type: String, values: ["card", "border-card", ""], default: "" }, closable: Boolean, addable: Boolean, modelValue: { type: [String, Number] }, editable: Boolean, tabPosition: { type: String, values: ["top", "right", "bottom", "left"], default: "top" }, beforeLeave: { type: eu(Function), default: () => true }, stretch: Boolean });
const rS = (e2) => St(e2) || Zs(e2);
const lS = { [fu]: (e2) => rS(e2), tabClick: (e2, t2) => t2 instanceof Event, tabChange: (e2) => rS(e2), edit: (e2, t2) => ["remove", "add"].includes(t2), tabRemove: (e2) => rS(e2), tabAdd: () => true };
const sS = vue.defineComponent({ name: "ElTabs", props: aS, emits: lS, setup(e2, { emit: t2, slots: n2, expose: o2 }) {
var a2;
const r2 = Vu("tabs");
const u2 = vue.computed(() => ["left", "right"].includes(e2.tabPosition));
const { children: c2, addChild: d2, removeChild: f2 } = Cf(vue.getCurrentInstance(), "ElTabPane");
const p2 = vue.ref();
const m2 = vue.ref((a2 = e2.modelValue) != null ? a2 : "0");
const h2 = async (n3, o3 = false) => {
var a3, r3, l2;
if (m2.value === n3 || Gs(n3)) return;
try {
const s2 = await ((a3 = e2.beforeLeave) == null ? void 0 : a3.call(e2, n3, m2.value));
if (s2 !== false) {
m2.value = n3;
if (o3) {
t2(fu, n3);
t2("tabChange", n3);
}
(l2 = (r3 = p2.value) == null ? void 0 : r3.removeFocus) == null ? void 0 : l2.call(r3);
}
} catch (e3) {
}
};
const b2 = (e3, n3, o3) => {
if (e3.props.disabled) return;
h2(n3, true);
t2("tabClick", e3, o3);
};
const g2 = (e3, n3) => {
if (e3.props.disabled || Gs(e3.props.name)) return;
n3.stopPropagation();
t2("edit", e3.props.name, "remove");
t2("tabRemove", e3.props.name);
};
const w2 = () => {
t2("edit", void 0, "add");
t2("tabAdd");
};
vue.watch(() => e2.modelValue, (e3) => h2(e3));
vue.watch(m2, async () => {
var e3;
await vue.nextTick();
(e3 = p2.value) == null ? void 0 : e3.scrollToActiveTab();
});
vue.provide(qk, { props: e2, currentName: m2, registerPane: d2, unregisterPane: f2 });
o2({ currentName: m2 });
return () => {
const t3 = n2["add-icon"];
const o3 = e2.editable || e2.addable ? vue.createVNode("div", { class: [r2.e("new-tab"), u2.value && r2.e("new-tab-vertical")], tabindex: "0", onClick: w2, onKeydown: (e3) => {
if (e3.code === cu.enter) w2();
} }, [t3 ? vue.renderSlot(n2, "add-icon") : vue.createVNode(Uf, { class: r2.is("icon-plus") }, { default: () => [vue.createVNode(Ui, null, null)] })]) : null;
const a3 = vue.createVNode("div", { class: [r2.e("header"), u2.value && r2.e("header-vertical"), r2.is(e2.tabPosition)] }, [vue.createVNode(oS, { ref: p2, currentName: m2.value, editable: e2.editable, type: e2.type, panes: c2.value, stretch: e2.stretch, onTabClick: b2, onTabRemove: g2 }, null), o3]);
const l2 = vue.createVNode("div", { class: r2.e("content") }, [vue.renderSlot(n2, "default")]);
return vue.createVNode("div", { class: [r2.b(), r2.m(e2.tabPosition), { [r2.m("card")]: e2.type === "card", [r2.m("border-card")]: e2.type === "border-card" }] }, [...e2.tabPosition !== "bottom" ? [a3, l2] : [l2, a3]]);
};
} });
const iS = ou({ label: { type: String, default: "" }, name: { type: [String, Number] }, closable: Boolean, disabled: Boolean, lazy: Boolean });
const uS = ["id", "aria-hidden", "aria-labelledby"];
const cS = "ElTabPane";
const dS = vue.defineComponent({ name: cS });
const fS = vue.defineComponent({ ...dS, props: iS, setup(e2) {
const o2 = e2;
const a2 = vue.getCurrentInstance();
const r2 = vue.useSlots();
const d2 = vue.inject(qk);
if (!d2) si(cS, "usage: <el-tabs><el-tab-pane /></el-tabs/>");
const f2 = Vu("tab-pane");
const m2 = vue.ref();
const h2 = vue.computed(() => o2.closable || d2.props.closable);
const b2 = Ne(() => {
var e3;
return d2.currentName.value === ((e3 = o2.name) != null ? e3 : m2.value);
});
const g2 = vue.ref(b2.value);
const y2 = vue.computed(() => {
var e3;
return (e3 = o2.name) != null ? e3 : m2.value;
});
const w2 = Ne(() => !o2.lazy || g2.value || b2.value);
vue.watch(b2, (e3) => {
if (e3) g2.value = true;
});
const k2 = vue.reactive({ uid: a2.uid, slots: r2, props: o2, paneName: y2, active: b2, index: m2, isClosable: h2 });
vue.onMounted(() => {
d2.registerPane(k2);
});
vue.onUnmounted(() => {
d2.unregisterPane(k2.uid);
});
return (e3, o3) => vue.unref(w2) ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", { key: 0, id: `pane-${vue.unref(y2)}`, class: vue.normalizeClass(vue.unref(f2).b()), role: "tabpanel", "aria-hidden": !vue.unref(b2), "aria-labelledby": `tab-${vue.unref(y2)}` }, [vue.renderSlot(e3.$slots, "default")], 10, uS)), [[vue.vShow, vue.unref(b2)]]) : vue.createCommentVNode("v-if", true);
} });
var pS = jf(fS, [["__file", "tab-pane.vue"]]);
const vS = su(sS, { TabPane: pS });
const mS = iu(pS);
function hS(t2) {
let n2;
const o2 = vue.ref(false);
const a2 = vue.reactive({ ...t2, originalPosition: "", originalOverflow: "", visible: false });
function r2(e2) {
a2.text = e2;
}
function l2() {
const e2 = a2.parent;
const t3 = f2.ns;
if (!e2.vLoadingAddClassList) {
let n3 = e2.getAttribute("loading-number");
n3 = Number.parseInt(n3) - 1;
if (!n3) {
fi(e2, t3.bm("parent", "relative"));
e2.removeAttribute("loading-number");
} else {
e2.setAttribute("loading-number", n3.toString());
}
fi(e2, t3.bm("parent", "hidden"));
}
s2();
d2.unmount();
}
function s2() {
var e2, t3;
(t3 = (e2 = f2.$el) == null ? void 0 : e2.parentNode) == null ? void 0 : t3.removeChild(f2.$el);
}
function i2() {
var e2;
if (t2.beforeClose && !t2.beforeClose()) return;
o2.value = true;
clearTimeout(n2);
n2 = window.setTimeout(u2, 400);
a2.visible = false;
(e2 = t2.closed) == null ? void 0 : e2.call(t2);
}
function u2() {
if (!o2.value) return;
const e2 = a2.parent;
o2.value = false;
e2.vLoadingAddClassList = void 0;
l2();
}
const c2 = vue.defineComponent({ name: "ElLoading", setup(e2, { expose: t3 }) {
const { ns: n3, zIndex: o3 } = Vf("loading");
t3({ ns: n3, zIndex: o3 });
return () => {
const e3 = a2.spinner || a2.svg;
const t4 = vue.h("svg", { class: "circular", viewBox: a2.svgViewBox ? a2.svgViewBox : "0 0 50 50", ...e3 ? { innerHTML: e3 } : {} }, [vue.h("circle", { class: "path", cx: "25", cy: "25", r: "20", fill: "none" })]);
const o4 = a2.text ? vue.h("p", { class: n3.b("text") }, [a2.text]) : void 0;
return vue.h(vue.Transition, { name: n3.b("fade"), onAfterLeave: u2 }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode("div", { style: { backgroundColor: a2.background || "" }, class: [n3.b("mask"), a2.customClass, a2.fullscreen ? "is-fullscreen" : ""] }, [vue.h("div", { class: n3.b("spinner") }, [t4, o4])]), [[vue.vShow, a2.visible]])]) });
};
} });
const d2 = vue.createApp(c2);
const f2 = d2.mount(document.createElement("div"));
return { ...vue.toRefs(a2), setText: r2, removeElLoadingChild: s2, close: i2, handleAfterLeave: u2, vm: f2, get $el() {
return f2.$el;
} };
}
let bS = void 0;
const gS = function(e2 = {}) {
if (!Ie) return void 0;
const t2 = yS(e2);
if (t2.fullscreen && bS) {
return bS;
}
const n2 = hS({ ...t2, closed: () => {
var e3;
(e3 = t2.closed) == null ? void 0 : e3.call(t2);
if (t2.fullscreen) bS = void 0;
} });
wS(t2, t2.parent, n2);
xS(t2, t2.parent, n2);
t2.parent.vLoadingAddClassList = () => xS(t2, t2.parent, n2);
let o2 = t2.parent.getAttribute("loading-number");
if (!o2) {
o2 = "1";
} else {
o2 = `${Number.parseInt(o2) + 1}`;
}
t2.parent.setAttribute("loading-number", o2);
t2.parent.appendChild(n2.$el);
vue.nextTick(() => n2.visible.value = t2.visible);
if (t2.fullscreen) {
bS = n2;
}
return n2;
};
const yS = (e2) => {
var t2, n2, o2, a2;
let r2;
if (St(e2.target)) {
r2 = (t2 = document.querySelector(e2.target)) != null ? t2 : document.body;
} else {
r2 = e2.target || document.body;
}
return { parent: r2 === document.body || e2.body ? document.body : r2, background: e2.background || "", svg: e2.svg || "", svgViewBox: e2.svgViewBox || "", spinner: e2.spinner || false, text: e2.text || "", fullscreen: r2 === document.body && ((n2 = e2.fullscreen) != null ? n2 : true), lock: (o2 = e2.lock) != null ? o2 : false, customClass: e2.customClass || "", visible: (a2 = e2.visible) != null ? a2 : true, beforeClose: e2.beforeClose, closed: e2.closed, target: r2 };
};
const wS = async (e2, t2, n2) => {
const { nextZIndex: o2 } = n2.vm.zIndex || n2.vm._.exposed.zIndex;
const a2 = {};
if (e2.fullscreen) {
n2.originalPosition.value = pi(document.body, "position");
n2.originalOverflow.value = pi(document.body, "overflow");
a2.zIndex = o2();
} else if (e2.parent === document.body) {
n2.originalPosition.value = pi(document.body, "position");
await vue.nextTick();
for (const t3 of ["top", "left"]) {
const n3 = t3 === "top" ? "scrollTop" : "scrollLeft";
a2[t3] = `${e2.target.getBoundingClientRect()[t3] + document.body[n3] + document.documentElement[n3] - Number.parseInt(pi(document.body, `margin-${t3}`), 10)}px`;
}
for (const t3 of ["height", "width"]) {
a2[t3] = `${e2.target.getBoundingClientRect()[t3]}px`;
}
} else {
n2.originalPosition.value = pi(t2, "position");
}
for (const [e3, t3] of Object.entries(a2)) {
n2.$el.style[e3] = t3;
}
};
const xS = (e2, t2, n2) => {
const o2 = n2.vm.ns || n2.vm._.exposed.ns;
if (!["absolute", "fixed", "sticky"].includes(n2.originalPosition.value)) {
di(t2, o2.bm("parent", "relative"));
} else {
fi(t2, o2.bm("parent", "relative"));
}
if (e2.fullscreen && e2.lock) {
di(t2, o2.bm("parent", "hidden"));
} else {
fi(t2, o2.bm("parent", "hidden"));
}
};
const kS = Symbol("ElLoading");
const SS = (e2, t2) => {
var n2, o2, a2, r2;
const l2 = t2.instance;
const s2 = (e3) => Ct(t2.value) ? t2.value[e3] : void 0;
const i2 = (e3) => {
const t3 = St(e3) && (l2 == null ? void 0 : l2[e3]) || e3;
if (t3) return vue.ref(t3);
else return t3;
};
const u2 = (t3) => i2(s2(t3) || e2.getAttribute(`element-loading-${Dt(t3)}`));
const c2 = (n2 = s2("fullscreen")) != null ? n2 : t2.modifiers.fullscreen;
const d2 = { text: u2("text"), svg: u2("svg"), svgViewBox: u2("svgViewBox"), spinner: u2("spinner"), background: u2("background"), customClass: u2("customClass"), fullscreen: c2, target: (o2 = s2("target")) != null ? o2 : c2 ? void 0 : e2, body: (a2 = s2("body")) != null ? a2 : t2.modifiers.body, lock: (r2 = s2("lock")) != null ? r2 : t2.modifiers.lock };
e2[kS] = { options: d2, instance: gS(d2) };
};
const CS = (e2, t2) => {
for (const n2 of Object.keys(t2)) {
if (vue.isRef(t2[n2])) t2[n2].value = e2[n2];
}
};
const ES = { mounted(e2, t2) {
if (t2.value) {
SS(e2, t2);
}
}, updated(e2, t2) {
const n2 = e2[kS];
if (t2.oldValue !== t2.value) {
if (t2.value && !t2.oldValue) {
SS(e2, t2);
} else if (t2.value && t2.oldValue) {
if (Ct(t2.value)) CS(t2.value, n2.options);
} else {
n2 == null ? void 0 : n2.instance.close();
}
}
}, unmounted(e2) {
var t2;
(t2 = e2[kS]) == null ? void 0 : t2.instance.close();
e2[kS] = null;
} };
var MS = /* @__PURE__ */ (() => typeof GM_log != "undefined" ? GM_log : void 0)();
var OS = /* @__PURE__ */ (() => typeof GM_registerMenuCommand != "undefined" ? GM_registerMenuCommand : void 0)();
var _S = /* @__PURE__ */ (() => typeof GM_xmlhttpRequest != "undefined" ? GM_xmlhttpRequest : void 0)();
var $S = /* @__PURE__ */ (() => typeof unsafeWindow != "undefined" ? unsafeWindow : void 0)();
const LS = (e2) => {
let { url: t2 } = e2;
const { method: n2, params: o2, data: a2, responseType: r2, headers: l2 } = e2;
if ((n2 === "get" || n2 === "GET") && o2) {
t2 += `?${ie.stringify(o2)}`;
}
return new Promise((e3, o3) => {
_S({ method: n2, url: t2, data: a2, responseType: r2 ? r2 : "json", headers: { "Content-Type": "application/x-www-form-urlencoded", ...l2 }, onload(t3) {
e3(t3);
}, onerror(e4) {
o3(e4);
} });
});
};
const AS = "https://www.doseeing.com/data";
const DS = (e2) => LS({ url: `${AS}/fan/${e2}`, method: "get", responseType: "text" });
const RS = (e2) => LS({ url: `${AS}/api/user_feed`, method: "get", params: e2 });
const TS = { class: "flex justify-between" };
const NS = { class: "flex-1" };
const PS = { class: "text-slate-400" };
const IS = ["innerHTML"];
const VS = ["src"];
const BS = vue.defineComponent({ __name: "DanmuRow", props: { data: {}, nickName: {} }, setup(e2) {
const a2 = e2;
const r2 = () => {
window.open(`https://www.doseeing.com/data/room/${a2.data.rid}`);
};
const l2 = (e3) => {
navigator.clipboard.writeText(`@${a2.nickName}:${e3}`);
elementPlus.ElMessage({ message: "复制成功", type: "success", plain: true });
};
const s2 = (e3) => {
navigator.clipboard.writeText(e3);
elementPlus.ElMessage({ message: "复制成功", type: "success", plain: true });
};
const i2 = (e3) => lh.unix(e3).format("YYYY-MM-DD HH:mm:ss");
return (e3, u2) => {
const c2 = th;
return vue.openBlock(), vue.createElementBlock("div", TS, [vue.createElementVNode("div", NS, [vue.createElementVNode("div", PS, [vue.createElementVNode("span", null, vue.toDisplayString(i2(a2.data.ts)), 1), vue.createVNode(c2, { class: "ml-5", type: "primary", size: "small", plain: "", onClick: u2[0] || (u2[0] = () => s2(a2.data.txt)) }, { default: vue.withCtx(() => [vue.createTextVNode("复制")]), _: 1 }), vue.createVNode(c2, { class: "ml-12", type: "primary", size: "small", plain: "", onClick: u2[1] || (u2[1] = () => l2(a2.data.txt)) }, { default: vue.withCtx(() => [vue.createTextVNode("含名称复制")]), _: 1 })]), vue.createElementVNode("div", { class: "font-black text-3xl", innerHTML: a2.data.txt }, null, 8, IS)]), vue.createElementVNode("div", { class: "flex w-56 cursor-pointer items-center flex-none", onClick: r2 }, [vue.createElementVNode("img", { src: `https://apic.douyucdn.cn/upload/${a2.data["room.av"]}_middle.jpg`, class: "w-16 h-16 rounded-md" }, null, 8, VS), vue.createElementVNode("div", null, vue.toDisplayString(a2.data["room.nn"]), 1)])]);
};
} });
const FS = { class: "flex justify-between mb-4" };
const jS = { class: "flex items-start" };
const zS = ["src"];
const HS = { class: "font-black text-xl ml-2" };
const WS = { class: "flex justify-between" };
const YS = { key: 1, class: "h-[58vh] text-center" };
const US = 50;
const KS = vue.defineComponent({ __name: "index", props: { rel: {}, nickName: {}, avatar: {} }, setup(e2) {
const a2 = e2;
const r2 = vue.ref(false);
const l2 = vue.ref("");
const s2 = vue.ref(false);
const u2 = vue.ref([]);
const c2 = vue.ref("1");
const d2 = vue.ref(lh().format());
const f2 = vue.ref(0);
const p2 = vue.ref(["chat"]);
const m2 = vue.reactive({});
let h2 = true;
const b2 = vue.ref(null);
const g2 = [{ title: "弹幕", value: "chat" }, { title: "礼物", value: "gift" }];
vue.watch(p2, (e3) => {
g2.forEach((t2) => m2[t2.value] = e3.includes(t2.value));
}, { immediate: true });
const y2 = () => {
window.open(`https://www.doseeing.com/data/fan/${a2.rel}`);
};
const w2 = async () => {
f2.value = 0;
await $2();
};
const x2 = () => {
d2.value = lh(d2.value).add(1, "day").format();
w2();
};
const k2 = () => {
d2.value = lh(d2.value).subtract(1, "day").format();
w2();
};
const S2 = ({ scrollTop: e3 }) => {
if (b2.value.wrapRef.scrollHeight - e3 <= b2.value.wrapRef.clientHeight && h2) {
f2.value += US;
$2();
}
};
let C2;
const E2 = async () => {
C2 = document.createElement("style");
C2.textContent = "body{overflow:hidden;}";
document.head.appendChild(C2);
r2.value = true;
s2.value = true;
f2.value = 0;
try {
const { finalUrl: e3, response: t2 } = await DS(a2.rel);
if (e3.startsWith("https://www.doseeing.com/login")) {
elementPlus.ElMessage({ message: "未登录(不可用)doseeing,请先登录(不可用)", type: "error", plain: true });
return;
}
const n2 = D2(t2, 'data-id="', '"');
if (!n2) {
elementPlus.ElMessage({ message: "未获取到用户id", type: "error", plain: true });
return;
}
l2.value = n2;
await $2();
} finally {
s2.value = false;
}
};
E2();
const M2 = () => {
C2.remove();
};
const $2 = async () => {
try {
s2.value = true;
const { response: { result: e3 } } = await RS({ uid: l2.value, dt: lh(d2.value).format("YYYY-MM-DD"), offset: f2.value, order: c2.value });
if (f2.value === 0) {
u2.value = e3;
b2.value && b2.value.wrapRef && b2.value.setScrollTop(0);
} else {
u2.value = [...u2.value, ...e3];
}
h2 = e3.length === US;
} finally {
s2.value = false;
}
};
const D2 = (e3, t2, n2) => {
const o2 = new RegExp(t2 + "(.*?)" + n2, "s");
const a3 = e3.match(o2);
return a3 ? a3[1] : null;
};
return (e3, l3) => {
const i2 = th;
const f3 = Cg;
const v2 = Sg;
const h3 = tg;
const C3 = ng;
const E3 = cw;
const $3 = Iw;
const D3 = Lp;
const R2 = Dw;
const P2 = ES;
return vue.openBlock(), vue.createBlock(R2, { modelValue: r2.value, "onUpdate:modelValue": l3[3] || (l3[3] = (e4) => r2.value = e4), title: "弹幕历史", width: "70%", top: "6vh", "destroy-on-close": "", "lock-scroll": "", onClosed: M2 }, { default: vue.withCtx(() => [vue.createElementVNode("div", FS, [vue.createElementVNode("div", jS, [vue.createElementVNode("img", { src: a2.avatar, class: "h-20 w-20 rounded-xl" }, null, 8, zS), vue.createElementVNode("span", HS, vue.toDisplayString(a2.nickName), 1)]), vue.createVNode(i2, { type: "primary", size: "small", onClick: y2 }, { default: vue.withCtx(() => [vue.createTextVNode("详情")]), _: 1 })]), vue.createElementVNode("div", WS, [vue.createElementVNode("div", null, [vue.createVNode(v2, { modelValue: c2.value, "onUpdate:modelValue": l3[0] || (l3[0] = (e4) => c2.value = e4), onChange: w2 }, { default: vue.withCtx(() => [vue.createVNode(f3, { label: "时间正序", value: "0" }), vue.createVNode(f3, { label: "时间倒序", value: "1" })]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(C3, { modelValue: p2.value, "onUpdate:modelValue": l3[1] || (l3[1] = (e4) => p2.value = e4) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(g2, (e4) => vue.createVNode(h3, { value: e4.value }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(e4.title), 1)]), _: 2 }, 1032, ["value"])), 64))]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(i2, { type: "primary", onClick: k2 }, { default: vue.withCtx(() => [vue.createTextVNode("前一天")]), _: 1 }), vue.createVNode(E3, { modelValue: d2.value, "onUpdate:modelValue": l3[2] || (l3[2] = (e4) => d2.value = e4), onChange: w2 }, null, 8, ["modelValue"]), vue.createVNode(i2, { type: "primary", onClick: x2 }, { default: vue.withCtx(() => [vue.createTextVNode("后一天")]), _: 1 })])]), vue.createVNode($3), u2.value.length > 0 ? vue.withDirectives((vue.openBlock(), vue.createBlock(D3, { key: 0, class: "h-[58vh] w-full", height: "58vh", onScroll: S2, ref_key: "danmuContainer", ref: b2 }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(u2.value, (e4, o2) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: `${o2}${e4.ts}` }, [m2[e4.type] ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createVNode(BS, { data: e4, "nick-name": a2.nickName }, null, 8, ["data", "nick-name"]), vue.createVNode($3)], 64)) : vue.createCommentVNode("", true)], 64))), 128))]), _: 1 })), [[P2, s2.value]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", YS, [vue.createTextVNode(" 翻来翻去还是没有记录 ")])), [[P2, s2.value]])]), _: 1 }, 8, ["modelValue"]);
};
} });
const _qS = class _qS {
constructor() {
__publicField(this, "app", null);
__publicField(this, "targetPosition", null);
}
init() {
const e2 = "DOUYUCRX";
$S[e2].handleDanmuHistory = (e3) => {
if (!this.targetPosition) {
this.targetPosition = document.querySelector(".layout-Player");
const e4 = document.createElement("div");
e4.id = _qS.appId;
this.targetPosition.appendChild(e4);
}
this.app && this.app.unmount();
this.app = vue.createApp(KS, { ...e3 });
this.app.mount(`#${_qS.appId}`);
};
}
};
__publicField(_qS, "appId", "danmu-history-btn");
let qS = _qS;
const GS = pinia.defineStore("setting-btn", () => {
const e2 = vue.ref({ show: true });
return { state: e2 };
}, { persist: true });
const XS = vue.defineComponent({ __name: "SettingButton", setup(e2) {
const a2 = vue.ref(false);
const { state: r2 } = GS();
const l2 = vue.ref({ display: "" });
OS("配置按钮[显示/隐藏]", () => {
r2.show = !r2.show;
});
const s2 = vue.ref();
let d2 = false;
let f2 = 0;
let p2 = 0;
let m2 = 0;
let h2 = 0;
let b2 = 0;
let g2 = 0;
let y2 = 0;
let w2 = 0;
vue.onMounted(() => {
y2 = s2.value.offsetWidth;
w2 = s2.value.offsetHeight;
m2 = window.innerWidth - y2;
b2 = window.innerWidth - y2;
s2.value.style.transform = `translate(${b2}px, ${g2}px)`;
vue.watch(() => r2.show, () => {
l2.value.display = r2.show ? "" : "none";
}, { immediate: true });
});
const k2 = (e3) => {
d2 = true;
f2 = e3.clientX;
p2 = e3.clientY;
document.addEventListener("mousemove", S2);
document.addEventListener("mouseup", C2);
};
const S2 = (e3) => {
if (d2) {
const t2 = e3.clientX - f2;
const n2 = e3.clientY - p2;
let o2 = m2 + t2;
let a3 = h2 + n2;
const r3 = window.innerWidth;
const l3 = window.innerHeight;
if (o2 < 0) o2 = 0;
if (a3 < 0) a3 = 0;
if (o2 + y2 > r3) o2 = r3 - y2;
if (a3 + w2 > l3) a3 = l3 - w2;
b2 = o2;
g2 = a3;
s2.value.style.transform = `translate(${b2}px, ${g2}px)`;
}
};
const C2 = () => {
d2 = false;
m2 = b2;
h2 = g2;
document.removeEventListener("mousemove", S2);
document.removeEventListener("mouseup", C2);
};
return (e3, r3) => {
const i2 = Uf;
const c2 = Kw;
return vue.openBlock(), vue.createElementBlock("div", null, [vue.createElementVNode("div", { ref_key: "draggable", ref: s2, class: "button-group fixed top-0 rounded-[6px] w-[32px] z-[10000]", style: vue.normalizeStyle(l2.value) }, [vue.createElementVNode("div", { class: "text-white flex items-center justify-center h-[32px] cursor-move", onMousedown: k2 }, [vue.createVNode(i2, { size: 18 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(qi))]), _: 1 })], 32), vue.createElementVNode("div", { class: "text-white flex items-center justify-center h-[32px] cursor-pointer", onClick: r3[0] || (r3[0] = (e4) => a2.value = true) }, [vue.createVNode(i2, { size: 18 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Xi))]), _: 1 })])], 4), vue.createVNode(c2, { modelValue: a2.value, "onUpdate:modelValue": r3[1] || (r3[1] = (e4) => a2.value = e4), size: "300px", "with-header": false, "z-index": 99999 }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default", {}, void 0, true)]), _: 3 }, 8, ["modelValue"])]);
};
} });
const ZS = (e2, t2) => {
const n2 = e2.__vccOpts || e2;
for (const [e3, o2] of t2) {
n2[e3] = o2;
}
return n2;
};
const JS = ZS(XS, [["__scopeId", "data-v-42544bd5"]]);
const QS = pinia.defineStore("light-stick", () => {
const e2 = vue.ref({ enabled: false, configList: [], completeDay: "" });
return { state: e2 };
}, { persist: true });
const eC = "https://www.douyu.com";
const tC = async () => {
const { response: e2 } = await LS({ url: `${eC}/member/cp/getFansBadgeList`, method: "get", responseType: "text" });
const t2 = /data-fans-room="(.+?)"[\s\S]+?data-anchor_name="(.+?)"/g;
let n2;
const o2 = [];
while ((n2 = t2.exec(e2)) !== null) {
o2.push({ rid: n2[1].trim(), name: n2[2] });
}
return o2;
};
const nC = (e2) => LS({ url: `${eC}/member/cp/getPropTransactionList`, method: "get", params: e2 });
const oC = (e2) => LS({ url: `${eC}/japi/prop/backpack/web/v2`, method: "get", params: e2, headers: { Referer: "https://www.douyu.com" } });
const aC = (e2) => {
const t2 = new URLSearchParams();
for (const [n2, o2] of Object.entries(e2)) {
t2.append(n2, o2);
}
t2.append("bizExt", '{"yzxq":{}}');
return LS({ url: `${eC}/japi/prop/donate/mainsite/v2`, method: "post", data: t2, headers: { Referer: "https://www.douyu.com" } });
};
const rC = { class: "dialog-footer" };
const lC = vue.defineComponent({ __name: "LightStickConfigDialog", props: { visible: { type: Boolean } }, emits: ["update:visible"], setup(e2, { emit: a2 }) {
const r2 = e2;
const l2 = vue.ref(true);
const s2 = a2;
const u2 = vue.ref(false);
const c2 = ["周一", "周二", "周三", "周四", "周五", "周六", "周日"];
const d2 = vue.ref([]);
const { state: f2 } = QS();
vue.watch(() => r2.visible, (e3) => {
if (e3) {
u2.value = true;
p2();
}
});
vue.watch(u2, (e3) => {
if (!e3) {
s2("update:visible", false);
}
});
const p2 = async () => {
l2.value = true;
try {
d2.value = Array.from({ length: 7 }, () => []);
const e3 = /* @__PURE__ */ new Map();
f2.configList.forEach((t3, n2) => {
const o2 = /* @__PURE__ */ new Map();
e3.set(n2, o2);
t3.forEach((e4) => {
o2.set(e4.rid, e4.count);
});
});
const t2 = await tC();
t2.forEach(({ rid: t3, name: n2 }) => {
d2.value.forEach((o2, a3) => {
var _a2;
const r3 = (_a2 = e3.get(a3)) == null ? void 0 : _a2.get(t3);
o2.push({ rid: t3, name: n2, count: r3 ? r3 : 0 });
});
});
} finally {
l2.value = false;
}
};
const m2 = (e3, t2) => {
d2.value.forEach((n2, o2) => {
if (t2 !== o2) {
d2.value[o2] = JSON.parse(JSON.stringify(e3));
}
});
elementPlus.ElMessage({ message: "同步成功", type: "success", plain: true });
};
const h2 = () => {
f2.configList = d2.value;
f2.completeDay = "";
elementPlus.ElMessage({ message: "保存成功", type: "success", plain: true });
u2.value = false;
};
return (e3, a3) => {
const r3 = th;
const s3 = Kk;
const i2 = tx;
const f3 = Uk;
const p3 = mS;
const v2 = vS;
const b2 = Dw;
const g2 = ES;
return vue.openBlock(), vue.createBlock(b2, { modelValue: u2.value, "onUpdate:modelValue": a3[1] || (a3[1] = (e4) => u2.value = e4), title: "荧光棒配置", width: "50%", top: "6vh", "destroy-on-close": "", "lock-scroll": "" }, { footer: vue.withCtx(() => [vue.createElementVNode("div", rC, [vue.createVNode(r3, { onClick: a3[0] || (a3[0] = (e4) => u2.value = false), loading: l2.value }, { default: vue.withCtx(() => [vue.createTextVNode("取消")]), _: 1 }, 8, ["loading"]), vue.createVNode(r3, { type: "primary", onClick: h2, loading: l2.value }, { default: vue.withCtx(() => [vue.createTextVNode(" 保存 ")]), _: 1 }, 8, ["loading"])])]), default: vue.withCtx(() => [vue.withDirectives((vue.openBlock(), vue.createBlock(v2, { type: "border-card" }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(d2.value, (e4, n2) => (vue.openBlock(), vue.createBlock(p3, { label: c2[n2], key: n2 }, { default: vue.withCtx(() => [vue.createVNode(r3, { type: "primary", onClick: (t2) => m2(e4, n2) }, { default: vue.withCtx(() => [vue.createTextVNode("同步至其他日")]), _: 2 }, 1032, ["onClick"]), vue.createVNode(f3, { data: e4, style: { width: "100%" }, height: "60vh" }, { default: vue.withCtx(() => [vue.createVNode(s3, { prop: "rid", label: "直播间号" }), vue.createVNode(s3, { prop: "name", label: "主播名称" }), vue.createVNode(s3, { prop: "count", label: "数量" }, { default: vue.withCtx((e5) => [vue.createVNode(i2, { modelValue: e5.row.count, "onUpdate:modelValue": (t2) => e5.row.count = t2, min: 0 }, null, 8, ["modelValue", "onUpdate:modelValue"])]), _: 1 })]), _: 2 }, 1032, ["data"])]), _: 2 }, 1032, ["label"]))), 128))]), _: 1 })), [[g2, l2.value]])]), _: 1 }, 8, ["modelValue"]);
};
} });
const sC = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "荧光棒配置", -1);
const iC = { class: "flex justify-between items-center pt-[5px] text-[14px]" };
const uC = vue.createElementVNode("span", null, "自动送荧光棒", -1);
const cC = vue.defineComponent({ __name: "LightStickConf", setup(e2) {
const a2 = vue.ref(false);
const { state: r2 } = QS();
return (e3, l2) => {
const s2 = px;
const i2 = th;
const c2 = Iw;
return vue.openBlock(), vue.createElementBlock("div", null, [sC, vue.createElementVNode("div", iC, [uC, vue.createVNode(s2, { modelValue: vue.unref(r2).enabled, "onUpdate:modelValue": l2[0] || (l2[0] = (e4) => vue.unref(r2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(i2, { size: "small", type: "primary", onClick: l2[1] || (l2[1] = (e4) => a2.value = true) }, { default: vue.withCtx(() => [vue.createTextVNode("详细配置")]), _: 1 })]), vue.createVNode(lC, { visible: a2.value, "onUpdate:visible": l2[2] || (l2[2] = (e4) => a2.value = e4) }, null, 8, ["visible"]), vue.createVNode(c2)]);
};
} });
const dC = pinia.defineStore("page-config", () => {
const e2 = vue.ref({});
const t2 = vue.ref({});
const n2 = vue.ref(true);
const o2 = (n3, o3) => {
const { title: a2, hide: r2, have: l2 } = o3;
const s2 = e2.value[n3];
e2.value[n3] = { hide: s2 ? s2.hide : r2 };
t2.value[n3] = { title: a2, have: l2 };
};
return { infoState: t2, hideState: e2, loading: n2, addPageConfig: o2 };
}, { persist: { paths: ["hideState"] } });
const fC = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "页面配置", -1);
const pC = { key: 0, class: "h-[80px]" };
const vC = { key: 0, class: "flex justify-between items-center pt-[5px] text-[14px]" };
const mC = vue.defineComponent({ __name: "ElementConf", setup(e2) {
const a2 = dC();
const { infoState: r2, hideState: l2, loading: s2 } = pinia.storeToRefs(a2);
return (e3, a3) => {
const i2 = px;
const c2 = ES;
return vue.openBlock(), vue.createElementBlock("div", null, [fC, vue.unref(s2) ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", pC, null, 512)), [[c2, true]]) : (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 1 }, vue.renderList(vue.unref(r2), (e4, a4) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [e4.have ? (vue.openBlock(), vue.createElementBlock("div", vC, [vue.createElementVNode("span", null, vue.toDisplayString(e4.title), 1), vue.createVNode(i2, { modelValue: vue.unref(l2)[a4].hide, "onUpdate:modelValue": (e5) => vue.unref(l2)[a4].hide = e5 }, null, 8, ["modelValue", "onUpdate:modelValue"])])) : vue.createCommentVNode("", true)], 64))), 256))]);
};
} });
const hC = "DOUYUCRX";
const bC = pinia.defineStore("red-packet", () => {
const e2 = vue.ref({ enabled: false });
vue.watch(() => e2.value.enabled, (e3) => {
$S[hC].redPacketEnabled = e3;
}, { immediate: true });
return { state: e2 };
}, { persist: true });
const gC = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "抢宝箱配置", -1);
const yC = { class: "flex justify-between items-center pt-[5px] text-[14px]" };
const wC = vue.createElementVNode("span", null, "自动抢宝箱", -1);
const xC = vue.defineComponent({ __name: "RedPacketConf", setup(e2) {
const { state: a2 } = bC();
return (e3, r2) => {
const l2 = px;
const s2 = Iw;
return vue.openBlock(), vue.createElementBlock("div", null, [gC, vue.createElementVNode("div", yC, [wC, vue.createVNode(l2, { modelValue: vue.unref(a2).enabled, "onUpdate:modelValue": r2[0] || (r2[0] = (e4) => vue.unref(a2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createVNode(s2)]);
};
} });
const kC = "DOUYUCRX";
const SC = pinia.defineStore("join-lottery", () => {
const e2 = vue.ref({ enabled: false, resolveHide: false, rejectHide: false });
const t2 = vue.ref();
let n2 = void 0;
const o2 = () => {
t2.value = $S[kC].uLotteryStart;
};
window.addEventListener("ULotteryStartComponentDidMount", o2);
window.addEventListener("ULotteryStartComponentWillUnmount", o2);
const a2 = () => {
n2 = $S[kC].lotteryContainer;
};
window.addEventListener("LotteryContainerComponentDidMount", a2);
window.addEventListener("LotteryContainerComponentWillUnmount", a2);
const r2 = async () => {
try {
await new Promise(async (e3, n3) => {
const o3 = t2.value;
const a3 = o3.props.lotteryInfo.join_condition.lottery_range;
if (a3 >= 4) {
o3.happyLotteryServices.getUserDiamondInfo().subscribe((t3) => {
if (t3) {
o3.joinLottery();
e3();
} else {
n3();
}
});
return;
}
if (a3 <= 1 || o3.props.isFans) {
o3.joinLottery();
e3();
return;
}
n3();
});
if (e2.value.resolveHide) {
setTimeout(() => {
n2 && n2.closePanel();
}, 1e3);
}
} catch {
if (e2.value.rejectHide) {
setTimeout(() => {
n2 && n2.closePanel();
}, 1e3);
}
}
};
vue.watch(t2, (t3) => {
if (!t3 || !e2.value.enabled) {
return;
}
r2();
});
vue.watch(() => e2.value.enabled, (e3) => {
if (!e3 || !t2.value) {
return;
}
r2();
});
return { state: e2 };
}, { persist: { paths: ["state"] } });
const CC = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "抽奖配置", -1);
const EC = { class: "flex justify-between items-center pt-[5px] text-[14px]" };
const MC = vue.createElementVNode("span", null, "自动参与抽奖", -1);
const OC = { class: "flex justify-between items-center pt-[5px] text-[14px]" };
const _C = vue.createElementVNode("span", null, "参与后自动关闭抽奖", -1);
const $C = { class: "flex justify-between items-center pt-[5px] text-[14px]" };
const LC = vue.createElementVNode("span", null, "无法自动满足条件关闭抽奖", -1);
const AC = vue.defineComponent({ __name: "JoinLotteryConf", setup(e2) {
const { state: a2 } = SC();
return (e3, r2) => {
const l2 = px;
const s2 = Iw;
return vue.openBlock(), vue.createElementBlock("div", null, [CC, vue.createElementVNode("div", EC, [MC, vue.createVNode(l2, { modelValue: vue.unref(a2).enabled, "onUpdate:modelValue": r2[0] || (r2[0] = (e4) => vue.unref(a2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createElementVNode("div", OC, [_C, vue.createVNode(l2, { modelValue: vue.unref(a2).resolveHide, "onUpdate:modelValue": r2[1] || (r2[1] = (e4) => vue.unref(a2).resolveHide = e4) }, null, 8, ["modelValue"])]), vue.createElementVNode("div", $C, [LC, vue.createVNode(l2, { modelValue: vue.unref(a2).rejectHide, "onUpdate:modelValue": r2[2] || (r2[2] = (e4) => vue.unref(a2).rejectHide = e4) }, null, 8, ["modelValue"])]), vue.createVNode(s2)]);
};
} });
const DC = { class: "p-[20px]" };
const RC = vue.defineComponent({ __name: "SettingPage", setup(e2) {
return (e3, o2) => {
const a2 = Iw;
return vue.openBlock(), vue.createElementBlock("div", DC, [vue.createVNode(cC), vue.createVNode(xC), vue.createVNode(AC), vue.createVNode(mC), vue.createVNode(a2)]);
};
} });
const TC = vue.defineComponent({ __name: "index", setup(e2) {
return (e3, n2) => (vue.openBlock(), vue.createBlock(JS, null, { default: vue.withCtx(() => [vue.createVNode(RC)]), _: 1 }));
} });
function NC(e2) {
return typeof e2 === "object" && e2 !== null;
}
function PC(e2, t2) {
e2 = NC(e2) ? e2 : /* @__PURE__ */ Object.create(null);
return new Proxy(e2, { get(e3, n2, o2) {
if (n2 === "key") return Reflect.get(e3, n2, o2);
return Reflect.get(e3, n2, o2) || Reflect.get(t2, n2, o2);
} });
}
function IC(e2, t2) {
return t2.reduce((e3, t3) => e3 == null ? void 0 : e3[t3], e2);
}
function VC(e2, t2, n2) {
return t2.slice(0, -1).reduce((e3, t3) => {
if (/^(__proto__)$/.test(t3)) return {};
else return e3[t3] = e3[t3] || {};
}, e2)[t2[t2.length - 1]] = n2, e2;
}
function BC(e2, t2) {
return t2.reduce((t3, n2) => {
const o2 = n2.split(".");
return VC(t3, o2, IC(e2, o2));
}, {});
}
function FC(e2, t2) {
return (n2) => {
var o2;
try {
const { storage: a2 = localStorage, beforeRestore: r2 = void 0, afterRestore: l2 = void 0, serializer: s2 = { serialize: JSON.stringify, deserialize: JSON.parse }, key: i2 = t2.$id, paths: u2 = null, debug: c2 = false } = n2;
return { storage: a2, beforeRestore: r2, afterRestore: l2, serializer: s2, key: ((o2 = e2.key) != null ? o2 : (e3) => e3)(typeof i2 == "string" ? i2 : i2(t2.$id)), paths: u2, debug: c2 };
} catch (e3) {
if (n2.debug) console.error("[pinia-plugin-persistedstate]", e3);
return null;
}
};
}
function jC(e2, { storage: t2, serializer: n2, key: o2, debug: a2 }) {
try {
const a3 = t2 == null ? void 0 : t2.getItem(o2);
if (a3) e2.$patch(n2 == null ? void 0 : n2.deserialize(a3));
} catch (e3) {
if (a2) console.error("[pinia-plugin-persistedstate]", e3);
}
}
function zC(e2, { storage: t2, serializer: n2, key: o2, paths: a2, debug: r2 }) {
try {
const r3 = Array.isArray(a2) ? BC(e2, a2) : e2;
t2.setItem(o2, n2.serialize(r3));
} catch (e3) {
if (r2) console.error("[pinia-plugin-persistedstate]", e3);
}
}
function HC(e2 = {}) {
return (t2) => {
const { auto: n2 = false } = e2;
const { options: { persist: o2 = n2 }, store: a2, pinia: r2 } = t2;
if (!o2) return;
if (!(a2.$id in r2.state.value)) {
const e3 = r2._s.get(a2.$id.replace("__hot:", ""));
if (e3) Promise.resolve().then(() => e3.$persist());
return;
}
const l2 = (Array.isArray(o2) ? o2.map((t3) => PC(t3, e2)) : [PC(o2, e2)]).map(FC(e2, a2)).filter(Boolean);
a2.$persist = () => {
l2.forEach((e3) => {
zC(a2.$state, e3);
});
};
a2.$hydrate = ({ runHooks: e3 = true } = {}) => {
l2.forEach((n3) => {
const { beforeRestore: o3, afterRestore: r3 } = n3;
if (e3) o3 == null ? void 0 : o3(t2);
jC(a2, n3);
if (e3) r3 == null ? void 0 : r3(t2);
});
};
l2.forEach((e3) => {
const { beforeRestore: n3, afterRestore: o3 } = e3;
n3 == null ? void 0 : n3(t2);
jC(a2, e3);
o3 == null ? void 0 : o3(t2);
a2.$subscribe((t3, n4) => {
zC(n4, e3);
}, { detached: true });
});
};
}
const WC = pinia.createPinia();
WC.use(HC({ key: (e2) => `douyu-crx-${e2}` }));
const _YC = class _YC {
constructor() {
__publicField(this, "app", null);
}
init() {
const e2 = document.querySelector("body");
const t2 = document.createElement("div");
t2.id = _YC.appId;
e2.appendChild(t2);
this.app = vue.createApp(TC);
this.app.use(WC);
this.app.mount(`#${_YC.appId}`);
}
};
__publicField(_YC, "appId", "setting-btn");
let YC = _YC;
class UC {
constructor(e2, t2, n2, o2) {
__publicField(this, "styleElement");
__publicField(this, "stopWatcher");
__publicField(this, "pageConfigStore", dC());
this.selector = e2;
this.title = t2;
this.defaultHide = n2;
this.defaultHave = o2;
this.styleElement = document.createElement("style");
this.styleElement.type = "text/css";
}
init() {
const { hideState: e2, addPageConfig: t2 } = this.pageConfigStore;
t2(this.selector, { hide: this.defaultHide, title: `隐藏${this.title}`, have: this.defaultHave });
const n2 = e2[this.selector];
this.stopWatcher = vue.watch(() => n2.hide, (e3) => {
if (e3) {
this.hide();
return;
}
this.show();
}, { immediate: true });
}
hide() {
this.styleElement.textContent = this.getTextContent();
document.head.appendChild(this.styleElement);
}
getTextContent() {
return `${this.selector}{display:none !important;}`;
}
show() {
this.styleElement.remove();
}
markTarget() {
const { infoState: e2 } = this.pageConfigStore;
const t2 = e2[this.selector];
if (!t2.have) {
const e3 = document.querySelector(this.selector);
t2.have = !!e3;
!t2.have && this.stopWatcher && this.stopWatcher();
}
}
}
class KC {
}
class qC extends KC {
}
const GC = [];
function XC(e2) {
GC.push(e2);
}
var ZC = Object.defineProperty;
var JC = Object.getOwnPropertyDescriptor;
var QC = (e2, t2, n2, o2) => {
var a2 = o2 > 1 ? void 0 : o2 ? JC(t2, n2) : t2;
for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2;
if (o2 && a2) ZC(t2, n2, a2);
return a2;
};
let eE = class extends qC {
constructor() {
super(...arguments);
__publicField(this, "name", "背包-送礼时额外添加一项所有数量");
__publicField(this, "matchModuleList", ["GiftHallBanner"]);
__publicField(this, "pattern", /BatchProp\.prototype\.componentWillReceiveProps/);
}
newModuleStr(e2) {
const t2 = e2.match(/BatchProp\.prototype\.componentWillReceiveProps=function componentWillReceiveProps.+?{(.+?)},BatchProp\.prototype/);
if (!t2) {
throw new Error("未提取到componentWillReceiveProps方法");
}
const n2 = t2[1];
return e2.replace(n2, `${n2};var propData=this.state.propData;!propData.batchInfo[""+propData.count]&&(propData.batchInfo[""+propData.count]={batchNum:propData.count,name:"暂不计算亲密度"})`);
}
};
eE = QC([XC], eE);
var tE = Object.defineProperty;
var nE = Object.getOwnPropertyDescriptor;
var oE = (e2, t2, n2, o2) => {
var a2 = o2 > 1 ? void 0 : o2 ? nE(t2, n2) : t2;
for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2;
if (o2 && a2) tE(t2, n2, a2);
return a2;
};
let aE = class extends qC {
constructor() {
super(...arguments);
__publicField(this, "name", "用户面板-弹幕历史按钮");
__publicField(this, "matchModuleList", ["ChatUserCard"]);
__publicField(this, "pattern", /ChatUserCard\.prototype\.getControls/);
}
newModuleStr(e2) {
const t2 = e2.match(/ChatUserCard\.prototype\.getControls=function getControls.+?{(.+?)},ChatUserCard\.prototype/);
if (!t2) {
throw new Error("未提取到getControls方法");
}
const n2 = t2[1];
const o2 = "DOUYUCRX";
return e2.replace(n2, `var resultFn=function(){${n2}};var result=resultFn.call(this);var self=this;result.push({text:"弹幕历史",type:"button",onClick:function onClick(){window['${o2}'].handleDanmuHistory(self.props.chatUserCardData);}});return result;`);
}
};
aE = oE([XC], aE);
var rE = Object.defineProperty;
var lE = Object.getOwnPropertyDescriptor;
var sE = (e2, t2, n2, o2) => {
var a2 = o2 > 1 ? void 0 : o2 ? lE(t2, n2) : t2;
for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2;
if (o2 && a2) rE(t2, n2, a2);
return a2;
};
const iE = "DOUYUCRX";
let uE = class extends qC {
constructor() {
super(...arguments);
__publicField(this, "name", "自动参与抽奖");
__publicField(this, "matchModuleList", ["LotteryContainer"]);
__publicField(this, "pattern", /ULotteryStart\.prototype\.render/);
}
newModuleStr(e2) {
const t2 = e2.match(/ULotteryStart\.prototype\.componentDidMount=function componentDidMount.+?{(.+?)},ULotteryStart\.prototype/);
if (!t2) {
throw new Error("未提取到componentDidMount方法");
}
const n2 = e2.match(/ULotteryStart\.prototype\.componentWillUnmount=function componentWillUnmount.+?{(.+?)},ULotteryStart\.prototype/);
if (!n2) {
throw new Error("未提取到componentWillUnmount方法");
}
const o2 = t2[1];
const a2 = n2[1];
SC();
return e2.replace(o2, `${o2};window['${iE}'].uLotteryStart=this;window.dispatchEvent(new Event('ULotteryStartComponentDidMount'));`).replace(a2, `${a2};window['${iE}'].uLotteryStart=undefined;window.dispatchEvent(new Event('ULotteryStartComponentWillUnmount'))`);
}
};
uE = sE([XC], uE);
var cE = Object.defineProperty;
var dE = Object.getOwnPropertyDescriptor;
var fE = (e2, t2, n2, o2) => {
var a2 = o2 > 1 ? void 0 : o2 ? dE(t2, n2) : t2;
for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2;
if (o2 && a2) cE(t2, n2, a2);
return a2;
};
const pE = "DOUYUCRX";
let vE = class extends qC {
constructor() {
super(...arguments);
__publicField(this, "name", "抽取抽奖面板关闭方法");
__publicField(this, "matchModuleList", ["LotteryContainer"]);
__publicField(this, "pattern", /LotteryContainer-close/);
}
newModuleStr(e2) {
const t2 = e2.match(/LotteryContainer\.prototype\.componentDidMount=function componentDidMount.+?{(.+?)},LotteryContainer\.prototype/);
if (!t2) {
throw new Error("未提取到componentDidMount方法");
}
const n2 = e2.match(/LotteryContainer\.prototype\.componentWillUnmount=function componentWillUnmount.+?{(.+?)},LotteryContainer\.prototype/);
if (!n2) {
throw new Error("未提取到componentWillUnmount方法");
}
const o2 = t2[1];
const a2 = n2[1];
return e2.replace(o2, `${o2};window['${pE}'].lotteryContainer=this;window.dispatchEvent(new Event('LotteryContainerComponentDidMount'));`).replace(a2, `${a2};window['${pE}'].lotteryContainer=undefined;window.dispatchEvent(new Event('LotteryContainerComponentWillUnmount'));`);
}
};
vE = fE([XC], vE);
class mE {
constructor() {
__publicField(this, "modifierList", []);
__publicField(this, "isDefine", false);
__publicField(this, "target");
}
intercept() {
this.initModifierList();
this.interceptDefine();
}
interceptDefine() {
const e2 = this;
Object.defineProperty($S, this.targetName, { get() {
return e2.target;
}, set(t2) {
e2.interceptPush(t2);
}, configurable: true });
}
interceptPush(e2) {
var _a2;
this.target = e2;
const t2 = this;
if (((_a2 = this.target) == null ? void 0 : _a2.push) !== Array.prototype.push && !this.isDefine) {
const e3 = this.target.push;
this.target.push = function(...n2) {
const { modifierList: o2 } = t2;
if (o2.length > 0) {
for (const e4 of n2) {
if (o2.length === 0) {
break;
}
t2.modifyModule(e4);
}
}
return e3.apply(this, n2);
};
this.isDefine = true;
}
}
modifyModule(e2) {
if (e2.length < 2) {
return;
}
const [t2, n2] = e2;
const { modifierList: o2 } = this;
for (let t3 = o2.length - 1; t3 >= 0; t3--) {
const a2 = o2[t3];
if (!this.isMatch(a2, e2)) {
continue;
}
const r2 = Object.keys(n2);
const { pattern: l2 } = a2;
for (const e3 of r2) {
const r3 = n2[e3].toString();
if (!l2.test(r3)) {
continue;
}
try {
n2[e3] = new Function("return " + a2.newModuleStr(r3))();
} catch (e4) {
MS(`执行修改器[${a2.name}]失败!`, e4);
}
o2.splice(t3, 1);
break;
}
}
}
isMatch(e2, t2) {
return true;
}
}
class hE extends mE {
constructor() {
super(...arguments);
__publicField(this, "targetName", "shark_room_jsonp");
}
initModifierList() {
GC.forEach((e2) => this.modifierList.push(new e2()));
}
isMatch(e2, t2) {
const { matchModuleList: n2 } = e2;
if (!n2 || n2.length === 0) {
return true;
}
const [o2] = t2;
const a2 = [...n2];
const r2 = [...o2];
for (let e3 = a2.length - 1; e3 >= 0; e3--) {
let t3 = false;
for (let n3 = r2.length - 1; n3 >= 0; n3--) {
if (r2[n3].startsWith(a2[e3])) {
r2.splice(n3, 1);
a2.splice(e3, 1);
t3 = true;
break;
}
}
if (!t3) {
return false;
}
}
return a2.length === 0;
}
}
const bE = [];
function gE(e2) {
bE.push(e2);
}
var yE = Object.defineProperty;
var wE = Object.getOwnPropertyDescriptor;
var xE = (e2, t2, n2, o2) => {
var a2 = o2 > 1 ? void 0 : o2 ? wE(t2, n2) : t2;
for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2;
if (o2 && a2) yE(t2, n2, a2);
return a2;
};
let kE = class extends KC {
constructor() {
super(...arguments);
__publicField(this, "name", "自动抢宝箱");
__publicField(this, "pattern", /prototype\.countDownView/);
}
newModuleStr(e2) {
const t2 = e2.match(/\.prototype\.countDownView=function.+?{(.+?)},[a-zA-Z]\.prototype/);
if (!t2) {
throw new Error("未提取到countDownView方法");
}
const n2 = t2[1];
const o2 = n2.match(/var (.+?)=this,.+?({statusText:"领取",.+?}\),.+?)\)/);
if (!o2) {
throw new Error("未提取到countDownView方法的目标代码");
}
const a2 = o2[1];
const r2 = o2[2];
const l2 = "DOUYUCRX";
bC();
return e2.replace(n2, n2.replace(r2, `${r2},window['${l2}'].redPacketEnabled&&${a2}.treasureService.drawTreasure(${a2}.props.treasureData.data[0],"init")`));
}
};
kE = xE([gE], kE);
class SE extends mE {
constructor() {
super(...arguments);
__publicField(this, "targetName", "shark-microlive-player-aside-jsonp");
}
initModifierList() {
bE.forEach((e2) => this.modifierList.push(new e2()));
}
}
const CE = [];
function EE(e2) {
CE.push(e2);
}
var ME = Object.defineProperty;
var OE = Object.getOwnPropertyDescriptor;
var _E = (e2, t2, n2, o2) => {
var a2 = o2 > 1 ? void 0 : o2 ? OE(t2, n2) : t2;
for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2;
if (o2 && a2) ME(t2, n2, a2);
return a2;
};
let $E = class extends KC {
constructor() {
super(...arguments);
__publicField(this, "name", "飘屏弹幕-加一");
__publicField(this, "pattern", /prototype\.addDzJyButton=.+isOpenFireFBComment/);
}
newModuleStr(e2) {
const t2 = e2.match(/([a-z])\.prototype\.addDzJyButton=.+?{(.+?)},\1\.prototype/);
if (!t2) {
throw new Error("未提取到addDzJyButton方法");
}
const n2 = t2[2];
const o2 = n2.match(/if\(([a-zA-Z])&&\1\.isOpenFireFBComment\)/);
if (!o2) {
throw new Error("未检测到addDzJyButton方法的目标代码");
}
return e2.replace(n2, n2.replace(o2[0], "if(!0)"));
}
};
$E = _E([EE], $E);
var LE = Object.defineProperty;
var AE = Object.getOwnPropertyDescriptor;
var DE = (e2, t2, n2, o2) => {
var a2 = o2 > 1 ? void 0 : o2 ? AE(t2, n2) : t2;
for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2;
if (o2 && a2) LE(t2, n2, a2);
return a2;
};
let RE = class extends KC {
constructor() {
super(...arguments);
__publicField(this, "name", "飘屏弹幕-弹幕历史按钮");
__publicField(this, "pattern", /复制.+举报.+屏蔽.+添加关键词屏蔽/);
}
newModuleStr(e2) {
const t2 = e2.match(/([a-z])\.prototype\.clickDanmudiv=.+?{(.+?)},\1\.prototype/);
if (!t2) {
throw new Error("未提取到clickDanmudiv方法");
}
const n2 = t2[2];
const o2 = n2.match(/[a-z]\.target==this\.CloseButton\?this\.CloseButtonHandle\(\):/);
if (!o2) {
throw new Error("未检测到clickDanmudiv方法的目标代码");
}
const a2 = e2.match(/[a-z]\.prototype\.render=(.{20,50}showReport.+?复制.+?举报.+?屏蔽.+?添加关键词屏蔽.+?),(?=[a-z]\.prototype)/);
if (!a2) {
throw new Error("未提取到render方法");
}
const r2 = a2[1];
const l2 = r2.match(/[a-zA-z]\.[a-zA-z]\.createElement\("div",{className:([a-zA-Z]\.[a-zA-Z]\.ReportButton).+?(ReportButtonHandle).+?(ReportButton).+?(举报).+?\)/);
if (!l2) {
throw new Error("未提取到render方法的目标代码");
}
const s2 = l2[0].replace(l2[1], '"danmu-btn-modifier"').replace(l2[2], "HistoryButtonHandle").replace(l2[3], "HistoryButton").replace(l2[4], "弹幕历史");
const i2 = r2.match(/\?[a-zA-z]\.[a-zA-z]\.createElement\("div",(.+?)\):null/);
if (!i2) {
throw new Error("未提取到render方法的目标代码");
}
const u2 = i2[1];
const c2 = document.createElement("style");
c2.type = "text/css";
c2.textContent = `.danmu-btn-modifier{position:absolute;text-align:center;line-height:27px;margin:0 auto;margin-top:265px;margin-left:14px;height:25px;width:204px;color:#777;cursor:pointer;border:1px solid #d7d7d7;border-radius:15px;}.danmu-btn-modifier:hover{color:#fff;background:#ef843d;}[class*="danmudiv"]{height:300px;background-color:#fff;background-image:none !important;border:1px solid #d7d7d7;border-radius:5px;}`;
document.head.appendChild(c2);
const d2 = "DOUYUCRX";
return e2.replace(`${r2}`, `${r2.replace(u2, `${u2},${s2}`)},e.prototype.HistoryButtonHandle=function(){var danmuObj=this.props.danmuobject.toJS();window['${d2}'].handleDanmuHistory({rel:parseInt(danmuObj.uid),nickName:danmuObj.author,avatar:''});}`).replace(n2, `${o2[0].replaceAll("Close", "History")}${n2}`);
}
};
RE = DE([EE], RE);
class TE extends mE {
constructor() {
super(...arguments);
__publicField(this, "targetName", "sharkLivePlayerJsonp");
}
initModifierList() {
CE.forEach((e2) => this.modifierList.push(new e2()));
}
}
const NE = [];
function PE(e2) {
NE.push(e2);
}
var IE = Object.defineProperty;
var VE = Object.getOwnPropertyDescriptor;
var BE = (e2, t2, n2, o2) => {
var a2 = o2 > 1 ? void 0 : o2 ? VE(t2, n2) : t2;
for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2;
if (o2 && a2) IE(t2, n2, a2);
return a2;
};
let FE = class extends KC {
constructor() {
super(...arguments);
__publicField(this, "name", "飘屏弹幕-屏蔽TA-解除最多20个限制");
__publicField(this, "pattern", /PlayerServices\.prototype\.setFilterWords/);
}
newModuleStr(e2) {
const t2 = e2.match(/PlayerServices\.prototype\.setFilterWords=function setFilterWords.+?{(.+?)},PlayerServices\.prototype/);
if (!t2) {
throw new Error("未提取到setFilterWords方法");
}
const n2 = t2[1];
const o2 = n2.match(/if\([a-zA-Z]\.length>=20\)/);
if (!o2) {
throw new Error("未检测到目标代码");
}
return e2.replace(n2, n2.replace(o2[0], "if(!1)"));
}
};
FE = BE([PE], FE);
class jE {
constructor() {
__publicField(this, "modifierList", []);
__publicField(this, "target", null);
}
intercept() {
this.initModifierList();
this.interceptDefine();
}
initModifierList() {
NE.forEach((e2) => this.modifierList.push(new e2()));
}
interceptDefine() {
const e2 = this;
Object.defineProperty($S, "_room_common_", { get() {
return e2.target;
}, set(t2) {
e2.modifyProperty(t2);
}, configurable: true });
}
modifyProperty(e2) {
this.target = e2;
const { modifierList: t2 } = this;
if (t2.length === 0) {
return;
}
Object.keys(e2.m).forEach((e3) => this.modifyModule(e3));
}
modifyModule(e2) {
const { modifierList: t2 } = this;
if (t2.length === 0) {
return;
}
const n2 = this.target;
const o2 = n2.m[e2];
const a2 = o2.toString();
for (let o3 = t2.length - 1; o3 >= 0; o3--) {
const r2 = t2[o3];
if (!r2.pattern.test(a2)) {
continue;
}
const l2 = r2.newModuleStr(a2);
if (l2) {
n2.m[e2] = new Function("return " + l2)();
}
t2.splice(o3, 1);
break;
}
}
}
class zE {
constructor() {
__publicField(this, "interceptors", [new jE(), new hE(), new TE(), new SE()]);
}
init() {
this.interceptors.forEach((e2) => {
new Promise(() => {
e2.intercept();
});
});
}
}
const HE = pinia.defineStore("room-info", () => {
const e2 = document.documentElement.outerHTML.match(/\$ROOM\.room_id =(.+?);/);
const t2 = vue.ref({ rid: e2 ? e2[1].trim() : "" });
return { state: t2 };
});
class WE {
constructor() {
__publicField(this, "pageSize", 50);
__publicField(this, "relId", 268);
__publicField(this, "executing", false);
__publicField(this, "today", lh().format("YYYY-MM-DD"));
__publicField(this, "roomInfoStore", HE());
__publicField(this, "lightStickStore", QS());
}
init() {
const { state: e2 } = this.lightStickStore;
const t2 = async () => {
if (this.executing) {
return;
}
this.executing = true;
try {
if (!e2.enabled || e2.configList.length < 7 || e2.completeDay === this.today) {
return;
}
const t3 = lh(this.today).day();
const n2 = t3 === 0 ? 6 : t3 - 1;
const o2 = e2.configList[n2];
if (!o2) {
elementPlus.ElMessage({ message: "未读取到[自动送荧光棒]配置,请先配置[自动送荧光棒]", type: "warning", plain: true });
return;
}
const a2 = await tC();
if (a2.length !== o2.length) {
elementPlus.ElMessage({ message: "粉丝牌发生变化,[自动送荧光棒]需重新配置", type: "warning", plain: true });
return;
}
const r2 = /* @__PURE__ */ new Set();
a2.forEach((e3) => r2.add(e3.rid));
for (const e3 of o2) {
if (!r2.has(e3.rid)) {
elementPlus.ElMessage({ message: "粉丝牌发生变化,[自动送荧光棒]需重新配置", type: "warning", plain: true });
return;
}
r2.delete(e3.rid);
}
if (r2.size > 0) {
elementPlus.ElMessage({ message: "粉丝牌发生变化,[自动送荧光棒]需重新配置", type: "warning", plain: true });
return;
}
const l2 = lh(this.today).unix();
const s2 = lh(this.today).add(1, "day").unix() - 1;
const i2 = /* @__PURE__ */ new Map();
let u2 = this.pageSize;
let c2 = 1;
while (u2 === this.pageSize) {
const { response: { data: { total: e3, details: t4 } } } = await nC({ beginTime: l2, endTime: s2, pageSize: this.pageSize, pageNum: c2++ });
u2 = e3;
t4.forEach((e4) => {
const t5 = e4.roomId + "";
const n3 = i2.get(t5);
if (e4.relId !== this.relId) {
return;
}
if (!n3) {
i2.set(t5, e4.number);
return;
}
i2.set(t5, e4.number + n3);
});
}
let d2 = 0;
const f2 = [];
for (const e3 of o2) {
const t4 = i2.get(e3.rid);
if (!t4) {
d2 += e3.count;
f2.push({ rid: e3.rid, count: e3.count });
continue;
}
const n3 = e3.count - t4;
if (n3 > 0) {
d2 += n3;
f2.push({ rid: e3.rid, count: n3 });
}
}
if (d2 === 0) {
elementPlus.ElMessage({ message: "无需执行[自动送荧光棒],当日赠送的荧光棒已满足配置", type: "success", plain: true });
e2.completeDay = this.today;
return;
}
const { response: { data: { list: p2 } } } = await oC({ rid: this.roomInfoStore.state.rid });
const v2 = p2.find((e3) => e3.id === this.relId);
if (!v2 && i2.size > 0 || v2 && v2.count < d2) {
elementPlus.ElMessage({ message: "荧光棒不足,视作当日[自动送荧光棒]已完成", type: "warning", plain: true });
e2.completeDay = this.today;
return;
}
if (!v2) {
return;
}
for (const e3 of f2) {
await aC({ propId: this.relId, roomId: e3.rid, propCount: e3.count });
}
elementPlus.ElMessage({ message: "[自动送荧光棒]已完成", type: "success", plain: true });
e2.completeDay = this.today;
} finally {
this.executing = false;
}
};
vue.watch(() => e2.enabled, t2, { immediate: true });
vue.watch(() => e2.configList, t2, { immediate: true });
t2();
}
}
class YE extends UC {
getTextContent() {
return `${super.getTextContent()} #js-player-asideMain{top:0}`;
}
}
class UE {
constructor() {
__publicField(this, "hideCssInitializers", [new UC(".PlayerToolbar", "直播画面底部所有按钮", false, true), new UC(".layout-Player-rank", "排行榜", false, true), new UC("#js-barrage-extend-container", "入场提示", false, true), new UC(`[class*="watermark"]`, "左下角房间号水印", false, false), new UC(".PubgInfo", "PUBG战绩统计", true, false), new UC("#webmActKefuWeidget", "活动客服", true, false), new UC(".AnchorPocketTips", "亲密度Buff提醒", false, false), new UC(".IconCardAdBoundsBox", "直播画面右下角广告", true, false), new UC("#js-room-activity", "右侧活动浮窗", true, false), new UC("#js-room-top-banner", "顶部大广告", true, false), new UC(".CloseVideoPlayerAd", "未开播时视频广告", true, true), new YE("#js-player-asideTopSuspension", "排行榜顶部广告", true, false)]);
__publicField(this, "pageConfigStore", pinia.storeToRefs(dC()));
}
init() {
this.hideCssInitializers.forEach((e2) => e2.init());
}
markTarget() {
this.hideCssInitializers.forEach((e3) => e3.markTarget());
const { loading: e2 } = this.pageConfigStore;
e2.value = false;
}
}
class KE {
constructor() {
__publicField(this, "src", "https://hm.baidu.com/hm.js?5c04e81d1fc372b0efa06e8c1b711042");
}
init() {
const e2 = document.createElement("script");
e2.src = this.src;
const t2 = document.getElementsByTagName("script")[0];
t2 && t2.parentNode && t2.parentNode.insertBefore(e2, t2);
}
}
const qE = "DOUYUCRX";
$S[qE] = {};
async function GE() {
new YC().init();
const e2 = new UE();
[new zE(), new qS(), new KE(), new WE(), e2].forEach((e3) => {
new Promise(() => {
e3.init();
});
});
await new Ce().observe();
e2.markTarget();
}
GE();
}
});
require_main_001();
})(Vue, ElementPlus, Qs, VueDemi, Pinia);