// ==UserScript==
// @name douyu-crx
// @namespace npm/douyu-crx
// @version 1.13
// @author monkey
// @description 斗鱼插件
// @icon https://vitejs.dev/logo.svg
// @match *://*.douyu.com/0*
// @match *://*.douyu.com/1*
// @match *://*.douyu.com/2*
// @match *://*.douyu.com/3*
// @match *://*.douyu.com/4*
// @match *://*.douyu.com/5*
// @match *://*.douyu.com/6*
// @match *://*.douyu.com/7*
// @match *://*.douyu.com/8*
// @match *://*.douyu.com/9*
// @match *://*.douyu.com/topic/*
// @exclude *://*.douyu.com/topic/h5/*
// @require https://lib.baomitu.com/vue/3.4.37/vue.global.prod.js
// @require data:application/javascript,%3Bwindow.Vue%3DVue%3B
// @require https://lib.baomitu.com/qs/6.13.0/qs.min.js
// @require https://lib.baomitu.com/vue-demi/0.14.10/index.iife.min.js
// @require https://lib.baomitu.com/pinia/2.2.1/pinia.iife.min.js
// @require https://lib.baomitu.com/dayjs/1.11.12/dayjs.min.js
// @require https://cdn.jsdelivr.net/npm/[email protected]/dist/system.min.js
// @require https://cdn.jsdelivr.net/npm/[email protected]/dist/extras/named-register.min.js
// @require data:application/javascript,%3B(typeof%20System!%3D'undefined')%26%26(System%3Dnew%20System.constructor())%3B
// @connect doseeing.com
// @connect douyu.com
// @grant GM_addStyle
// @grant GM_registerMenuCommand
// @grant GM_xmlhttpRequest
// @grant unsafeWindow
// ==/UserScript==
(e=>{if(typeof GM_addStyle=="function"){GM_addStyle(e);return}const r=document.createElement("style");r.textContent=e,document.head.append(r)})(' @charset "UTF-8";*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }.visible{visibility:visible}.fixed{position:fixed}.absolute{position:absolute}.top-0{top:0}.z-\\[10000\\]{z-index:10000}.mb-4{margin-bottom:1rem}.ml-12{margin-left:3rem}.ml-2{margin-left:.5rem}.ml-5{margin-left:1.25rem}.flex{display:flex}.h-16{height:4rem}.h-20{height:5rem}.h-\\[30px\\]{height:30px}.h-\\[58vh\\]{height:58vh}.h-\\[80px\\]{height:80px}.w-16{width:4rem}.w-20{width:5rem}.w-56{width:14rem}.w-\\[254px\\]{width:254px}.w-\\[30px\\]{width:30px}.w-full{width:100%}.flex-1{flex:1 1 0%}.flex-none{flex:none}.transform{transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.cursor-default{cursor:default}.cursor-move{cursor:move}.cursor-pointer{cursor:pointer}.resize{resize:both}.flex-wrap{flex-wrap:wrap}.items-start{align-items:flex-start}.items-center{align-items:center}.justify-end{justify-content:flex-end}.justify-center{justify-content:center}.justify-between{justify-content:space-between}.overflow-auto{overflow:auto}.rounded-\\[6px\\]{border-radius:6px}.rounded-md{border-radius:.375rem}.rounded-xl{border-radius:.75rem}.border{border-width:1px}.p-\\[20px\\]{padding:20px}.pt-\\[5px\\]{padding-top:5px}.text-center{text-align:center}.text-3xl{font-size:1.875rem;line-height:2.25rem}.text-\\[14px\\]{font-size:14px}.text-xl{font-size:1.25rem;line-height:1.75rem}.font-black{font-weight:900}.font-bold{font-weight:700}.text-slate-400{--tw-text-opacity: 1;color:rgb(148 163 184 / var(--tw-text-opacity))}.text-white{--tw-text-opacity: 1;color:rgb(255 255 255 / var(--tw-text-opacity))}:root{--el-color-white: #ffffff;--el-color-black: #000000;--el-color-primary-rgb: 255, 119, 0;--el-color-success-rgb: 103, 194, 58;--el-color-warning-rgb: 230, 162, 60;--el-color-danger-rgb: 245, 108, 108;--el-color-error-rgb: 245, 108, 108;--el-color-info-rgb: 144, 147, 153;--el-font-size-extra-large: 20px;--el-font-size-large: 18px;--el-font-size-medium: 16px;--el-font-size-base: 14px;--el-font-size-small: 13px;--el-font-size-extra-small: 12px;--el-font-family: "Helvetica Neue", Helvetica, "PingFang SC", "Hiragino Sans GB", "Microsoft YaHei", "\u5FAE\u8F6F\u96C5\u9ED1", Arial, sans-serif;--el-font-weight-primary: 500;--el-font-line-height-primary: 24px;--el-index-normal: 1;--el-index-top: 1000;--el-index-popper: 2000;--el-border-radius-base: 4px;--el-border-radius-small: 2px;--el-border-radius-round: 20px;--el-border-radius-circle: 100%;--el-transition-duration: .3s;--el-transition-duration-fast: .2s;--el-transition-function-ease-in-out-bezier: cubic-bezier(.645, .045, .355, 1);--el-transition-function-fast-bezier: cubic-bezier(.23, 1, .32, 1);--el-transition-all: all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade: opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade: transform var(--el-transition-duration) var(--el-transition-function-fast-bezier), opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear: opacity var(--el-transition-duration-fast) linear;--el-transition-border: border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow: box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color: color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large: 40px;--el-component-size: 32px;--el-component-size-small: 24px;color-scheme:light;--el-color-primary: #f70;--el-color-primary-light-3: #ffa04d;--el-color-primary-light-5: #ffbb80;--el-color-primary-light-7: #ffd6b3;--el-color-primary-light-8: #ffe4cc;--el-color-primary-light-9: #fff1e6;--el-color-primary-dark-2: #cc5f00;--el-color-success: #67c23a;--el-color-success-light-3: #95d475;--el-color-success-light-5: #b3e19d;--el-color-success-light-7: #d1edc4;--el-color-success-light-8: #e1f3d8;--el-color-success-light-9: #f0f9eb;--el-color-success-dark-2: #529b2e;--el-color-warning: #e6a23c;--el-color-warning-light-3: #eebe77;--el-color-warning-light-5: #f3d19e;--el-color-warning-light-7: #f8e3c5;--el-color-warning-light-8: #faecd8;--el-color-warning-light-9: #fdf6ec;--el-color-warning-dark-2: #b88230;--el-color-danger: #f56c6c;--el-color-danger-light-3: #f89898;--el-color-danger-light-5: #fab6b6;--el-color-danger-light-7: #fcd3d3;--el-color-danger-light-8: #fde2e2;--el-color-danger-light-9: #fef0f0;--el-color-danger-dark-2: #c45656;--el-color-error: #f56c6c;--el-color-error-light-3: #f89898;--el-color-error-light-5: #fab6b6;--el-color-error-light-7: #fcd3d3;--el-color-error-light-8: #fde2e2;--el-color-error-light-9: #fef0f0;--el-color-error-dark-2: #c45656;--el-color-info: #909399;--el-color-info-light-3: #b1b3b8;--el-color-info-light-5: #c8c9cc;--el-color-info-light-7: #dedfe0;--el-color-info-light-8: #e9e9eb;--el-color-info-light-9: #f4f4f5;--el-color-info-dark-2: #73767a;--el-bg-color: #ffffff;--el-bg-color-page: #f2f3f5;--el-bg-color-overlay: #ffffff;--el-text-color-primary: #303133;--el-text-color-regular: #606266;--el-text-color-secondary: #909399;--el-text-color-placeholder: #a8abb2;--el-text-color-disabled: #c0c4cc;--el-border-color: #dcdfe6;--el-border-color-light: #e4e7ed;--el-border-color-lighter: #ebeef5;--el-border-color-extra-light: #f2f6fc;--el-border-color-dark: #d4d7de;--el-border-color-darker: #cdd0d6;--el-fill-color: #f0f2f5;--el-fill-color-light: #f5f7fa;--el-fill-color-lighter: #fafafa;--el-fill-color-extra-light: #fafcff;--el-fill-color-dark: #ebedf0;--el-fill-color-darker: #e6e8eb;--el-fill-color-blank: #ffffff;--el-box-shadow: 0px 12px 32px 4px rgba(0, 0, 0, .04), 0px 8px 20px rgba(0, 0, 0, .08);--el-box-shadow-light: 0px 0px 12px rgba(0, 0, 0, .12);--el-box-shadow-lighter: 0px 0px 6px rgba(0, 0, 0, .12);--el-box-shadow-dark: 0px 16px 48px 16px rgba(0, 0, 0, .08), 0px 12px 32px rgba(0, 0, 0, .12), 0px 8px 16px -8px rgba(0, 0, 0, .16);--el-disabled-bg-color: var(--el-fill-color-light);--el-disabled-text-color: var(--el-text-color-placeholder);--el-disabled-border-color: var(--el-border-color-light);--el-overlay-color: rgba(0, 0, 0, .8);--el-overlay-color-light: rgba(0, 0, 0, .7);--el-overlay-color-lighter: rgba(0, 0, 0, .5);--el-mask-color: rgba(255, 255, 255, .9);--el-mask-color-extra-light: rgba(255, 255, 255, .3);--el-border-width: 1px;--el-border-style: solid;--el-border-color-hover: var(--el-text-color-disabled);--el-border: var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey: var(--el-border-color)}.el-icon-loading{animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.el-icon{--color: inherit;height:1em;width:1em;line-height:1em;display:inline-flex;justify-content:center;align-items:center;position:relative;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}.el-overlay{position:fixed;top:0;right:0;bottom:0;left:0;z-index:2000;height:100%;background-color:var(--el-overlay-color-lighter);overflow:auto}.el-overlay .el-overlay-root{height:0}.el-divider{position:relative}.el-divider--horizontal{display:block;height:1px;width:100%;margin:24px 0;border-top:1px var(--el-border-color) var(--el-border-style)}.el-divider--vertical{display:inline-block;width:1px;height:1em;margin:0 8px;vertical-align:middle;position:relative;border-left:1px var(--el-border-color) var(--el-border-style)}.el-divider__text{position:absolute;background-color:var(--el-bg-color);padding:0 20px;font-weight:500;color:var(--el-text-color-primary);font-size:14px}.el-divider__text.is-left{left:20px;transform:translateY(-50%)}.el-divider__text.is-center{left:50%;transform:translate(-50%) translateY(-50%)}.el-divider__text.is-right{right:20px;transform:translateY(-50%)}:root{--el-loading-spinner-size: 42px;--el-loading-fullscreen-spinner-size: 50px}.el-loading-parent--relative{position:relative!important}.el-loading-parent--hidden{overflow:hidden!important}.el-loading-mask{position:absolute;z-index:2000;background-color:var(--el-mask-color);margin:0;top:0;right:0;bottom:0;left:0;transition:opacity var(--el-transition-duration)}.el-loading-mask.is-fullscreen{position:fixed}.el-loading-mask.is-fullscreen .el-loading-spinner{margin-top:calc((0px - var(--el-loading-fullscreen-spinner-size)) / 2)}.el-loading-mask.is-fullscreen .el-loading-spinner .circular{height:var(--el-loading-fullscreen-spinner-size);width:var(--el-loading-fullscreen-spinner-size)}.el-loading-spinner{top:50%;margin-top:calc((0px - var(--el-loading-spinner-size)) / 2);width:100%;text-align:center;position:absolute}.el-loading-spinner .el-loading-text{color:var(--el-color-primary);margin:3px 0;font-size:14px}.el-loading-spinner .circular{display:inline;height:var(--el-loading-spinner-size);width:var(--el-loading-spinner-size);animation:loading-rotate 2s linear infinite}.el-loading-spinner .path{animation:loading-dash 1.5s ease-in-out infinite;stroke-dasharray:90,150;stroke-dashoffset:0;stroke-width:2;stroke:var(--el-color-primary);stroke-linecap:round}.el-loading-spinner i{color:var(--el-color-primary)}.el-loading-fade-enter-from,.el-loading-fade-leave-to{opacity:0}@keyframes loading-rotate{to{transform:rotate(360deg)}}@keyframes loading-dash{0%{stroke-dasharray:1,200;stroke-dashoffset:0}50%{stroke-dasharray:90,150;stroke-dashoffset:-40px}to{stroke-dasharray:90,150;stroke-dashoffset:-120px}}.el-button{--el-button-font-weight: var(--el-font-weight-primary);--el-button-border-color: var(--el-border-color);--el-button-bg-color: var(--el-fill-color-blank);--el-button-text-color: var(--el-text-color-regular);--el-button-disabled-text-color: var(--el-disabled-text-color);--el-button-disabled-bg-color: var(--el-fill-color-blank);--el-button-disabled-border-color: var(--el-border-color-light);--el-button-divide-border-color: rgba(255, 255, 255, .5);--el-button-hover-text-color: var(--el-color-primary);--el-button-hover-bg-color: var(--el-color-primary-light-9);--el-button-hover-border-color: var(--el-color-primary-light-7);--el-button-active-text-color: var(--el-button-hover-text-color);--el-button-active-border-color: var(--el-color-primary);--el-button-active-bg-color: var(--el-button-hover-bg-color);--el-button-outline-color: var(--el-color-primary-light-5);--el-button-hover-link-text-color: var(--el-color-info);--el-button-active-color: var(--el-text-color-primary);display:inline-flex;justify-content:center;align-items:center;line-height:1;height:32px;white-space:nowrap;cursor:pointer;color:var(--el-button-text-color);text-align:center;box-sizing:border-box;outline:none;transition:.1s;font-weight:var(--el-button-font-weight);-webkit-user-select:none;user-select:none;vertical-align:middle;-webkit-appearance:none;background-color:var(--el-button-bg-color);border:var(--el-border);border-color:var(--el-button-border-color)}.el-button:hover{color:var(--el-button-hover-text-color);border-color:var(--el-button-hover-border-color);background-color:var(--el-button-hover-bg-color);outline:none}.el-button:active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:none}.el-button:focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button>span{display:inline-flex;align-items:center}.el-button+.el-button{margin-left:12px}.el-button{padding:8px 15px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button.is-round{padding:8px 15px}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-hover-text-color: var(--el-color-primary);--el-button-hover-bg-color: var(--el-fill-color-blank);--el-button-hover-border-color: var(--el-color-primary)}.el-button.is-active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:none}.el-button.is-disabled,.el-button.is-disabled:hover{color:var(--el-button-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color);border-color:var(--el-button-disabled-border-color)}.el-button.is-loading{position:relative;pointer-events:none}.el-button.is-loading:before{z-index:1;pointer-events:none;content:"";position:absolute;left:-1px;top:-1px;right:-1px;bottom:-1px;border-radius:inherit;background-color:var(--el-mask-color-extra-light)}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{width:32px;border-radius:50%;padding:8px}.el-button.is-text{color:var(--el-button-text-color);border:0 solid transparent;background-color:transparent}.el-button.is-text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important}.el-button.is-text:not(.is-disabled):hover{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled):focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button.is-text:not(.is-disabled):active{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled).is-has-bg:hover{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg:active{background-color:var(--el-fill-color-dark)}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button.is-link{border-color:transparent;color:var(--el-button-text-color);background:transparent;padding:2px;height:auto}.el-button.is-link:hover{color:var(--el-button-hover-link-text-color)}.el-button.is-link.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button.is-link:not(.is-disabled):hover{border-color:transparent;background-color:transparent}.el-button.is-link:not(.is-disabled):active{color:var(--el-button-active-color);border-color:transparent;background-color:transparent}.el-button--text{border-color:transparent;background:transparent;color:var(--el-color-primary);padding-left:0;padding-right:0}.el-button--text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button--text:not(.is-disabled):hover{color:var(--el-color-primary-light-3);border-color:transparent;background-color:transparent}.el-button--text:not(.is-disabled):active{color:var(--el-color-primary-dark-2);border-color:transparent;background-color:transparent}.el-button__link--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--primary{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-primary);--el-button-border-color: var(--el-color-primary);--el-button-outline-color: var(--el-color-primary-light-5);--el-button-active-color: var(--el-color-primary-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-primary-light-5);--el-button-hover-bg-color: var(--el-color-primary-light-3);--el-button-hover-border-color: var(--el-color-primary-light-3);--el-button-active-bg-color: var(--el-color-primary-dark-2);--el-button-active-border-color: var(--el-color-primary-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-primary-light-5);--el-button-disabled-border-color: var(--el-color-primary-light-5)}.el-button--primary.is-plain,.el-button--primary.is-text,.el-button--primary.is-link{--el-button-text-color: var(--el-color-primary);--el-button-bg-color: var(--el-color-primary-light-9);--el-button-border-color: var(--el-color-primary-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-primary);--el-button-hover-border-color: var(--el-color-primary);--el-button-active-text-color: var(--el-color-white)}.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:hover,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-text.is-disabled,.el-button--primary.is-text.is-disabled:hover,.el-button--primary.is-text.is-disabled:focus,.el-button--primary.is-text.is-disabled:active,.el-button--primary.is-link.is-disabled,.el-button--primary.is-link.is-disabled:hover,.el-button--primary.is-link.is-disabled:focus,.el-button--primary.is-link.is-disabled:active{color:var(--el-color-primary-light-5);background-color:var(--el-color-primary-light-9);border-color:var(--el-color-primary-light-8)}.el-button--success{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-success);--el-button-border-color: var(--el-color-success);--el-button-outline-color: var(--el-color-success-light-5);--el-button-active-color: var(--el-color-success-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-success-light-5);--el-button-hover-bg-color: var(--el-color-success-light-3);--el-button-hover-border-color: var(--el-color-success-light-3);--el-button-active-bg-color: var(--el-color-success-dark-2);--el-button-active-border-color: var(--el-color-success-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-success-light-5);--el-button-disabled-border-color: var(--el-color-success-light-5)}.el-button--success.is-plain,.el-button--success.is-text,.el-button--success.is-link{--el-button-text-color: var(--el-color-success);--el-button-bg-color: var(--el-color-success-light-9);--el-button-border-color: var(--el-color-success-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-success);--el-button-hover-border-color: var(--el-color-success);--el-button-active-text-color: var(--el-color-white)}.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:hover,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-text.is-disabled,.el-button--success.is-text.is-disabled:hover,.el-button--success.is-text.is-disabled:focus,.el-button--success.is-text.is-disabled:active,.el-button--success.is-link.is-disabled,.el-button--success.is-link.is-disabled:hover,.el-button--success.is-link.is-disabled:focus,.el-button--success.is-link.is-disabled:active{color:var(--el-color-success-light-5);background-color:var(--el-color-success-light-9);border-color:var(--el-color-success-light-8)}.el-button--warning{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-warning);--el-button-border-color: var(--el-color-warning);--el-button-outline-color: var(--el-color-warning-light-5);--el-button-active-color: var(--el-color-warning-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-warning-light-5);--el-button-hover-bg-color: var(--el-color-warning-light-3);--el-button-hover-border-color: var(--el-color-warning-light-3);--el-button-active-bg-color: var(--el-color-warning-dark-2);--el-button-active-border-color: var(--el-color-warning-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-warning-light-5);--el-button-disabled-border-color: var(--el-color-warning-light-5)}.el-button--warning.is-plain,.el-button--warning.is-text,.el-button--warning.is-link{--el-button-text-color: var(--el-color-warning);--el-button-bg-color: var(--el-color-warning-light-9);--el-button-border-color: var(--el-color-warning-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-warning);--el-button-hover-border-color: var(--el-color-warning);--el-button-active-text-color: var(--el-color-white)}.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:hover,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-text.is-disabled,.el-button--warning.is-text.is-disabled:hover,.el-button--warning.is-text.is-disabled:focus,.el-button--warning.is-text.is-disabled:active,.el-button--warning.is-link.is-disabled,.el-button--warning.is-link.is-disabled:hover,.el-button--warning.is-link.is-disabled:focus,.el-button--warning.is-link.is-disabled:active{color:var(--el-color-warning-light-5);background-color:var(--el-color-warning-light-9);border-color:var(--el-color-warning-light-8)}.el-button--danger{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-danger);--el-button-border-color: var(--el-color-danger);--el-button-outline-color: var(--el-color-danger-light-5);--el-button-active-color: var(--el-color-danger-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-danger-light-5);--el-button-hover-bg-color: var(--el-color-danger-light-3);--el-button-hover-border-color: var(--el-color-danger-light-3);--el-button-active-bg-color: var(--el-color-danger-dark-2);--el-button-active-border-color: var(--el-color-danger-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-danger-light-5);--el-button-disabled-border-color: var(--el-color-danger-light-5)}.el-button--danger.is-plain,.el-button--danger.is-text,.el-button--danger.is-link{--el-button-text-color: var(--el-color-danger);--el-button-bg-color: var(--el-color-danger-light-9);--el-button-border-color: var(--el-color-danger-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-danger);--el-button-hover-border-color: var(--el-color-danger);--el-button-active-text-color: var(--el-color-white)}.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:hover,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-text.is-disabled,.el-button--danger.is-text.is-disabled:hover,.el-button--danger.is-text.is-disabled:focus,.el-button--danger.is-text.is-disabled:active,.el-button--danger.is-link.is-disabled,.el-button--danger.is-link.is-disabled:hover,.el-button--danger.is-link.is-disabled:focus,.el-button--danger.is-link.is-disabled:active{color:var(--el-color-danger-light-5);background-color:var(--el-color-danger-light-9);border-color:var(--el-color-danger-light-8)}.el-button--info{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-info);--el-button-border-color: var(--el-color-info);--el-button-outline-color: var(--el-color-info-light-5);--el-button-active-color: var(--el-color-info-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-info-light-5);--el-button-hover-bg-color: var(--el-color-info-light-3);--el-button-hover-border-color: var(--el-color-info-light-3);--el-button-active-bg-color: var(--el-color-info-dark-2);--el-button-active-border-color: var(--el-color-info-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-info-light-5);--el-button-disabled-border-color: var(--el-color-info-light-5)}.el-button--info.is-plain,.el-button--info.is-text,.el-button--info.is-link{--el-button-text-color: var(--el-color-info);--el-button-bg-color: var(--el-color-info-light-9);--el-button-border-color: var(--el-color-info-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-info);--el-button-hover-border-color: var(--el-color-info);--el-button-active-text-color: var(--el-color-white)}.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:hover,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-text.is-disabled,.el-button--info.is-text.is-disabled:hover,.el-button--info.is-text.is-disabled:focus,.el-button--info.is-text.is-disabled:active,.el-button--info.is-link.is-disabled,.el-button--info.is-link.is-disabled:hover,.el-button--info.is-link.is-disabled:focus,.el-button--info.is-link.is-disabled:active{color:var(--el-color-info-light-5);background-color:var(--el-color-info-light-9);border-color:var(--el-color-info-light-8)}.el-button--large{--el-button-size: 40px;height:var(--el-button-size)}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large{padding:12px 19px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{width:var(--el-button-size);padding:12px}.el-button--small{--el-button-size: 24px;height:var(--el-button-size)}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small{padding:5px 11px;font-size:12px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{width:var(--el-button-size);padding:5px}:root{--el-popup-modal-bg-color: var(--el-color-black);--el-popup-modal-opacity: .5}.v-modal-enter{animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-out{to{opacity:0}}.v-modal{position:fixed;left:0;top:0;width:100%;height:100%;opacity:var(--el-popup-modal-opacity);background:var(--el-popup-modal-bg-color)}.el-popup-parent--hidden{overflow:hidden}.el-dialog{--el-dialog-width: 50%;--el-dialog-margin-top: 15vh;--el-dialog-bg-color: var(--el-bg-color);--el-dialog-box-shadow: var(--el-box-shadow);--el-dialog-title-font-size: var(--el-font-size-large);--el-dialog-content-font-size: 14px;--el-dialog-font-line-height: var(--el-font-line-height-primary);--el-dialog-padding-primary: 16px;--el-dialog-border-radius: var(--el-border-radius-small);position:relative;margin:var(--el-dialog-margin-top, 15vh) auto 50px;background:var(--el-dialog-bg-color);border-radius:var(--el-dialog-border-radius);box-shadow:var(--el-dialog-box-shadow);box-sizing:border-box;padding:var(--el-dialog-padding-primary);width:var(--el-dialog-width, 50%);overflow-wrap:break-word}.el-dialog:focus{outline:none!important}.el-dialog.is-align-center{margin:auto}.el-dialog.is-fullscreen{--el-dialog-width: 100%;--el-dialog-margin-top: 0;margin-bottom:0;height:100%;overflow:auto}.el-dialog__wrapper{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto;margin:0}.el-dialog.is-draggable .el-dialog__header{cursor:move;-webkit-user-select:none;user-select:none}.el-dialog__header{padding-bottom:var(--el-dialog-padding-primary)}.el-dialog__header.show-close{padding-right:calc(var(--el-dialog-padding-primary) + var(--el-message-close-size, 16px))}.el-dialog__headerbtn{position:absolute;top:0;right:0;padding:0;width:48px;height:48px;background:transparent;border:none;outline:none;cursor:pointer;font-size:var(--el-message-close-size, 16px)}.el-dialog__headerbtn .el-dialog__close{color:var(--el-color-info);font-size:inherit}.el-dialog__headerbtn:focus .el-dialog__close,.el-dialog__headerbtn:hover .el-dialog__close{color:var(--el-color-primary)}.el-dialog__title{line-height:var(--el-dialog-font-line-height);font-size:var(--el-dialog-title-font-size);color:var(--el-text-color-primary)}.el-dialog__body{color:var(--el-text-color-regular);font-size:var(--el-dialog-content-font-size)}.el-dialog__footer{padding-top:var(--el-dialog-padding-primary);text-align:right;box-sizing:border-box}.el-dialog--center{text-align:center}.el-dialog--center .el-dialog__body{text-align:initial}.el-dialog--center .el-dialog__footer{text-align:inherit}.el-overlay-dialog{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto}.dialog-fade-enter-active{animation:modal-fade-in var(--el-transition-duration)}.dialog-fade-enter-active .el-overlay-dialog{animation:dialog-fade-in var(--el-transition-duration)}.dialog-fade-leave-active{animation:modal-fade-out var(--el-transition-duration)}.dialog-fade-leave-active .el-overlay-dialog{animation:dialog-fade-out var(--el-transition-duration)}@keyframes dialog-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@keyframes dialog-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}@keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}.el-checkbox{--el-checkbox-font-size: 14px;--el-checkbox-font-weight: var(--el-font-weight-primary);--el-checkbox-text-color: var(--el-text-color-regular);--el-checkbox-input-height: 14px;--el-checkbox-input-width: 14px;--el-checkbox-border-radius: var(--el-border-radius-small);--el-checkbox-bg-color: var(--el-fill-color-blank);--el-checkbox-input-border: var(--el-border);--el-checkbox-disabled-border-color: var(--el-border-color);--el-checkbox-disabled-input-fill: var(--el-fill-color-light);--el-checkbox-disabled-icon-color: var(--el-text-color-placeholder);--el-checkbox-disabled-checked-input-fill: var(--el-border-color-extra-light);--el-checkbox-disabled-checked-input-border-color: var(--el-border-color);--el-checkbox-disabled-checked-icon-color: var(--el-text-color-placeholder);--el-checkbox-checked-text-color: var(--el-color-primary);--el-checkbox-checked-input-border-color: var(--el-color-primary);--el-checkbox-checked-bg-color: var(--el-color-primary);--el-checkbox-checked-icon-color: var(--el-color-white);--el-checkbox-input-border-color-hover: var(--el-color-primary);color:var(--el-checkbox-text-color);font-weight:var(--el-checkbox-font-weight);font-size:var(--el-font-size-base);position:relative;cursor:pointer;display:inline-flex;align-items:center;white-space:nowrap;-webkit-user-select:none;user-select:none;margin-right:30px;height:var(--el-checkbox-height, 32px)}.el-checkbox.is-disabled{cursor:not-allowed}.el-checkbox.is-bordered{padding:0 15px 0 9px;border-radius:var(--el-border-radius-base);border:var(--el-border);box-sizing:border-box}.el-checkbox.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-checkbox.is-bordered.is-disabled{border-color:var(--el-border-color-lighter)}.el-checkbox.is-bordered.el-checkbox--large{padding:0 19px 0 11px;border-radius:var(--el-border-radius-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__label{font-size:var(--el-font-size-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.is-bordered.el-checkbox--small{padding:0 11px 0 7px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox input:focus-visible+.el-checkbox__inner{outline:2px solid var(--el-checkbox-input-border-color-hover);outline-offset:1px;border-radius:var(--el-checkbox-border-radius)}.el-checkbox__input{white-space:nowrap;cursor:pointer;outline:none;display:inline-flex;position:relative}.el-checkbox__input.is-disabled .el-checkbox__inner{background-color:var(--el-checkbox-disabled-input-fill);border-color:var(--el-checkbox-disabled-border-color);cursor:not-allowed}.el-checkbox__input.is-disabled .el-checkbox__inner:after{cursor:not-allowed;border-color:var(--el-checkbox-disabled-icon-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-disabled-checked-icon-color);border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled+span.el-checkbox__label{color:var(--el-disabled-text-color);cursor:not-allowed}.el-checkbox__input.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-checked .el-checkbox__inner:after{transform:rotate(45deg) scaleY(1);border-color:var(--el-checkbox-checked-icon-color)}.el-checkbox__input.is-checked+.el-checkbox__label{color:var(--el-checkbox-checked-text-color)}.el-checkbox__input.is-focus:not(.is-checked) .el-checkbox__original:not(:focus-visible){border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__input.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:before{content:"";position:absolute;display:block;background-color:var(--el-checkbox-checked-icon-color);height:2px;transform:scale(.5);left:0;right:0;top:5px}.el-checkbox__input.is-indeterminate .el-checkbox__inner:after{display:none}.el-checkbox__inner{display:inline-block;position:relative;border:var(--el-checkbox-input-border);border-radius:var(--el-checkbox-border-radius);box-sizing:border-box;width:var(--el-checkbox-input-width);height:var(--el-checkbox-input-height);background-color:var(--el-checkbox-bg-color);z-index:var(--el-index-normal);transition:border-color .25s cubic-bezier(.71,-.46,.29,1.46),background-color .25s cubic-bezier(.71,-.46,.29,1.46),outline .25s cubic-bezier(.71,-.46,.29,1.46)}.el-checkbox__inner:hover{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__inner:after{box-sizing:content-box;content:"";border:1px solid transparent;border-left:0;border-top:0;height:7px;left:4px;position:absolute;top:1px;transform:rotate(45deg) scaleY(0);width:3px;transition:transform .15s ease-in .05s;transform-origin:center}.el-checkbox__original{opacity:0;outline:none;position:absolute;margin:0;width:0;height:0;z-index:-1}.el-checkbox__label{display:inline-block;padding-left:8px;line-height:1;font-size:var(--el-checkbox-font-size)}.el-checkbox.el-checkbox--large{height:40px}.el-checkbox.el-checkbox--large .el-checkbox__label{font-size:14px}.el-checkbox.el-checkbox--large .el-checkbox__inner{width:14px;height:14px}.el-checkbox.el-checkbox--small{height:24px}.el-checkbox.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.el-checkbox--small .el-checkbox__inner{width:12px;height:12px}.el-checkbox.el-checkbox--small .el-checkbox__input.is-indeterminate .el-checkbox__inner:before{top:4px}.el-checkbox.el-checkbox--small .el-checkbox__inner:after{width:2px;height:6px}.el-checkbox:last-of-type{margin-right:0}.el-popper{--el-popper-border-radius: var(--el-popover-border-radius, 4px);position:absolute;border-radius:var(--el-popper-border-radius);padding:5px 11px;z-index:2000;font-size:12px;line-height:20px;min-width:10px;overflow-wrap:break-word;visibility:visible}.el-popper.is-dark{color:var(--el-bg-color);background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary)}.el-popper.is-dark .el-popper__arrow:before{border:1px solid var(--el-text-color-primary);background:var(--el-text-color-primary);right:0}.el-popper.is-light{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow:before{border:1px solid var(--el-border-color-light);background:var(--el-bg-color-overlay);right:0}.el-popper.is-pure{padding:0}.el-popper__arrow{position:absolute;width:10px;height:10px;z-index:-1}.el-popper__arrow:before{position:absolute;width:10px;height:10px;z-index:-1;content:" ";transform:rotate(45deg);background:var(--el-text-color-primary);box-sizing:border-box}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow:before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow:before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow:before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow:before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent!important;border-bottom-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent!important;border-top-color:transparent!important}.el-scrollbar{--el-scrollbar-opacity: .3;--el-scrollbar-bg-color: var(--el-text-color-secondary);--el-scrollbar-hover-opacity: .5;--el-scrollbar-hover-bg-color: var(--el-text-color-secondary);overflow:hidden;position:relative;height:100%}.el-scrollbar__wrap{overflow:auto;height:100%}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{position:relative;display:block;width:0;height:0;cursor:pointer;border-radius:inherit;background-color:var(--el-scrollbar-bg-color, var(--el-text-color-secondary));transition:var(--el-transition-duration) background-color;opacity:var(--el-scrollbar-opacity, .3)}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color, var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity, .5)}.el-scrollbar__bar{position:absolute;right:2px;bottom:2px;z-index:1;border-radius:4px}.el-scrollbar__bar.is-vertical{width:6px;top:2px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity .34s ease-out}.el-scrollbar-fade-leave-active{transition:opacity .12s ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}.el-radio-group{display:inline-flex;align-items:center;flex-wrap:wrap;font-size:0}.el-textarea{--el-input-text-color: var(--el-text-color-regular);--el-input-border: var(--el-border);--el-input-hover-border: var(--el-border-color-hover);--el-input-focus-border: var(--el-color-primary);--el-input-transparent-border: 0 0 0 1px transparent inset;--el-input-border-color: var(--el-border-color);--el-input-border-radius: var(--el-border-radius-base);--el-input-bg-color: var(--el-fill-color-blank);--el-input-icon-color: var(--el-text-color-placeholder);--el-input-placeholder-color: var(--el-text-color-placeholder);--el-input-hover-border-color: var(--el-border-color-hover);--el-input-clear-hover-color: var(--el-text-color-secondary);--el-input-focus-border-color: var(--el-color-primary);--el-input-width: 100%;position:relative;display:inline-block;width:100%;vertical-align:bottom;font-size:var(--el-font-size-base)}.el-textarea__inner{position:relative;display:block;resize:vertical;padding:5px 11px;line-height:1.5;box-sizing:border-box;width:100%;font-size:inherit;font-family:inherit;color:var(--el-input-text-color, var(--el-text-color-regular));background-color:var(--el-input-bg-color, var(--el-fill-color-blank));background-image:none;-webkit-appearance:none;box-shadow:0 0 0 1px var(--el-input-border-color, var(--el-border-color)) inset;border-radius:var(--el-input-border-radius, var(--el-border-radius-base));transition:var(--el-transition-box-shadow);border:none}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color, var(--el-text-color-placeholder))}.el-textarea__inner:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-textarea__inner:focus{outline:none;box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-textarea .el-input__count{color:var(--el-color-info);background:var(--el-fill-color-blank);position:absolute;font-size:12px;line-height:14px;bottom:5px;right:10px}.el-textarea.is-disabled .el-textarea__inner{box-shadow:0 0 0 1px var(--el-disabled-border-color) inset;background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color: var(--el-text-color-regular);--el-input-border: var(--el-border);--el-input-hover-border: var(--el-border-color-hover);--el-input-focus-border: var(--el-color-primary);--el-input-transparent-border: 0 0 0 1px transparent inset;--el-input-border-color: var(--el-border-color);--el-input-border-radius: var(--el-border-radius-base);--el-input-bg-color: var(--el-fill-color-blank);--el-input-icon-color: var(--el-text-color-placeholder);--el-input-placeholder-color: var(--el-text-color-placeholder);--el-input-hover-border-color: var(--el-border-color-hover);--el-input-clear-hover-color: var(--el-text-color-secondary);--el-input-focus-border-color: var(--el-color-primary);--el-input-width: 100%;--el-input-height: var(--el-component-size);position:relative;font-size:var(--el-font-size-base);display:inline-flex;width:var(--el-input-width);line-height:var(--el-input-height);box-sizing:border-box;vertical-align:middle}.el-input::-webkit-scrollbar{z-index:11;width:6px}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{border-radius:5px;width:6px;background:var(--el-text-color-disabled)}.el-input::-webkit-scrollbar-corner{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track-piece{background:var(--el-fill-color-blank);width:6px}.el-input .el-input__clear,.el-input .el-input__password{color:var(--el-input-icon-color);font-size:14px;cursor:pointer}.el-input .el-input__clear:hover,.el-input .el-input__password:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{height:100%;display:inline-flex;align-items:center;color:var(--el-color-info);font-size:12px}.el-input .el-input__count .el-input__count-inner{background:var(--el-fill-color-blank);line-height:initial;display:inline-block;padding-left:8px}.el-input__wrapper{display:inline-flex;flex-grow:1;align-items:center;justify-content:center;padding:1px 11px;background-color:var(--el-input-bg-color, var(--el-fill-color-blank));background-image:none;border-radius:var(--el-input-border-radius, var(--el-border-radius-base));cursor:text;transition:var(--el-transition-box-shadow);transform:translateZ(0);box-shadow:0 0 0 1px var(--el-input-border-color, var(--el-border-color)) inset}.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-input__inner{--el-input-inner-height: calc(var(--el-input-height, 32px) - 2px);width:100%;flex-grow:1;-webkit-appearance:none;color:var(--el-input-text-color, var(--el-text-color-regular));font-size:inherit;height:var(--el-input-inner-height);line-height:var(--el-input-inner-height);padding:0;outline:none;border:none;background:none;box-sizing:border-box}.el-input__inner:focus{outline:none}.el-input__inner::placeholder{color:var(--el-input-placeholder-color, var(--el-text-color-placeholder))}.el-input__inner[type=password]::-ms-reveal{display:none}.el-input__inner[type=number]{line-height:1}.el-input__prefix{display:inline-flex;white-space:nowrap;flex-shrink:0;flex-wrap:nowrap;height:100%;text-align:center;color:var(--el-input-icon-color, var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__prefix-inner{pointer-events:all;display:inline-flex;align-items:center;justify-content:center}.el-input__prefix-inner>:last-child{margin-right:8px}.el-input__prefix-inner>:first-child,.el-input__prefix-inner>:first-child.el-input__icon{margin-left:0}.el-input__suffix{display:inline-flex;white-space:nowrap;flex-shrink:0;flex-wrap:nowrap;height:100%;text-align:center;color:var(--el-input-icon-color, var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__suffix-inner{pointer-events:all;display:inline-flex;align-items:center;justify-content:center}.el-input__suffix-inner>:first-child{margin-left:8px}.el-input .el-input__icon{height:inherit;line-height:inherit;display:flex;justify-content:center;align-items:center;transition:all var(--el-transition-duration);margin-left:8px}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-color, ) inset}.el-input.is-disabled{cursor:not-allowed}.el-input.is-disabled .el-input__wrapper{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset}.el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color);-webkit-text-fill-color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--large{--el-input-height: var(--el-component-size-large);font-size:14px}.el-input--large .el-input__wrapper{padding:1px 15px}.el-input--large .el-input__inner{--el-input-inner-height: calc(var(--el-input-height, 40px) - 2px)}.el-input--small{--el-input-height: var(--el-component-size-small);font-size:12px}.el-input--small .el-input__wrapper{padding:1px 7px}.el-input--small .el-input__inner{--el-input-inner-height: calc(var(--el-input-height, 24px) - 2px)}.el-input-group{display:inline-flex;width:100%;align-items:stretch}.el-input-group__append,.el-input-group__prepend{background-color:var(--el-fill-color-light);color:var(--el-color-info);position:relative;display:inline-flex;align-items:center;justify-content:center;min-height:100%;border-radius:var(--el-input-border-radius);padding:0 20px;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:none}.el-input-group__append .el-select,.el-input-group__append .el-button,.el-input-group__prepend .el-select,.el-input-group__prepend .el-button{display:inline-block;margin:0 -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-select__wrapper,.el-input-group__append div.el-select:hover .el-select__wrapper,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-select__wrapper,.el-input-group__prepend div.el-select:hover .el-select__wrapper{border-color:transparent;background-color:transparent;color:inherit}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-right:0;border-top-right-radius:0;border-bottom-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group__append{border-left:0;border-top-left-radius:0;border-bottom-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--prepend>.el-input__wrapper{border-top-left-radius:0;border-bottom-left-radius:0}.el-input-group--prepend .el-input-group__prepend .el-select .el-select__wrapper{border-top-right-radius:0;border-bottom-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group--append>.el-input__wrapper{border-top-right-radius:0;border-bottom-right-radius:0}.el-input-group--append .el-input-group__append .el-select .el-select__wrapper{border-top-left-radius:0;border-bottom-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-hidden{display:none!important}.el-badge{--el-badge-bg-color: var(--el-color-danger);--el-badge-radius: 10px;--el-badge-font-size: 12px;--el-badge-padding: 6px;--el-badge-size: 18px;position:relative;vertical-align:middle;display:inline-block;width:fit-content}.el-badge__content{background-color:var(--el-badge-bg-color);border-radius:var(--el-badge-radius);color:var(--el-color-white);display:inline-flex;justify-content:center;align-items:center;font-size:var(--el-badge-font-size);height:var(--el-badge-size);padding:0 var(--el-badge-padding);white-space:nowrap;border:1px solid var(--el-bg-color)}.el-badge__content.is-fixed{position:absolute;top:0;right:calc(1px + var(--el-badge-size) / 2);transform:translateY(-50%) translate(100%);z-index:var(--el-index-normal)}.el-badge__content.is-fixed.is-dot{right:5px}.el-badge__content.is-dot{height:8px;width:8px;padding:0;right:0;border-radius:50%}.el-badge__content--primary{background-color:var(--el-color-primary)}.el-badge__content--success{background-color:var(--el-color-success)}.el-badge__content--warning{background-color:var(--el-color-warning)}.el-badge__content--info{background-color:var(--el-color-info)}.el-badge__content--danger{background-color:var(--el-color-danger)}.el-message{--el-message-bg-color: var(--el-color-info-light-9);--el-message-border-color: var(--el-border-color-lighter);--el-message-padding: 11px 15px;--el-message-close-size: 16px;--el-message-close-icon-color: var(--el-text-color-placeholder);--el-message-close-hover-color: var(--el-text-color-secondary);width:fit-content;max-width:calc(100% - 32px);box-sizing:border-box;border-radius:var(--el-border-radius-base);border-width:var(--el-border-width);border-style:var(--el-border-style);border-color:var(--el-message-border-color);position:fixed;left:50%;top:20px;transform:translate(-50%);background-color:var(--el-message-bg-color);transition:opacity var(--el-transition-duration),transform .4s,top .4s;padding:var(--el-message-padding);display:flex;align-items:center;gap:8px}.el-message.is-center{justify-content:center}.el-message.is-plain{background-color:var(--el-bg-color-overlay);border-color:var(--el-bg-color-overlay);box-shadow:var(--el-box-shadow-light)}.el-message p{margin:0}.el-message--success{--el-message-bg-color: var(--el-color-success-light-9);--el-message-border-color: var(--el-color-success-light-8);--el-message-text-color: var(--el-color-success)}.el-message--success .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--success{color:var(--el-message-text-color)}.el-message--info{--el-message-bg-color: var(--el-color-info-light-9);--el-message-border-color: var(--el-color-info-light-8);--el-message-text-color: var(--el-color-info)}.el-message--info .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--info{color:var(--el-message-text-color)}.el-message--warning{--el-message-bg-color: var(--el-color-warning-light-9);--el-message-border-color: var(--el-color-warning-light-8);--el-message-text-color: var(--el-color-warning)}.el-message--warning .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--warning{color:var(--el-message-text-color)}.el-message--error{--el-message-bg-color: var(--el-color-error-light-9);--el-message-border-color: var(--el-color-error-light-8);--el-message-text-color: var(--el-color-error)}.el-message--error .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--error{color:var(--el-message-text-color)}.el-message .el-message__badge{position:absolute;top:-8px;right:-8px}.el-message__content{padding:0;font-size:14px;line-height:1}.el-message__content:focus{outline-width:0}.el-message .el-message__closeBtn{cursor:pointer;color:var(--el-message-close-icon-color);font-size:var(--el-message-close-size)}.el-message .el-message__closeBtn:focus{outline-width:0}.el-message .el-message__closeBtn:hover{color:var(--el-message-close-hover-color)}.el-message-fade-enter-from,.el-message-fade-leave-to{opacity:0;transform:translate(-50%,-100%)}.el-radio-button{--el-radio-button-checked-bg-color: var(--el-color-primary);--el-radio-button-checked-text-color: var(--el-color-white);--el-radio-button-checked-border-color: var(--el-color-primary);--el-radio-button-disabled-checked-fill: var(--el-border-color-extra-light);position:relative;display:inline-block;outline:none}.el-radio-button__inner{display:inline-block;line-height:1;white-space:nowrap;vertical-align:middle;background:var(--el-button-bg-color, var(--el-fill-color-blank));border:var(--el-border);font-weight:var(--el-button-font-weight, var(--el-font-weight-primary));border-left:0;color:var(--el-button-text-color, var(--el-text-color-regular));-webkit-appearance:none;text-align:center;box-sizing:border-box;outline:none;margin:0;position:relative;cursor:pointer;transition:var(--el-transition-all);-webkit-user-select:none;user-select:none;padding:8px 15px;font-size:var(--el-font-size-base);border-radius:0}.el-radio-button__inner.is-round{padding:8px 15px}.el-radio-button__inner:hover{color:var(--el-color-primary)}.el-radio-button__inner [class*=el-icon-]{line-height:.9}.el-radio-button__inner [class*=el-icon-]+span{margin-left:5px}.el-radio-button:first-child .el-radio-button__inner{border-left:var(--el-border);border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);box-shadow:none!important}.el-radio-button.is-active .el-radio-button__original-radio:not(:disabled)+.el-radio-button__inner{color:var(--el-radio-button-checked-text-color, var(--el-color-white));background-color:var(--el-radio-button-checked-bg-color, var(--el-color-primary));border-color:var(--el-radio-button-checked-border-color, var(--el-color-primary));box-shadow:-1px 0 0 0 var(--el-radio-button-checked-border-color, var(--el-color-primary))}.el-radio-button__original-radio{opacity:0;outline:none;position:absolute;z-index:-1}.el-radio-button__original-radio:focus-visible+.el-radio-button__inner{border-left:var(--el-border);border-left-color:var(--el-radio-button-checked-border-color, var(--el-color-primary));outline:2px solid var(--el-radio-button-checked-border-color);outline-offset:1px;z-index:2;border-radius:var(--el-border-radius-base);box-shadow:none}.el-radio-button__original-radio:disabled+.el-radio-button__inner{color:var(--el-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color, var(--el-fill-color-blank));border-color:var(--el-button-disabled-border-color, var(--el-border-color-light));box-shadow:none}.el-radio-button__original-radio:disabled:checked+.el-radio-button__inner{background-color:var(--el-radio-button-disabled-checked-fill)}.el-radio-button:last-child .el-radio-button__inner{border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0}.el-radio-button:first-child:last-child .el-radio-button__inner{border-radius:var(--el-border-radius-base)}.el-radio-button--large .el-radio-button__inner{padding:12px 19px;font-size:var(--el-font-size-base);border-radius:0}.el-radio-button--large .el-radio-button__inner.is-round{padding:12px 19px}.el-radio-button--small .el-radio-button__inner{padding:5px 11px;font-size:12px;border-radius:0}.el-radio-button--small .el-radio-button__inner.is-round{padding:5px 11px}.el-drawer{--el-drawer-bg-color: var(--el-dialog-bg-color, var(--el-bg-color));--el-drawer-padding-primary: var(--el-dialog-padding-primary, 20px);position:absolute;box-sizing:border-box;background-color:var(--el-drawer-bg-color);display:flex;flex-direction:column;box-shadow:var(--el-box-shadow-dark);overflow:hidden;transition:all var(--el-transition-duration)}.el-drawer .rtl,.el-drawer .ltr,.el-drawer .ttb,.el-drawer .btt{transform:translate(0)}.el-drawer__sr-focus:focus{outline:none!important}.el-drawer__header{align-items:center;color:#72767b;display:flex;margin-bottom:32px;padding:var(--el-drawer-padding-primary);padding-bottom:0}.el-drawer__header>:first-child{flex:1}.el-drawer__title{margin:0;flex:1;line-height:inherit;font-size:16px}.el-drawer__footer{padding:var(--el-drawer-padding-primary);padding-top:10px;text-align:right}.el-drawer__close-btn{display:inline-flex;border:none;cursor:pointer;font-size:var(--el-font-size-extra-large);color:inherit;background-color:transparent;outline:none}.el-drawer__close-btn:focus i,.el-drawer__close-btn:hover i{color:var(--el-color-primary)}.el-drawer__body{flex:1;padding:var(--el-drawer-padding-primary);overflow:auto}.el-drawer__body>*{box-sizing:border-box}.el-drawer.ltr,.el-drawer.rtl{height:100%;top:0;bottom:0}.el-drawer.ttb,.el-drawer.btt{width:100%;left:0;right:0}.el-drawer.ltr{left:0}.el-drawer.rtl{right:0}.el-drawer.ttb{top:0}.el-drawer.btt{bottom:0}.el-drawer-fade-enter-active,.el-drawer-fade-leave-active{transition:all var(--el-transition-duration)}.el-drawer-fade-enter-from,.el-drawer-fade-enter-active,.el-drawer-fade-enter-to,.el-drawer-fade-leave-from,.el-drawer-fade-leave-active,.el-drawer-fade-leave-to{overflow:hidden!important}.el-drawer-fade-enter-from,.el-drawer-fade-leave-to{background-color:transparent!important}.el-drawer-fade-enter-from .rtl,.el-drawer-fade-leave-to .rtl{transform:translate(100%)}.el-drawer-fade-enter-from .ltr,.el-drawer-fade-leave-to .ltr{transform:translate(-100%)}.el-drawer-fade-enter-from .ttb,.el-drawer-fade-leave-to .ttb{transform:translateY(-100%)}.el-drawer-fade-enter-from .btt,.el-drawer-fade-leave-to .btt{transform:translateY(100%)}.setting-button{background-color:var(--el-color-primary)}.custom-modal{background-color:#0003}.el-switch{--el-switch-on-color: var(--el-color-primary);--el-switch-off-color: var(--el-border-color);display:inline-flex;align-items:center;position:relative;font-size:14px;line-height:20px;height:32px;vertical-align:middle}.el-switch.is-disabled .el-switch__core,.el-switch.is-disabled .el-switch__label{cursor:not-allowed}.el-switch__label{transition:var(--el-transition-duration-fast);height:20px;display:inline-block;font-size:14px;font-weight:500;cursor:pointer;vertical-align:middle;color:var(--el-text-color-primary)}.el-switch__label.is-active{color:var(--el-color-primary)}.el-switch__label--left{margin-right:10px}.el-switch__label--right{margin-left:10px}.el-switch__label *{line-height:1;font-size:14px;display:inline-block}.el-switch__label .el-icon{height:inherit}.el-switch__label .el-icon svg{vertical-align:middle}.el-switch__input{position:absolute;width:0;height:0;opacity:0;margin:0}.el-switch__input:focus-visible~.el-switch__core{outline:2px solid var(--el-switch-on-color);outline-offset:1px}.el-switch__core{display:inline-flex;position:relative;align-items:center;min-width:40px;height:20px;border:1px solid var(--el-switch-border-color, var(--el-switch-off-color));outline:none;border-radius:10px;box-sizing:border-box;background:var(--el-switch-off-color);cursor:pointer;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration)}.el-switch__core .el-switch__inner{width:100%;transition:all var(--el-transition-duration);height:16px;display:flex;justify-content:center;align-items:center;overflow:hidden;padding:0 4px 0 18px}.el-switch__core .el-switch__inner .is-icon,.el-switch__core .el-switch__inner .is-text{font-size:12px;color:var(--el-color-white);-webkit-user-select:none;user-select:none;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.el-switch__core .el-switch__action{position:absolute;left:1px;border-radius:var(--el-border-radius-circle);transition:all var(--el-transition-duration);width:16px;height:16px;background-color:var(--el-color-white);display:flex;justify-content:center;align-items:center;color:var(--el-switch-off-color)}.el-switch.is-checked .el-switch__core{border-color:var(--el-switch-border-color, var(--el-switch-on-color));background-color:var(--el-switch-on-color)}.el-switch.is-checked .el-switch__core .el-switch__action{left:calc(100% - 17px);color:var(--el-switch-on-color)}.el-switch.is-checked .el-switch__core .el-switch__inner{padding:0 18px 0 4px}.el-switch.is-disabled{opacity:.6}.el-switch--wide .el-switch__label.el-switch__label--left span{left:10px}.el-switch--wide .el-switch__label.el-switch__label--right span{right:10px}.el-switch .label-fade-enter-from,.el-switch .label-fade-leave-active{opacity:0}.el-switch--large{font-size:14px;line-height:24px;height:40px}.el-switch--large .el-switch__label{height:24px;font-size:14px}.el-switch--large .el-switch__label *{font-size:14px}.el-switch--large .el-switch__core{min-width:50px;height:24px;border-radius:12px}.el-switch--large .el-switch__core .el-switch__inner{height:20px;padding:0 6px 0 22px}.el-switch--large .el-switch__core .el-switch__action{width:20px;height:20px}.el-switch--large.is-checked .el-switch__core .el-switch__action{left:calc(100% - 21px)}.el-switch--large.is-checked .el-switch__core .el-switch__inner{padding:0 22px 0 6px}.el-switch--small{font-size:12px;line-height:16px;height:24px}.el-switch--small .el-switch__label{height:16px;font-size:12px}.el-switch--small .el-switch__label *{font-size:12px}.el-switch--small .el-switch__core{min-width:30px;height:16px;border-radius:8px}.el-switch--small .el-switch__core .el-switch__inner{height:12px;padding:0 2px 0 14px}.el-switch--small .el-switch__core .el-switch__action{width:12px;height:12px}.el-switch--small.is-checked .el-switch__core .el-switch__action{left:calc(100% - 13px)}.el-switch--small.is-checked .el-switch__core .el-switch__inner{padding:0 14px 0 2px}.el-tabs{--el-tabs-header-height: 40px;display:flex}.el-tabs__header{padding:0;position:relative;margin:0 0 15px;display:flex;align-items:center;justify-content:space-between}.el-tabs__header-vertical{flex-direction:column}.el-tabs__active-bar{position:absolute;bottom:0;left:0;height:2px;background-color:var(--el-color-primary);z-index:1;transition:width var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier),transform var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);list-style:none}.el-tabs__new-tab{display:flex;align-items:center;justify-content:center;border:1px solid var(--el-border-color);height:20px;width:20px;line-height:20px;margin:10px 0 10px 10px;border-radius:3px;text-align:center;font-size:12px;color:var(--el-text-color-primary);cursor:pointer;transition:all .15s}.el-tabs__new-tab .is-icon-plus{height:inherit;width:inherit;transform:scale(.8)}.el-tabs__new-tab .is-icon-plus svg{vertical-align:middle}.el-tabs__new-tab:hover{color:var(--el-color-primary)}.el-tabs__new-tab-vertical{margin-left:0}.el-tabs__nav-wrap{overflow:hidden;margin-bottom:-1px;position:relative;flex:1 auto}.el-tabs__nav-wrap:after{content:"";position:absolute;left:0;bottom:0;width:100%;height:2px;background-color:var(--el-border-color-light);z-index:var(--el-index-normal)}.el-tabs__nav-wrap.is-scrollable{padding:0 20px;box-sizing:border-box}.el-tabs__nav-scroll{overflow:hidden}.el-tabs__nav-next,.el-tabs__nav-prev{position:absolute;cursor:pointer;line-height:44px;font-size:12px;color:var(--el-text-color-secondary);width:20px;text-align:center}.el-tabs__nav-next{right:0}.el-tabs__nav-prev{left:0}.el-tabs__nav{display:flex;white-space:nowrap;position:relative;transition:transform var(--el-transition-duration);float:left;z-index:calc(var(--el-index-normal) + 1)}.el-tabs__nav.is-stretch{min-width:100%;display:flex}.el-tabs__nav.is-stretch>*{flex:1;text-align:center}.el-tabs__item{padding:0 20px;height:var(--el-tabs-header-height);box-sizing:border-box;display:flex;align-items:center;justify-content:center;list-style:none;font-size:var(--el-font-size-base);font-weight:500;color:var(--el-text-color-primary);position:relative}.el-tabs__item:focus,.el-tabs__item:focus:active{outline:none}.el-tabs__item:focus-visible{box-shadow:0 0 2px 2px var(--el-color-primary) inset;border-radius:3px}.el-tabs__item .is-icon-close{border-radius:50%;text-align:center;transition:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);margin-left:5px}.el-tabs__item .is-icon-close:before{transform:scale(.9);display:inline-block}.el-tabs__item .is-icon-close:hover{background-color:var(--el-text-color-placeholder);color:#fff}.el-tabs__item.is-active{color:var(--el-color-primary)}.el-tabs__item:hover{color:var(--el-color-primary);cursor:pointer}.el-tabs__item.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-tabs__content{overflow:hidden;position:relative;flex-grow:1}.el-tabs--top>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom>.el-tabs__header .el-tabs__item:nth-child(2){padding-left:0}.el-tabs--top>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom>.el-tabs__header .el-tabs__item:last-child{padding-right:0}.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2){padding-left:20px}.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:last-child{padding-right:20px}.el-tabs--card>.el-tabs__header{border-bottom:1px solid var(--el-border-color-light);height:var(--el-tabs-header-height)}.el-tabs--card>.el-tabs__header .el-tabs__nav-wrap:after{content:none}.el-tabs--card>.el-tabs__header .el-tabs__nav{border:1px solid var(--el-border-color-light);border-bottom:none;border-radius:4px 4px 0 0;box-sizing:border-box}.el-tabs--card>.el-tabs__header .el-tabs__active-bar{display:none}.el-tabs--card>.el-tabs__header .el-tabs__item .is-icon-close{position:relative;font-size:12px;width:0;height:14px;overflow:hidden;right:-2px;transform-origin:100% 50%}.el-tabs--card>.el-tabs__header .el-tabs__item{border-bottom:1px solid transparent;border-left:1px solid var(--el-border-color-light);transition:color var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier),padding var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier)}.el-tabs--card>.el-tabs__header .el-tabs__item:first-child{border-left:none}.el-tabs--card>.el-tabs__header .el-tabs__item.is-closable:hover{padding-left:13px;padding-right:13px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-closable:hover .is-icon-close{width:14px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active{border-bottom-color:var(--el-bg-color)}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active.is-closable{padding-left:20px;padding-right:20px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active.is-closable .is-icon-close{width:14px}.el-tabs--border-card{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color)}.el-tabs--border-card>.el-tabs__content{padding:15px}.el-tabs--border-card>.el-tabs__header{background-color:var(--el-fill-color-light);border-bottom:1px solid var(--el-border-color-light);margin:0}.el-tabs--border-card>.el-tabs__header .el-tabs__nav-wrap:after{content:none}.el-tabs--border-card>.el-tabs__header .el-tabs__item{transition:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);border:1px solid transparent;margin-top:-1px;color:var(--el-text-color-secondary)}.el-tabs--border-card>.el-tabs__header .el-tabs__item:first-child{margin-left:-1px}.el-tabs--border-card>.el-tabs__header .el-tabs__item+.el-tabs__item{margin-left:-1px}.el-tabs--border-card>.el-tabs__header .el-tabs__item.is-active{color:var(--el-color-primary);background-color:var(--el-bg-color-overlay);border-right-color:var(--el-border-color);border-left-color:var(--el-border-color)}.el-tabs--border-card>.el-tabs__header .el-tabs__item:not(.is-disabled):hover{color:var(--el-color-primary)}.el-tabs--border-card>.el-tabs__header .el-tabs__item.is-disabled{color:var(--el-disabled-text-color)}.el-tabs--border-card>.el-tabs__header .is-scrollable .el-tabs__item:first-child{margin-left:0}.el-tabs--bottom{flex-direction:column}.el-tabs--bottom .el-tabs__header.is-bottom{margin-bottom:0;margin-top:10px}.el-tabs--bottom.el-tabs--border-card .el-tabs__header.is-bottom{border-bottom:0;border-top:1px solid var(--el-border-color)}.el-tabs--bottom.el-tabs--border-card .el-tabs__nav-wrap.is-bottom{margin-top:-1px;margin-bottom:0}.el-tabs--bottom.el-tabs--border-card .el-tabs__item.is-bottom:not(.is-active){border:1px solid transparent}.el-tabs--bottom.el-tabs--border-card .el-tabs__item.is-bottom{margin:0 -1px -1px}.el-tabs--left,.el-tabs--right{overflow:hidden}.el-tabs--left .el-tabs__header.is-left,.el-tabs--left .el-tabs__header.is-right,.el-tabs--left .el-tabs__nav-wrap.is-left,.el-tabs--left .el-tabs__nav-wrap.is-right,.el-tabs--left .el-tabs__nav-scroll,.el-tabs--right .el-tabs__header.is-left,.el-tabs--right .el-tabs__header.is-right,.el-tabs--right .el-tabs__nav-wrap.is-left,.el-tabs--right .el-tabs__nav-wrap.is-right,.el-tabs--right .el-tabs__nav-scroll{height:100%}.el-tabs--left .el-tabs__active-bar.is-left,.el-tabs--left .el-tabs__active-bar.is-right,.el-tabs--right .el-tabs__active-bar.is-left,.el-tabs--right .el-tabs__active-bar.is-right{top:0;bottom:auto;width:2px;height:auto}.el-tabs--left .el-tabs__nav-wrap.is-left,.el-tabs--left .el-tabs__nav-wrap.is-right,.el-tabs--right .el-tabs__nav-wrap.is-left,.el-tabs--right .el-tabs__nav-wrap.is-right{margin-bottom:0}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next{height:30px;line-height:30px;width:100%;text-align:center;cursor:pointer}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev i,.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next i,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev i,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next i,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev i,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next i,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev i,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next i{transform:rotate(90deg)}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev{left:auto;top:0}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next{right:auto;bottom:0}.el-tabs--left .el-tabs__nav-wrap.is-left.is-scrollable,.el-tabs--left .el-tabs__nav-wrap.is-right.is-scrollable,.el-tabs--right .el-tabs__nav-wrap.is-left.is-scrollable,.el-tabs--right .el-tabs__nav-wrap.is-right.is-scrollable{padding:30px 0}.el-tabs--left .el-tabs__nav-wrap.is-left:after,.el-tabs--left .el-tabs__nav-wrap.is-right:after,.el-tabs--right .el-tabs__nav-wrap.is-left:after,.el-tabs--right .el-tabs__nav-wrap.is-right:after{height:100%;width:2px;bottom:auto;top:0}.el-tabs--left .el-tabs__nav.is-left,.el-tabs--left .el-tabs__nav.is-right,.el-tabs--right .el-tabs__nav.is-left,.el-tabs--right .el-tabs__nav.is-right{flex-direction:column}.el-tabs--left .el-tabs__item.is-left,.el-tabs--right .el-tabs__item.is-left{justify-content:flex-end}.el-tabs--left .el-tabs__item.is-right,.el-tabs--right .el-tabs__item.is-right{justify-content:flex-start}.el-tabs--left{flex-direction:row-reverse}.el-tabs--left .el-tabs__header.is-left{margin-bottom:0;margin-right:10px}.el-tabs--left .el-tabs__nav-wrap.is-left{margin-right:-1px}.el-tabs--left .el-tabs__nav-wrap.is-left:after{left:auto;right:0}.el-tabs--left .el-tabs__active-bar.is-left{right:0;left:auto}.el-tabs--left .el-tabs__item.is-left{text-align:right}.el-tabs--left.el-tabs--card .el-tabs__active-bar.is-left{display:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left{border-left:none;border-right:1px solid var(--el-border-color-light);border-bottom:none;border-top:1px solid var(--el-border-color-light);text-align:left}.el-tabs--left.el-tabs--card .el-tabs__item.is-left:first-child{border-right:1px solid var(--el-border-color-light);border-top:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active{border:1px solid var(--el-border-color-light);border-right-color:#fff;border-left:none;border-bottom:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active:first-child{border-top:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active:last-child{border-bottom:none}.el-tabs--left.el-tabs--card .el-tabs__nav{border-radius:4px 0 0 4px;border-bottom:1px solid var(--el-border-color-light);border-right:none}.el-tabs--left.el-tabs--card .el-tabs__new-tab{float:none}.el-tabs--left.el-tabs--border-card .el-tabs__header.is-left{border-right:1px solid var(--el-border-color)}.el-tabs--left.el-tabs--border-card .el-tabs__item.is-left{border:1px solid transparent;margin:-1px 0 -1px -1px}.el-tabs--left.el-tabs--border-card .el-tabs__item.is-left.is-active{border-color:transparent;border-top-color:#d1dbe5;border-bottom-color:#d1dbe5}.el-tabs--right .el-tabs__header.is-right{margin-bottom:0;margin-left:10px}.el-tabs--right .el-tabs__nav-wrap.is-right{margin-left:-1px}.el-tabs--right .el-tabs__nav-wrap.is-right:after{left:0;right:auto}.el-tabs--right .el-tabs__active-bar.is-right{left:0}.el-tabs--right.el-tabs--card .el-tabs__active-bar.is-right{display:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right{border-bottom:none;border-top:1px solid var(--el-border-color-light)}.el-tabs--right.el-tabs--card .el-tabs__item.is-right:first-child{border-left:1px solid var(--el-border-color-light);border-top:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active{border:1px solid var(--el-border-color-light);border-left-color:#fff;border-right:none;border-bottom:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active:first-child{border-top:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active:last-child{border-bottom:none}.el-tabs--right.el-tabs--card .el-tabs__nav{border-radius:0 4px 4px 0;border-bottom:1px solid var(--el-border-color-light);border-left:none}.el-tabs--right.el-tabs--border-card .el-tabs__header.is-right{border-left:1px solid var(--el-border-color)}.el-tabs--right.el-tabs--border-card .el-tabs__item.is-right{border:1px solid transparent;margin:-1px -1px -1px 0}.el-tabs--right.el-tabs--border-card .el-tabs__item.is-right.is-active{border-color:transparent;border-top-color:#d1dbe5;border-bottom-color:#d1dbe5}.el-tabs--top{flex-direction:column-reverse}.slideInRight-transition,.slideInLeft-transition{display:inline-block}.slideInRight-enter{animation:slideInRight-enter var(--el-transition-duration)}.slideInRight-leave{position:absolute;left:0;right:0;animation:slideInRight-leave var(--el-transition-duration)}.slideInLeft-enter{animation:slideInLeft-enter var(--el-transition-duration)}.slideInLeft-leave{position:absolute;left:0;right:0;animation:slideInLeft-leave var(--el-transition-duration)}@keyframes slideInRight-enter{0%{opacity:0;transform-origin:0 0;transform:translate(100%)}to{opacity:1;transform-origin:0 0;transform:translate(0)}}@keyframes slideInRight-leave{0%{transform-origin:0 0;transform:translate(0);opacity:1}to{transform-origin:0 0;transform:translate(100%);opacity:0}}@keyframes slideInLeft-enter{0%{opacity:0;transform-origin:0 0;transform:translate(-100%)}to{opacity:1;transform-origin:0 0;transform:translate(0)}}@keyframes slideInLeft-leave{0%{transform-origin:0 0;transform:translate(0);opacity:1}to{transform-origin:0 0;transform:translate(-100%);opacity:0}}.el-table{--el-table-border-color: var(--el-border-color-lighter);--el-table-border: 1px solid var(--el-table-border-color);--el-table-text-color: var(--el-text-color-regular);--el-table-header-text-color: var(--el-text-color-secondary);--el-table-row-hover-bg-color: var(--el-fill-color-light);--el-table-current-row-bg-color: var(--el-color-primary-light-9);--el-table-header-bg-color: var(--el-bg-color);--el-table-fixed-box-shadow: var(--el-box-shadow-light);--el-table-bg-color: var(--el-fill-color-blank);--el-table-tr-bg-color: var(--el-bg-color);--el-table-expanded-cell-bg-color: var(--el-fill-color-blank);--el-table-fixed-left-column: inset 10px 0 10px -10px rgba(0, 0, 0, .15);--el-table-fixed-right-column: inset -10px 0 10px -10px rgba(0, 0, 0, .15);--el-table-index: var(--el-index-normal);position:relative;overflow:hidden;box-sizing:border-box;height:fit-content;width:100%;max-width:100%;background-color:var(--el-table-bg-color);font-size:14px;color:var(--el-table-text-color)}.el-table__inner-wrapper{position:relative;display:flex;flex-direction:column;height:100%}.el-table__inner-wrapper:before{left:0;bottom:0;height:1px}.el-table tbody:focus-visible{outline:none}.el-table.has-footer.el-table--scrollable-y tr:last-child td.el-table__cell,.el-table.has-footer.el-table--fluid-height tr:last-child td.el-table__cell{border-bottom-color:transparent}.el-table__empty-block{position:sticky;left:0;min-height:60px;text-align:center;width:100%;display:flex;justify-content:center;align-items:center}.el-table__empty-text{line-height:60px;width:50%;color:var(--el-text-color-secondary)}.el-table__expand-column .cell{padding:0;text-align:center;-webkit-user-select:none;user-select:none}.el-table__expand-icon{position:relative;cursor:pointer;color:var(--el-text-color-regular);font-size:12px;transition:transform var(--el-transition-duration-fast) ease-in-out;height:20px}.el-table__expand-icon--expanded{transform:rotate(90deg)}.el-table__expand-icon>.el-icon{font-size:12px}.el-table__expanded-cell{background-color:var(--el-table-expanded-cell-bg-color)}.el-table__expanded-cell[class*=cell]{padding:20px 50px}.el-table__expanded-cell:hover{background-color:transparent!important}.el-table__placeholder{display:inline-block;width:20px}.el-table__append-wrapper{overflow:hidden}.el-table--fit{border-right:0;border-bottom:0}.el-table--fit .el-table__cell.gutter{border-right-width:1px}.el-table--fit .el-table__inner-wrapper:before{width:100%}.el-table thead{color:var(--el-table-header-text-color)}.el-table thead th{font-weight:600}.el-table thead.is-group th.el-table__cell{background:var(--el-fill-color-light)}.el-table .el-table__cell{padding:8px 0;min-width:0;box-sizing:border-box;text-overflow:ellipsis;vertical-align:middle;position:relative;text-align:left;z-index:var(--el-table-index)}.el-table .el-table__cell.is-center{text-align:center}.el-table .el-table__cell.is-right{text-align:right}.el-table .el-table__cell.gutter{width:15px;border-right-width:0;border-bottom-width:0;padding:0}.el-table .el-table__cell.is-hidden>*{visibility:hidden}.el-table .cell{box-sizing:border-box;overflow:hidden;text-overflow:ellipsis;white-space:normal;overflow-wrap:break-word;line-height:23px;padding:0 12px}.el-table .cell.el-tooltip{white-space:nowrap;min-width:50px}.el-table--large{font-size:var(--el-font-size-base)}.el-table--large .el-table__cell{padding:12px 0}.el-table--large .cell{padding:0 16px}.el-table--default{font-size:14px}.el-table--default .el-table__cell{padding:8px 0}.el-table--default .cell{padding:0 12px}.el-table--small{font-size:12px}.el-table--small .el-table__cell{padding:4px 0}.el-table--small .cell{padding:0 8px}.el-table tr{background-color:var(--el-table-tr-bg-color)}.el-table tr input[type=checkbox]{margin:0}.el-table th.el-table__cell.is-leaf,.el-table td.el-table__cell{border-bottom:var(--el-table-border)}.el-table th.el-table__cell.is-sortable{cursor:pointer}.el-table th.el-table__cell{background-color:var(--el-table-header-bg-color)}.el-table th.el-table__cell>.cell.highlight{color:var(--el-color-primary)}.el-table th.el-table__cell.required>div:before{display:inline-block;content:"";width:8px;height:8px;border-radius:50%;background:#ff4d51;margin-right:5px;vertical-align:middle}.el-table td.el-table__cell div{box-sizing:border-box}.el-table td.el-table__cell.gutter{width:0}.el-table--border:after,.el-table--border:before,.el-table--border .el-table__inner-wrapper:after,.el-table__inner-wrapper:before{content:"";position:absolute;background-color:var(--el-table-border-color);z-index:calc(var(--el-table-index) + 2)}.el-table--border .el-table__inner-wrapper:after{left:0;top:0;width:100%;height:1px;z-index:calc(var(--el-table-index) + 2)}.el-table--border:before{top:-1px;left:0;width:1px;height:100%}.el-table--border:after{top:-1px;right:0;width:1px;height:100%}.el-table--border .el-table__inner-wrapper{border-right:none;border-bottom:none}.el-table--border .el-table__footer-wrapper{position:relative;flex-shrink:0}.el-table--border .el-table__cell{border-right:var(--el-table-border)}.el-table--border th.el-table__cell.gutter:last-of-type{border-bottom:var(--el-table-border);border-bottom-width:1px}.el-table--border th.el-table__cell{border-bottom:var(--el-table-border)}.el-table--hidden{visibility:hidden}.el-table__header-wrapper,.el-table__body-wrapper,.el-table__footer-wrapper{width:100%}.el-table__header-wrapper tr td.el-table-fixed-column--left,.el-table__header-wrapper tr td.el-table-fixed-column--right,.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right,.el-table__body-wrapper tr td.el-table-fixed-column--left,.el-table__body-wrapper tr td.el-table-fixed-column--right,.el-table__body-wrapper tr th.el-table-fixed-column--left,.el-table__body-wrapper tr th.el-table-fixed-column--right,.el-table__footer-wrapper tr td.el-table-fixed-column--left,.el-table__footer-wrapper tr td.el-table-fixed-column--right,.el-table__footer-wrapper tr th.el-table-fixed-column--left,.el-table__footer-wrapper tr th.el-table-fixed-column--right{position:sticky!important;background:inherit;z-index:calc(var(--el-table-index) + 1)}.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column:before{content:"";position:absolute;top:0;width:10px;bottom:-1px;overflow-x:hidden;overflow-y:hidden;box-shadow:none;touch-action:none;pointer-events:none}.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column:before{left:-10px}.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column:before{right:-10px;box-shadow:none}.el-table__header-wrapper tr td.el-table__fixed-right-patch,.el-table__header-wrapper tr th.el-table__fixed-right-patch,.el-table__body-wrapper tr td.el-table__fixed-right-patch,.el-table__body-wrapper tr th.el-table__fixed-right-patch,.el-table__footer-wrapper tr td.el-table__fixed-right-patch,.el-table__footer-wrapper tr th.el-table__fixed-right-patch{position:sticky!important;z-index:calc(var(--el-table-index) + 1);background:#fff;right:0}.el-table__header-wrapper{flex-shrink:0}.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table__header,.el-table__body,.el-table__footer{table-layout:fixed;border-collapse:separate}.el-table__header-wrapper{overflow:hidden}.el-table__header-wrapper tbody td.el-table__cell{background-color:var(--el-table-row-hover-bg-color);color:var(--el-table-text-color)}.el-table__footer-wrapper{overflow:hidden;flex-shrink:0}.el-table__footer-wrapper tfoot td.el-table__cell{background-color:var(--el-table-row-hover-bg-color);color:var(--el-table-text-color)}.el-table__header-wrapper .el-table-column--selection>.cell,.el-table__body-wrapper .el-table-column--selection>.cell{display:inline-flex;align-items:center;height:23px}.el-table__header-wrapper .el-table-column--selection .el-checkbox,.el-table__body-wrapper .el-table-column--selection .el-checkbox{height:unset}.el-table.is-scrolling-left .el-table-fixed-column--right.is-first-column:before{box-shadow:var(--el-table-fixed-right-column)}.el-table.is-scrolling-left.el-table--border .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:var(--el-table-border)}.el-table.is-scrolling-left th.el-table-fixed-column--left{background-color:var(--el-table-header-bg-color)}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column:before{box-shadow:var(--el-table-fixed-left-column)}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-right th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-middle .el-table-fixed-column--right.is-first-column:before{box-shadow:var(--el-table-fixed-right-column)}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column:before{box-shadow:var(--el-table-fixed-left-column)}.el-table.is-scrolling-none .el-table-fixed-column--left.is-first-column:before,.el-table.is-scrolling-none .el-table-fixed-column--left.is-last-column:before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-first-column:before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-last-column:before{box-shadow:none}.el-table.is-scrolling-none th.el-table-fixed-column--left,.el-table.is-scrolling-none th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table__body-wrapper{overflow:hidden;position:relative;flex:1}.el-table__body-wrapper .el-scrollbar__bar{z-index:calc(var(--el-table-index) + 2)}.el-table .caret-wrapper{display:inline-flex;flex-direction:column;align-items:center;height:14px;width:24px;vertical-align:middle;cursor:pointer;overflow:initial;position:relative}.el-table .sort-caret{width:0;height:0;border:solid 5px transparent;position:absolute;left:7px}.el-table .sort-caret.ascending{border-bottom-color:var(--el-text-color-placeholder);top:-5px}.el-table .sort-caret.descending{border-top-color:var(--el-text-color-placeholder);bottom:-3px}.el-table .ascending .sort-caret.ascending{border-bottom-color:var(--el-color-primary)}.el-table .descending .sort-caret.descending{border-top-color:var(--el-color-primary)}.el-table .hidden-columns{visibility:hidden;position:absolute;z-index:-1}.el-table--striped .el-table__body tr.el-table__row--striped td.el-table__cell{background:var(--el-fill-color-lighter)}.el-table--striped .el-table__body tr.el-table__row--striped.current-row td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table__body tr.hover-row>td.el-table__cell,.el-table__body tr.hover-row.current-row>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped.current-row>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table__body tr>td.hover-cell{background-color:var(--el-table-row-hover-bg-color)}.el-table__body tr.current-row>td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table.el-table--scrollable-y .el-table__body-header{position:sticky;top:0;z-index:calc(var(--el-table-index) + 2)}.el-table.el-table--scrollable-y .el-table__body-footer{position:sticky;bottom:0;z-index:calc(var(--el-table-index) + 2)}.el-table__column-resize-proxy{position:absolute;left:200px;top:0;bottom:0;width:0;border-left:var(--el-table-border);z-index:calc(var(--el-table-index) + 9)}.el-table__column-filter-trigger{display:inline-block;cursor:pointer}.el-table__column-filter-trigger i{color:var(--el-color-info);font-size:14px;vertical-align:middle}.el-table__border-left-patch{top:0;left:0;width:1px;height:100%;z-index:calc(var(--el-table-index) + 2);position:absolute;background-color:var(--el-table-border-color)}.el-table__border-bottom-patch{left:0;height:1px;z-index:calc(var(--el-table-index) + 2);position:absolute;background-color:var(--el-table-border-color)}.el-table__border-right-patch{top:0;height:100%;width:1px;z-index:calc(var(--el-table-index) + 2);position:absolute;background-color:var(--el-table-border-color)}.el-table--enable-row-transition .el-table__body td.el-table__cell{transition:background-color .25s ease}.el-table--enable-row-hover .el-table__body tr:hover>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table [class*=el-table__row--level] .el-table__expand-icon{display:inline-block;width:12px;line-height:12px;height:12px;text-align:center;margin-right:8px}.el-table .el-table.el-table--border .el-table__cell{border-right:var(--el-table-border)}.el-table:not(.el-table--border) .el-table__cell{border-right:none}.el-table:not(.el-table--border)>.el-table__inner-wrapper:after{content:none}.el-radio{--el-radio-font-size: var(--el-font-size-base);--el-radio-text-color: var(--el-text-color-regular);--el-radio-font-weight: var(--el-font-weight-primary);--el-radio-input-height: 14px;--el-radio-input-width: 14px;--el-radio-input-border-radius: var(--el-border-radius-circle);--el-radio-input-bg-color: var(--el-fill-color-blank);--el-radio-input-border: var(--el-border);--el-radio-input-border-color: var(--el-border-color);--el-radio-input-border-color-hover: var(--el-color-primary);color:var(--el-radio-text-color);font-weight:var(--el-radio-font-weight);position:relative;cursor:pointer;display:inline-flex;align-items:center;white-space:nowrap;outline:none;font-size:var(--el-font-size-base);-webkit-user-select:none;user-select:none;margin-right:30px;height:32px}.el-radio.el-radio--large{height:40px}.el-radio.el-radio--small{height:24px}.el-radio.is-bordered{padding:0 15px 0 9px;border-radius:var(--el-border-radius-base);border:var(--el-border);box-sizing:border-box}.el-radio.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-radio.is-bordered.is-disabled{cursor:not-allowed;border-color:var(--el-border-color-lighter)}.el-radio.is-bordered.el-radio--large{padding:0 19px 0 11px;border-radius:var(--el-border-radius-base)}.el-radio.is-bordered.el-radio--large .el-radio__label{font-size:var(--el-font-size-base)}.el-radio.is-bordered.el-radio--large .el-radio__inner{height:14px;width:14px}.el-radio.is-bordered.el-radio--small{padding:0 11px 0 7px;border-radius:var(--el-border-radius-base)}.el-radio.is-bordered.el-radio--small .el-radio__label{font-size:12px}.el-radio.is-bordered.el-radio--small .el-radio__inner{height:12px;width:12px}.el-radio:last-child{margin-right:0}.el-radio__input{white-space:nowrap;cursor:pointer;outline:none;display:inline-flex;position:relative;vertical-align:middle}.el-radio__input.is-disabled .el-radio__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);cursor:not-allowed}.el-radio__input.is-disabled .el-radio__inner:after{cursor:not-allowed;background-color:var(--el-disabled-bg-color)}.el-radio__input.is-disabled .el-radio__inner+.el-radio__label{cursor:not-allowed}.el-radio__input.is-disabled.is-checked .el-radio__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color)}.el-radio__input.is-disabled.is-checked .el-radio__inner:after{background-color:var(--el-text-color-placeholder)}.el-radio__input.is-disabled+span.el-radio__label{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-radio__input.is-checked .el-radio__inner{border-color:var(--el-color-primary);background:var(--el-color-primary)}.el-radio__input.is-checked .el-radio__inner:after{transform:translate(-50%,-50%) scale(1)}.el-radio__input.is-checked+.el-radio__label{color:var(--el-color-primary)}.el-radio__input.is-focus .el-radio__inner{border-color:var(--el-radio-input-border-color-hover)}.el-radio__inner{border:var(--el-radio-input-border);border-radius:var(--el-radio-input-border-radius);width:var(--el-radio-input-width);height:var(--el-radio-input-height);background-color:var(--el-radio-input-bg-color);position:relative;cursor:pointer;display:inline-block;box-sizing:border-box}.el-radio__inner:hover{border-color:var(--el-radio-input-border-color-hover)}.el-radio__inner:after{width:4px;height:4px;border-radius:var(--el-radio-input-border-radius);background-color:var(--el-color-white);content:"";position:absolute;left:50%;top:50%;transform:translate(-50%,-50%) scale(0);transition:transform .15s ease-in}.el-radio__original{opacity:0;outline:none;position:absolute;z-index:-1;top:0;left:0;right:0;bottom:0;margin:0}.el-radio__original:focus-visible+.el-radio__inner{outline:2px solid var(--el-radio-input-border-color-hover);outline-offset:1px;border-radius:var(--el-radio-input-border-radius)}.el-radio:focus:not(:focus-visible):not(.is-focus):not(:active):not(.is-disabled) .el-radio__inner{box-shadow:0 0 2px 2px var(--el-radio-input-border-color-hover)}.el-radio__label{font-size:var(--el-radio-font-size);padding-left:8px}.el-radio.el-radio--large .el-radio__label{font-size:14px}.el-radio.el-radio--large .el-radio__inner{width:14px;height:14px}.el-radio.el-radio--small .el-radio__label{font-size:12px}.el-radio.el-radio--small .el-radio__inner{width:12px;height:12px}.el-input-number{position:relative;display:inline-flex;width:150px;line-height:30px}.el-input-number .el-input__wrapper{padding-left:42px;padding-right:42px}.el-input-number .el-input__inner{-webkit-appearance:none;-moz-appearance:textfield;text-align:center;line-height:1}.el-input-number .el-input__inner::-webkit-inner-spin-button,.el-input-number .el-input__inner::-webkit-outer-spin-button{margin:0;-webkit-appearance:none}.el-input-number__increase,.el-input-number__decrease{display:flex;justify-content:center;align-items:center;height:auto;position:absolute;z-index:1;top:1px;bottom:1px;width:32px;background:var(--el-fill-color-light);color:var(--el-text-color-regular);cursor:pointer;font-size:13px;-webkit-user-select:none;user-select:none}.el-input-number__increase:hover,.el-input-number__decrease:hover{color:var(--el-color-primary)}.el-input-number__increase:hover~.el-input:not(.is-disabled) .el-input__wrapper,.el-input-number__decrease:hover~.el-input:not(.is-disabled) .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-border-color, var(--el-color-primary)) inset}.el-input-number__increase.is-disabled,.el-input-number__decrease.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-input-number__increase{right:1px;border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0;border-left:var(--el-border)}.el-input-number__decrease{left:1px;border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);border-right:var(--el-border)}.el-input-number.is-disabled .el-input-number__increase,.el-input-number.is-disabled .el-input-number__decrease{border-color:var(--el-disabled-border-color);color:var(--el-disabled-border-color)}.el-input-number.is-disabled .el-input-number__increase:hover,.el-input-number.is-disabled .el-input-number__decrease:hover{color:var(--el-disabled-border-color);cursor:not-allowed}.el-input-number--large{width:180px;line-height:38px}.el-input-number--large .el-input-number__increase,.el-input-number--large .el-input-number__decrease{width:40px;font-size:14px}.el-input-number--large .el-input--large .el-input__wrapper{padding-left:47px;padding-right:47px}.el-input-number--small{width:120px;line-height:22px}.el-input-number--small .el-input-number__increase,.el-input-number--small .el-input-number__decrease{width:24px;font-size:12px}.el-input-number--small .el-input--small .el-input__wrapper{padding-left:31px;padding-right:31px}.el-input-number--small .el-input-number__increase [class*=el-icon],.el-input-number--small .el-input-number__decrease [class*=el-icon]{transform:scale(.9)}.el-input-number.is-without-controls .el-input__wrapper{padding-left:15px;padding-right:15px}.el-input-number.is-controls-right .el-input__wrapper{padding-left:15px;padding-right:42px}.el-input-number.is-controls-right .el-input-number__increase,.el-input-number.is-controls-right .el-input-number__decrease{--el-input-number-controls-height: 15px;height:var(--el-input-number-controls-height);line-height:var(--el-input-number-controls-height)}.el-input-number.is-controls-right .el-input-number__increase [class*=el-icon],.el-input-number.is-controls-right .el-input-number__decrease [class*=el-icon]{transform:scale(.8)}.el-input-number.is-controls-right .el-input-number__increase{bottom:auto;left:auto;border-radius:0 var(--el-border-radius-base) 0 0;border-bottom:var(--el-border)}.el-input-number.is-controls-right .el-input-number__decrease{right:1px;top:auto;left:auto;border-right:none;border-left:var(--el-border);border-radius:0 0 var(--el-border-radius-base) 0}.el-input-number.is-controls-right[class*=large] [class*=increase],.el-input-number.is-controls-right[class*=large] [class*=decrease]{--el-input-number-controls-height: 19px}.el-input-number.is-controls-right[class*=small] [class*=increase],.el-input-number.is-controls-right[class*=small] [class*=decrease]{--el-input-number-controls-height: 11px}.el-table-column--selection .cell{padding-left:14px;padding-right:14px}.el-table-filter{border:solid 1px var(--el-border-color-lighter);border-radius:2px;background-color:#fff;box-shadow:var(--el-box-shadow-light);box-sizing:border-box}.el-table-filter__list{padding:5px 0;margin:0;list-style:none;min-width:100px}.el-table-filter__list-item{line-height:36px;padding:0 10px;cursor:pointer;font-size:var(--el-font-size-base)}.el-table-filter__list-item:hover{background-color:var(--el-color-primary-light-9);color:var(--el-color-primary)}.el-table-filter__list-item.is-active{background-color:var(--el-color-primary);color:#fff}.el-table-filter__content{min-width:100px}.el-table-filter__bottom{border-top:1px solid var(--el-border-color-lighter);padding:8px}.el-table-filter__bottom button{background:transparent;border:none;color:var(--el-text-color-regular);cursor:pointer;font-size:var(--el-font-size-small);padding:0 3px}.el-table-filter__bottom button:hover{color:var(--el-color-primary)}.el-table-filter__bottom button:focus{outline:none}.el-table-filter__bottom button.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-table-filter__wrap{max-height:280px}.el-table-filter__checkbox-group{padding:10px}.el-table-filter__checkbox-group label.el-checkbox{display:flex;align-items:center;margin-right:5px;margin-bottom:12px;margin-left:5px;height:unset}.el-table-filter__checkbox-group .el-checkbox:last-child{margin-bottom:0}.el-tag{--el-tag-font-size: 12px;--el-tag-border-radius: 4px;--el-tag-border-radius-rounded: 9999px;background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);color:var(--el-tag-text-color);display:inline-flex;justify-content:center;align-items:center;vertical-align:middle;height:24px;padding:0 9px;font-size:var(--el-tag-font-size);line-height:1;border-width:1px;border-style:solid;border-radius:var(--el-tag-border-radius);box-sizing:border-box;white-space:nowrap;--el-icon-size: 14px;--el-tag-bg-color: var(--el-color-primary-light-9);--el-tag-border-color: var(--el-color-primary-light-8);--el-tag-hover-color: var(--el-color-primary)}.el-tag.el-tag--primary{--el-tag-bg-color: var(--el-color-primary-light-9);--el-tag-border-color: var(--el-color-primary-light-8);--el-tag-hover-color: var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-bg-color: var(--el-color-success-light-9);--el-tag-border-color: var(--el-color-success-light-8);--el-tag-hover-color: var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-bg-color: var(--el-color-warning-light-9);--el-tag-border-color: var(--el-color-warning-light-8);--el-tag-hover-color: var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-bg-color: var(--el-color-danger-light-9);--el-tag-border-color: var(--el-color-danger-light-8);--el-tag-hover-color: var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-bg-color: var(--el-color-error-light-9);--el-tag-border-color: var(--el-color-error-light-8);--el-tag-hover-color: var(--el-color-error)}.el-tag.el-tag--info{--el-tag-bg-color: var(--el-color-info-light-9);--el-tag-border-color: var(--el-color-info-light-8);--el-tag-hover-color: var(--el-color-info)}.el-tag.is-hit{border-color:var(--el-color-primary)}.el-tag.is-round{border-radius:var(--el-tag-border-radius-rounded)}.el-tag .el-tag__close{flex-shrink:0;color:var(--el-tag-text-color)}.el-tag .el-tag__close:hover{color:var(--el-color-white);background-color:var(--el-tag-hover-color)}.el-tag.el-tag--primary{--el-tag-text-color: var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-text-color: var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-text-color: var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-text-color: var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-text-color: var(--el-color-error)}.el-tag.el-tag--info{--el-tag-text-color: var(--el-color-info)}.el-tag .el-icon{border-radius:50%;cursor:pointer;font-size:calc(var(--el-icon-size) - 2px);height:var(--el-icon-size);width:var(--el-icon-size)}.el-tag .el-tag__close{margin-left:6px}.el-tag--dark{--el-tag-text-color: var(--el-color-white);--el-tag-bg-color: var(--el-color-primary);--el-tag-border-color: var(--el-color-primary);--el-tag-hover-color: var(--el-color-primary-light-3)}.el-tag--dark.el-tag--primary{--el-tag-bg-color: var(--el-color-primary);--el-tag-border-color: var(--el-color-primary);--el-tag-hover-color: var(--el-color-primary-light-3)}.el-tag--dark.el-tag--success{--el-tag-bg-color: var(--el-color-success);--el-tag-border-color: var(--el-color-success);--el-tag-hover-color: var(--el-color-success-light-3)}.el-tag--dark.el-tag--warning{--el-tag-bg-color: var(--el-color-warning);--el-tag-border-color: var(--el-color-warning);--el-tag-hover-color: var(--el-color-warning-light-3)}.el-tag--dark.el-tag--danger{--el-tag-bg-color: var(--el-color-danger);--el-tag-border-color: var(--el-color-danger);--el-tag-hover-color: var(--el-color-danger-light-3)}.el-tag--dark.el-tag--error{--el-tag-bg-color: var(--el-color-error);--el-tag-border-color: var(--el-color-error);--el-tag-hover-color: var(--el-color-error-light-3)}.el-tag--dark.el-tag--info{--el-tag-bg-color: var(--el-color-info);--el-tag-border-color: var(--el-color-info);--el-tag-hover-color: var(--el-color-info-light-3)}.el-tag--dark.el-tag--primary,.el-tag--dark.el-tag--success,.el-tag--dark.el-tag--warning,.el-tag--dark.el-tag--danger,.el-tag--dark.el-tag--error,.el-tag--dark.el-tag--info{--el-tag-text-color: var(--el-color-white)}.el-tag--plain,.el-tag--plain.el-tag--primary{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-primary-light-5);--el-tag-hover-color: var(--el-color-primary)}.el-tag--plain.el-tag--success{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-success-light-5);--el-tag-hover-color: var(--el-color-success)}.el-tag--plain.el-tag--warning{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-warning-light-5);--el-tag-hover-color: var(--el-color-warning)}.el-tag--plain.el-tag--danger{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-danger-light-5);--el-tag-hover-color: var(--el-color-danger)}.el-tag--plain.el-tag--error{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-error-light-5);--el-tag-hover-color: var(--el-color-error)}.el-tag--plain.el-tag--info{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-info-light-5);--el-tag-hover-color: var(--el-color-info)}.el-tag.is-closable{padding-right:5px}.el-tag--large{padding:0 11px;height:32px;--el-icon-size: 16px}.el-tag--large .el-tag__close{margin-left:8px}.el-tag--large.is-closable{padding-right:7px}.el-tag--small{padding:0 7px;height:20px;--el-icon-size: 12px}.el-tag--small .el-tag__close{margin-left:4px}.el-tag--small.is-closable{padding-right:3px}.el-tag--small .el-icon-close{transform:scale(.8)}.el-tag.el-tag--primary.is-hit{border-color:var(--el-color-primary)}.el-tag.el-tag--success.is-hit{border-color:var(--el-color-success)}.el-tag.el-tag--warning.is-hit{border-color:var(--el-color-warning)}.el-tag.el-tag--danger.is-hit{border-color:var(--el-color-danger)}.el-tag.el-tag--error.is-hit{border-color:var(--el-color-error)}.el-tag.el-tag--info.is-hit{border-color:var(--el-color-info)}.el-message{z-index:99999!important}.setting-title{font-size:1.25rem;line-height:1.75rem;font-weight:700}.setting-row{display:flex;align-items:center;justify-content:space-between;padding-top:5px;font-size:14px}.danmu-btn-modifier{position:absolute;text-align:center;line-height:27px;margin:265px auto 0 14px;height:25px;width:204px;color:#fff;cursor:pointer;border-radius:15px;background:#ec6839}.danmu-btn-modifier:hover{background:#ef843d}[class*=danmudiv]{height:300px!important;background-color:#fff!important;background-image:none!important;border:1px solid #d7d7d7!important;border-radius:5px!important}.el-date-table{font-size:12px;-webkit-user-select:none;user-select:none}.el-date-table.is-week-mode .el-date-table__row:hover .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table.is-week-mode .el-date-table__row:hover td.available:hover{color:var(--el-datepicker-text-color)}.el-date-table.is-week-mode .el-date-table__row:hover td:first-child .el-date-table-cell{margin-left:5px;border-top-left-radius:15px;border-bottom-left-radius:15px}.el-date-table.is-week-mode .el-date-table__row:hover td:last-child .el-date-table-cell{margin-right:5px;border-top-right-radius:15px;border-bottom-right-radius:15px}.el-date-table.is-week-mode .el-date-table__row.current .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td{width:32px;height:30px;padding:4px 0;box-sizing:border-box;text-align:center;cursor:pointer;position:relative}.el-date-table td .el-date-table-cell{height:30px;padding:3px 0;box-sizing:border-box}.el-date-table td .el-date-table-cell .el-date-table-cell__text{width:24px;height:24px;display:block;margin:0 auto;line-height:24px;position:absolute;left:50%;transform:translate(-50%);border-radius:50%}.el-date-table td.next-month,.el-date-table td.prev-month{color:var(--el-datepicker-off-text-color)}.el-date-table td.today{position:relative}.el-date-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-date-table td.today.start-date .el-date-table-cell__text,.el-date-table td.today.end-date .el-date-table-cell__text{color:#fff}.el-date-table td.available:hover{color:var(--el-datepicker-hover-text-color)}.el-date-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-date-table td.current:not(.disabled) .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-date-table td.current:not(.disabled):focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-date-table td.start-date .el-date-table-cell,.el-date-table td.end-date .el-date-table-cell{color:#fff}.el-date-table td.start-date .el-date-table-cell__text,.el-date-table td.end-date .el-date-table-cell__text{background-color:var(--el-datepicker-active-color)}.el-date-table td.start-date .el-date-table-cell{margin-left:5px;border-top-left-radius:15px;border-bottom-left-radius:15px}.el-date-table td.end-date .el-date-table-cell{margin-right:5px;border-top-right-radius:15px;border-bottom-right-radius:15px}.el-date-table td.disabled .el-date-table-cell{background-color:var(--el-fill-color-light);opacity:1;cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-date-table td.selected .el-date-table-cell{margin-left:5px;margin-right:5px;border-radius:15px}.el-date-table td.selected .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);color:#fff;border-radius:15px}.el-date-table td.week{font-size:80%;color:var(--el-datepicker-header-text-color)}.el-date-table td:focus{outline:none}.el-date-table th{padding:5px;color:var(--el-datepicker-header-text-color);font-weight:400;border-bottom:solid 1px var(--el-border-color-lighter)}.el-month-table{font-size:12px;margin:-1px;border-collapse:collapse}.el-month-table td{width:68px;text-align:center;padding:8px 0;cursor:pointer;position:relative}.el-month-table td .el-date-table-cell{height:48px;padding:6px 0;box-sizing:border-box}.el-month-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-month-table td.today.start-date .el-date-table-cell__text,.el-month-table td.today.end-date .el-date-table-cell__text{color:#fff}.el-month-table td.disabled .el-date-table-cell__text{background-color:var(--el-fill-color-light);cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-month-table td.disabled .el-date-table-cell__text:hover{color:var(--el-text-color-placeholder)}.el-month-table td .el-date-table-cell__text{width:54px;height:36px;display:block;line-height:36px;color:var(--el-datepicker-text-color);margin:0 auto;border-radius:18px;position:absolute;left:50%;transform:translate(-50%)}.el-month-table td .el-date-table-cell__text:hover{color:var(--el-datepicker-hover-text-color)}.el-month-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-month-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-month-table td.start-date .el-date-table-cell,.el-month-table td.end-date .el-date-table-cell{color:#fff}.el-month-table td.start-date .el-date-table-cell__text,.el-month-table td.end-date .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-month-table td.start-date .el-date-table-cell{margin-left:3px;border-top-left-radius:24px;border-bottom-left-radius:24px}.el-month-table td.end-date .el-date-table-cell{margin-right:3px;border-top-right-radius:24px;border-bottom-right-radius:24px}.el-month-table td.current:not(.disabled) .el-date-table-cell{border-radius:24px;margin-left:3px;margin-right:3px}.el-month-table td.current:not(.disabled) .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-month-table td:focus-visible{outline:none}.el-month-table td:focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-year-table{font-size:12px;margin:-1px;border-collapse:collapse}.el-year-table .el-icon{color:var(--el-datepicker-icon-color)}.el-year-table td{width:68px;text-align:center;padding:8px 0;cursor:pointer;position:relative}.el-year-table td .el-date-table-cell{height:48px;padding:6px 0;box-sizing:border-box}.el-year-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-year-table td.today.start-date .el-date-table-cell__text,.el-year-table td.today.end-date .el-date-table-cell__text{color:#fff}.el-year-table td.disabled .el-date-table-cell__text{background-color:var(--el-fill-color-light);cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-year-table td.disabled .el-date-table-cell__text:hover{color:var(--el-text-color-placeholder)}.el-year-table td .el-date-table-cell__text{width:60px;height:36px;display:block;line-height:36px;color:var(--el-datepicker-text-color);border-radius:18px;margin:0 auto;position:absolute;left:50%;transform:translate(-50%)}.el-year-table td .el-date-table-cell__text:hover{color:var(--el-datepicker-hover-text-color)}.el-year-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-year-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-year-table td.start-date .el-date-table-cell,.el-year-table td.end-date .el-date-table-cell{color:#fff}.el-year-table td.start-date .el-date-table-cell__text,.el-year-table td.end-date .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-year-table td.start-date .el-date-table-cell{border-top-left-radius:24px;border-bottom-left-radius:24px}.el-year-table td.end-date .el-date-table-cell{border-top-right-radius:24px;border-bottom-right-radius:24px}.el-year-table td.current:not(.disabled) .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-year-table td:focus-visible{outline:none}.el-year-table td:focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-time-spinner.has-seconds .el-time-spinner__wrapper{width:33.3%}.el-time-spinner__wrapper{max-height:192px;overflow:auto;display:inline-block;width:50%;vertical-align:top;position:relative}.el-time-spinner__wrapper.el-scrollbar__wrap:not(.el-scrollbar__wrap--hidden-default){padding-bottom:15px}.el-time-spinner__wrapper.is-arrow{box-sizing:border-box;text-align:center;overflow:hidden}.el-time-spinner__wrapper.is-arrow .el-time-spinner__list{transform:translateY(-32px)}.el-time-spinner__wrapper.is-arrow .el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:default}.el-time-spinner__arrow{font-size:12px;color:var(--el-text-color-secondary);position:absolute;left:0;width:100%;z-index:var(--el-index-normal);text-align:center;height:30px;line-height:30px;cursor:pointer}.el-time-spinner__arrow:hover{color:var(--el-color-primary)}.el-time-spinner__arrow.arrow-up{top:10px}.el-time-spinner__arrow.arrow-down{bottom:10px}.el-time-spinner__input.el-input{width:70%}.el-time-spinner__input.el-input .el-input__inner{padding:0;text-align:center}.el-time-spinner__list{padding:0;margin:0;list-style:none;text-align:center}.el-time-spinner__list:after,.el-time-spinner__list:before{content:"";display:block;width:100%;height:80px}.el-time-spinner__item{height:32px;line-height:32px;font-size:12px;color:var(--el-text-color-regular)}.el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:pointer}.el-time-spinner__item.is-active:not(.is-disabled){color:var(--el-text-color-primary);font-weight:700}.el-time-spinner__item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center top}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center bottom}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transition:var(--el-transition-md-fade);transform-origin:top left}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-leave-active,.el-collapse-transition-enter-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-picker__popper{--el-datepicker-border-color: var(--el-disabled-border-color)}.el-picker__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-datepicker-border-color);box-shadow:var(--el-box-shadow-light)}.el-picker__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-datepicker-border-color)}.el-picker__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-date-editor{--el-date-editor-width: 220px;--el-date-editor-monthrange-width: 300px;--el-date-editor-daterange-width: 350px;--el-date-editor-datetimerange-width: 400px;--el-input-text-color: var(--el-text-color-regular);--el-input-border: var(--el-border);--el-input-hover-border: var(--el-border-color-hover);--el-input-focus-border: var(--el-color-primary);--el-input-transparent-border: 0 0 0 1px transparent inset;--el-input-border-color: var(--el-border-color);--el-input-border-radius: var(--el-border-radius-base);--el-input-bg-color: var(--el-fill-color-blank);--el-input-icon-color: var(--el-text-color-placeholder);--el-input-placeholder-color: var(--el-text-color-placeholder);--el-input-hover-border-color: var(--el-border-color-hover);--el-input-clear-hover-color: var(--el-text-color-secondary);--el-input-focus-border-color: var(--el-color-primary);--el-input-width: 100%;position:relative;text-align:left;vertical-align:middle}.el-date-editor.el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-border-color, var(--el-border-color)) inset}.el-date-editor.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-date-editor.el-input,.el-date-editor.el-input__wrapper{width:var(--el-date-editor-width);height:var(--el-input-height, var(--el-component-size))}.el-date-editor--monthrange{--el-date-editor-width: var(--el-date-editor-monthrange-width)}.el-date-editor--daterange,.el-date-editor--timerange{--el-date-editor-width: var(--el-date-editor-daterange-width)}.el-date-editor--datetimerange{--el-date-editor-width: var(--el-date-editor-datetimerange-width)}.el-date-editor--dates .el-input__wrapper{text-overflow:ellipsis;white-space:nowrap}.el-date-editor .close-icon,.el-date-editor .clear-icon{cursor:pointer}.el-date-editor .clear-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__icon{height:inherit;font-size:14px;color:var(--el-text-color-placeholder);float:left}.el-date-editor .el-range__icon svg{vertical-align:middle}.el-date-editor .el-range-input{-webkit-appearance:none;-moz-appearance:none;appearance:none;border:none;outline:none;display:inline-block;height:30px;line-height:30px;margin:0;padding:0;width:39%;text-align:center;font-size:var(--el-font-size-base);color:var(--el-text-color-regular);background-color:transparent}.el-date-editor .el-range-input::placeholder{color:var(--el-text-color-placeholder)}.el-date-editor .el-range-separator{flex:1;display:inline-flex;justify-content:center;align-items:center;height:100%;padding:0 5px;margin:0;font-size:14px;overflow-wrap:break-word;color:var(--el-text-color-primary)}.el-date-editor .el-range__close-icon{font-size:14px;color:var(--el-text-color-placeholder);height:inherit;width:unset;cursor:pointer}.el-date-editor .el-range__close-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__close-icon svg{vertical-align:middle}.el-date-editor .el-range__close-icon--hidden{opacity:0;visibility:hidden}.el-range-editor.el-input__wrapper{display:inline-flex;align-items:center;padding:0 10px}.el-range-editor.is-active,.el-range-editor.is-active:hover{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-range-editor--large{line-height:var(--el-component-size-large)}.el-range-editor--large.el-input__wrapper{height:var(--el-component-size-large)}.el-range-editor--large .el-range-separator{line-height:40px;font-size:14px}.el-range-editor--large .el-range-input{height:38px;line-height:38px;font-size:14px}.el-range-editor--small{line-height:var(--el-component-size-small)}.el-range-editor--small.el-input__wrapper{height:var(--el-component-size-small)}.el-range-editor--small .el-range-separator{line-height:24px;font-size:12px}.el-range-editor--small .el-range-input{height:22px;line-height:22px;font-size:12px}.el-range-editor.is-disabled{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled:hover,.el-range-editor.is-disabled:focus{border-color:var(--el-disabled-border-color)}.el-range-editor.is-disabled input{background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled input::placeholder{color:var(--el-text-color-placeholder)}.el-range-editor.is-disabled .el-range-separator{color:var(--el-disabled-text-color)}.el-picker-panel{color:var(--el-text-color-regular);background:var(--el-bg-color-overlay);border-radius:var(--el-border-radius-base);line-height:30px}.el-picker-panel .el-time-panel{margin:5px 0;border:solid 1px var(--el-datepicker-border-color);background-color:var(--el-bg-color-overlay);box-shadow:var(--el-box-shadow-light)}.el-picker-panel__body:after,.el-picker-panel__body-wrapper:after{content:"";display:table;clear:both}.el-picker-panel__content{position:relative;margin:15px}.el-picker-panel__footer{border-top:1px solid var(--el-datepicker-inner-border-color);padding:4px 12px;text-align:right;background-color:var(--el-bg-color-overlay);position:relative;font-size:0}.el-picker-panel__shortcut{display:block;width:100%;border:0;background-color:transparent;line-height:28px;font-size:14px;color:var(--el-datepicker-text-color);padding-left:12px;text-align:left;outline:none;cursor:pointer}.el-picker-panel__shortcut:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__shortcut.active{background-color:#e6f1fe;color:var(--el-datepicker-active-color)}.el-picker-panel__btn{border:1px solid var(--el-fill-color-darker);color:var(--el-text-color-primary);line-height:24px;border-radius:2px;padding:0 20px;cursor:pointer;background-color:transparent;outline:none;font-size:12px}.el-picker-panel__btn[disabled]{color:var(--el-text-color-disabled);cursor:not-allowed}.el-picker-panel__icon-btn{font-size:12px;color:var(--el-datepicker-icon-color);border:0;background:transparent;cursor:pointer;outline:none;margin-top:8px}.el-picker-panel__icon-btn:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn:focus-visible{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn.is-disabled{color:var(--el-text-color-disabled)}.el-picker-panel__icon-btn.is-disabled:hover{cursor:not-allowed}.el-picker-panel__icon-btn .el-icon{cursor:pointer;font-size:inherit}.el-picker-panel__link-btn{vertical-align:middle}.el-picker-panel *[slot=sidebar],.el-picker-panel__sidebar{position:absolute;top:0;bottom:0;width:110px;border-right:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;padding-top:6px;background-color:var(--el-bg-color-overlay);overflow:auto}.el-picker-panel *[slot=sidebar]+.el-picker-panel__body,.el-picker-panel__sidebar+.el-picker-panel__body{margin-left:110px}.el-date-picker{--el-datepicker-text-color: var(--el-text-color-regular);--el-datepicker-off-text-color: var(--el-text-color-placeholder);--el-datepicker-header-text-color: var(--el-text-color-regular);--el-datepicker-icon-color: var(--el-text-color-primary);--el-datepicker-border-color: var(--el-disabled-border-color);--el-datepicker-inner-border-color: var(--el-border-color-light);--el-datepicker-inrange-bg-color: var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color: var(--el-border-color-extra-light);--el-datepicker-active-color: var(--el-color-primary);--el-datepicker-hover-text-color: var(--el-color-primary);width:322px}.el-date-picker.has-sidebar.has-time{width:434px}.el-date-picker.has-sidebar{width:438px}.el-date-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-picker .el-picker-panel__content{width:292px}.el-date-picker table{table-layout:fixed;width:100%}.el-date-picker__editor-wrap{position:relative;display:table-cell;padding:0 5px}.el-date-picker__time-header{position:relative;border-bottom:1px solid var(--el-datepicker-inner-border-color);font-size:12px;padding:8px 5px 5px;display:table;width:100%;box-sizing:border-box}.el-date-picker__header{margin:12px;text-align:center}.el-date-picker__header--bordered{margin-bottom:0;padding-bottom:12px;border-bottom:solid 1px var(--el-border-color-lighter)}.el-date-picker__header--bordered+.el-picker-panel__content{margin-top:0}.el-date-picker__header-label{font-size:16px;font-weight:500;padding:0 5px;line-height:22px;text-align:center;cursor:pointer;color:var(--el-text-color-regular)}.el-date-picker__header-label:hover{color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label:focus-visible{outline:none;color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label.active{color:var(--el-datepicker-active-color)}.el-date-picker__prev-btn{float:left}.el-date-picker__next-btn{float:right}.el-date-picker__time-wrap{padding:10px;text-align:center}.el-date-picker__time-label{float:left;cursor:pointer;line-height:30px;margin-left:10px}.el-date-picker .el-time-panel{position:absolute}.el-date-range-picker{--el-datepicker-text-color: var(--el-text-color-regular);--el-datepicker-off-text-color: var(--el-text-color-placeholder);--el-datepicker-header-text-color: var(--el-text-color-regular);--el-datepicker-icon-color: var(--el-text-color-primary);--el-datepicker-border-color: var(--el-disabled-border-color);--el-datepicker-inner-border-color: var(--el-border-color-light);--el-datepicker-inrange-bg-color: var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color: var(--el-border-color-extra-light);--el-datepicker-active-color: var(--el-color-primary);--el-datepicker-hover-text-color: var(--el-color-primary);width:646px}.el-date-range-picker.has-sidebar{width:756px}.el-date-range-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-range-picker table{table-layout:fixed;width:100%}.el-date-range-picker .el-picker-panel__body{min-width:513px}.el-date-range-picker .el-picker-panel__content{margin:0}.el-date-range-picker__header{position:relative;text-align:center;height:28px}.el-date-range-picker__header [class*=arrow-left]{float:left}.el-date-range-picker__header [class*=arrow-right]{float:right}.el-date-range-picker__header div{font-size:16px;font-weight:500;margin-right:50px}.el-date-range-picker__content{float:left;width:50%;box-sizing:border-box;margin:0;padding:16px}.el-date-range-picker__content.is-left{border-right:1px solid var(--el-datepicker-inner-border-color)}.el-date-range-picker__content .el-date-range-picker__header div{margin-left:50px;margin-right:50px}.el-date-range-picker__editors-wrap{box-sizing:border-box;display:table-cell}.el-date-range-picker__editors-wrap.is-right{text-align:right}.el-date-range-picker__time-header{position:relative;border-bottom:1px solid var(--el-datepicker-inner-border-color);font-size:12px;padding:8px 5px 5px;display:table;width:100%;box-sizing:border-box}.el-date-range-picker__time-header>.el-icon-arrow-right{font-size:20px;vertical-align:middle;display:table-cell;color:var(--el-datepicker-icon-color)}.el-date-range-picker__time-picker-wrap{position:relative;display:table-cell;padding:0 5px}.el-date-range-picker__time-picker-wrap .el-picker-panel{position:absolute;top:13px;right:0;z-index:1;background:#fff}.el-date-range-picker__time-picker-wrap .el-time-panel{position:absolute}.el-time-range-picker{width:354px;overflow:visible}.el-time-range-picker__content{position:relative;text-align:center;padding:10px;z-index:1}.el-time-range-picker__cell{box-sizing:border-box;margin:0;padding:4px 7px 7px;width:50%;display:inline-block}.el-time-range-picker__header{margin-bottom:5px;text-align:center;font-size:14px}.el-time-range-picker__body{border-radius:2px;border:1px solid var(--el-datepicker-border-color)}.el-time-panel{border-radius:2px;position:relative;width:180px;left:0;z-index:var(--el-index-top);-webkit-user-select:none;user-select:none;box-sizing:content-box}.el-time-panel__content{font-size:0;position:relative;overflow:hidden}.el-time-panel__content:after,.el-time-panel__content:before{content:"";top:50%;position:absolute;margin-top:-16px;height:32px;z-index:-1;left:0;right:0;box-sizing:border-box;padding-top:6px;text-align:left}.el-time-panel__content:after{left:50%;margin-left:12%;margin-right:12%}.el-time-panel__content:before{padding-left:50%;margin-right:12%;margin-left:12%;border-top:1px solid var(--el-border-color-light);border-bottom:1px solid var(--el-border-color-light)}.el-time-panel__content.has-seconds:after{left:66.6666666667%}.el-time-panel__content.has-seconds:before{padding-left:33.3333333333%}.el-time-panel__footer{border-top:1px solid var(--el-timepicker-inner-border-color, var(--el-border-color-light));padding:4px;height:36px;line-height:25px;text-align:right;box-sizing:border-box}.el-time-panel__btn{border:none;line-height:28px;padding:0 5px;margin:0 5px;cursor:pointer;background-color:transparent;outline:none;font-size:12px;color:var(--el-text-color-primary)}.el-time-panel__btn.confirm{font-weight:800;color:var(--el-timepicker-active-color, var(--el-color-primary))}.el-checkbox-group{font-size:0;line-height:0} ');
System.addImportMap({ imports: {"vue":"user:vue","pinia":"user:pinia","dayjs":"user:dayjs","qs":"user:qs","vue-demi":"user:vue-demi"} });
System.set("user:vue", (()=>{const _=Vue;('default' in _)||(_.default=_);return _})());
System.set("user:pinia", (()=>{const _=Pinia;('default' in _)||(_.default=_);return _})());
System.set("user:dayjs", (()=>{const _=dayjs;('default' in _)||(_.default=_);return _})());
System.set("user:qs", (()=>{const _=Qs;('default' in _)||(_.default=_);return _})());
System.set("user:vue-demi", (()=>{const _=VueDemi;('default' in _)||(_.default=_);return _})());
System.register("./__entry.js", ['./__monkey.entry-DHMkWzvL.js'], (function (exports, module) {
'use strict';
return {
setters: [null],
execute: (function () {
})
};
}));
System.register("./__monkey.entry-DHMkWzvL.js", [], (function (exports, module) {
'use strict';
return {
execute: (function () {
const e = function e2() {
const t2 = typeof document !== "undefined" && document.createElement("link").relList;
return t2 && t2.supports && t2.supports("modulepreload") ? "modulepreload" : "preload";
}();
const t = function(e3) {
return "/" + e3;
};
const n = {};
const o = function o2(r2, i2, s2) {
let d = Promise.resolve();
if (i2 && i2.length > 0) {
document.getElementsByTagName("link");
const o3 = document.querySelector("meta[property=csp-nonce]");
const r3 = (o3 == null ? void 0 : o3.nonce) || (o3 == null ? void 0 : o3.getAttribute("nonce"));
d = Promise.all(i2.map((o4) => {
o4 = t(o4);
if (o4 in n) return;
n[o4] = true;
const i3 = o4.endsWith(".css");
const s3 = i3 ? '[rel="stylesheet"]' : "";
if (document.querySelector(`link[href="${o4}"]${s3}`)) {
return;
}
const d2 = document.createElement("link");
d2.rel = i3 ? "stylesheet" : e;
if (!i3) {
d2.as = "script";
d2.crossOrigin = "";
}
d2.href = o4;
if (r3) {
d2.setAttribute("nonce", r3);
}
document.head.appendChild(d2);
if (i3) {
return new Promise((e3, t2) => {
d2.addEventListener("load", e3);
d2.addEventListener("error", () => t2(new Error(`Unable to preload CSS for ${o4}`)));
});
}
}));
}
return d.then(() => r2()).catch((e3) => {
const t2 = new Event("vite:preloadError", { cancelable: true });
t2.payload = e3;
window.dispatchEvent(t2);
if (!t2.defaultPrevented) {
throw e3;
}
});
};
var r = exports("r", /* @__PURE__ */ (() => typeof GM_registerMenuCommand != "undefined" ? GM_registerMenuCommand : void 0)());
var i = exports("i", /* @__PURE__ */ (() => typeof GM_xmlhttpRequest != "undefined" ? GM_xmlhttpRequest : void 0)());
var s = exports("s", /* @__PURE__ */ (() => typeof unsafeWindow != "undefined" ? unsafeWindow : void 0)());
(async () => {
if (!document.querySelector(".layout-Main")) {
return;
}
const e3 = "DOUYUCRX";
s[e3] = {};
await o(() => module.import('./index-BqwrdpQQ-D2JkU8d-.js'), void 0 );
o(() => module.import('./index-B30Rk5mQ-XjBNwp0Q.js'), void 0 );
})();
})
};
}));
System.register("./index-BqwrdpQQ-D2JkU8d-.js", ['vue', './pageful-B6Krc0i4-BxfQe0NR.js', 'pinia', './__monkey.entry-DHMkWzvL.js', 'dayjs', 'vue-demi', 'qs'], (function (exports, module) {
'use strict';
var defineComponent, useSlots, computed, ref, openBlock, createBlock, unref, withCtx, createVNode, Transition, withDirectives, createElementVNode, mergeProps, withModifiers, normalizeClass, createElementBlock, renderSlot, toDisplayString, createCommentVNode, vShow, reactive, watch, onMounted, onUpdated, withKeys, resolveDynamicComponent, normalizeStyle, getCurrentInstance, inject, nextTick, h, onUnmounted, provide, onBeforeMount, onBeforeUnmount, Fragment, createTextVNode, renderList, createApp, shallowRef, isRef, resolveComponent, resolveDirective, watchEffect, Comment, isVNode, toRefs, render, Mt, ti, uh, Ci, zi, Bi, dh, rl, ev, nh, xp, Ud, El, $d, li, wd, Hs, Bd, Gd, Vs, Kd, Yd, Rs, fi, il, Pl, cm, vl, Nl, lf, ni, Jl, Zd, pi, vi, Js, zl, Bm, Ef, lv, lm, tl, nl, Te, Ms, bt, ui, yi, Xs, tt, Ze, ct, cl, fl, di, Be, Dl, Ul, Gh, Jh, Yh, og, rg, sg, ig, cg, fg, mi, ch, Ds, wt, vt, Ue, rm, Gm, Zm, mh, Bh, wh, Xm, Hn, Qn, fn, Lt, Ws, el, rn, no, qn, Yn, va, gi, Gs, nr, Kn, yo, Qo, Gt, fo, gn, ro, Wt, Ut, mt, Xn, or, Pa, aa, ta, yt, Yt, dr, Qr, Es, Cs, ir, ea, defineStore, createPinia, r, s, je;
return {
setters: [module => {
defineComponent = module.defineComponent;
useSlots = module.useSlots;
computed = module.computed;
ref = module.ref;
openBlock = module.openBlock;
createBlock = module.createBlock;
unref = module.unref;
withCtx = module.withCtx;
createVNode = module.createVNode;
Transition = module.Transition;
withDirectives = module.withDirectives;
createElementVNode = module.createElementVNode;
mergeProps = module.mergeProps;
withModifiers = module.withModifiers;
normalizeClass = module.normalizeClass;
createElementBlock = module.createElementBlock;
renderSlot = module.renderSlot;
toDisplayString = module.toDisplayString;
createCommentVNode = module.createCommentVNode;
vShow = module.vShow;
reactive = module.reactive;
watch = module.watch;
onMounted = module.onMounted;
onUpdated = module.onUpdated;
withKeys = module.withKeys;
resolveDynamicComponent = module.resolveDynamicComponent;
normalizeStyle = module.normalizeStyle;
getCurrentInstance = module.getCurrentInstance;
inject = module.inject;
nextTick = module.nextTick;
h = module.h;
onUnmounted = module.onUnmounted;
provide = module.provide;
onBeforeMount = module.onBeforeMount;
onBeforeUnmount = module.onBeforeUnmount;
Fragment = module.Fragment;
createTextVNode = module.createTextVNode;
renderList = module.renderList;
createApp = module.createApp;
shallowRef = module.shallowRef;
isRef = module.isRef;
resolveComponent = module.resolveComponent;
resolveDirective = module.resolveDirective;
watchEffect = module.watchEffect;
Comment = module.Comment;
isVNode = module.isVNode;
toRefs = module.toRefs;
render = module.render;
}, module => {
Mt = module.M;
ti = module.t;
uh = module.u;
Ci = module.C;
zi = module.z;
Bi = module.B;
dh = module.d;
rl = module.r;
ev = module.e;
nh = module.n;
xp = module.x;
Ud = module.U;
El = module.E;
$d = module.$;
li = module.l;
wd = module.w;
Hs = module.H;
Bd = module.a;
Gd = module.G;
Vs = module.V;
Kd = module.K;
Yd = module.Y;
Rs = module.R;
fi = module.f;
il = module.i;
Pl = module.P;
cm = module.c;
vl = module.v;
Nl = module.N;
lf = module.b;
ni = module.g;
Jl = module.J;
Zd = module.Z;
pi = module.p;
vi = module.h;
Js = module.j;
zl = module.k;
Bm = module.m;
Ef = module.o;
lv = module.q;
lm = module.s;
tl = module.y;
nl = module.A;
Te = module.T;
Ms = module.D;
bt = module.F;
ui = module.I;
yi = module.L;
Xs = module.X;
tt = module.O;
Ze = module.Q;
ct = module.S;
cl = module.W;
fl = module._;
di = module.a0;
Be = module.a1;
Dl = module.a2;
Ul = module.a3;
Gh = module.a4;
Jh = module.a5;
Yh = module.a6;
og = module.a7;
rg = module.a8;
sg = module.a9;
ig = module.aa;
cg = module.ab;
fg = module.ac;
mi = module.ad;
ch = module.ae;
Ds = module.af;
wt = module.ag;
vt = module.ah;
Ue = module.ai;
rm = module.aj;
Gm = module.ak;
Zm = module.al;
mh = module.am;
Bh = module.an;
wh = module.ao;
Xm = module.ap;
Hn = module.aq;
Qn = module.ar;
fn = module.as;
Lt = module.at;
Ws = module.au;
el = module.av;
rn = module.aw;
no = module.ax;
qn = module.ay;
Yn = module.az;
va = module.aA;
gi = module.aB;
Gs = module.aC;
nr = module.aD;
Kn = module.aE;
yo = module.aF;
Qo = module.aG;
Gt = module.aH;
fo = module.aI;
gn = module.aJ;
ro = module.aK;
Wt = module.aL;
Ut = module.aM;
mt = module.aN;
Xn = module.aO;
or = module.aP;
Pa = module.aQ;
aa = module.aR;
ta = module.aS;
yt = module.aT;
Yt = module.aU;
dr = module.aV;
Qr = module.aW;
Es = module.aX;
Cs = module.aY;
ir = module.aZ;
ea = module.a_;
}, module => {
defineStore = module.defineStore;
createPinia = module.createPinia;
}, module => {
r = module.r;
s = module.s;
}, module => {
je = module.default;
}, null, null],
execute: (function () {
var __getOwnPropNames = Object.getOwnPropertyNames;
var __commonJS = (cb, mod) => function __require() {
return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports;
};
var require_index_002 = __commonJS({
"index-BqwrdpQQ.js"(exports, module) {
var il$1 = Object.create;
var ul = /* @__PURE__ */ function() {
function e2() {
}
return function(t2) {
if (!rn(t2)) {
return {};
}
if (il$1) {
return il$1(t2);
}
e2.prototype = t2;
var l2 = new e2();
e2.prototype = void 0;
return l2;
};
}();
function cl$1(e2, t2) {
var l2 = -1, n2 = e2.length;
t2 || (t2 = Array(n2));
while (++l2 < n2) {
t2[l2] = e2[l2];
}
return t2;
}
function dl(e2, t2, l2, n2) {
var o2 = !l2;
l2 || (l2 = {});
var a2 = -1, s2 = t2.length;
while (++a2 < s2) {
var r2 = t2[a2];
var i2 = void 0;
if (i2 === void 0) {
i2 = e2[r2];
}
if (o2) {
Kn(l2, r2, i2);
} else {
Xn(l2, r2, i2);
}
}
return l2;
}
function fl$1(e2, t2) {
return Hn(Qn(e2, t2, fn), e2 + "");
}
function pl(e2, t2, l2) {
if (!rn(l2)) {
return false;
}
var n2 = typeof t2;
if (n2 == "number" ? no(l2) && qn(t2, l2.length) : n2 == "string" && t2 in l2) {
return Yn(l2[t2], e2);
}
return false;
}
function vl$1(e2) {
return fl$1(function(t2, l2) {
var n2 = -1, o2 = l2.length, a2 = o2 > 1 ? l2[o2 - 1] : void 0, s2 = o2 > 2 ? l2[2] : void 0;
a2 = e2.length > 3 && typeof a2 == "function" ? (o2--, a2) : void 0;
if (s2 && pl(l2[0], l2[1], s2)) {
a2 = o2 < 3 ? void 0 : a2;
o2 = 1;
}
t2 = Object(t2);
while (++n2 < o2) {
var r2 = l2[n2];
if (r2) {
e2(t2, r2, n2, a2);
}
}
return t2;
});
}
function hl(e2) {
var t2 = [];
if (e2 != null) {
for (var l2 in Object(e2)) {
t2.push(l2);
}
}
return t2;
}
var ml = Object.prototype;
var gl = ml.hasOwnProperty;
function bl(e2) {
if (!rn(e2)) {
return hl(e2);
}
var t2 = ro(e2), l2 = [];
for (var n2 in e2) {
if (!(n2 == "constructor" && (t2 || !gl.call(e2, n2)))) {
l2.push(n2);
}
}
return l2;
}
function yl(e2) {
return no(e2) ? nr(e2, true) : bl(e2);
}
var wl = or(Object.getPrototypeOf, Object);
var xl = "[object Object]";
var Cl = Function.prototype, Sl = Object.prototype;
var kl = Cl.toString;
var El$1 = Sl.hasOwnProperty;
var Nl$1 = kl.call(Object);
function Rl(e2) {
if (!Wt(e2) || Ut(e2) != xl) {
return false;
}
var t2 = wl(e2);
if (t2 === null) {
return true;
}
var l2 = El$1.call(t2, "constructor") && t2.constructor;
return typeof l2 == "function" && l2 instanceof l2 && kl.call(l2) == Nl$1;
}
var Vl = typeof exports == "object" && exports && !exports.nodeType && exports;
var Al = Vl && typeof module == "object" && module && !module.nodeType && module;
var Ol = Al && Al.exports === Vl;
var $l = Ol ? Mt.Buffer : void 0;
$l ? $l.allocUnsafe : void 0;
function Ll(e2, t2) {
{
return e2.slice();
}
}
function Tl(e2) {
var t2 = new e2.constructor(e2.byteLength);
new Pa(t2).set(new Pa(e2));
return t2;
}
function Fl(e2, t2) {
var l2 = Tl(e2.buffer);
return new e2.constructor(l2, e2.byteOffset, e2.length);
}
function _l(e2) {
return typeof e2.constructor == "function" && !ro(e2) ? ul(wl(e2)) : {};
}
var Ml = 1, Hl = 2;
function Il(e2, t2, l2, n2) {
var o2 = l2.length, a2 = o2;
if (e2 == null) {
return !a2;
}
e2 = Object(e2);
while (o2--) {
var s2 = l2[o2];
if (s2[2] ? s2[1] !== e2[s2[0]] : !(s2[0] in e2)) {
return false;
}
}
while (++o2 < a2) {
s2 = l2[o2];
var r2 = s2[0], i2 = e2[r2], u2 = s2[1];
if (s2[2]) {
if (i2 === void 0 && !(r2 in e2)) {
return false;
}
} else {
var c2 = new va();
var d2;
if (!(d2 === void 0 ? Cs(u2, i2, Ml | Hl, n2, c2) : d2)) {
return false;
}
}
}
return true;
}
function Wl(e2) {
return e2 === e2 && !rn(e2);
}
function Bl(e2) {
var t2 = ir(e2), l2 = t2.length;
while (l2--) {
var n2 = t2[l2], o2 = e2[n2];
t2[l2] = [n2, o2, Wl(o2)];
}
return t2;
}
function Pl$1(e2, t2) {
return function(l2) {
if (l2 == null) {
return false;
}
return l2[e2] === t2 && (t2 !== void 0 || e2 in Object(l2));
};
}
function zl$1(e2) {
var t2 = Bl(e2);
if (t2.length == 1 && t2[0][2]) {
return Pl$1(t2[0][0], t2[0][1]);
}
return function(l2) {
return l2 === e2 || Il(l2, e2, t2);
};
}
var Dl$1 = 1, jl = 2;
function Kl(e2, t2) {
if (dr(e2) && Wl(t2)) {
return Pl$1(Qr(e2), t2);
}
return function(l2) {
var n2 = ta(l2, e2);
return n2 === void 0 && n2 === t2 ? Es(l2, e2) : Cs(t2, n2, Dl$1 | jl);
};
}
function Ul$1(e2) {
return function(t2) {
return t2 == null ? void 0 : t2[e2];
};
}
function Yl(e2) {
return function(t2) {
return ea(t2, e2);
};
}
function ql(e2) {
return dr(e2) ? Ul$1(Qr(e2)) : Yl(e2);
}
function Xl(e2) {
if (typeof e2 == "function") {
return e2;
}
if (e2 == null) {
return fn;
}
if (typeof e2 == "object") {
return Gt(e2) ? Kl(e2[0], e2[1]) : zl$1(e2);
}
return ql(e2);
}
function Gl(e2) {
return function(e3, t2, l2) {
var n2 = -1, o2 = Object(e3), a2 = l2(e3), s2 = a2.length;
while (s2--) {
var r2 = a2[++n2];
if (t2(o2[r2], r2, o2) === false) {
break;
}
}
return e3;
};
}
var Jl$1 = Gl();
function Ql(e2, t2) {
return e2 && Jl$1(e2, t2, ir);
}
function Zl(e2, t2) {
return function(t3, l2) {
if (t3 == null) {
return t3;
}
if (!no(t3)) {
return e2(t3, l2);
}
var n2 = t3.length, o2 = -1, a2 = Object(t3);
while (++o2 < n2) {
if (l2(a2[o2], o2, a2) === false) {
break;
}
}
return t3;
};
}
var en = Zl(Ql);
function tn(e2, t2, l2) {
if (l2 !== void 0 && !Yn(e2[t2], l2) || l2 === void 0 && !(t2 in e2)) {
Kn(e2, t2, l2);
}
}
function ln(e2) {
return Wt(e2) && no(e2);
}
function nn(e2, t2) {
if (t2 === "constructor" && typeof e2[t2] === "function") {
return;
}
if (t2 == "__proto__") {
return;
}
return e2[t2];
}
function on(e2) {
return dl(e2, yl(e2));
}
function an(e2, t2, l2, n2, o2, a2, s2) {
var r2 = nn(e2, l2), i2 = nn(t2, l2), u2 = s2.get(i2);
if (u2) {
tn(e2, l2, u2);
return;
}
var c2 = a2 ? a2(r2, i2, l2 + "", e2, t2, s2) : void 0;
var d2 = c2 === void 0;
if (d2) {
var f2 = Gt(i2), p2 = !f2 && yo(i2), v2 = !f2 && !p2 && Qo(i2);
c2 = i2;
if (f2 || p2 || v2) {
if (Gt(r2)) {
c2 = r2;
} else if (ln(r2)) {
c2 = cl$1(r2);
} else if (p2) {
d2 = false;
c2 = Ll(i2);
} else if (v2) {
d2 = false;
c2 = Fl(i2);
} else {
c2 = [];
}
} else if (Rl(i2) || fo(i2)) {
c2 = r2;
if (fo(r2)) {
c2 = on(r2);
} else if (!rn(r2) || gn(r2)) {
c2 = _l(i2);
}
} else {
d2 = false;
}
}
if (d2) {
s2.set(i2, c2);
o2(c2, i2, n2, a2, s2);
s2["delete"](i2);
}
tn(e2, l2, c2);
}
function sn(e2, t2, l2, n2, o2) {
if (e2 === t2) {
return;
}
Jl$1(t2, function(a2, s2) {
o2 || (o2 = new va());
if (rn(a2)) {
an(e2, t2, s2, l2, sn, n2, o2);
} else {
var r2 = n2 ? n2(nn(e2, s2), a2, s2 + "", e2, t2, o2) : void 0;
if (r2 === void 0) {
r2 = a2;
}
tn(e2, s2, r2);
}
}, yl);
}
function rn$1(e2, t2) {
var l2 = -1, n2 = no(e2) ? Array(e2.length) : [];
en(e2, function(e3, o2, a2) {
n2[++l2] = t2(e3, o2, a2);
});
return n2;
}
function un(e2, t2) {
var l2 = Gt(e2) ? Yt : rn$1;
return l2(e2, Xl(t2));
}
function cn(e2, t2) {
return aa(un(e2, t2));
}
var dn = vl$1(function(e2, t2, l2) {
sn(e2, t2, l2);
});
const fn$1 = (e2) => Te ? window.requestAnimationFrame(e2) : setTimeout(e2, 16);
const pn = (e2) => Lt(e2);
const vn = (e2) => ["", ...mi].includes(e2);
const hn = (e2, l2, n2) => {
const o2 = gi(e2.subTree).filter((e3) => {
var n3;
return isVNode(e3) && ((n3 = e3.type) == null ? void 0 : n3.name) === l2 && !!e3.component;
});
const a2 = o2.map((e3) => e3.component.uid);
return a2.map((e3) => n2[e3]).filter((e3) => !!e3);
};
const mn = (t2, l2) => {
const n2 = {};
const o2 = shallowRef([]);
const a2 = (e2) => {
n2[e2.uid] = e2;
o2.value = hn(t2, l2, n2);
};
const s2 = (e2) => {
delete n2[e2];
o2.value = o2.value.filter((t3) => t3.uid !== e2);
};
return { children: o2, addChild: a2, removeChild: s2 };
};
var gn$1 = false, bn, yn, wn, xn, Cn, Sn, kn, En, Nn, Rn, Vn, An, On, $n, Ln;
function Tn() {
if (!gn$1) {
gn$1 = true;
var e2 = navigator.userAgent, t2 = /(?:MSIE.(\d+\.\d+))|(?:(?:Firefox|GranParadiso|Iceweasel).(\d+\.\d+))|(?:Opera(?:.+Version.|.)(\d+\.\d+))|(?:AppleWebKit.(\d+(?:\.\d+)?))|(?:Trident\/\d+\.\d+.*rv:(\d+\.\d+))/.exec(e2), l2 = /(Mac OS X)|(Windows)|(Linux)/.exec(e2);
if (An = /\b(iPhone|iP[ao]d)/.exec(e2), On = /\b(iP[ao]d)/.exec(e2), Rn = /Android/i.exec(e2), $n = /FBAN\/\w+;/i.exec(e2), Ln = /Mobile/i.exec(e2), Vn = !!/Win64/.exec(e2), t2) {
bn = t2[1] ? parseFloat(t2[1]) : t2[5] ? parseFloat(t2[5]) : NaN, bn && document && document.documentMode && (bn = document.documentMode);
var n2 = /(?:Trident\/(\d+.\d+))/.exec(e2);
Sn = n2 ? parseFloat(n2[1]) + 4 : bn, yn = t2[2] ? parseFloat(t2[2]) : NaN, wn = t2[3] ? parseFloat(t2[3]) : NaN, xn = t2[4] ? parseFloat(t2[4]) : NaN, xn ? (t2 = /(?:Chrome\/(\d+\.\d+))/.exec(e2), Cn = t2 && t2[1] ? parseFloat(t2[1]) : NaN) : Cn = NaN;
} else bn = yn = wn = Cn = xn = NaN;
if (l2) {
if (l2[1]) {
var o2 = /(?:Mac OS X (\d+(?:[._]\d+)?))/.exec(e2);
kn = o2 ? parseFloat(o2[1].replace("_", ".")) : true;
} else kn = false;
En = !!l2[2], Nn = !!l2[3];
} else kn = En = Nn = false;
}
}
var Fn = { ie: function() {
return Tn() || bn;
}, ieCompatibilityMode: function() {
return Tn() || Sn > bn;
}, ie64: function() {
return Fn.ie() && Vn;
}, firefox: function() {
return Tn() || yn;
}, opera: function() {
return Tn() || wn;
}, webkit: function() {
return Tn() || xn;
}, safari: function() {
return Fn.webkit();
}, chrome: function() {
return Tn() || Cn;
}, windows: function() {
return Tn() || En;
}, osx: function() {
return Tn() || kn;
}, linux: function() {
return Tn() || Nn;
}, iphone: function() {
return Tn() || An;
}, mobile: function() {
return Tn() || An || On || Rn || Ln;
}, nativeApp: function() {
return Tn() || $n;
}, android: function() {
return Tn() || Rn;
}, ipad: function() {
return Tn() || On;
} }, _n = Fn;
var Mn = !!(typeof window < "u" && window.document && window.document.createElement), Hn$1 = { canUseDOM: Mn, canUseWorkers: typeof Worker < "u", canUseEventListeners: Mn && !!(window.addEventListener || window.attachEvent), canUseViewport: Mn && !!window.screen, isInWorker: !Mn }, In = Hn$1;
var Wn;
In.canUseDOM && (Wn = document.implementation && document.implementation.hasFeature && document.implementation.hasFeature("", "") !== true);
function Bn(e2, t2) {
if (!In.canUseDOM || t2 && !("addEventListener" in document)) return false;
var l2 = "on" + e2, n2 = l2 in document;
if (!n2) {
var o2 = document.createElement("div");
o2.setAttribute(l2, "return;"), n2 = typeof o2[l2] == "function";
}
return !n2 && Wn && e2 === "wheel" && (n2 = document.implementation.hasFeature("Events.wheel", "3.0")), n2;
}
var Pn = Bn;
var zn = 10, Dn = 40, jn = 800;
function Kn$1(e2) {
var t2 = 0, l2 = 0, n2 = 0, o2 = 0;
return "detail" in e2 && (l2 = e2.detail), "wheelDelta" in e2 && (l2 = -e2.wheelDelta / 120), "wheelDeltaY" in e2 && (l2 = -e2.wheelDeltaY / 120), "wheelDeltaX" in e2 && (t2 = -e2.wheelDeltaX / 120), "axis" in e2 && e2.axis === e2.HORIZONTAL_AXIS && (t2 = l2, l2 = 0), n2 = t2 * zn, o2 = l2 * zn, "deltaY" in e2 && (o2 = e2.deltaY), "deltaX" in e2 && (n2 = e2.deltaX), (n2 || o2) && e2.deltaMode && (e2.deltaMode == 1 ? (n2 *= Dn, o2 *= Dn) : (n2 *= jn, o2 *= jn)), n2 && !t2 && (t2 = n2 < 1 ? -1 : 1), o2 && !l2 && (l2 = o2 < 1 ? -1 : 1), { spinX: t2, spinY: l2, pixelX: n2, pixelY: o2 };
}
Kn$1.getEventType = function() {
return _n.firefox() ? "DOMMouseScroll" : Pn("wheel") ? "wheel" : "mousewheel";
};
var Un = Kn$1;
/**
* Checks if an event is supported in the current execution environment.
*
* NOTE: This will not work correctly for non-generic events such as `change`,
* `reset`, `load`, `error`, and `select`.
*
* Borrows from Modernizr.
*
* @param {string} eventNameSuffix Event name, e.g. "click".
* @param {?boolean} capture Check if the capture phase is supported.
* @return {boolean} True if the event is supported.
* @internal
* @license Modernizr 3.0.0pre (Custom Build) | MIT
*/
const Yn$1 = function(e2, t2) {
if (e2 && e2.addEventListener) {
const l2 = function(e3) {
const l3 = Un(e3);
t2 && Reflect.apply(t2, this, [e3, l3]);
};
e2.addEventListener("wheel", l2, { passive: true });
}
};
const qn$1 = { beforeMount(e2, t2) {
Yn$1(e2, t2.value);
} };
const Xn$1 = ti({ ...uh, direction: { type: String, default: "rtl", values: ["ltr", "rtl", "ttb", "btt"] }, size: { type: [String, Number], default: "30%" }, withHeader: { type: Boolean, default: true }, modalFade: { type: Boolean, default: true }, headerAriaLevel: { type: String, default: "2" } });
const Gn = ch;
const Jn = defineComponent({ name: "ElDrawer", inheritAttrs: false });
const Qn$1 = defineComponent({ ...Jn, props: Xn$1, emits: Gn, setup(e2, { expose: t2 }) {
const l2 = e2;
const C2 = useSlots();
Ci({ scope: "el-drawer", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/drawer.html#slots" }, computed(() => !!C2.title));
const S2 = ref();
const k2 = ref();
const E2 = zi("drawer");
const { t: N2 } = Bi();
const { afterEnter: R2, afterLeave: V2, beforeLeave: A2, visible: O2, rendered: $2, titleId: L2, bodyId: T2, zIndex: F2, onModalClick: _2, onOpenAutoFocus: M2, onCloseAutoFocus: H2, onFocusoutPrevented: I2, onCloseRequested: W2, handleClose: B2 } = dh(l2, S2);
const P2 = computed(() => l2.direction === "rtl" || l2.direction === "ltr");
const z2 = computed(() => rl(l2.size));
t2({ handleClose: B2, afterEnter: R2, afterLeave: V2 });
return (e3, t3) => (openBlock(), createBlock(unref(ev), { to: e3.appendTo, disabled: e3.appendTo !== "body" ? false : !e3.appendToBody }, { default: withCtx(() => [createVNode(Transition, { name: unref(E2).b("fade"), onAfterEnter: unref(R2), onAfterLeave: unref(V2), onBeforeLeave: unref(A2), persisted: "" }, { default: withCtx(() => [withDirectives(createVNode(unref(nh), { mask: e3.modal, "overlay-class": e3.modalClass, "z-index": unref(F2), onClick: unref(_2) }, { default: withCtx(() => [createVNode(unref(xp), { loop: "", trapped: unref(O2), "focus-trap-el": S2.value, "focus-start-el": k2.value, onFocusAfterTrapped: unref(M2), onFocusAfterReleased: unref(H2), onFocusoutPrevented: unref(I2), onReleaseRequested: unref(W2) }, { default: withCtx(() => [createElementVNode("div", mergeProps({ ref_key: "drawerRef", ref: S2, "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? unref(L2) : void 0, "aria-describedby": unref(T2) }, e3.$attrs, { class: [unref(E2).b(), e3.direction, unref(O2) && "open"], style: unref(P2) ? "width: " + unref(z2) : "height: " + unref(z2), role: "dialog", onClick: withModifiers(() => {
}, ["stop"]) }), [createElementVNode("span", { ref_key: "focusStartRef", ref: k2, class: normalizeClass(unref(E2).e("sr-focus")), tabindex: "-1" }, null, 2), e3.withHeader ? (openBlock(), createElementBlock("header", { key: 0, class: normalizeClass(unref(E2).e("header")) }, [!e3.$slots.title ? renderSlot(e3.$slots, "header", { key: 0, close: unref(B2), titleId: unref(L2), titleClass: unref(E2).e("title") }, () => [!e3.$slots.title ? (openBlock(), createElementBlock("span", { key: 0, id: unref(L2), role: "heading", "aria-level": e3.headerAriaLevel, class: normalizeClass(unref(E2).e("title")) }, toDisplayString(e3.title), 11, ["id", "aria-level"])) : createCommentVNode("v-if", true)]) : renderSlot(e3.$slots, "title", { key: 1 }, () => [createCommentVNode(" DEPRECATED SLOT ")]), e3.showClose ? (openBlock(), createElementBlock("button", { key: 2, "aria-label": unref(N2)("el.drawer.close"), class: normalizeClass(unref(E2).e("close-btn")), type: "button", onClick: unref(B2) }, [createVNode(unref(Ud), { class: normalizeClass(unref(E2).e("close")) }, { default: withCtx(() => [createVNode(unref(El))]), _: 1 }, 8, ["class"])], 10, ["aria-label", "onClick"])) : createCommentVNode("v-if", true)], 2)) : createCommentVNode("v-if", true), unref($2) ? (openBlock(), createElementBlock("div", { key: 1, id: unref(T2), class: normalizeClass(unref(E2).e("body")) }, [renderSlot(e3.$slots, "default")], 10, ["id"])) : createCommentVNode("v-if", true), e3.$slots.footer ? (openBlock(), createElementBlock("div", { key: 2, class: normalizeClass(unref(E2).e("footer")) }, [renderSlot(e3.$slots, "footer")], 2)) : createCommentVNode("v-if", true)], 16, ["aria-label", "aria-labelledby", "aria-describedby", "onClick"])]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])]), _: 3 }, 8, ["mask", "overlay-class", "z-index", "onClick"]), [[vShow, unref(O2)]])]), _: 3 }, 8, ["name", "onAfterEnter", "onAfterLeave", "onBeforeLeave"])]), _: 3 }, 8, ["to", "disabled"]));
} });
var Zn = $d(Qn$1, [["__file", "drawer.vue"]]);
const eo = li(Zn);
const to = ti({ id: { type: String, default: void 0 }, step: { type: Number, default: 1 }, stepStrictly: Boolean, max: { type: Number, default: Number.POSITIVE_INFINITY }, min: { type: Number, default: Number.NEGATIVE_INFINITY }, modelValue: Number, readonly: Boolean, disabled: Boolean, size: wd, controls: { type: Boolean, default: true }, controlsPosition: { type: String, default: "", values: ["", "right"] }, valueOnClear: { type: [String, Number, null], validator: (e2) => e2 === null || Hs(e2) || ["min", "max"].includes(e2), default: null }, name: String, placeholder: String, precision: { type: Number, validator: (e2) => e2 >= 0 && e2 === Number.parseInt(`${e2}`, 10) }, validateEvent: { type: Boolean, default: true }, ...Bd(["ariaLabel"]) });
const lo = { [pi]: (e2, t2) => t2 !== e2, blur: (e2) => e2 instanceof FocusEvent, focus: (e2) => e2 instanceof FocusEvent, [vi]: (e2) => Hs(e2) || Rs(e2), [fi]: (e2) => Hs(e2) || Rs(e2) };
const no$1 = defineComponent({ name: "ElInputNumber" });
const oo = defineComponent({ ...no$1, props: to, emits: lo, setup(e2, { expose: t2, emit: l2 }) {
const n2 = e2;
const { t: d2 } = Bi();
const p2 = zi("input-number");
const v2 = ref();
const y2 = reactive({ currentValue: n2.modelValue, userInput: null });
const { formItem: x2 } = Gd();
const R2 = computed(() => Hs(n2.modelValue) && n2.modelValue <= n2.min);
const V2 = computed(() => Hs(n2.modelValue) && n2.modelValue >= n2.max);
const A2 = computed(() => {
const e3 = _2(n2.step);
if (!Vs(n2.precision)) {
if (e3 > n2.precision) ;
return n2.precision;
} else {
return Math.max(_2(n2.modelValue), e3);
}
});
const O2 = computed(() => n2.controls && n2.controlsPosition === "right");
const $2 = Kd();
const L2 = Yd();
const T2 = computed(() => {
if (y2.userInput !== null) {
return y2.userInput;
}
let e3 = y2.currentValue;
if (Rs(e3)) return "";
if (Hs(e3)) {
if (Number.isNaN(e3)) return "";
if (!Vs(n2.precision)) {
e3 = e3.toFixed(n2.precision);
}
}
return e3;
});
const F2 = (e3, t3) => {
if (Vs(t3)) t3 = A2.value;
if (t3 === 0) return Math.round(e3);
let l3 = String(e3);
const n3 = l3.indexOf(".");
if (n3 === -1) return e3;
const o2 = l3.replace(".", "").split("");
const a2 = o2[n3 + t3];
if (!a2) return e3;
const s2 = l3.length;
if (l3.charAt(s2 - 1) === "5") {
l3 = `${l3.slice(0, Math.max(0, s2 - 1))}6`;
}
return Number.parseFloat(Number(l3).toFixed(t3));
};
const _2 = (e3) => {
if (Rs(e3)) return 0;
const t3 = e3.toString();
const l3 = t3.indexOf(".");
let n3 = 0;
if (l3 !== -1) {
n3 = t3.length - l3 - 1;
}
return n3;
};
const M2 = (e3, t3 = 1) => {
if (!Hs(e3)) return y2.currentValue;
return F2(e3 + n2.step * t3);
};
const H2 = () => {
if (n2.readonly || L2.value || V2.value) return;
const e3 = Number(T2.value) || 0;
const t3 = M2(e3);
B2(t3);
l2(vi, y2.currentValue);
Y2();
};
const I2 = () => {
if (n2.readonly || L2.value || R2.value) return;
const e3 = Number(T2.value) || 0;
const t3 = M2(e3, -1);
B2(t3);
l2(vi, y2.currentValue);
Y2();
};
const W2 = (e3, t3) => {
const { max: o2, min: a2, step: s2, precision: r2, stepStrictly: i2, valueOnClear: u2 } = n2;
if (o2 < a2) {
Xs("InputNumber", "min should not be greater than max.");
}
let c2 = Number(e3);
if (Rs(e3) || Number.isNaN(c2)) {
return null;
}
if (e3 === "") {
if (u2 === null) {
return null;
}
c2 = bt(u2) ? { min: a2, max: o2 }[u2] : u2;
}
if (i2) {
c2 = F2(Math.round(c2 / s2) * s2, r2);
}
if (!Vs(r2)) {
c2 = F2(c2, r2);
}
if (c2 > o2 || c2 < a2) {
c2 = c2 > o2 ? o2 : a2;
t3 && l2(fi, c2);
}
return c2;
};
const B2 = (e3, t3 = true) => {
var o2;
const a2 = y2.currentValue;
const s2 = W2(e3);
if (!t3) {
l2(fi, s2);
return;
}
if (a2 === s2 && e3) return;
y2.userInput = null;
l2(fi, s2);
if (a2 !== s2) {
l2(pi, s2, a2);
}
if (n2.validateEvent) {
(o2 = x2 == null ? void 0 : x2.validate) == null ? void 0 : o2.call(x2, "change").catch((e4) => Js());
}
y2.currentValue = s2;
};
const P2 = (e3) => {
y2.userInput = e3;
const t3 = e3 === "" ? null : Number(e3);
l2(vi, t3);
B2(t3, false);
};
const z2 = (e3) => {
const t3 = e3 !== "" ? Number(e3) : "";
if (Hs(t3) && !Number.isNaN(t3) || e3 === "") {
B2(t3);
}
Y2();
y2.userInput = null;
};
const D2 = () => {
var e3, t3;
(t3 = (e3 = v2.value) == null ? void 0 : e3.focus) == null ? void 0 : t3.call(e3);
};
const j2 = () => {
var e3, t3;
(t3 = (e3 = v2.value) == null ? void 0 : e3.blur) == null ? void 0 : t3.call(e3);
};
const K2 = (e3) => {
l2("focus", e3);
};
const U2 = (e3) => {
var t3;
y2.userInput = null;
l2("blur", e3);
if (n2.validateEvent) {
(t3 = x2 == null ? void 0 : x2.validate) == null ? void 0 : t3.call(x2, "blur").catch((e4) => Js());
}
};
const Y2 = () => {
if (y2.currentValue !== n2.modelValue) {
y2.currentValue = n2.modelValue;
}
};
const q2 = (e3) => {
if (document.activeElement === e3.target) e3.preventDefault();
};
watch(() => n2.modelValue, (e3, t3) => {
const l3 = W2(e3, true);
if (y2.userInput === null && l3 !== t3) {
y2.currentValue = l3;
}
}, { immediate: true });
onMounted(() => {
var e3;
const { min: t3, max: o2, modelValue: a2 } = n2;
const s2 = (e3 = v2.value) == null ? void 0 : e3.input;
s2.setAttribute("role", "spinbutton");
if (Number.isFinite(o2)) {
s2.setAttribute("aria-valuemax", String(o2));
} else {
s2.removeAttribute("aria-valuemax");
}
if (Number.isFinite(t3)) {
s2.setAttribute("aria-valuemin", String(t3));
} else {
s2.removeAttribute("aria-valuemin");
}
s2.setAttribute("aria-valuenow", y2.currentValue || y2.currentValue === 0 ? String(y2.currentValue) : "");
s2.setAttribute("aria-disabled", String(L2.value));
if (!Hs(a2) && a2 != null) {
let e4 = Number(a2);
if (Number.isNaN(e4)) {
e4 = null;
}
l2(fi, e4);
}
s2.addEventListener("wheel", q2, { passive: false });
});
onUpdated(() => {
var e3, t3;
const l3 = (e3 = v2.value) == null ? void 0 : e3.input;
l3 == null ? void 0 : l3.setAttribute("aria-valuenow", `${(t3 = y2.currentValue) != null ? t3 : ""}`);
});
t2({ focus: D2, blur: j2 });
return (e3, t3) => (openBlock(), createElementBlock("div", { class: normalizeClass([unref(p2).b(), unref(p2).m(unref($2)), unref(p2).is("disabled", unref(L2)), unref(p2).is("without-controls", !e3.controls), unref(p2).is("controls-right", unref(O2))]), onDragstart: withModifiers(() => {
}, ["prevent"]) }, [e3.controls ? withDirectives((openBlock(), createElementBlock("span", { key: 0, role: "button", "aria-label": unref(d2)("el.inputNumber.decrease"), class: normalizeClass([unref(p2).e("decrease"), unref(p2).is("disabled", unref(R2))]), onKeydown: withKeys(I2, ["enter"]) }, [renderSlot(e3.$slots, "decrease-icon", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [unref(O2) ? (openBlock(), createBlock(unref(il), { key: 0 })) : (openBlock(), createBlock(unref(Pl), { key: 1 }))]), _: 1 })])], 42, ["aria-label", "onKeydown"])), [[unref(cm), I2]]) : createCommentVNode("v-if", true), e3.controls ? withDirectives((openBlock(), createElementBlock("span", { key: 1, role: "button", "aria-label": unref(d2)("el.inputNumber.increase"), class: normalizeClass([unref(p2).e("increase"), unref(p2).is("disabled", unref(V2))]), onKeydown: withKeys(H2, ["enter"]) }, [renderSlot(e3.$slots, "increase-icon", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [unref(O2) ? (openBlock(), createBlock(unref(vl), { key: 0 })) : (openBlock(), createBlock(unref(Nl), { key: 1 }))]), _: 1 })])], 42, ["aria-label", "onKeydown"])), [[unref(cm), H2]]) : createCommentVNode("v-if", true), createVNode(unref(lf), { id: e3.id, ref_key: "input", ref: v2, type: "number", step: e3.step, "model-value": unref(T2), placeholder: e3.placeholder, readonly: e3.readonly, disabled: unref(L2), size: unref($2), max: e3.max, min: e3.min, name: e3.name, "aria-label": e3.ariaLabel, "validate-event": false, onKeydown: [withKeys(withModifiers(H2, ["prevent"]), ["up"]), withKeys(withModifiers(I2, ["prevent"]), ["down"])], onBlur: U2, onFocus: K2, onInput: P2, onChange: z2 }, null, 8, ["id", "step", "model-value", "placeholder", "readonly", "disabled", "size", "max", "min", "name", "aria-label", "onKeydown"])], 42, ["onDragstart"]));
} });
var ao = $d(oo, [["__file", "input-number.vue"]]);
const so = li(ao);
const ro$1 = ti({ modelValue: { type: [Boolean, String, Number], default: false }, disabled: Boolean, loading: Boolean, size: { type: String, validator: vn }, width: { type: [String, Number], default: "" }, inlinePrompt: Boolean, inactiveActionIcon: { type: ni }, activeActionIcon: { type: ni }, activeIcon: { type: ni }, inactiveIcon: { type: ni }, activeText: { type: String, default: "" }, inactiveText: { type: String, default: "" }, activeValue: { type: [Boolean, String, Number], default: true }, inactiveValue: { type: [Boolean, String, Number], default: false }, name: { type: String, default: "" }, validateEvent: { type: Boolean, default: true }, beforeChange: { type: Jl(Function) }, id: String, tabindex: { type: [String, Number] }, ...Bd(["ariaLabel"]) });
const io = { [fi]: (e2) => Ds(e2) || bt(e2) || Hs(e2), [pi]: (e2) => Ds(e2) || bt(e2) || Hs(e2), [vi]: (e2) => Ds(e2) || bt(e2) || Hs(e2) };
const uo = "ElSwitch";
const co = defineComponent({ name: uo });
const fo$1 = defineComponent({ ...co, props: ro$1, emits: io, setup(e2, { expose: t2, emit: l2 }) {
const n2 = e2;
const { formItem: d2 } = Gd();
const f2 = Kd();
const v2 = zi("switch");
const { inputId: x2 } = Zd(n2, { formItemContext: d2 });
const C2 = Yd(computed(() => n2.loading));
const E2 = ref(n2.modelValue !== false);
const O2 = ref();
const $2 = ref();
const L2 = computed(() => [v2.b(), v2.m(f2.value), v2.is("disabled", C2.value), v2.is("checked", H2.value)]);
const T2 = computed(() => [v2.e("label"), v2.em("label", "left"), v2.is("active", !H2.value)]);
const F2 = computed(() => [v2.e("label"), v2.em("label", "right"), v2.is("active", H2.value)]);
const _2 = computed(() => ({ width: rl(n2.width) }));
watch(() => n2.modelValue, () => {
E2.value = true;
});
const M2 = computed(() => E2.value ? n2.modelValue : false);
const H2 = computed(() => M2.value === n2.activeValue);
if (![n2.activeValue, n2.inactiveValue].includes(M2.value)) {
l2(fi, n2.inactiveValue);
l2(pi, n2.inactiveValue);
l2(vi, n2.inactiveValue);
}
watch(H2, (e3) => {
var t3;
O2.value.checked = e3;
if (n2.validateEvent) {
(t3 = d2 == null ? void 0 : d2.validate) == null ? void 0 : t3.call(d2, "change").catch((e4) => Js());
}
});
const I2 = () => {
const e3 = H2.value ? n2.inactiveValue : n2.activeValue;
l2(fi, e3);
l2(pi, e3);
l2(vi, e3);
nextTick(() => {
O2.value.checked = H2.value;
});
};
const W2 = () => {
if (C2.value) return;
const { beforeChange: e3 } = n2;
if (!e3) {
I2();
return;
}
const t3 = e3();
const l3 = [wt(t3), Ds(t3)].includes(true);
if (!l3) {
Xs(uo, "beforeChange must return type `Promise<boolean>` or `boolean`");
}
if (wt(t3)) {
t3.then((e4) => {
if (e4) {
I2();
}
}).catch((e4) => {
});
} else if (t3) {
I2();
}
};
const B2 = () => {
var e3, t3;
(t3 = (e3 = O2.value) == null ? void 0 : e3.focus) == null ? void 0 : t3.call(e3);
};
onMounted(() => {
O2.value.checked = H2.value;
});
t2({ focus: B2, checked: H2 });
return (e3, t3) => (openBlock(), createElementBlock("div", { class: normalizeClass(unref(L2)), onClick: withModifiers(W2, ["prevent"]) }, [createElementVNode("input", { id: unref(x2), ref_key: "input", ref: O2, class: normalizeClass(unref(v2).e("input")), type: "checkbox", role: "switch", "aria-checked": unref(H2), "aria-disabled": unref(C2), "aria-label": e3.ariaLabel, name: e3.name, "true-value": e3.activeValue, "false-value": e3.inactiveValue, disabled: unref(C2), tabindex: e3.tabindex, onChange: I2, onKeydown: withKeys(W2, ["enter"]) }, null, 42, ["id", "aria-checked", "aria-disabled", "aria-label", "name", "true-value", "false-value", "disabled", "tabindex", "onKeydown"]), !e3.inlinePrompt && (e3.inactiveIcon || e3.inactiveText) ? (openBlock(), createElementBlock("span", { key: 0, class: normalizeClass(unref(T2)) }, [e3.inactiveIcon ? (openBlock(), createBlock(unref(Ud), { key: 0 }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e3.inactiveIcon)))]), _: 1 })) : createCommentVNode("v-if", true), !e3.inactiveIcon && e3.inactiveText ? (openBlock(), createElementBlock("span", { key: 1, "aria-hidden": unref(H2) }, toDisplayString(e3.inactiveText), 9, ["aria-hidden"])) : createCommentVNode("v-if", true)], 2)) : createCommentVNode("v-if", true), createElementVNode("span", { ref_key: "core", ref: $2, class: normalizeClass(unref(v2).e("core")), style: normalizeStyle(unref(_2)) }, [e3.inlinePrompt ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(v2).e("inner")) }, [e3.activeIcon || e3.inactiveIcon ? (openBlock(), createBlock(unref(Ud), { key: 0, class: normalizeClass(unref(v2).is("icon")) }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(unref(H2) ? e3.activeIcon : e3.inactiveIcon)))]), _: 1 }, 8, ["class"])) : e3.activeText || e3.inactiveText ? (openBlock(), createElementBlock("span", { key: 1, class: normalizeClass(unref(v2).is("text")), "aria-hidden": !unref(H2) }, toDisplayString(unref(H2) ? e3.activeText : e3.inactiveText), 11, ["aria-hidden"])) : createCommentVNode("v-if", true)], 2)) : createCommentVNode("v-if", true), createElementVNode("div", { class: normalizeClass(unref(v2).e("action")) }, [e3.loading ? (openBlock(), createBlock(unref(Ud), { key: 0, class: normalizeClass(unref(v2).is("loading")) }, { default: withCtx(() => [createVNode(unref(zl))]), _: 1 }, 8, ["class"])) : unref(H2) ? renderSlot(e3.$slots, "active-action", { key: 1 }, () => [e3.activeActionIcon ? (openBlock(), createBlock(unref(Ud), { key: 0 }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e3.activeActionIcon)))]), _: 1 })) : createCommentVNode("v-if", true)]) : !unref(H2) ? renderSlot(e3.$slots, "inactive-action", { key: 2 }, () => [e3.inactiveActionIcon ? (openBlock(), createBlock(unref(Ud), { key: 0 }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e3.inactiveActionIcon)))]), _: 1 })) : createCommentVNode("v-if", true)]) : createCommentVNode("v-if", true)], 2)], 6), !e3.inlinePrompt && (e3.activeIcon || e3.activeText) ? (openBlock(), createElementBlock("span", { key: 1, class: normalizeClass(unref(F2)) }, [e3.activeIcon ? (openBlock(), createBlock(unref(Ud), { key: 0 }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e3.activeIcon)))]), _: 1 })) : createCommentVNode("v-if", true), !e3.activeIcon && e3.activeText ? (openBlock(), createElementBlock("span", { key: 1, "aria-hidden": !unref(H2) }, toDisplayString(e3.activeText), 9, ["aria-hidden"])) : createCommentVNode("v-if", true)], 2)) : createCommentVNode("v-if", true)], 10, ["onClick"]));
} });
var po = $d(fo$1, [["__file", "switch.vue"]]);
const vo = li(po);
const ho = function(e2) {
var t2;
return (t2 = e2.target) == null ? void 0 : t2.closest("td");
};
const mo = function(e2, t2, l2, n2, o2) {
if (!t2 && !n2 && (!o2 || Array.isArray(o2) && !o2.length)) {
return e2;
}
if (typeof l2 === "string") {
l2 = l2 === "descending" ? -1 : 1;
} else {
l2 = l2 && l2 < 0 ? -1 : 1;
}
const a2 = n2 ? null : function(l3, n3) {
if (o2) {
if (!Array.isArray(o2)) {
o2 = [o2];
}
return o2.map((t3) => {
if (typeof t3 === "string") {
return ta(l3, t3);
} else {
return t3(l3, n3, e2);
}
});
}
if (t2 !== "$key") {
if (yt(l3) && "$value" in l3) l3 = l3.$value;
}
return [yt(l3) ? ta(l3, t2) : l3];
};
const s2 = function(e3, t3) {
if (n2) {
return n2(e3.value, t3.value);
}
for (let l3 = 0, n3 = e3.key.length; l3 < n3; l3++) {
if (e3.key[l3] < t3.key[l3]) {
return -1;
}
if (e3.key[l3] > t3.key[l3]) {
return 1;
}
}
return 0;
};
return e2.map((e3, t3) => ({ value: e3, index: t3, key: a2 ? a2(e3, t3) : null })).sort((e3, t3) => {
let n3 = s2(e3, t3);
if (!n3) {
n3 = e3.index - t3.index;
}
return n3 * +l2;
}).map((e3) => e3.value);
};
const go = function(e2, t2) {
let l2 = null;
e2.columns.forEach((e3) => {
if (e3.id === t2) {
l2 = e3;
}
});
return l2;
};
const bo = function(e2, t2) {
let l2 = null;
for (let n2 = 0; n2 < e2.columns.length; n2++) {
const o2 = e2.columns[n2];
if (o2.columnKey === t2) {
l2 = o2;
break;
}
}
if (!l2) Xs("ElTable", `No column matching with column-key: ${t2}`);
return l2;
};
const yo$1 = function(e2, t2, l2) {
const n2 = (t2.className || "").match(new RegExp(`${l2}-table_[^\\s]+`, "gm"));
if (n2) {
return go(e2, n2[0]);
}
return null;
};
const wo = (e2, t2) => {
if (!e2) throw new Error("Row is required when get row identity");
if (typeof t2 === "string") {
if (!t2.includes(".")) {
return `${e2[t2]}`;
}
const l2 = t2.split(".");
let n2 = e2;
for (const e3 of l2) {
n2 = n2[e3];
}
return `${n2}`;
} else if (typeof t2 === "function") {
return t2.call(null, e2);
}
};
const xo = function(e2, t2) {
const l2 = {};
(e2 || []).forEach((e3, n2) => {
l2[wo(e3, t2)] = { row: e3, index: n2 };
});
return l2;
};
function Co(e2, t2) {
const l2 = {};
let n2;
for (n2 in e2) {
l2[n2] = e2[n2];
}
for (n2 in t2) {
if (vt(t2, n2)) {
const e3 = t2[n2];
if (typeof e3 !== "undefined") {
l2[n2] = e3;
}
}
}
return l2;
}
function So(e2) {
if (e2 === "") return e2;
if (e2 !== void 0) {
e2 = Number.parseInt(e2, 10);
if (Number.isNaN(e2)) {
e2 = "";
}
}
return e2;
}
function ko(e2) {
if (e2 === "") return e2;
if (e2 !== void 0) {
e2 = So(e2);
if (Number.isNaN(e2)) {
e2 = 80;
}
}
return e2;
}
function Eo(e2) {
if (typeof e2 === "number") {
return e2;
}
if (typeof e2 === "string") {
if (/^\d+(?:px)?$/.test(e2)) {
return Number.parseInt(e2, 10);
} else {
return e2;
}
}
return null;
}
function No(...e2) {
if (e2.length === 0) {
return (e3) => e3;
}
if (e2.length === 1) {
return e2[0];
}
return e2.reduce((e3, t2) => (...l2) => e3(t2(...l2)));
}
function Ro(e2, t2, l2, n2, o2, a2) {
let s2 = a2 != null ? a2 : 0;
let r2 = false;
const i2 = e2.indexOf(t2);
const u2 = i2 !== -1;
const c2 = o2 == null ? void 0 : o2.call(null, t2, a2);
const d2 = (l3) => {
if (l3 === "add") {
e2.push(t2);
} else {
e2.splice(i2, 1);
}
r2 = true;
};
const f2 = (e3) => {
let t3 = 0;
const l3 = (n2 == null ? void 0 : n2.children) && e3[n2.children];
if (l3 && mt(l3)) {
t3 += l3.length;
l3.forEach((e4) => {
t3 += f2(e4);
});
}
return t3;
};
if (!o2 || c2) {
if (Ds(l2)) {
if (l2 && !u2) {
d2("add");
} else if (!l2 && u2) {
d2("remove");
}
} else {
u2 ? d2("remove") : d2("add");
}
}
if (!(n2 == null ? void 0 : n2.checkStrictly) && (n2 == null ? void 0 : n2.children) && mt(t2[n2.children])) {
t2[n2.children].forEach((t3) => {
Ro(e2, t3, l2 != null ? l2 : !u2, n2, o2, s2 + 1);
s2 += f2(t3) + 1;
});
}
return r2;
}
function Vo(e2, t2, l2 = "children", n2 = "hasChildren") {
const o2 = (e3) => !(Array.isArray(e3) && e3.length);
function a2(e3, s2, r2) {
t2(e3, s2, r2);
s2.forEach((e4) => {
if (e4[n2]) {
t2(e4, null, r2 + 1);
return;
}
const s3 = e4[l2];
if (!o2(s3)) {
a2(e4, s3, r2 + 1);
}
});
}
e2.forEach((e3) => {
if (e3[n2]) {
t2(e3, null, 0);
return;
}
const s2 = e3[l2];
if (!o2(s2)) {
a2(e3, s2, 0);
}
});
}
let Ao = null;
function Oo(e2, t2, l2, n2) {
if ((Ao == null ? void 0 : Ao.trigger) === l2) {
return;
}
Ao == null ? void 0 : Ao();
const o2 = n2 == null ? void 0 : n2.refs.tableWrapper;
const a2 = o2 == null ? void 0 : o2.dataset.prefix;
const s2 = { strategy: "fixed", ...e2.popperOptions };
const r2 = createVNode(lv, { content: t2, virtualTriggering: true, virtualRef: l2, appendTo: o2, placement: "top", transition: "none", offset: 0, hideAfter: 0, ...e2, popperOptions: s2, onHide: () => {
Ao == null ? void 0 : Ao();
} });
r2.appContext = { ...n2.appContext, ...n2 };
const i2 = document.createElement("div");
render(r2, i2);
r2.component.exposed.onOpen();
const u2 = o2 == null ? void 0 : o2.querySelector(`.${a2}-scrollbar__wrap`);
Ao = () => {
render(null, i2);
u2 == null ? void 0 : u2.removeEventListener("scroll", Ao);
Ao = null;
};
Ao.trigger = l2;
u2 == null ? void 0 : u2.addEventListener("scroll", Ao);
}
function $o(e2) {
if (e2.children) {
return cn(e2.children, $o);
} else {
return [e2];
}
}
function Lo(e2, t2) {
return e2 + t2.colSpan;
}
const To = (e2, t2, l2, n2) => {
let o2 = 0;
let a2 = e2;
const s2 = l2.states.columns.value;
if (n2) {
const t3 = $o(n2[e2]);
const l3 = s2.slice(0, s2.indexOf(t3[0]));
o2 = l3.reduce(Lo, 0);
a2 = o2 + t3.reduce(Lo, 0) - 1;
} else {
o2 = e2;
}
let r2;
switch (t2) {
case "left":
if (a2 < l2.states.fixedLeafColumnsLength.value) {
r2 = "left";
}
break;
case "right":
if (o2 >= s2.length - l2.states.rightFixedLeafColumnsLength.value) {
r2 = "right";
}
break;
default:
if (a2 < l2.states.fixedLeafColumnsLength.value) {
r2 = "left";
} else if (o2 >= s2.length - l2.states.rightFixedLeafColumnsLength.value) {
r2 = "right";
}
}
return r2 ? { direction: r2, start: o2, after: a2 } : {};
};
const Fo = (e2, t2, l2, n2, o2, a2 = 0) => {
const s2 = [];
const { direction: r2, start: i2, after: u2 } = To(t2, l2, n2, o2);
if (r2) {
const t3 = r2 === "left";
s2.push(`${e2}-fixed-column--${r2}`);
if (t3 && u2 + a2 === n2.states.fixedLeafColumnsLength.value - 1) {
s2.push("is-last-column");
} else if (!t3 && i2 - a2 === n2.states.columns.value.length - n2.states.rightFixedLeafColumnsLength.value) {
s2.push("is-first-column");
}
}
return s2;
};
function _o(e2, t2) {
return e2 + (t2.realWidth === null || Number.isNaN(t2.realWidth) ? Number(t2.width) : t2.realWidth);
}
const Mo = (e2, t2, l2, n2) => {
const { direction: o2, start: a2 = 0, after: s2 = 0 } = To(e2, t2, l2, n2);
if (!o2) {
return;
}
const r2 = {};
const i2 = o2 === "left";
const u2 = l2.states.columns.value;
if (i2) {
r2.left = u2.slice(0, a2).reduce(_o, 0);
} else {
r2.right = u2.slice(s2 + 1).reverse().reduce(_o, 0);
}
return r2;
};
const Ho = (e2, t2) => {
if (!e2) return;
if (!Number.isNaN(e2[t2])) {
e2[t2] = `${e2[t2]}px`;
}
};
function Io(e2) {
const t2 = getCurrentInstance();
const l2 = ref(false);
const n2 = ref([]);
const o2 = () => {
const t3 = e2.data.value || [];
const o3 = e2.rowKey.value;
if (l2.value) {
n2.value = t3.slice();
} else if (o3) {
const e3 = xo(n2.value, o3);
n2.value = t3.reduce((t4, l3) => {
const n3 = wo(l3, o3);
const a2 = e3[n3];
if (a2) {
t4.push(l3);
}
return t4;
}, []);
} else {
n2.value = [];
}
};
const s2 = (e3, l3) => {
const o3 = Ro(n2.value, e3, l3);
if (o3) {
t2.emit("expand-change", e3, n2.value.slice());
}
};
const r2 = (l3) => {
t2.store.assertRowKey();
const o3 = e2.data.value || [];
const a2 = e2.rowKey.value;
const s3 = xo(o3, a2);
n2.value = l3.reduce((e3, t3) => {
const l4 = s3[t3];
if (l4) {
e3.push(l4.row);
}
return e3;
}, []);
};
const i2 = (t3) => {
const l3 = e2.rowKey.value;
if (l3) {
const e3 = xo(n2.value, l3);
return !!e3[wo(t3, l3)];
}
return n2.value.includes(t3);
};
return { updateExpandRows: o2, toggleRowExpansion: s2, setExpandRowKeys: r2, isRowExpanded: i2, states: { expandRows: n2, defaultExpandAll: l2 } };
}
function Wo(e2) {
const t2 = getCurrentInstance();
const l2 = ref(null);
const n2 = ref(null);
const o2 = (e3) => {
t2.store.assertRowKey();
l2.value = e3;
r2(e3);
};
const s2 = () => {
l2.value = null;
};
const r2 = (l3) => {
const { data: o3, rowKey: a2 } = e2;
let s3 = null;
if (a2.value) {
s3 = (unref(o3) || []).find((e3) => wo(e3, a2.value) === l3);
}
n2.value = s3;
t2.emit("current-change", n2.value, null);
};
const u2 = (e3) => {
const l3 = n2.value;
if (e3 && e3 !== l3) {
n2.value = e3;
t2.emit("current-change", n2.value, l3);
return;
}
if (!e3 && l3) {
n2.value = null;
t2.emit("current-change", null, l3);
}
};
const c2 = () => {
const o3 = e2.rowKey.value;
const a2 = e2.data.value || [];
const i2 = n2.value;
if (!a2.includes(i2) && i2) {
if (o3) {
const e3 = wo(i2, o3);
r2(e3);
} else {
n2.value = null;
}
if (n2.value === null) {
t2.emit("current-change", null, i2);
}
} else if (l2.value) {
r2(l2.value);
s2();
}
};
return { setCurrentRowKey: o2, restoreCurrentRowKey: s2, setCurrentRowByKey: r2, updateCurrentRow: u2, updateCurrentRowData: c2, states: { _currentRowKey: l2, currentRow: n2 } };
}
function Bo(e2) {
const t2 = ref([]);
const l2 = ref({});
const n2 = ref(16);
const s2 = ref(false);
const r2 = ref({});
const u2 = ref("hasChildren");
const c2 = ref("children");
const d2 = ref(false);
const f2 = getCurrentInstance();
const p2 = computed(() => {
if (!e2.rowKey.value) return {};
const t3 = e2.data.value || [];
return h2(t3);
});
const v2 = computed(() => {
const t3 = e2.rowKey.value;
const l3 = Object.keys(r2.value);
const n3 = {};
if (!l3.length) return n3;
l3.forEach((e3) => {
if (r2.value[e3].length) {
const l4 = { children: [] };
r2.value[e3].forEach((e4) => {
const o2 = wo(e4, t3);
l4.children.push(o2);
if (e4[u2.value] && !n3[o2]) {
n3[o2] = { children: [] };
}
});
n3[e3] = l4;
}
});
return n3;
});
const h2 = (t3) => {
const l3 = e2.rowKey.value;
const n3 = {};
Vo(t3, (e3, t4, o2) => {
const a2 = wo(e3, l3);
if (Array.isArray(t4)) {
n3[a2] = { children: t4.map((e4) => wo(e4, l3)), level: o2 };
} else if (s2.value) {
n3[a2] = { children: [], lazy: true, level: o2 };
}
}, c2.value, u2.value);
return n3;
};
const m2 = (e3 = false, n3 = ((e4) => (e4 = f2.store) == null ? void 0 : e4.states.defaultExpandAll.value)()) => {
var o2;
const a2 = p2.value;
const r3 = v2.value;
const u3 = Object.keys(a2);
const c3 = {};
if (u3.length) {
const o3 = unref(l2);
const d3 = [];
const f3 = (l3, o4) => {
if (e3) {
if (t2.value) {
return n3 || t2.value.includes(o4);
} else {
return !!(n3 || (l3 == null ? void 0 : l3.expanded));
}
} else {
const e4 = n3 || t2.value && t2.value.includes(o4);
return !!((l3 == null ? void 0 : l3.expanded) || e4);
}
};
u3.forEach((e4) => {
const t3 = o3[e4];
const l3 = { ...a2[e4] };
l3.expanded = f3(t3, e4);
if (l3.lazy) {
const { loaded: n4 = false, loading: o4 = false } = t3 || {};
l3.loaded = !!n4;
l3.loading = !!o4;
d3.push(e4);
}
c3[e4] = l3;
});
const p3 = Object.keys(r3);
if (s2.value && p3.length && d3.length) {
p3.forEach((e4) => {
const t3 = o3[e4];
const l3 = r3[e4].children;
if (d3.includes(e4)) {
if (c3[e4].children.length !== 0) {
throw new Error("[ElTable]children must be an empty array.");
}
c3[e4].children = l3;
} else {
const { loaded: n4 = false, loading: o4 = false } = t3 || {};
c3[e4] = { lazy: true, loaded: !!n4, loading: !!o4, expanded: f3(t3, e4), children: l3, level: "" };
}
});
}
}
l2.value = c3;
(o2 = f2.store) == null ? void 0 : o2.updateTableScrollY();
};
watch(() => t2.value, () => {
m2(true);
});
watch(() => p2.value, () => {
m2();
});
watch(() => v2.value, () => {
m2();
});
const g2 = (e3) => {
t2.value = e3;
m2();
};
const b2 = (t3, n3) => {
f2.store.assertRowKey();
const o2 = e2.rowKey.value;
const a2 = wo(t3, o2);
const s3 = a2 && l2.value[a2];
if (a2 && s3 && "expanded" in s3) {
const e3 = s3.expanded;
n3 = typeof n3 === "undefined" ? !s3.expanded : n3;
l2.value[a2].expanded = n3;
if (e3 !== n3) {
f2.emit("expand-change", t3, n3);
}
f2.store.updateTableScrollY();
}
};
const y2 = (t3) => {
f2.store.assertRowKey();
const n3 = e2.rowKey.value;
const o2 = wo(t3, n3);
const a2 = l2.value[o2];
if (s2.value && a2 && "loaded" in a2 && !a2.loaded) {
w2(t3, o2, a2);
} else {
b2(t3, void 0);
}
};
const w2 = (e3, t3, n3) => {
const { load: o2 } = f2.props;
if (o2 && !l2.value[t3].loaded) {
l2.value[t3].loading = true;
o2(e3, n3, (n4) => {
if (!Array.isArray(n4)) {
throw new TypeError("[ElTable] data must be an array");
}
l2.value[t3].loading = false;
l2.value[t3].loaded = true;
l2.value[t3].expanded = true;
if (n4.length) {
r2.value[t3] = n4;
}
f2.emit("expand-change", e3, true);
});
}
};
return { loadData: w2, loadOrToggle: y2, toggleTreeExpansion: b2, updateTreeExpandKeys: g2, updateTreeData: m2, normalize: h2, states: { expandRowKeys: t2, treeData: l2, indent: n2, lazy: s2, lazyTreeNodeMap: r2, lazyColumnIdentifier: u2, childrenColumnName: c2, checkStrictly: d2 } };
}
const Po = (e2, t2) => {
const l2 = t2.sortingColumn;
if (!l2 || typeof l2.sortable === "string") {
return e2;
}
return mo(e2, t2.sortProp, t2.sortOrder, l2.sortMethod, l2.sortBy);
};
const zo = (e2) => {
const t2 = [];
e2.forEach((e3) => {
if (e3.children && e3.children.length > 0) {
t2.push.apply(t2, zo(e3.children));
} else {
t2.push(e3);
}
});
return t2;
};
function Do() {
var e2;
const t2 = getCurrentInstance();
const { size: l2 } = toRefs((e2 = t2.proxy) == null ? void 0 : e2.$props);
const n2 = ref(null);
const o2 = ref([]);
const s2 = ref([]);
const r2 = ref(false);
const u2 = ref([]);
const c2 = ref([]);
const d2 = ref([]);
const f2 = ref([]);
const p2 = ref([]);
const v2 = ref([]);
const h2 = ref([]);
const m2 = ref([]);
const g2 = [];
const b2 = ref(0);
const y2 = ref(0);
const w2 = ref(0);
const x2 = ref(false);
const C2 = ref([]);
const k2 = ref(false);
const E2 = ref(false);
const N2 = ref(null);
const R2 = ref({});
const V2 = ref(null);
const A2 = ref(null);
const O2 = ref(null);
const T2 = ref(null);
const F2 = ref(null);
watch(o2, () => t2.state && I2(false), { deep: true });
const _2 = () => {
if (!n2.value) throw new Error("[ElTable] prop row-key is required");
};
const M2 = (e3) => {
var t3;
(t3 = e3.children) == null ? void 0 : t3.forEach((t4) => {
t4.fixed = e3.fixed;
M2(t4);
});
};
const H2 = () => {
u2.value.forEach((e4) => {
M2(e4);
});
f2.value = u2.value.filter((e4) => e4.fixed === true || e4.fixed === "left");
p2.value = u2.value.filter((e4) => e4.fixed === "right");
if (f2.value.length > 0 && u2.value[0] && u2.value[0].type === "selection" && !u2.value[0].fixed) {
u2.value[0].fixed = true;
f2.value.unshift(u2.value[0]);
}
const e3 = u2.value.filter((e4) => !e4.fixed);
c2.value = [].concat(f2.value).concat(e3).concat(p2.value);
const t3 = zo(e3);
const l3 = zo(f2.value);
const n3 = zo(p2.value);
b2.value = t3.length;
y2.value = l3.length;
w2.value = n3.length;
d2.value = [].concat(l3).concat(t3).concat(n3);
r2.value = f2.value.length > 0 || p2.value.length > 0;
};
const I2 = (e3, l3 = false) => {
if (e3) {
H2();
}
if (l3) {
t2.state.doLayout();
} else {
t2.state.debouncedUpdateLayout();
}
};
const W2 = (e3) => C2.value.includes(e3);
const B2 = () => {
x2.value = false;
const e3 = C2.value;
C2.value = [];
if (e3.length) {
t2.emit("selection-change", []);
}
};
const P2 = () => {
let e3;
if (n2.value) {
e3 = [];
const t3 = xo(C2.value, n2.value);
const l3 = xo(o2.value, n2.value);
for (const n3 in t3) {
if (vt(t3, n3) && !l3[n3]) {
e3.push(t3[n3].row);
}
}
} else {
e3 = C2.value.filter((e4) => !o2.value.includes(e4));
}
if (e3.length) {
const l3 = C2.value.filter((t3) => !e3.includes(t3));
C2.value = l3;
t2.emit("selection-change", l3.slice());
}
};
const z2 = () => (C2.value || []).slice();
const D2 = (e3, l3, n3 = true) => {
var o3, a2, s3, r3;
const i2 = { children: (a2 = (o3 = t2 == null ? void 0 : t2.store) == null ? void 0 : o3.states) == null ? void 0 : a2.childrenColumnName.value, checkStrictly: (r3 = (s3 = t2 == null ? void 0 : t2.store) == null ? void 0 : s3.states) == null ? void 0 : r3.checkStrictly.value };
const u3 = Ro(C2.value, e3, l3, i2, N2.value);
if (u3) {
const l4 = (C2.value || []).slice();
if (n3) {
t2.emit("select", l4, e3);
}
t2.emit("selection-change", l4);
}
};
const j2 = () => {
var e3, l3;
const n3 = E2.value ? !x2.value : !(x2.value || C2.value.length);
x2.value = n3;
let a2 = false;
let s3 = 0;
const r3 = (l3 = (e3 = t2 == null ? void 0 : t2.store) == null ? void 0 : e3.states) == null ? void 0 : l3.rowKey.value;
const { childrenColumnName: i2 } = t2.store.states;
const u3 = { children: i2.value, checkStrictly: false };
o2.value.forEach((e4, t3) => {
const l4 = t3 + s3;
if (Ro(C2.value, e4, n3, u3, N2.value, l4)) {
a2 = true;
}
s3 += Y2(wo(e4, r3));
});
if (a2) {
t2.emit("selection-change", C2.value ? C2.value.slice() : []);
}
t2.emit("select-all", (C2.value || []).slice());
};
const K2 = () => {
const e3 = xo(C2.value, n2.value);
o2.value.forEach((t3) => {
const l3 = wo(t3, n2.value);
const o3 = e3[l3];
if (o3) {
C2.value[o3.index] = t3;
}
});
};
const U2 = () => {
var e3;
if (((e3 = o2.value) == null ? void 0 : e3.length) === 0) {
x2.value = false;
return;
}
const { childrenColumnName: l3 } = t2.store.states;
const a2 = n2.value ? xo(C2.value, n2.value) : void 0;
let s3 = 0;
let r3 = 0;
const i2 = (e4) => {
if (a2) {
return !!a2[wo(e4, n2.value)];
} else {
return C2.value.includes(e4);
}
};
const u3 = (e4) => {
var t3;
for (const n3 of e4) {
const e5 = N2.value && N2.value.call(null, n3, s3);
if (!i2(n3)) {
if (!N2.value || e5) {
return false;
}
} else {
r3++;
}
s3++;
if (((t3 = n3[l3.value]) == null ? void 0 : t3.length) && !u3(n3[l3.value])) {
return false;
}
}
return true;
};
const c3 = u3(o2.value || []);
x2.value = r3 === 0 ? false : c3;
};
const Y2 = (e3) => {
var l3;
if (!t2 || !t2.store) return 0;
const { treeData: n3 } = t2.store.states;
let o3 = 0;
const a2 = (l3 = n3.value[e3]) == null ? void 0 : l3.children;
if (a2) {
o3 += a2.length;
a2.forEach((e4) => {
o3 += Y2(e4);
});
}
return o3;
};
const q2 = (e3, t3) => {
if (!Array.isArray(e3)) {
e3 = [e3];
}
const l3 = {};
e3.forEach((e4) => {
R2.value[e4.id] = t3;
l3[e4.columnKey || e4.id] = t3;
});
return l3;
};
const X2 = (e3, t3, l3) => {
if (A2.value && A2.value !== e3) {
A2.value.order = null;
}
A2.value = e3;
O2.value = t3;
T2.value = l3;
};
const G2 = () => {
let e3 = unref(s2);
Object.keys(R2.value).forEach((t3) => {
const l3 = R2.value[t3];
if (!l3 || l3.length === 0) return;
const n3 = go({ columns: d2.value }, t3);
if (n3 && n3.filterMethod) {
e3 = e3.filter((e4) => l3.some((t4) => n3.filterMethod.call(null, t4, e4, n3)));
}
});
V2.value = e3;
};
const J2 = () => {
o2.value = Po(V2.value, { sortingColumn: A2.value, sortProp: O2.value, sortOrder: T2.value });
};
const Q2 = (e3 = void 0) => {
if (!(e3 && e3.filter)) {
G2();
}
J2();
};
const Z2 = (e3) => {
const { tableHeaderRef: l3 } = t2.refs;
if (!l3) return;
const n3 = Object.assign({}, l3.filterPanels);
const o3 = Object.keys(n3);
if (!o3.length) return;
if (typeof e3 === "string") {
e3 = [e3];
}
if (Array.isArray(e3)) {
const l4 = e3.map((e4) => bo({ columns: d2.value }, e4));
o3.forEach((e4) => {
const t3 = l4.find((t4) => t4.id === e4);
if (t3) {
t3.filteredValue = [];
}
});
t2.store.commit("filterChange", { column: l4, values: [], silent: true, multi: true });
} else {
o3.forEach((e4) => {
const t3 = d2.value.find((t4) => t4.id === e4);
if (t3) {
t3.filteredValue = [];
}
});
R2.value = {};
t2.store.commit("filterChange", { column: {}, values: [], silent: true });
}
};
const ee2 = () => {
if (!A2.value) return;
X2(null, null, null);
t2.store.commit("changeSortCondition", { silent: true });
};
const { setExpandRowKeys: te2, toggleRowExpansion: le2, updateExpandRows: ne2, states: oe2, isRowExpanded: ae2 } = Io({ data: o2, rowKey: n2 });
const { updateTreeExpandKeys: se2, toggleTreeExpansion: re2, updateTreeData: ie2, loadOrToggle: ue2, states: ce2 } = Bo({ data: o2, rowKey: n2 });
const { updateCurrentRowData: de2, updateCurrentRow: fe2, setCurrentRowKey: pe2, states: ve2 } = Wo({ data: o2, rowKey: n2 });
const he2 = (e3) => {
te2(e3);
se2(e3);
};
const me2 = (e3, t3) => {
const l3 = d2.value.some(({ type: e4 }) => e4 === "expand");
if (l3) {
le2(e3, t3);
} else {
re2(e3, t3);
}
};
return { assertRowKey: _2, updateColumns: H2, scheduleLayout: I2, isSelected: W2, clearSelection: B2, cleanSelection: P2, getSelectionRows: z2, toggleRowSelection: D2, _toggleAllSelection: j2, toggleAllSelection: null, updateSelectionByRowKey: K2, updateAllSelected: U2, updateFilters: q2, updateCurrentRow: fe2, updateSort: X2, execFilter: G2, execSort: J2, execQuery: Q2, clearFilter: Z2, clearSort: ee2, toggleRowExpansion: le2, setExpandRowKeysAdapter: he2, setCurrentRowKey: pe2, toggleRowExpansionAdapter: me2, isRowExpanded: ae2, updateExpandRows: ne2, updateCurrentRowData: de2, loadOrToggle: ue2, updateTreeData: ie2, states: { tableSize: l2, rowKey: n2, data: o2, _data: s2, isComplex: r2, _columns: u2, originColumns: c2, columns: d2, fixedColumns: f2, rightFixedColumns: p2, leafColumns: v2, fixedLeafColumns: h2, rightFixedLeafColumns: m2, updateOrderFns: g2, leafColumnsLength: b2, fixedLeafColumnsLength: y2, rightFixedLeafColumnsLength: w2, isAllSelected: x2, selection: C2, reserveSelection: k2, selectOnIndeterminate: E2, selectable: N2, filters: R2, filteredData: V2, sortingColumn: A2, sortProp: O2, sortOrder: T2, hoverRow: F2, ...oe2, ...ce2, ...ve2 } };
}
function jo(e2, t2) {
return e2.map((e3) => {
var l2;
if (e3.id === t2.id) {
return t2;
} else if ((l2 = e3.children) == null ? void 0 : l2.length) {
e3.children = jo(e3.children, t2);
}
return e3;
});
}
function Ko(e2) {
e2.forEach((e3) => {
var t2, l2;
e3.no = (t2 = e3.getColumnIndex) == null ? void 0 : t2.call(e3);
if ((l2 = e3.children) == null ? void 0 : l2.length) {
Ko(e3.children);
}
});
e2.sort((e3, t2) => e3.no - t2.no);
}
function Uo() {
const e2 = getCurrentInstance();
const t2 = Do();
const l2 = zi("table");
const n2 = { setData(t3, l3) {
const n3 = unref(t3._data) !== l3;
t3.data.value = l3;
t3._data.value = l3;
e2.store.execQuery();
e2.store.updateCurrentRowData();
e2.store.updateExpandRows();
e2.store.updateTreeData(e2.store.states.defaultExpandAll.value);
if (unref(t3.reserveSelection)) {
e2.store.assertRowKey();
e2.store.updateSelectionByRowKey();
} else {
if (n3) {
e2.store.clearSelection();
} else {
e2.store.cleanSelection();
}
}
e2.store.updateAllSelected();
if (e2.$ready) {
e2.store.scheduleLayout();
}
}, insertColumn(t3, l3, n3, o3) {
const a3 = unref(t3._columns);
let s2 = [];
if (!n3) {
a3.push(l3);
s2 = a3;
} else {
if (n3 && !n3.children) {
n3.children = [];
}
n3.children.push(l3);
s2 = jo(a3, n3);
}
Ko(s2);
t3._columns.value = s2;
t3.updateOrderFns.push(o3);
if (l3.type === "selection") {
t3.selectable.value = l3.selectable;
t3.reserveSelection.value = l3.reserveSelection;
}
if (e2.$ready) {
e2.store.updateColumns();
e2.store.scheduleLayout();
}
}, updateColumnOrder(t3, l3) {
var n3;
const o3 = (n3 = l3.getColumnIndex) == null ? void 0 : n3.call(l3);
if (o3 === l3.no) return;
Ko(t3._columns.value);
if (e2.$ready) {
e2.store.updateColumns();
}
}, removeColumn(t3, l3, n3, o3) {
const a3 = unref(t3._columns) || [];
if (n3) {
n3.children.splice(n3.children.findIndex((e3) => e3.id === l3.id), 1);
nextTick(() => {
var e3;
if (((e3 = n3.children) == null ? void 0 : e3.length) === 0) {
delete n3.children;
}
});
t3._columns.value = jo(a3, n3);
} else {
const e3 = a3.indexOf(l3);
if (e3 > -1) {
a3.splice(e3, 1);
t3._columns.value = a3;
}
}
const s2 = t3.updateOrderFns.indexOf(o3);
s2 > -1 && t3.updateOrderFns.splice(s2, 1);
if (e2.$ready) {
e2.store.updateColumns();
e2.store.scheduleLayout();
}
}, sort(t3, l3) {
const { prop: n3, order: o3, init: a3 } = l3;
if (n3) {
const l4 = unref(t3.columns).find((e3) => e3.property === n3);
if (l4) {
l4.order = o3;
e2.store.updateSort(l4, n3, o3);
e2.store.commit("changeSortCondition", { init: a3 });
}
}
}, changeSortCondition(t3, l3) {
const { sortingColumn: n3, sortProp: o3, sortOrder: a3 } = t3;
const s2 = unref(n3), r2 = unref(o3), u2 = unref(a3);
if (u2 === null) {
t3.sortingColumn.value = null;
t3.sortProp.value = null;
}
const c2 = { filter: true };
e2.store.execQuery(c2);
if (!l3 || !(l3.silent || l3.init)) {
e2.emit("sort-change", { column: s2, prop: r2, order: u2 });
}
e2.store.updateTableScrollY();
}, filterChange(t3, l3) {
const { column: n3, values: o3, silent: a3 } = l3;
const s2 = e2.store.updateFilters(n3, o3);
e2.store.execQuery();
if (!a3) {
e2.emit("filter-change", s2);
}
e2.store.updateTableScrollY();
}, toggleAllSelection() {
e2.store.toggleAllSelection();
}, rowSelectedChanged(t3, l3) {
e2.store.toggleRowSelection(l3);
e2.store.updateAllSelected();
}, setHoverRow(e3, t3) {
e3.hoverRow.value = t3;
}, setCurrentRow(t3, l3) {
e2.store.updateCurrentRow(l3);
} };
const o2 = function(t3, ...l3) {
const n3 = e2.store.mutations;
if (n3[t3]) {
n3[t3].apply(e2, [e2.store.states].concat(l3));
} else {
throw new Error(`Action not found: ${t3}`);
}
};
const a2 = function() {
nextTick(() => e2.layout.updateScrollY.apply(e2.layout));
};
return { ns: l2, ...t2, mutations: n2, commit: o2, updateTableScrollY: a2 };
}
const Yo = { rowKey: "rowKey", defaultExpandAll: "defaultExpandAll", selectOnIndeterminate: "selectOnIndeterminate", indent: "indent", lazy: "lazy", data: "data", ["treeProps.hasChildren"]: { key: "lazyColumnIdentifier", default: "hasChildren" }, ["treeProps.children"]: { key: "childrenColumnName", default: "children" }, ["treeProps.checkStrictly"]: { key: "checkStrictly", default: false } };
function qo(e2, t2) {
if (!e2) {
throw new Error("Table is required.");
}
const l2 = Uo();
l2.toggleAllSelection = Ms(l2._toggleAllSelection, 10);
Object.keys(Yo).forEach((e3) => {
Go(Jo(t2, e3), e3, l2);
});
Xo(l2, t2);
return l2;
}
function Xo(e2, t2) {
Object.keys(Yo).forEach((l2) => {
watch(() => Jo(t2, l2), (t3) => {
Go(t3, l2, e2);
});
});
}
function Go(e2, t2, l2) {
let n2 = e2;
let o2 = Yo[t2];
if (typeof Yo[t2] === "object") {
o2 = o2.key;
n2 = n2 || Yo[t2].default;
}
l2.states[o2].value = n2;
}
function Jo(e2, t2) {
if (t2.includes(".")) {
const l2 = t2.split(".");
let n2 = e2;
l2.forEach((e3) => {
n2 = n2[e3];
});
return n2;
} else {
return e2[t2];
}
}
let Qo$1 = class Qo {
constructor(e2) {
this.observers = [];
this.table = null;
this.store = null;
this.columns = [];
this.fit = true;
this.showHeader = true;
this.height = ref(null);
this.scrollX = ref(false);
this.scrollY = ref(false);
this.bodyWidth = ref(null);
this.fixedWidth = ref(null);
this.rightFixedWidth = ref(null);
this.gutterWidth = 0;
for (const t2 in e2) {
if (vt(e2, t2)) {
if (isRef(this[t2])) {
this[t2].value = e2[t2];
} else {
this[t2] = e2[t2];
}
}
}
if (!this.table) {
throw new Error("Table is required for Table Layout");
}
if (!this.store) {
throw new Error("Store is required for Table Layout");
}
}
updateScrollY() {
const e2 = this.height.value;
if (e2 === null) return false;
const t2 = this.table.refs.scrollBarRef;
if (this.table.vnode.el && (t2 == null ? void 0 : t2.wrapRef)) {
let e3 = true;
const l2 = this.scrollY.value;
e3 = t2.wrapRef.scrollHeight > t2.wrapRef.clientHeight;
this.scrollY.value = e3;
return l2 !== e3;
}
return false;
}
setHeight(e2, t2 = "height") {
if (!Te) return;
const l2 = this.table.vnode.el;
e2 = Eo(e2);
this.height.value = Number(e2);
if (!l2 && (e2 || e2 === 0)) return nextTick(() => this.setHeight(e2, t2));
if (typeof e2 === "number") {
l2.style[t2] = `${e2}px`;
this.updateElsHeight();
} else if (typeof e2 === "string") {
l2.style[t2] = e2;
this.updateElsHeight();
}
}
setMaxHeight(e2) {
this.setHeight(e2, "max-height");
}
getFlattenColumns() {
const e2 = [];
const t2 = this.table.store.states.columns.value;
t2.forEach((t3) => {
if (t3.isColumnGroup) {
e2.push.apply(e2, t3.columns);
} else {
e2.push(t3);
}
});
return e2;
}
updateElsHeight() {
this.updateScrollY();
this.notifyObservers("scrollable");
}
headerDisplayNone(e2) {
if (!e2) return true;
let t2 = e2;
while (t2.tagName !== "DIV") {
if (getComputedStyle(t2).display === "none") {
return true;
}
t2 = t2.parentElement;
}
return false;
}
updateColumnsWidth() {
if (!Te) return;
const e2 = this.fit;
const t2 = this.table.vnode.el.clientWidth;
let l2 = 0;
const n2 = this.getFlattenColumns();
const o2 = n2.filter((e3) => typeof e3.width !== "number");
n2.forEach((e3) => {
if (typeof e3.width === "number" && e3.realWidth) e3.realWidth = null;
});
if (o2.length > 0 && e2) {
n2.forEach((e3) => {
l2 += Number(e3.width || e3.minWidth || 80);
});
if (l2 <= t2) {
this.scrollX.value = false;
const e3 = t2 - l2;
if (o2.length === 1) {
o2[0].realWidth = Number(o2[0].minWidth || 80) + e3;
} else {
const t3 = o2.reduce((e4, t4) => e4 + Number(t4.minWidth || 80), 0);
const l3 = e3 / t3;
let n3 = 0;
o2.forEach((e4, t4) => {
if (t4 === 0) return;
const o3 = Math.floor(Number(e4.minWidth || 80) * l3);
n3 += o3;
e4.realWidth = Number(e4.minWidth || 80) + o3;
});
o2[0].realWidth = Number(o2[0].minWidth || 80) + e3 - n3;
}
} else {
this.scrollX.value = true;
o2.forEach((e3) => {
e3.realWidth = Number(e3.minWidth);
});
}
this.bodyWidth.value = Math.max(l2, t2);
this.table.state.resizeState.value.width = this.bodyWidth.value;
} else {
n2.forEach((e3) => {
if (!e3.width && !e3.minWidth) {
e3.realWidth = 80;
} else {
e3.realWidth = Number(e3.width || e3.minWidth);
}
l2 += e3.realWidth;
});
this.scrollX.value = l2 > t2;
this.bodyWidth.value = l2;
}
const a2 = this.store.states.fixedColumns.value;
if (a2.length > 0) {
let e3 = 0;
a2.forEach((t3) => {
e3 += Number(t3.realWidth || t3.width);
});
this.fixedWidth.value = e3;
}
const s2 = this.store.states.rightFixedColumns.value;
if (s2.length > 0) {
let e3 = 0;
s2.forEach((t3) => {
e3 += Number(t3.realWidth || t3.width);
});
this.rightFixedWidth.value = e3;
}
this.notifyObservers("columns");
}
addObserver(e2) {
this.observers.push(e2);
}
removeObserver(e2) {
const t2 = this.observers.indexOf(e2);
if (t2 !== -1) {
this.observers.splice(t2, 1);
}
}
notifyObservers(e2) {
const t2 = this.observers;
t2.forEach((t3) => {
var l2, n2;
switch (e2) {
case "columns":
(l2 = t3.state) == null ? void 0 : l2.onColumnsChange(this);
break;
case "scrollable":
(n2 = t3.state) == null ? void 0 : n2.onScrollableChange(this);
break;
default:
throw new Error(`Table Layout don't have event ${e2}.`);
}
});
}
};
const { CheckboxGroup: Zo } = Bm;
const ea$1 = defineComponent({ name: "ElTableFilterPanel", components: { ElCheckbox: Bm, ElCheckboxGroup: Zo, ElScrollbar: Ef, ElTooltip: lv, ElIcon: Ud, ArrowDown: il, ArrowUp: vl }, directives: { ClickOutside: lm }, props: { placement: { type: String, default: "bottom-start" }, store: { type: Object }, column: { type: Object }, upDataColumn: { type: Function } }, setup(e2) {
const t2 = getCurrentInstance();
const { t: l2 } = Bi();
const n2 = zi("table-filter");
const s2 = t2 == null ? void 0 : t2.parent;
if (!s2.filterPanels.value[e2.column.id]) {
s2.filterPanels.value[e2.column.id] = t2;
}
const r2 = ref(false);
const i2 = ref(null);
const u2 = computed(() => e2.column && e2.column.filters);
const c2 = computed(() => {
if (e2.column.filterClassName) {
return `${n2.b()} ${e2.column.filterClassName}`;
}
return n2.b();
});
const d2 = computed({ get: () => {
var t3;
return (((t3 = e2.column) == null ? void 0 : t3.filteredValue) || [])[0];
}, set: (e3) => {
if (f2.value) {
if (typeof e3 !== "undefined" && e3 !== null) {
f2.value.splice(0, 1, e3);
} else {
f2.value.splice(0, 1);
}
}
} });
const f2 = computed({ get() {
if (e2.column) {
return e2.column.filteredValue || [];
}
return [];
}, set(t3) {
if (e2.column) {
e2.upDataColumn("filteredValue", t3);
}
} });
const p2 = computed(() => {
if (e2.column) {
return e2.column.filterMultiple;
}
return true;
});
const v2 = (e3) => e3.value === d2.value;
const h2 = () => {
r2.value = false;
};
const m2 = (e3) => {
e3.stopPropagation();
r2.value = !r2.value;
};
const g2 = () => {
r2.value = false;
};
const b2 = () => {
x2(f2.value);
h2();
};
const y2 = () => {
f2.value = [];
x2(f2.value);
h2();
};
const w2 = (e3) => {
d2.value = e3;
if (typeof e3 !== "undefined" && e3 !== null) {
x2(f2.value);
} else {
x2([]);
}
h2();
};
const x2 = (t3) => {
e2.store.commit("filterChange", { column: e2.column, values: t3 });
e2.store.updateAllSelected();
};
watch(r2, (t3) => {
if (e2.column) {
e2.upDataColumn("filterOpened", t3);
}
}, { immediate: true });
const C2 = computed(() => {
var e3, t3;
return (t3 = (e3 = i2.value) == null ? void 0 : e3.popperRef) == null ? void 0 : t3.contentRef;
});
return { tooltipVisible: r2, multiple: p2, filterClassName: c2, filteredValue: f2, filterValue: d2, filters: u2, handleConfirm: b2, handleReset: y2, handleSelect: w2, isActive: v2, t: l2, ns: n2, showFilterPanel: m2, hideFilterPanel: g2, popperPaneRef: C2, tooltip: i2 };
} });
function ta$1(e2, t2, l2, n2, o2, a2) {
const i2 = resolveComponent("el-checkbox");
const d2 = resolveComponent("el-checkbox-group");
const v2 = resolveComponent("el-scrollbar");
const h2 = resolveComponent("arrow-up");
const w2 = resolveComponent("arrow-down");
const x2 = resolveComponent("el-icon");
const C2 = resolveComponent("el-tooltip");
const S2 = resolveDirective("click-outside");
return openBlock(), createBlock(C2, { ref: "tooltip", visible: e2.tooltipVisible, offset: 0, placement: e2.placement, "show-arrow": false, "stop-popper-mouse-event": false, teleported: "", effect: "light", pure: "", "popper-class": e2.filterClassName, persistent: "" }, { content: withCtx(() => [e2.multiple ? (openBlock(), createElementBlock("div", { key: 0 }, [createElementVNode("div", { class: normalizeClass(e2.ns.e("content")) }, [createVNode(v2, { "wrap-class": e2.ns.e("wrap") }, { default: withCtx(() => [createVNode(d2, { modelValue: e2.filteredValue, "onUpdate:modelValue": (t3) => e2.filteredValue = t3, class: normalizeClass(e2.ns.e("checkbox-group")) }, { default: withCtx(() => [(openBlock(true), createElementBlock(Fragment, null, renderList(e2.filters, (e3) => (openBlock(), createBlock(i2, { key: e3.value, value: e3.value }, { default: withCtx(() => [createTextVNode(toDisplayString(e3.text), 1)]), _: 2 }, 1032, ["value"]))), 128))]), _: 1 }, 8, ["modelValue", "onUpdate:modelValue", "class"])]), _: 1 }, 8, ["wrap-class"])], 2), createElementVNode("div", { class: normalizeClass(e2.ns.e("bottom")) }, [createElementVNode("button", { class: normalizeClass({ [e2.ns.is("disabled")]: e2.filteredValue.length === 0 }), disabled: e2.filteredValue.length === 0, type: "button", onClick: e2.handleConfirm }, toDisplayString(e2.t("el.table.confirmFilter")), 11, ["disabled", "onClick"]), createElementVNode("button", { type: "button", onClick: e2.handleReset }, toDisplayString(e2.t("el.table.resetFilter")), 9, ["onClick"])], 2)])) : (openBlock(), createElementBlock("ul", { key: 1, class: normalizeClass(e2.ns.e("list")) }, [createElementVNode("li", { class: normalizeClass([e2.ns.e("list-item"), { [e2.ns.is("active")]: e2.filterValue === void 0 || e2.filterValue === null }]), onClick: (t3) => e2.handleSelect(null) }, toDisplayString(e2.t("el.table.clearFilter")), 11, ["onClick"]), (openBlock(true), createElementBlock(Fragment, null, renderList(e2.filters, (t3) => (openBlock(), createElementBlock("li", { key: t3.value, class: normalizeClass([e2.ns.e("list-item"), e2.ns.is("active", e2.isActive(t3))]), label: t3.value, onClick: (l3) => e2.handleSelect(t3.value) }, toDisplayString(t3.text), 11, ["label", "onClick"]))), 128))], 2))]), default: withCtx(() => [withDirectives((openBlock(), createElementBlock("span", { class: normalizeClass([`${e2.ns.namespace.value}-table__column-filter-trigger`, `${e2.ns.namespace.value}-none-outline`]), onClick: e2.showFilterPanel }, [createVNode(x2, null, { default: withCtx(() => [renderSlot(e2.$slots, "filter-icon", {}, () => [e2.column.filterOpened ? (openBlock(), createBlock(h2, { key: 0 })) : (openBlock(), createBlock(w2, { key: 1 }))])]), _: 3 })], 10, ["onClick"])), [[S2, e2.hideFilterPanel, e2.popperPaneRef]])]), _: 3 }, 8, ["visible", "placement", "popper-class"]);
}
var la = $d(ea$1, [["render", ta$1], ["__file", "filter-panel.vue"]]);
function na(e2) {
const t2 = getCurrentInstance();
onBeforeMount(() => {
l2.value.addObserver(t2);
});
onMounted(() => {
n2(l2.value);
a2(l2.value);
});
onUpdated(() => {
n2(l2.value);
a2(l2.value);
});
onUnmounted(() => {
l2.value.removeObserver(t2);
});
const l2 = computed(() => {
const t3 = e2.layout;
if (!t3) {
throw new Error("Can not find table layout.");
}
return t3;
});
const n2 = (t3) => {
var l3;
const n3 = ((l3 = e2.vnode.el) == null ? void 0 : l3.querySelectorAll("colgroup > col")) || [];
if (!n3.length) return;
const o2 = t3.getFlattenColumns();
const a3 = {};
o2.forEach((e3) => {
a3[e3.id] = e3;
});
for (let e3 = 0, t4 = n3.length; e3 < t4; e3++) {
const t5 = n3[e3];
const l4 = t5.getAttribute("name");
const o3 = a3[l4];
if (o3) {
t5.setAttribute("width", o3.realWidth || o3.width);
}
}
};
const a2 = (t3) => {
var l3, n3;
const o2 = ((l3 = e2.vnode.el) == null ? void 0 : l3.querySelectorAll("colgroup > col[name=gutter]")) || [];
for (let e3 = 0, l4 = o2.length; e3 < l4; e3++) {
const l5 = o2[e3];
l5.setAttribute("width", t3.scrollY.value ? t3.gutterWidth : "0");
}
const a3 = ((n3 = e2.vnode.el) == null ? void 0 : n3.querySelectorAll("th.gutter")) || [];
for (let e3 = 0, l4 = a3.length; e3 < l4; e3++) {
const l5 = a3[e3];
l5.style.width = t3.scrollY.value ? `${t3.gutterWidth}px` : "0";
l5.style.display = t3.scrollY.value ? "" : "none";
}
};
return { tableLayout: l2.value, onColumnsChange: n2, onScrollableChange: a2 };
}
const oa = Symbol("ElTable");
function aa$1(e2, t2) {
const l2 = getCurrentInstance();
const n2 = inject(oa);
const o2 = (e3) => {
e3.stopPropagation();
return;
};
const s2 = (e3, t3) => {
if (!t3.filters && t3.sortable) {
h2(e3, t3, false);
} else if (t3.filterable && !t3.sortable) {
o2(e3);
}
n2 == null ? void 0 : n2.emit("header-click", t3, e3);
};
const r2 = (e3, t3) => {
n2 == null ? void 0 : n2.emit("header-contextmenu", t3, e3);
};
const i2 = ref(null);
const u2 = ref(false);
const c2 = ref({});
const d2 = (o3, a2) => {
if (!Te) return;
if (a2.children && a2.children.length > 0) return;
if (i2.value && e2.border) {
u2.value = true;
const s3 = n2;
t2("set-drag-visible", true);
const r3 = s3 == null ? void 0 : s3.vnode.el;
const d3 = r3.getBoundingClientRect().left;
const f3 = l2.vnode.el.querySelector(`th.${a2.id}`);
const p3 = f3.getBoundingClientRect();
const v3 = p3.left - d3 + 30;
tl(f3, "noclick");
c2.value = { startMouseLeft: o3.clientX, startLeft: p3.right - d3, startColumnLeft: p3.left - d3, tableLeft: d3 };
const h3 = s3 == null ? void 0 : s3.refs.resizeProxy;
h3.style.left = `${c2.value.startLeft}px`;
document.onselectstart = function() {
return false;
};
document.ondragstart = function() {
return false;
};
const m2 = (e3) => {
const t3 = e3.clientX - c2.value.startMouseLeft;
const l3 = c2.value.startLeft + t3;
h3.style.left = `${Math.max(v3, l3)}px`;
};
const g2 = () => {
if (u2.value) {
const { startColumnLeft: l3, startLeft: n3 } = c2.value;
const r4 = Number.parseInt(h3.style.left, 10);
const d4 = r4 - l3;
a2.width = a2.realWidth = d4;
s3 == null ? void 0 : s3.emit("header-dragend", a2.width, n3 - l3, a2, o3);
requestAnimationFrame(() => {
e2.store.scheduleLayout(false, true);
});
document.body.style.cursor = "";
u2.value = false;
i2.value = null;
c2.value = {};
t2("set-drag-visible", false);
}
document.removeEventListener("mousemove", m2);
document.removeEventListener("mouseup", g2);
document.onselectstart = null;
document.ondragstart = null;
setTimeout(() => {
nl(f3, "noclick");
}, 0);
};
document.addEventListener("mousemove", m2);
document.addEventListener("mouseup", g2);
}
};
const f2 = (t3, l3) => {
if (l3.children && l3.children.length > 0) return;
const n3 = t3.target;
if (!Ws(n3)) {
return;
}
const o3 = n3 == null ? void 0 : n3.closest("th");
if (!l3 || !l3.resizable) return;
if (!u2.value && e2.border) {
const e3 = o3.getBoundingClientRect();
const n4 = document.body.style;
if (e3.width > 12 && e3.right - t3.pageX < 8) {
n4.cursor = "col-resize";
if (el(o3, "is-sortable")) {
o3.style.cursor = "col-resize";
}
i2.value = l3;
} else if (!u2.value) {
n4.cursor = "";
if (el(o3, "is-sortable")) {
o3.style.cursor = "pointer";
}
i2.value = null;
}
}
};
const p2 = () => {
if (!Te) return;
document.body.style.cursor = "";
};
const v2 = ({ order: e3, sortOrders: t3 }) => {
if (e3 === "") return t3[0];
const l3 = t3.indexOf(e3 || null);
return t3[l3 > t3.length - 2 ? 0 : l3 + 1];
};
const h2 = (t3, l3, o3) => {
var a2;
t3.stopPropagation();
const s3 = l3.order === o3 ? null : o3 || v2(l3);
const r3 = (a2 = t3.target) == null ? void 0 : a2.closest("th");
if (r3) {
if (el(r3, "noclick")) {
nl(r3, "noclick");
return;
}
}
if (!l3.sortable) return;
const i3 = t3.currentTarget;
if (["ascending", "descending"].some((e3) => el(i3, e3) && !l3.sortOrders.includes(e3))) {
return;
}
const u3 = e2.store.states;
let c3 = u3.sortProp.value;
let d3;
const f3 = u3.sortingColumn.value;
if (f3 !== l3 || f3 === l3 && f3.order === null) {
if (f3) {
f3.order = null;
}
u3.sortingColumn.value = l3;
c3 = l3.property;
}
if (!s3) {
d3 = l3.order = null;
} else {
d3 = l3.order = s3;
}
u3.sortProp.value = c3;
u3.sortOrder.value = d3;
n2 == null ? void 0 : n2.store.commit("changeSortCondition");
};
return { handleHeaderClick: s2, handleHeaderContextMenu: r2, handleMouseDown: d2, handleMouseMove: f2, handleMouseOut: p2, handleSortClick: h2, handleFilterClick: o2 };
}
function sa(e2) {
const t2 = inject(oa);
const l2 = zi("table");
const n2 = (e3) => {
const l3 = t2 == null ? void 0 : t2.props.headerRowStyle;
if (typeof l3 === "function") {
return l3.call(null, { rowIndex: e3 });
}
return l3;
};
const o2 = (e3) => {
const l3 = [];
const n3 = t2 == null ? void 0 : t2.props.headerRowClassName;
if (typeof n3 === "string") {
l3.push(n3);
} else if (typeof n3 === "function") {
l3.push(n3.call(null, { rowIndex: e3 }));
}
return l3.join(" ");
};
const a2 = (l3, n3, o3, a3) => {
var s3;
let r2 = (s3 = t2 == null ? void 0 : t2.props.headerCellStyle) != null ? s3 : {};
if (typeof r2 === "function") {
r2 = r2.call(null, { rowIndex: l3, columnIndex: n3, row: o3, column: a3 });
}
const i2 = Mo(n3, a3.fixed, e2.store, o3);
Ho(i2, "left");
Ho(i2, "right");
return Object.assign({}, r2, i2);
};
const s2 = (n3, o3, a3, s3) => {
const r2 = Fo(l2.b(), o3, s3.fixed, e2.store, a3);
const i2 = [s3.id, s3.order, s3.headerAlign, s3.className, s3.labelClassName, ...r2];
if (!s3.children) {
i2.push("is-leaf");
}
if (s3.sortable) {
i2.push("is-sortable");
}
const u2 = t2 == null ? void 0 : t2.props.headerCellClassName;
if (typeof u2 === "string") {
i2.push(u2);
} else if (typeof u2 === "function") {
i2.push(u2.call(null, { rowIndex: n3, columnIndex: o3, row: a3, column: s3 }));
}
i2.push(l2.e("cell"));
return i2.filter((e3) => Boolean(e3)).join(" ");
};
return { getHeaderRowStyle: n2, getHeaderRowClass: o2, getHeaderCellStyle: a2, getHeaderCellClass: s2 };
}
const ra = (e2) => {
const t2 = [];
e2.forEach((e3) => {
if (e3.children) {
t2.push(e3);
t2.push.apply(t2, ra(e3.children));
} else {
t2.push(e3);
}
});
return t2;
};
const ia = (e2) => {
let t2 = 1;
const l2 = (e3, n3) => {
if (n3) {
e3.level = n3.level + 1;
if (t2 < e3.level) {
t2 = e3.level;
}
}
if (e3.children) {
let t3 = 0;
e3.children.forEach((n4) => {
l2(n4, e3);
t3 += n4.colSpan;
});
e3.colSpan = t3;
} else {
e3.colSpan = 1;
}
};
e2.forEach((e3) => {
e3.level = 1;
l2(e3, void 0);
});
const n2 = [];
for (let e3 = 0; e3 < t2; e3++) {
n2.push([]);
}
const o2 = ra(e2);
o2.forEach((e3) => {
if (!e3.children) {
e3.rowSpan = t2 - e3.level + 1;
} else {
e3.rowSpan = 1;
e3.children.forEach((e4) => e4.isSubColumn = true);
}
n2[e3.level - 1].push(e3);
});
return n2;
};
function ua(e2) {
const t2 = inject(oa);
const l2 = computed(() => ia(e2.store.states.originColumns.value));
const n2 = computed(() => {
const e3 = l2.value.length > 1;
if (e3 && t2) {
t2.state.isGroup.value = true;
}
return e3;
});
const a2 = (e3) => {
e3.stopPropagation();
t2 == null ? void 0 : t2.store.commit("toggleAllSelection");
};
return { isGroup: n2, toggleAllSelection: a2, columnRows: l2 };
}
var ca = defineComponent({ name: "ElTableHeader", components: { ElCheckbox: Bm }, props: { fixed: { type: String, default: "" }, store: { required: true, type: Object }, border: Boolean, defaultSort: { type: Object, default: () => ({ prop: "", order: "" }) } }, setup(e2, { emit: t2 }) {
const l2 = getCurrentInstance();
const n2 = inject(oa);
const o2 = zi("table");
const s2 = ref({});
const { onColumnsChange: r2, onScrollableChange: i2 } = na(n2);
onMounted(async () => {
await nextTick();
await nextTick();
const { prop: t3, order: l3 } = e2.defaultSort;
n2 == null ? void 0 : n2.store.commit("sort", { prop: t3, order: l3, init: true });
});
const { handleHeaderClick: u2, handleHeaderContextMenu: c2, handleMouseDown: d2, handleMouseMove: f2, handleMouseOut: p2, handleSortClick: v2, handleFilterClick: h2 } = aa$1(e2, t2);
const { getHeaderRowStyle: m2, getHeaderRowClass: g2, getHeaderCellStyle: b2, getHeaderCellClass: y2 } = sa(e2);
const { isGroup: w2, toggleAllSelection: x2, columnRows: C2 } = ua(e2);
l2.state = { onColumnsChange: r2, onScrollableChange: i2 };
l2.filterPanels = s2;
return { ns: o2, filterPanels: s2, onColumnsChange: r2, onScrollableChange: i2, columnRows: C2, getHeaderRowClass: g2, getHeaderRowStyle: m2, getHeaderCellClass: y2, getHeaderCellStyle: b2, handleHeaderClick: u2, handleHeaderContextMenu: c2, handleMouseDown: d2, handleMouseMove: f2, handleMouseOut: p2, handleSortClick: v2, handleFilterClick: h2, isGroup: w2, toggleAllSelection: x2 };
}, render() {
const { ns: e2, isGroup: t2, columnRows: l2, getHeaderCellStyle: n2, getHeaderCellClass: o2, getHeaderRowClass: a2, getHeaderRowStyle: s2, handleHeaderClick: r2, handleHeaderContextMenu: i2, handleMouseDown: u2, handleMouseMove: c2, handleSortClick: d2, handleMouseOut: f2, store: p2, $parent: v2 } = this;
let h2 = 1;
return h("thead", { class: { [e2.is("group")]: t2 } }, l2.map((e3, t3) => h("tr", { class: a2(t3), key: t3, style: s2(t3) }, e3.map((l3, a3) => {
if (l3.rowSpan > h2) {
h2 = l3.rowSpan;
}
return h("th", { class: o2(t3, a3, e3, l3), colspan: l3.colSpan, key: `${l3.id}-thead`, rowspan: l3.rowSpan, style: n2(t3, a3, e3, l3), onClick: (e4) => {
if (e4.currentTarget.classList.contains("noclick")) {
return;
}
r2(e4, l3);
}, onContextmenu: (e4) => i2(e4, l3), onMousedown: (e4) => u2(e4, l3), onMousemove: (e4) => c2(e4, l3), onMouseout: f2 }, [h("div", { class: ["cell", l3.filteredValue && l3.filteredValue.length > 0 ? "highlight" : ""] }, [l3.renderHeader ? l3.renderHeader({ column: l3, $index: a3, store: p2, _self: v2 }) : l3.label, l3.sortable && h("span", { onClick: (e4) => d2(e4, l3), class: "caret-wrapper" }, [h("i", { onClick: (e4) => d2(e4, l3, "ascending"), class: "sort-caret ascending" }), h("i", { onClick: (e4) => d2(e4, l3, "descending"), class: "sort-caret descending" })]), l3.filterable && h(la, { store: p2, placement: l3.filterPlacement || "bottom-start", column: l3, upDataColumn: (e4, t4) => {
l3[e4] = t4;
} }, { "filter-icon": () => l3.renderFilterIcon ? l3.renderFilterIcon({ filterOpened: l3.filterOpened }) : null })])]);
}))));
} });
function da(e2, t2, l2 = 0.03) {
return e2 - t2 > l2;
}
function fa(e2) {
const t2 = inject(oa);
const l2 = ref("");
const n2 = ref(h("div"));
const o2 = (l3, n3, o3) => {
var a2;
const s3 = t2;
const r3 = ho(l3);
let i3;
const u3 = (a2 = s3 == null ? void 0 : s3.vnode.el) == null ? void 0 : a2.dataset.prefix;
if (r3) {
i3 = yo$1({ columns: e2.store.states.columns.value }, r3, u3);
if (i3) {
s3 == null ? void 0 : s3.emit(`cell-${o3}`, n3, i3, r3, l3);
}
}
s3 == null ? void 0 : s3.emit(`row-${o3}`, n3, i3, l3);
};
const s2 = (e3, t3) => {
o2(e3, t3, "dblclick");
};
const r2 = (t3, l3) => {
e2.store.commit("setCurrentRow", l3);
o2(t3, l3, "click");
};
const i2 = (e3, t3) => {
o2(e3, t3, "contextmenu");
};
const u2 = Ms((t3) => {
e2.store.commit("setHoverRow", t3);
}, 30);
const c2 = Ms(() => {
e2.store.commit("setHoverRow", null);
}, 30);
const d2 = (e3) => {
const t3 = window.getComputedStyle(e3, null);
const l3 = Number.parseInt(t3.paddingLeft, 10) || 0;
const n3 = Number.parseInt(t3.paddingRight, 10) || 0;
const o3 = Number.parseInt(t3.paddingTop, 10) || 0;
const a2 = Number.parseInt(t3.paddingBottom, 10) || 0;
return { left: l3, right: n3, top: o3, bottom: a2 };
};
const f2 = (e3, t3, l3) => {
let n3 = t3.target.parentNode;
while (e3 > 1) {
n3 = n3 == null ? void 0 : n3.nextSibling;
if (!n3 || n3.nodeName !== "TR") break;
l3(n3, "hover-row hover-fixed-row");
e3--;
}
};
const p2 = (l3, n3, o3) => {
var a2;
const s3 = t2;
const r3 = ho(l3);
const i3 = (a2 = s3 == null ? void 0 : s3.vnode.el) == null ? void 0 : a2.dataset.prefix;
if (r3) {
const t3 = yo$1({ columns: e2.store.states.columns.value }, r3, i3);
if (r3.rowSpan > 1) {
f2(r3.rowSpan, l3, tl);
}
const o4 = s3.hoverState = { cell: r3, column: t3, row: n3 };
s3 == null ? void 0 : s3.emit("cell-mouse-enter", o4.row, o4.column, o4.cell, l3);
}
if (!o3) {
return;
}
const u3 = l3.target.querySelector(".cell");
if (!(el(u3, `${i3}-tooltip`) && u3.childNodes.length)) {
return;
}
const c3 = document.createRange();
c3.setStart(u3, 0);
c3.setEnd(u3, u3.childNodes.length);
const { width: p3, height: v3 } = c3.getBoundingClientRect();
const { width: h2, height: m2 } = u3.getBoundingClientRect();
const { top: g2, left: b2, right: y2, bottom: w2 } = d2(u3);
const x2 = b2 + y2;
const C2 = g2 + w2;
if (da(p3 + x2, h2) || da(v3 + C2, m2) || da(u3.scrollWidth, h2)) {
Oo(o3, r3.innerText || r3.textContent, r3, s3);
}
};
const v2 = (e3) => {
const l3 = ho(e3);
if (!l3) return;
if (l3.rowSpan > 1) {
f2(l3.rowSpan, e3, nl);
}
const n3 = t2 == null ? void 0 : t2.hoverState;
t2 == null ? void 0 : t2.emit("cell-mouse-leave", n3 == null ? void 0 : n3.row, n3 == null ? void 0 : n3.column, n3 == null ? void 0 : n3.cell, e3);
};
return { handleDoubleClick: s2, handleClick: r2, handleContextMenu: i2, handleMouseEnter: u2, handleMouseLeave: c2, handleCellMouseEnter: p2, handleCellMouseLeave: v2, tooltipContent: l2, tooltipTrigger: n2 };
}
function pa(e2) {
const t2 = inject(oa);
const l2 = zi("table");
const n2 = (e3, l3) => {
const n3 = t2 == null ? void 0 : t2.props.rowStyle;
if (typeof n3 === "function") {
return n3.call(null, { row: e3, rowIndex: l3 });
}
return n3 || null;
};
const o2 = (n3, o3) => {
const a3 = [l2.e("row")];
if ((t2 == null ? void 0 : t2.props.highlightCurrentRow) && n3 === e2.store.states.currentRow.value) {
a3.push("current-row");
}
if (e2.stripe && o3 % 2 === 1) {
a3.push(l2.em("row", "striped"));
}
const s3 = t2 == null ? void 0 : t2.props.rowClassName;
if (typeof s3 === "string") {
a3.push(s3);
} else if (typeof s3 === "function") {
a3.push(s3.call(null, { row: n3, rowIndex: o3 }));
}
return a3;
};
const a2 = (l3, n3, o3, a3) => {
const s3 = t2 == null ? void 0 : t2.props.cellStyle;
let r3 = s3 != null ? s3 : {};
if (typeof s3 === "function") {
r3 = s3.call(null, { rowIndex: l3, columnIndex: n3, row: o3, column: a3 });
}
const i3 = Mo(n3, e2 == null ? void 0 : e2.fixed, e2.store);
Ho(i3, "left");
Ho(i3, "right");
return Object.assign({}, r3, i3);
};
const s2 = (n3, o3, a3, s3, r3) => {
const i3 = Fo(l2.b(), o3, e2 == null ? void 0 : e2.fixed, e2.store, void 0, r3);
const u2 = [s3.id, s3.align, s3.className, ...i3];
const c2 = t2 == null ? void 0 : t2.props.cellClassName;
if (typeof c2 === "string") {
u2.push(c2);
} else if (typeof c2 === "function") {
u2.push(c2.call(null, { rowIndex: n3, columnIndex: o3, row: a3, column: s3 }));
}
u2.push(l2.e("cell"));
return u2.filter((e3) => Boolean(e3)).join(" ");
};
const r2 = (e3, l3, n3, o3) => {
let a3 = 1;
let s3 = 1;
const r3 = t2 == null ? void 0 : t2.props.spanMethod;
if (typeof r3 === "function") {
const t3 = r3({ row: e3, column: l3, rowIndex: n3, columnIndex: o3 });
if (Array.isArray(t3)) {
a3 = t3[0];
s3 = t3[1];
} else if (typeof t3 === "object") {
a3 = t3.rowspan;
s3 = t3.colspan;
}
}
return { rowspan: a3, colspan: s3 };
};
const i2 = (e3, t3, l3) => {
if (t3 < 1) {
return e3[l3].realWidth;
}
const n3 = e3.map(({ realWidth: e4, width: t4 }) => e4 || t4).slice(l3, l3 + t3);
return Number(n3.reduce((e4, t4) => Number(e4) + Number(t4), -1));
};
return { getRowStyle: n2, getRowClass: o2, getCellStyle: a2, getCellClass: s2, getSpan: r2, getColspanRealWidth: i2 };
}
function va$1(e2) {
const t2 = inject(oa);
const l2 = zi("table");
const { handleDoubleClick: n2, handleClick: a2, handleContextMenu: s2, handleMouseEnter: r2, handleMouseLeave: i2, handleCellMouseEnter: u2, handleCellMouseLeave: c2, tooltipContent: d2, tooltipTrigger: f2 } = fa(e2);
const { getRowStyle: p2, getRowClass: v2, getCellStyle: h2, getCellClass: m2, getSpan: g2, getColspanRealWidth: b2 } = pa(e2);
const y2 = computed(() => e2.store.states.columns.value.findIndex(({ type: e3 }) => e3 === "default"));
const w2 = (e3, l3) => {
const n3 = t2.props.rowKey;
if (n3) {
return wo(e3, n3);
}
return l3;
};
const x2 = (o2, d3, f3, x3 = false) => {
const { tooltipEffect: S3, tooltipOptions: k2, store: E2 } = e2;
const { indent: N2, columns: R2 } = E2.states;
const V2 = v2(o2, d3);
let A2 = true;
if (f3) {
V2.push(l2.em("row", `level-${f3.level}`));
A2 = f3.display;
}
const O2 = A2 ? null : { display: "none" };
return h("tr", { style: [O2, p2(o2, d3)], class: V2, key: w2(o2, d3), onDblclick: (e3) => n2(e3, o2), onClick: (e3) => a2(e3, o2), onContextmenu: (e3) => s2(e3, o2), onMouseenter: () => r2(d3), onMouseleave: i2 }, R2.value.map((l3, n3) => {
const { rowspan: a3, colspan: s3 } = g2(o2, l3, d3, n3);
if (!a3 || !s3) {
return null;
}
const r3 = Object.assign({}, l3);
r3.realWidth = b2(R2.value, s3, n3);
const i3 = { store: e2.store, _self: e2.context || t2, column: r3, row: o2, $index: d3, cellIndex: n3, expanded: x3 };
if (n3 === y2.value && f3) {
i3.treeNode = { indent: f3.level * N2.value, level: f3.level };
if (typeof f3.expanded === "boolean") {
i3.treeNode.expanded = f3.expanded;
if ("loading" in f3) {
i3.treeNode.loading = f3.loading;
}
if ("noLazyChildren" in f3) {
i3.treeNode.noLazyChildren = f3.noLazyChildren;
}
}
}
const p3 = `${w2(o2, d3)},${n3}`;
const v3 = r3.columnKey || r3.rawColumnKey || "";
const E3 = C2(n3, l3, i3);
const V3 = l3.showOverflowTooltip && dn({ effect: S3 }, k2, l3.showOverflowTooltip);
return h("td", { style: h2(d3, n3, o2, l3), class: m2(d3, n3, o2, l3, s3 - 1), key: `${v3}${p3}`, rowspan: a3, colspan: s3, onMouseenter: (e3) => u2(e3, o2, V3), onMouseleave: c2 }, [E3]);
}));
};
const C2 = (e3, t3, l3) => t3.renderCell(l3);
const S2 = (n3, o2) => {
const a3 = e2.store;
const { isRowExpanded: s3, assertRowKey: r3 } = a3;
const { treeData: i3, lazyTreeNodeMap: u3, childrenColumnName: c3, rowKey: d3 } = a3.states;
const f3 = a3.states.columns.value;
const p3 = f3.some(({ type: e3 }) => e3 === "expand");
if (p3) {
const e3 = s3(n3);
const r4 = x2(n3, o2, void 0, e3);
const i4 = t2.renderExpanded;
if (e3) {
if (!i4) {
console.error("[Element Error]renderExpanded is required.");
return r4;
}
return [[r4, h("tr", { key: `expanded-row__${r4.key}` }, [h("td", { colspan: f3.length, class: `${l2.e("cell")} ${l2.e("expanded-cell")}` }, [i4({ row: n3, $index: o2, store: a3, expanded: e3 })])])]];
} else {
return [[r4]];
}
} else if (Object.keys(i3.value).length) {
r3();
const e3 = wo(n3, d3.value);
let t3 = i3.value[e3];
let l3 = null;
if (t3) {
l3 = { expanded: t3.expanded, level: t3.level, display: true };
if (typeof t3.lazy === "boolean") {
if (typeof t3.loaded === "boolean" && t3.loaded) {
l3.noLazyChildren = !(t3.children && t3.children.length);
}
l3.loading = t3.loading;
}
}
const a4 = [x2(n3, o2, l3)];
if (t3) {
let l4 = 0;
const s4 = (e4, n4) => {
if (!(e4 && e4.length && n4)) return;
e4.forEach((e5) => {
const r5 = { display: n4.display && n4.expanded, level: n4.level + 1, expanded: false, noLazyChildren: false, loading: false };
const f4 = wo(e5, d3.value);
if (f4 === void 0 || f4 === null) {
throw new Error("For nested data item, row-key is required.");
}
t3 = { ...i3.value[f4] };
if (t3) {
r5.expanded = t3.expanded;
t3.level = t3.level || r5.level;
t3.display = !!(t3.expanded && r5.display);
if (typeof t3.lazy === "boolean") {
if (typeof t3.loaded === "boolean" && t3.loaded) {
r5.noLazyChildren = !(t3.children && t3.children.length);
}
r5.loading = t3.loading;
}
}
l4++;
a4.push(x2(e5, o2 + l4, r5));
if (t3) {
const l5 = u3.value[f4] || e5[c3.value];
s4(l5, t3);
}
});
};
t3.display = true;
const r4 = u3.value[e3] || n3[c3.value];
s4(r4, t3);
}
return a4;
} else {
return x2(n3, o2, void 0);
}
};
return { wrappedRowRender: S2, tooltipContent: d2, tooltipTrigger: f2 };
}
const ha = { store: { required: true, type: Object }, stripe: Boolean, tooltipEffect: String, tooltipOptions: { type: Object }, context: { default: () => ({}), type: Object }, rowClassName: [String, Function], rowStyle: [Object, Function], fixed: { type: String, default: "" }, highlight: Boolean };
var ma = defineComponent({ name: "ElTableBody", props: ha, setup(e2) {
const t2 = getCurrentInstance();
const l2 = inject(oa);
const n2 = zi("table");
const { wrappedRowRender: o2, tooltipContent: a2, tooltipTrigger: s2 } = va$1(e2);
const { onColumnsChange: r2, onScrollableChange: i2 } = na(l2);
const u2 = [];
watch(e2.store.states.hoverRow, (l3, o3) => {
var a3;
const s3 = t2 == null ? void 0 : t2.vnode.el;
const r3 = Array.from((s3 == null ? void 0 : s3.children) || []).filter((e3) => e3 == null ? void 0 : e3.classList.contains(`${n2.e("row")}`));
let i3 = l3;
const c2 = (a3 = r3[i3]) == null ? void 0 : a3.childNodes;
if (c2 == null ? void 0 : c2.length) {
let e3 = 0;
const t3 = Array.from(c2).reduce((t4, l4, n3) => {
var o4, a4;
if (((o4 = c2[n3]) == null ? void 0 : o4.colSpan) > 1) {
e3 = (a4 = c2[n3]) == null ? void 0 : a4.colSpan;
}
if (l4.nodeName !== "TD" && e3 === 0) {
t4.push(n3);
}
e3 > 0 && e3--;
return t4;
}, []);
t3.forEach((e4) => {
var t4;
i3 = l3;
while (i3 > 0) {
const l4 = (t4 = r3[i3 - 1]) == null ? void 0 : t4.childNodes;
if (l4[e4] && l4[e4].nodeName === "TD" && l4[e4].rowSpan > 1) {
tl(l4[e4], "hover-cell");
u2.push(l4[e4]);
break;
}
i3--;
}
});
} else {
u2.forEach((e3) => nl(e3, "hover-cell"));
u2.length = 0;
}
if (!e2.store.states.isComplex.value || !Te) return;
fn$1(() => {
const e3 = r3[o3];
const t3 = r3[l3];
if (e3 && !e3.classList.contains("hover-fixed-row")) {
nl(e3, "hover-row");
}
if (t3) {
tl(t3, "hover-row");
}
});
});
onUnmounted(() => {
var e3;
(e3 = Ao) == null ? void 0 : e3();
});
return { ns: n2, onColumnsChange: r2, onScrollableChange: i2, wrappedRowRender: o2, tooltipContent: a2, tooltipTrigger: s2 };
}, render() {
const { wrappedRowRender: e2, store: t2 } = this;
const l2 = t2.states.data.value || [];
return h("tbody", { tabIndex: -1 }, [l2.reduce((t3, l3) => t3.concat(e2(l3, t3.length)), [])]);
} });
function ga() {
const e2 = inject(oa);
const t2 = e2 == null ? void 0 : e2.store;
const l2 = computed(() => t2.states.fixedLeafColumnsLength.value);
const n2 = computed(() => t2.states.rightFixedColumns.value.length);
const a2 = computed(() => t2.states.columns.value.length);
const s2 = computed(() => t2.states.fixedColumns.value.length);
const r2 = computed(() => t2.states.rightFixedColumns.value.length);
return { leftFixedLeafCount: l2, rightFixedLeafCount: n2, columnsCount: a2, leftFixedCount: s2, rightFixedCount: r2, columns: t2.states.columns };
}
function ba(e2) {
const { columns: t2 } = ga();
const l2 = zi("table");
const n2 = (t3, n3) => {
const o3 = t3[n3];
const a2 = [l2.e("cell"), o3.id, o3.align, o3.labelClassName, ...Fo(l2.b(), n3, o3.fixed, e2.store)];
if (o3.className) {
a2.push(o3.className);
}
if (!o3.children) {
a2.push(l2.is("leaf"));
}
return a2;
};
const o2 = (t3, l3) => {
const n3 = Mo(l3, t3.fixed, e2.store);
Ho(n3, "left");
Ho(n3, "right");
return n3;
};
return { getCellClasses: n2, getCellStyles: o2, columns: t2 };
}
var ya = defineComponent({ name: "ElTableFooter", props: { fixed: { type: String, default: "" }, store: { required: true, type: Object }, summaryMethod: Function, sumText: String, border: Boolean, defaultSort: { type: Object, default: () => ({ prop: "", order: "" }) } }, setup(e2) {
const { getCellClasses: t2, getCellStyles: l2, columns: n2 } = ba(e2);
const o2 = zi("table");
return { ns: o2, getCellClasses: t2, getCellStyles: l2, columns: n2 };
}, render() {
const { columns: e2, getCellStyles: t2, getCellClasses: l2, summaryMethod: n2, sumText: o2 } = this;
const a2 = this.store.states.data.value;
let s2 = [];
if (n2) {
s2 = n2({ columns: e2, data: a2 });
} else {
e2.forEach((e3, t3) => {
if (t3 === 0) {
s2[t3] = o2;
return;
}
const l3 = a2.map((t4) => Number(t4[e3.property]));
const n3 = [];
let r2 = true;
l3.forEach((e4) => {
if (!Number.isNaN(+e4)) {
r2 = false;
const t4 = `${e4}`.split(".")[1];
n3.push(t4 ? t4.length : 0);
}
});
const i2 = Math.max.apply(null, n3);
if (!r2) {
s2[t3] = l3.reduce((e4, t4) => {
const l4 = Number(t4);
if (!Number.isNaN(+l4)) {
return Number.parseFloat((e4 + t4).toFixed(Math.min(i2, 20)));
} else {
return e4;
}
}, 0);
} else {
s2[t3] = "";
}
});
}
return h(h("tfoot", [h("tr", {}, [...e2.map((n3, o3) => h("td", { key: o3, colspan: n3.colSpan, rowspan: n3.rowSpan, class: l2(e2, o3), style: t2(n3, o3) }, [h("div", { class: ["cell", n3.labelClassName] }, [s2[o3]])]))])]));
} });
function wa(e2) {
const t2 = (t3) => {
e2.commit("setCurrentRow", t3);
};
const l2 = () => e2.getSelectionRows();
const n2 = (t3, l3) => {
e2.toggleRowSelection(t3, l3, false);
e2.updateAllSelected();
};
const o2 = () => {
e2.clearSelection();
};
const a2 = (t3) => {
e2.clearFilter(t3);
};
const s2 = () => {
e2.commit("toggleAllSelection");
};
const r2 = (t3, l3) => {
e2.toggleRowExpansionAdapter(t3, l3);
};
const i2 = () => {
e2.clearSort();
};
const u2 = (t3, l3) => {
e2.commit("sort", { prop: t3, order: l3 });
};
return { setCurrentRow: t2, getSelectionRows: l2, toggleRowSelection: n2, clearSelection: o2, clearFilter: a2, toggleAllSelection: s2, toggleRowExpansion: r2, clearSort: i2, sort: u2 };
}
function xa(e2, t2, l2, n2) {
const s2 = ref(false);
const r2 = ref(null);
const u2 = ref(false);
const c2 = (e3) => {
u2.value = e3;
};
const d2 = ref({ width: null, height: null, headerHeight: null });
const f2 = ref(false);
const p2 = { display: "inline-block", verticalAlign: "middle" };
const v2 = ref();
const h2 = ref(0);
const m2 = ref(0);
const g2 = ref(0);
const b2 = ref(0);
const y2 = ref(0);
watchEffect(() => {
t2.setHeight(e2.height);
});
watchEffect(() => {
t2.setMaxHeight(e2.maxHeight);
});
watch(() => [e2.currentRowKey, l2.states.rowKey], ([e3, t3]) => {
if (!unref(t3) || !unref(e3)) return;
l2.setCurrentRowKey(`${e3}`);
}, { immediate: true });
watch(() => e2.data, (e3) => {
n2.store.commit("setData", e3);
}, { immediate: true, deep: true });
watchEffect(() => {
if (e2.expandRowKeys) {
l2.setExpandRowKeysAdapter(e2.expandRowKeys);
}
});
const w2 = () => {
n2.store.commit("setHoverRow", null);
if (n2.hoverState) n2.hoverState = null;
};
const x2 = (e3, t3) => {
const { pixelX: l3, pixelY: o2 } = t3;
if (Math.abs(l3) >= Math.abs(o2)) {
n2.refs.bodyWrapper.scrollLeft += t3.pixelX / 5;
}
};
const C2 = computed(() => e2.height || e2.maxHeight || l2.states.fixedColumns.value.length > 0 || l2.states.rightFixedColumns.value.length > 0);
const E2 = computed(() => ({ width: t2.bodyWidth.value ? `${t2.bodyWidth.value}px` : "" }));
const N2 = () => {
if (C2.value) {
t2.updateElsHeight();
}
t2.updateColumnsWidth();
requestAnimationFrame($2);
};
onMounted(async () => {
await nextTick();
l2.updateColumns();
L2();
requestAnimationFrame(N2);
const t3 = n2.vnode.el;
const o2 = n2.refs.headerWrapper;
if (e2.flexible && t3 && t3.parentElement) {
t3.parentElement.style.minWidth = "0";
}
d2.value = { width: v2.value = t3.offsetWidth, height: t3.offsetHeight, headerHeight: e2.showHeader && o2 ? o2.offsetHeight : null };
l2.states.columns.value.forEach((e3) => {
if (e3.filteredValue && e3.filteredValue.length) {
n2.store.commit("filterChange", { column: e3, values: e3.filteredValue, silent: true });
}
});
n2.$ready = true;
});
const R2 = (e3, l3) => {
if (!e3) return;
const n3 = Array.from(e3.classList).filter((e4) => !e4.startsWith("is-scrolling-"));
n3.push(t2.scrollX.value ? l3 : "is-scrolling-none");
e3.className = n3.join(" ");
};
const V2 = (e3) => {
const { tableWrapper: t3 } = n2.refs;
R2(t3, e3);
};
const O2 = (e3) => {
const { tableWrapper: t3 } = n2.refs;
return !!(t3 && t3.classList.contains(e3));
};
const $2 = function() {
if (!n2.refs.scrollBarRef) return;
if (!t2.scrollX.value) {
const e4 = "is-scrolling-none";
if (!O2(e4)) {
V2(e4);
}
return;
}
const e3 = n2.refs.scrollBarRef.wrapRef;
if (!e3) return;
const { scrollLeft: l3, offsetWidth: o2, scrollWidth: a2 } = e3;
const { headerWrapper: s3, footerWrapper: r3 } = n2.refs;
if (s3) s3.scrollLeft = l3;
if (r3) r3.scrollLeft = l3;
const i2 = a2 - o2 - 1;
if (l3 >= i2) {
V2("is-scrolling-right");
} else if (l3 === 0) {
V2("is-scrolling-left");
} else {
V2("is-scrolling-middle");
}
};
const L2 = () => {
if (!n2.refs.scrollBarRef) return;
if (n2.refs.scrollBarRef.wrapRef) {
Ue(n2.refs.scrollBarRef.wrapRef, "scroll", $2, { passive: true });
}
if (e2.fit) {
tt(n2.vnode.el, T2);
} else {
Ue(window, "resize", T2);
}
tt(n2.refs.bodyWrapper, () => {
var e3, t3;
T2();
(t3 = (e3 = n2.refs) == null ? void 0 : e3.scrollBarRef) == null ? void 0 : t3.update();
});
};
const T2 = () => {
var t3, l3, o2, a2;
const s3 = n2.vnode.el;
if (!n2.$ready || !s3) return;
let r3 = false;
const { width: i2, height: u3, headerHeight: c3 } = d2.value;
const f3 = v2.value = s3.offsetWidth;
if (i2 !== f3) {
r3 = true;
}
const p3 = s3.offsetHeight;
if ((e2.height || C2.value) && u3 !== p3) {
r3 = true;
}
const w3 = e2.tableLayout === "fixed" ? n2.refs.headerWrapper : (t3 = n2.refs.tableHeaderRef) == null ? void 0 : t3.$el;
if (e2.showHeader && (w3 == null ? void 0 : w3.offsetHeight) !== c3) {
r3 = true;
}
h2.value = ((l3 = n2.refs.tableWrapper) == null ? void 0 : l3.scrollHeight) || 0;
g2.value = (w3 == null ? void 0 : w3.scrollHeight) || 0;
b2.value = ((o2 = n2.refs.footerWrapper) == null ? void 0 : o2.offsetHeight) || 0;
y2.value = ((a2 = n2.refs.appendWrapper) == null ? void 0 : a2.offsetHeight) || 0;
m2.value = h2.value - g2.value - b2.value - y2.value;
if (r3) {
d2.value = { width: f3, height: p3, headerHeight: e2.showHeader && (w3 == null ? void 0 : w3.offsetHeight) || 0 };
N2();
}
};
const F2 = Kd();
const _2 = computed(() => {
const { bodyWidth: e3, scrollY: l3, gutterWidth: n3 } = t2;
return e3.value ? `${e3.value - (l3.value ? n3 : 0)}px` : "";
});
const M2 = computed(() => {
if (e2.maxHeight) return "fixed";
return e2.tableLayout;
});
const H2 = computed(() => {
if (e2.data && e2.data.length) return null;
let t3 = "100%";
if (e2.height && m2.value) {
t3 = `${m2.value}px`;
}
const l3 = v2.value;
return { width: l3 ? `${l3}px` : "", height: t3 };
});
const I2 = computed(() => {
if (e2.height) {
return { height: !Number.isNaN(Number(e2.height)) ? `${e2.height}px` : e2.height };
}
if (e2.maxHeight) {
return { maxHeight: !Number.isNaN(Number(e2.maxHeight)) ? `${e2.maxHeight}px` : e2.maxHeight };
}
return {};
});
const W2 = computed(() => {
if (e2.height) {
return { height: "100%" };
}
if (e2.maxHeight) {
if (!Number.isNaN(Number(e2.maxHeight))) {
return { maxHeight: `${e2.maxHeight - g2.value - b2.value}px` };
} else {
return { maxHeight: `calc(${e2.maxHeight} - ${g2.value + b2.value}px)` };
}
}
return {};
});
const B2 = (e3, t3) => {
const l3 = n2.refs.bodyWrapper;
if (Math.abs(t3.spinY) > 0) {
const n3 = l3.scrollTop;
if (t3.pixelY < 0 && n3 !== 0) {
e3.preventDefault();
}
if (t3.pixelY > 0 && l3.scrollHeight - l3.clientHeight > n3) {
e3.preventDefault();
}
l3.scrollTop += Math.ceil(t3.pixelY / 5);
} else {
l3.scrollLeft += Math.ceil(t3.pixelX / 5);
}
};
return { isHidden: s2, renderExpanded: r2, setDragVisible: c2, isGroup: f2, handleMouseLeave: w2, handleHeaderFooterMousewheel: x2, tableSize: F2, emptyBlockStyle: H2, handleFixedMousewheel: B2, resizeProxyVisible: u2, bodyWidth: _2, resizeState: d2, doLayout: N2, tableBodyStyles: E2, tableLayout: M2, scrollbarViewStyle: p2, tableInnerStyle: I2, scrollbarStyle: W2 };
}
function Ca(e2) {
const t2 = ref();
const l2 = () => {
const l3 = e2.vnode.el;
const n2 = l3.querySelector(".hidden-columns");
const o2 = { childList: true, subtree: true };
const a2 = e2.store.states.updateOrderFns;
t2.value = new MutationObserver(() => {
a2.forEach((e3) => e3());
});
t2.value.observe(n2, o2);
};
onMounted(() => {
l2();
});
onUnmounted(() => {
var e3;
(e3 = t2.value) == null ? void 0 : e3.disconnect();
});
}
var Sa = { data: { type: Array, default: () => [] }, size: wd, width: [String, Number], height: [String, Number], maxHeight: [String, Number], fit: { type: Boolean, default: true }, stripe: Boolean, border: Boolean, rowKey: [String, Function], showHeader: { type: Boolean, default: true }, showSummary: Boolean, sumText: String, summaryMethod: Function, rowClassName: [String, Function], rowStyle: [Object, Function], cellClassName: [String, Function], cellStyle: [Object, Function], headerRowClassName: [String, Function], headerRowStyle: [Object, Function], headerCellClassName: [String, Function], headerCellStyle: [Object, Function], highlightCurrentRow: Boolean, currentRowKey: [String, Number], emptyText: String, expandRowKeys: Array, defaultExpandAll: Boolean, defaultSort: Object, tooltipEffect: String, tooltipOptions: Object, spanMethod: Function, selectOnIndeterminate: { type: Boolean, default: true }, indent: { type: Number, default: 16 }, treeProps: { type: Object, default: () => ({ hasChildren: "hasChildren", children: "children", checkStrictly: false }) }, lazy: Boolean, load: Function, style: { type: Object, default: () => ({}) }, className: { type: String, default: "" }, tableLayout: { type: String, default: "fixed" }, scrollbarAlwaysOn: Boolean, flexible: Boolean, showOverflowTooltip: [Boolean, Object] };
function ka(e2) {
const t2 = e2.tableLayout === "auto";
let l2 = e2.columns || [];
if (t2) {
if (l2.every((e3) => e3.width === void 0)) {
l2 = [];
}
}
const n2 = (l3) => {
const n3 = { key: `${e2.tableLayout}_${l3.id}`, style: {}, name: void 0 };
if (t2) {
n3.style = { width: `${l3.width}px` };
} else {
n3.name = l3.id;
}
return n3;
};
return h("colgroup", {}, l2.map((e3) => h("col", n2(e3))));
}
ka.props = ["columns", "tableLayout"];
const Ea = () => {
const e2 = ref();
const t2 = (t3, l3) => {
const n3 = e2.value;
if (n3) {
n3.scrollTo(t3, l3);
}
};
const l2 = (t3, l3) => {
const n3 = e2.value;
if (n3 && Hs(l3) && ["Top", "Left"].includes(t3)) {
n3[`setScroll${t3}`](l3);
}
};
const n2 = (e3) => l2("Top", e3);
const o2 = (e3) => l2("Left", e3);
return { scrollBarRef: e2, scrollTo: t2, setScrollTop: n2, setScrollLeft: o2 };
};
let Na = 1;
const Ra = defineComponent({ name: "ElTable", directives: { Mousewheel: qn$1 }, components: { TableHeader: ca, TableBody: ma, TableFooter: ya, ElScrollbar: Ef, hColgroup: ka }, props: Sa, emits: ["select", "select-all", "selection-change", "cell-mouse-enter", "cell-mouse-leave", "cell-contextmenu", "cell-click", "cell-dblclick", "row-click", "row-contextmenu", "row-dblclick", "header-click", "header-contextmenu", "sort-change", "filter-change", "current-change", "header-dragend", "expand-change"], setup(e2) {
const { t: t2 } = Bi();
const l2 = zi("table");
const n2 = getCurrentInstance();
provide(oa, n2);
const a2 = qo(n2, e2);
n2.store = a2;
const s2 = new Qo$1({ store: n2.store, table: n2, fit: e2.fit, showHeader: e2.showHeader });
n2.layout = s2;
const r2 = computed(() => (a2.states.data.value || []).length === 0);
const { setCurrentRow: i2, getSelectionRows: u2, toggleRowSelection: c2, clearSelection: d2, clearFilter: f2, toggleAllSelection: p2, toggleRowExpansion: v2, clearSort: h2, sort: m2 } = wa(a2);
const { isHidden: g2, renderExpanded: b2, setDragVisible: y2, isGroup: w2, handleMouseLeave: x2, handleHeaderFooterMousewheel: C2, tableSize: S2, emptyBlockStyle: k2, handleFixedMousewheel: E2, resizeProxyVisible: N2, bodyWidth: R2, resizeState: V2, doLayout: A2, tableBodyStyles: O2, tableLayout: L2, scrollbarViewStyle: T2, tableInnerStyle: F2, scrollbarStyle: _2 } = xa(e2, s2, a2, n2);
const { scrollBarRef: M2, scrollTo: H2, setScrollLeft: I2, setScrollTop: W2 } = Ea();
const B2 = Ms(A2, 50);
const P2 = `${l2.namespace.value}-table_${Na++}`;
n2.tableId = P2;
n2.state = { isGroup: w2, resizeState: V2, doLayout: A2, debouncedUpdateLayout: B2 };
const z2 = computed(() => e2.sumText || t2("el.table.sumText"));
const D2 = computed(() => e2.emptyText || t2("el.table.emptyText"));
const K2 = computed(() => ia(a2.states.originColumns.value)[0]);
Ca(n2);
return { ns: l2, layout: s2, store: a2, columns: K2, handleHeaderFooterMousewheel: C2, handleMouseLeave: x2, tableId: P2, tableSize: S2, isHidden: g2, isEmpty: r2, renderExpanded: b2, resizeProxyVisible: N2, resizeState: V2, isGroup: w2, bodyWidth: R2, tableBodyStyles: O2, emptyBlockStyle: k2, debouncedUpdateLayout: B2, handleFixedMousewheel: E2, setCurrentRow: i2, getSelectionRows: u2, toggleRowSelection: c2, clearSelection: d2, clearFilter: f2, toggleAllSelection: p2, toggleRowExpansion: v2, clearSort: h2, doLayout: A2, sort: m2, t: t2, setDragVisible: y2, context: n2, computedSumText: z2, computedEmptyText: D2, tableLayout: L2, scrollbarViewStyle: T2, tableInnerStyle: F2, scrollbarStyle: _2, scrollBarRef: M2, scrollTo: H2, setScrollLeft: I2, setScrollTop: W2 };
} });
function Va(e2, t2, l2, n2, o2, a2) {
const i2 = resolveComponent("hColgroup");
const d2 = resolveComponent("table-header");
const v2 = resolveComponent("table-body");
const h2 = resolveComponent("table-footer");
const C2 = resolveComponent("el-scrollbar");
const S2 = resolveDirective("mousewheel");
return openBlock(), createElementBlock("div", { ref: "tableWrapper", class: normalizeClass([{ [e2.ns.m("fit")]: e2.fit, [e2.ns.m("striped")]: e2.stripe, [e2.ns.m("border")]: e2.border || e2.isGroup, [e2.ns.m("hidden")]: e2.isHidden, [e2.ns.m("group")]: e2.isGroup, [e2.ns.m("fluid-height")]: e2.maxHeight, [e2.ns.m("scrollable-x")]: e2.layout.scrollX.value, [e2.ns.m("scrollable-y")]: e2.layout.scrollY.value, [e2.ns.m("enable-row-hover")]: !e2.store.states.isComplex.value, [e2.ns.m("enable-row-transition")]: (e2.store.states.data.value || []).length !== 0 && (e2.store.states.data.value || []).length < 100, "has-footer": e2.showSummary }, e2.ns.m(e2.tableSize), e2.className, e2.ns.b(), e2.ns.m(`layout-${e2.tableLayout}`)]), style: normalizeStyle(e2.style), "data-prefix": e2.ns.namespace.value, onMouseleave: e2.handleMouseLeave }, [createElementVNode("div", { class: normalizeClass(e2.ns.e("inner-wrapper")), style: normalizeStyle(e2.tableInnerStyle) }, [createElementVNode("div", { ref: "hiddenColumns", class: "hidden-columns" }, [renderSlot(e2.$slots, "default")], 512), e2.showHeader && e2.tableLayout === "fixed" ? withDirectives((openBlock(), createElementBlock("div", { key: 0, ref: "headerWrapper", class: normalizeClass(e2.ns.e("header-wrapper")) }, [createElementVNode("table", { ref: "tableHeader", class: normalizeClass(e2.ns.e("header")), style: normalizeStyle(e2.tableBodyStyles), border: "0", cellpadding: "0", cellspacing: "0" }, [createVNode(i2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), createVNode(d2, { ref: "tableHeaderRef", border: e2.border, "default-sort": e2.defaultSort, store: e2.store, onSetDragVisible: e2.setDragVisible }, null, 8, ["border", "default-sort", "store", "onSetDragVisible"])], 6)], 2)), [[S2, e2.handleHeaderFooterMousewheel]]) : createCommentVNode("v-if", true), createElementVNode("div", { ref: "bodyWrapper", class: normalizeClass(e2.ns.e("body-wrapper")) }, [createVNode(C2, { ref: "scrollBarRef", "view-style": e2.scrollbarViewStyle, "wrap-style": e2.scrollbarStyle, always: e2.scrollbarAlwaysOn }, { default: withCtx(() => [createElementVNode("table", { ref: "tableBody", class: normalizeClass(e2.ns.e("body")), cellspacing: "0", cellpadding: "0", border: "0", style: normalizeStyle({ width: e2.bodyWidth, tableLayout: e2.tableLayout }) }, [createVNode(i2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), e2.showHeader && e2.tableLayout === "auto" ? (openBlock(), createBlock(d2, { key: 0, ref: "tableHeaderRef", class: normalizeClass(e2.ns.e("body-header")), border: e2.border, "default-sort": e2.defaultSort, store: e2.store, onSetDragVisible: e2.setDragVisible }, null, 8, ["class", "border", "default-sort", "store", "onSetDragVisible"])) : createCommentVNode("v-if", true), createVNode(v2, { context: e2.context, highlight: e2.highlightCurrentRow, "row-class-name": e2.rowClassName, "tooltip-effect": e2.tooltipEffect, "tooltip-options": e2.tooltipOptions, "row-style": e2.rowStyle, store: e2.store, stripe: e2.stripe }, null, 8, ["context", "highlight", "row-class-name", "tooltip-effect", "tooltip-options", "row-style", "store", "stripe"]), e2.showSummary && e2.tableLayout === "auto" ? (openBlock(), createBlock(h2, { key: 1, class: normalizeClass(e2.ns.e("body-footer")), border: e2.border, "default-sort": e2.defaultSort, store: e2.store, "sum-text": e2.computedSumText, "summary-method": e2.summaryMethod }, null, 8, ["class", "border", "default-sort", "store", "sum-text", "summary-method"])) : createCommentVNode("v-if", true)], 6), e2.isEmpty ? (openBlock(), createElementBlock("div", { key: 0, ref: "emptyBlock", style: normalizeStyle(e2.emptyBlockStyle), class: normalizeClass(e2.ns.e("empty-block")) }, [createElementVNode("span", { class: normalizeClass(e2.ns.e("empty-text")) }, [renderSlot(e2.$slots, "empty", {}, () => [createTextVNode(toDisplayString(e2.computedEmptyText), 1)])], 2)], 6)) : createCommentVNode("v-if", true), e2.$slots.append ? (openBlock(), createElementBlock("div", { key: 1, ref: "appendWrapper", class: normalizeClass(e2.ns.e("append-wrapper")) }, [renderSlot(e2.$slots, "append")], 2)) : createCommentVNode("v-if", true)]), _: 3 }, 8, ["view-style", "wrap-style", "always"])], 2), e2.showSummary && e2.tableLayout === "fixed" ? withDirectives((openBlock(), createElementBlock("div", { key: 1, ref: "footerWrapper", class: normalizeClass(e2.ns.e("footer-wrapper")) }, [createElementVNode("table", { class: normalizeClass(e2.ns.e("footer")), cellspacing: "0", cellpadding: "0", border: "0", style: normalizeStyle(e2.tableBodyStyles) }, [createVNode(i2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), createVNode(h2, { border: e2.border, "default-sort": e2.defaultSort, store: e2.store, "sum-text": e2.computedSumText, "summary-method": e2.summaryMethod }, null, 8, ["border", "default-sort", "store", "sum-text", "summary-method"])], 6)], 2)), [[vShow, !e2.isEmpty], [S2, e2.handleHeaderFooterMousewheel]]) : createCommentVNode("v-if", true), e2.border || e2.isGroup ? (openBlock(), createElementBlock("div", { key: 2, class: normalizeClass(e2.ns.e("border-left-patch")) }, null, 2)) : createCommentVNode("v-if", true)], 6), withDirectives(createElementVNode("div", { ref: "resizeProxy", class: normalizeClass(e2.ns.e("column-resize-proxy")) }, null, 2), [[vShow, e2.resizeProxyVisible]])], 46, ["data-prefix", "onMouseleave"]);
}
var Aa = $d(Ra, [["render", Va], ["__file", "table.vue"]]);
const Oa = { selection: "table-column--selection", expand: "table__expand-column" };
const $a = { default: { order: "" }, selection: { width: 48, minWidth: 48, realWidth: 48, order: "" }, expand: { width: 48, minWidth: 48, realWidth: 48, order: "" }, index: { width: 48, minWidth: 48, realWidth: 48, order: "" } };
const La = (e2) => Oa[e2] || "";
const Ta = { selection: { renderHeader({ store: e2, column: t2 }) {
function l2() {
return e2.states.data.value && e2.states.data.value.length === 0;
}
return h(Bm, { disabled: l2(), size: e2.states.tableSize.value, indeterminate: e2.states.selection.value.length > 0 && !e2.states.isAllSelected.value, "onUpdate:modelValue": e2.toggleAllSelection, modelValue: e2.states.isAllSelected.value, ariaLabel: t2.label });
}, renderCell({ row: e2, column: t2, store: l2, $index: n2 }) {
return h(Bm, { disabled: t2.selectable ? !t2.selectable.call(null, e2, n2) : false, size: l2.states.tableSize.value, onChange: () => {
l2.commit("rowSelectedChanged", e2);
}, onClick: (e3) => e3.stopPropagation(), modelValue: l2.isSelected(e2), ariaLabel: t2.label });
}, sortable: false, resizable: false }, index: { renderHeader({ column: e2 }) {
return e2.label || "#";
}, renderCell({ column: e2, $index: t2 }) {
let l2 = t2 + 1;
const n2 = e2.index;
if (typeof n2 === "number") {
l2 = t2 + n2;
} else if (typeof n2 === "function") {
l2 = n2(t2);
}
return h("div", {}, [l2]);
}, sortable: false }, expand: { renderHeader({ column: e2 }) {
return e2.label || "";
}, renderCell({ row: e2, store: t2, expanded: l2 }) {
const { ns: n2 } = t2;
const o2 = [n2.e("expand-icon")];
if (l2) {
o2.push(n2.em("expand-icon", "expanded"));
}
const a2 = function(l3) {
l3.stopPropagation();
t2.toggleRowExpansion(e2);
};
return h("div", { class: o2, onClick: a2 }, { default: () => [h(Ud, null, { default: () => [h(fl)] })] });
}, sortable: false, resizable: false } };
function Fa({ row: e2, column: t2, $index: l2 }) {
var n2;
const o2 = t2.property;
const a2 = o2 && Gs(e2, o2).value;
if (t2 && t2.formatter) {
return t2.formatter(e2, t2, a2, l2);
}
return ((n2 = a2 == null ? void 0 : a2.toString) == null ? void 0 : n2.call(a2)) || "";
}
function _a({ row: e2, treeNode: t2, store: l2 }, n2 = false) {
const { ns: o2 } = l2;
if (!t2) {
if (n2) {
return [h("span", { class: o2.e("placeholder") })];
}
return null;
}
const a2 = [];
const s2 = function(n3) {
n3.stopPropagation();
if (t2.loading) {
return;
}
l2.loadOrToggle(e2);
};
if (t2.indent) {
a2.push(h("span", { class: o2.e("indent"), style: { "padding-left": `${t2.indent}px` } }));
}
if (typeof t2.expanded === "boolean" && !t2.noLazyChildren) {
const e3 = [o2.e("expand-icon"), t2.expanded ? o2.em("expand-icon", "expanded") : ""];
let l3 = fl;
if (t2.loading) {
l3 = zl;
}
a2.push(h("div", { class: e3, onClick: s2 }, { default: () => [h(Ud, { class: { [o2.is("loading")]: t2.loading } }, { default: () => [h(l3)] })] }));
} else {
a2.push(h("span", { class: o2.e("placeholder") }));
}
return a2;
}
function Ma(e2, t2) {
return e2.reduce((e3, t3) => {
e3[t3] = t3;
return e3;
}, t2);
}
function Ha(e2, t2) {
const l2 = getCurrentInstance();
const n2 = () => {
const n3 = ["fixed"];
const o3 = { realWidth: "width", realMinWidth: "minWidth" };
const a2 = Ma(n3, o3);
Object.keys(a2).forEach((n4) => {
const a3 = o3[n4];
if (vt(t2, a3)) {
watch(() => t2[a3], (t3) => {
let o4 = t3;
if (a3 === "width" && n4 === "realWidth") {
o4 = So(t3);
}
if (a3 === "minWidth" && n4 === "realMinWidth") {
o4 = ko(t3);
}
l2.columnConfig.value[a3] = o4;
l2.columnConfig.value[n4] = o4;
const s2 = a3 === "fixed";
e2.value.store.scheduleLayout(s2);
});
}
});
};
const o2 = () => {
const e3 = ["label", "filters", "filterMultiple", "filteredValue", "sortable", "index", "formatter", "className", "labelClassName", "filterClassName", "showOverflowTooltip"];
const n3 = { property: "prop", align: "realAlign", headerAlign: "realHeaderAlign" };
const o3 = Ma(e3, n3);
Object.keys(o3).forEach((e4) => {
const o4 = n3[e4];
if (vt(t2, o4)) {
watch(() => t2[o4], (t3) => {
l2.columnConfig.value[e4] = t3;
});
}
});
};
return { registerComplexWatchers: n2, registerNormalWatchers: o2 };
}
function Ia(e2, t2, l2) {
const n2 = getCurrentInstance();
const s2 = ref("");
const r2 = ref(false);
const u2 = ref();
const c2 = ref();
const d2 = zi("table");
watchEffect(() => {
u2.value = e2.align ? `is-${e2.align}` : null;
u2.value;
});
watchEffect(() => {
c2.value = e2.headerAlign ? `is-${e2.headerAlign}` : u2.value;
c2.value;
});
const f2 = computed(() => {
let e3 = n2.vnode.vParent || n2.parent;
while (e3 && !e3.tableId && !e3.columnId) {
e3 = e3.vnode.vParent || e3.parent;
}
return e3;
});
const p2 = computed(() => {
const { store: e3 } = n2.parent;
if (!e3) return false;
const { treeData: t3 } = e3.states;
const l3 = t3.value;
return l3 && Object.keys(l3).length > 0;
});
const v2 = ref(So(e2.width));
const h2 = ref(ko(e2.minWidth));
const m2 = (e3) => {
if (v2.value) e3.width = v2.value;
if (h2.value) {
e3.minWidth = h2.value;
}
if (!v2.value && h2.value) {
e3.width = void 0;
}
if (!e3.minWidth) {
e3.minWidth = 80;
}
e3.realWidth = Number(e3.width === void 0 ? e3.minWidth : e3.width);
return e3;
};
const g2 = (e3) => {
const t3 = e3.type;
const l3 = Ta[t3] || {};
Object.keys(l3).forEach((t4) => {
const n4 = l3[t4];
if (t4 !== "className" && n4 !== void 0) {
e3[t4] = n4;
}
});
const n3 = La(t3);
if (n3) {
const t4 = `${unref(d2.namespace)}-${n3}`;
e3.className = e3.className ? `${e3.className} ${t4}` : t4;
}
return e3;
};
const y2 = (e3) => {
if (Array.isArray(e3)) {
e3.forEach((e4) => t3(e4));
} else {
t3(e3);
}
function t3(e4) {
var t4;
if (((t4 = e4 == null ? void 0 : e4.type) == null ? void 0 : t4.name) === "ElTableColumn") {
e4.vParent = n2;
}
}
};
const w2 = (o2) => {
if (e2.renderHeader) ;
else if (o2.type !== "selection") {
o2.renderHeader = (e3) => {
n2.columnConfig.value["label"];
return renderSlot(t2, "header", e3, () => [o2.label]);
};
}
if (t2["filter-icon"]) {
o2.renderFilterIcon = (e3) => renderSlot(t2, "filter-icon", e3);
}
let a2 = o2.renderCell;
if (o2.type === "expand") {
o2.renderCell = (e3) => h("div", { class: "cell" }, [a2(e3)]);
l2.value.renderExpanded = (e3) => t2.default ? t2.default(e3) : t2.default;
} else {
a2 = a2 || Fa;
o2.renderCell = (e3) => {
let n3 = null;
if (t2.default) {
const l3 = t2.default(e3);
n3 = l3.some((e4) => e4.type !== Comment) ? l3 : a2(e3);
} else {
n3 = a2(e3);
}
const { columns: s3 } = l2.value.store.states;
const r3 = s3.value.findIndex((e4) => e4.type === "default");
const u3 = p2.value && e3.cellIndex === r3;
const c3 = _a(e3, u3);
const f3 = { class: "cell", style: {} };
if (o2.showOverflowTooltip) {
f3.class = `${f3.class} ${unref(d2.namespace)}-tooltip`;
f3.style = { width: `${(e3.column.realWidth || Number(e3.column.width)) - 1}px` };
}
y2(n3);
return h("div", f3, [c3, n3]);
};
}
return o2;
};
const x2 = (...t3) => t3.reduce((t4, l3) => {
if (Array.isArray(l3)) {
l3.forEach((l4) => {
t4[l4] = e2[l4];
});
}
return t4;
}, {});
const C2 = (e3, t3) => Array.prototype.indexOf.call(e3, t3);
const S2 = () => {
l2.value.store.commit("updateColumnOrder", n2.columnConfig.value);
};
return { columnId: s2, realAlign: u2, isSubColumn: r2, realHeaderAlign: c2, columnOrTableParent: f2, setColumnWidth: m2, setColumnForcedProps: g2, setColumnRenders: w2, getPropsData: x2, getColumnElIndex: C2, updateColumnOrder: S2 };
}
var Wa = { type: { type: String, default: "default" }, label: String, className: String, labelClassName: String, property: String, prop: String, width: { type: [String, Number], default: "" }, minWidth: { type: [String, Number], default: "" }, renderHeader: Function, sortable: { type: [Boolean, String], default: false }, sortMethod: Function, sortBy: [String, Function, Array], resizable: { type: Boolean, default: true }, columnKey: String, align: String, headerAlign: String, showOverflowTooltip: { type: [Boolean, Object], default: void 0 }, fixed: [Boolean, String], formatter: Function, selectable: Function, reserveSelection: Boolean, filterMethod: Function, filteredValue: Array, filters: Array, filterPlacement: String, filterMultiple: { type: Boolean, default: true }, filterClassName: String, index: [Number, Function], sortOrders: { type: Array, default: () => ["ascending", "descending", null], validator: (e2) => e2.every((e3) => ["ascending", "descending", null].includes(e3)) } };
let Ba = 1;
var Pa$1 = defineComponent({ name: "ElTableColumn", components: { ElCheckbox: Bm }, props: Wa, setup(e2, { slots: t2 }) {
const l2 = getCurrentInstance();
const n2 = ref({});
const s2 = computed(() => {
let e3 = l2.parent;
while (e3 && !e3.tableId) {
e3 = e3.parent;
}
return e3;
});
const { registerNormalWatchers: r2, registerComplexWatchers: i2 } = Ha(s2, e2);
const { columnId: u2, isSubColumn: c2, realHeaderAlign: d2, columnOrTableParent: f2, setColumnWidth: p2, setColumnForcedProps: v2, setColumnRenders: h2, getPropsData: m2, getColumnElIndex: g2, realAlign: b2, updateColumnOrder: y2 } = Ia(e2, t2, s2);
const w2 = f2.value;
u2.value = `${w2.tableId || w2.columnId}_column_${Ba++}`;
onBeforeMount(() => {
c2.value = s2.value !== w2;
const t3 = e2.type || "default";
const o2 = e2.sortable === "" ? true : e2.sortable;
const a2 = Vs(e2.showOverflowTooltip) ? w2.props.showOverflowTooltip : e2.showOverflowTooltip;
const f3 = { ...$a[t3], id: u2.value, type: t3, property: e2.prop || e2.property, align: b2, headerAlign: d2, showOverflowTooltip: a2, filterable: e2.filters || e2.filterMethod, filteredValue: [], filterPlacement: "", filterClassName: "", isColumnGroup: false, isSubColumn: false, filterOpened: false, sortable: o2, index: e2.index, rawColumnKey: l2.vnode.key };
const g3 = ["columnKey", "label", "className", "labelClassName", "type", "renderHeader", "formatter", "fixed", "resizable"];
const y3 = ["sortMethod", "sortBy", "sortOrders"];
const x2 = ["selectable", "reserveSelection"];
const C2 = ["filterMethod", "filters", "filterMultiple", "filterOpened", "filteredValue", "filterPlacement", "filterClassName"];
let S2 = m2(g3, y3, x2, C2);
S2 = Co(f3, S2);
const k2 = No(h2, p2, v2);
S2 = k2(S2);
n2.value = S2;
r2();
i2();
});
onMounted(() => {
var e3;
const t3 = f2.value;
const o2 = c2.value ? t3.vnode.el.children : (e3 = t3.refs.hiddenColumns) == null ? void 0 : e3.children;
const a2 = () => g2(o2 || [], l2.vnode.el);
n2.value.getColumnIndex = a2;
const r3 = a2();
r3 > -1 && s2.value.store.commit("insertColumn", n2.value, c2.value ? t3.columnConfig.value : null, y2);
});
onBeforeUnmount(() => {
const e3 = n2.value.getColumnIndex();
e3 > -1 && s2.value.store.commit("removeColumn", n2.value, c2.value ? w2.columnConfig.value : null, y2);
});
l2.columnId = u2.value;
l2.columnConfig = n2;
return;
}, render() {
var e2, t2, l2;
try {
const n2 = (t2 = (e2 = this.$slots).default) == null ? void 0 : t2.call(e2, { row: {}, column: {}, $index: -1 });
const o2 = [];
if (Array.isArray(n2)) {
for (const e3 of n2) {
if (((l2 = e3.type) == null ? void 0 : l2.name) === "ElTableColumn" || e3.shapeFlag & 2) {
o2.push(e3);
} else if (e3.type === Fragment && Array.isArray(e3.children)) {
e3.children.forEach((e4) => {
if ((e4 == null ? void 0 : e4.patchFlag) !== 1024 && !bt(e4 == null ? void 0 : e4.children)) {
o2.push(e4);
}
});
}
}
}
const a2 = h("div", o2);
return a2;
} catch (e3) {
return h("div", []);
}
} });
const za = li(Aa, { TableColumn: Pa$1 });
const Da = ui(Pa$1);
const ja = Symbol("tabsRootContextKey");
const Ka = ti({ tabs: { type: Jl(Array), default: () => yi([]) } });
const Ua = "ElTabBar";
const Ya = defineComponent({ name: Ua });
const qa = defineComponent({ ...Ya, props: Ka, setup(e2, { expose: t2 }) {
const l2 = e2;
const n2 = getCurrentInstance();
const o2 = inject(ja);
if (!o2) Xs(Ua, "<el-tabs><el-tab-bar /></el-tabs>");
const r2 = zi("tabs");
const u2 = ref();
const c2 = ref();
const d2 = () => {
let e3 = 0;
let t3 = 0;
const a2 = ["top", "bottom"].includes(o2.props.tabPosition) ? "width" : "height";
const s2 = a2 === "width" ? "x" : "y";
const r3 = s2 === "x" ? "left" : "top";
l2.tabs.every((l3) => {
var o3, s3;
const i2 = (s3 = (o3 = n2.parent) == null ? void 0 : o3.refs) == null ? void 0 : s3[`tab-${l3.uid}`];
if (!i2) return false;
if (!l3.active) {
return true;
}
e3 = i2[`offset${pn(r3)}`];
t3 = i2[`client${pn(a2)}`];
const u3 = window.getComputedStyle(i2);
if (a2 === "width") {
t3 -= Number.parseFloat(u3.paddingLeft) + Number.parseFloat(u3.paddingRight);
e3 += Number.parseFloat(u3.paddingLeft);
}
return false;
});
return { [a2]: `${t3}px`, transform: `translate${pn(s2)}(${e3}px)` };
};
const f2 = () => c2.value = d2();
watch(() => l2.tabs, async () => {
await nextTick();
f2();
}, { immediate: true });
tt(u2, () => f2());
t2({ ref: u2, update: f2 });
return (e3, t3) => (openBlock(), createElementBlock("div", { ref_key: "barRef", ref: u2, class: normalizeClass([unref(r2).e("active-bar"), unref(r2).is(unref(o2).props.tabPosition)]), style: normalizeStyle(c2.value) }, null, 6));
} });
var Xa = $d(qa, [["__file", "tab-bar.vue"]]);
const Ga = ti({ panes: { type: Jl(Array), default: () => yi([]) }, currentName: { type: [String, Number], default: "" }, editable: Boolean, type: { type: String, values: ["card", "border-card", ""], default: "" }, stretch: Boolean });
const Ja = { tabClick: (e2, t2, l2) => l2 instanceof Event, tabRemove: (e2, t2) => t2 instanceof Event };
const Qa = "ElTabNav";
const Za = defineComponent({ name: Qa, props: Ga, emits: Ja, setup(e2, { expose: t2, emit: l2 }) {
const n2 = inject(ja);
if (!n2) Xs(Qa, `<el-tabs><tab-nav /></el-tabs>`);
const s2 = zi("tabs");
const r2 = Ze();
const i2 = ct();
const u2 = ref();
const d2 = ref();
const f2 = ref();
const p2 = ref();
const v2 = ref(false);
const h2 = ref(0);
const m2 = ref(false);
const g2 = ref(true);
const b2 = computed(() => ["top", "bottom"].includes(n2.props.tabPosition) ? "width" : "height");
const y2 = computed(() => {
const e3 = b2.value === "width" ? "X" : "Y";
return { transform: `translate${e3}(-${h2.value}px)` };
});
const w2 = () => {
if (!u2.value) return;
const e3 = u2.value[`offset${pn(b2.value)}`];
const t3 = h2.value;
if (!t3) return;
const l3 = t3 > e3 ? t3 - e3 : 0;
h2.value = l3;
};
const x2 = () => {
if (!u2.value || !d2.value) return;
const e3 = d2.value[`offset${pn(b2.value)}`];
const t3 = u2.value[`offset${pn(b2.value)}`];
const l3 = h2.value;
if (e3 - l3 <= t3) return;
const n3 = e3 - l3 > t3 * 2 ? l3 + t3 : e3 - t3;
h2.value = n3;
};
const C2 = async () => {
const e3 = d2.value;
if (!v2.value || !f2.value || !u2.value || !e3) return;
await nextTick();
const t3 = f2.value.querySelector(".is-active");
if (!t3) return;
const l3 = u2.value;
const o2 = ["top", "bottom"].includes(n2.props.tabPosition);
const a2 = t3.getBoundingClientRect();
const s3 = l3.getBoundingClientRect();
const r3 = o2 ? e3.offsetWidth - s3.width : e3.offsetHeight - s3.height;
const i3 = h2.value;
let c2 = i3;
if (o2) {
if (a2.left < s3.left) {
c2 = i3 - (s3.left - a2.left);
}
if (a2.right > s3.right) {
c2 = i3 + a2.right - s3.right;
}
} else {
if (a2.top < s3.top) {
c2 = i3 - (s3.top - a2.top);
}
if (a2.bottom > s3.bottom) {
c2 = i3 + (a2.bottom - s3.bottom);
}
}
c2 = Math.max(c2, 0);
h2.value = Math.min(c2, r3);
};
const N2 = () => {
var t3;
if (!d2.value || !u2.value) return;
e2.stretch && ((t3 = p2.value) == null ? void 0 : t3.update());
const l3 = d2.value[`offset${pn(b2.value)}`];
const n3 = u2.value[`offset${pn(b2.value)}`];
const o2 = h2.value;
if (n3 < l3) {
v2.value = v2.value || {};
v2.value.prev = o2;
v2.value.next = o2 + n3 < l3;
if (l3 - o2 < n3) {
h2.value = l3 - n3;
}
} else {
v2.value = false;
if (o2 > 0) {
h2.value = 0;
}
}
};
const R2 = (e3) => {
const t3 = e3.code;
const { up: l3, down: n3, left: o2, right: a2 } = di;
if (![l3, n3, o2, a2].includes(t3)) return;
const s3 = Array.from(e3.currentTarget.querySelectorAll("[role=tab]:not(.is-disabled)"));
const r3 = s3.indexOf(e3.target);
let i3;
if (t3 === o2 || t3 === l3) {
if (r3 === 0) {
i3 = s3.length - 1;
} else {
i3 = r3 - 1;
}
} else {
if (r3 < s3.length - 1) {
i3 = r3 + 1;
} else {
i3 = 0;
}
}
s3[i3].focus({ preventScroll: true });
s3[i3].click();
V2();
};
const V2 = () => {
if (g2.value) m2.value = true;
};
const O2 = () => m2.value = false;
watch(r2, (e3) => {
if (e3 === "hidden") {
g2.value = false;
} else if (e3 === "visible") {
setTimeout(() => g2.value = true, 50);
}
});
watch(i2, (e3) => {
if (e3) {
setTimeout(() => g2.value = true, 50);
} else {
g2.value = false;
}
});
tt(f2, N2);
onMounted(() => setTimeout(() => C2(), 0));
onUpdated(() => N2());
t2({ scrollToActiveTab: C2, removeFocus: O2 });
return () => {
const t3 = v2.value ? [createVNode("span", { class: [s2.e("nav-prev"), s2.is("disabled", !v2.value.prev)], onClick: w2 }, [createVNode(Ud, null, { default: () => [createVNode(cl, null, null)] })]), createVNode("span", { class: [s2.e("nav-next"), s2.is("disabled", !v2.value.next)], onClick: x2 }, [createVNode(Ud, null, { default: () => [createVNode(fl, null, null)] })])] : null;
const o2 = e2.panes.map((t4, o3) => {
var a2, r3, i3, u3;
const d3 = t4.uid;
const f3 = t4.props.disabled;
const p3 = (r3 = (a2 = t4.props.name) != null ? a2 : t4.index) != null ? r3 : `${o3}`;
const v3 = !f3 && (t4.isClosable || e2.editable);
t4.index = `${o3}`;
const h3 = v3 ? createVNode(Ud, { class: "is-icon-close", onClick: (e3) => l2("tabRemove", t4, e3) }, { default: () => [createVNode(El, null, null)] }) : null;
const g3 = ((u3 = (i3 = t4.slots).label) == null ? void 0 : u3.call(i3)) || t4.props.label;
const b3 = !f3 && t4.active ? 0 : -1;
return createVNode("div", { ref: `tab-${d3}`, class: [s2.e("item"), s2.is(n2.props.tabPosition), s2.is("active", t4.active), s2.is("disabled", f3), s2.is("closable", v3), s2.is("focus", m2.value)], id: `tab-${p3}`, key: `tab-${d3}`, "aria-controls": `pane-${p3}`, role: "tab", "aria-selected": t4.active, tabindex: b3, onFocus: () => V2(), onBlur: () => O2(), onClick: (e3) => {
O2();
l2("tabClick", t4, p3, e3);
}, onKeydown: (e3) => {
if (v3 && (e3.code === di.delete || e3.code === di.backspace)) {
l2("tabRemove", t4, e3);
}
} }, [...[g3, h3]]);
});
return createVNode("div", { ref: f2, class: [s2.e("nav-wrap"), s2.is("scrollable", !!v2.value), s2.is(n2.props.tabPosition)] }, [t3, createVNode("div", { class: s2.e("nav-scroll"), ref: u2 }, [createVNode("div", { class: [s2.e("nav"), s2.is(n2.props.tabPosition), s2.is("stretch", e2.stretch && ["top", "bottom"].includes(n2.props.tabPosition))], ref: d2, style: y2.value, role: "tablist", onKeydown: R2 }, [...[!e2.type ? createVNode(Xa, { ref: p2, tabs: [...e2.panes] }, null) : null, o2]])])]);
};
} });
const es = ti({ type: { type: String, values: ["card", "border-card", ""], default: "" }, closable: Boolean, addable: Boolean, modelValue: { type: [String, Number] }, editable: Boolean, tabPosition: { type: String, values: ["top", "right", "bottom", "left"], default: "top" }, beforeLeave: { type: Jl(Function), default: () => true }, stretch: Boolean });
const ts = (e2) => bt(e2) || Hs(e2);
const ls = { [fi]: (e2) => ts(e2), tabClick: (e2, t2) => t2 instanceof Event, tabChange: (e2) => ts(e2), edit: (e2, t2) => ["remove", "add"].includes(t2), tabRemove: (e2) => ts(e2), tabAdd: () => true };
const ns = defineComponent({ name: "ElTabs", props: es, emits: ls, setup(e2, { emit: t2, slots: l2, expose: n2 }) {
var s2;
const r2 = zi("tabs");
const i2 = computed(() => ["left", "right"].includes(e2.tabPosition));
const { children: u2, addChild: d2, removeChild: f2 } = mn(getCurrentInstance(), "ElTabPane");
const p2 = ref();
const v2 = ref((s2 = e2.modelValue) != null ? s2 : "0");
const h2 = async (l3, n3 = false) => {
var o2, a2, s3;
if (v2.value === l3 || Vs(l3)) return;
try {
const r3 = await ((o2 = e2.beforeLeave) == null ? void 0 : o2.call(e2, l3, v2.value));
if (r3 !== false) {
v2.value = l3;
if (n3) {
t2(fi, l3);
t2("tabChange", l3);
}
(s3 = (a2 = p2.value) == null ? void 0 : a2.removeFocus) == null ? void 0 : s3.call(a2);
}
} catch (e3) {
}
};
const m2 = (e3, l3, n3) => {
if (e3.props.disabled) return;
h2(l3, true);
t2("tabClick", e3, n3);
};
const g2 = (e3, l3) => {
if (e3.props.disabled || Vs(e3.props.name)) return;
l3.stopPropagation();
t2("edit", e3.props.name, "remove");
t2("tabRemove", e3.props.name);
};
const y2 = () => {
t2("edit", void 0, "add");
t2("tabAdd");
};
watch(() => e2.modelValue, (e3) => h2(e3));
watch(v2, async () => {
var e3;
await nextTick();
(e3 = p2.value) == null ? void 0 : e3.scrollToActiveTab();
});
provide(ja, { props: e2, currentName: v2, registerPane: (e3) => {
u2.value.push(e3);
}, sortPane: d2, unregisterPane: f2 });
n2({ currentName: v2 });
const w2 = ({ render: e3 }) => e3();
return () => {
const t3 = l2["add-icon"];
const n3 = e2.editable || e2.addable ? createVNode("div", { class: [r2.e("new-tab"), i2.value && r2.e("new-tab-vertical")], tabindex: "0", onClick: y2, onKeydown: (e3) => {
if (e3.code === di.enter) y2();
} }, [t3 ? renderSlot(l2, "add-icon") : createVNode(Ud, { class: r2.is("icon-plus") }, { default: () => [createVNode(Nl, null, null)] })]) : null;
const o2 = createVNode("div", { class: [r2.e("header"), i2.value && r2.e("header-vertical"), r2.is(e2.tabPosition)] }, [createVNode(w2, { render: () => {
const t4 = u2.value.some((e3) => e3.slots.label);
return createVNode(Za, { ref: p2, currentName: v2.value, editable: e2.editable, type: e2.type, panes: u2.value, stretch: e2.stretch, onTabClick: m2, onTabRemove: g2 }, { $stable: !t4 });
} }, null), n3]);
const a2 = createVNode("div", { class: r2.e("content") }, [renderSlot(l2, "default")]);
return createVNode("div", { class: [r2.b(), r2.m(e2.tabPosition), { [r2.m("card")]: e2.type === "card", [r2.m("border-card")]: e2.type === "border-card" }] }, [a2, o2]);
};
} });
const os = ti({ label: { type: String, default: "" }, name: { type: [String, Number] }, closable: Boolean, disabled: Boolean, lazy: Boolean });
const as = "ElTabPane";
const ss = defineComponent({ name: as });
const rs = defineComponent({ ...ss, props: os, setup(e2) {
const t2 = e2;
const l2 = getCurrentInstance();
const r2 = useSlots();
const u2 = inject(ja);
if (!u2) Xs(as, "usage: <el-tabs><el-tab-pane /></el-tabs/>");
const c2 = zi("tab-pane");
const d2 = ref();
const p2 = computed(() => t2.closable || u2.props.closable);
const v2 = Be(() => {
var e3;
return u2.currentName.value === ((e3 = t2.name) != null ? e3 : d2.value);
});
const h2 = ref(v2.value);
const y2 = computed(() => {
var e3;
return (e3 = t2.name) != null ? e3 : d2.value;
});
const E2 = Be(() => !t2.lazy || h2.value || v2.value);
watch(v2, (e3) => {
if (e3) h2.value = true;
});
const N2 = reactive({ uid: l2.uid, slots: r2, props: t2, paneName: y2, active: v2, index: d2, isClosable: p2 });
u2.registerPane(N2);
onMounted(() => {
u2.sortPane(N2);
});
onUnmounted(() => {
u2.unregisterPane(N2.uid);
});
return (e3, t3) => unref(E2) ? withDirectives((openBlock(), createElementBlock("div", { key: 0, id: `pane-${unref(y2)}`, class: normalizeClass(unref(c2).b()), role: "tabpanel", "aria-hidden": !unref(v2), "aria-labelledby": `tab-${unref(y2)}` }, [renderSlot(e3.$slots, "default")], 10, ["id", "aria-hidden", "aria-labelledby"])), [[vShow, unref(v2)]]) : createCommentVNode("v-if", true);
} });
var is = $d(rs, [["__file", "tab-pane.vue"]]);
const us = li(ns, { TabPane: is });
const cs = ui(is);
const ds = defineStore("setting-btn", () => {
const e2 = ref({ show: true });
return { state: e2 };
}, { persist: true });
const fs = defineStore("setting-direction", () => {
const e2 = ref({ drawerDirection: "rtl", btnDirection: "2" });
return { state: e2 };
}, { persist: true });
const ps = defineComponent({ __name: "SettingButton", setup(e2) {
const { state: t2 } = fs();
const l2 = ref(false);
const { state: n2 } = ds();
const o2 = ref({ display: "" });
r("配置按钮[显示/隐藏]", () => {
n2.show = !n2.show;
});
const r2 = ref();
let d2 = false;
let f2 = 0;
let v2 = 0;
let h2 = 0;
let m2 = 0;
let y2 = 0;
let w2 = 0;
let x2 = 0;
let C2 = 0;
const E2 = () => {
const e3 = t2.btnDirection;
f2 = 0;
v2 = 0;
const l3 = e3 === "2" || e3 === "4" ? document.documentElement.clientWidth - x2 : 0;
const n3 = e3 === "1" || e3 === "2" ? 0 : document.documentElement.clientHeight - C2;
h2 = l3;
m2 = n3;
y2 = l3;
w2 = n3;
r2.value.style.transform = `translate(${y2}px, ${w2}px)`;
};
onMounted(() => {
x2 = r2.value.offsetWidth;
C2 = r2.value.offsetHeight;
watch(() => t2.btnDirection, () => {
E2();
}, { immediate: true });
watch(() => n2.show, () => {
o2.value.display = n2.show ? "" : "none";
}, { immediate: true });
window.addEventListener("resize", E2);
});
onUnmounted(() => {
window.removeEventListener("resize", E2);
});
const N2 = (e3) => {
d2 = true;
f2 = e3.clientX;
v2 = e3.clientY;
document.addEventListener("mousemove", R2);
document.addEventListener("mouseup", A2);
};
const R2 = (e3) => {
if (d2) {
const t3 = e3.clientX - f2;
const l3 = e3.clientY - v2;
let n3 = h2 + t3;
let o3 = m2 + l3;
const a2 = window.innerWidth;
const s2 = window.innerHeight;
if (n3 < 0) n3 = 0;
if (o3 < 0) o3 = 0;
if (n3 + x2 > a2) n3 = a2 - x2;
if (o3 + C2 > s2) o3 = s2 - C2;
y2 = n3;
w2 = o3;
r2.value.style.transform = `translate(${y2}px, ${w2}px)`;
}
};
const A2 = () => {
d2 = false;
h2 = y2;
m2 = w2;
document.removeEventListener("mousemove", R2);
document.removeEventListener("mouseup", A2);
};
return (e3, n3) => {
const a2 = Ud;
const d3 = eo;
return openBlock(), createElementBlock("div", null, [createElementVNode("div", { ref_key: "draggable", ref: r2, class: "setting-button fixed top-0 rounded-[6px] w-[30px] z-[10000]", style: normalizeStyle(o2.value) }, [createElementVNode("div", { class: "text-white flex items-center justify-center h-[30px] cursor-move", onMousedown: N2 }, [createVNode(a2, { size: 18 }, { default: withCtx(() => [createVNode(unref(Dl))]), _: 1 })], 32), createElementVNode("div", { class: "text-white flex items-center justify-center h-[30px] cursor-pointer", onClick: n3[0] || (n3[0] = (e4) => l2.value = true) }, [createVNode(a2, { size: 18 }, { default: withCtx(() => [createVNode(unref(Ul))]), _: 1 })])], 4), createVNode(d3, { modelValue: l2.value, "onUpdate:modelValue": n3[1] || (n3[1] = (e4) => l2.value = e4), size: "334px", "with-header": false, "z-index": 99999, "modal-class": "custom-modal", direction: unref(t2).drawerDirection }, { default: withCtx(() => [renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["modelValue", "direction"])]);
};
} });
const vs = { class: "dialog-footer" };
const hs = defineComponent({ __name: "LightStickConfigDialog", props: { visible: { type: Boolean } }, emits: ["update:visible"], setup(e2, { emit: t2 }) {
const l2 = e2;
const n2 = ref(true);
const o2 = t2;
const i2 = ref(false);
const d2 = ["周一", "周二", "周三", "周四", "周五", "周六", "周日"];
const v2 = ref([]);
const { state: h2 } = Gh();
const m2 = je().day();
const b2 = ref(m2 === 0 ? 6 : m2 - 1);
watch(() => l2.visible, (e3) => {
if (e3) {
i2.value = true;
y2();
}
});
watch(i2, (e3) => {
if (!e3) {
o2("update:visible", false);
}
});
const y2 = async () => {
n2.value = true;
try {
v2.value = Array.from({ length: 7 }, () => []);
const e3 = /* @__PURE__ */ new Map();
h2.configList.forEach((t4, l3) => {
const n3 = /* @__PURE__ */ new Map();
e3.set(l3, n3);
for (const e4 of t4) {
n3.set(e4.rid, { count: e4.count, remaining: e4.remaining });
}
});
const t3 = await Jh();
if (t3.length === 0) {
Yh.warning("不存在粉丝牌,无法配置自动送荧光棒!");
i2.value = false;
return;
}
for (const { rid: l3, name: n3 } of t3) {
v2.value.forEach((t4, o3) => {
const a2 = e3.get(o3);
const s2 = a2 == null ? void 0 : a2.get(l3);
t4.push({ rid: l3, name: n3, count: s2 ? s2.count : 0, remaining: !!(s2 == null ? void 0 : s2.remaining) });
});
}
} finally {
n2.value = false;
}
};
const w2 = (e3, t3) => {
v2.value.forEach((l3, n3) => {
if (t3 !== n3) {
v2.value[n3] = JSON.parse(JSON.stringify(e3));
}
});
Yh.success("同步成功");
};
const x2 = () => {
h2.configList = v2.value;
h2.completeDay = "";
Yh.success("保存成功");
i2.value = false;
};
const C2 = (e3, t3) => {
if (!e3[t3].remaining) {
return;
}
e3.forEach((e4, l3) => {
if (l3 !== t3) {
e4.remaining = false;
}
});
};
return (e3, t3) => {
const l3 = rm;
const o3 = Da;
const a2 = so;
const h3 = Gm;
const m3 = Zm;
const y3 = za;
const S2 = cs;
const k2 = us;
const E2 = mh;
const N2 = Bh;
return openBlock(), createBlock(E2, { modelValue: i2.value, "onUpdate:modelValue": t3[2] || (t3[2] = (e4) => i2.value = e4), title: "荧光棒配置", width: "50%", top: "6vh", "destroy-on-close": "", "lock-scroll": "" }, { footer: withCtx(() => [createElementVNode("div", vs, [createVNode(l3, { onClick: t3[1] || (t3[1] = (e4) => i2.value = false), loading: n2.value }, { default: withCtx(() => [createTextVNode("取消")]), _: 1 }, 8, ["loading"]), createVNode(l3, { type: "primary", onClick: x2, loading: n2.value }, { default: withCtx(() => [createTextVNode(" 保存 ")]), _: 1 }, 8, ["loading"])])]), default: withCtx(() => [withDirectives((openBlock(), createBlock(k2, { modelValue: b2.value, "onUpdate:modelValue": t3[0] || (t3[0] = (e4) => b2.value = e4), type: "border-card" }, { default: withCtx(() => [(openBlock(true), createElementBlock(Fragment, null, renderList(v2.value, (e4, t4) => (openBlock(), createBlock(S2, { label: d2[t4], key: t4, name: t4, class: "overflow-auto" }, { default: withCtx(() => [createVNode(l3, { type: "primary", onClick: (l4) => w2(e4, t4) }, { default: withCtx(() => [createTextVNode("同步至其他日")]), _: 2 }, 1032, ["onClick"]), createVNode(y3, { data: e4, style: { width: "100%" }, height: "60vh" }, { default: withCtx(() => [createVNode(o3, { prop: "rid", label: "直播间号" }), createVNode(o3, { prop: "name", label: "主播名称" }), createVNode(o3, { prop: "count", label: "数量", width: "200" }, { default: withCtx((t5) => [createVNode(m3, { modelValue: t5.row.remaining, "onUpdate:modelValue": (e5) => t5.row.remaining = e5, onChange: (l4) => C2(e4, t5.$index) }, { default: withCtx(() => [createVNode(h3, { value: false, border: "" }, { default: withCtx(() => [createVNode(a2, { modelValue: t5.row.count, "onUpdate:modelValue": (e5) => t5.row.count = e5, size: "small", min: 0, disabled: t5.row.remaining }, null, 8, ["modelValue", "onUpdate:modelValue", "disabled"])]), _: 2 }, 1024), createVNode(h3, { value: true, border: "" }, { default: withCtx(() => [createTextVNode("剩下全部")]), _: 1 })]), _: 2 }, 1032, ["modelValue", "onUpdate:modelValue", "onChange"])]), _: 2 }, 1024)]), _: 2 }, 1032, ["data"])]), _: 2 }, 1032, ["label", "name"]))), 128))]), _: 1 }, 8, ["modelValue"])), [[N2, n2.value]])]), _: 1 }, 8, ["modelValue"]);
};
} });
const ms = createElementVNode("h4", { class: "setting-title" }, "荧光棒", -1);
const gs = { class: "setting-row" };
const bs = createElementVNode("span", null, "自动送荧光棒", -1);
const ys = defineComponent({ __name: "LightStickConf", setup(e2) {
const t2 = ref(false);
const l2 = je().format("YYYY-MM-DD");
const { state: n2 } = og();
const { state: r2 } = Gh();
const d2 = computed(() => !n2.end && r2.receiveDay !== l2);
return (e3, l3) => {
const n3 = vo;
const o2 = rm;
const a2 = wh;
const v2 = Bh;
return openBlock(), createElementBlock("div", null, [ms, withDirectives((openBlock(), createElementBlock("div", null, [createElementVNode("div", gs, [bs, createVNode(n3, { modelValue: unref(r2).enabled, "onUpdate:modelValue": l3[0] || (l3[0] = (e4) => unref(r2).enabled = e4) }, null, 8, ["modelValue"])]), createElementVNode("div", null, [createVNode(o2, { size: "small", type: "primary", onClick: l3[1] || (l3[1] = (e4) => t2.value = true) }, { default: withCtx(() => [createTextVNode("详细配置")]), _: 1 })])])), [[v2, d2.value]]), createVNode(hs, { visible: t2.value, "onUpdate:visible": l3[2] || (l3[2] = (e4) => t2.value = e4) }, null, 8, ["visible"]), createVNode(a2)]);
};
} });
const ws = createElementVNode("h4", { class: "setting-title" }, "页面", -1);
const xs = { key: 0, class: "h-[80px]" };
const Cs$1 = ["onMouseenter", "onMouseleave"];
const Ss = { class: "cursor-default" };
const ks = defineComponent({ __name: "ElementConf", setup(e2) {
const { infoState: t2, hideState: l2 } = rg();
const { state: n2 } = og();
const o2 = /* @__PURE__ */ new Map();
const a2 = (e3) => {
const t3 = document.querySelector(e3);
if (!t3) {
return;
}
let l3 = o2.get(e3);
if (!l3) {
l3 = document.createElement("div");
l3.style.position = "absolute";
l3.style.background = "rgba(0, 0, 0, 0.5)";
l3.style.zIndex = "99998";
o2.set(e3, l3);
}
const n3 = t3.getBoundingClientRect();
l3.style.width = `${n3.width}px`;
l3.style.height = `${n3.height}px`;
l3.style.top = `${n3.top + window.scrollY}px`;
l3.style.left = `${n3.left + window.scrollX}px`;
document.body.appendChild(l3);
};
const r2 = (e3) => {
const t3 = o2.get(e3);
if (t3) {
t3.remove();
}
};
return (e3, o3) => {
const u2 = vo;
const d2 = wh;
const v2 = Bh;
return openBlock(), createElementBlock("div", null, [ws, !unref(n2).end ? withDirectives((openBlock(), createElementBlock("div", xs, null, 512)), [[v2, true]]) : (openBlock(true), createElementBlock(Fragment, { key: 1 }, renderList(unref(t2), (e4, t3) => (openBlock(), createElementBlock(Fragment, null, [e4.have ? (openBlock(), createElementBlock("div", { key: 0, class: "setting-row", onMouseenter: (e5) => a2(t3), onMouseleave: (e5) => r2(t3) }, [createElementVNode("span", Ss, toDisplayString(e4.title), 1), createVNode(u2, { modelValue: unref(l2)[t3].hide, "onUpdate:modelValue": (e5) => unref(l2)[t3].hide = e5 }, null, 8, ["modelValue", "onUpdate:modelValue"])], 40, Cs$1)) : createCommentVNode("", true)], 64))), 256)), createVNode(d2)]);
};
} });
const Es$1 = createElementVNode("h4", { class: "setting-title" }, "礼物宝箱", -1);
const Ns = { class: "setting-row" };
const Rs$1 = createElementVNode("span", null, "自动抢宝箱", -1);
const Vs$1 = defineComponent({ __name: "RedPacketConf", setup(e2) {
const { state: t2 } = sg();
return (e3, l2) => {
const n2 = vo;
const o2 = wh;
return openBlock(), createElementBlock("div", null, [Es$1, createElementVNode("div", Ns, [Rs$1, createVNode(n2, { modelValue: unref(t2).enabled, "onUpdate:modelValue": l2[0] || (l2[0] = (e4) => unref(t2).enabled = e4) }, null, 8, ["modelValue"])]), createVNode(o2)]);
};
} });
const As = createElementVNode("h4", { class: "setting-title" }, "鱼翅红包", -1);
const Os = { class: "setting-row" };
const $s = createElementVNode("span", null, "自动参与鱼翅红包", -1);
const Ls = defineComponent({ __name: "GiftTreasureConf", setup(e2) {
const { state: t2 } = ig();
return (e3, l2) => {
const n2 = vo;
const o2 = wh;
return openBlock(), createElementBlock("div", null, [As, createElementVNode("div", Os, [$s, createVNode(n2, { modelValue: unref(t2).enabled, "onUpdate:modelValue": l2[0] || (l2[0] = (e4) => unref(t2).enabled = e4) }, null, 8, ["modelValue"])]), createVNode(o2)]);
};
} });
const Ts = createElementVNode("h4", { class: "setting-title" }, "抽奖", -1);
const Fs = { class: "setting-row" };
const _s = createElementVNode("span", null, "自动参与抽奖", -1);
const Ms$1 = { class: "setting-row" };
const Hs$1 = createElementVNode("span", null, "参与后自动关闭抽奖", -1);
const Is = { class: "setting-row" };
const Ws$1 = createElementVNode("span", null, "无法自动满足条件则关闭抽奖", -1);
const Bs = { class: "setting-row" };
const Ps = createElementVNode("span", null, "未中奖则关闭抽奖结果", -1);
const zs = defineComponent({ __name: "JoinLotteryConf", setup(e2) {
const { state: t2 } = cg();
return (e3, l2) => {
const n2 = vo;
const o2 = wh;
return openBlock(), createElementBlock("div", null, [Ts, createElementVNode("div", Fs, [_s, createVNode(n2, { modelValue: unref(t2).enabled, "onUpdate:modelValue": l2[0] || (l2[0] = (e4) => unref(t2).enabled = e4) }, null, 8, ["modelValue"])]), createElementVNode("div", Ms$1, [Hs$1, createVNode(n2, { modelValue: unref(t2).resolveHide, "onUpdate:modelValue": l2[1] || (l2[1] = (e4) => unref(t2).resolveHide = e4) }, null, 8, ["modelValue"])]), createElementVNode("div", Is, [Ws$1, createVNode(n2, { modelValue: unref(t2).rejectHide, "onUpdate:modelValue": l2[2] || (l2[2] = (e4) => unref(t2).rejectHide = e4) }, null, 8, ["modelValue"])]), createElementVNode("div", Bs, [Ps, createVNode(n2, { modelValue: unref(t2).closeResult, "onUpdate:modelValue": l2[3] || (l2[3] = (e4) => unref(t2).closeResult = e4) }, null, 8, ["modelValue"])]), createVNode(o2)]);
};
} });
const Ds$1 = createElementVNode("h4", { class: "setting-title" }, "配置位置", -1);
const js = { class: "setting-row" };
const Ks = createElementVNode("span", null, "弹框位置", -1);
const Us = { class: "flex flex-wrap justify-between items-center pt-[5px] text-[14px]" };
const Ys = createElementVNode("span", { class: "" }, "配置按钮位置", -1);
const qs = { class: "flex justify-end w-[254px]" };
const Xs$1 = defineComponent({ __name: "SettingDirectionConf", setup(e2) {
const { state: t2 } = fs();
return (e3, l2) => {
const n2 = Xm;
const o2 = Zm;
return openBlock(), createElementBlock("div", null, [Ds$1, createElementVNode("div", js, [Ks, createVNode(o2, { modelValue: unref(t2).drawerDirection, "onUpdate:modelValue": l2[0] || (l2[0] = (e4) => unref(t2).drawerDirection = e4), size: "small" }, { default: withCtx(() => [createVNode(n2, { value: "ltr" }, { default: withCtx(() => [createTextVNode("左")]), _: 1 }), createVNode(n2, { value: "rtl" }, { default: withCtx(() => [createTextVNode("右")]), _: 1 }), createVNode(n2, { value: "ttb" }, { default: withCtx(() => [createTextVNode("上")]), _: 1 }), createVNode(n2, { value: "btt" }, { default: withCtx(() => [createTextVNode("下")]), _: 1 })]), _: 1 }, 8, ["modelValue"])]), createElementVNode("div", Us, [Ys, createElementVNode("div", qs, [createVNode(o2, { modelValue: unref(t2).btnDirection, "onUpdate:modelValue": l2[1] || (l2[1] = (e4) => unref(t2).btnDirection = e4), size: "small" }, { default: withCtx(() => [createVNode(n2, { value: "1" }, { default: withCtx(() => [createTextVNode("左上角")]), _: 1 }), createVNode(n2, { value: "2" }, { default: withCtx(() => [createTextVNode("右上角")]), _: 1 }), createVNode(n2, { value: "3" }, { default: withCtx(() => [createTextVNode("左下角")]), _: 1 }), createVNode(n2, { value: "4" }, { default: withCtx(() => [createTextVNode("右下角")]), _: 1 })]), _: 1 }, 8, ["modelValue"])])])]);
};
} });
const Gs$1 = "DOUYUCRX";
const Js$1 = defineStore("prevent-afk", () => {
const e2 = ref({ enabled: false });
watch(() => e2.value.enabled, (e3) => {
s[Gs$1].preventAfkEnabled = e3;
}, { immediate: true });
return { state: e2 };
}, { persist: true });
const Qs = createElementVNode("h4", { class: "setting-title" }, "挂机检测", -1);
const Zs = { class: "setting-row" };
const er = createElementVNode("span", null, "去除挂机检测", -1);
const tr = defineComponent({ __name: "PreventAfkConf", setup(e2) {
const { state: t2 } = Js$1();
return (e3, l2) => {
const n2 = vo;
const o2 = wh;
return openBlock(), createElementBlock("div", null, [Qs, createElementVNode("div", Zs, [er, createVNode(n2, { modelValue: unref(t2).enabled, "onUpdate:modelValue": l2[0] || (l2[0] = (e4) => unref(t2).enabled = e4) }, null, 8, ["modelValue"])]), createVNode(o2)]);
};
} });
const lr = createElementVNode("h4", { class: "setting-title" }, "网页全屏", -1);
const nr$1 = { class: "setting-row" };
const or$1 = createElementVNode("span", null, "自动网页全屏", -1);
const ar = { class: "setting-row" };
const sr = createElementVNode("span", null, "自动直播画面网页全屏", -1);
const rr = defineComponent({ __name: "PagefulConf", setup(e2) {
const { state: t2 } = fg();
return (e3, l2) => {
const n2 = vo;
const o2 = wh;
return openBlock(), createElementBlock("div", null, [lr, createElementVNode("div", nr$1, [or$1, createVNode(n2, { modelValue: unref(t2).layoutFull, "onUpdate:modelValue": l2[0] || (l2[0] = (e4) => unref(t2).layoutFull = e4) }, null, 8, ["modelValue"])]), createElementVNode("div", ar, [sr, createVNode(n2, { modelValue: unref(t2).videoFull, "onUpdate:modelValue": l2[1] || (l2[1] = (e4) => unref(t2).videoFull = e4) }, null, 8, ["modelValue"])]), createVNode(o2)]);
};
} });
const ir$1 = { class: "p-[20px]" };
const ur = defineComponent({ __name: "SettingPage", setup(e2) {
return (e3, t2) => {
const l2 = wh;
return openBlock(), createElementBlock("div", ir$1, [createVNode(ys), createVNode(Ls), createVNode(Vs$1), createVNode(zs), createVNode(rr), createVNode(ks), createVNode(tr), createVNode(Xs$1), createVNode(l2)]);
};
} });
const cr = defineComponent({ __name: "index", setup(e2) {
return (e3, t2) => (openBlock(), createBlock(ps, null, { default: withCtx(() => [createVNode(ur)]), _: 1 }));
} });
function dr$1(e2) {
return typeof e2 === "object" && e2 !== null;
}
function fr(e2, t2) {
e2 = dr$1(e2) ? e2 : /* @__PURE__ */ Object.create(null);
return new Proxy(e2, { get(e3, l2, n2) {
if (l2 === "key") return Reflect.get(e3, l2, n2);
return Reflect.get(e3, l2, n2) || Reflect.get(t2, l2, n2);
} });
}
function pr(e2, t2) {
return t2.reduce((e3, t3) => e3 == null ? void 0 : e3[t3], e2);
}
function vr(e2, t2, l2) {
return t2.slice(0, -1).reduce((e3, t3) => {
if (/^(__proto__)$/.test(t3)) return {};
else return e3[t3] = e3[t3] || {};
}, e2)[t2[t2.length - 1]] = l2, e2;
}
function hr(e2, t2) {
return t2.reduce((t3, l2) => {
const n2 = l2.split(".");
return vr(t3, n2, pr(e2, n2));
}, {});
}
function mr(e2, t2) {
return (l2) => {
var n2;
try {
const { storage: o2 = localStorage, beforeRestore: a2 = void 0, afterRestore: s2 = void 0, serializer: r2 = { serialize: JSON.stringify, deserialize: JSON.parse }, key: i2 = t2.$id, paths: u2 = null, debug: c2 = false } = l2;
return { storage: o2, beforeRestore: a2, afterRestore: s2, serializer: r2, key: ((n2 = e2.key) != null ? n2 : (e3) => e3)(typeof i2 == "string" ? i2 : i2(t2.$id)), paths: u2, debug: c2 };
} catch (e3) {
if (l2.debug) console.error("[pinia-plugin-persistedstate]", e3);
return null;
}
};
}
function gr(e2, { storage: t2, serializer: l2, key: n2, debug: o2 }) {
try {
const o3 = t2 == null ? void 0 : t2.getItem(n2);
if (o3) e2.$patch(l2 == null ? void 0 : l2.deserialize(o3));
} catch (e3) {
if (o2) console.error("[pinia-plugin-persistedstate]", e3);
}
}
function br(e2, { storage: t2, serializer: l2, key: n2, paths: o2, debug: a2 }) {
try {
const a3 = Array.isArray(o2) ? hr(e2, o2) : e2;
t2.setItem(n2, l2.serialize(a3));
} catch (e3) {
if (a2) console.error("[pinia-plugin-persistedstate]", e3);
}
}
function yr(e2 = {}) {
return (t2) => {
const { auto: l2 = false } = e2;
const { options: { persist: n2 = l2 }, store: o2, pinia: a2 } = t2;
if (!n2) return;
if (!(o2.$id in a2.state.value)) {
const e3 = a2._s.get(o2.$id.replace("__hot:", ""));
if (e3) Promise.resolve().then(() => e3.$persist());
return;
}
const s2 = (Array.isArray(n2) ? n2.map((t3) => fr(t3, e2)) : [fr(n2, e2)]).map(mr(e2, o2)).filter(Boolean);
o2.$persist = () => {
s2.forEach((e3) => {
br(o2.$state, e3);
});
};
o2.$hydrate = ({ runHooks: e3 = true } = {}) => {
s2.forEach((l3) => {
const { beforeRestore: n3, afterRestore: a3 } = l3;
if (e3) n3 == null ? void 0 : n3(t2);
gr(o2, l3);
if (e3) a3 == null ? void 0 : a3(t2);
});
};
s2.forEach((e3) => {
const { beforeRestore: l3, afterRestore: n3 } = e3;
l3 == null ? void 0 : l3(t2);
gr(o2, e3);
n3 == null ? void 0 : n3(t2);
o2.$subscribe((t3, l4) => {
br(l4, e3);
}, { detached: true });
});
};
}
const wr = createPinia();
wr.use(yr({ key: (e2) => `douyu-crx-${e2}` }));
const xr = document.querySelector("body");
const Cr = document.createElement("div");
Cr.id = "setting-btn";
xr == null ? void 0 : xr.appendChild(Cr);
const Sr = createApp(cr);
Sr.use(wr);
Sr.mount(`#${Cr.id}`);
}
});
const indexBqwrdpQQ = exports("default", require_index_002());
})
};
}));
System.register("./index-B30Rk5mQ-XjBNwp0Q.js", ['./pageful-B6Krc0i4-BxfQe0NR.js', './__monkey.entry-DHMkWzvL.js', 'vue', 'dayjs', 'pinia', 'vue-demi', 'qs'], (function (exports, module) {
'use strict';
var ti, Jl, Sl, wd, Od, Bd, Bi, zi, Gd, Ld, Js, mt$1, Is, kl, hl, Kd, qe$1, lv, lf, Ud, $d, Ms, Ef, vl, cm, il, Vs, Pp, lm, Ll, cl, fl, Bl, rm, li, cg, sg, ig, fg, Yh, og, Gh, Us, di, ol, sa$1, el, gt$1, Xm, Zm, Bm, Mm, wh, mh, Bh, rg, ht$1, Zh, Jh, Qh, eg, tg, s, defineComponent, useAttrs, inject, ref, computed, watch, nextTick, unref, onBeforeUnmount, provide, openBlock, createBlock, mergeProps, withCtx, normalizeClass, normalizeStyle, withModifiers, resolveDynamicComponent, createCommentVNode, createElementBlock, createElementVNode, renderSlot, toDisplayString, onMounted, Fragment, renderList, createTextVNode, withDirectives, createVNode, Transition, withKeys, useSlots, toRef, vShow, reactive, createApp, getCurrentInstance, je, defineStore;
return {
setters: [module => {
ti = module.t;
Jl = module.J;
Sl = module.a$;
wd = module.w;
Od = module.b0;
Bd = module.a;
Bi = module.B;
zi = module.z;
Gd = module.G;
Ld = module.b1;
Js = module.j;
mt$1 = module.aN;
Is = module.b2;
kl = module.b3;
hl = module.b4;
Kd = module.K;
qe$1 = module.b5;
lv = module.q;
lf = module.b;
Ud = module.U;
$d = module.$;
Ms = module.D;
Ef = module.o;
vl = module.v;
cm = module.c;
il = module.i;
Vs = module.V;
Pp = module.b6;
lm = module.s;
Ll = module.b7;
cl = module.W;
fl = module._;
Bl = module.b8;
rm = module.aj;
li = module.l;
cg = module.ab;
sg = module.a9;
ig = module.aa;
fg = module.ac;
Yh = module.a6;
og = module.a7;
Gh = module.a4;
Us = module.b9;
di = module.a0;
ol = module.ba;
sa$1 = module.bb;
el = module.av;
gt$1 = module.bc;
Xm = module.ap;
Zm = module.al;
Bm = module.m;
Mm = module.bd;
wh = module.ao;
mh = module.am;
Bh = module.an;
rg = module.a8;
ht$1 = module.be;
Zh = module.bf;
Jh = module.a5;
Qh = module.bg;
eg = module.bh;
tg = module.bi;
}, module => {
s = module.s;
}, module => {
defineComponent = module.defineComponent;
useAttrs = module.useAttrs;
inject = module.inject;
ref = module.ref;
computed = module.computed;
watch = module.watch;
nextTick = module.nextTick;
unref = module.unref;
onBeforeUnmount = module.onBeforeUnmount;
provide = module.provide;
openBlock = module.openBlock;
createBlock = module.createBlock;
mergeProps = module.mergeProps;
withCtx = module.withCtx;
normalizeClass = module.normalizeClass;
normalizeStyle = module.normalizeStyle;
withModifiers = module.withModifiers;
resolveDynamicComponent = module.resolveDynamicComponent;
createCommentVNode = module.createCommentVNode;
createElementBlock = module.createElementBlock;
createElementVNode = module.createElementVNode;
renderSlot = module.renderSlot;
toDisplayString = module.toDisplayString;
onMounted = module.onMounted;
Fragment = module.Fragment;
renderList = module.renderList;
createTextVNode = module.createTextVNode;
withDirectives = module.withDirectives;
createVNode = module.createVNode;
Transition = module.Transition;
withKeys = module.withKeys;
useSlots = module.useSlots;
toRef = module.toRef;
vShow = module.vShow;
reactive = module.reactive;
createApp = module.createApp;
getCurrentInstance = module.getCurrentInstance;
}, module => {
je = module.default;
}, module => {
defineStore = module.defineStore;
}, null, null],
execute: (function () {
var __defProp = Object.defineProperty;
var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __publicField = (obj, key, value) => __defNormalProp(obj, typeof key !== "symbol" ? key + "" : key, value);
var _a2;
const Ze = ["year", "years", "month", "months", "date", "dates", "week", "datetime", "datetimerange", "daterange", "monthrange", "yearrange"];
const Ge = (e15) => {
if (!e15 && e15 !== 0) return [];
return Array.isArray(e15) ? e15 : [e15];
};
var Xe = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
function qe(e15) {
return e15 && e15.__esModule && Object.prototype.hasOwnProperty.call(e15, "default") ? e15["default"] : e15;
}
var Je = { exports: {} };
(function(e15, t2) {
!function(t3, a2) {
e15.exports = a2();
}(Xe, function() {
var e16 = { LTS: "h:mm:ss A", LT: "h:mm A", L: "MM/DD/YYYY", LL: "MMMM D, YYYY", LLL: "MMMM D, YYYY h:mm A", LLLL: "dddd, MMMM D, YYYY h:mm A" }, t3 = /(\[[^[]*\])|([-_:/.,()\s]+)|(A|a|YYYY|YY?|MM?M?M?|Do|DD?|hh?|HH?|mm?|ss?|S{1,3}|z|ZZ?)/g, a2 = /\d\d/, n2 = /\d\d?/, o2 = /\d*[^-_:/,()\s\d]+/, l2 = {}, s2 = function(e17) {
return (e17 = +e17) + (e17 > 68 ? 1900 : 2e3);
};
var r2 = function(e17) {
return function(t4) {
this[e17] = +t4;
};
}, i2 = [/[+-]\d\d:?(\d\d)?|Z/, function(e17) {
(this.zone || (this.zone = {})).offset = function(e18) {
if (!e18) return 0;
if ("Z" === e18) return 0;
var t4 = e18.match(/([+-]|\d\d)/g), a3 = 60 * t4[1] + (+t4[2] || 0);
return 0 === a3 ? 0 : "+" === t4[0] ? -a3 : a3;
}(e17);
}], u2 = function(e17) {
var t4 = l2[e17];
return t4 && (t4.indexOf ? t4 : t4.s.concat(t4.f));
}, c2 = function(e17, t4) {
var a3, n3 = l2.meridiem;
if (n3) {
for (var o3 = 1; o3 <= 24; o3 += 1) if (e17.indexOf(n3(o3, 0, t4)) > -1) {
a3 = o3 > 12;
break;
}
} else a3 = e17 === (t4 ? "pm" : "PM");
return a3;
}, d2 = { A: [o2, function(e17) {
this.afternoon = c2(e17, false);
}], a: [o2, function(e17) {
this.afternoon = c2(e17, true);
}], S: [/\d/, function(e17) {
this.milliseconds = 100 * +e17;
}], SS: [a2, function(e17) {
this.milliseconds = 10 * +e17;
}], SSS: [/\d{3}/, function(e17) {
this.milliseconds = +e17;
}], s: [n2, r2("seconds")], ss: [n2, r2("seconds")], m: [n2, r2("minutes")], mm: [n2, r2("minutes")], H: [n2, r2("hours")], h: [n2, r2("hours")], HH: [n2, r2("hours")], hh: [n2, r2("hours")], D: [n2, r2("day")], DD: [a2, r2("day")], Do: [o2, function(e17) {
var t4 = l2.ordinal, a3 = e17.match(/\d+/);
if (this.day = a3[0], t4) for (var n3 = 1; n3 <= 31; n3 += 1) t4(n3).replace(/\[|\]/g, "") === e17 && (this.day = n3);
}], M: [n2, r2("month")], MM: [a2, r2("month")], MMM: [o2, function(e17) {
var t4 = u2("months"), a3 = (u2("monthsShort") || t4.map(function(e18) {
return e18.slice(0, 3);
})).indexOf(e17) + 1;
if (a3 < 1) throw new Error();
this.month = a3 % 12 || a3;
}], MMMM: [o2, function(e17) {
var t4 = u2("months").indexOf(e17) + 1;
if (t4 < 1) throw new Error();
this.month = t4 % 12 || t4;
}], Y: [/[+-]?\d+/, r2("year")], YY: [a2, function(e17) {
this.year = s2(e17);
}], YYYY: [/\d{4}/, r2("year")], Z: i2, ZZ: i2 };
function f2(a3) {
var n3, o3;
n3 = a3, o3 = l2 && l2.formats;
for (var s3 = (a3 = n3.replace(/(\[[^\]]+])|(LTS?|l{1,4}|L{1,4})/g, function(t4, a4, n4) {
var l3 = n4 && n4.toUpperCase();
return a4 || o3[n4] || e16[n4] || o3[l3].replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e17, t5, a5) {
return t5 || a5.slice(1);
});
})).match(t3), r3 = s3.length, i3 = 0; i3 < r3; i3 += 1) {
var u3 = s3[i3], c3 = d2[u3], f3 = c3 && c3[0], v2 = c3 && c3[1];
s3[i3] = v2 ? { regex: f3, parser: v2 } : u3.replace(/^\[|\]$/g, "");
}
return function(e17) {
for (var t4 = {}, a4 = 0, n4 = 0; a4 < r3; a4 += 1) {
var o4 = s3[a4];
if ("string" == typeof o4) n4 += o4.length;
else {
var l3 = o4.regex, i4 = o4.parser, u4 = e17.slice(n4), c4 = l3.exec(u4)[0];
i4.call(t4, c4), e17 = e17.replace(c4, "");
}
}
return function(e18) {
var t5 = e18.afternoon;
if (void 0 !== t5) {
var a5 = e18.hours;
t5 ? a5 < 12 && (e18.hours += 12) : 12 === a5 && (e18.hours = 0), delete e18.afternoon;
}
}(t4), t4;
};
}
return function(e17, t4, a3) {
a3.p.customParseFormat = true, e17 && e17.parseTwoDigitYear && (s2 = e17.parseTwoDigitYear);
var n3 = t4.prototype, o3 = n3.parse;
n3.parse = function(e18) {
var t5 = e18.date, n4 = e18.utc, s3 = e18.args;
this.$u = n4;
var r3 = s3[1];
if ("string" == typeof r3) {
var i3 = true === s3[2], u3 = true === s3[3], c3 = i3 || u3, d3 = s3[2];
u3 && (d3 = s3[2]), l2 = this.$locale(), !i3 && d3 && (l2 = a3.Ls[d3]), this.$d = function(e19, t6, a4) {
try {
if (["x", "X"].indexOf(t6) > -1) return new Date(("X" === t6 ? 1e3 : 1) * e19);
var n5 = f2(t6)(e19), o4 = n5.year, l3 = n5.month, s4 = n5.day, r4 = n5.hours, i4 = n5.minutes, u4 = n5.seconds, c4 = n5.milliseconds, d4 = n5.zone, v3 = /* @__PURE__ */ new Date(), p3 = s4 || (o4 || l3 ? 1 : v3.getDate()), m3 = o4 || v3.getFullYear(), h2 = 0;
o4 && !l3 || (h2 = l3 > 0 ? l3 - 1 : v3.getMonth());
var y2 = r4 || 0, g2 = i4 || 0, b2 = u4 || 0, w2 = c4 || 0;
return d4 ? new Date(Date.UTC(m3, h2, p3, y2, g2, b2, w2 + 60 * d4.offset * 1e3)) : a4 ? new Date(Date.UTC(m3, h2, p3, y2, g2, b2, w2)) : new Date(m3, h2, p3, y2, g2, b2, w2);
} catch (e20) {
return /* @__PURE__ */ new Date("");
}
}(t5, r3, n4), this.init(), d3 && true !== d3 && (this.$L = this.locale(d3).$L), c3 && t5 != this.format(r3) && (this.$d = /* @__PURE__ */ new Date("")), l2 = {};
} else if (r3 instanceof Array) for (var v2 = r3.length, p2 = 1; p2 <= v2; p2 += 1) {
s3[1] = r3[p2 - 1];
var m2 = a3.apply(this, s3);
if (m2.isValid()) {
this.$d = m2.$d, this.$L = m2.$L, this.init();
break;
}
p2 === v2 && (this.$d = /* @__PURE__ */ new Date(""));
}
else o3.call(this, e18);
};
};
});
})(Je);
var Qe = Je.exports;
const et = qe(Qe);
const tt = ["hours", "minutes", "seconds"];
const at = "HH:mm:ss";
const nt = "YYYY-MM-DD";
const ot = { date: nt, dates: nt, week: "gggg[w]ww", year: "YYYY", years: "YYYY", month: "YYYY-MM", months: "YYYY-MM", datetime: `${nt} ${at}`, monthrange: "YYYY-MM", yearrange: "YYYY", daterange: nt, datetimerange: `${nt} ${at}` };
const lt = (e15, t2) => [e15 > 0 ? e15 - 1 : void 0, e15, e15 < t2 ? e15 + 1 : void 0];
const st = (e15) => Array.from(Array.from({ length: e15 }).keys());
const rt = (e15) => e15.replace(/\W?m{1,2}|\W?ZZ/g, "").replace(/\W?h{1,2}|\W?s{1,3}|\W?a/gi, "").trim();
const it = (e15) => e15.replace(/\W?D{1,2}|\W?Do|\W?d{1,4}|\W?M{1,4}|\W?Y{2,4}/g, "").trim();
const ut = function(e15, a2) {
const n2 = ht$1(e15);
const o2 = ht$1(a2);
if (n2 && o2) {
return e15.getTime() === a2.getTime();
}
if (!n2 && !o2) {
return e15 === a2;
}
return false;
};
const ct = function(e15, t2) {
const n2 = mt$1(e15);
const o2 = mt$1(t2);
if (n2 && o2) {
if (e15.length !== t2.length) {
return false;
}
return e15.every((e16, a2) => ut(e16, t2[a2]));
}
if (!n2 && !o2) {
return ut(e15, t2);
}
return false;
};
const dt = function(t2, a2, n2) {
const o2 = Us(a2) || a2 === "x" ? je(t2).locale(n2) : je(t2, a2).locale(n2);
return o2.isValid() ? o2 : void 0;
};
const ft = function(t2, a2, n2) {
if (Us(a2)) return t2;
if (a2 === "x") return +t2;
return je(t2).locale(n2).format(a2);
};
const vt = (e15, t2) => {
var a2;
const n2 = [];
const o2 = t2 == null ? void 0 : t2();
for (let t3 = 0; t3 < e15; t3++) {
n2.push((a2 = o2 == null ? void 0 : o2.includes(t3)) != null ? a2 : false);
}
return n2;
};
const pt = ti({ disabledHours: { type: Jl(Function) }, disabledMinutes: { type: Jl(Function) }, disabledSeconds: { type: Jl(Function) } });
const mt = ti({ visible: Boolean, actualVisible: { type: Boolean, default: void 0 }, format: { type: String, default: "" } });
const ht = ti({ id: { type: Jl([Array, String]) }, name: { type: Jl([Array, String]), default: "" }, popperClass: { type: String, default: "" }, format: String, valueFormat: String, dateFormat: String, timeFormat: String, type: { type: String, default: "" }, clearable: { type: Boolean, default: true }, clearIcon: { type: Jl([String, Object]), default: Sl }, editable: { type: Boolean, default: true }, prefixIcon: { type: Jl([String, Object]), default: "" }, size: wd, readonly: Boolean, disabled: Boolean, placeholder: { type: String, default: "" }, popperOptions: { type: Jl(Object), default: () => ({}) }, modelValue: { type: Jl([Date, Array, String, Number]), default: "" }, rangeSeparator: { type: String, default: "-" }, startPlaceholder: String, endPlaceholder: String, defaultValue: { type: Jl([Date, Array]) }, defaultTime: { type: Jl([Date, Array]) }, isRange: Boolean, ...pt, disabledDate: { type: Function }, cellClassName: { type: Function }, shortcuts: { type: Array, default: () => [] }, arrowControl: Boolean, tabindex: { type: Jl([String, Number]), default: 0 }, validateEvent: { type: Boolean, default: true }, unlinkPanels: Boolean, ...Od, ...Bd(["ariaLabel"]) });
const yt = defineComponent({ name: "Picker" });
const gt = defineComponent({ ...yt, props: ht, emits: ["update:modelValue", "change", "focus", "blur", "clear", "calendar-change", "panel-change", "visible-change", "keydown"], setup(e15, { expose: t2, emit: n2 }) {
const o2 = e15;
const l2 = useAttrs();
const { lang: s2 } = Bi();
const r2 = zi("date");
const i2 = zi("input");
const D2 = zi("range");
const { form: C2, formItem: S2 } = Gd();
const M2 = inject("ElPopperOptions", {});
const { valueOnClear: $2 } = Ld(o2, null);
const P2 = ref();
const Y2 = ref();
const _2 = ref(false);
const V2 = ref(false);
const O2 = ref(null);
let T2 = false;
let A2 = false;
const L2 = computed(() => [r2.b("editor"), r2.bm("editor", o2.type), i2.e("wrapper"), r2.is("disabled", ee2.value), r2.is("active", _2.value), D2.b("editor"), Ne2 ? D2.bm("editor", Ne2.value) : "", l2.class]);
const E2 = computed(() => [i2.e("icon"), D2.e("close-icon"), !ue2.value ? D2.e("close-icon--hidden") : ""]);
watch(_2, (e16) => {
if (!e16) {
ze2.value = null;
nextTick(() => {
R2(o2.modelValue);
});
} else {
nextTick(() => {
if (e16) {
O2.value = o2.modelValue;
}
});
}
});
const R2 = (e16, t3) => {
if (t3 || !ct(e16, O2.value)) {
n2("change", e16);
o2.validateEvent && (S2 == null ? void 0 : S2.validate("change").catch((e17) => Js()));
}
};
const I2 = (e16) => {
if (!ct(o2.modelValue, e16)) {
let t3;
if (mt$1(e16)) {
t3 = e16.map((e17) => ft(e17, o2.valueFormat, s2.value));
} else if (e16) {
t3 = ft(e16, o2.valueFormat, s2.value);
}
n2("update:modelValue", e16 ? t3 : e16, s2.value);
}
};
const N2 = (e16) => {
n2("keydown", e16);
};
const B2 = computed(() => {
if (Y2.value) {
const e16 = Ie2.value ? Y2.value : Y2.value.$el;
return Array.from(e16.querySelectorAll("input"));
}
return [];
});
const F2 = (e16, t3, a2) => {
const n3 = B2.value;
if (!n3.length) return;
if (!a2 || a2 === "min") {
n3[0].setSelectionRange(e16, t3);
n3[0].focus();
} else if (a2 === "max") {
n3[1].setSelectionRange(e16, t3);
n3[1].focus();
}
};
const U2 = () => {
X2(true, true);
nextTick(() => {
A2 = false;
});
};
const z2 = (e16 = "", t3 = false) => {
if (!t3) {
A2 = true;
}
_2.value = t3;
let n3;
if (mt$1(e16)) {
n3 = e16.map((e17) => e17.toDate());
} else {
n3 = e16 ? e16.toDate() : e16;
}
ze2.value = null;
I2(n3);
};
const W2 = () => {
V2.value = true;
};
const H2 = () => {
n2("visible-change", true);
};
const j2 = (e16) => {
if ((e16 == null ? void 0 : e16.key) === di.esc) {
X2(true, true);
}
};
const K2 = () => {
V2.value = false;
_2.value = false;
A2 = false;
n2("visible-change", false);
};
const Z2 = () => {
_2.value = true;
};
const G2 = () => {
_2.value = false;
};
const X2 = (e16 = true, t3 = false) => {
A2 = t3;
const [a2, n3] = unref(B2);
let o3 = a2;
if (!e16 && Ie2.value) {
o3 = n3;
}
if (o3) {
o3.focus();
}
};
const q2 = (e16) => {
if (o2.readonly || ee2.value || _2.value || A2) {
return;
}
_2.value = true;
n2("focus", e16);
};
let J2 = void 0;
const Q2 = (e16) => {
const t3 = async () => {
setTimeout(() => {
var a2;
if (J2 === t3) {
if (!(((a2 = P2.value) == null ? void 0 : a2.isFocusInsideContent()) && !T2) && B2.value.filter((e17) => e17.contains(document.activeElement)).length === 0) {
We2();
_2.value = false;
n2("blur", e16);
o2.validateEvent && (S2 == null ? void 0 : S2.validate("blur").catch((e17) => Js()));
}
T2 = false;
}
}, 0);
};
J2 = t3;
t3();
};
const ee2 = computed(() => o2.disabled || (C2 == null ? void 0 : C2.disabled));
const te2 = computed(() => {
let e16;
if (Te2.value) {
if (et2.value.getDefaultValue) {
e16 = et2.value.getDefaultValue();
}
} else {
if (mt$1(o2.modelValue)) {
e16 = o2.modelValue.map((e17) => dt(e17, o2.valueFormat, s2.value));
} else {
e16 = dt(o2.modelValue, o2.valueFormat, s2.value);
}
}
if (et2.value.getRangeAvailableTime) {
const t3 = et2.value.getRangeAvailableTime(e16);
if (!Is(t3, e16)) {
e16 = t3;
I2(mt$1(e16) ? e16.map((e17) => e17.toDate()) : e16.toDate());
}
}
if (mt$1(e16) && e16.some((e17) => !e17)) {
e16 = [];
}
return e16;
});
const ae2 = computed(() => {
if (!et2.value.panelReady) return "";
const e16 = je2(te2.value);
if (mt$1(ze2.value)) {
return [ze2.value[0] || e16 && e16[0] || "", ze2.value[1] || e16 && e16[1] || ""];
} else if (ze2.value !== null) {
return ze2.value;
}
if (!oe2.value && Te2.value) return "";
if (!_2.value && Te2.value) return "";
if (e16) {
return le2.value || se2.value || re2.value ? e16.join(", ") : e16;
}
return "";
});
const ne2 = computed(() => o2.type.includes("time"));
const oe2 = computed(() => o2.type.startsWith("time"));
const le2 = computed(() => o2.type === "dates");
const se2 = computed(() => o2.type === "months");
const re2 = computed(() => o2.type === "years");
const ie2 = computed(() => o2.prefixIcon || (ne2.value ? kl : hl));
const ue2 = ref(false);
const Oe2 = (e16) => {
if (o2.readonly || ee2.value) return;
if (ue2.value) {
e16.stopPropagation();
U2();
if (et2.value.handleClear) {
et2.value.handleClear();
} else {
I2($2.value);
}
R2($2.value, true);
ue2.value = false;
_2.value = false;
}
n2("clear");
};
const Te2 = computed(() => {
const { modelValue: e16 } = o2;
return !e16 || mt$1(e16) && !e16.filter(Boolean).length;
});
const Ae2 = async (e16) => {
var t3;
if (o2.readonly || ee2.value) return;
if (((t3 = e16.target) == null ? void 0 : t3.tagName) !== "INPUT" || B2.value.includes(document.activeElement)) {
_2.value = true;
}
};
const Le2 = () => {
if (o2.readonly || ee2.value) return;
if (!Te2.value && o2.clearable) {
ue2.value = true;
}
};
const Ee2 = () => {
ue2.value = false;
};
const Re2 = (e16) => {
var t3;
if (o2.readonly || ee2.value) return;
if (((t3 = e16.touches[0].target) == null ? void 0 : t3.tagName) !== "INPUT" || B2.value.includes(document.activeElement)) {
_2.value = true;
}
};
const Ie2 = computed(() => o2.type.includes("range"));
const Ne2 = Kd();
const Be2 = computed(() => {
var e16, t3;
return (t3 = (e16 = unref(P2)) == null ? void 0 : e16.popperRef) == null ? void 0 : t3.contentRef;
});
const Fe2 = computed(() => {
var e16;
if (unref(Ie2)) {
return unref(Y2);
}
return (e16 = unref(Y2)) == null ? void 0 : e16.$el;
});
const Ue2 = qe$1(Fe2, (e16) => {
const t3 = unref(Be2);
const a2 = unref(Fe2);
if (t3 && (e16.target === t3 || e16.composedPath().includes(t3)) || e16.target === a2 || e16.composedPath().includes(a2)) return;
_2.value = false;
});
onBeforeUnmount(() => {
Ue2 == null ? void 0 : Ue2();
});
const ze2 = ref(null);
const We2 = () => {
if (ze2.value) {
const e16 = He2(ae2.value);
if (e16) {
if (Ke2(e16)) {
I2(mt$1(e16) ? e16.map((e17) => e17.toDate()) : e16.toDate());
ze2.value = null;
}
}
}
if (ze2.value === "") {
I2($2.value);
R2($2.value);
ze2.value = null;
}
};
const He2 = (e16) => {
if (!e16) return null;
return et2.value.parseUserInput(e16);
};
const je2 = (e16) => {
if (!e16) return null;
return et2.value.formatToString(e16);
};
const Ke2 = (e16) => et2.value.isValidValue(e16);
const Ze2 = async (e16) => {
if (o2.readonly || ee2.value) return;
const { code: t3 } = e16;
N2(e16);
if (t3 === di.esc) {
if (_2.value === true) {
_2.value = false;
e16.preventDefault();
e16.stopPropagation();
}
return;
}
if (t3 === di.down) {
if (et2.value.handleFocusPicker) {
e16.preventDefault();
e16.stopPropagation();
}
if (_2.value === false) {
_2.value = true;
await nextTick();
}
if (et2.value.handleFocusPicker) {
et2.value.handleFocusPicker();
return;
}
}
if (t3 === di.tab) {
T2 = true;
return;
}
if (t3 === di.enter || t3 === di.numpadEnter) {
if (ze2.value === null || ze2.value === "" || Ke2(He2(ae2.value))) {
We2();
_2.value = false;
}
e16.stopPropagation();
return;
}
if (ze2.value) {
e16.stopPropagation();
return;
}
if (et2.value.handleKeydownInput) {
et2.value.handleKeydownInput(e16);
}
};
const Ge2 = (e16) => {
ze2.value = e16;
if (!_2.value) {
_2.value = true;
}
};
const Xe2 = (e16) => {
const t3 = e16.target;
if (ze2.value) {
ze2.value = [t3.value, ze2.value[1]];
} else {
ze2.value = [t3.value, null];
}
};
const qe2 = (e16) => {
const t3 = e16.target;
if (ze2.value) {
ze2.value = [ze2.value[0], t3.value];
} else {
ze2.value = [null, t3.value];
}
};
const Je2 = () => {
var e16;
const t3 = ze2.value;
const a2 = He2(t3 && t3[0]);
const n3 = unref(te2);
if (a2 && a2.isValid()) {
ze2.value = [je2(a2), ((e16 = ae2.value) == null ? void 0 : e16[1]) || null];
const t4 = [a2, n3 && (n3[1] || null)];
if (Ke2(t4)) {
I2(t4);
ze2.value = null;
}
}
};
const Qe2 = () => {
var e16;
const t3 = unref(ze2);
const a2 = He2(t3 && t3[1]);
const n3 = unref(te2);
if (a2 && a2.isValid()) {
ze2.value = [((e16 = unref(ae2)) == null ? void 0 : e16[0]) || null, je2(a2)];
const t4 = [n3 && n3[0], a2];
if (Ke2(t4)) {
I2(t4);
ze2.value = null;
}
}
};
const et2 = ref({});
const tt2 = (e16) => {
et2.value[e16[0]] = e16[1];
et2.value.panelReady = true;
};
const at2 = (e16) => {
n2("calendar-change", e16);
};
const nt2 = (e16, t3, a2) => {
n2("panel-change", e16, t3, a2);
};
provide("EP_PICKER_BASE", { props: o2 });
t2({ focus: X2, handleFocusInput: q2, handleBlurInput: Q2, handleOpen: Z2, handleClose: G2, onPick: z2 });
return (e16, t3) => (openBlock(), createBlock(unref(lv), mergeProps({ ref_key: "refPopper", ref: P2, visible: _2.value, effect: "light", pure: "", trigger: "click" }, e16.$attrs, { role: "dialog", teleported: "", transition: `${unref(r2).namespace.value}-zoom-in-top`, "popper-class": [`${unref(r2).namespace.value}-picker__popper`, e16.popperClass], "popper-options": unref(M2), "fallback-placements": ["bottom", "top", "right", "left"], "gpu-acceleration": false, "stop-popper-mouse-event": false, "hide-after": 0, persistent: "", onBeforeShow: W2, onShow: H2, onHide: K2 }), { default: withCtx(() => [!unref(Ie2) ? (openBlock(), createBlock(unref(lf), { key: 0, id: e16.id, ref_key: "inputRef", ref: Y2, "container-role": "combobox", "model-value": unref(ae2), name: e16.name, size: unref(Ne2), disabled: unref(ee2), placeholder: e16.placeholder, class: normalizeClass([unref(r2).b("editor"), unref(r2).bm("editor", e16.type), e16.$attrs.class]), style: normalizeStyle(e16.$attrs.style), readonly: !e16.editable || e16.readonly || unref(le2) || unref(se2) || unref(re2) || e16.type === "week", "aria-label": e16.ariaLabel, tabindex: e16.tabindex, "validate-event": false, onInput: Ge2, onFocus: q2, onBlur: Q2, onKeydown: Ze2, onChange: We2, onMousedown: Ae2, onMouseenter: Le2, onMouseleave: Ee2, onTouchstartPassive: Re2, onClick: withModifiers(() => {
}, ["stop"]) }, { prefix: withCtx(() => [unref(ie2) ? (openBlock(), createBlock(unref(Ud), { key: 0, class: normalizeClass(unref(i2).e("icon")), onMousedown: withModifiers(Ae2, ["prevent"]), onTouchstartPassive: Re2 }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(unref(ie2))))]), _: 1 }, 8, ["class", "onMousedown"])) : createCommentVNode("v-if", true)]), suffix: withCtx(() => [ue2.value && e16.clearIcon ? (openBlock(), createBlock(unref(Ud), { key: 0, class: normalizeClass(`${unref(i2).e("icon")} clear-icon`), onClick: withModifiers(Oe2, ["stop"]) }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e16.clearIcon)))]), _: 1 }, 8, ["class", "onClick"])) : createCommentVNode("v-if", true)]), _: 1 }, 8, ["id", "model-value", "name", "size", "disabled", "placeholder", "class", "style", "readonly", "aria-label", "tabindex", "onKeydown", "onClick"])) : (openBlock(), createElementBlock("div", { key: 1, ref_key: "inputRef", ref: Y2, class: normalizeClass(unref(L2)), style: normalizeStyle(e16.$attrs.style), onClick: q2, onMouseenter: Le2, onMouseleave: Ee2, onTouchstartPassive: Re2, onKeydown: Ze2 }, [unref(ie2) ? (openBlock(), createBlock(unref(Ud), { key: 0, class: normalizeClass([unref(i2).e("icon"), unref(D2).e("icon")]), onMousedown: withModifiers(Ae2, ["prevent"]), onTouchstartPassive: Re2 }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(unref(ie2))))]), _: 1 }, 8, ["class", "onMousedown"])) : createCommentVNode("v-if", true), createElementVNode("input", { id: e16.id && e16.id[0], autocomplete: "off", name: e16.name && e16.name[0], placeholder: e16.startPlaceholder, value: unref(ae2) && unref(ae2)[0], disabled: unref(ee2), readonly: !e16.editable || e16.readonly, class: normalizeClass(unref(D2).b("input")), onMousedown: Ae2, onInput: Xe2, onChange: Je2, onFocus: q2, onBlur: Q2 }, null, 42, ["id", "name", "placeholder", "value", "disabled", "readonly"]), renderSlot(e16.$slots, "range-separator", {}, () => [createElementVNode("span", { class: normalizeClass(unref(D2).b("separator")) }, toDisplayString(e16.rangeSeparator), 3)]), createElementVNode("input", { id: e16.id && e16.id[1], autocomplete: "off", name: e16.name && e16.name[1], placeholder: e16.endPlaceholder, value: unref(ae2) && unref(ae2)[1], disabled: unref(ee2), readonly: !e16.editable || e16.readonly, class: normalizeClass(unref(D2).b("input")), onMousedown: Ae2, onFocus: q2, onBlur: Q2, onInput: qe2, onChange: Qe2 }, null, 42, ["id", "name", "placeholder", "value", "disabled", "readonly"]), e16.clearIcon ? (openBlock(), createBlock(unref(Ud), { key: 1, class: normalizeClass(unref(E2)), onClick: Oe2 }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e16.clearIcon)))]), _: 1 }, 8, ["class"])) : createCommentVNode("v-if", true)], 38))]), content: withCtx(() => [renderSlot(e16.$slots, "default", { visible: _2.value, actualVisible: V2.value, parsedValue: unref(te2), format: e16.format, dateFormat: e16.dateFormat, timeFormat: e16.timeFormat, unlinkPanels: e16.unlinkPanels, type: e16.type, defaultValue: e16.defaultValue, onPick: z2, onSelectRange: F2, onSetPickerOption: tt2, onCalendarChange: at2, onPanelChange: nt2, onKeydown: j2, onMousedown: withModifiers(() => {
}, ["stop"]) })]), _: 3 }, 16, ["visible", "transition", "popper-class", "popper-options"]));
} });
var bt = $d(gt, [["__file", "picker.vue"]]);
const wt = ti({ ...mt, datetimeRole: String, parsedValue: { type: Jl(Object) } });
const kt = ({ getAvailableHours: e15, getAvailableMinutes: t2, getAvailableSeconds: a2 }) => {
const n2 = (n3, o3, l3, s2) => {
const r2 = { hour: e15, minute: t2, second: a2 };
let i2 = n3;
["hour", "minute", "second"].forEach((e16) => {
if (r2[e16]) {
let t3;
const a3 = r2[e16];
switch (e16) {
case "minute": {
t3 = a3(i2.hour(), o3, s2);
break;
}
case "second": {
t3 = a3(i2.hour(), i2.minute(), o3, s2);
break;
}
default: {
t3 = a3(o3, s2);
break;
}
}
if ((t3 == null ? void 0 : t3.length) && !t3.includes(i2[e16]())) {
const a4 = l3 ? 0 : t3.length - 1;
i2 = i2[e16](t3[a4]);
}
}
});
return i2;
};
const o2 = {};
const l2 = ([e16, t3]) => {
o2[e16] = t3;
};
return { timePickerOptions: o2, getAvailableTime: n2, onSetOption: l2 };
};
const Dt = (e15) => {
const t2 = (e16, t3) => e16 || t3;
const a2 = (e16) => e16 !== true;
return e15.map(t2).filter(a2);
};
const xt = (e15, t2, a2) => {
const n2 = (t3, a3) => vt(24, e15 && (() => e15 == null ? void 0 : e15(t3, a3)));
const o2 = (e16, a3, n3) => vt(60, t2 && (() => t2 == null ? void 0 : t2(e16, a3, n3)));
const l2 = (e16, t3, n3, o3) => vt(60, a2 && (() => a2 == null ? void 0 : a2(e16, t3, n3, o3)));
return { getHoursList: n2, getMinutesList: o2, getSecondsList: l2 };
};
const Ct = (e15, t2, a2) => {
const { getHoursList: n2, getMinutesList: o2, getSecondsList: l2 } = xt(e15, t2, a2);
const s2 = (e16, t3) => Dt(n2(e16, t3));
const r2 = (e16, t3, a3) => Dt(o2(e16, t3, a3));
const i2 = (e16, t3, a3, n3) => Dt(l2(e16, t3, a3, n3));
return { getAvailableHours: s2, getAvailableMinutes: r2, getAvailableSeconds: i2 };
};
const St = (e15) => {
const t2 = ref(e15.parsedValue);
watch(() => e15.visible, (a2) => {
if (!a2) {
t2.value = e15.parsedValue;
}
});
return t2;
};
const Mt = ti({ role: { type: String, required: true }, spinnerDate: { type: Jl(Object), required: true }, showSeconds: { type: Boolean, default: true }, arrowControl: Boolean, amPmMode: { type: Jl(String), default: "" }, ...pt });
const $t = defineComponent({ __name: "basic-time-spinner", props: Mt, emits: ["change", "select-range", "set-option"], setup(e15, { emit: t2 }) {
const a2 = e15;
const n2 = zi("time");
const { getHoursList: o2, getMinutesList: l2, getSecondsList: s2 } = xt(a2.disabledHours, a2.disabledMinutes, a2.disabledSeconds);
let r2 = false;
const i2 = ref();
const u2 = ref();
const d2 = ref();
const f2 = ref();
const v2 = { hours: u2, minutes: d2, seconds: f2 };
const p2 = computed(() => a2.showSeconds ? tt : tt.slice(0, 2));
const m2 = computed(() => {
const { spinnerDate: e16 } = a2;
const t3 = e16.hour();
const n3 = e16.minute();
const o3 = e16.second();
return { hours: t3, minutes: n3, seconds: o3 };
});
const h2 = computed(() => {
const { hours: e16, minutes: t3 } = unref(m2);
return { hours: o2(a2.role), minutes: l2(e16, a2.role), seconds: s2(e16, t3, a2.role) };
});
const y2 = computed(() => {
const { hours: e16, minutes: t3, seconds: a3 } = unref(m2);
return { hours: lt(e16, 23), minutes: lt(t3, 59), seconds: lt(a3, 59) };
});
const g2 = Ms((e16) => {
r2 = false;
D2(e16);
}, 200);
const b2 = (e16) => {
const t3 = !!a2.amPmMode;
if (!t3) return "";
const n3 = a2.amPmMode === "A";
let o3 = e16 < 12 ? " am" : " pm";
if (n3) o3 = o3.toUpperCase();
return o3;
};
const w2 = (e16) => {
let a3;
switch (e16) {
case "hours":
a3 = [0, 2];
break;
case "minutes":
a3 = [3, 5];
break;
case "seconds":
a3 = [6, 8];
break;
}
const [n3, o3] = a3;
t2("select-range", n3, o3);
i2.value = e16;
};
const D2 = (e16) => {
V2(e16, unref(m2)[e16]);
};
const x2 = () => {
D2("hours");
D2("minutes");
D2("seconds");
};
const _2 = (e16) => e16.querySelector(`.${n2.namespace.value}-scrollbar__wrap`);
const V2 = (e16, t3) => {
if (a2.arrowControl) return;
const n3 = unref(v2[e16]);
if (n3 && n3.$el) {
_2(n3.$el).scrollTop = Math.max(0, t3 * O2(e16));
}
};
const O2 = (e16) => {
const t3 = unref(v2[e16]);
const a3 = t3 == null ? void 0 : t3.$el.querySelector("li");
if (a3) {
return Number.parseFloat(ol(a3, "height")) || 0;
}
return 0;
};
const T2 = () => {
L2(1);
};
const A2 = () => {
L2(-1);
};
const L2 = (e16) => {
if (!i2.value) {
w2("hours");
}
const t3 = i2.value;
const a3 = unref(m2)[t3];
const n3 = i2.value === "hours" ? 24 : 60;
const o3 = E2(t3, a3, e16, n3);
R2(t3, o3);
V2(t3, o3);
nextTick(() => w2(t3));
};
const E2 = (e16, t3, a3, n3) => {
let o3 = (t3 + a3 + n3) % n3;
const l3 = unref(h2)[e16];
while (l3[o3] && o3 !== t3) {
o3 = (o3 + a3 + n3) % n3;
}
return o3;
};
const R2 = (e16, n3) => {
const o3 = unref(h2)[e16];
const l3 = o3[n3];
if (l3) return;
const { hours: s3, minutes: r3, seconds: i3 } = unref(m2);
let u3;
switch (e16) {
case "hours":
u3 = a2.spinnerDate.hour(n3).minute(r3).second(i3);
break;
case "minutes":
u3 = a2.spinnerDate.hour(s3).minute(n3).second(i3);
break;
case "seconds":
u3 = a2.spinnerDate.hour(s3).minute(r3).second(n3);
break;
}
t2("change", u3);
};
const I2 = (e16, { value: t3, disabled: a3 }) => {
if (!a3) {
R2(e16, t3);
w2(e16);
V2(e16, t3);
}
};
const N2 = (e16) => {
r2 = true;
g2(e16);
const t3 = Math.min(Math.round((_2(unref(v2[e16]).$el).scrollTop - (B2(e16) * 0.5 - 10) / O2(e16) + 3) / O2(e16)), e16 === "hours" ? 23 : 59);
R2(e16, t3);
};
const B2 = (e16) => unref(v2[e16]).$el.offsetHeight;
const F2 = () => {
const e16 = (e17) => {
const t3 = unref(v2[e17]);
if (t3 && t3.$el) {
_2(t3.$el).onscroll = () => {
N2(e17);
};
}
};
e16("hours");
e16("minutes");
e16("seconds");
};
onMounted(() => {
nextTick(() => {
!a2.arrowControl && F2();
x2();
if (a2.role === "start") w2("hours");
});
});
const U2 = (e16, t3) => {
v2[t3].value = e16;
};
t2("set-option", [`${a2.role}_scrollDown`, L2]);
t2("set-option", [`${a2.role}_emitSelectRange`, w2]);
watch(() => a2.spinnerDate, () => {
if (r2) return;
x2();
});
return (e16, t3) => (openBlock(), createElementBlock("div", { class: normalizeClass([unref(n2).b("spinner"), { "has-seconds": e16.showSeconds }]) }, [!e16.arrowControl ? (openBlock(true), createElementBlock(Fragment, { key: 0 }, renderList(unref(p2), (t4) => (openBlock(), createBlock(unref(Ef), { key: t4, ref_for: true, ref: (e17) => U2(e17, t4), class: normalizeClass(unref(n2).be("spinner", "wrapper")), "wrap-style": "max-height: inherit;", "view-class": unref(n2).be("spinner", "list"), noresize: "", tag: "ul", onMouseenter: (e17) => w2(t4), onMousemove: (e17) => D2(t4) }, { default: withCtx(() => [(openBlock(true), createElementBlock(Fragment, null, renderList(unref(h2)[t4], (a3, o3) => (openBlock(), createElementBlock("li", { key: o3, class: normalizeClass([unref(n2).be("spinner", "item"), unref(n2).is("active", o3 === unref(m2)[t4]), unref(n2).is("disabled", a3)]), onClick: (e17) => I2(t4, { value: o3, disabled: a3 }) }, [t4 === "hours" ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [createTextVNode(toDisplayString(("0" + (e16.amPmMode ? o3 % 12 || 12 : o3)).slice(-2)) + toDisplayString(b2(o3)), 1)], 64)) : (openBlock(), createElementBlock(Fragment, { key: 1 }, [createTextVNode(toDisplayString(("0" + o3).slice(-2)), 1)], 64))], 10, ["onClick"]))), 128))]), _: 2 }, 1032, ["class", "view-class", "onMouseenter", "onMousemove"]))), 128)) : createCommentVNode("v-if", true), e16.arrowControl ? (openBlock(true), createElementBlock(Fragment, { key: 1 }, renderList(unref(p2), (t4) => (openBlock(), createElementBlock("div", { key: t4, class: normalizeClass([unref(n2).be("spinner", "wrapper"), unref(n2).is("arrow")]), onMouseenter: (e17) => w2(t4) }, [withDirectives((openBlock(), createBlock(unref(Ud), { class: normalizeClass(["arrow-up", unref(n2).be("spinner", "arrow")]) }, { default: withCtx(() => [createVNode(unref(vl))]), _: 1 }, 8, ["class"])), [[unref(cm), A2]]), withDirectives((openBlock(), createBlock(unref(Ud), { class: normalizeClass(["arrow-down", unref(n2).be("spinner", "arrow")]) }, { default: withCtx(() => [createVNode(unref(il))]), _: 1 }, 8, ["class"])), [[unref(cm), T2]]), createElementVNode("ul", { class: normalizeClass(unref(n2).be("spinner", "list")) }, [(openBlock(true), createElementBlock(Fragment, null, renderList(unref(y2)[t4], (a3, o3) => (openBlock(), createElementBlock("li", { key: o3, class: normalizeClass([unref(n2).be("spinner", "item"), unref(n2).is("active", a3 === unref(m2)[t4]), unref(n2).is("disabled", unref(h2)[t4][a3])]) }, [typeof a3 === "number" ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [t4 === "hours" ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [createTextVNode(toDisplayString(("0" + (e16.amPmMode ? a3 % 12 || 12 : a3)).slice(-2)) + toDisplayString(b2(a3)), 1)], 64)) : (openBlock(), createElementBlock(Fragment, { key: 1 }, [createTextVNode(toDisplayString(("0" + a3).slice(-2)), 1)], 64))], 64)) : createCommentVNode("v-if", true)], 2))), 128))], 2)], 42, ["onMouseenter"]))), 128)) : createCommentVNode("v-if", true)], 2));
} });
var Pt = $d($t, [["__file", "basic-time-spinner.vue"]]);
const Yt = defineComponent({ __name: "panel-time-pick", props: wt, emits: ["pick", "select-range", "set-picker-option"], setup(e15, { emit: t2 }) {
const a2 = e15;
const n2 = inject("EP_PICKER_BASE");
const { arrowControl: o2, disabledHours: l2, disabledMinutes: s2, disabledSeconds: r2, defaultValue: i2 } = n2.props;
const { getAvailableHours: d2, getAvailableMinutes: f2, getAvailableSeconds: v2 } = Ct(l2, s2, r2);
const p2 = zi("time");
const { t: m2, lang: h2 } = Bi();
const y2 = ref([0, 2]);
const g2 = St(a2);
const b2 = computed(() => Vs(a2.actualVisible) ? `${p2.namespace.value}-zoom-in-top` : "");
const w2 = computed(() => a2.format.includes("ss"));
const k2 = computed(() => {
if (a2.format.includes("A")) return "A";
if (a2.format.includes("a")) return "a";
return "";
});
const D2 = (e16) => {
const t3 = je(e16).locale(h2.value);
const a3 = A2(t3);
return t3.isSame(a3);
};
const C2 = () => {
t2("pick", g2.value, false);
};
const S2 = (e16 = false, n3 = false) => {
if (n3) return;
t2("pick", a2.parsedValue, e16);
};
const M2 = (e16) => {
if (!a2.visible) {
return;
}
const n3 = A2(e16).millisecond(0);
t2("pick", n3, true);
};
const $2 = (e16, a3) => {
t2("select-range", e16, a3);
y2.value = [e16, a3];
};
const P2 = (e16) => {
const t3 = [0, 3].concat(w2.value ? [6] : []);
const a3 = ["hours", "minutes"].concat(w2.value ? ["seconds"] : []);
const n3 = t3.indexOf(y2.value[0]);
const o3 = (n3 + e16 + t3.length) % t3.length;
V2["start_emitSelectRange"](a3[o3]);
};
const Y2 = (e16) => {
const t3 = e16.code;
const { left: a3, right: n3, up: o3, down: l3 } = di;
if ([a3, n3].includes(t3)) {
const n4 = t3 === a3 ? -1 : 1;
P2(n4);
e16.preventDefault();
return;
}
if ([o3, l3].includes(t3)) {
const a4 = t3 === o3 ? -1 : 1;
V2["start_scrollDown"](a4);
e16.preventDefault();
return;
}
};
const { timePickerOptions: V2, onSetOption: O2, getAvailableTime: T2 } = kt({ getAvailableHours: d2, getAvailableMinutes: f2, getAvailableSeconds: v2 });
const A2 = (e16) => T2(e16, a2.datetimeRole || "", true);
const L2 = (e16) => {
if (!e16) return null;
return je(e16, a2.format).locale(h2.value);
};
const E2 = (e16) => {
if (!e16) return null;
return e16.format(a2.format);
};
const R2 = () => je(i2).locale(h2.value);
t2("set-picker-option", ["isValidValue", D2]);
t2("set-picker-option", ["formatToString", E2]);
t2("set-picker-option", ["parseUserInput", L2]);
t2("set-picker-option", ["handleKeydownInput", Y2]);
t2("set-picker-option", ["getRangeAvailableTime", A2]);
t2("set-picker-option", ["getDefaultValue", R2]);
return (e16, t3) => (openBlock(), createBlock(Transition, { name: unref(b2) }, { default: withCtx(() => [e16.actualVisible || e16.visible ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(p2).b("panel")) }, [createElementVNode("div", { class: normalizeClass([unref(p2).be("panel", "content"), { "has-seconds": unref(w2) }]) }, [createVNode(Pt, { ref: "spinner", role: e16.datetimeRole || "start", "arrow-control": unref(o2), "show-seconds": unref(w2), "am-pm-mode": unref(k2), "spinner-date": e16.parsedValue, "disabled-hours": unref(l2), "disabled-minutes": unref(s2), "disabled-seconds": unref(r2), onChange: M2, onSetOption: unref(O2), onSelectRange: $2 }, null, 8, ["role", "arrow-control", "show-seconds", "am-pm-mode", "spinner-date", "disabled-hours", "disabled-minutes", "disabled-seconds", "onSetOption"])], 2), createElementVNode("div", { class: normalizeClass(unref(p2).be("panel", "footer")) }, [createElementVNode("button", { type: "button", class: normalizeClass([unref(p2).be("panel", "btn"), "cancel"]), onClick: C2 }, toDisplayString(unref(m2)("el.datepicker.cancel")), 3), createElementVNode("button", { type: "button", class: normalizeClass([unref(p2).be("panel", "btn"), "confirm"]), onClick: (e17) => S2() }, toDisplayString(unref(m2)("el.datepicker.confirm")), 11, ["onClick"])], 2)], 2)) : createCommentVNode("v-if", true)]), _: 1 }, 8, ["name"]));
} });
var _t = $d(Yt, [["__file", "panel-time-pick.vue"]]);
var Vt = { exports: {} };
(function(e15, t2) {
!function(t3, a2) {
e15.exports = a2();
}(Xe, function() {
return function(e16, t3, a2) {
var n2 = t3.prototype, o2 = function(e17) {
return e17 && (e17.indexOf ? e17 : e17.s);
}, l2 = function(e17, t4, a3, n3, l3) {
var s3 = e17.name ? e17 : e17.$locale(), r3 = o2(s3[t4]), i3 = o2(s3[a3]), u2 = r3 || i3.map(function(e18) {
return e18.slice(0, n3);
});
if (!l3) return u2;
var c2 = s3.weekStart;
return u2.map(function(e18, t5) {
return u2[(t5 + (c2 || 0)) % 7];
});
}, s2 = function() {
return a2.Ls[a2.locale()];
}, r2 = function(e17, t4) {
return e17.formats[t4] || function(e18) {
return e18.replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e19, t5, a3) {
return t5 || a3.slice(1);
});
}(e17.formats[t4.toUpperCase()]);
}, i2 = function() {
var e17 = this;
return { months: function(t4) {
return t4 ? t4.format("MMMM") : l2(e17, "months");
}, monthsShort: function(t4) {
return t4 ? t4.format("MMM") : l2(e17, "monthsShort", "months", 3);
}, firstDayOfWeek: function() {
return e17.$locale().weekStart || 0;
}, weekdays: function(t4) {
return t4 ? t4.format("dddd") : l2(e17, "weekdays");
}, weekdaysMin: function(t4) {
return t4 ? t4.format("dd") : l2(e17, "weekdaysMin", "weekdays", 2);
}, weekdaysShort: function(t4) {
return t4 ? t4.format("ddd") : l2(e17, "weekdaysShort", "weekdays", 3);
}, longDateFormat: function(t4) {
return r2(e17.$locale(), t4);
}, meridiem: this.$locale().meridiem, ordinal: this.$locale().ordinal };
};
n2.localeData = function() {
return i2.bind(this)();
}, a2.localeData = function() {
var e17 = s2();
return { firstDayOfWeek: function() {
return e17.weekStart || 0;
}, weekdays: function() {
return a2.weekdays();
}, weekdaysShort: function() {
return a2.weekdaysShort();
}, weekdaysMin: function() {
return a2.weekdaysMin();
}, months: function() {
return a2.months();
}, monthsShort: function() {
return a2.monthsShort();
}, longDateFormat: function(t4) {
return r2(e17, t4);
}, meridiem: e17.meridiem, ordinal: e17.ordinal };
}, a2.months = function() {
return l2(s2(), "months");
}, a2.monthsShort = function() {
return l2(s2(), "monthsShort", "months", 3);
}, a2.weekdays = function(e17) {
return l2(s2(), "weekdays", null, null, e17);
}, a2.weekdaysShort = function(e17) {
return l2(s2(), "weekdaysShort", "weekdays", 3, e17);
}, a2.weekdaysMin = function(e17) {
return l2(s2(), "weekdaysMin", "weekdays", 2, e17);
};
};
});
})(Vt);
var Ot = Vt.exports;
const Tt = qe(Ot);
var At = { exports: {} };
(function(e15, t2) {
!function(t3, a2) {
e15.exports = a2();
}(Xe, function() {
return function(e16, t3) {
var a2 = t3.prototype, n2 = a2.format;
a2.format = function(e17) {
var t4 = this, a3 = this.$locale();
if (!this.isValid()) return n2.bind(this)(e17);
var o2 = this.$utils(), l2 = (e17 || "YYYY-MM-DDTHH:mm:ssZ").replace(/\[([^\]]+)]|Q|wo|ww|w|WW|W|zzz|z|gggg|GGGG|Do|X|x|k{1,2}|S/g, function(e18) {
switch (e18) {
case "Q":
return Math.ceil((t4.$M + 1) / 3);
case "Do":
return a3.ordinal(t4.$D);
case "gggg":
return t4.weekYear();
case "GGGG":
return t4.isoWeekYear();
case "wo":
return a3.ordinal(t4.week(), "W");
case "w":
case "ww":
return o2.s(t4.week(), "w" === e18 ? 1 : 2, "0");
case "W":
case "WW":
return o2.s(t4.isoWeek(), "W" === e18 ? 1 : 2, "0");
case "k":
case "kk":
return o2.s(String(0 === t4.$H ? 24 : t4.$H), "k" === e18 ? 1 : 2, "0");
case "X":
return Math.floor(t4.$d.getTime() / 1e3);
case "x":
return t4.$d.getTime();
case "z":
return "[" + t4.offsetName() + "]";
case "zzz":
return "[" + t4.offsetName("long") + "]";
default:
return e18;
}
});
return n2.bind(this)(l2);
};
};
});
})(At);
var Lt = At.exports;
const Et = qe(Lt);
var Rt = { exports: {} };
(function(e15, t2) {
!function(t3, a2) {
e15.exports = a2();
}(Xe, function() {
var e16 = "week", t3 = "year";
return function(a2, n2, o2) {
var l2 = n2.prototype;
l2.week = function(a3) {
if (void 0 === a3 && (a3 = null), null !== a3) return this.add(7 * (a3 - this.week()), "day");
var n3 = this.$locale().yearStart || 1;
if (11 === this.month() && this.date() > 25) {
var l3 = o2(this).startOf(t3).add(1, t3).date(n3), s2 = o2(this).endOf(e16);
if (l3.isBefore(s2)) return 1;
}
var r2 = o2(this).startOf(t3).date(n3).startOf(e16).subtract(1, "millisecond"), i2 = this.diff(r2, e16, true);
return i2 < 0 ? o2(this).startOf("week").week() : Math.ceil(i2);
}, l2.weeks = function(e17) {
return void 0 === e17 && (e17 = null), this.week(e17);
};
};
});
})(Rt);
var It = Rt.exports;
const Nt = qe(It);
var Bt = { exports: {} };
(function(e15, t2) {
!function(t3, a2) {
e15.exports = a2();
}(Xe, function() {
return function(e16, t3) {
t3.prototype.weekYear = function() {
var e17 = this.month(), t4 = this.week(), a2 = this.year();
return 1 === t4 && 11 === e17 ? a2 + 1 : 0 === e17 && t4 >= 52 ? a2 - 1 : a2;
};
};
});
})(Bt);
var Ft = Bt.exports;
const Ut = qe(Ft);
var zt = { exports: {} };
(function(e15, t2) {
!function(t3, a2) {
e15.exports = a2();
}(Xe, function() {
return function(e16, t3, a2) {
t3.prototype.dayOfYear = function(e17) {
var t4 = Math.round((a2(this).startOf("day") - a2(this).startOf("year")) / 864e5) + 1;
return null == e17 ? t4 : this.add(e17 - t4, "day");
};
};
});
})(zt);
var Wt = zt.exports;
const Ht = qe(Wt);
var jt = { exports: {} };
(function(e15, t2) {
!function(t3, a2) {
e15.exports = a2();
}(Xe, function() {
return function(e16, t3) {
t3.prototype.isSameOrAfter = function(e17, t4) {
return this.isSame(e17, t4) || this.isAfter(e17, t4);
};
};
});
})(jt);
var Kt = jt.exports;
const Zt = qe(Kt);
var Gt = { exports: {} };
(function(e15, t2) {
!function(t3, a2) {
e15.exports = a2();
}(Xe, function() {
return function(e16, t3) {
t3.prototype.isSameOrBefore = function(e17, t4) {
return this.isSame(e17, t4) || this.isBefore(e17, t4);
};
};
});
})(Gt);
var Xt = Gt.exports;
const qt = qe(Xt);
const Jt = Symbol();
const Qt = ti({ ...ht, type: { type: Jl(String), default: "date" } });
const ea = ["date", "dates", "year", "years", "month", "months", "week", "range"];
const ta = ti({ disabledDate: { type: Jl(Function) }, date: { type: Jl(Object), required: true }, minDate: { type: Jl(Object) }, maxDate: { type: Jl(Object) }, parsedValue: { type: Jl([Object, Array]) }, rangeState: { type: Jl(Object), default: () => ({ endDate: null, selecting: false }) } });
const aa = ti({ type: { type: Jl(String), required: true, values: Ze }, dateFormat: String, timeFormat: String });
const na = ti({ unlinkPanels: Boolean, parsedValue: { type: Jl(Array) } });
const oa = (e15) => ({ type: String, values: ea, default: e15 });
const la = ti({ ...aa, parsedValue: { type: Jl([Object, Array]) }, visible: { type: Boolean }, format: { type: String, default: "" } });
const sa = ti({ ...ta, cellClassName: { type: Jl(Function) }, showWeekNumber: Boolean, selectionMode: oa("date") });
const ra = ["changerange", "pick", "select"];
const ia = (e15) => {
if (!mt$1(e15)) return false;
const [t2, n2] = e15;
return je.isDayjs(t2) && je.isDayjs(n2) && t2.isSameOrBefore(n2);
};
const ua = (e15, { lang: t2, unit: n2, unlinkPanels: o2 }) => {
let l2;
if (mt$1(e15)) {
let [a2, l3] = e15.map((e16) => je(e16).locale(t2));
if (!o2) {
l3 = a2.add(1, n2);
}
return [a2, l3];
} else if (e15) {
l2 = je(e15);
} else {
l2 = je();
}
l2 = l2.locale(t2);
return [l2, l2.add(1, n2)];
};
const ca = (e15, t2, { columnIndexOffset: a2, startDate: n2, nextEndDate: o2, now: l2, unit: s2, relativeDateGetter: r2, setCellMetadata: i2, setRowMetadata: u2 }) => {
for (let c2 = 0; c2 < e15.row; c2++) {
const d2 = t2[c2];
for (let t3 = 0; t3 < e15.column; t3++) {
let u3 = d2[t3 + a2];
if (!u3) {
u3 = { row: c2, column: t3, type: "normal", inRange: false, start: false, end: false };
}
const f2 = c2 * e15.column + t3;
const v2 = r2(f2);
u3.dayjs = v2;
u3.date = v2.toDate();
u3.timestamp = v2.valueOf();
u3.type = "normal";
u3.inRange = !!(n2 && v2.isSameOrAfter(n2, s2) && o2 && v2.isSameOrBefore(o2, s2)) || !!(n2 && v2.isSameOrBefore(n2, s2) && o2 && v2.isSameOrAfter(o2, s2));
if (n2 == null ? void 0 : n2.isSameOrAfter(o2)) {
u3.start = !!o2 && v2.isSame(o2, s2);
u3.end = n2 && v2.isSame(n2, s2);
} else {
u3.start = !!n2 && v2.isSame(n2, s2);
u3.end = !!o2 && v2.isSame(o2, s2);
}
const p2 = v2.isSame(l2, s2);
if (p2) {
u3.type = "today";
}
i2 == null ? void 0 : i2(u3, { rowIndex: c2, columnIndex: t3 });
d2[t3 + a2] = u3;
}
u2 == null ? void 0 : u2(d2);
}
};
const da = (e15 = "") => ["normal", "today"].includes(e15);
const fa = (e15, t2) => {
const { lang: a2 } = Bi();
const n2 = ref();
const o2 = ref();
const l2 = ref();
const s2 = ref();
const r2 = ref([[], [], [], [], [], []]);
let i2 = false;
const c2 = e15.date.$locale().weekStart || 7;
const d2 = e15.date.locale("en").localeData().weekdaysShort().map((e16) => e16.toLowerCase());
const f2 = computed(() => c2 > 3 ? 7 - c2 : -c2);
const v2 = computed(() => {
const t3 = e15.date.startOf("month");
return t3.subtract(t3.day() || 7, "day");
});
const p2 = computed(() => d2.concat(d2).slice(c2, c2 + 7));
const m2 = computed(() => sa$1(unref(k2)).some((e16) => e16.isCurrent));
const h2 = computed(() => {
const t3 = e15.date.startOf("month");
const a3 = t3.day() || 7;
const n3 = t3.daysInMonth();
const o3 = t3.subtract(1, "month").daysInMonth();
return { startOfMonthDay: a3, dateCountOfMonth: n3, dateCountOfLastMonth: o3 };
});
const y2 = computed(() => e15.selectionMode === "dates" ? Ge(e15.parsedValue) : []);
const g2 = (e16, { count: t3, rowIndex: a3, columnIndex: n3 }) => {
const { startOfMonthDay: o3, dateCountOfMonth: l3, dateCountOfLastMonth: s3 } = unref(h2);
const r3 = unref(f2);
if (a3 >= 0 && a3 <= 1) {
const l4 = o3 + r3 < 0 ? 7 + o3 + r3 : o3 + r3;
if (n3 + a3 * 7 >= l4) {
e16.text = t3;
return true;
} else {
e16.text = s3 - (l4 - n3 % 7) + 1 + a3 * 7;
e16.type = "prev-month";
}
} else {
if (t3 <= l3) {
e16.text = t3;
} else {
e16.text = t3 - l3;
e16.type = "next-month";
}
return true;
}
return false;
};
const b2 = (t3, { columnIndex: a3, rowIndex: n3 }, o3) => {
const { disabledDate: l3, cellClassName: s3 } = e15;
const r3 = unref(y2);
const i3 = g2(t3, { count: o3, rowIndex: n3, columnIndex: a3 });
const u2 = t3.dayjs.toDate();
t3.selected = r3.find((e16) => e16.isSame(t3.dayjs, "day"));
t3.isSelected = !!t3.selected;
t3.isCurrent = x2(t3);
t3.disabled = l3 == null ? void 0 : l3(u2);
t3.customClass = s3 == null ? void 0 : s3(u2);
return i3;
};
const w2 = (t3) => {
if (e15.selectionMode === "week") {
const [a3, n3] = e15.showWeekNumber ? [1, 7] : [0, 6];
const o3 = E2(t3[a3 + 1]);
t3[a3].inRange = o3;
t3[a3].start = o3;
t3[n3].inRange = o3;
t3[n3].end = o3;
}
};
const k2 = computed(() => {
const { minDate: t3, maxDate: n3, rangeState: o3, showWeekNumber: l3 } = e15;
const s3 = unref(f2);
const i3 = unref(r2);
const u2 = "day";
let c3 = 1;
if (l3) {
for (let e16 = 0; e16 < 6; e16++) {
if (!i3[e16][0]) {
i3[e16][0] = { type: "week", text: unref(v2).add(e16 * 7 + 1, u2).week() };
}
}
}
ca({ row: 6, column: 7 }, i3, { startDate: t3, columnIndexOffset: l3 ? 1 : 0, nextEndDate: o3.endDate || n3 || o3.selecting && t3 || null, now: je().locale(unref(a2)).startOf(u2), unit: u2, relativeDateGetter: (e16) => unref(v2).add(e16 - s3, u2), setCellMetadata: (...e16) => {
if (b2(...e16, c3)) {
c3 += 1;
}
}, setRowMetadata: w2 });
return i3;
});
watch(() => e15.date, async () => {
var e16;
if ((e16 = unref(n2)) == null ? void 0 : e16.contains(document.activeElement)) {
await nextTick();
await D2();
}
});
const D2 = async () => {
var e16;
return (e16 = unref(o2)) == null ? void 0 : e16.focus();
};
const x2 = (t3) => e15.selectionMode === "date" && da(t3.type) && C2(t3, e15.parsedValue);
const C2 = (t3, n3) => {
if (!n3) return false;
return je(n3).locale(unref(a2)).isSame(e15.date.date(Number(t3.text)), "day");
};
const S2 = (t3, a3) => {
const n3 = t3 * 7 + (a3 - (e15.showWeekNumber ? 1 : 0)) - unref(f2);
return unref(v2).add(n3, "day");
};
const M2 = (a3) => {
var n3;
if (!e15.rangeState.selecting) return;
let o3 = a3.target;
if (o3.tagName === "SPAN") {
o3 = (n3 = o3.parentNode) == null ? void 0 : n3.parentNode;
}
if (o3.tagName === "DIV") {
o3 = o3.parentNode;
}
if (o3.tagName !== "TD") return;
const r3 = o3.parentNode.rowIndex - 1;
const i3 = o3.cellIndex;
if (unref(k2)[r3][i3].disabled) return;
if (r3 !== unref(l2) || i3 !== unref(s2)) {
l2.value = r3;
s2.value = i3;
t2("changerange", { selecting: true, endDate: S2(r3, i3) });
}
};
const $2 = (e16) => !unref(m2) && (e16 == null ? void 0 : e16.text) === 1 && e16.type === "normal" || e16.isCurrent;
const P2 = (t3) => {
if (i2 || unref(m2) || e15.selectionMode !== "date") return;
L2(t3, true);
};
const Y2 = (e16) => {
const t3 = e16.target.closest("td");
if (!t3) return;
i2 = true;
};
const _2 = (e16) => {
const t3 = e16.target.closest("td");
if (!t3) return;
i2 = false;
};
const O2 = (a3) => {
if (!e15.rangeState.selecting || !e15.minDate) {
t2("pick", { minDate: a3, maxDate: null });
t2("select", true);
} else {
if (a3 >= e15.minDate) {
t2("pick", { minDate: e15.minDate, maxDate: a3 });
} else {
t2("pick", { minDate: a3, maxDate: e15.minDate });
}
t2("select", false);
}
};
const T2 = (e16) => {
const a3 = e16.week();
const n3 = `${e16.year()}w${a3}`;
t2("pick", { year: e16.year(), week: a3, value: n3, date: e16.startOf("week") });
};
const A2 = (a3, n3) => {
const o3 = n3 ? Ge(e15.parsedValue).filter((e16) => (e16 == null ? void 0 : e16.valueOf()) !== a3.valueOf()) : Ge(e15.parsedValue).concat([a3]);
t2("pick", o3);
};
const L2 = (a3, n3 = false) => {
const o3 = a3.target.closest("td");
if (!o3) return;
const l3 = o3.parentNode.rowIndex - 1;
const s3 = o3.cellIndex;
const r3 = unref(k2)[l3][s3];
if (r3.disabled || r3.type === "week") return;
const i3 = S2(l3, s3);
switch (e15.selectionMode) {
case "range": {
O2(i3);
break;
}
case "date": {
t2("pick", i3, n3);
break;
}
case "week": {
T2(i3);
break;
}
case "dates": {
A2(i3, !!r3.selected);
break;
}
}
};
const E2 = (t3) => {
if (e15.selectionMode !== "week") return false;
let a3 = e15.date.startOf("day");
if (t3.type === "prev-month") {
a3 = a3.subtract(1, "month");
}
if (t3.type === "next-month") {
a3 = a3.add(1, "month");
}
a3 = a3.date(Number.parseInt(t3.text, 10));
if (e15.parsedValue && !Array.isArray(e15.parsedValue)) {
const t4 = (e15.parsedValue.day() - c2 + 7) % 7 - 1;
const n3 = e15.parsedValue.subtract(t4, "day");
return n3.isSame(a3, "day");
}
return false;
};
return { WEEKS: p2, rows: k2, tbodyRef: n2, currentCellRef: o2, focus: D2, isCurrent: x2, isWeekActive: E2, isSelectedCell: $2, handlePickDate: L2, handleMouseUp: _2, handleMouseDown: Y2, handleMouseMove: M2, handleFocus: P2 };
};
const va = (e15, { isCurrent: t2, isWeekActive: a2 }) => {
const n2 = zi("date-table");
const { t: o2 } = Bi();
const l2 = computed(() => [n2.b(), { "is-week-mode": e15.selectionMode === "week" }]);
const s2 = computed(() => o2("el.datepicker.dateTablePrompt"));
const r2 = computed(() => o2("el.datepicker.week"));
const i2 = (a3) => {
const n3 = [];
if (da(a3.type) && !a3.disabled) {
n3.push("available");
if (a3.type === "today") {
n3.push("today");
}
} else {
n3.push(a3.type);
}
if (t2(a3)) {
n3.push("current");
}
if (a3.inRange && (da(a3.type) || e15.selectionMode === "week")) {
n3.push("in-range");
if (a3.start) {
n3.push("start-date");
}
if (a3.end) {
n3.push("end-date");
}
}
if (a3.disabled) {
n3.push("disabled");
}
if (a3.selected) {
n3.push("selected");
}
if (a3.customClass) {
n3.push(a3.customClass);
}
return n3.join(" ");
};
const d2 = (e16) => [n2.e("row"), { current: a2(e16) }];
return { tableKls: l2, tableLabel: s2, weekLabel: r2, getCellClasses: i2, getRowKls: d2, t: o2 };
};
const pa = ti({ cell: { type: Jl(Object) } });
var ma = defineComponent({ name: "ElDatePickerCell", props: pa, setup(e15) {
const t2 = zi("date-table-cell");
const { slots: a2 } = inject(Jt);
return () => {
const { cell: n2 } = e15;
return renderSlot(a2, "default", { ...n2 }, () => {
var e16;
return [createVNode("div", { class: t2.b() }, [createVNode("span", { class: t2.e("text") }, [(e16 = n2 == null ? void 0 : n2.renderText) != null ? e16 : n2 == null ? void 0 : n2.text])])];
});
};
} });
const ha = defineComponent({ __name: "basic-date-table", props: sa, emits: ra, setup(e15, { expose: t2, emit: a2 }) {
const n2 = e15;
const { WEEKS: o2, rows: l2, tbodyRef: s2, currentCellRef: r2, focus: i2, isCurrent: u2, isWeekActive: c2, isSelectedCell: d2, handlePickDate: f2, handleMouseUp: v2, handleMouseDown: p2, handleMouseMove: m2, handleFocus: h2 } = fa(n2, a2);
const { tableLabel: y2, tableKls: g2, weekLabel: b2, getCellClasses: w2, getRowKls: k2, t: D2 } = va(n2, { isCurrent: u2, isWeekActive: c2 });
t2({ focus: i2 });
return (e16, t3) => (openBlock(), createElementBlock("table", { "aria-label": unref(y2), class: normalizeClass(unref(g2)), cellspacing: "0", cellpadding: "0", role: "grid", onClick: unref(f2), onMousemove: unref(m2), onMousedown: withModifiers(unref(p2), ["prevent"]), onMouseup: unref(v2) }, [createElementVNode("tbody", { ref_key: "tbodyRef", ref: s2 }, [createElementVNode("tr", null, [e16.showWeekNumber ? (openBlock(), createElementBlock("th", { key: 0, scope: "col" }, toDisplayString(unref(b2)), 1)) : createCommentVNode("v-if", true), (openBlock(true), createElementBlock(Fragment, null, renderList(unref(o2), (e17, t4) => (openBlock(), createElementBlock("th", { key: t4, "aria-label": unref(D2)("el.datepicker.weeksFull." + e17), scope: "col" }, toDisplayString(unref(D2)("el.datepicker.weeks." + e17)), 9, ["aria-label"]))), 128))]), (openBlock(true), createElementBlock(Fragment, null, renderList(unref(l2), (e17, t4) => (openBlock(), createElementBlock("tr", { key: t4, class: normalizeClass(unref(k2)(e17[1])) }, [(openBlock(true), createElementBlock(Fragment, null, renderList(e17, (e18, a3) => (openBlock(), createElementBlock("td", { key: `${t4}.${a3}`, ref_for: true, ref: (t5) => unref(d2)(e18) && (r2.value = t5), class: normalizeClass(unref(w2)(e18)), "aria-current": e18.isCurrent ? "date" : void 0, "aria-selected": e18.isCurrent, tabindex: unref(d2)(e18) ? 0 : -1, onFocus: unref(h2) }, [createVNode(unref(ma), { cell: e18 }, null, 8, ["cell"])], 42, ["aria-current", "aria-selected", "tabindex", "onFocus"]))), 128))], 2))), 128))], 512)], 42, ["aria-label", "onClick", "onMousemove", "onMousedown", "onMouseup"]));
} });
var ya = $d(ha, [["__file", "basic-date-table.vue"]]);
const ga = ti({ ...ta, selectionMode: oa("month") });
const ba = defineComponent({ __name: "basic-month-table", props: ga, emits: ["changerange", "pick", "select"], setup(e15, { expose: t2, emit: a2 }) {
const n2 = e15;
const o2 = (e16, t3, a3) => {
const n3 = je().locale(a3).startOf("month").month(t3).year(e16);
const o3 = n3.daysInMonth();
return st(o3).map((e17) => n3.add(e17, "day").toDate());
};
const l2 = zi("month-table");
const { t: s2, lang: r2 } = Bi();
const i2 = ref();
const d2 = ref();
const f2 = ref(n2.date.locale("en").localeData().monthsShort().map((e16) => e16.toLowerCase()));
const v2 = ref([[], [], []]);
const p2 = ref();
const m2 = ref();
const h2 = computed(() => {
var e16, t3;
const a3 = v2.value;
const o3 = je().locale(r2.value).startOf("month");
for (let l3 = 0; l3 < 3; l3++) {
const s3 = a3[l3];
for (let a4 = 0; a4 < 4; a4++) {
const r3 = s3[a4] || (s3[a4] = { row: l3, column: a4, type: "normal", inRange: false, start: false, end: false, text: -1, disabled: false });
r3.type = "normal";
const i3 = l3 * 4 + a4;
const u2 = n2.date.startOf("year").month(i3);
const c2 = n2.rangeState.endDate || n2.maxDate || n2.rangeState.selecting && n2.minDate || null;
r3.inRange = !!(n2.minDate && u2.isSameOrAfter(n2.minDate, "month") && c2 && u2.isSameOrBefore(c2, "month")) || !!(n2.minDate && u2.isSameOrBefore(n2.minDate, "month") && c2 && u2.isSameOrAfter(c2, "month"));
if ((e16 = n2.minDate) == null ? void 0 : e16.isSameOrAfter(c2)) {
r3.start = !!(c2 && u2.isSame(c2, "month"));
r3.end = n2.minDate && u2.isSame(n2.minDate, "month");
} else {
r3.start = !!(n2.minDate && u2.isSame(n2.minDate, "month"));
r3.end = !!(c2 && u2.isSame(c2, "month"));
}
const d3 = o3.isSame(u2);
if (d3) {
r3.type = "today";
}
r3.text = i3;
r3.disabled = ((t3 = n2.disabledDate) == null ? void 0 : t3.call(n2, u2.toDate())) || false;
}
}
return a3;
});
const y2 = () => {
var e16;
(e16 = d2.value) == null ? void 0 : e16.focus();
};
const g2 = (e16) => {
const t3 = {};
const a3 = n2.date.year();
const l3 = /* @__PURE__ */ new Date();
const s3 = e16.text;
t3.disabled = n2.disabledDate ? o2(a3, s3, r2.value).every(n2.disabledDate) : false;
t3.current = Ge(n2.parsedValue).findIndex((e17) => je.isDayjs(e17) && e17.year() === a3 && e17.month() === s3) >= 0;
t3.today = l3.getFullYear() === a3 && l3.getMonth() === s3;
if (e16.inRange) {
t3["in-range"] = true;
if (e16.start) {
t3["start-date"] = true;
}
if (e16.end) {
t3["end-date"] = true;
}
}
return t3;
};
const b2 = (e16) => {
const t3 = n2.date.year();
const a3 = e16.text;
return Ge(n2.date).findIndex((e17) => e17.year() === t3 && e17.month() === a3) >= 0;
};
const w2 = (e16) => {
var t3;
if (!n2.rangeState.selecting) return;
let o3 = e16.target;
if (o3.tagName === "SPAN") {
o3 = (t3 = o3.parentNode) == null ? void 0 : t3.parentNode;
}
if (o3.tagName === "DIV") {
o3 = o3.parentNode;
}
if (o3.tagName !== "TD") return;
const l3 = o3.parentNode.rowIndex;
const s3 = o3.cellIndex;
if (h2.value[l3][s3].disabled) return;
if (l3 !== p2.value || s3 !== m2.value) {
p2.value = l3;
m2.value = s3;
a2("changerange", { selecting: true, endDate: n2.date.startOf("year").month(l3 * 4 + s3) });
}
};
const k2 = (e16) => {
var t3;
const o3 = (t3 = e16.target) == null ? void 0 : t3.closest("td");
if ((o3 == null ? void 0 : o3.tagName) !== "TD") return;
if (el(o3, "disabled")) return;
const l3 = o3.cellIndex;
const s3 = o3.parentNode.rowIndex;
const r3 = s3 * 4 + l3;
const i3 = n2.date.startOf("year").month(r3);
if (n2.selectionMode === "months") {
if (e16.type === "keydown") {
a2("pick", Ge(n2.parsedValue), false);
return;
}
const t4 = n2.date.startOf("month").month(r3);
const l4 = el(o3, "current") ? Ge(n2.parsedValue).filter((e17) => Number(e17) !== Number(t4)) : Ge(n2.parsedValue).concat([je(t4)]);
a2("pick", l4);
} else if (n2.selectionMode === "range") {
if (!n2.rangeState.selecting) {
a2("pick", { minDate: i3, maxDate: null });
a2("select", true);
} else {
if (n2.minDate && i3 >= n2.minDate) {
a2("pick", { minDate: n2.minDate, maxDate: i3 });
} else {
a2("pick", { minDate: i3, maxDate: n2.minDate });
}
a2("select", false);
}
} else {
a2("pick", r3);
}
};
watch(() => n2.date, async () => {
var e16, t3;
if ((e16 = i2.value) == null ? void 0 : e16.contains(document.activeElement)) {
await nextTick();
(t3 = d2.value) == null ? void 0 : t3.focus();
}
});
t2({ focus: y2 });
return (e16, t3) => (openBlock(), createElementBlock("table", { role: "grid", "aria-label": unref(s2)("el.datepicker.monthTablePrompt"), class: normalizeClass(unref(l2).b()), onClick: k2, onMousemove: w2 }, [createElementVNode("tbody", { ref_key: "tbodyRef", ref: i2 }, [(openBlock(true), createElementBlock(Fragment, null, renderList(unref(h2), (e17, t4) => (openBlock(), createElementBlock("tr", { key: t4 }, [(openBlock(true), createElementBlock(Fragment, null, renderList(e17, (e18, t5) => (openBlock(), createElementBlock("td", { key: t5, ref_for: true, ref: (t6) => b2(e18) && (d2.value = t6), class: normalizeClass(g2(e18)), "aria-selected": `${b2(e18)}`, "aria-label": unref(s2)(`el.datepicker.month${+e18.text + 1}`), tabindex: b2(e18) ? 0 : -1, onKeydown: [withKeys(withModifiers(k2, ["prevent", "stop"]), ["space"]), withKeys(withModifiers(k2, ["prevent", "stop"]), ["enter"])] }, [createVNode(unref(ma), { cell: { ...e18, renderText: unref(s2)("el.datepicker.months." + f2.value[e18.text]) } }, null, 8, ["cell"])], 42, ["aria-selected", "aria-label", "tabindex", "onKeydown"]))), 128))]))), 128))], 512)], 42, ["aria-label"]));
} });
var wa = $d(ba, [["__file", "basic-month-table.vue"]]);
const ka = ti({ ...ta, selectionMode: oa("year") });
const Da = defineComponent({ __name: "basic-year-table", props: ka, emits: ["changerange", "pick", "select"], setup(e15, { expose: t2, emit: a2 }) {
const n2 = e15;
const o2 = (e16, t3) => {
const a3 = je(String(e16)).locale(t3).startOf("year");
const n3 = a3.endOf("year");
const o3 = n3.dayOfYear();
return st(o3).map((e17) => a3.add(e17, "day").toDate());
};
const l2 = zi("year-table");
const { t: s2, lang: r2 } = Bi();
const i2 = ref();
const d2 = ref();
const f2 = computed(() => Math.floor(n2.date.year() / 10) * 10);
const v2 = ref([[], [], []]);
const p2 = ref();
const m2 = ref();
const h2 = computed(() => {
var e16;
const t3 = v2.value;
const a3 = je().locale(r2.value).startOf("year");
for (let o3 = 0; o3 < 3; o3++) {
const l3 = t3[o3];
for (let t4 = 0; t4 < 4; t4++) {
if (o3 * 4 + t4 >= 10) {
break;
}
let s3 = l3[t4];
if (!s3) {
s3 = { row: o3, column: t4, type: "normal", inRange: false, start: false, end: false, text: -1, disabled: false };
}
s3.type = "normal";
const r3 = o3 * 4 + t4 + f2.value;
const i3 = je().year(r3);
const u2 = n2.rangeState.endDate || n2.maxDate || n2.rangeState.selecting && n2.minDate || null;
s3.inRange = !!(n2.minDate && i3.isSameOrAfter(n2.minDate, "year") && u2 && i3.isSameOrBefore(u2, "year")) || !!(n2.minDate && i3.isSameOrBefore(n2.minDate, "year") && u2 && i3.isSameOrAfter(u2, "year"));
if ((e16 = n2.minDate) == null ? void 0 : e16.isSameOrAfter(u2)) {
s3.start = !!(u2 && i3.isSame(u2, "year"));
s3.end = !!(n2.minDate && i3.isSame(n2.minDate, "year"));
} else {
s3.start = !!(n2.minDate && i3.isSame(n2.minDate, "year"));
s3.end = !!(u2 && i3.isSame(u2, "year"));
}
const c2 = a3.isSame(i3);
if (c2) {
s3.type = "today";
}
s3.text = r3;
const d3 = i3.toDate();
s3.disabled = n2.disabledDate && n2.disabledDate(d3) || false;
l3[t4] = s3;
}
}
return t3;
});
const y2 = () => {
var e16;
(e16 = d2.value) == null ? void 0 : e16.focus();
};
const g2 = (e16) => {
const t3 = {};
const a3 = je().locale(r2.value);
const l3 = e16.text;
t3.disabled = n2.disabledDate ? o2(l3, r2.value).every(n2.disabledDate) : false;
t3.today = a3.year() === l3;
t3.current = Ge(n2.parsedValue).findIndex((e17) => e17.year() === l3) >= 0;
if (e16.inRange) {
t3["in-range"] = true;
if (e16.start) {
t3["start-date"] = true;
}
if (e16.end) {
t3["end-date"] = true;
}
}
return t3;
};
const b2 = (e16) => {
const t3 = e16.text;
return Ge(n2.date).findIndex((e17) => e17.year() === t3) >= 0;
};
const w2 = (e16) => {
var t3;
const o3 = (t3 = e16.target) == null ? void 0 : t3.closest("td");
if (!o3 || !o3.textContent || el(o3, "disabled")) return;
const l3 = o3.cellIndex;
const s3 = o3.parentNode.rowIndex;
const r3 = s3 * 4 + l3 + f2.value;
const i3 = je().year(r3);
if (n2.selectionMode === "range") {
if (!n2.rangeState.selecting) {
a2("pick", { minDate: i3, maxDate: null });
a2("select", true);
} else {
if (n2.minDate && i3 >= n2.minDate) {
a2("pick", { minDate: n2.minDate, maxDate: i3 });
} else {
a2("pick", { minDate: i3, maxDate: n2.minDate });
}
a2("select", false);
}
} else if (n2.selectionMode === "years") {
if (e16.type === "keydown") {
a2("pick", Ge(n2.parsedValue), false);
return;
}
const t4 = el(o3, "current") ? Ge(n2.parsedValue).filter((e17) => (e17 == null ? void 0 : e17.year()) !== r3) : Ge(n2.parsedValue).concat([i3]);
a2("pick", t4);
} else {
a2("pick", r3);
}
};
const k2 = (e16) => {
var t3;
if (!n2.rangeState.selecting) return;
const o3 = (t3 = e16.target) == null ? void 0 : t3.closest("td");
if (!o3) return;
const l3 = o3.parentNode.rowIndex;
const s3 = o3.cellIndex;
if (h2.value[l3][s3].disabled) return;
if (l3 !== p2.value || s3 !== m2.value) {
p2.value = l3;
m2.value = s3;
a2("changerange", { selecting: true, endDate: je().year(f2.value).add(l3 * 4 + s3, "year") });
}
};
watch(() => n2.date, async () => {
var e16, t3;
if ((e16 = i2.value) == null ? void 0 : e16.contains(document.activeElement)) {
await nextTick();
(t3 = d2.value) == null ? void 0 : t3.focus();
}
});
t2({ focus: y2 });
return (e16, t3) => (openBlock(), createElementBlock("table", { role: "grid", "aria-label": unref(s2)("el.datepicker.yearTablePrompt"), class: normalizeClass(unref(l2).b()), onClick: w2, onMousemove: k2 }, [createElementVNode("tbody", { ref_key: "tbodyRef", ref: i2 }, [(openBlock(true), createElementBlock(Fragment, null, renderList(unref(h2), (e17, t4) => (openBlock(), createElementBlock("tr", { key: t4 }, [(openBlock(true), createElementBlock(Fragment, null, renderList(e17, (e18, a3) => (openBlock(), createElementBlock("td", { key: `${t4}_${a3}`, ref_for: true, ref: (t5) => b2(e18) && (d2.value = t5), class: normalizeClass(["available", g2(e18)]), "aria-selected": b2(e18), "aria-label": String(e18.text), tabindex: b2(e18) ? 0 : -1, onKeydown: [withKeys(withModifiers(w2, ["prevent", "stop"]), ["space"]), withKeys(withModifiers(w2, ["prevent", "stop"]), ["enter"])] }, [createVNode(unref(ma), { cell: e18 }, null, 8, ["cell"])], 42, ["aria-selected", "aria-label", "tabindex", "onKeydown"]))), 128))]))), 128))], 512)], 42, ["aria-label"]));
} });
var xa = $d(Da, [["__file", "basic-year-table.vue"]]);
const Ca = defineComponent({ __name: "panel-date-pick", props: la, emits: ["pick", "set-picker-option", "panel-change"], setup(e15, { emit: t2 }) {
const n2 = e15;
const o2 = (e16, t3, a2) => true;
const l2 = zi("picker-panel");
const s2 = zi("date-picker");
const r2 = useAttrs();
const i2 = useSlots();
const { t: d2, lang: f2 } = Bi();
const v2 = inject("EP_PICKER_BASE");
const p2 = inject(Pp);
const { shortcuts: m2, disabledDate: h2, cellClassName: y2, defaultTime: g2 } = v2.props;
const b2 = toRef(v2.props, "defaultValue");
const D2 = ref();
const C2 = ref(je().locale(f2.value));
const S2 = ref(false);
let M2 = false;
const $2 = computed(() => je(g2).locale(f2.value));
const P2 = computed(() => C2.value.month());
const Y2 = computed(() => C2.value.year());
const _2 = ref([]);
const V2 = ref(null);
const O2 = ref(null);
const F2 = (e16) => _2.value.length > 0 ? o2(e16, _2.value, n2.format || "HH:mm:ss") : true;
const U2 = (e16) => {
if (g2 && !ge2.value && !S2.value && !M2) {
return $2.value.year(e16.year()).month(e16.month()).date(e16.date());
}
if (ne2.value) return e16.millisecond(0);
return e16.startOf("day");
};
const z2 = (e16, ...n3) => {
if (!e16) {
t2("pick", e16, ...n3);
} else if (mt$1(e16)) {
const a2 = e16.map(U2);
t2("pick", a2, ...n3);
} else {
t2("pick", U2(e16), ...n3);
}
V2.value = null;
O2.value = null;
S2.value = false;
M2 = false;
};
const W2 = async (e16, t3) => {
if (X2.value === "date") {
e16 = e16;
let a2 = n2.parsedValue ? n2.parsedValue.year(e16.year()).month(e16.month()).date(e16.date()) : e16;
if (!F2(a2)) {
a2 = _2.value[0][0].year(e16.year()).month(e16.month()).date(e16.date());
}
C2.value = a2;
z2(a2, ne2.value || t3);
if (n2.type === "datetime") {
await nextTick();
Xe2();
}
} else if (X2.value === "week") {
z2(e16.date);
} else if (X2.value === "dates") {
z2(e16, true);
}
};
const H2 = (e16) => {
const t3 = e16 ? "add" : "subtract";
C2.value = C2.value[t3](1, "month");
Qe2("month");
};
const j2 = (e16) => {
const t3 = C2.value;
const a2 = e16 ? "add" : "subtract";
C2.value = K2.value === "year" ? t3[a2](10, "year") : t3[a2](1, "year");
Qe2("year");
};
const K2 = ref("date");
const Z2 = computed(() => {
const e16 = d2("el.datepicker.year");
if (K2.value === "year") {
const t3 = Math.floor(Y2.value / 10) * 10;
if (e16) {
return `${t3} ${e16} - ${t3 + 9} ${e16}`;
}
return `${t3} - ${t3 + 9}`;
}
return `${Y2.value} ${e16}`;
});
const G2 = (e16) => {
const a2 = gt$1(e16.value) ? e16.value() : e16.value;
if (a2) {
M2 = true;
z2(je(a2).locale(f2.value));
return;
}
if (e16.onClick) {
e16.onClick({ attrs: r2, slots: i2, emit: t2 });
}
};
const X2 = computed(() => {
const { type: e16 } = n2;
if (["week", "month", "months", "year", "years", "dates"].includes(e16)) return e16;
return "date";
});
const q2 = computed(() => X2.value === "dates" || X2.value === "months" || X2.value === "years");
const J2 = computed(() => X2.value === "date" ? K2.value : X2.value);
const Q2 = computed(() => !!m2.length);
const ee2 = async (e16, t3) => {
if (X2.value === "month") {
C2.value = C2.value.startOf("month").month(e16);
z2(C2.value, false);
} else if (X2.value === "months") {
z2(e16, t3 != null ? t3 : true);
} else {
C2.value = C2.value.startOf("month").month(e16);
K2.value = "date";
if (["month", "year", "date", "week"].includes(X2.value)) {
z2(C2.value, true);
await nextTick();
Xe2();
}
}
Qe2("month");
};
const te2 = async (e16, t3) => {
if (X2.value === "year") {
C2.value = C2.value.startOf("year").year(e16);
z2(C2.value, false);
} else if (X2.value === "years") {
z2(e16, t3 != null ? t3 : true);
} else {
C2.value = C2.value.year(e16);
K2.value = "month";
if (["month", "year", "date", "week"].includes(X2.value)) {
z2(C2.value, true);
await nextTick();
Xe2();
}
}
Qe2("year");
};
const ae2 = async (e16) => {
K2.value = e16;
await nextTick();
Xe2();
};
const ne2 = computed(() => n2.type === "datetime" || n2.type === "datetimerange");
const oe2 = computed(() => {
const e16 = ne2.value || X2.value === "dates";
const t3 = X2.value === "years";
const a2 = X2.value === "months";
const n3 = K2.value === "date";
const o3 = K2.value === "year";
const l3 = K2.value === "month";
return e16 && n3 || t3 && o3 || a2 && l3;
});
const le2 = computed(() => {
if (!h2) return false;
if (!n2.parsedValue) return true;
if (mt$1(n2.parsedValue)) {
return h2(n2.parsedValue[0].toDate());
}
return h2(n2.parsedValue.toDate());
});
const se2 = () => {
if (q2.value) {
z2(n2.parsedValue);
} else {
let e16 = n2.parsedValue;
if (!e16) {
const t3 = je(g2).locale(f2.value);
const a2 = Ge2();
e16 = t3.year(a2.year()).month(a2.month()).date(a2.date());
}
C2.value = e16;
z2(e16);
}
};
const re2 = computed(() => {
if (!h2) return false;
return h2(je().locale(f2.value).toDate());
});
const ie2 = () => {
const e16 = je().locale(f2.value);
const t3 = e16.toDate();
S2.value = true;
if ((!h2 || !h2(t3)) && F2(t3)) {
C2.value = je().locale(f2.value);
z2(C2.value);
}
};
const ue2 = computed(() => n2.timeFormat || it(n2.format));
const ye2 = computed(() => n2.dateFormat || rt(n2.format));
const ge2 = computed(() => {
if (O2.value) return O2.value;
if (!n2.parsedValue && !b2.value) return;
return (n2.parsedValue || C2.value).format(ue2.value);
});
const ke2 = computed(() => {
if (V2.value) return V2.value;
if (!n2.parsedValue && !b2.value) return;
return (n2.parsedValue || C2.value).format(ye2.value);
});
const Ce2 = ref(false);
const Se2 = () => {
Ce2.value = true;
};
const Me2 = () => {
Ce2.value = false;
};
const Oe2 = (e16) => ({ hour: e16.hour(), minute: e16.minute(), second: e16.second(), year: e16.year(), month: e16.month(), date: e16.date() });
const Ie2 = (e16, t3, a2) => {
const { hour: o3, minute: l3, second: s3 } = Oe2(e16);
const r3 = n2.parsedValue ? n2.parsedValue.hour(o3).minute(l3).second(s3) : e16;
C2.value = r3;
z2(C2.value, true);
if (!a2) {
Ce2.value = t3;
}
};
const ze2 = (e16) => {
const t3 = je(e16, ue2.value).locale(f2.value);
if (t3.isValid() && F2(t3)) {
const { year: e17, month: a2, date: n3 } = Oe2(C2.value);
C2.value = t3.year(e17).month(a2).date(n3);
O2.value = null;
Ce2.value = false;
z2(C2.value, true);
}
};
const We2 = (e16) => {
const t3 = je(e16, ye2.value).locale(f2.value);
if (t3.isValid()) {
if (h2 && h2(t3.toDate())) {
return;
}
const { hour: e17, minute: a2, second: n3 } = Oe2(C2.value);
C2.value = t3.hour(e17).minute(a2).second(n3);
V2.value = null;
z2(C2.value, true);
}
};
const He2 = (e16) => je.isDayjs(e16) && e16.isValid() && (h2 ? !h2(e16.toDate()) : true);
const Ke2 = (e16) => mt$1(e16) ? e16.map((e17) => e17.format(n2.format)) : e16.format(n2.format);
const Ze2 = (e16) => je(e16, n2.format).locale(f2.value);
const Ge2 = () => {
const e16 = je(b2.value).locale(f2.value);
if (!b2.value) {
const e17 = $2.value;
return je().hour(e17.hour()).minute(e17.minute()).second(e17.second()).locale(f2.value);
}
return e16;
};
const Xe2 = async () => {
var e16;
if (["week", "month", "year", "date"].includes(X2.value)) {
(e16 = D2.value) == null ? void 0 : e16.focus();
if (X2.value === "week") {
Je2(di.down);
}
}
};
const qe2 = (e16) => {
const { code: t3 } = e16;
const a2 = [di.up, di.down, di.left, di.right, di.home, di.end, di.pageUp, di.pageDown];
if (a2.includes(t3)) {
Je2(t3);
e16.stopPropagation();
e16.preventDefault();
}
if ([di.enter, di.space, di.numpadEnter].includes(t3) && V2.value === null && O2.value === null) {
e16.preventDefault();
z2(C2.value, false);
}
};
const Je2 = (e16) => {
var a2;
const { up: n3, down: o3, left: l3, right: s3, home: r3, end: i3, pageUp: u2, pageDown: c2 } = di;
const d3 = { year: { [n3]: -4, [o3]: 4, [l3]: -1, [s3]: 1, offset: (e17, t3) => e17.setFullYear(e17.getFullYear() + t3) }, month: { [n3]: -4, [o3]: 4, [l3]: -1, [s3]: 1, offset: (e17, t3) => e17.setMonth(e17.getMonth() + t3) }, week: { [n3]: -1, [o3]: 1, [l3]: -1, [s3]: 1, offset: (e17, t3) => e17.setDate(e17.getDate() + t3 * 7) }, date: { [n3]: -7, [o3]: 7, [l3]: -1, [s3]: 1, [r3]: (e17) => -e17.getDay(), [i3]: (e17) => -e17.getDay() + 6, [u2]: (e17) => -new Date(e17.getFullYear(), e17.getMonth(), 0).getDate(), [c2]: (e17) => new Date(e17.getFullYear(), e17.getMonth() + 1, 0).getDate(), offset: (e17, t3) => e17.setDate(e17.getDate() + t3) } };
const v3 = C2.value.toDate();
while (Math.abs(C2.value.diff(v3, "year", true)) < 1) {
const n4 = d3[J2.value];
if (!n4) return;
n4.offset(v3, gt$1(n4[e16]) ? n4[e16](v3) : (a2 = n4[e16]) != null ? a2 : 0);
if (h2 && h2(v3)) {
break;
}
const o4 = je(v3).locale(f2.value);
C2.value = o4;
t2("pick", o4, true);
break;
}
};
const Qe2 = (e16) => {
t2("panel-change", C2.value.toDate(), e16, K2.value);
};
watch(() => X2.value, (e16) => {
if (["month", "year"].includes(e16)) {
K2.value = e16;
return;
} else if (e16 === "years") {
K2.value = "year";
return;
} else if (e16 === "months") {
K2.value = "month";
return;
}
K2.value = "date";
}, { immediate: true });
watch(() => K2.value, () => {
p2 == null ? void 0 : p2.updatePopper();
});
watch(() => b2.value, (e16) => {
if (e16) {
C2.value = Ge2();
}
}, { immediate: true });
watch(() => n2.parsedValue, (e16) => {
if (e16) {
if (q2.value) return;
if (Array.isArray(e16)) return;
C2.value = e16;
} else {
C2.value = Ge2();
}
}, { immediate: true });
t2("set-picker-option", ["isValidValue", He2]);
t2("set-picker-option", ["formatToString", Ke2]);
t2("set-picker-option", ["parseUserInput", Ze2]);
t2("set-picker-option", ["handleFocusPicker", Xe2]);
return (e16, t3) => (openBlock(), createElementBlock("div", { class: normalizeClass([unref(l2).b(), unref(s2).b(), { "has-sidebar": e16.$slots.sidebar || unref(Q2), "has-time": unref(ne2) }]) }, [createElementVNode("div", { class: normalizeClass(unref(l2).e("body-wrapper")) }, [renderSlot(e16.$slots, "sidebar", { class: normalizeClass(unref(l2).e("sidebar")) }), unref(Q2) ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(l2).e("sidebar")) }, [(openBlock(true), createElementBlock(Fragment, null, renderList(unref(m2), (e17, t4) => (openBlock(), createElementBlock("button", { key: t4, type: "button", class: normalizeClass(unref(l2).e("shortcut")), onClick: (t5) => G2(e17) }, toDisplayString(e17.text), 11, ["onClick"]))), 128))], 2)) : createCommentVNode("v-if", true), createElementVNode("div", { class: normalizeClass(unref(l2).e("body")) }, [unref(ne2) ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(s2).e("time-header")) }, [createElementVNode("span", { class: normalizeClass(unref(s2).e("editor-wrap")) }, [createVNode(unref(lf), { placeholder: unref(d2)("el.datepicker.selectDate"), "model-value": unref(ke2), size: "small", "validate-event": false, onInput: (e17) => V2.value = e17, onChange: We2 }, null, 8, ["placeholder", "model-value", "onInput"])], 2), withDirectives((openBlock(), createElementBlock("span", { class: normalizeClass(unref(s2).e("editor-wrap")) }, [createVNode(unref(lf), { placeholder: unref(d2)("el.datepicker.selectTime"), "model-value": unref(ge2), size: "small", "validate-event": false, onFocus: Se2, onInput: (e17) => O2.value = e17, onChange: ze2 }, null, 8, ["placeholder", "model-value", "onInput"]), createVNode(unref(_t), { visible: Ce2.value, format: unref(ue2), "parsed-value": C2.value, onPick: Ie2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[unref(lm), Me2]])], 2)) : createCommentVNode("v-if", true), withDirectives(createElementVNode("div", { class: normalizeClass([unref(s2).e("header"), (K2.value === "year" || K2.value === "month") && unref(s2).e("header--bordered")]) }, [createElementVNode("span", { class: normalizeClass(unref(s2).e("prev-btn")) }, [createElementVNode("button", { type: "button", "aria-label": unref(d2)(`el.datepicker.prevYear`), class: normalizeClass(["d-arrow-left", unref(l2).e("icon-btn")]), onClick: (e17) => j2(false) }, [renderSlot(e16.$slots, "prev-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Ll))]), _: 1 })])], 10, ["aria-label", "onClick"]), withDirectives(createElementVNode("button", { type: "button", "aria-label": unref(d2)(`el.datepicker.prevMonth`), class: normalizeClass([unref(l2).e("icon-btn"), "arrow-left"]), onClick: (e17) => H2(false) }, [renderSlot(e16.$slots, "prev-month", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(cl))]), _: 1 })])], 10, ["aria-label", "onClick"]), [[vShow, K2.value === "date"]])], 2), createElementVNode("span", { role: "button", class: normalizeClass(unref(s2).e("header-label")), "aria-live": "polite", tabindex: "0", onKeydown: withKeys((e17) => ae2("year"), ["enter"]), onClick: (e17) => ae2("year") }, toDisplayString(unref(Z2)), 43, ["onKeydown", "onClick"]), withDirectives(createElementVNode("span", { role: "button", "aria-live": "polite", tabindex: "0", class: normalizeClass([unref(s2).e("header-label"), { active: K2.value === "month" }]), onKeydown: withKeys((e17) => ae2("month"), ["enter"]), onClick: (e17) => ae2("month") }, toDisplayString(unref(d2)(`el.datepicker.month${unref(P2) + 1}`)), 43, ["onKeydown", "onClick"]), [[vShow, K2.value === "date"]]), createElementVNode("span", { class: normalizeClass(unref(s2).e("next-btn")) }, [withDirectives(createElementVNode("button", { type: "button", "aria-label": unref(d2)(`el.datepicker.nextMonth`), class: normalizeClass([unref(l2).e("icon-btn"), "arrow-right"]), onClick: (e17) => H2(true) }, [renderSlot(e16.$slots, "next-month", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(fl))]), _: 1 })])], 10, ["aria-label", "onClick"]), [[vShow, K2.value === "date"]]), createElementVNode("button", { type: "button", "aria-label": unref(d2)(`el.datepicker.nextYear`), class: normalizeClass([unref(l2).e("icon-btn"), "d-arrow-right"]), onClick: (e17) => j2(true) }, [renderSlot(e16.$slots, "next-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Bl))]), _: 1 })])], 10, ["aria-label", "onClick"])], 2)], 2), [[vShow, K2.value !== "time"]]), createElementVNode("div", { class: normalizeClass(unref(l2).e("content")), onKeydown: qe2 }, [K2.value === "date" ? (openBlock(), createBlock(ya, { key: 0, ref_key: "currentViewRef", ref: D2, "selection-mode": unref(X2), date: C2.value, "parsed-value": e16.parsedValue, "disabled-date": unref(h2), "cell-class-name": unref(y2), onPick: W2 }, null, 8, ["selection-mode", "date", "parsed-value", "disabled-date", "cell-class-name"])) : createCommentVNode("v-if", true), K2.value === "year" ? (openBlock(), createBlock(xa, { key: 1, ref_key: "currentViewRef", ref: D2, "selection-mode": unref(X2), date: C2.value, "disabled-date": unref(h2), "parsed-value": e16.parsedValue, onPick: te2 }, null, 8, ["selection-mode", "date", "disabled-date", "parsed-value"])) : createCommentVNode("v-if", true), K2.value === "month" ? (openBlock(), createBlock(wa, { key: 2, ref_key: "currentViewRef", ref: D2, "selection-mode": unref(X2), date: C2.value, "parsed-value": e16.parsedValue, "disabled-date": unref(h2), onPick: ee2 }, null, 8, ["selection-mode", "date", "parsed-value", "disabled-date"])) : createCommentVNode("v-if", true)], 34)], 2)], 2), withDirectives(createElementVNode("div", { class: normalizeClass(unref(l2).e("footer")) }, [withDirectives(createVNode(unref(rm), { text: "", size: "small", class: normalizeClass(unref(l2).e("link-btn")), disabled: unref(re2), onClick: ie2 }, { default: withCtx(() => [createTextVNode(toDisplayString(unref(d2)("el.datepicker.now")), 1)]), _: 1 }, 8, ["class", "disabled"]), [[vShow, !unref(q2)]]), createVNode(unref(rm), { plain: "", size: "small", class: normalizeClass(unref(l2).e("link-btn")), disabled: unref(le2), onClick: se2 }, { default: withCtx(() => [createTextVNode(toDisplayString(unref(d2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled"])], 2), [[vShow, unref(oe2)]])], 2));
} });
var Sa = $d(Ca, [["__file", "panel-date-pick.vue"]]);
const Ma = ti({ ...aa, ...na, visible: Boolean });
const $a = (e15) => {
const { emit: t2 } = getCurrentInstance();
const a2 = useAttrs();
const n2 = useSlots();
const o2 = (o3) => {
const l2 = gt$1(o3.value) ? o3.value() : o3.value;
if (l2) {
t2("pick", [je(l2[0]).locale(e15.value), je(l2[1]).locale(e15.value)]);
return;
}
if (o3.onClick) {
o3.onClick({ attrs: a2, slots: n2, emit: t2 });
}
};
return o2;
};
const Pa = (e15, { defaultValue: t2, leftDate: n2, rightDate: o2, unit: l2, onParsedValueChanged: s2 }) => {
const { emit: r2 } = getCurrentInstance();
const { pickerNs: i2 } = inject(Jt);
const d2 = zi("date-range-picker");
const { t: f2, lang: v2 } = Bi();
const p2 = $a(v2);
const m2 = ref();
const h2 = ref();
const y2 = ref({ endDate: null, selecting: false });
const g2 = (e16) => {
y2.value = e16;
};
const b2 = (e16 = false) => {
const t3 = unref(m2);
const a2 = unref(h2);
if (ia([t3, a2])) {
r2("pick", [t3, a2], e16);
}
};
const w2 = (e16) => {
y2.value.selecting = e16;
if (!e16) {
y2.value.endDate = null;
}
};
const k2 = (e16) => {
if (mt$1(e16) && e16.length === 2) {
const [t3, a2] = e16;
m2.value = t3;
n2.value = t3;
h2.value = a2;
s2(unref(m2), unref(h2));
} else {
D2();
}
};
const D2 = () => {
const [a2, s3] = ua(unref(t2), { lang: unref(v2), unit: l2, unlinkPanels: e15.unlinkPanels });
m2.value = void 0;
h2.value = void 0;
n2.value = a2;
o2.value = s3;
};
watch(t2, (e16) => {
if (e16) {
D2();
}
}, { immediate: true });
watch(() => e15.parsedValue, k2, { immediate: true });
return { minDate: m2, maxDate: h2, rangeState: y2, lang: v2, ppNs: i2, drpNs: d2, handleChangeRange: g2, handleRangeConfirm: b2, handleShortcutClick: p2, onSelect: w2, onReset: k2, t: f2 };
};
const Ya = "month";
const _a = defineComponent({ __name: "panel-date-range", props: Ma, emits: ["pick", "set-picker-option", "calendar-change", "panel-change"], setup(e15, { emit: t2 }) {
const n2 = e15;
const o2 = inject("EP_PICKER_BASE");
const { disabledDate: l2, cellClassName: s2, defaultTime: r2, clearable: i2 } = o2.props;
const c2 = toRef(o2.props, "format");
const d2 = toRef(o2.props, "shortcuts");
const f2 = toRef(o2.props, "defaultValue");
const { lang: v2 } = Bi();
const p2 = ref(je().locale(v2.value));
const m2 = ref(je().locale(v2.value).add(1, Ya));
const { minDate: h2, maxDate: y2, rangeState: g2, ppNs: b2, drpNs: D2, handleChangeRange: x2, handleRangeConfirm: C2, handleShortcutClick: S2, onSelect: M2, onReset: $2, t: P2 } = Pa(n2, { defaultValue: f2, leftDate: p2, rightDate: m2, unit: Ya, onParsedValueChanged: He2 });
watch(() => n2.visible, (e16) => {
if (!e16 && g2.value.selecting) {
$2(n2.parsedValue);
M2(false);
}
});
const Y2 = ref({ min: null, max: null });
const _2 = ref({ min: null, max: null });
const V2 = computed(() => `${p2.value.year()} ${P2("el.datepicker.year")} ${P2(`el.datepicker.month${p2.value.month() + 1}`)}`);
const O2 = computed(() => `${m2.value.year()} ${P2("el.datepicker.year")} ${P2(`el.datepicker.month${m2.value.month() + 1}`)}`);
const T2 = computed(() => p2.value.year());
const B2 = computed(() => p2.value.month());
const F2 = computed(() => m2.value.year());
const U2 = computed(() => m2.value.month());
const z2 = computed(() => !!d2.value.length);
const W2 = computed(() => {
if (Y2.value.min !== null) return Y2.value.min;
if (h2.value) return h2.value.format(G2.value);
return "";
});
const H2 = computed(() => {
if (Y2.value.max !== null) return Y2.value.max;
if (y2.value || h2.value) return (y2.value || h2.value).format(G2.value);
return "";
});
const j2 = computed(() => {
if (_2.value.min !== null) return _2.value.min;
if (h2.value) return h2.value.format(Z2.value);
return "";
});
const K2 = computed(() => {
if (_2.value.max !== null) return _2.value.max;
if (y2.value || h2.value) return (y2.value || h2.value).format(Z2.value);
return "";
});
const Z2 = computed(() => n2.timeFormat || it(c2.value));
const G2 = computed(() => n2.dateFormat || rt(c2.value));
const X2 = (e16) => ia(e16) && (l2 ? !l2(e16[0].toDate()) && !l2(e16[1].toDate()) : true);
const q2 = () => {
p2.value = p2.value.subtract(1, "year");
if (!n2.unlinkPanels) {
m2.value = p2.value.add(1, "month");
}
le2("year");
};
const J2 = () => {
p2.value = p2.value.subtract(1, "month");
if (!n2.unlinkPanels) {
m2.value = p2.value.add(1, "month");
}
le2("month");
};
const Q2 = () => {
if (!n2.unlinkPanels) {
p2.value = p2.value.add(1, "year");
m2.value = p2.value.add(1, "month");
} else {
m2.value = m2.value.add(1, "year");
}
le2("year");
};
const ee2 = () => {
if (!n2.unlinkPanels) {
p2.value = p2.value.add(1, "month");
m2.value = p2.value.add(1, "month");
} else {
m2.value = m2.value.add(1, "month");
}
le2("month");
};
const te2 = () => {
p2.value = p2.value.add(1, "year");
le2("year");
};
const ae2 = () => {
p2.value = p2.value.add(1, "month");
le2("month");
};
const ne2 = () => {
m2.value = m2.value.subtract(1, "year");
le2("year");
};
const oe2 = () => {
m2.value = m2.value.subtract(1, "month");
le2("month");
};
const le2 = (e16) => {
t2("panel-change", [p2.value.toDate(), m2.value.toDate()], e16);
};
const se2 = computed(() => {
const e16 = (B2.value + 1) % 12;
const t3 = B2.value + 1 >= 12 ? 1 : 0;
return n2.unlinkPanels && new Date(T2.value + t3, e16) < new Date(F2.value, U2.value);
});
const re2 = computed(() => n2.unlinkPanels && F2.value * 12 + U2.value - (T2.value * 12 + B2.value + 1) >= 12);
const ie2 = computed(() => !(h2.value && y2.value && !g2.value.selecting && ia([h2.value, y2.value])));
const ue2 = computed(() => n2.type === "datetime" || n2.type === "datetimerange");
const ce2 = (e16, t3) => {
if (!e16) return;
if (r2) {
const a2 = je(r2[t3] || r2).locale(v2.value);
return a2.year(e16.year()).month(e16.month()).date(e16.date());
}
return e16;
};
const me2 = (e16, a2 = true) => {
const n3 = e16.minDate;
const o3 = e16.maxDate;
const l3 = ce2(n3, 0);
const s3 = ce2(o3, 1);
if (y2.value === s3 && h2.value === l3) {
return;
}
t2("calendar-change", [n3.toDate(), o3 && o3.toDate()]);
y2.value = s3;
h2.value = l3;
if (!a2 || ue2.value) return;
C2();
};
const ye2 = ref(false);
const ge2 = ref(false);
const ke2 = () => {
ye2.value = false;
};
const Ce2 = () => {
ge2.value = false;
};
const Se2 = (e16, t3) => {
Y2.value[t3] = e16;
const a2 = je(e16, G2.value).locale(v2.value);
if (a2.isValid()) {
if (l2 && l2(a2.toDate())) {
return;
}
if (t3 === "min") {
p2.value = a2;
h2.value = (h2.value || p2.value).year(a2.year()).month(a2.month()).date(a2.date());
if (!n2.unlinkPanels && (!y2.value || y2.value.isBefore(h2.value))) {
m2.value = a2.add(1, "month");
y2.value = h2.value.add(1, "month");
}
} else {
m2.value = a2;
y2.value = (y2.value || m2.value).year(a2.year()).month(a2.month()).date(a2.date());
if (!n2.unlinkPanels && (!h2.value || h2.value.isAfter(y2.value))) {
p2.value = a2.subtract(1, "month");
h2.value = y2.value.subtract(1, "month");
}
}
}
};
const Me2 = (e16, t3) => {
Y2.value[t3] = null;
};
const Oe2 = (e16, t3) => {
_2.value[t3] = e16;
const a2 = je(e16, Z2.value).locale(v2.value);
if (a2.isValid()) {
if (t3 === "min") {
ye2.value = true;
h2.value = (h2.value || p2.value).hour(a2.hour()).minute(a2.minute()).second(a2.second());
} else {
ge2.value = true;
y2.value = (y2.value || m2.value).hour(a2.hour()).minute(a2.minute()).second(a2.second());
m2.value = y2.value;
}
}
};
const Ie2 = (e16, t3) => {
_2.value[t3] = null;
if (t3 === "min") {
p2.value = h2.value;
ye2.value = false;
if (!y2.value || y2.value.isBefore(h2.value)) {
y2.value = h2.value;
}
} else {
m2.value = y2.value;
ge2.value = false;
if (y2.value && y2.value.isBefore(h2.value)) {
h2.value = y2.value;
}
}
};
const Ne2 = (e16, t3, a2) => {
if (_2.value.min) return;
if (e16) {
p2.value = e16;
h2.value = (h2.value || p2.value).hour(e16.hour()).minute(e16.minute()).second(e16.second());
}
if (!a2) {
ye2.value = t3;
}
if (!y2.value || y2.value.isBefore(h2.value)) {
y2.value = h2.value;
m2.value = e16;
}
};
const Be2 = (e16, t3, a2) => {
if (_2.value.max) return;
if (e16) {
m2.value = e16;
y2.value = (y2.value || m2.value).hour(e16.hour()).minute(e16.minute()).second(e16.second());
}
if (!a2) {
ge2.value = t3;
}
if (y2.value && y2.value.isBefore(h2.value)) {
h2.value = y2.value;
}
};
const Ue2 = () => {
p2.value = ua(unref(f2), { lang: unref(v2), unit: "month", unlinkPanels: n2.unlinkPanels })[0];
m2.value = p2.value.add(1, "month");
y2.value = void 0;
h2.value = void 0;
t2("pick", null);
};
const ze2 = (e16) => mt$1(e16) ? e16.map((e17) => e17.format(c2.value)) : e16.format(c2.value);
const We2 = (e16) => mt$1(e16) ? e16.map((e17) => je(e17, c2.value).locale(v2.value)) : je(e16, c2.value).locale(v2.value);
function He2(e16, t3) {
if (n2.unlinkPanels && t3) {
const a2 = (e16 == null ? void 0 : e16.year()) || 0;
const n3 = (e16 == null ? void 0 : e16.month()) || 0;
const o3 = t3.year();
const l3 = t3.month();
m2.value = a2 === o3 && n3 === l3 ? t3.add(1, Ya) : t3;
} else {
m2.value = p2.value.add(1, Ya);
if (t3) {
m2.value = m2.value.hour(t3.hour()).minute(t3.minute()).second(t3.second());
}
}
}
t2("set-picker-option", ["isValidValue", X2]);
t2("set-picker-option", ["parseUserInput", We2]);
t2("set-picker-option", ["formatToString", ze2]);
t2("set-picker-option", ["handleClear", Ue2]);
return (e16, t3) => (openBlock(), createElementBlock("div", { class: normalizeClass([unref(b2).b(), unref(D2).b(), { "has-sidebar": e16.$slots.sidebar || unref(z2), "has-time": unref(ue2) }]) }, [createElementVNode("div", { class: normalizeClass(unref(b2).e("body-wrapper")) }, [renderSlot(e16.$slots, "sidebar", { class: normalizeClass(unref(b2).e("sidebar")) }), unref(z2) ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(b2).e("sidebar")) }, [(openBlock(true), createElementBlock(Fragment, null, renderList(unref(d2), (e17, t4) => (openBlock(), createElementBlock("button", { key: t4, type: "button", class: normalizeClass(unref(b2).e("shortcut")), onClick: (t5) => unref(S2)(e17) }, toDisplayString(e17.text), 11, ["onClick"]))), 128))], 2)) : createCommentVNode("v-if", true), createElementVNode("div", { class: normalizeClass(unref(b2).e("body")) }, [unref(ue2) ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(D2).e("time-header")) }, [createElementVNode("span", { class: normalizeClass(unref(D2).e("editors-wrap")) }, [createElementVNode("span", { class: normalizeClass(unref(D2).e("time-picker-wrap")) }, [createVNode(unref(lf), { size: "small", disabled: unref(g2).selecting, placeholder: unref(P2)("el.datepicker.startDate"), class: normalizeClass(unref(D2).e("editor")), "model-value": unref(W2), "validate-event": false, onInput: (e17) => Se2(e17, "min"), onChange: (e17) => Me2(e17, "min") }, null, 8, ["disabled", "placeholder", "class", "model-value", "onInput", "onChange"])], 2), withDirectives((openBlock(), createElementBlock("span", { class: normalizeClass(unref(D2).e("time-picker-wrap")) }, [createVNode(unref(lf), { size: "small", class: normalizeClass(unref(D2).e("editor")), disabled: unref(g2).selecting, placeholder: unref(P2)("el.datepicker.startTime"), "model-value": unref(j2), "validate-event": false, onFocus: (e17) => ye2.value = true, onInput: (e17) => Oe2(e17, "min"), onChange: (e17) => Ie2(e17, "min") }, null, 8, ["class", "disabled", "placeholder", "model-value", "onFocus", "onInput", "onChange"]), createVNode(unref(_t), { visible: ye2.value, format: unref(Z2), "datetime-role": "start", "parsed-value": p2.value, onPick: Ne2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[unref(lm), ke2]])], 2), createElementVNode("span", null, [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(fl))]), _: 1 })]), createElementVNode("span", { class: normalizeClass([unref(D2).e("editors-wrap"), "is-right"]) }, [createElementVNode("span", { class: normalizeClass(unref(D2).e("time-picker-wrap")) }, [createVNode(unref(lf), { size: "small", class: normalizeClass(unref(D2).e("editor")), disabled: unref(g2).selecting, placeholder: unref(P2)("el.datepicker.endDate"), "model-value": unref(H2), readonly: !unref(h2), "validate-event": false, onInput: (e17) => Se2(e17, "max"), onChange: (e17) => Me2(e17, "max") }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly", "onInput", "onChange"])], 2), withDirectives((openBlock(), createElementBlock("span", { class: normalizeClass(unref(D2).e("time-picker-wrap")) }, [createVNode(unref(lf), { size: "small", class: normalizeClass(unref(D2).e("editor")), disabled: unref(g2).selecting, placeholder: unref(P2)("el.datepicker.endTime"), "model-value": unref(K2), readonly: !unref(h2), "validate-event": false, onFocus: (e17) => unref(h2) && (ge2.value = true), onInput: (e17) => Oe2(e17, "max"), onChange: (e17) => Ie2(e17, "max") }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly", "onFocus", "onInput", "onChange"]), createVNode(unref(_t), { "datetime-role": "end", visible: ge2.value, format: unref(Z2), "parsed-value": m2.value, onPick: Be2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[unref(lm), Ce2]])], 2)], 2)) : createCommentVNode("v-if", true), createElementVNode("div", { class: normalizeClass([[unref(b2).e("content"), unref(D2).e("content")], "is-left"]) }, [createElementVNode("div", { class: normalizeClass(unref(D2).e("header")) }, [createElementVNode("button", { type: "button", class: normalizeClass([unref(b2).e("icon-btn"), "d-arrow-left"]), "aria-label": unref(P2)(`el.datepicker.prevYear`), onClick: q2 }, [renderSlot(e16.$slots, "prev-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Ll))]), _: 1 })])], 10, ["aria-label"]), createElementVNode("button", { type: "button", class: normalizeClass([unref(b2).e("icon-btn"), "arrow-left"]), "aria-label": unref(P2)(`el.datepicker.prevMonth`), onClick: J2 }, [renderSlot(e16.$slots, "prev-month", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(cl))]), _: 1 })])], 10, ["aria-label"]), e16.unlinkPanels ? (openBlock(), createElementBlock("button", { key: 0, type: "button", disabled: !unref(re2), class: normalizeClass([[unref(b2).e("icon-btn"), { "is-disabled": !unref(re2) }], "d-arrow-right"]), "aria-label": unref(P2)(`el.datepicker.nextYear`), onClick: te2 }, [renderSlot(e16.$slots, "next-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Bl))]), _: 1 })])], 10, ["disabled", "aria-label"])) : createCommentVNode("v-if", true), e16.unlinkPanels ? (openBlock(), createElementBlock("button", { key: 1, type: "button", disabled: !unref(se2), class: normalizeClass([[unref(b2).e("icon-btn"), { "is-disabled": !unref(se2) }], "arrow-right"]), "aria-label": unref(P2)(`el.datepicker.nextMonth`), onClick: ae2 }, [renderSlot(e16.$slots, "next-month", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(fl))]), _: 1 })])], 10, ["disabled", "aria-label"])) : createCommentVNode("v-if", true), createElementVNode("div", null, toDisplayString(unref(V2)), 1)], 2), createVNode(ya, { "selection-mode": "range", date: p2.value, "min-date": unref(h2), "max-date": unref(y2), "range-state": unref(g2), "disabled-date": unref(l2), "cell-class-name": unref(s2), onChangerange: unref(x2), onPick: me2, onSelect: unref(M2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2), createElementVNode("div", { class: normalizeClass([[unref(b2).e("content"), unref(D2).e("content")], "is-right"]) }, [createElementVNode("div", { class: normalizeClass(unref(D2).e("header")) }, [e16.unlinkPanels ? (openBlock(), createElementBlock("button", { key: 0, type: "button", disabled: !unref(re2), class: normalizeClass([[unref(b2).e("icon-btn"), { "is-disabled": !unref(re2) }], "d-arrow-left"]), "aria-label": unref(P2)(`el.datepicker.prevYear`), onClick: ne2 }, [renderSlot(e16.$slots, "prev-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Ll))]), _: 1 })])], 10, ["disabled", "aria-label"])) : createCommentVNode("v-if", true), e16.unlinkPanels ? (openBlock(), createElementBlock("button", { key: 1, type: "button", disabled: !unref(se2), class: normalizeClass([[unref(b2).e("icon-btn"), { "is-disabled": !unref(se2) }], "arrow-left"]), "aria-label": unref(P2)(`el.datepicker.prevMonth`), onClick: oe2 }, [renderSlot(e16.$slots, "prev-month", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(cl))]), _: 1 })])], 10, ["disabled", "aria-label"])) : createCommentVNode("v-if", true), createElementVNode("button", { type: "button", "aria-label": unref(P2)(`el.datepicker.nextYear`), class: normalizeClass([unref(b2).e("icon-btn"), "d-arrow-right"]), onClick: Q2 }, [renderSlot(e16.$slots, "next-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Bl))]), _: 1 })])], 10, ["aria-label"]), createElementVNode("button", { type: "button", class: normalizeClass([unref(b2).e("icon-btn"), "arrow-right"]), "aria-label": unref(P2)(`el.datepicker.nextMonth`), onClick: ee2 }, [renderSlot(e16.$slots, "next-month", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(fl))]), _: 1 })])], 10, ["aria-label"]), createElementVNode("div", null, toDisplayString(unref(O2)), 1)], 2), createVNode(ya, { "selection-mode": "range", date: m2.value, "min-date": unref(h2), "max-date": unref(y2), "range-state": unref(g2), "disabled-date": unref(l2), "cell-class-name": unref(s2), onChangerange: unref(x2), onPick: me2, onSelect: unref(M2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2)], 2)], 2), unref(ue2) ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(b2).e("footer")) }, [unref(i2) ? (openBlock(), createBlock(unref(rm), { key: 0, text: "", size: "small", class: normalizeClass(unref(b2).e("link-btn")), onClick: Ue2 }, { default: withCtx(() => [createTextVNode(toDisplayString(unref(P2)("el.datepicker.clear")), 1)]), _: 1 }, 8, ["class"])) : createCommentVNode("v-if", true), createVNode(unref(rm), { plain: "", size: "small", class: normalizeClass(unref(b2).e("link-btn")), disabled: unref(ie2), onClick: (e17) => unref(C2)(false) }, { default: withCtx(() => [createTextVNode(toDisplayString(unref(P2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled", "onClick"])], 2)) : createCommentVNode("v-if", true)], 2));
} });
var Va = $d(_a, [["__file", "panel-date-range.vue"]]);
const Oa = ti({ ...na });
const Ta = ["pick", "set-picker-option", "calendar-change"];
const Aa = ({ unlinkPanels: e15, leftDate: t2, rightDate: a2 }) => {
const { t: n2 } = Bi();
const o2 = () => {
t2.value = t2.value.subtract(1, "year");
if (!e15.value) {
a2.value = a2.value.subtract(1, "year");
}
};
const l2 = () => {
if (!e15.value) {
t2.value = t2.value.add(1, "year");
}
a2.value = a2.value.add(1, "year");
};
const s2 = () => {
t2.value = t2.value.add(1, "year");
};
const r2 = () => {
a2.value = a2.value.subtract(1, "year");
};
const i2 = computed(() => `${t2.value.year()} ${n2("el.datepicker.year")}`);
const c2 = computed(() => `${a2.value.year()} ${n2("el.datepicker.year")}`);
const d2 = computed(() => t2.value.year());
const f2 = computed(() => a2.value.year() === t2.value.year() ? t2.value.year() + 1 : a2.value.year());
return { leftPrevYear: o2, rightNextYear: l2, leftNextYear: s2, rightPrevYear: r2, leftLabel: i2, rightLabel: c2, leftYear: d2, rightYear: f2 };
};
const La = "year";
const Ea = defineComponent({ name: "DatePickerMonthRange" });
const Ra = defineComponent({ ...Ea, props: Oa, emits: Ta, setup(e15, { emit: t2 }) {
const n2 = e15;
const { lang: o2 } = Bi();
const l2 = inject("EP_PICKER_BASE");
const { shortcuts: s2, disabledDate: r2 } = l2.props;
const i2 = toRef(l2.props, "format");
const c2 = toRef(l2.props, "defaultValue");
const d2 = ref(je().locale(o2.value));
const f2 = ref(je().locale(o2.value).add(1, La));
const { minDate: v2, maxDate: p2, rangeState: m2, ppNs: h2, drpNs: y2, handleChangeRange: g2, handleRangeConfirm: b2, handleShortcutClick: w2, onSelect: D2 } = Pa(n2, { defaultValue: c2, leftDate: d2, rightDate: f2, unit: La, onParsedValueChanged: N2 });
const x2 = computed(() => !!s2.length);
const { leftPrevYear: C2, rightNextYear: S2, leftNextYear: M2, rightPrevYear: $2, leftLabel: P2, rightLabel: Y2, leftYear: _2, rightYear: V2 } = Aa({ unlinkPanels: toRef(n2, "unlinkPanels"), leftDate: d2, rightDate: f2 });
const O2 = computed(() => n2.unlinkPanels && V2.value > _2.value + 1);
const T2 = (e16, a2 = true) => {
const n3 = e16.minDate;
const o3 = e16.maxDate;
if (p2.value === o3 && v2.value === n3) {
return;
}
t2("calendar-change", [n3.toDate(), o3 && o3.toDate()]);
p2.value = o3;
v2.value = n3;
if (!a2) return;
b2();
};
const A2 = () => {
d2.value = ua(unref(c2), { lang: unref(o2), unit: "year", unlinkPanels: n2.unlinkPanels })[0];
f2.value = d2.value.add(1, "year");
t2("pick", null);
};
const E2 = (e16) => mt$1(e16) ? e16.map((e17) => e17.format(i2.value)) : e16.format(i2.value);
const R2 = (e16) => mt$1(e16) ? e16.map((e17) => je(e17, i2.value).locale(o2.value)) : je(e16, i2.value).locale(o2.value);
function N2(e16, t3) {
if (n2.unlinkPanels && t3) {
const a2 = (e16 == null ? void 0 : e16.year()) || 0;
const n3 = t3.year();
f2.value = a2 === n3 ? t3.add(1, La) : t3;
} else {
f2.value = d2.value.add(1, La);
}
}
t2("set-picker-option", ["isValidValue", ia]);
t2("set-picker-option", ["formatToString", E2]);
t2("set-picker-option", ["parseUserInput", R2]);
t2("set-picker-option", ["handleClear", A2]);
return (e16, t3) => (openBlock(), createElementBlock("div", { class: normalizeClass([unref(h2).b(), unref(y2).b(), { "has-sidebar": Boolean(e16.$slots.sidebar) || unref(x2) }]) }, [createElementVNode("div", { class: normalizeClass(unref(h2).e("body-wrapper")) }, [renderSlot(e16.$slots, "sidebar", { class: normalizeClass(unref(h2).e("sidebar")) }), unref(x2) ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(h2).e("sidebar")) }, [(openBlock(true), createElementBlock(Fragment, null, renderList(unref(s2), (e17, t4) => (openBlock(), createElementBlock("button", { key: t4, type: "button", class: normalizeClass(unref(h2).e("shortcut")), onClick: (t5) => unref(w2)(e17) }, toDisplayString(e17.text), 11, ["onClick"]))), 128))], 2)) : createCommentVNode("v-if", true), createElementVNode("div", { class: normalizeClass(unref(h2).e("body")) }, [createElementVNode("div", { class: normalizeClass([[unref(h2).e("content"), unref(y2).e("content")], "is-left"]) }, [createElementVNode("div", { class: normalizeClass(unref(y2).e("header")) }, [createElementVNode("button", { type: "button", class: normalizeClass([unref(h2).e("icon-btn"), "d-arrow-left"]), onClick: unref(C2) }, [renderSlot(e16.$slots, "prev-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Ll))]), _: 1 })])], 10, ["onClick"]), e16.unlinkPanels ? (openBlock(), createElementBlock("button", { key: 0, type: "button", disabled: !unref(O2), class: normalizeClass([[unref(h2).e("icon-btn"), { [unref(h2).is("disabled")]: !unref(O2) }], "d-arrow-right"]), onClick: unref(M2) }, [renderSlot(e16.$slots, "next-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Bl))]), _: 1 })])], 10, ["disabled", "onClick"])) : createCommentVNode("v-if", true), createElementVNode("div", null, toDisplayString(unref(P2)), 1)], 2), createVNode(wa, { "selection-mode": "range", date: d2.value, "min-date": unref(v2), "max-date": unref(p2), "range-state": unref(m2), "disabled-date": unref(r2), onChangerange: unref(g2), onPick: T2, onSelect: unref(D2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2), createElementVNode("div", { class: normalizeClass([[unref(h2).e("content"), unref(y2).e("content")], "is-right"]) }, [createElementVNode("div", { class: normalizeClass(unref(y2).e("header")) }, [e16.unlinkPanels ? (openBlock(), createElementBlock("button", { key: 0, type: "button", disabled: !unref(O2), class: normalizeClass([[unref(h2).e("icon-btn"), { "is-disabled": !unref(O2) }], "d-arrow-left"]), onClick: unref($2) }, [renderSlot(e16.$slots, "prev-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Ll))]), _: 1 })])], 10, ["disabled", "onClick"])) : createCommentVNode("v-if", true), createElementVNode("button", { type: "button", class: normalizeClass([unref(h2).e("icon-btn"), "d-arrow-right"]), onClick: unref(S2) }, [renderSlot(e16.$slots, "next-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Bl))]), _: 1 })])], 10, ["onClick"]), createElementVNode("div", null, toDisplayString(unref(Y2)), 1)], 2), createVNode(wa, { "selection-mode": "range", date: f2.value, "min-date": unref(v2), "max-date": unref(p2), "range-state": unref(m2), "disabled-date": unref(r2), onChangerange: unref(g2), onPick: T2, onSelect: unref(D2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2)], 2)], 2)], 2));
} });
var Ia = $d(Ra, [["__file", "panel-month-range.vue"]]);
const Na = ti({ ...na });
const Ba = ["pick", "set-picker-option", "calendar-change"];
const Fa = ({ unlinkPanels: e15, leftDate: t2, rightDate: a2 }) => {
const n2 = () => {
t2.value = t2.value.subtract(10, "year");
if (!e15.value) {
a2.value = a2.value.subtract(10, "year");
}
};
const o2 = () => {
if (!e15.value) {
t2.value = t2.value.add(10, "year");
}
a2.value = a2.value.add(10, "year");
};
const l2 = () => {
t2.value = t2.value.add(10, "year");
};
const s2 = () => {
a2.value = a2.value.subtract(10, "year");
};
const r2 = computed(() => {
const e16 = Math.floor(t2.value.year() / 10) * 10;
return `${e16}-${e16 + 9}`;
});
const i2 = computed(() => {
const e16 = Math.floor(a2.value.year() / 10) * 10;
return `${e16}-${e16 + 9}`;
});
const u2 = computed(() => {
const e16 = Math.floor(t2.value.year() / 10) * 10 + 9;
return e16;
});
const c2 = computed(() => {
const e16 = Math.floor(a2.value.year() / 10) * 10;
return e16;
});
return { leftPrevYear: n2, rightNextYear: o2, leftNextYear: l2, rightPrevYear: s2, leftLabel: r2, rightLabel: i2, leftYear: u2, rightYear: c2 };
};
const Ua = "year";
const za = defineComponent({ name: "DatePickerYearRange" });
const Wa = defineComponent({ ...za, props: Na, emits: Ba, setup(e15, { emit: t2 }) {
const n2 = e15;
const { lang: o2 } = Bi();
const l2 = ref(je().locale(o2.value));
const s2 = ref(l2.value.add(10, "year"));
const { pickerNs: r2 } = inject(Jt);
const i2 = zi("date-range-picker");
const d2 = computed(() => !!A2.length);
const f2 = computed(() => [r2.b(), i2.b(), { "has-sidebar": Boolean(useSlots().sidebar) || d2.value }]);
const v2 = computed(() => ({ content: [r2.e("content"), i2.e("content"), "is-left"], arrowLeftBtn: [r2.e("icon-btn"), "d-arrow-left"], arrowRightBtn: [r2.e("icon-btn"), { [r2.is("disabled")]: !S2.value }, "d-arrow-right"] }));
const p2 = computed(() => ({ content: [r2.e("content"), i2.e("content"), "is-right"], arrowLeftBtn: [r2.e("icon-btn"), { "is-disabled": !S2.value }, "d-arrow-left"], arrowRightBtn: [r2.e("icon-btn"), "d-arrow-right"] }));
const m2 = $a(o2);
const { leftPrevYear: h2, rightNextYear: y2, leftNextYear: g2, rightPrevYear: b2, leftLabel: w2, rightLabel: D2, leftYear: x2, rightYear: C2 } = Fa({ unlinkPanels: toRef(n2, "unlinkPanels"), leftDate: l2, rightDate: s2 });
const S2 = computed(() => n2.unlinkPanels && C2.value > x2.value + 1);
const M2 = ref();
const $2 = ref();
const P2 = ref({ endDate: null, selecting: false });
const Y2 = (e16) => {
P2.value = e16;
};
const _2 = (e16, a2 = true) => {
const n3 = e16.minDate;
const o3 = e16.maxDate;
if ($2.value === o3 && M2.value === n3) {
return;
}
t2("calendar-change", [n3.toDate(), o3 && o3.toDate()]);
$2.value = o3;
M2.value = n3;
if (!a2) return;
V2();
};
const V2 = (e16 = false) => {
if (ia([M2.value, $2.value])) {
t2("pick", [M2.value, $2.value], e16);
}
};
const O2 = (e16) => {
P2.value.selecting = e16;
if (!e16) {
P2.value.endDate = null;
}
};
const T2 = inject("EP_PICKER_BASE");
const { shortcuts: A2, disabledDate: E2 } = T2.props;
const R2 = toRef(T2.props, "format");
const N2 = toRef(T2.props, "defaultValue");
const B2 = () => {
let e16;
if (mt$1(N2.value)) {
const e17 = je(N2.value[0]);
let t3 = je(N2.value[1]);
if (!n2.unlinkPanels) {
t3 = e17.add(10, Ua);
}
return [e17, t3];
} else if (N2.value) {
e16 = je(N2.value);
} else {
e16 = je();
}
e16 = e16.locale(o2.value);
return [e16, e16.add(10, Ua)];
};
watch(() => N2.value, (e16) => {
if (e16) {
const e17 = B2();
l2.value = e17[0];
s2.value = e17[1];
}
}, { immediate: true });
watch(() => n2.parsedValue, (e16) => {
if (e16 && e16.length === 2) {
M2.value = e16[0];
$2.value = e16[1];
l2.value = M2.value;
if (n2.unlinkPanels && $2.value) {
const e17 = M2.value.year();
const t3 = $2.value.year();
s2.value = e17 === t3 ? $2.value.add(10, "year") : $2.value;
} else {
s2.value = l2.value.add(10, "year");
}
} else {
const e17 = B2();
M2.value = void 0;
$2.value = void 0;
l2.value = e17[0];
s2.value = e17[1];
}
}, { immediate: true });
const F2 = (e16) => mt$1(e16) ? e16.map((e17) => je(e17, R2.value).locale(o2.value)) : je(e16, R2.value).locale(o2.value);
const U2 = (e16) => mt$1(e16) ? e16.map((e17) => e17.format(R2.value)) : e16.format(R2.value);
const z2 = (e16) => ia(e16) && (E2 ? !E2(e16[0].toDate()) && !E2(e16[1].toDate()) : true);
const W2 = () => {
const e16 = B2();
l2.value = e16[0];
s2.value = e16[1];
$2.value = void 0;
M2.value = void 0;
t2("pick", null);
};
t2("set-picker-option", ["isValidValue", z2]);
t2("set-picker-option", ["parseUserInput", F2]);
t2("set-picker-option", ["formatToString", U2]);
t2("set-picker-option", ["handleClear", W2]);
return (e16, t3) => (openBlock(), createElementBlock("div", { class: normalizeClass(unref(f2)) }, [createElementVNode("div", { class: normalizeClass(unref(r2).e("body-wrapper")) }, [renderSlot(e16.$slots, "sidebar", { class: normalizeClass(unref(r2).e("sidebar")) }), unref(d2) ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(r2).e("sidebar")) }, [(openBlock(true), createElementBlock(Fragment, null, renderList(unref(A2), (e17, t4) => (openBlock(), createElementBlock("button", { key: t4, type: "button", class: normalizeClass(unref(r2).e("shortcut")), onClick: (t5) => unref(m2)(e17) }, toDisplayString(e17.text), 11, ["onClick"]))), 128))], 2)) : createCommentVNode("v-if", true), createElementVNode("div", { class: normalizeClass(unref(r2).e("body")) }, [createElementVNode("div", { class: normalizeClass(unref(v2).content) }, [createElementVNode("div", { class: normalizeClass(unref(i2).e("header")) }, [createElementVNode("button", { type: "button", class: normalizeClass(unref(v2).arrowLeftBtn), onClick: unref(h2) }, [renderSlot(e16.$slots, "prev-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Ll))]), _: 1 })])], 10, ["onClick"]), e16.unlinkPanels ? (openBlock(), createElementBlock("button", { key: 0, type: "button", disabled: !unref(S2), class: normalizeClass(unref(v2).arrowRightBtn), onClick: unref(g2) }, [renderSlot(e16.$slots, "next-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Bl))]), _: 1 })])], 10, ["disabled", "onClick"])) : createCommentVNode("v-if", true), createElementVNode("div", null, toDisplayString(unref(w2)), 1)], 2), createVNode(xa, { "selection-mode": "range", date: l2.value, "min-date": M2.value, "max-date": $2.value, "range-state": P2.value, "disabled-date": unref(E2), onChangerange: Y2, onPick: _2, onSelect: O2 }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date"])], 2), createElementVNode("div", { class: normalizeClass(unref(p2).content) }, [createElementVNode("div", { class: normalizeClass(unref(i2).e("header")) }, [e16.unlinkPanels ? (openBlock(), createElementBlock("button", { key: 0, type: "button", disabled: !unref(S2), class: normalizeClass(unref(p2).arrowLeftBtn), onClick: unref(b2) }, [renderSlot(e16.$slots, "prev-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Ll))]), _: 1 })])], 10, ["disabled", "onClick"])) : createCommentVNode("v-if", true), createElementVNode("button", { type: "button", class: normalizeClass(unref(p2).arrowRightBtn), onClick: unref(y2) }, [renderSlot(e16.$slots, "next-year", {}, () => [createVNode(unref(Ud), null, { default: withCtx(() => [createVNode(unref(Bl))]), _: 1 })])], 10, ["onClick"]), createElementVNode("div", null, toDisplayString(unref(D2)), 1)], 2), createVNode(xa, { "selection-mode": "range", date: s2.value, "min-date": M2.value, "max-date": $2.value, "range-state": P2.value, "disabled-date": unref(E2), onChangerange: Y2, onPick: _2, onSelect: O2 }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date"])], 2)], 2)], 2)], 2));
} });
var Ha = $d(Wa, [["__file", "panel-year-range.vue"]]);
const ja = function(e15) {
switch (e15) {
case "daterange":
case "datetimerange": {
return Va;
}
case "monthrange": {
return Ia;
}
case "yearrange": {
return Ha;
}
default: {
return Sa;
}
}
};
je.extend(Tt);
je.extend(Et);
je.extend(et);
je.extend(Nt);
je.extend(Ut);
je.extend(Ht);
je.extend(Zt);
je.extend(qt);
var Ka = defineComponent({ name: "ElDatePicker", install: null, props: Qt, emits: ["update:modelValue"], setup(e15, { expose: t2, emit: a2, slots: n2 }) {
const o2 = zi("picker-panel");
provide("ElPopperOptions", reactive(toRef(e15, "popperOptions")));
provide(Jt, { slots: n2, pickerNs: o2 });
const l2 = ref();
const s2 = { focus: (e16 = true) => {
var t3;
(t3 = l2.value) == null ? void 0 : t3.focus(e16);
}, handleOpen: () => {
var e16;
(e16 = l2.value) == null ? void 0 : e16.handleOpen();
}, handleClose: () => {
var e16;
(e16 = l2.value) == null ? void 0 : e16.handleClose();
} };
t2(s2);
const r2 = (e16) => {
a2("update:modelValue", e16);
};
return () => {
var t3;
const a3 = (t3 = e15.format) != null ? t3 : ot[e15.type] || nt;
const o3 = ja(e15.type);
return createVNode(bt, mergeProps(e15, { format: a3, type: e15.type, ref: l2, "onUpdate:modelValue": r2 }), { default: (e16) => createVNode(o3, e16, { "prev-month": n2["prev-month"], "next-month": n2["next-month"], "prev-year": n2["prev-year"], "next-year": n2["next-year"] }), "range-separator": n2["range-separator"] });
};
} });
const Za = li(Ka);
class Ga {
}
class Xa extends Ga {
}
const qa = new class e2 extends Xa {
constructor() {
super(...arguments);
__publicField(this, "name", "背包-送礼时额外添加一项所有数量");
__publicField(this, "matchModuleList", ["GiftHallBanner"]);
__publicField(this, "pattern", /BatchProp\.prototype\.componentWillReceiveProps/);
}
newModuleStr(e15) {
const t2 = e15.match(/BatchProp\.prototype\.componentWillReceiveProps=function componentWillReceiveProps.+?{(.+?)},BatchProp\.prototype/);
if (!t2) {
throw new Error("未提取到componentWillReceiveProps方法");
}
const a2 = t2[1];
return e15.replace(a2, `${a2};var propData=this.state.propData;!propData.batchInfo[""+propData.count]&&(propData.batchInfo[""+propData.count]={batchNum:propData.count,name:"暂不计算亲密度"})`);
}
}();
const Ja = new class e3 extends Xa {
constructor() {
super(...arguments);
__publicField(this, "name", "用户面板-弹幕历史按钮");
__publicField(this, "matchModuleList", ["ChatUserCard"]);
__publicField(this, "pattern", /ChatUserCard\.prototype\.getControls/);
}
newModuleStr(e15) {
const t2 = e15.match(/ChatUserCard\.prototype\.getControls=function getControls.+?{(.+?)},ChatUserCard\.prototype/);
if (!t2) {
throw new Error("未提取到getControls方法");
}
const a2 = t2[1];
const n2 = "DOUYUCRX";
return e15.replace(a2, `var resultFn=function(){${a2}};var result=resultFn.call(this);var self=this;result.push({text:"弹幕历史",type:"button",onClick:function onClick(){window['${n2}'].handleDanmuHistory(self.props.chatUserCardData);}});return result;`);
}
}();
const Qa = "DOUYUCRX";
const en = new class e4 extends Xa {
constructor() {
super(...arguments);
__publicField(this, "name", "自动参与抽奖");
__publicField(this, "matchModuleList", ["LotteryContainer"]);
__publicField(this, "pattern", /ULotteryStart\.prototype\.render/);
}
newModuleStr(e15) {
const t2 = e15.match(/ULotteryStart\.prototype\.componentDidMount=function componentDidMount.+?{(.+?)},ULotteryStart\.prototype/);
if (!t2) {
throw new Error("未提取到componentDidMount方法");
}
const a2 = e15.match(/ULotteryStart\.prototype\.componentWillUnmount=function componentWillUnmount.+?{(.+?)},ULotteryStart\.prototype/);
if (!a2) {
throw new Error("未提取到componentWillUnmount方法");
}
const n2 = t2[1];
const o2 = a2[1];
cg();
return e15.replace(n2, `${n2};window['${Qa}'].uLotteryStartChange(this);`).replace(o2, `${o2};window['${Qa}'].uLotteryStartChange(undefined);`);
}
}();
const tn = "DOUYUCRX";
const an = new class e5 extends Xa {
constructor() {
super(...arguments);
__publicField(this, "name", "抽取抽奖结果");
__publicField(this, "matchModuleList", ["LotteryContainer"]);
__publicField(this, "pattern", /ULotteryEnd\.prototype\.render/);
}
newModuleStr(e15) {
const t2 = e15.match(/ULotteryEnd\.prototype\.componentDidMount=function componentDidMount.+?{(.+?)},ULotteryEnd\.prototype/);
if (!t2) {
throw new Error("未提取到componentDidMount方法");
}
const a2 = e15.match(/ULotteryEnd\.prototype\.componentWillUnmount=function componentWillUnmount.+?{(.+?)},ULotteryEnd\.prototype/);
if (!a2) {
throw new Error("未提取到componentWillUnmount方法");
}
const n2 = t2[1];
const o2 = a2[1];
cg();
return e15.replace(n2, `${n2};window['${tn}'].uLotteryEndChange(this);`).replace(o2, `${o2};window['${tn}'].uLotteryEndChange(undefined);`);
}
}();
const nn = "DOUYUCRX";
const on = new class e6 extends Xa {
constructor() {
super(...arguments);
__publicField(this, "name", "抽取抽奖面板关闭方法");
__publicField(this, "matchModuleList", ["LotteryContainer"]);
__publicField(this, "pattern", /LotteryContainer-close/);
}
newModuleStr(e15) {
const t2 = e15.match(/LotteryContainer\.prototype\.componentDidMount=function componentDidMount.+?{(.+?)},LotteryContainer\.prototype/);
if (!t2) {
throw new Error("未提取到componentDidMount方法");
}
const a2 = e15.match(/LotteryContainer\.prototype\.componentWillUnmount=function componentWillUnmount.+?{(.+?)},LotteryContainer\.prototype/);
if (!a2) {
throw new Error("未提取到componentWillUnmount方法");
}
const n2 = t2[1];
const o2 = a2[1];
cg();
return e15.replace(n2, `${n2};window['${nn}'].lotteryContainerChange(this);`).replace(o2, `${o2};window['${nn}'].lotteryContainerChange(undefined);`);
}
}();
class ln {
constructor() {
__publicField(this, "isDefine", false);
__publicField(this, "target");
}
intercept() {
const e15 = this;
Object.defineProperty(s, this.targetName, { get() {
return e15.target;
}, set(t2) {
e15.interceptPush(t2);
}, configurable: true });
}
interceptPush(e15) {
var _a3;
this.target = e15;
const t2 = this;
if (((_a3 = this.target) == null ? void 0 : _a3.push) !== Array.prototype.push && !this.isDefine) {
const e16 = this.target.push;
this.target.push = function(...a2) {
const { modifierList: n2 } = t2;
if (n2.length > 0) {
for (const e17 of a2) {
if (n2.length === 0) {
break;
}
t2.modifyModule(e17);
}
}
return e16.apply(this, a2);
};
this.isDefine = true;
}
}
modifyModule(e15) {
if (e15.length < 2) {
return;
}
const [t2, a2] = e15;
const { modifierList: n2 } = this;
for (let t3 = n2.length - 1; t3 >= 0; t3--) {
const o2 = n2[t3];
if (!this.isMatch(o2, e15)) {
continue;
}
const l2 = Object.keys(a2);
const { pattern: s2 } = o2;
for (const e16 of l2) {
const l3 = a2[e16].toString();
if (!s2.test(l3)) {
continue;
}
try {
a2[e16] = new Function(`return ${o2.newModuleStr(l3)}`)();
} catch (e17) {
const t4 = e17;
Yh.error(`执行修改[${o2.name}]失败!(${t4.message})`);
}
n2.splice(t3, 1);
break;
}
}
}
isMatch(e15, t2) {
return true;
}
}
class sn extends ln {
constructor() {
super(...arguments);
__publicField(this, "modifierList", [qa, Ja, en, an, on]);
__publicField(this, "targetName", "shark_room_jsonp");
}
isMatch(e15, t2) {
const { matchModuleList: a2 } = e15;
if (!a2 || a2.length === 0) {
return true;
}
const [n2] = t2;
const o2 = [...a2];
const l2 = [...n2];
for (let e16 = o2.length - 1; e16 >= 0; e16--) {
let t3 = false;
for (let a3 = l2.length - 1; a3 >= 0; a3--) {
if (l2[a3].startsWith(o2[e16])) {
l2.splice(a3, 1);
o2.splice(e16, 1);
t3 = true;
break;
}
}
if (!t3) {
return false;
}
}
return o2.length === 0;
}
}
new sn().intercept();
const rn = new class e7 extends Ga {
constructor() {
super(...arguments);
__publicField(this, "name", "自动抢宝箱");
__publicField(this, "pattern", /prototype\.countDownView/);
}
newModuleStr(e15) {
const t2 = e15.match(/\.prototype\.countDownView=function.+?{(.+?)},[a-zA-Z]\.prototype/);
if (!t2) {
throw new Error("未提取到countDownView方法");
}
const a2 = t2[1];
const n2 = a2.match(/var (.+?)=this,.+?({statusText:"领取",.+?}\),.+?)\)/);
if (!n2) {
throw new Error("未提取到countDownView方法的目标代码");
}
const o2 = n2[1];
const l2 = n2[2];
const s2 = "DOUYUCRX";
sg();
return e15.replace(a2, a2.replace(l2, `${l2},window['${s2}'].redPacketEnabled&&${o2}.treasureService.drawTreasure(${o2}.props.treasureData.data[0],"init")`));
}
}();
const un = "DOUYUCRX";
const cn = new class e8 extends Ga {
constructor() {
super(...arguments);
__publicField(this, "name", "自动抢鱼翅红包");
__publicField(this, "pattern", /prototype\.reqJoin/);
}
newModuleStr(e15) {
const t2 = e15.match(/\.prototype\.updateBoxInfo=function\(([a-zA-Z])\){(.+?)},[a-zA-Z]\.prototype/);
if (!t2) {
throw new Error("未提取到updateBoxInfo方法");
}
const a2 = t2[1];
const n2 = t2[2];
ig();
return e15.replace(n2, `${n2};window['${un}'].joinGiftTreasure(this,${a2});`);
}
}();
const dn = new class e9 extends Ga {
constructor() {
super(...arguments);
__publicField(this, "name", "关键词屏蔽解除20个限制");
__publicField(this, "pattern", /[a-zA-Z]\.addKeywords=function/);
}
newModuleStr(e15) {
const t2 = e15.match(/([a-zA-Z])\.addKeywords=function.+?{(.+?)},\1\./);
if (!t2) {
throw new Error("未提取到addKeywords方法");
}
const a2 = t2[2];
const n2 = a2.match(/\)(if\("room"==.+?20.+?20.+?else)\s/);
if (!n2) {
throw new Error("未提取到addKeywords方法的目标代码");
}
const o2 = n2[1];
return e15.replace(a2, a2.replace(o2, ""));
}
}();
class fn extends ln {
constructor() {
super(...arguments);
__publicField(this, "modifierList", [rn, cn, dn]);
__publicField(this, "targetName", "shark-microlive-player-aside-jsonp");
}
}
new fn().intercept();
const vn = new class e10 extends Ga {
constructor() {
super(...arguments);
__publicField(this, "name", "飘屏弹幕-加一和回复");
__publicField(this, "pattern", /prototype\.addDzJyButton=.+isOpenFireFBComment/);
}
newModuleStr(e15) {
const t2 = e15.match(/([a-z])\.prototype\.addDzJyButton=.+?{(.+?)},\1\.prototype/);
if (!t2) {
throw new Error("未提取到addDzJyButton方法");
}
const a2 = t2[2];
const n2 = a2.match(/if\(([a-zA-Z])&&\1\.isOpenFireFBComment\)/);
if (!n2) {
throw new Error("未检测到addDzJyButton方法的目标代码");
}
const o2 = a2.match(/(if\([a-zA-Z]&&!this\.isFireOpenRank\([a-zA-Z]\)\))(if\(.*?\)){/);
if (!o2) {
throw new Error("未检测到addDzJyButton方法的目标代码");
}
return e15.replace(a2, a2.replace(n2[0], "if(!0)").replace(o2[1], "if(!0)").replace(o2[2], "if(!0)"));
}
}();
const pn = new class e11 extends Ga {
constructor() {
super(...arguments);
__publicField(this, "name", "飘屏弹幕-弹幕历史按钮");
__publicField(this, "pattern", /复制.+举报.+屏蔽.+添加关键词屏蔽/);
}
newModuleStr(e15) {
const t2 = e15.match(/([a-z])\.prototype\.clickDanmudiv=.+?{(.+?)},\1\.prototype/);
if (!t2) {
throw new Error("未提取到clickDanmudiv方法");
}
const a2 = t2[2];
const n2 = a2.match(/[a-z]\.target==this\.CloseButton\?this\.CloseButtonHandle\(\):/);
if (!n2) {
throw new Error("未检测到clickDanmudiv方法的目标代码");
}
const o2 = e15.match(/[a-z]\.prototype\.render=(.{20,50}showReport.+?复制.+?举报.+?屏蔽.+?添加关键词屏蔽.+?),(?=[a-z]\.prototype)/);
if (!o2) {
throw new Error("未提取到render方法");
}
const l2 = o2[1];
const s2 = l2.match(/[a-zA-z]\.[a-zA-z]\.createElement\("div",{className:([a-zA-Z]\.[a-zA-Z]\.ReportButton).+?(ReportButtonHandle).+?(ReportButton).+?(举报).+?\)/);
if (!s2) {
throw new Error("未提取到render方法的目标代码");
}
const r2 = s2[0].replace(s2[1], '"danmu-btn-modifier"').replace(s2[2], "HistoryButtonHandle").replace(s2[3], "HistoryButton").replace(s2[4], "弹幕历史");
const i2 = l2.match(/\?[a-zA-z]\.[a-zA-z]\.createElement\("div",(.+?)\):null/);
if (!i2) {
throw new Error("未提取到render方法的目标代码");
}
const u2 = i2[1];
const c2 = "DOUYUCRX";
return e15.replace(`${l2}`, `${l2.replace(u2, `${u2},${r2}`)},e.prototype.HistoryButtonHandle=function(){var danmuObj=this.props.danmuobject.toJS();window['${c2}'].handleDanmuHistory({rel:parseInt(danmuObj.uid),nickName:danmuObj.author,avatar:''});}`).replace(a2, `${n2[0].replaceAll("Close", "History")}${a2}`);
}
}();
const mn = "DOUYUCRX";
const hn = new class e12 extends Ga {
constructor() {
super(...arguments);
__publicField(this, "name", "去除挂机检测");
__publicField(this, "pattern", /\.prototype\.syncTimeHandler/);
}
newModuleStr(e15) {
const t2 = e15.match(/([a-z])\.prototype\.syncTimeHandler=.+?{(.+?userNoHandle.+?)},\1\.prototype/);
if (!t2) {
throw new Error("未提取到syncTimeHandler方法");
}
const a2 = t2[2];
return e15.replace(a2, `if(window['${mn}'].preventAfkEnabled){return;}${a2}`);
}
}();
const yn = "DOUYUCRX";
const gn = new class e13 extends Ga {
constructor() {
super(...arguments);
__publicField(this, "name", "网页全屏方法抽取");
__publicField(this, "pattern", /\.prototype\.clickPageful=/);
}
newModuleStr(e15) {
const t2 = e15.match(/([a-z])\.prototype\.componentDidMount=.+?{(.+?layout-Player-videoMain.+?)},\1\.prototype/);
if (!t2) {
throw new Error("未提取到componentDidMount方法");
}
const a2 = t2[2];
fg();
return e15.replace(a2, `${a2};window['${yn}'].videoLayoutChange(this);`);
}
}();
class bn extends ln {
constructor() {
super(...arguments);
__publicField(this, "modifierList", [vn, pn, hn, gn]);
__publicField(this, "targetName", "sharkLivePlayerJsonp");
}
}
new bn().intercept();
const wn = new class e14 extends Ga {
constructor() {
super(...arguments);
__publicField(this, "name", "飘屏弹幕-屏蔽TA-解除最多20个限制");
__publicField(this, "pattern", /PlayerServices\.prototype\.setFilterWords/);
}
newModuleStr(e15) {
const t2 = e15.match(/PlayerServices\.prototype\.setFilterWords=function setFilterWords.+?{(.+?)},PlayerServices\.prototype/);
if (!t2) {
throw new Error("未提取到setFilterWords方法");
}
const a2 = t2[1];
const n2 = a2.match(/if\([a-zA-Z]\.length>=20\)/);
if (!n2) {
throw new Error("未检测到目标代码");
}
return e15.replace(a2, a2.replace(n2[0], "if(!1)"));
}
}();
class kn {
constructor() {
__publicField(this, "target", null);
}
intercept() {
const e15 = this;
Object.defineProperty(s, this.targetName, { get() {
return e15.target;
}, set(t2) {
e15.modifyProperty(t2);
}, configurable: true });
}
modifyProperty(e15) {
this.target = new Proxy((...t2) => {
const a2 = t2[0];
if (!e15.c[a2]) {
e15.m[a2] = this.getNewModule(e15.m[a2]);
}
return e15(a2);
}, { apply(e16, t2, a2) {
return e16.apply(t2, a2);
}, get(t2, a2, n2) {
return Reflect.get(e15, a2, n2);
} });
}
getNewModule(e15) {
const { modifierList: t2 } = this;
if (t2.length === 0) {
return e15;
}
const a2 = e15.toString();
for (let n2 = t2.length - 1; n2 >= 0; n2--) {
const o2 = t2[n2];
if (!o2.pattern.test(a2)) {
continue;
}
t2.splice(n2, 1);
let l2 = null;
try {
l2 = new Function(`return ${o2.newModuleStr(a2)}`)();
} catch (e16) {
const t3 = e16;
Yh.error(`执行修改[${o2.name}]失败!(${t3.message})`);
}
return l2 ? l2 : e15;
}
return e15;
}
}
class Dn extends kn {
constructor() {
super(...arguments);
__publicField(this, "modifierList", [wn]);
__publicField(this, "targetName", "_room_common_");
}
}
new Dn().intercept();
const xn = "https://www.doseeing.com/data";
const Cn = (e15) => Zh({ url: `${xn}/fan/${e15}`, method: "get", responseType: "text" });
const Sn = (e15) => Zh({ url: `${xn}/api/user_feed`, method: "get", params: e15 });
const Mn = { class: "flex justify-between" };
const $n = { class: "flex-1" };
const Pn = { class: "text-slate-400" };
const Yn = ["innerHTML"];
const _n = ["src"];
const Vn = defineComponent({ __name: "DanmuRow", props: { data: {}, nickName: {} }, setup(e15) {
const t2 = e15;
const a2 = () => {
window.open(`https://www.doseeing.com/data/room/${t2.data.rid}`);
};
const n2 = (e16) => {
navigator.clipboard.writeText(`@${t2.nickName}:${e16}`);
Yh.success("复制成功");
};
const o2 = (e16) => {
navigator.clipboard.writeText(e16);
Yh.success("复制成功");
};
const l2 = (e16) => je.unix(e16).format("YYYY-MM-DD HH:mm:ss");
return (e16, s2) => {
const r2 = rm;
return openBlock(), createElementBlock("div", Mn, [createElementVNode("div", $n, [createElementVNode("div", Pn, [createElementVNode("span", null, toDisplayString(l2(t2.data.ts)), 1), createVNode(r2, { class: "ml-5", type: "primary", size: "small", plain: "", onClick: s2[0] || (s2[0] = () => o2(t2.data.txt)) }, { default: withCtx(() => [createTextVNode("复制")]), _: 1 }), createVNode(r2, { class: "ml-12", type: "primary", size: "small", plain: "", onClick: s2[1] || (s2[1] = () => n2(t2.data.txt)) }, { default: withCtx(() => [createTextVNode("含名称复制")]), _: 1 })]), createElementVNode("div", { class: "font-black text-3xl", innerHTML: t2.data.txt }, null, 8, Yn)]), createElementVNode("div", { class: "flex w-56 cursor-pointer items-center flex-none", onClick: a2 }, [createElementVNode("img", { src: `https://apic.douyucdn.cn/upload/${t2.data["room.av"]}_middle.jpg`, class: "w-16 h-16 rounded-md" }, null, 8, _n), createElementVNode("div", null, toDisplayString(t2.data["room.nn"]), 1)])]);
};
} });
const On = { class: "flex justify-between mb-4" };
const Tn = { class: "flex items-start" };
const An = ["src"];
const Ln = { class: "font-black text-xl ml-2" };
const En = { class: "flex justify-between" };
const Rn = { key: 1, class: "h-[58vh] text-center" };
const In = 50;
const Nn = defineComponent({ __name: "index", props: { rel: {}, nickName: {}, avatar: {} }, setup(e15) {
const t2 = e15;
const a2 = ref(false);
const n2 = ref("");
const o2 = ref(false);
const l2 = ref([]);
const s2 = ref("1");
const r2 = ref(je().format());
const i2 = ref(0);
const u2 = ref(["chat"]);
const c2 = reactive({});
let d2 = true;
const f2 = ref(null);
const v2 = [{ title: "弹幕", value: "chat" }, { title: "礼物", value: "gift" }];
watch(u2, (e16) => {
for (const t3 of v2) {
c2[t3.value] = e16.includes(t3.value);
}
}, { immediate: true });
const p2 = () => {
window.open(`https://www.doseeing.com/data/fan/${t2.rel}`);
};
const m2 = async () => {
i2.value = 0;
await D2();
};
const h2 = () => {
r2.value = je(r2.value).add(1, "day").format();
m2();
};
const y2 = () => {
r2.value = je(r2.value).subtract(1, "day").format();
m2();
};
const g2 = ({ scrollTop: e16 }) => {
var _a3;
if (!((_a3 = f2 == null ? void 0 : f2.value) == null ? void 0 : _a3.wrapRef)) {
return;
}
if (f2.value.wrapRef.scrollHeight - e16 <= f2.value.wrapRef.clientHeight && d2) {
i2.value += In;
D2();
}
};
let b2;
const w2 = async () => {
b2 = document.createElement("style");
b2.textContent = "body{overflow:hidden;}";
document.head.appendChild(b2);
a2.value = true;
o2.value = true;
i2.value = 0;
try {
const { finalUrl: e16, response: a3 } = await Cn(t2.rel);
if (e16.startsWith("https://www.doseeing.com/login")) {
Yh.error("未登录(不可用)doseeing,请先登录(不可用)");
return;
}
const o3 = x2(a3, 'data-id="', '"');
if (!o3) {
Yh.error("未获取到用户id");
return;
}
n2.value = o3;
await D2();
} finally {
o2.value = false;
}
};
w2();
const k2 = () => {
b2.remove();
};
const D2 = async () => {
var _a3;
try {
o2.value = true;
const { response: { result: e16 } } = await Sn({ uid: n2.value, dt: je(r2.value).format("YYYY-MM-DD"), offset: i2.value, order: s2.value });
if (i2.value === 0) {
l2.value = e16;
((_a3 = f2.value) == null ? void 0 : _a3.wrapRef) && f2.value.setScrollTop(0);
} else {
l2.value = [...l2.value, ...e16];
}
d2 = e16.length === In;
} finally {
o2.value = false;
}
};
const x2 = (e16, t3, a3) => {
const n3 = new RegExp(`${t3}(.*?)${a3}`, "s");
const o3 = e16.match(n3);
return o3 ? o3[1] : null;
};
return (e16, n3) => {
const i3 = rm;
const d3 = Xm;
const b3 = Zm;
const w3 = Bm;
const D3 = Mm;
const x3 = Za;
const C2 = wh;
const S2 = Ef;
const $2 = mh;
const P2 = Bh;
return openBlock(), createBlock($2, { modelValue: a2.value, "onUpdate:modelValue": n3[3] || (n3[3] = (e17) => a2.value = e17), title: "弹幕历史", width: "70%", top: "6vh", "destroy-on-close": "", "lock-scroll": "", onClosed: k2 }, { default: withCtx(() => [createElementVNode("div", On, [createElementVNode("div", Tn, [createElementVNode("img", { src: t2.avatar, class: "h-20 w-20 rounded-xl" }, null, 8, An), createElementVNode("span", Ln, toDisplayString(t2.nickName), 1)]), createVNode(i3, { type: "primary", size: "small", onClick: p2 }, { default: withCtx(() => [createTextVNode("详情")]), _: 1 })]), createElementVNode("div", En, [createElementVNode("div", null, [createVNode(b3, { modelValue: s2.value, "onUpdate:modelValue": n3[0] || (n3[0] = (e17) => s2.value = e17), onChange: m2 }, { default: withCtx(() => [createVNode(d3, { label: "时间正序", value: "0" }), createVNode(d3, { label: "时间倒序", value: "1" })]), _: 1 }, 8, ["modelValue"])]), createElementVNode("div", null, [createVNode(D3, { modelValue: u2.value, "onUpdate:modelValue": n3[1] || (n3[1] = (e17) => u2.value = e17) }, { default: withCtx(() => [(openBlock(), createElementBlock(Fragment, null, renderList(v2, (e17) => createVNode(w3, { value: e17.value }, { default: withCtx(() => [createTextVNode(toDisplayString(e17.title), 1)]), _: 2 }, 1032, ["value"])), 64))]), _: 1 }, 8, ["modelValue"])]), createElementVNode("div", null, [createVNode(i3, { type: "primary", onClick: y2 }, { default: withCtx(() => [createTextVNode("前一天")]), _: 1 }), createVNode(x3, { modelValue: r2.value, "onUpdate:modelValue": n3[2] || (n3[2] = (e17) => r2.value = e17), onChange: m2 }, null, 8, ["modelValue"]), createVNode(i3, { type: "primary", onClick: h2 }, { default: withCtx(() => [createTextVNode("后一天")]), _: 1 })])]), createVNode(C2), l2.value.length > 0 ? withDirectives((openBlock(), createBlock(S2, { key: 0, class: "h-[58vh] w-full", height: "58vh", onScroll: g2, ref_key: "danmuContainer", ref: f2 }, { default: withCtx(() => [(openBlock(true), createElementBlock(Fragment, null, renderList(l2.value, (e17, a3) => (openBlock(), createElementBlock(Fragment, { key: `${a3}${e17.ts}` }, [c2[e17.type] ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [createVNode(Vn, { data: e17, "nick-name": t2.nickName }, null, 8, ["data", "nick-name"]), createVNode(C2)], 64)) : createCommentVNode("", true)], 64))), 128))]), _: 1 })), [[P2, o2.value]]) : withDirectives((openBlock(), createElementBlock("div", Rn, [createTextVNode(" 翻来翻去还是没有记录 ")])), [[P2, o2.value]])]), _: 1 }, 8, ["modelValue"]);
};
} });
const Bn = "DOUYUCRX";
const Fn = "danmu-history-btn";
let Un = null;
let zn = null;
s[Bn].handleDanmuHistory = (e15) => {
if (!zn) {
zn = document.querySelector(".layout-Player");
if (!zn) {
Yh.error("加载失败");
return;
}
const e16 = document.createElement("div");
e16.id = Fn;
zn.appendChild(e16);
}
if (Un) {
Un.unmount();
}
Un = createApp(Nn, { ...e15 });
Un.mount(`#${Fn}`);
};
const Wn = document.createElement("script");
Wn.src = "https://hm.baidu.com/hm.js?5c04e81d1fc372b0efa06e8c1b711042";
const Hn = document.getElementsByTagName("script")[0];
(_a2 = Hn == null ? void 0 : Hn.parentNode) == null ? void 0 : _a2.insertBefore(Wn, Hn);
class jn {
constructor(e15, t2, a2, n2) {
__publicField(this, "styleElement");
__publicField(this, "stopWatcher");
__publicField(this, "pageConfigStore", rg());
this.selector = e15;
this.title = t2;
this.defaultHide = a2;
this.defaultHave = n2;
this.styleElement = document.createElement("style");
this.styleElement.type = "text/css";
}
init() {
const { hideState: e15, addPageConfig: t2 } = this.pageConfigStore;
t2(this.selector, { hide: this.defaultHide, title: `隐藏${this.title}`, have: this.defaultHave });
const a2 = e15[this.selector];
this.stopWatcher = watch(() => a2.hide, (e16) => {
if (e16) {
this.hide();
return;
}
this.show();
}, { immediate: true });
}
hide() {
this.styleElement.textContent = this.getTextContent();
document.head.appendChild(this.styleElement);
}
getTextContent() {
return `${this.selector}{display:none !important;}`;
}
show() {
this.styleElement.remove();
}
markTarget() {
const { infoState: e15 } = this.pageConfigStore;
const t2 = e15[this.selector];
if (!t2.have) {
const e16 = document.querySelector(this.selector);
t2.have = !!e16;
!t2.have && this.stopWatcher && this.stopWatcher();
}
}
}
class Kn extends jn {
getTextContent() {
return `${super.getTextContent()} #js-player-asideMain{top:0}`;
}
}
const { state: Zn } = og();
const Gn = [new jn(".Title-header", "直播间标题", false, true), new jn(".Title-report", "举报按钮", false, true), new jn(".Title-category", "直播间分类", false, true), new jn(".Title-addFriend", "添加友邻按钮", false, false), new jn(".Title-followNum", "粉丝数", false, false), new jn(".Title-followBtn", "关注按钮", false, false), new jn(".Title-AnchorLevel", "主播等级", false, true), new jn(".Title-anchorName", "主播名称", false, true), new jn(".Title-anchorHot", "热度", false, true), new jn(".Title-txAuthentication", "腾讯认证", false, false), new jn(".Title-official-wrap", "官方认证", false, false), new jn(".Title-anchorFriendWrapper", "友邻", false, true), new jn(".SociatyLabel", "公会", false, false), new jn(".Title-anchorComment", "主播玩过", false, false), new jn(".Title-sharkWeight", "成就点", false, true), new jn(".Title-anchorLocation", "商品橱窗", false, false), new jn(".SuperFansV2-entrance", "超级粉丝团", false, true), new jn(".Title-GiftHallEntrance-icon", "礼物展馆", false, true), new jn(".RoomVipSysTitle", "V周榜", false, true), new jn(".LuckyStarTitle", "福星挑战", false, true), new jn(".WishGiftTitle", "心愿", false, true), new jn(".RankCoverage", "小时榜", false, false), new jn(".YJWJGameIcon", "游戏数据", false, false), new jn(".ComSuperscript", "巨星榜", false, false), new jn(".DiamondFansMatchEntrance", "钻粉联赛", false, true), new jn(".GiftNamingEntrance", "最强勇士团", false, true), new jn(".TitleShare", "分享按钮", false, true), new jn(".ClientJump", "客户端按钮", false, true), new jn(".ToolbarActivityArea-left", "直播画面底部元素1", false, true), new jn(".ToolbarActivityArea-right", "直播画面底部元素2", false, true), new jn(".ToolbarGiftArea", "直播画面底部元素3", false, true), new jn(".PlayerToolbar-couponInfo", "福利券", false, true), new jn(".PlayerToolbar-ywInfo", "鱼丸", false, true), new jn(".PlayerToolbar-ycInfo", "鱼翅", false, true), new jn(".PlayerToolbar-getYCArea", "充值按钮", false, true), new jn(".PlayerToolbar-backpackArea", "背包按钮", false, true), new jn(".layout-Player-announce", "主播投稿和直播回看", false, true), new jn(".layout-Player-rank", "排行榜", false, true), new jn("#js-barrage-extend-container", "入场提示", false, true), new jn(`[class*="watermark"]`, "左下角房间号水印", false, false), new jn(".PubgInfo-icon", "PUBG战绩统计", false, false), new jn("#bc1152", "赛事点评", false, false), new jn("#webmActKefuWeidget > *", "活动客服", false, false), new jn(".AnchorPocketTips", "亲密度Buff提醒", false, false), new jn("#js-room-activity > *", "右侧活动浮窗", false, false), new jn(".IconCardAdBoundsBox", "直播画面右下角广告", true, false), new jn("#js-room-top-banner", "顶部大广告", true, false), new jn(".CloseVideoPlayerAd", "未开播时视频广告", true, true), new jn(".Title-ad", "分享按钮左侧广告", true, false), new Kn("#js-player-asideTopSuspension > *", "排行榜顶部广告", true, false)];
for (const e15 of Gn) {
e15.init();
}
watch(() => Zn.end, (e15) => {
if (!e15) {
return;
}
for (const e16 of Gn) {
e16.markTarget();
}
});
const Xn = defineStore("room-info", () => {
const e15 = document.documentElement.outerHTML.match(/\$ROOM\.room_id =(.+?);/);
const t2 = ref({ rid: e15 ? e15[1].trim() : "" });
return { state: t2 };
});
const qn = 50;
const Jn = 268;
let Qn = false;
const eo = Xn();
const { state: to } = Gh();
const { state: ao } = og();
const no = async () => {
if (Qn) {
return;
}
Qn = true;
try {
const e15 = je().format("YYYY-MM-DD");
if (!to.enabled || to.configList.length < 7 || to.completeDay === e15) {
return;
}
const t2 = je(e15).day();
const a2 = t2 === 0 ? 6 : t2 - 1;
const n2 = to.configList[a2];
if (!n2 || n2.length === 0) {
Yh.warning("未读取到[自动送荧光棒]配置,请先配置[自动送荧光棒]");
return;
}
const o2 = await Jh();
if (o2.length !== n2.length) {
Yh.warning("粉丝牌发生变化,[自动送荧光棒]需重新配置");
return;
}
const l2 = /* @__PURE__ */ new Set();
for (const e16 of o2) {
l2.add(e16.rid);
}
for (const e16 of n2) {
if (!l2.has(e16.rid)) {
Yh.warning("粉丝牌发生变化,[自动送荧光棒]需重新配置");
return;
}
l2.delete(e16.rid);
}
if (l2.size > 0) {
Yh.warning("粉丝牌发生变化,[自动送荧光棒]需重新配置");
return;
}
const s2 = je(e15).unix();
const r2 = je(e15).add(1, "day").unix() - 1;
const i2 = /* @__PURE__ */ new Map();
let u2 = qn;
let c2 = 1;
while (u2 === qn) {
const { response: { data: { total: e16, details: t3 } } } = await Qh({ beginTime: s2, endTime: r2, pageSize: qn, pageNum: c2++ });
u2 = e16;
for (const e17 of t3) {
const t4 = `${e17.roomId}`;
const a3 = i2.get(t4);
if (e17.relId !== Jn) {
continue;
}
if (!a3) {
i2.set(t4, e17.number);
continue;
}
i2.set(t4, e17.number + a3);
}
}
if (i2.size > 0) {
to.receiveDay = e15;
}
let d2 = 0;
const f2 = [];
let v2 = null;
for (const e16 of n2) {
if (e16.remaining) {
v2 = e16;
continue;
}
if (e16.count <= 0) {
continue;
}
const t3 = i2.get(e16.rid);
if (!t3) {
d2 += e16.count;
f2.push({ rid: e16.rid, count: e16.count });
continue;
}
const a3 = e16.count - t3;
if (a3 > 0) {
d2 += a3;
f2.push({ rid: e16.rid, count: a3 });
}
}
if (d2 === 0 && !v2) {
Yh.success("无需执行[自动送荧光棒],当日赠送的荧光棒已满足配置");
to.completeDay = e15;
return;
}
const p2 = await eg({ rid: eo.state.rid });
const m2 = p2.response.data.list.find((e16) => e16.id === Jn);
if (!m2) {
if (i2.size === 0) {
return;
}
if (d2 === 0) {
Yh.success("无需执行[自动送荧光棒],当日赠送的荧光棒已满足配置");
to.completeDay = e15;
return;
}
Yh.warning("荧光棒不足,视作当日[自动送荧光棒]已完成");
to.completeDay = e15;
return;
}
to.receiveDay = e15;
if (d2 > m2.count) {
Yh.warning("荧光棒不足,视作当日[自动送荧光棒]已完成");
to.completeDay = e15;
return;
}
for (const e16 of f2) {
await tg({ propId: Jn, roomId: e16.rid, propCount: e16.count });
}
const h2 = m2.count - d2;
if (v2 && h2 > 0) {
await tg({ propId: Jn, roomId: v2.rid, propCount: h2 });
}
Yh.success("[自动送荧光棒]已完成");
to.completeDay = e15;
} catch (e15) {
const t2 = e15;
console.log("自动送荧光棒出错:", e15);
Yh.error(`自动送荧光棒出错:${t2.message}`);
} finally {
Qn = false;
}
};
const oo = () => {
watch(() => to.enabled, no);
watch(() => to.configList, no);
no();
};
(() => {
const e15 = je().format("YYYY-MM-DD");
if (to.receiveDay === e15) {
oo();
return;
}
const t2 = watch(() => ao.end, (e16) => {
if (!e16) {
return;
}
oo();
t2();
}, { immediate: true });
})();
const lo = ".ChatSend-txt";
const so = 70;
const { state: ro } = og();
watch(() => ro.end, (e15) => {
if (!e15) {
return;
}
const t2 = document.querySelector(lo);
if (t2 && t2.maxLength < so) {
t2.maxLength = so;
}
});
})
};
}));
System.register("./pageful-B6Krc0i4-BxfQe0NR.js", ['vue', 'vue-demi', 'pinia', 'qs', './__monkey.entry-DHMkWzvL.js'], (function (exports, module) {
'use strict';
var defineComponent, openBlock, createElementBlock, createElementVNode, ref, watch, renderSlot, computed, mergeProps, unref, useAttrs, useSlots, shallowRef, nextTick, onMounted, toRef, createCommentVNode, Fragment, normalizeClass, createBlock, withCtx, resolveDynamicComponent, withModifiers, createVNode, toDisplayString, normalizeStyle, inject, onBeforeUnmount, Transition, withDirectives, vShow, provide, reactive, onActivated, onUpdated, cloneVNode, Text, Comment, Teleport, readonly, onDeactivated, isRef, vModelCheckbox, createTextVNode, toRefs, vModelRadio, h, createSlots, shallowReactive, warn, getCurrentInstance, watchEffect, onBeforeMount, onUnmounted, onScopeDispose$1, toRaw, isVNode, render, createApp, watch$1, shallowRef$1, watchEffect$1, readonly$1, unref$1, getCurrentScope, onScopeDispose, ref$1, getCurrentInstance$1, onMounted$1, nextTick$1, defineStore, ge, s, i;
return {
setters: [module => {
defineComponent = module.defineComponent;
openBlock = module.openBlock;
createElementBlock = module.createElementBlock;
createElementVNode = module.createElementVNode;
ref = module.ref;
watch = module.watch;
renderSlot = module.renderSlot;
computed = module.computed;
mergeProps = module.mergeProps;
unref = module.unref;
useAttrs = module.useAttrs;
useSlots = module.useSlots;
shallowRef = module.shallowRef;
nextTick = module.nextTick;
onMounted = module.onMounted;
toRef = module.toRef;
createCommentVNode = module.createCommentVNode;
Fragment = module.Fragment;
normalizeClass = module.normalizeClass;
createBlock = module.createBlock;
withCtx = module.withCtx;
resolveDynamicComponent = module.resolveDynamicComponent;
withModifiers = module.withModifiers;
createVNode = module.createVNode;
toDisplayString = module.toDisplayString;
normalizeStyle = module.normalizeStyle;
inject = module.inject;
onBeforeUnmount = module.onBeforeUnmount;
Transition = module.Transition;
withDirectives = module.withDirectives;
vShow = module.vShow;
provide = module.provide;
reactive = module.reactive;
onActivated = module.onActivated;
onUpdated = module.onUpdated;
cloneVNode = module.cloneVNode;
Text = module.Text;
Comment = module.Comment;
Teleport = module.Teleport;
readonly = module.readonly;
onDeactivated = module.onDeactivated;
isRef = module.isRef;
vModelCheckbox = module.vModelCheckbox;
createTextVNode = module.createTextVNode;
toRefs = module.toRefs;
vModelRadio = module.vModelRadio;
h = module.h;
createSlots = module.createSlots;
shallowReactive = module.shallowReactive;
warn = module.warn;
getCurrentInstance = module.getCurrentInstance;
watchEffect = module.watchEffect;
onBeforeMount = module.onBeforeMount;
onUnmounted = module.onUnmounted;
onScopeDispose$1 = module.onScopeDispose;
toRaw = module.toRaw;
isVNode = module.isVNode;
render = module.render;
createApp = module.createApp;
}, module => {
watch$1 = module.watch;
shallowRef$1 = module.shallowRef;
watchEffect$1 = module.watchEffect;
readonly$1 = module.readonly;
unref$1 = module.unref;
getCurrentScope = module.getCurrentScope;
onScopeDispose = module.onScopeDispose;
ref$1 = module.ref;
getCurrentInstance$1 = module.getCurrentInstance;
onMounted$1 = module.onMounted;
nextTick$1 = module.nextTick;
}, module => {
defineStore = module.defineStore;
}, module => {
ge = module.default;
}, module => {
s = module.s;
i = module.i;
}],
execute: (function () {
exports({
D: Ms,
O: tt,
Q: Ze,
R: Rs,
S: ct,
X: Xs,
a1: Be,
aA: va,
aD: nr,
aE: Kn,
aJ: gn,
aK: ro,
aL: Wt,
aM: Ut,
aO: Xn,
aP: or,
aR: aa,
aS: ta,
aU: Yt,
aV: dr,
aW: Qr,
aX: Es,
aY: Cs,
aZ: ir,
a_: ea,
ai: Ue,
ar: Qn,
as: fn,
aw: rn,
ax: no,
ay: qn,
az: Yn,
b2: Is,
b5: qe,
bb: sa,
j: Js,
r: rl
});
const we = (e2, t2, { checkForDefaultPrevented: n2 = true } = {}) => {
const o2 = (o3) => {
const r2 = e2 == null ? void 0 : e2(o3);
if (n2 === false || !r2) {
return t2 == null ? void 0 : t2(o3);
}
};
return o2;
};
var xe = Object.defineProperty;
var Se = Object.defineProperties;
var Ce = Object.getOwnPropertyDescriptors;
var ke = Object.getOwnPropertySymbols;
var _e = Object.prototype.hasOwnProperty;
var Ee = Object.prototype.propertyIsEnumerable;
var Oe = (e2, t2, n2) => t2 in e2 ? xe(e2, t2, { enumerable: true, configurable: true, writable: true, value: n2 }) : e2[t2] = n2;
var Le = (e2, t2) => {
for (var n2 in t2 || (t2 = {})) if (_e.call(t2, n2)) Oe(e2, n2, t2[n2]);
if (ke) for (var n2 of ke(t2)) {
if (Ee.call(t2, n2)) Oe(e2, n2, t2[n2]);
}
return e2;
};
var Ae = (e2, t2) => Se(e2, Ce(t2));
function Be(e2, t2) {
var n2;
const o2 = shallowRef$1();
watchEffect$1(() => {
o2.value = e2();
}, Ae(Le({}, t2), { flush: (n2 = void 0) != null ? n2 : "sync" }));
return readonly$1(o2);
}
var Me;
const Te = exports("T", typeof window !== "undefined");
const Ie = (e2) => typeof e2 === "string";
const Re = () => {
};
const je = Te && ((Me = window == null ? void 0 : window.navigator) == null ? void 0 : Me.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent);
function ze(e2) {
return typeof e2 === "function" ? e2() : unref$1(e2);
}
function Fe(e2) {
return e2;
}
function Pe(e2) {
if (getCurrentScope()) {
onScopeDispose(e2);
return true;
}
return false;
}
function $e(e2, t2 = true) {
if (getCurrentInstance$1()) onMounted$1(e2);
else if (t2) e2();
else nextTick$1(e2);
}
function Ne(e2, t2, n2 = {}) {
const { immediate: o2 = true } = n2;
const r2 = ref$1(false);
let a2 = null;
function s2() {
if (a2) {
clearTimeout(a2);
a2 = null;
}
}
function l2() {
r2.value = false;
s2();
}
function i2(...n3) {
s2();
r2.value = true;
a2 = setTimeout(() => {
r2.value = false;
a2 = null;
e2(...n3);
}, ze(t2));
}
if (o2) {
r2.value = true;
if (Te) i2();
}
Pe(l2);
return { isPending: readonly$1(r2), start: i2, stop: l2 };
}
function Ve(e2) {
var t2;
const n2 = ze(e2);
return (t2 = n2 == null ? void 0 : n2.$el) != null ? t2 : n2;
}
const De = Te ? window : void 0;
const He = Te ? window.document : void 0;
function Ue(...e2) {
let t2;
let n2;
let o2;
let r2;
if (Ie(e2[0]) || Array.isArray(e2[0])) {
[n2, o2, r2] = e2;
t2 = De;
} else {
[t2, n2, o2, r2] = e2;
}
if (!t2) return Re;
if (!Array.isArray(n2)) n2 = [n2];
if (!Array.isArray(o2)) o2 = [o2];
const a2 = [];
const s2 = () => {
a2.forEach((e3) => e3());
a2.length = 0;
};
const l2 = (e3, t3, n3, o3) => {
e3.addEventListener(t3, n3, o3);
return () => e3.removeEventListener(t3, n3, o3);
};
const i2 = watch$1(() => [Ve(t2), ze(r2)], ([e3, t3]) => {
s2();
if (!e3) return;
a2.push(...n2.flatMap((n3) => o2.map((o3) => l2(e3, n3, o3, t3))));
}, { immediate: true, flush: "post" });
const u2 = () => {
i2();
s2();
};
Pe(u2);
return u2;
}
let We = false;
function qe(e2, t2, n2 = {}) {
const { window: o2 = De, ignore: r2 = [], capture: a2 = true, detectIframe: s2 = false } = n2;
if (!o2) return;
if (je && !We) {
We = true;
Array.from(o2.document.body.children).forEach((e3) => e3.addEventListener("click", Re));
}
let l2 = true;
const i2 = (e3) => r2.some((t3) => {
if (typeof t3 === "string") {
return Array.from(o2.document.querySelectorAll(t3)).some((t4) => t4 === e3.target || e3.composedPath().includes(t4));
} else {
const n3 = Ve(t3);
return n3 && (e3.target === n3 || e3.composedPath().includes(n3));
}
});
const u2 = (n3) => {
const o3 = Ve(e2);
if (!o3 || o3 === n3.target || n3.composedPath().includes(o3)) return;
if (n3.detail === 0) l2 = !i2(n3);
if (!l2) {
l2 = true;
return;
}
t2(n3);
};
const c2 = [Ue(o2, "click", u2, { passive: true, capture: a2 }), Ue(o2, "pointerdown", (t3) => {
const n3 = Ve(e2);
if (n3) l2 = !t3.composedPath().includes(n3) && !i2(t3);
}, { passive: true }), s2 && Ue(o2, "blur", (n3) => {
var r3;
const a3 = Ve(e2);
if (((r3 = o2.document.activeElement) == null ? void 0 : r3.tagName) === "IFRAME" && !(a3 == null ? void 0 : a3.contains(o2.document.activeElement))) t2(n3);
})].filter(Boolean);
const d2 = () => c2.forEach((e3) => e3());
return d2;
}
function Ke(e2, t2 = false) {
const n2 = ref$1();
const o2 = () => n2.value = Boolean(e2());
o2();
$e(o2, t2);
return n2;
}
const Ye = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
const Ge = "__vueuse_ssr_handlers__";
Ye[Ge] = Ye[Ge] || {};
function Ze({ document: e2 = He } = {}) {
if (!e2) return ref$1("visible");
const t2 = ref$1(e2.visibilityState);
Ue(e2, "visibilitychange", () => {
t2.value = e2.visibilityState;
});
return t2;
}
var Xe = Object.getOwnPropertySymbols;
var Je = Object.prototype.hasOwnProperty;
var Qe = Object.prototype.propertyIsEnumerable;
var et = (e2, t2) => {
var n2 = {};
for (var o2 in e2) if (Je.call(e2, o2) && t2.indexOf(o2) < 0) n2[o2] = e2[o2];
if (e2 != null && Xe) for (var o2 of Xe(e2)) {
if (t2.indexOf(o2) < 0 && Qe.call(e2, o2)) n2[o2] = e2[o2];
}
return n2;
};
function tt(e2, t2, n2 = {}) {
const o2 = n2, { window: r2 = De } = o2, a2 = et(o2, ["window"]);
let s2;
const l2 = Ke(() => r2 && "ResizeObserver" in r2);
const i2 = () => {
if (s2) {
s2.disconnect();
s2 = void 0;
}
};
const u2 = watch$1(() => Ve(e2), (e3) => {
i2();
if (l2.value && r2 && e3) {
s2 = new ResizeObserver(t2);
s2.observe(e3, a2);
}
}, { immediate: true, flush: "post" });
const c2 = () => {
i2();
u2();
};
Pe(c2);
return { isSupported: l2, stop: c2 };
}
var nt;
(function(e2) {
e2["UP"] = "UP";
e2["RIGHT"] = "RIGHT";
e2["DOWN"] = "DOWN";
e2["LEFT"] = "LEFT";
e2["NONE"] = "NONE";
})(nt || (nt = {}));
var ot = Object.defineProperty;
var rt = Object.getOwnPropertySymbols;
var at = Object.prototype.hasOwnProperty;
var st = Object.prototype.propertyIsEnumerable;
var lt = (e2, t2, n2) => t2 in e2 ? ot(e2, t2, { enumerable: true, configurable: true, writable: true, value: n2 }) : e2[t2] = n2;
var it = (e2, t2) => {
for (var n2 in t2 || (t2 = {})) if (at.call(t2, n2)) lt(e2, n2, t2[n2]);
if (rt) for (var n2 of rt(t2)) {
if (st.call(t2, n2)) lt(e2, n2, t2[n2]);
}
return e2;
};
const ut = { easeInSine: [0.12, 0, 0.39, 0], easeOutSine: [0.61, 1, 0.88, 1], easeInOutSine: [0.37, 0, 0.63, 1], easeInQuad: [0.11, 0, 0.5, 0], easeOutQuad: [0.5, 1, 0.89, 1], easeInOutQuad: [0.45, 0, 0.55, 1], easeInCubic: [0.32, 0, 0.67, 0], easeOutCubic: [0.33, 1, 0.68, 1], easeInOutCubic: [0.65, 0, 0.35, 1], easeInQuart: [0.5, 0, 0.75, 0], easeOutQuart: [0.25, 1, 0.5, 1], easeInOutQuart: [0.76, 0, 0.24, 1], easeInQuint: [0.64, 0, 0.78, 0], easeOutQuint: [0.22, 1, 0.36, 1], easeInOutQuint: [0.83, 0, 0.17, 1], easeInExpo: [0.7, 0, 0.84, 0], easeOutExpo: [0.16, 1, 0.3, 1], easeInOutExpo: [0.87, 0, 0.13, 1], easeInCirc: [0.55, 0, 1, 0.45], easeOutCirc: [0, 0.55, 0.45, 1], easeInOutCirc: [0.85, 0, 0.15, 1], easeInBack: [0.36, 0, 0.66, -0.56], easeOutBack: [0.34, 1.56, 0.64, 1], easeInOutBack: [0.68, -0.6, 0.32, 1.6] };
it({ linear: Fe }, ut);
function ct({ window: e2 = De } = {}) {
if (!e2) return ref$1(false);
const t2 = ref$1(e2.document.hasFocus());
Ue(e2, "blur", () => {
t2.value = false;
});
Ue(e2, "focus", () => {
t2.value = true;
});
return t2;
}
const dt = () => Te && /firefox/i.test(window.navigator.userAgent);
const ft = () => {
};
const pt = Object.prototype.hasOwnProperty;
const vt = exports("ah", (e2, t2) => pt.call(e2, t2));
const mt = exports("aN", Array.isArray);
const ht = exports("be", (e2) => St(e2) === "[object Date]");
const gt = exports("bc", (e2) => typeof e2 === "function");
const bt = exports("F", (e2) => typeof e2 === "string");
const yt = exports("aT", (e2) => e2 !== null && typeof e2 === "object");
const wt = exports("ag", (e2) => (yt(e2) || gt(e2)) && gt(e2.then) && gt(e2.catch));
const xt = Object.prototype.toString;
const St = (e2) => xt.call(e2);
const Ct = (e2) => {
const t2 = /* @__PURE__ */ Object.create(null);
return (n2) => {
const o2 = t2[n2];
return o2 || (t2[n2] = e2(n2));
};
};
const kt = /-(\w)/g;
const _t = Ct((e2) => e2.replace(kt, (e3, t2) => t2 ? t2.toUpperCase() : ""));
const Et = /\B([A-Z])/g;
const Ot = Ct((e2) => e2.replace(Et, "-$1").toLowerCase());
const Lt = exports("at", Ct((e2) => e2.charAt(0).toUpperCase() + e2.slice(1)));
var At = typeof global == "object" && global && global.Object === Object && global;
var Bt = typeof self == "object" && self && self.Object === Object && self;
var Mt = exports("M", At || Bt || Function("return this")());
var Tt = Mt.Symbol;
var It = Object.prototype;
var Rt = It.hasOwnProperty;
var jt = It.toString;
var zt = Tt ? Tt.toStringTag : void 0;
function Ft(e2) {
var t2 = Rt.call(e2, zt), n2 = e2[zt];
try {
e2[zt] = void 0;
var o2 = true;
} catch (e3) {
}
var r2 = jt.call(e2);
if (o2) {
if (t2) {
e2[zt] = n2;
} else {
delete e2[zt];
}
}
return r2;
}
var Pt = Object.prototype;
var $t = Pt.toString;
function Nt(e2) {
return $t.call(e2);
}
var Vt = "[object Null]", Dt = "[object Undefined]";
var Ht = Tt ? Tt.toStringTag : void 0;
function Ut(e2) {
if (e2 == null) {
return e2 === void 0 ? Dt : Vt;
}
return Ht && Ht in Object(e2) ? Ft(e2) : Nt(e2);
}
function Wt(e2) {
return e2 != null && typeof e2 == "object";
}
var qt = "[object Symbol]";
function Kt(e2) {
return typeof e2 == "symbol" || Wt(e2) && Ut(e2) == qt;
}
function Yt(e2, t2) {
var n2 = -1, o2 = e2 == null ? 0 : e2.length, r2 = Array(o2);
while (++n2 < o2) {
r2[n2] = t2(e2[n2], n2, e2);
}
return r2;
}
var Gt = exports("aH", Array.isArray);
var Zt = 1 / 0;
var Xt = Tt ? Tt.prototype : void 0, Jt = Xt ? Xt.toString : void 0;
function Qt(e2) {
if (typeof e2 == "string") {
return e2;
}
if (Gt(e2)) {
return Yt(e2, Qt) + "";
}
if (Kt(e2)) {
return Jt ? Jt.call(e2) : "";
}
var t2 = e2 + "";
return t2 == "0" && 1 / e2 == -Zt ? "-0" : t2;
}
var en = /\s/;
function tn(e2) {
var t2 = e2.length;
while (t2-- && en.test(e2.charAt(t2))) {
}
return t2;
}
var nn = /^\s+/;
function on(e2) {
return e2 ? e2.slice(0, tn(e2) + 1).replace(nn, "") : e2;
}
function rn(e2) {
var t2 = typeof e2;
return e2 != null && (t2 == "object" || t2 == "function");
}
var an = 0 / 0;
var sn = /^[-+]0x[0-9a-f]+$/i;
var ln = /^0b[01]+$/i;
var un = /^0o[0-7]+$/i;
var cn = parseInt;
function dn(e2) {
if (typeof e2 == "number") {
return e2;
}
if (Kt(e2)) {
return an;
}
if (rn(e2)) {
var t2 = typeof e2.valueOf == "function" ? e2.valueOf() : e2;
e2 = rn(t2) ? t2 + "" : t2;
}
if (typeof e2 != "string") {
return e2 === 0 ? e2 : +e2;
}
e2 = on(e2);
var n2 = ln.test(e2);
return n2 || un.test(e2) ? cn(e2.slice(2), n2 ? 2 : 8) : sn.test(e2) ? an : +e2;
}
function fn(e2) {
return e2;
}
var pn = "[object AsyncFunction]", vn = "[object Function]", mn = "[object GeneratorFunction]", hn = "[object Proxy]";
function gn(e2) {
if (!rn(e2)) {
return false;
}
var t2 = Ut(e2);
return t2 == vn || t2 == mn || t2 == pn || t2 == hn;
}
var bn = Mt["__core-js_shared__"];
var yn = function() {
var e2 = /[^.]+$/.exec(bn && bn.keys && bn.keys.IE_PROTO || "");
return e2 ? "Symbol(src)_1." + e2 : "";
}();
function wn(e2) {
return !!yn && yn in e2;
}
var xn = Function.prototype;
var Sn = xn.toString;
function Cn(e2) {
if (e2 != null) {
try {
return Sn.call(e2);
} catch (e3) {
}
try {
return e2 + "";
} catch (e3) {
}
}
return "";
}
var kn = /[\\^$.*+?()[\]{}|]/g;
var _n = /^\[object .+?Constructor\]$/;
var En = Function.prototype, On = Object.prototype;
var Ln = En.toString;
var An = On.hasOwnProperty;
var Bn = RegExp("^" + Ln.call(An).replace(kn, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$");
function Mn(e2) {
if (!rn(e2) || wn(e2)) {
return false;
}
var t2 = gn(e2) ? Bn : _n;
return t2.test(Cn(e2));
}
function Tn(e2, t2) {
return e2 == null ? void 0 : e2[t2];
}
function In(e2, t2) {
var n2 = Tn(e2, t2);
return Mn(n2) ? n2 : void 0;
}
var Rn = In(Mt, "WeakMap");
function jn(e2, t2, n2) {
switch (n2.length) {
case 0:
return e2.call(t2);
case 1:
return e2.call(t2, n2[0]);
case 2:
return e2.call(t2, n2[0], n2[1]);
case 3:
return e2.call(t2, n2[0], n2[1], n2[2]);
}
return e2.apply(t2, n2);
}
var zn = 800, Fn = 16;
var Pn = Date.now;
function $n(e2) {
var t2 = 0, n2 = 0;
return function() {
var o2 = Pn(), r2 = Fn - (o2 - n2);
n2 = o2;
if (r2 > 0) {
if (++t2 >= zn) {
return arguments[0];
}
} else {
t2 = 0;
}
return e2.apply(void 0, arguments);
};
}
function Nn(e2) {
return function() {
return e2;
};
}
var Vn = function() {
try {
var e2 = In(Object, "defineProperty");
e2({}, "", {});
return e2;
} catch (e3) {
}
}();
var Dn = !Vn ? fn : function(e2, t2) {
return Vn(e2, "toString", { configurable: true, enumerable: false, value: Nn(t2), writable: true });
};
var Hn = exports("aq", $n(Dn));
var Un = 9007199254740991;
var Wn = /^(?:0|[1-9]\d*)$/;
function qn(e2, t2) {
var n2 = typeof e2;
t2 = t2 == null ? Un : t2;
return !!t2 && (n2 == "number" || n2 != "symbol" && Wn.test(e2)) && (e2 > -1 && e2 % 1 == 0 && e2 < t2);
}
function Kn(e2, t2, n2) {
if (t2 == "__proto__" && Vn) {
Vn(e2, t2, { configurable: true, enumerable: true, value: n2, writable: true });
} else {
e2[t2] = n2;
}
}
function Yn(e2, t2) {
return e2 === t2 || e2 !== e2 && t2 !== t2;
}
var Gn = Object.prototype;
var Zn = Gn.hasOwnProperty;
function Xn(e2, t2, n2) {
var o2 = e2[t2];
if (!(Zn.call(e2, t2) && Yn(o2, n2)) || n2 === void 0 && !(t2 in e2)) {
Kn(e2, t2, n2);
}
}
var Jn = Math.max;
function Qn(e2, t2, n2) {
t2 = Jn(t2 === void 0 ? e2.length - 1 : t2, 0);
return function() {
var o2 = arguments, r2 = -1, a2 = Jn(o2.length - t2, 0), s2 = Array(a2);
while (++r2 < a2) {
s2[r2] = o2[t2 + r2];
}
r2 = -1;
var l2 = Array(t2 + 1);
while (++r2 < t2) {
l2[r2] = o2[r2];
}
l2[t2] = n2(s2);
return jn(e2, this, l2);
};
}
var eo = 9007199254740991;
function to(e2) {
return typeof e2 == "number" && e2 > -1 && e2 % 1 == 0 && e2 <= eo;
}
function no(e2) {
return e2 != null && to(e2.length) && !gn(e2);
}
var oo = Object.prototype;
function ro(e2) {
var t2 = e2 && e2.constructor, n2 = typeof t2 == "function" && t2.prototype || oo;
return e2 === n2;
}
function ao(e2, t2) {
var n2 = -1, o2 = Array(e2);
while (++n2 < e2) {
o2[n2] = t2(n2);
}
return o2;
}
var so = "[object Arguments]";
function lo(e2) {
return Wt(e2) && Ut(e2) == so;
}
var io = Object.prototype;
var uo = io.hasOwnProperty;
var co = io.propertyIsEnumerable;
var fo = exports("aI", lo(/* @__PURE__ */ function() {
return arguments;
}()) ? lo : function(e2) {
return Wt(e2) && uo.call(e2, "callee") && !co.call(e2, "callee");
});
function po() {
return false;
}
var vo = typeof exports == "object" && exports && !exports.nodeType && exports;
var mo = vo && typeof module == "object" && module && !module.nodeType && module;
var ho = mo && mo.exports === vo;
var go = ho ? Mt.Buffer : void 0;
var bo = go ? go.isBuffer : void 0;
var yo = exports("aF", bo || po);
var wo = "[object Arguments]", xo = "[object Array]", So = "[object Boolean]", Co = "[object Date]", ko = "[object Error]", _o = "[object Function]", Eo = "[object Map]", Oo = "[object Number]", Lo = "[object Object]", Ao = "[object RegExp]", Bo = "[object Set]", Mo = "[object String]", To = "[object WeakMap]";
var Io = "[object ArrayBuffer]", Ro = "[object DataView]", jo = "[object Float32Array]", zo = "[object Float64Array]", Fo = "[object Int8Array]", Po = "[object Int16Array]", $o = "[object Int32Array]", No = "[object Uint8Array]", Vo = "[object Uint8ClampedArray]", Do = "[object Uint16Array]", Ho = "[object Uint32Array]";
var Uo = {};
Uo[jo] = Uo[zo] = Uo[Fo] = Uo[Po] = Uo[$o] = Uo[No] = Uo[Vo] = Uo[Do] = Uo[Ho] = true;
Uo[wo] = Uo[xo] = Uo[Io] = Uo[So] = Uo[Ro] = Uo[Co] = Uo[ko] = Uo[_o] = Uo[Eo] = Uo[Oo] = Uo[Lo] = Uo[Ao] = Uo[Bo] = Uo[Mo] = Uo[To] = false;
function Wo(e2) {
return Wt(e2) && to(e2.length) && !!Uo[Ut(e2)];
}
function qo(e2) {
return function(t2) {
return e2(t2);
};
}
var Ko = typeof exports == "object" && exports && !exports.nodeType && exports;
var Yo = Ko && typeof module == "object" && module && !module.nodeType && module;
var Go = Yo && Yo.exports === Ko;
var Zo = Go && At.process;
var Xo = function() {
try {
var e2 = Yo && Yo.require && Yo.require("util").types;
if (e2) {
return e2;
}
return Zo && Zo.binding && Zo.binding("util");
} catch (e3) {
}
}();
var Jo = Xo && Xo.isTypedArray;
var Qo = exports("aG", Jo ? qo(Jo) : Wo);
var er = Object.prototype;
var tr = er.hasOwnProperty;
function nr(e2, t2) {
var n2 = Gt(e2), o2 = !n2 && fo(e2), r2 = !n2 && !o2 && yo(e2), a2 = !n2 && !o2 && !r2 && Qo(e2), s2 = n2 || o2 || r2 || a2, l2 = s2 ? ao(e2.length, String) : [], i2 = l2.length;
for (var u2 in e2) {
if ((t2 || tr.call(e2, u2)) && !(s2 && (u2 == "length" || r2 && (u2 == "offset" || u2 == "parent") || a2 && (u2 == "buffer" || u2 == "byteLength" || u2 == "byteOffset") || qn(u2, i2)))) {
l2.push(u2);
}
}
return l2;
}
function or(e2, t2) {
return function(n2) {
return e2(t2(n2));
};
}
var rr = or(Object.keys, Object);
var ar = Object.prototype;
var sr = ar.hasOwnProperty;
function lr(e2) {
if (!ro(e2)) {
return rr(e2);
}
var t2 = [];
for (var n2 in Object(e2)) {
if (sr.call(e2, n2) && n2 != "constructor") {
t2.push(n2);
}
}
return t2;
}
function ir(e2) {
return no(e2) ? nr(e2) : lr(e2);
}
var ur = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, cr = /^\w*$/;
function dr(e2, t2) {
if (Gt(e2)) {
return false;
}
var n2 = typeof e2;
if (n2 == "number" || n2 == "symbol" || n2 == "boolean" || e2 == null || Kt(e2)) {
return true;
}
return cr.test(e2) || !ur.test(e2) || t2 != null && e2 in Object(t2);
}
var fr = In(Object, "create");
function pr() {
this.__data__ = fr ? fr(null) : {};
this.size = 0;
}
function vr(e2) {
var t2 = this.has(e2) && delete this.__data__[e2];
this.size -= t2 ? 1 : 0;
return t2;
}
var mr = "__lodash_hash_undefined__";
var hr = Object.prototype;
var gr = hr.hasOwnProperty;
function br(e2) {
var t2 = this.__data__;
if (fr) {
var n2 = t2[e2];
return n2 === mr ? void 0 : n2;
}
return gr.call(t2, e2) ? t2[e2] : void 0;
}
var yr = Object.prototype;
var wr = yr.hasOwnProperty;
function xr(e2) {
var t2 = this.__data__;
return fr ? t2[e2] !== void 0 : wr.call(t2, e2);
}
var Sr = "__lodash_hash_undefined__";
function Cr(e2, t2) {
var n2 = this.__data__;
this.size += this.has(e2) ? 0 : 1;
n2[e2] = fr && t2 === void 0 ? Sr : t2;
return this;
}
function kr(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length;
this.clear();
while (++t2 < n2) {
var o2 = e2[t2];
this.set(o2[0], o2[1]);
}
}
kr.prototype.clear = pr;
kr.prototype["delete"] = vr;
kr.prototype.get = br;
kr.prototype.has = xr;
kr.prototype.set = Cr;
function _r() {
this.__data__ = [];
this.size = 0;
}
function Er(e2, t2) {
var n2 = e2.length;
while (n2--) {
if (Yn(e2[n2][0], t2)) {
return n2;
}
}
return -1;
}
var Or = Array.prototype;
var Lr = Or.splice;
function Ar(e2) {
var t2 = this.__data__, n2 = Er(t2, e2);
if (n2 < 0) {
return false;
}
var o2 = t2.length - 1;
if (n2 == o2) {
t2.pop();
} else {
Lr.call(t2, n2, 1);
}
--this.size;
return true;
}
function Br(e2) {
var t2 = this.__data__, n2 = Er(t2, e2);
return n2 < 0 ? void 0 : t2[n2][1];
}
function Mr(e2) {
return Er(this.__data__, e2) > -1;
}
function Tr(e2, t2) {
var n2 = this.__data__, o2 = Er(n2, e2);
if (o2 < 0) {
++this.size;
n2.push([e2, t2]);
} else {
n2[o2][1] = t2;
}
return this;
}
function Ir(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length;
this.clear();
while (++t2 < n2) {
var o2 = e2[t2];
this.set(o2[0], o2[1]);
}
}
Ir.prototype.clear = _r;
Ir.prototype["delete"] = Ar;
Ir.prototype.get = Br;
Ir.prototype.has = Mr;
Ir.prototype.set = Tr;
var Rr = In(Mt, "Map");
function jr() {
this.size = 0;
this.__data__ = { hash: new kr(), map: new (Rr || Ir)(), string: new kr() };
}
function zr(e2) {
var t2 = typeof e2;
return t2 == "string" || t2 == "number" || t2 == "symbol" || t2 == "boolean" ? e2 !== "__proto__" : e2 === null;
}
function Fr(e2, t2) {
var n2 = e2.__data__;
return zr(t2) ? n2[typeof t2 == "string" ? "string" : "hash"] : n2.map;
}
function Pr(e2) {
var t2 = Fr(this, e2)["delete"](e2);
this.size -= t2 ? 1 : 0;
return t2;
}
function $r(e2) {
return Fr(this, e2).get(e2);
}
function Nr(e2) {
return Fr(this, e2).has(e2);
}
function Vr(e2, t2) {
var n2 = Fr(this, e2), o2 = n2.size;
n2.set(e2, t2);
this.size += n2.size == o2 ? 0 : 1;
return this;
}
function Dr(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length;
this.clear();
while (++t2 < n2) {
var o2 = e2[t2];
this.set(o2[0], o2[1]);
}
}
Dr.prototype.clear = jr;
Dr.prototype["delete"] = Pr;
Dr.prototype.get = $r;
Dr.prototype.has = Nr;
Dr.prototype.set = Vr;
var Hr = "Expected a function";
function Ur(e2, t2) {
if (typeof e2 != "function" || t2 != null && typeof t2 != "function") {
throw new TypeError(Hr);
}
var n2 = function() {
var o2 = arguments, r2 = t2 ? t2.apply(this, o2) : o2[0], a2 = n2.cache;
if (a2.has(r2)) {
return a2.get(r2);
}
var s2 = e2.apply(this, o2);
n2.cache = a2.set(r2, s2) || a2;
return s2;
};
n2.cache = new (Ur.Cache || Dr)();
return n2;
}
Ur.Cache = Dr;
var Wr = 500;
function qr(e2) {
var t2 = Ur(e2, function(e3) {
if (n2.size === Wr) {
n2.clear();
}
return e3;
});
var n2 = t2.cache;
return t2;
}
var Kr = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
var Yr = /\\(\\)?/g;
var Gr = qr(function(e2) {
var t2 = [];
if (e2.charCodeAt(0) === 46) {
t2.push("");
}
e2.replace(Kr, function(e3, n2, o2, r2) {
t2.push(o2 ? r2.replace(Yr, "$1") : n2 || e3);
});
return t2;
});
function Zr(e2) {
return e2 == null ? "" : Qt(e2);
}
function Xr(e2, t2) {
if (Gt(e2)) {
return e2;
}
return dr(e2, t2) ? [e2] : Gr(Zr(e2));
}
var Jr = 1 / 0;
function Qr(e2) {
if (typeof e2 == "string" || Kt(e2)) {
return e2;
}
var t2 = e2 + "";
return t2 == "0" && 1 / e2 == -Jr ? "-0" : t2;
}
function ea(e2, t2) {
t2 = Xr(t2, e2);
var n2 = 0, o2 = t2.length;
while (e2 != null && n2 < o2) {
e2 = e2[Qr(t2[n2++])];
}
return n2 && n2 == o2 ? e2 : void 0;
}
function ta(e2, t2, n2) {
var o2 = e2 == null ? void 0 : ea(e2, t2);
return o2 === void 0 ? n2 : o2;
}
function na(e2, t2) {
var n2 = -1, o2 = t2.length, r2 = e2.length;
while (++n2 < o2) {
e2[r2 + n2] = t2[n2];
}
return e2;
}
var oa = Tt ? Tt.isConcatSpreadable : void 0;
function ra(e2) {
return Gt(e2) || fo(e2) || !!(oa && e2 && e2[oa]);
}
function aa(e2, t2, n2, o2, r2) {
var a2 = -1, s2 = e2.length;
n2 || (n2 = ra);
r2 || (r2 = []);
while (++a2 < s2) {
var l2 = e2[a2];
if (n2(l2)) {
{
na(r2, l2);
}
} else {
r2[r2.length] = l2;
}
}
return r2;
}
function sa(e2) {
var t2 = e2 == null ? 0 : e2.length;
return t2 ? aa(e2) : [];
}
function la(e2) {
return Hn(Qn(e2, void 0, sa), e2 + "");
}
function ia() {
this.__data__ = new Ir();
this.size = 0;
}
function ua(e2) {
var t2 = this.__data__, n2 = t2["delete"](e2);
this.size = t2.size;
return n2;
}
function ca(e2) {
return this.__data__.get(e2);
}
function da(e2) {
return this.__data__.has(e2);
}
var fa = 200;
function pa(e2, t2) {
var n2 = this.__data__;
if (n2 instanceof Ir) {
var o2 = n2.__data__;
if (!Rr || o2.length < fa - 1) {
o2.push([e2, t2]);
this.size = ++n2.size;
return this;
}
n2 = this.__data__ = new Dr(o2);
}
n2.set(e2, t2);
this.size = n2.size;
return this;
}
function va(e2) {
var t2 = this.__data__ = new Ir(e2);
this.size = t2.size;
}
va.prototype.clear = ia;
va.prototype["delete"] = ua;
va.prototype.get = ca;
va.prototype.has = da;
va.prototype.set = pa;
function ma(e2, t2) {
var n2 = -1, o2 = e2 == null ? 0 : e2.length, r2 = 0, a2 = [];
while (++n2 < o2) {
var s2 = e2[n2];
if (t2(s2, n2, e2)) {
a2[r2++] = s2;
}
}
return a2;
}
function ha() {
return [];
}
var ga = Object.prototype;
var ba = ga.propertyIsEnumerable;
var ya = Object.getOwnPropertySymbols;
var wa = !ya ? ha : function(e2) {
if (e2 == null) {
return [];
}
e2 = Object(e2);
return ma(ya(e2), function(t2) {
return ba.call(e2, t2);
});
};
function xa(e2, t2, n2) {
var o2 = t2(e2);
return Gt(e2) ? o2 : na(o2, n2(e2));
}
function Sa(e2) {
return xa(e2, ir, wa);
}
var Ca = In(Mt, "DataView");
var ka = In(Mt, "Promise");
var _a = In(Mt, "Set");
var Ea = "[object Map]", Oa = "[object Object]", La = "[object Promise]", Aa = "[object Set]", Ba = "[object WeakMap]";
var Ma = "[object DataView]";
var Ta = Cn(Ca), Ia = Cn(Rr), Ra = Cn(ka), ja = Cn(_a), za = Cn(Rn);
var Fa = Ut;
if (Ca && Fa(new Ca(new ArrayBuffer(1))) != Ma || Rr && Fa(new Rr()) != Ea || ka && Fa(ka.resolve()) != La || _a && Fa(new _a()) != Aa || Rn && Fa(new Rn()) != Ba) {
Fa = function(e2) {
var t2 = Ut(e2), n2 = t2 == Oa ? e2.constructor : void 0, o2 = n2 ? Cn(n2) : "";
if (o2) {
switch (o2) {
case Ta:
return Ma;
case Ia:
return Ea;
case Ra:
return La;
case ja:
return Aa;
case za:
return Ba;
}
}
return t2;
};
}
var Pa = exports("aQ", Mt.Uint8Array);
var $a = "__lodash_hash_undefined__";
function Na(e2) {
this.__data__.set(e2, $a);
return this;
}
function Va(e2) {
return this.__data__.has(e2);
}
function Da(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length;
this.__data__ = new Dr();
while (++t2 < n2) {
this.add(e2[t2]);
}
}
Da.prototype.add = Da.prototype.push = Na;
Da.prototype.has = Va;
function Ha(e2, t2) {
var n2 = -1, o2 = e2 == null ? 0 : e2.length;
while (++n2 < o2) {
if (t2(e2[n2], n2, e2)) {
return true;
}
}
return false;
}
function Ua(e2, t2) {
return e2.has(t2);
}
var Wa = 1, qa = 2;
function Ka(e2, t2, n2, o2, r2, a2) {
var s2 = n2 & Wa, l2 = e2.length, i2 = t2.length;
if (l2 != i2 && !(s2 && i2 > l2)) {
return false;
}
var u2 = a2.get(e2);
var c2 = a2.get(t2);
if (u2 && c2) {
return u2 == t2 && c2 == e2;
}
var d2 = -1, f2 = true, p2 = n2 & qa ? new Da() : void 0;
a2.set(e2, t2);
a2.set(t2, e2);
while (++d2 < l2) {
var v2 = e2[d2], m2 = t2[d2];
if (o2) {
var h2 = s2 ? o2(m2, v2, d2, t2, e2, a2) : o2(v2, m2, d2, e2, t2, a2);
}
if (h2 !== void 0) {
if (h2) {
continue;
}
f2 = false;
break;
}
if (p2) {
if (!Ha(t2, function(e3, t3) {
if (!Ua(p2, t3) && (v2 === e3 || r2(v2, e3, n2, o2, a2))) {
return p2.push(t3);
}
})) {
f2 = false;
break;
}
} else if (!(v2 === m2 || r2(v2, m2, n2, o2, a2))) {
f2 = false;
break;
}
}
a2["delete"](e2);
a2["delete"](t2);
return f2;
}
function Ya(e2) {
var t2 = -1, n2 = Array(e2.size);
e2.forEach(function(e3, o2) {
n2[++t2] = [o2, e3];
});
return n2;
}
function Ga(e2) {
var t2 = -1, n2 = Array(e2.size);
e2.forEach(function(e3) {
n2[++t2] = e3;
});
return n2;
}
var Za = 1, Xa = 2;
var Ja = "[object Boolean]", Qa = "[object Date]", es = "[object Error]", ts = "[object Map]", ns = "[object Number]", os = "[object RegExp]", rs = "[object Set]", as = "[object String]", ss = "[object Symbol]";
var ls = "[object ArrayBuffer]", is = "[object DataView]";
var us = Tt ? Tt.prototype : void 0, cs = us ? us.valueOf : void 0;
function ds(e2, t2, n2, o2, r2, a2, s2) {
switch (n2) {
case is:
if (e2.byteLength != t2.byteLength || e2.byteOffset != t2.byteOffset) {
return false;
}
e2 = e2.buffer;
t2 = t2.buffer;
case ls:
if (e2.byteLength != t2.byteLength || !a2(new Pa(e2), new Pa(t2))) {
return false;
}
return true;
case Ja:
case Qa:
case ns:
return Yn(+e2, +t2);
case es:
return e2.name == t2.name && e2.message == t2.message;
case os:
case as:
return e2 == t2 + "";
case ts:
var l2 = Ya;
case rs:
var i2 = o2 & Za;
l2 || (l2 = Ga);
if (e2.size != t2.size && !i2) {
return false;
}
var u2 = s2.get(e2);
if (u2) {
return u2 == t2;
}
o2 |= Xa;
s2.set(e2, t2);
var c2 = Ka(l2(e2), l2(t2), o2, r2, a2, s2);
s2["delete"](e2);
return c2;
case ss:
if (cs) {
return cs.call(e2) == cs.call(t2);
}
}
return false;
}
var fs = 1;
var ps = Object.prototype;
var vs = ps.hasOwnProperty;
function ms(e2, t2, n2, o2, r2, a2) {
var s2 = n2 & fs, l2 = Sa(e2), i2 = l2.length, u2 = Sa(t2), c2 = u2.length;
if (i2 != c2 && !s2) {
return false;
}
var d2 = i2;
while (d2--) {
var f2 = l2[d2];
if (!(s2 ? f2 in t2 : vs.call(t2, f2))) {
return false;
}
}
var p2 = a2.get(e2);
var v2 = a2.get(t2);
if (p2 && v2) {
return p2 == t2 && v2 == e2;
}
var m2 = true;
a2.set(e2, t2);
a2.set(t2, e2);
var h2 = s2;
while (++d2 < i2) {
f2 = l2[d2];
var g2 = e2[f2], b2 = t2[f2];
if (o2) {
var y2 = s2 ? o2(b2, g2, f2, t2, e2, a2) : o2(g2, b2, f2, e2, t2, a2);
}
if (!(y2 === void 0 ? g2 === b2 || r2(g2, b2, n2, o2, a2) : y2)) {
m2 = false;
break;
}
h2 || (h2 = f2 == "constructor");
}
if (m2 && !h2) {
var w2 = e2.constructor, x2 = t2.constructor;
if (w2 != x2 && ("constructor" in e2 && "constructor" in t2) && !(typeof w2 == "function" && w2 instanceof w2 && typeof x2 == "function" && x2 instanceof x2)) {
m2 = false;
}
}
a2["delete"](e2);
a2["delete"](t2);
return m2;
}
var hs = 1;
var gs = "[object Arguments]", bs = "[object Array]", ys = "[object Object]";
var ws = Object.prototype;
var xs = ws.hasOwnProperty;
function Ss(e2, t2, n2, o2, r2, a2) {
var s2 = Gt(e2), l2 = Gt(t2), i2 = s2 ? bs : Fa(e2), u2 = l2 ? bs : Fa(t2);
i2 = i2 == gs ? ys : i2;
u2 = u2 == gs ? ys : u2;
var c2 = i2 == ys, d2 = u2 == ys, f2 = i2 == u2;
if (f2 && yo(e2)) {
if (!yo(t2)) {
return false;
}
s2 = true;
c2 = false;
}
if (f2 && !c2) {
a2 || (a2 = new va());
return s2 || Qo(e2) ? Ka(e2, t2, n2, o2, r2, a2) : ds(e2, t2, i2, n2, o2, r2, a2);
}
if (!(n2 & hs)) {
var p2 = c2 && xs.call(e2, "__wrapped__"), v2 = d2 && xs.call(t2, "__wrapped__");
if (p2 || v2) {
var m2 = p2 ? e2.value() : e2, h2 = v2 ? t2.value() : t2;
a2 || (a2 = new va());
return r2(m2, h2, n2, o2, a2);
}
}
if (!f2) {
return false;
}
a2 || (a2 = new va());
return ms(e2, t2, n2, o2, r2, a2);
}
function Cs(e2, t2, n2, o2, r2) {
if (e2 === t2) {
return true;
}
if (e2 == null || t2 == null || !Wt(e2) && !Wt(t2)) {
return e2 !== e2 && t2 !== t2;
}
return Ss(e2, t2, n2, o2, Cs, r2);
}
function ks(e2, t2) {
return e2 != null && t2 in Object(e2);
}
function _s(e2, t2, n2) {
t2 = Xr(t2, e2);
var o2 = -1, r2 = t2.length, a2 = false;
while (++o2 < r2) {
var s2 = Qr(t2[o2]);
if (!(a2 = e2 != null && n2(e2, s2))) {
break;
}
e2 = e2[s2];
}
if (a2 || ++o2 != r2) {
return a2;
}
r2 = e2 == null ? 0 : e2.length;
return !!r2 && to(r2) && qn(s2, r2) && (Gt(e2) || fo(e2));
}
function Es(e2, t2) {
return e2 != null && _s(e2, t2, ks);
}
var Os = function() {
return Mt.Date.now();
};
var Ls = "Expected a function";
var As = Math.max, Bs = Math.min;
function Ms(e2, t2, n2) {
var o2, r2, a2, s2, l2, i2, u2 = 0, c2 = false, d2 = false, f2 = true;
if (typeof e2 != "function") {
throw new TypeError(Ls);
}
t2 = dn(t2) || 0;
if (rn(n2)) {
c2 = !!n2.leading;
d2 = "maxWait" in n2;
a2 = d2 ? As(dn(n2.maxWait) || 0, t2) : a2;
f2 = "trailing" in n2 ? !!n2.trailing : f2;
}
function p2(t3) {
var n3 = o2, a3 = r2;
o2 = r2 = void 0;
u2 = t3;
s2 = e2.apply(a3, n3);
return s2;
}
function v2(e3) {
u2 = e3;
l2 = setTimeout(g2, t2);
return c2 ? p2(e3) : s2;
}
function m2(e3) {
var n3 = e3 - i2, o3 = e3 - u2, r3 = t2 - n3;
return d2 ? Bs(r3, a2 - o3) : r3;
}
function h2(e3) {
var n3 = e3 - i2, o3 = e3 - u2;
return i2 === void 0 || n3 >= t2 || n3 < 0 || d2 && o3 >= a2;
}
function g2() {
var e3 = Os();
if (h2(e3)) {
return b2(e3);
}
l2 = setTimeout(g2, m2(e3));
}
function b2(e3) {
l2 = void 0;
if (f2 && o2) {
return p2(e3);
}
o2 = r2 = void 0;
return s2;
}
function y2() {
if (l2 !== void 0) {
clearTimeout(l2);
}
u2 = 0;
o2 = i2 = r2 = l2 = void 0;
}
function w2() {
return l2 === void 0 ? s2 : b2(Os());
}
function x2() {
var e3 = Os(), n3 = h2(e3);
o2 = arguments;
r2 = this;
i2 = e3;
if (n3) {
if (l2 === void 0) {
return v2(i2);
}
if (d2) {
clearTimeout(l2);
l2 = setTimeout(g2, t2);
return p2(i2);
}
}
if (l2 === void 0) {
l2 = setTimeout(g2, t2);
}
return s2;
}
x2.cancel = y2;
x2.flush = w2;
return x2;
}
function Ts(e2) {
var t2 = -1, n2 = e2 == null ? 0 : e2.length, o2 = {};
while (++t2 < n2) {
var r2 = e2[t2];
o2[r2[0]] = r2[1];
}
return o2;
}
function Is(e2, t2) {
return Cs(e2, t2);
}
function Rs(e2) {
return e2 == null;
}
function js(e2) {
return e2 === void 0;
}
function zs(e2, t2, n2, o2) {
if (!rn(e2)) {
return e2;
}
t2 = Xr(t2, e2);
var r2 = -1, a2 = t2.length, s2 = a2 - 1, l2 = e2;
while (l2 != null && ++r2 < a2) {
var i2 = Qr(t2[r2]), u2 = n2;
if (i2 === "__proto__" || i2 === "constructor" || i2 === "prototype") {
return e2;
}
if (r2 != s2) {
var c2 = l2[i2];
u2 = void 0;
if (u2 === void 0) {
u2 = rn(c2) ? c2 : qn(t2[r2 + 1]) ? [] : {};
}
}
Xn(l2, i2, u2);
l2 = l2[i2];
}
return e2;
}
function Fs(e2, t2, n2) {
var o2 = -1, r2 = t2.length, a2 = {};
while (++o2 < r2) {
var s2 = t2[o2], l2 = ea(e2, s2);
if (n2(l2, s2)) {
zs(a2, Xr(s2, e2), l2);
}
}
return a2;
}
function Ps(e2, t2) {
return Fs(e2, t2, function(t3, n2) {
return Es(e2, n2);
});
}
var $s = la(function(e2, t2) {
return e2 == null ? {} : Ps(e2, t2);
});
function Ns(e2, t2, n2) {
return e2 == null ? e2 : zs(e2, t2, n2);
}
const Vs = exports("V", (e2) => e2 === void 0);
const Ds = exports("af", (e2) => typeof e2 === "boolean");
const Hs = exports("H", (e2) => typeof e2 === "number");
const Us = exports("b9", (e2) => !e2 && e2 !== 0 || mt(e2) && e2.length === 0 || yt(e2) && !Object.keys(e2).length);
const Ws = exports("au", (e2) => {
if (typeof Element === "undefined") return false;
return e2 instanceof Element;
});
const qs = (e2) => Rs(e2);
const Ks = (e2) => {
if (!bt(e2)) {
return false;
}
return !Number.isNaN(Number(e2));
};
const Ys = (e2) => Object.keys(e2);
const Gs = exports("aC", (e2, t2, n2) => ({ get value() {
return ta(e2, t2, n2);
}, set value(n3) {
Ns(e2, t2, n3);
} }));
class Zs extends Error {
constructor(e2) {
super(e2);
this.name = "ElementPlusError";
}
}
function Xs(e2, t2) {
throw new Zs(`[${e2}] ${t2}`);
}
function Js(e2, t2) {
}
const Qs = (e2 = "") => e2.split(" ").filter((e3) => !!e3.trim());
const el = exports("av", (e2, t2) => {
if (!e2 || !t2) return false;
if (t2.includes(" ")) throw new Error("className should not contain space.");
return e2.classList.contains(t2);
});
const tl = exports("y", (e2, t2) => {
if (!e2 || !t2.trim()) return;
e2.classList.add(...Qs(t2));
});
const nl = exports("A", (e2, t2) => {
if (!e2 || !t2.trim()) return;
e2.classList.remove(...Qs(t2));
});
const ol = exports("ba", (e2, t2) => {
var n2;
if (!Te || !e2 || !t2) return "";
let o2 = _t(t2);
if (o2 === "float") o2 = "cssFloat";
try {
const t3 = e2.style[o2];
if (t3) return t3;
const r2 = (n2 = document.defaultView) == null ? void 0 : n2.getComputedStyle(e2, "");
return r2 ? r2[o2] : "";
} catch (t3) {
return e2.style[o2];
}
});
function rl(e2, t2 = "px") {
if (!e2) return "";
if (Hs(e2) || Ks(e2)) {
return `${e2}${t2}`;
} else if (bt(e2)) {
return e2;
}
}
let al;
const sl = (e2) => {
var t2;
if (!Te) return 0;
if (al !== void 0) return al;
const n2 = document.createElement("div");
n2.className = `${e2}-scrollbar__wrap`;
n2.style.visibility = "hidden";
n2.style.width = "100px";
n2.style.position = "absolute";
n2.style.top = "-9999px";
document.body.appendChild(n2);
const o2 = n2.offsetWidth;
n2.style.overflow = "scroll";
const r2 = document.createElement("div");
r2.style.width = "100%";
n2.appendChild(r2);
const a2 = r2.offsetWidth;
(t2 = n2.parentNode) == null ? void 0 : t2.removeChild(n2);
al = o2 - a2;
return al;
};
/*! Element Plus Icons Vue v2.3.1 */
var ll = defineComponent({ name: "ArrowDown", __name: "arrow-down", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M831.872 340.864 512 652.672 192.128 340.864a30.592 30.592 0 0 0-42.752 0 29.12 29.12 0 0 0 0 41.6L489.664 714.24a32 32 0 0 0 44.672 0l340.288-331.712a29.12 29.12 0 0 0 0-41.728 30.592 30.592 0 0 0-42.752 0z" })]));
} });
var il = exports("i", ll);
var ul = defineComponent({ name: "ArrowLeft", __name: "arrow-left", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M609.408 149.376 277.76 489.6a32 32 0 0 0 0 44.672l331.648 340.352a29.12 29.12 0 0 0 41.728 0 30.592 30.592 0 0 0 0-42.752L339.264 511.936l311.872-319.872a30.592 30.592 0 0 0 0-42.688 29.12 29.12 0 0 0-41.728 0z" })]));
} });
var cl = exports("W", ul);
var dl = defineComponent({ name: "ArrowRight", __name: "arrow-right", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M340.864 149.312a30.592 30.592 0 0 0 0 42.752L652.736 512 340.864 831.872a30.592 30.592 0 0 0 0 42.752 29.12 29.12 0 0 0 41.728 0L714.24 534.336a32 32 0 0 0 0-44.672L382.592 149.376a29.12 29.12 0 0 0-41.728 0z" })]));
} });
var fl = exports("_", dl);
var pl = defineComponent({ name: "ArrowUp", __name: "arrow-up", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "m488.832 344.32-339.84 356.672a32 32 0 0 0 0 44.16l.384.384a29.44 29.44 0 0 0 42.688 0l320-335.872 319.872 335.872a29.44 29.44 0 0 0 42.688 0l.384-.384a32 32 0 0 0 0-44.16L535.168 344.32a32 32 0 0 0-46.336 0" })]));
} });
var vl = exports("v", pl);
var ml = defineComponent({ name: "Calendar", __name: "calendar", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M128 384v512h768V192H768v32a32 32 0 1 1-64 0v-32H320v32a32 32 0 0 1-64 0v-32H128v128h768v64zm192-256h384V96a32 32 0 1 1 64 0v32h160a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h160V96a32 32 0 0 1 64 0zm-32 384h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64" })]));
} });
var hl = exports("b4", ml);
var gl = defineComponent({ name: "CircleCheck", __name: "circle-check", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), createElementVNode("path", { fill: "currentColor", d: "M745.344 361.344a32 32 0 0 1 45.312 45.312l-288 288a32 32 0 0 1-45.312 0l-160-160a32 32 0 1 1 45.312-45.312L480 626.752l265.344-265.408z" })]));
} });
var bl = gl;
var yl = defineComponent({ name: "CircleCloseFilled", __name: "circle-close-filled", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m0 393.664L407.936 353.6a38.4 38.4 0 1 0-54.336 54.336L457.664 512 353.6 616.064a38.4 38.4 0 1 0 54.336 54.336L512 566.336 616.064 670.4a38.4 38.4 0 1 0 54.336-54.336L566.336 512 670.4 407.936a38.4 38.4 0 1 0-54.336-54.336z" })]));
} });
var wl = yl;
var xl = defineComponent({ name: "CircleClose", __name: "circle-close", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "m466.752 512-90.496-90.496a32 32 0 0 1 45.248-45.248L512 466.752l90.496-90.496a32 32 0 1 1 45.248 45.248L557.248 512l90.496 90.496a32 32 0 1 1-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 0 1-45.248-45.248z" }), createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" })]));
} });
var Sl = exports("a$", xl);
var Cl = defineComponent({ name: "Clock", __name: "clock", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), createElementVNode("path", { fill: "currentColor", d: "M480 256a32 32 0 0 1 32 32v256a32 32 0 0 1-64 0V288a32 32 0 0 1 32-32" }), createElementVNode("path", { fill: "currentColor", d: "M480 512h256q32 0 32 32t-32 32H480q-32 0-32-32t32-32" })]));
} });
var kl = exports("b3", Cl);
var _l = defineComponent({ name: "Close", __name: "close", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z" })]));
} });
var El = exports("E", _l);
var Ol = defineComponent({ name: "DArrowLeft", __name: "d-arrow-left", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M529.408 149.376a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L259.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L197.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224zm256 0a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L515.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L453.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224z" })]));
} });
var Ll = exports("b7", Ol);
var Al = defineComponent({ name: "DArrowRight", __name: "d-arrow-right", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M452.864 149.312a29.12 29.12 0 0 1 41.728.064L826.24 489.664a32 32 0 0 1 0 44.672L494.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L764.736 512 452.864 192a30.592 30.592 0 0 1 0-42.688m-256 0a29.12 29.12 0 0 1 41.728.064L570.24 489.664a32 32 0 0 1 0 44.672L238.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L508.736 512 196.864 192a30.592 30.592 0 0 1 0-42.688z" })]));
} });
var Bl = exports("b8", Al);
var Ml = defineComponent({ name: "Hide", __name: "hide", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M876.8 156.8c0-9.6-3.2-16-9.6-22.4-6.4-6.4-12.8-9.6-22.4-9.6-9.6 0-16 3.2-22.4 9.6L736 220.8c-64-32-137.6-51.2-224-60.8-160 16-288 73.6-377.6 176C44.8 438.4 0 496 0 512s48 73.6 134.4 176c22.4 25.6 44.8 48 73.6 67.2l-86.4 89.6c-6.4 6.4-9.6 12.8-9.6 22.4 0 9.6 3.2 16 9.6 22.4 6.4 6.4 12.8 9.6 22.4 9.6 9.6 0 16-3.2 22.4-9.6l704-710.4c3.2-6.4 6.4-12.8 6.4-22.4Zm-646.4 528c-76.8-70.4-128-128-153.6-172.8 28.8-48 80-105.6 153.6-172.8C304 272 400 230.4 512 224c64 3.2 124.8 19.2 176 44.8l-54.4 54.4C598.4 300.8 560 288 512 288c-64 0-115.2 22.4-160 64s-64 96-64 160c0 48 12.8 89.6 35.2 124.8L256 707.2c-9.6-6.4-19.2-16-25.6-22.4Zm140.8-96c-12.8-22.4-19.2-48-19.2-76.8 0-44.8 16-83.2 48-112 32-28.8 67.2-48 112-48 28.8 0 54.4 6.4 73.6 19.2zM889.599 336c-12.8-16-28.8-28.8-41.6-41.6l-48 48c73.6 67.2 124.8 124.8 150.4 169.6-28.8 48-80 105.6-153.6 172.8-73.6 67.2-172.8 108.8-284.8 115.2-51.2-3.2-99.2-12.8-140.8-28.8l-48 48c57.6 22.4 118.4 38.4 188.8 44.8 160-16 288-73.6 377.6-176C979.199 585.6 1024 528 1024 512s-48.001-73.6-134.401-176Z" }), createElementVNode("path", { fill: "currentColor", d: "M511.998 672c-12.8 0-25.6-3.2-38.4-6.4l-51.2 51.2c28.8 12.8 57.6 19.2 89.6 19.2 64 0 115.2-22.4 160-64 41.6-41.6 64-96 64-160 0-32-6.4-64-19.2-89.6l-51.2 51.2c3.2 12.8 6.4 25.6 6.4 38.4 0 44.8-16 83.2-48 112-32 28.8-67.2 48-112 48Z" })]));
} });
var Tl = Ml;
var Il = defineComponent({ name: "InfoFilled", __name: "info-filled", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896.064A448 448 0 0 1 512 64m67.2 275.072c33.28 0 60.288-23.104 60.288-57.344s-27.072-57.344-60.288-57.344c-33.28 0-60.16 23.104-60.16 57.344s26.88 57.344 60.16 57.344M590.912 699.2c0-6.848 2.368-24.64 1.024-34.752l-52.608 60.544c-10.88 11.456-24.512 19.392-30.912 17.28a12.992 12.992 0 0 1-8.256-14.72l87.68-276.992c7.168-35.136-12.544-67.2-54.336-71.296-44.096 0-108.992 44.736-148.48 101.504 0 6.784-1.28 23.68.064 33.792l52.544-60.608c10.88-11.328 23.552-19.328 29.952-17.152a12.8 12.8 0 0 1 7.808 16.128L388.48 728.576c-10.048 32.256 8.96 63.872 55.04 71.04 67.84 0 107.904-43.648 147.456-100.416z" })]));
} });
var Rl = Il;
var jl = defineComponent({ name: "Loading", __name: "loading", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32m0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32m448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32m-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32M195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0m-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z" })]));
} });
var zl = exports("k", jl);
var Fl = defineComponent({ name: "Minus", __name: "minus", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M128 544h768a32 32 0 1 0 0-64H128a32 32 0 0 0 0 64" })]));
} });
var Pl = exports("P", Fl);
var $l = defineComponent({ name: "Plus", __name: "plus", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M480 480V128a32 32 0 0 1 64 0v352h352a32 32 0 1 1 0 64H544v352a32 32 0 1 1-64 0V544H128a32 32 0 0 1 0-64z" })]));
} });
var Nl = exports("N", $l);
var Vl = defineComponent({ name: "Rank", __name: "rank", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "m186.496 544 41.408 41.344a32 32 0 1 1-45.248 45.312l-96-96a32 32 0 0 1 0-45.312l96-96a32 32 0 1 1 45.248 45.312L186.496 480h290.816V186.432l-41.472 41.472a32 32 0 1 1-45.248-45.184l96-96.128a32 32 0 0 1 45.312 0l96 96.064a32 32 0 0 1-45.248 45.184l-41.344-41.28V480H832l-41.344-41.344a32 32 0 0 1 45.248-45.312l96 96a32 32 0 0 1 0 45.312l-96 96a32 32 0 0 1-45.248-45.312L832 544H541.312v293.44l41.344-41.28a32 32 0 1 1 45.248 45.248l-96 96a32 32 0 0 1-45.312 0l-96-96a32 32 0 1 1 45.312-45.248l41.408 41.408V544H186.496z" })]));
} });
var Dl = exports("a2", Vl);
var Hl = defineComponent({ name: "Setting", __name: "setting", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M600.704 64a32 32 0 0 1 30.464 22.208l35.2 109.376c14.784 7.232 28.928 15.36 42.432 24.512l112.384-24.192a32 32 0 0 1 34.432 15.36L944.32 364.8a32 32 0 0 1-4.032 37.504l-77.12 85.12a357.12 357.12 0 0 1 0 49.024l77.12 85.248a32 32 0 0 1 4.032 37.504l-88.704 153.6a32 32 0 0 1-34.432 15.296L708.8 803.904c-13.44 9.088-27.648 17.28-42.368 24.512l-35.264 109.376A32 32 0 0 1 600.704 960H423.296a32 32 0 0 1-30.464-22.208L357.696 828.48a351.616 351.616 0 0 1-42.56-24.64l-112.32 24.256a32 32 0 0 1-34.432-15.36L79.68 659.2a32 32 0 0 1 4.032-37.504l77.12-85.248a357.12 357.12 0 0 1 0-48.896l-77.12-85.248A32 32 0 0 1 79.68 364.8l88.704-153.6a32 32 0 0 1 34.432-15.296l112.32 24.256c13.568-9.152 27.776-17.408 42.56-24.64l35.2-109.312A32 32 0 0 1 423.232 64H600.64zm-23.424 64H446.72l-36.352 113.088-24.512 11.968a294.113 294.113 0 0 0-34.816 20.096l-22.656 15.36-116.224-25.088-65.28 113.152 79.68 88.192-1.92 27.136a293.12 293.12 0 0 0 0 40.192l1.92 27.136-79.808 88.192 65.344 113.152 116.224-25.024 22.656 15.296a294.113 294.113 0 0 0 34.816 20.096l24.512 11.968L446.72 896h130.688l36.48-113.152 24.448-11.904a288.282 288.282 0 0 0 34.752-20.096l22.592-15.296 116.288 25.024 65.28-113.152-79.744-88.192 1.92-27.136a293.12 293.12 0 0 0 0-40.256l-1.92-27.136 79.808-88.128-65.344-113.152-116.288 24.96-22.592-15.232a287.616 287.616 0 0 0-34.752-20.096l-24.448-11.904L577.344 128zM512 320a192 192 0 1 1 0 384 192 192 0 0 1 0-384m0 64a128 128 0 1 0 0 256 128 128 0 0 0 0-256" })]));
} });
var Ul = exports("a3", Hl);
var Wl = defineComponent({ name: "SuccessFilled", __name: "success-filled", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m-55.808 536.384-99.52-99.584a38.4 38.4 0 1 0-54.336 54.336l126.72 126.72a38.272 38.272 0 0 0 54.336 0l262.4-262.464a38.4 38.4 0 1 0-54.272-54.336z" })]));
} });
var ql = Wl;
var Kl = defineComponent({ name: "View", __name: "view", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352m0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 1 1 0 448 224 224 0 0 1 0-448m0 64a160.192 160.192 0 0 0-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160" })]));
} });
var Yl = Kl;
var Gl = defineComponent({ name: "WarningFilled", __name: "warning-filled", setup(e2) {
return (e3, r2) => (openBlock(), createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m0 192a58.432 58.432 0 0 0-58.24 63.744l23.36 256.384a35.072 35.072 0 0 0 69.76 0l23.296-256.384A58.432 58.432 0 0 0 512 256m0 512a51.2 51.2 0 1 0 0-102.4 51.2 51.2 0 0 0 0 102.4" })]));
} });
var Zl = Gl;
const Xl = "__epPropKey";
const Jl = exports("J", (e2) => e2);
const Ql = (e2) => yt(e2) && !!e2[Xl];
const ei = (e2, t2) => {
if (!yt(e2) || Ql(e2)) return e2;
const { values: n2, required: o2, default: a2, type: s2, validator: l2 } = e2;
const i2 = n2 || l2 ? (o3) => {
let s3 = false;
let i3 = [];
if (n2) {
i3 = Array.from(n2);
if (vt(e2, "default")) {
i3.push(a2);
}
s3 || (s3 = i3.includes(o3));
}
if (l2) s3 || (s3 = l2(o3));
if (!s3 && i3.length > 0) {
const e3 = [...new Set(i3)].map((e4) => JSON.stringify(e4)).join(", ");
warn(`Invalid prop: validation failed${t2 ? ` for prop "${t2}"` : ""}. Expected one of [${e3}], got value ${JSON.stringify(o3)}.`);
}
return s3;
} : void 0;
const u2 = { type: s2, required: !!o2, validator: i2, [Xl]: true };
if (vt(e2, "default")) u2.default = a2;
return u2;
};
const ti = exports("t", (e2) => Ts(Object.entries(e2).map(([e3, t2]) => [e3, ei(t2, e3)])));
const ni = exports("g", Jl([String, Object, Function]));
const oi = { Close: El };
const ri = { Close: El, SuccessFilled: ql, InfoFilled: Rl, WarningFilled: Zl, CircleCloseFilled: wl };
const ai = { success: ql, warning: Zl, error: wl, info: Rl };
const si = { validating: zl, success: bl, error: Sl };
const li = exports("l", (e2, t2) => {
e2.install = (n2) => {
for (const o2 of [e2, ...Object.values(t2 != null ? t2 : {})]) {
n2.component(o2.name, o2);
}
};
if (t2) {
for (const [n2, o2] of Object.entries(t2)) {
e2[n2] = o2;
}
}
return e2;
});
const ii = (e2, t2) => {
e2.install = (n2) => {
e2._context = n2._context;
n2.config.globalProperties[t2] = e2;
};
return e2;
};
const ui = exports("I", (e2) => {
e2.install = ft;
return e2;
});
const ci = (...e2) => (t2) => {
e2.forEach((e3) => {
if (gt(e3)) {
e3(t2);
} else {
e3.value = t2;
}
});
};
const di = exports("a0", { tab: "Tab", enter: "Enter", space: "Space", left: "ArrowLeft", up: "ArrowUp", right: "ArrowRight", down: "ArrowDown", esc: "Escape", delete: "Delete", backspace: "Backspace", numpadEnter: "NumpadEnter", pageUp: "PageUp", pageDown: "PageDown", home: "Home", end: "End" });
const fi = exports("f", "update:modelValue");
const pi = exports("p", "change");
const vi = exports("h", "input");
const mi = exports("ad", ["", "default", "small", "large"]);
var hi = ((e2) => {
e2[e2["TEXT"] = 1] = "TEXT";
e2[e2["CLASS"] = 2] = "CLASS";
e2[e2["STYLE"] = 4] = "STYLE";
e2[e2["PROPS"] = 8] = "PROPS";
e2[e2["FULL_PROPS"] = 16] = "FULL_PROPS";
e2[e2["HYDRATE_EVENTS"] = 32] = "HYDRATE_EVENTS";
e2[e2["STABLE_FRAGMENT"] = 64] = "STABLE_FRAGMENT";
e2[e2["KEYED_FRAGMENT"] = 128] = "KEYED_FRAGMENT";
e2[e2["UNKEYED_FRAGMENT"] = 256] = "UNKEYED_FRAGMENT";
e2[e2["NEED_PATCH"] = 512] = "NEED_PATCH";
e2[e2["DYNAMIC_SLOTS"] = 1024] = "DYNAMIC_SLOTS";
e2[e2["HOISTED"] = -1] = "HOISTED";
e2[e2["BAIL"] = -2] = "BAIL";
return e2;
})(hi || {});
const gi = exports("aB", (e2) => {
const t2 = mt(e2) ? e2 : [e2];
const n2 = [];
t2.forEach((e3) => {
var t3;
if (mt(e3)) {
n2.push(...gi(e3));
} else if (isVNode(e3) && mt(e3.children)) {
n2.push(...gi(e3.children));
} else {
n2.push(e3);
if (isVNode(e3) && ((t3 = e3.component) == null ? void 0 : t3.subTree)) {
n2.push(...gi(e3.component.subTree));
}
}
});
return n2;
});
const bi = (e2) => /([\uAC00-\uD7AF\u3130-\u318F])+/gi.test(e2);
const yi = exports("L", (e2) => e2);
const wi = ["class", "style"];
const xi = /^on[A-Z]/;
const Si = (e2 = {}) => {
const { excludeListeners: t2 = false, excludeKeys: n2 } = e2;
const o2 = computed(() => ((n2 == null ? void 0 : n2.value) || []).concat(wi));
const r2 = getCurrentInstance();
if (!r2) {
return computed(() => ({}));
}
return computed(() => {
var e3;
return Ts(Object.entries((e3 = r2.proxy) == null ? void 0 : e3.$attrs).filter(([e4]) => !o2.value.includes(e4) && !(t2 && xi.test(e4))));
});
};
const Ci = exports("C", ({ from: e2, replacement: t2, scope: n2, version: o2, ref: r2, type: a2 = "API" }, s2) => {
watch(() => unref(s2), (e3) => {
}, { immediate: true });
});
const ki = (e2, t2, n2, o2) => {
let r2 = { offsetX: 0, offsetY: 0 };
const a2 = (t3) => {
const n3 = t3.clientX;
const a3 = t3.clientY;
const { offsetX: s3, offsetY: l3 } = r2;
const i3 = e2.value.getBoundingClientRect();
const u2 = i3.left;
const c2 = i3.top;
const d2 = i3.width;
const f2 = i3.height;
const p2 = document.documentElement.clientWidth;
const v2 = document.documentElement.clientHeight;
const m2 = -u2 + s3;
const h2 = -c2 + l3;
const g2 = p2 - u2 - d2 + s3;
const b2 = v2 - c2 - f2 + l3;
const y2 = (t4) => {
let i4 = s3 + t4.clientX - n3;
let u3 = l3 + t4.clientY - a3;
if (!(o2 == null ? void 0 : o2.value)) {
i4 = Math.min(Math.max(i4, m2), g2);
u3 = Math.min(Math.max(u3, h2), b2);
}
r2 = { offsetX: i4, offsetY: u3 };
if (e2.value) {
e2.value.style.transform = `translate(${rl(i4)}, ${rl(u3)})`;
}
};
const w2 = () => {
document.removeEventListener("mousemove", y2);
document.removeEventListener("mouseup", w2);
};
document.addEventListener("mousemove", y2);
document.addEventListener("mouseup", w2);
};
const s2 = () => {
if (t2.value && e2.value) {
t2.value.addEventListener("mousedown", a2);
}
};
const l2 = () => {
if (t2.value && e2.value) {
t2.value.removeEventListener("mousedown", a2);
}
};
const i2 = () => {
r2 = { offsetX: 0, offsetY: 0 };
if (e2.value) {
e2.value.style.transform = "none";
}
};
onMounted(() => {
watchEffect(() => {
if (n2.value) {
s2();
} else {
l2();
}
});
});
onBeforeUnmount(() => {
l2();
});
return { resetPostion: i2 };
};
var _i = { name: "en", el: { breadcrumb: { label: "Breadcrumb" }, colorpicker: { confirm: "OK", clear: "Clear", defaultLabel: "color picker", description: "current color is {color}. press enter to select a new color.", alphaLabel: "pick alpha value" }, datepicker: { now: "Now", today: "Today", cancel: "Cancel", clear: "Clear", confirm: "OK", dateTablePrompt: "Use the arrow keys and enter to select the day of the month", monthTablePrompt: "Use the arrow keys and enter to select the month", yearTablePrompt: "Use the arrow keys and enter to select the year", selectedDate: "Selected date", selectDate: "Select date", selectTime: "Select time", startDate: "Start Date", startTime: "Start Time", endDate: "End Date", endTime: "End Time", prevYear: "Previous Year", nextYear: "Next Year", prevMonth: "Previous Month", nextMonth: "Next Month", year: "", month1: "January", month2: "February", month3: "March", month4: "April", month5: "May", month6: "June", month7: "July", month8: "August", month9: "September", month10: "October", month11: "November", month12: "December", week: "week", weeks: { sun: "Sun", mon: "Mon", tue: "Tue", wed: "Wed", thu: "Thu", fri: "Fri", sat: "Sat" }, weeksFull: { sun: "Sunday", mon: "Monday", tue: "Tuesday", wed: "Wednesday", thu: "Thursday", fri: "Friday", sat: "Saturday" }, months: { jan: "Jan", feb: "Feb", mar: "Mar", apr: "Apr", may: "May", jun: "Jun", jul: "Jul", aug: "Aug", sep: "Sep", oct: "Oct", nov: "Nov", dec: "Dec" } }, inputNumber: { decrease: "decrease number", increase: "increase number" }, select: { loading: "Loading", noMatch: "No matching data", noData: "No data", placeholder: "Select" }, mention: { loading: "Loading" }, dropdown: { toggleDropdown: "Toggle Dropdown" }, cascader: { noMatch: "No matching data", loading: "Loading", placeholder: "Select", noData: "No data" }, pagination: { goto: "Go to", pagesize: "/page", total: "Total {total}", pageClassifier: "", page: "Page", prev: "Go to previous page", next: "Go to next page", currentPage: "page {pager}", prevPages: "Previous {pager} pages", nextPages: "Next {pager} pages", deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details" }, dialog: { close: "Close this dialog" }, drawer: { close: "Close this dialog" }, messagebox: { title: "Message", confirm: "OK", cancel: "Cancel", error: "Illegal input", close: "Close this dialog" }, upload: { deleteTip: "press delete to remove", delete: "Delete", preview: "Preview", continue: "Continue" }, slider: { defaultLabel: "slider between {min} and {max}", defaultRangeStartLabel: "pick start value", defaultRangeEndLabel: "pick end value" }, table: { emptyText: "No Data", confirmFilter: "Confirm", resetFilter: "Reset", clearFilter: "All", sumText: "Sum" }, tour: { next: "Next", previous: "Previous", finish: "Finish" }, tree: { emptyText: "No Data" }, transfer: { noMatch: "No matching data", noData: "No data", titles: ["List 1", "List 2"], filterPlaceholder: "Enter keyword", noCheckedFormat: "{total} items", hasCheckedFormat: "{checked}/{total} checked" }, image: { error: "FAILED" }, pageHeader: { title: "Back" }, popconfirm: { confirmButtonText: "Yes", cancelButtonText: "No" }, carousel: { leftArrow: "Carousel arrow left", rightArrow: "Carousel arrow right", indicator: "Carousel switch to index {index}" } } };
const Ei = (e2) => (t2, n2) => Oi(t2, n2, unref(e2));
const Oi = (e2, t2, n2) => ta(n2, e2, e2).replace(/\{(\w+)\}/g, (e3, n3) => {
var o2;
return `${(o2 = t2 == null ? void 0 : t2[n3]) != null ? o2 : `{${n3}}`}`;
});
const Li = (e2) => {
const t2 = computed(() => unref(e2).name);
const n2 = isRef(e2) ? e2 : ref(e2);
return { lang: t2, locale: n2, t: Ei(e2) };
};
const Ai = Symbol("localeContextKey");
const Bi = exports("B", (e2) => {
const t2 = e2 || inject(Ai, ref());
return Li(computed(() => t2.value || _i));
});
const Mi = "el";
const Ti = "is-";
const Ii = (e2, t2, n2, o2, r2) => {
let a2 = `${e2}-${t2}`;
if (n2) {
a2 += `-${n2}`;
}
if (o2) {
a2 += `__${o2}`;
}
if (r2) {
a2 += `--${r2}`;
}
return a2;
};
const Ri = Symbol("namespaceContextKey");
const ji = (e2) => {
const t2 = e2 || (getCurrentInstance() ? inject(Ri, ref(Mi)) : ref(Mi));
const n2 = computed(() => unref(t2) || Mi);
return n2;
};
const zi = exports("z", (e2, t2) => {
const n2 = ji(t2);
const o2 = (t3 = "") => Ii(n2.value, e2, t3, "", "");
const r2 = (t3) => t3 ? Ii(n2.value, e2, "", t3, "") : "";
const a2 = (t3) => t3 ? Ii(n2.value, e2, "", "", t3) : "";
const s2 = (t3, o3) => t3 && o3 ? Ii(n2.value, e2, t3, o3, "") : "";
const l2 = (t3, o3) => t3 && o3 ? Ii(n2.value, e2, "", t3, o3) : "";
const i2 = (t3, o3) => t3 && o3 ? Ii(n2.value, e2, t3, "", o3) : "";
const u2 = (t3, o3, r3) => t3 && o3 && r3 ? Ii(n2.value, e2, t3, o3, r3) : "";
const c2 = (e3, ...t3) => {
const n3 = t3.length >= 1 ? t3[0] : true;
return e3 && n3 ? `${Ti}${e3}` : "";
};
const d2 = (e3) => {
const t3 = {};
for (const o3 in e3) {
if (e3[o3]) {
t3[`--${n2.value}-${o3}`] = e3[o3];
}
}
return t3;
};
const f2 = (t3) => {
const o3 = {};
for (const r3 in t3) {
if (t3[r3]) {
o3[`--${n2.value}-${e2}-${r3}`] = t3[r3];
}
}
return o3;
};
const p2 = (e3) => `--${n2.value}-${e3}`;
const v2 = (t3) => `--${n2.value}-${e2}-${t3}`;
return { namespace: n2, b: o2, e: r2, m: a2, be: s2, em: l2, bm: i2, bem: u2, is: c2, cssVar: d2, cssVarName: p2, cssVarBlock: f2, cssVarBlockName: v2 };
});
const Fi = (e2, t2 = {}) => {
if (!isRef(e2)) {
Xs("[useLockscreen]", "You need to pass a ref param to this function");
}
const n2 = t2.ns || zi("popup");
const o2 = computed(() => n2.bm("parent", "hidden"));
if (!Te || el(document.body, o2.value)) {
return;
}
let r2 = 0;
let a2 = false;
let l2 = "0";
const u2 = () => {
setTimeout(() => {
nl(document == null ? void 0 : document.body, o2.value);
if (a2 && document) {
document.body.style.width = l2;
}
}, 200);
};
watch(e2, (e3) => {
if (!e3) {
u2();
return;
}
a2 = !el(document.body, o2.value);
if (a2) {
l2 = document.body.style.width;
}
r2 = sl(n2.namespace.value);
const t3 = document.documentElement.clientHeight < document.body.scrollHeight;
const s2 = ol(document.body, "overflowY");
if (r2 > 0 && (t3 || s2 === "scroll") && a2) {
document.body.style.width = `calc(100% - ${r2}px)`;
}
tl(document.body, o2.value);
});
onScopeDispose$1(() => u2());
};
const Pi = ei({ type: Jl(Boolean), default: null });
const $i = ei({ type: Jl(Function) });
const Ni = (e2) => {
const t2 = `update:${e2}`;
const n2 = `onUpdate:${e2}`;
const o2 = [t2];
const r2 = { [e2]: Pi, [n2]: $i };
const a2 = ({ indicator: o3, toggleReason: r3, shouldHideWhenRouteChanges: a3, shouldProceed: u2, onShow: d2, onHide: f2 }) => {
const p2 = getCurrentInstance();
const { emit: v2 } = p2;
const m2 = p2.props;
const h2 = computed(() => gt(m2[n2]));
const g2 = computed(() => m2[e2] === null);
const b2 = (e3) => {
if (o3.value === true) {
return;
}
o3.value = true;
if (r3) {
r3.value = e3;
}
if (gt(d2)) {
d2(e3);
}
};
const y2 = (e3) => {
if (o3.value === false) {
return;
}
o3.value = false;
if (r3) {
r3.value = e3;
}
if (gt(f2)) {
f2(e3);
}
};
const w2 = (e3) => {
if (m2.disabled === true || gt(u2) && !u2()) return;
const n3 = h2.value && Te;
if (n3) {
v2(t2, true);
}
if (g2.value || !n3) {
b2(e3);
}
};
const x2 = (e3) => {
if (m2.disabled === true || !Te) return;
const n3 = h2.value && Te;
if (n3) {
v2(t2, false);
}
if (g2.value || !n3) {
y2(e3);
}
};
const S2 = (e3) => {
if (!Ds(e3)) return;
if (m2.disabled && e3) {
if (h2.value) {
v2(t2, false);
}
} else if (o3.value !== e3) {
if (e3) {
b2();
} else {
y2();
}
}
};
const C2 = () => {
if (o3.value) {
x2();
} else {
w2();
}
};
watch(() => m2[e2], S2);
if (a3 && p2.appContext.config.globalProperties.$route !== void 0) {
watch(() => ({ ...p2.proxy.$route }), () => {
if (a3.value && o3.value) {
x2();
}
});
}
onMounted(() => {
S2(m2[e2]);
});
return { hide: x2, show: w2, toggle: C2, hasUpdateHandler: h2 };
};
return { useModelToggle: a2, useModelToggleProps: r2, useModelToggleEmits: o2 };
};
const Vi = (e2) => {
const t2 = getCurrentInstance();
return computed(() => {
var n2, o2;
return (o2 = (n2 = t2 == null ? void 0 : t2.proxy) == null ? void 0 : n2.$props) == null ? void 0 : o2[e2];
});
};
var Di = "top", Hi = "bottom", Ui = "right", Wi = "left", qi = "auto", Ki = [Di, Hi, Ui, Wi], Yi = "start", Gi = "end", Zi = "clippingParents", Xi = "viewport", Ji = "popper", Qi = "reference", eu = Ki.reduce(function(e2, t2) {
return e2.concat([t2 + "-" + Yi, t2 + "-" + Gi]);
}, []), tu = [].concat(Ki, [qi]).reduce(function(e2, t2) {
return e2.concat([t2, t2 + "-" + Yi, t2 + "-" + Gi]);
}, []), nu = "beforeRead", ou = "read", ru = "afterRead", au = "beforeMain", su = "main", lu = "afterMain", iu = "beforeWrite", uu = "write", cu = "afterWrite", du = [nu, ou, ru, au, su, lu, iu, uu, cu];
function fu(e2) {
return e2 ? (e2.nodeName || "").toLowerCase() : null;
}
function pu(e2) {
if (e2 == null) return window;
if (e2.toString() !== "[object Window]") {
var t2 = e2.ownerDocument;
return t2 && t2.defaultView || window;
}
return e2;
}
function vu(e2) {
var t2 = pu(e2).Element;
return e2 instanceof t2 || e2 instanceof Element;
}
function mu(e2) {
var t2 = pu(e2).HTMLElement;
return e2 instanceof t2 || e2 instanceof HTMLElement;
}
function hu(e2) {
if (typeof ShadowRoot == "undefined") return false;
var t2 = pu(e2).ShadowRoot;
return e2 instanceof t2 || e2 instanceof ShadowRoot;
}
function gu(e2) {
var t2 = e2.state;
Object.keys(t2.elements).forEach(function(e3) {
var n2 = t2.styles[e3] || {}, o2 = t2.attributes[e3] || {}, r2 = t2.elements[e3];
!mu(r2) || !fu(r2) || (Object.assign(r2.style, n2), Object.keys(o2).forEach(function(e4) {
var t3 = o2[e4];
t3 === false ? r2.removeAttribute(e4) : r2.setAttribute(e4, t3 === true ? "" : t3);
}));
});
}
function bu(e2) {
var t2 = e2.state, n2 = { popper: { position: t2.options.strategy, left: "0", top: "0", margin: "0" }, arrow: { position: "absolute" }, reference: {} };
return Object.assign(t2.elements.popper.style, n2.popper), t2.styles = n2, t2.elements.arrow && Object.assign(t2.elements.arrow.style, n2.arrow), function() {
Object.keys(t2.elements).forEach(function(e3) {
var o2 = t2.elements[e3], r2 = t2.attributes[e3] || {}, a2 = Object.keys(t2.styles.hasOwnProperty(e3) ? t2.styles[e3] : n2[e3]), s2 = a2.reduce(function(e4, t3) {
return e4[t3] = "", e4;
}, {});
!mu(o2) || !fu(o2) || (Object.assign(o2.style, s2), Object.keys(r2).forEach(function(e4) {
o2.removeAttribute(e4);
}));
});
};
}
var yu = { name: "applyStyles", enabled: true, phase: "write", fn: gu, effect: bu, requires: ["computeStyles"] };
function wu(e2) {
return e2.split("-")[0];
}
var xu = Math.max, Su = Math.min, Cu = Math.round;
function ku(e2, t2) {
t2 === void 0 && (t2 = false);
var n2 = e2.getBoundingClientRect(), o2 = 1, r2 = 1;
if (mu(e2) && t2) {
var a2 = e2.offsetHeight, s2 = e2.offsetWidth;
s2 > 0 && (o2 = Cu(n2.width) / s2 || 1), a2 > 0 && (r2 = Cu(n2.height) / a2 || 1);
}
return { width: n2.width / o2, height: n2.height / r2, top: n2.top / r2, right: n2.right / o2, bottom: n2.bottom / r2, left: n2.left / o2, x: n2.left / o2, y: n2.top / r2 };
}
function _u(e2) {
var t2 = ku(e2), n2 = e2.offsetWidth, o2 = e2.offsetHeight;
return Math.abs(t2.width - n2) <= 1 && (n2 = t2.width), Math.abs(t2.height - o2) <= 1 && (o2 = t2.height), { x: e2.offsetLeft, y: e2.offsetTop, width: n2, height: o2 };
}
function Eu(e2, t2) {
var n2 = t2.getRootNode && t2.getRootNode();
if (e2.contains(t2)) return true;
if (n2 && hu(n2)) {
var o2 = t2;
do {
if (o2 && e2.isSameNode(o2)) return true;
o2 = o2.parentNode || o2.host;
} while (o2);
}
return false;
}
function Ou(e2) {
return pu(e2).getComputedStyle(e2);
}
function Lu(e2) {
return ["table", "td", "th"].indexOf(fu(e2)) >= 0;
}
function Au(e2) {
return ((vu(e2) ? e2.ownerDocument : e2.document) || window.document).documentElement;
}
function Bu(e2) {
return fu(e2) === "html" ? e2 : e2.assignedSlot || e2.parentNode || (hu(e2) ? e2.host : null) || Au(e2);
}
function Mu(e2) {
return !mu(e2) || Ou(e2).position === "fixed" ? null : e2.offsetParent;
}
function Tu(e2) {
var t2 = navigator.userAgent.toLowerCase().indexOf("firefox") !== -1, n2 = navigator.userAgent.indexOf("Trident") !== -1;
if (n2 && mu(e2)) {
var o2 = Ou(e2);
if (o2.position === "fixed") return null;
}
var r2 = Bu(e2);
for (hu(r2) && (r2 = r2.host); mu(r2) && ["html", "body"].indexOf(fu(r2)) < 0; ) {
var a2 = Ou(r2);
if (a2.transform !== "none" || a2.perspective !== "none" || a2.contain === "paint" || ["transform", "perspective"].indexOf(a2.willChange) !== -1 || t2 && a2.willChange === "filter" || t2 && a2.filter && a2.filter !== "none") return r2;
r2 = r2.parentNode;
}
return null;
}
function Iu(e2) {
for (var t2 = pu(e2), n2 = Mu(e2); n2 && Lu(n2) && Ou(n2).position === "static"; ) n2 = Mu(n2);
return n2 && (fu(n2) === "html" || fu(n2) === "body" && Ou(n2).position === "static") ? t2 : n2 || Tu(e2) || t2;
}
function Ru(e2) {
return ["top", "bottom"].indexOf(e2) >= 0 ? "x" : "y";
}
function ju(e2, t2, n2) {
return xu(e2, Su(t2, n2));
}
function zu(e2, t2, n2) {
var o2 = ju(e2, t2, n2);
return o2 > n2 ? n2 : o2;
}
function Fu() {
return { top: 0, right: 0, bottom: 0, left: 0 };
}
function Pu(e2) {
return Object.assign({}, Fu(), e2);
}
function $u(e2, t2) {
return t2.reduce(function(t3, n2) {
return t3[n2] = e2, t3;
}, {});
}
var Nu = function(e2, t2) {
return e2 = typeof e2 == "function" ? e2(Object.assign({}, t2.rects, { placement: t2.placement })) : e2, Pu(typeof e2 != "number" ? e2 : $u(e2, Ki));
};
function Vu(e2) {
var t2, n2 = e2.state, o2 = e2.name, r2 = e2.options, a2 = n2.elements.arrow, s2 = n2.modifiersData.popperOffsets, l2 = wu(n2.placement), i2 = Ru(l2), u2 = [Wi, Ui].indexOf(l2) >= 0, c2 = u2 ? "height" : "width";
if (!(!a2 || !s2)) {
var d2 = Nu(r2.padding, n2), f2 = _u(a2), p2 = i2 === "y" ? Di : Wi, v2 = i2 === "y" ? Hi : Ui, m2 = n2.rects.reference[c2] + n2.rects.reference[i2] - s2[i2] - n2.rects.popper[c2], h2 = s2[i2] - n2.rects.reference[i2], g2 = Iu(a2), b2 = g2 ? i2 === "y" ? g2.clientHeight || 0 : g2.clientWidth || 0 : 0, y2 = m2 / 2 - h2 / 2, w2 = d2[p2], x2 = b2 - f2[c2] - d2[v2], S2 = b2 / 2 - f2[c2] / 2 + y2, C2 = ju(w2, S2, x2), k2 = i2;
n2.modifiersData[o2] = (t2 = {}, t2[k2] = C2, t2.centerOffset = C2 - S2, t2);
}
}
function Du(e2) {
var t2 = e2.state, n2 = e2.options, o2 = n2.element, r2 = o2 === void 0 ? "[data-popper-arrow]" : o2;
r2 != null && (typeof r2 == "string" && (r2 = t2.elements.popper.querySelector(r2), !r2) || !Eu(t2.elements.popper, r2) || (t2.elements.arrow = r2));
}
var Hu = { name: "arrow", enabled: true, phase: "main", fn: Vu, effect: Du, requires: ["popperOffsets"], requiresIfExists: ["preventOverflow"] };
function Uu(e2) {
return e2.split("-")[1];
}
var Wu = { top: "auto", right: "auto", bottom: "auto", left: "auto" };
function qu(e2) {
var t2 = e2.x, n2 = e2.y, o2 = window, r2 = o2.devicePixelRatio || 1;
return { x: Cu(t2 * r2) / r2 || 0, y: Cu(n2 * r2) / r2 || 0 };
}
function Ku(e2) {
var t2, n2 = e2.popper, o2 = e2.popperRect, r2 = e2.placement, a2 = e2.variation, s2 = e2.offsets, l2 = e2.position, i2 = e2.gpuAcceleration, u2 = e2.adaptive, c2 = e2.roundOffsets, d2 = e2.isFixed, f2 = s2.x, p2 = f2 === void 0 ? 0 : f2, v2 = s2.y, m2 = v2 === void 0 ? 0 : v2, h2 = typeof c2 == "function" ? c2({ x: p2, y: m2 }) : { x: p2, y: m2 };
p2 = h2.x, m2 = h2.y;
var g2 = s2.hasOwnProperty("x"), b2 = s2.hasOwnProperty("y"), y2 = Wi, w2 = Di, x2 = window;
if (u2) {
var S2 = Iu(n2), C2 = "clientHeight", k2 = "clientWidth";
if (S2 === pu(n2) && (S2 = Au(n2), Ou(S2).position !== "static" && l2 === "absolute" && (C2 = "scrollHeight", k2 = "scrollWidth")), S2 = S2, r2 === Di || (r2 === Wi || r2 === Ui) && a2 === Gi) {
w2 = Hi;
var _2 = d2 && S2 === x2 && x2.visualViewport ? x2.visualViewport.height : S2[C2];
m2 -= _2 - o2.height, m2 *= i2 ? 1 : -1;
}
if (r2 === Wi || (r2 === Di || r2 === Hi) && a2 === Gi) {
y2 = Ui;
var E2 = d2 && S2 === x2 && x2.visualViewport ? x2.visualViewport.width : S2[k2];
p2 -= E2 - o2.width, p2 *= i2 ? 1 : -1;
}
}
var O2 = Object.assign({ position: l2 }, u2 && Wu), L2 = c2 === true ? qu({ x: p2, y: m2 }) : { x: p2, y: m2 };
if (p2 = L2.x, m2 = L2.y, i2) {
var A2;
return Object.assign({}, O2, (A2 = {}, A2[w2] = b2 ? "0" : "", A2[y2] = g2 ? "0" : "", A2.transform = (x2.devicePixelRatio || 1) <= 1 ? "translate(" + p2 + "px, " + m2 + "px)" : "translate3d(" + p2 + "px, " + m2 + "px, 0)", A2));
}
return Object.assign({}, O2, (t2 = {}, t2[w2] = b2 ? m2 + "px" : "", t2[y2] = g2 ? p2 + "px" : "", t2.transform = "", t2));
}
function Yu(e2) {
var t2 = e2.state, n2 = e2.options, o2 = n2.gpuAcceleration, r2 = o2 === void 0 ? true : o2, a2 = n2.adaptive, s2 = a2 === void 0 ? true : a2, l2 = n2.roundOffsets, i2 = l2 === void 0 ? true : l2, u2 = { placement: wu(t2.placement), variation: Uu(t2.placement), popper: t2.elements.popper, popperRect: t2.rects.popper, gpuAcceleration: r2, isFixed: t2.options.strategy === "fixed" };
t2.modifiersData.popperOffsets != null && (t2.styles.popper = Object.assign({}, t2.styles.popper, Ku(Object.assign({}, u2, { offsets: t2.modifiersData.popperOffsets, position: t2.options.strategy, adaptive: s2, roundOffsets: i2 })))), t2.modifiersData.arrow != null && (t2.styles.arrow = Object.assign({}, t2.styles.arrow, Ku(Object.assign({}, u2, { offsets: t2.modifiersData.arrow, position: "absolute", adaptive: false, roundOffsets: i2 })))), t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-placement": t2.placement });
}
var Gu = { name: "computeStyles", enabled: true, phase: "beforeWrite", fn: Yu, data: {} }, Zu = { passive: true };
function Xu(e2) {
var t2 = e2.state, n2 = e2.instance, o2 = e2.options, r2 = o2.scroll, a2 = r2 === void 0 ? true : r2, s2 = o2.resize, l2 = s2 === void 0 ? true : s2, i2 = pu(t2.elements.popper), u2 = [].concat(t2.scrollParents.reference, t2.scrollParents.popper);
return a2 && u2.forEach(function(e3) {
e3.addEventListener("scroll", n2.update, Zu);
}), l2 && i2.addEventListener("resize", n2.update, Zu), function() {
a2 && u2.forEach(function(e3) {
e3.removeEventListener("scroll", n2.update, Zu);
}), l2 && i2.removeEventListener("resize", n2.update, Zu);
};
}
var Ju = { name: "eventListeners", enabled: true, phase: "write", fn: function() {
}, effect: Xu, data: {} }, Qu = { left: "right", right: "left", bottom: "top", top: "bottom" };
function ec(e2) {
return e2.replace(/left|right|bottom|top/g, function(e3) {
return Qu[e3];
});
}
var tc = { start: "end", end: "start" };
function nc(e2) {
return e2.replace(/start|end/g, function(e3) {
return tc[e3];
});
}
function oc(e2) {
var t2 = pu(e2), n2 = t2.pageXOffset, o2 = t2.pageYOffset;
return { scrollLeft: n2, scrollTop: o2 };
}
function rc(e2) {
return ku(Au(e2)).left + oc(e2).scrollLeft;
}
function ac(e2) {
var t2 = pu(e2), n2 = Au(e2), o2 = t2.visualViewport, r2 = n2.clientWidth, a2 = n2.clientHeight, s2 = 0, l2 = 0;
return o2 && (r2 = o2.width, a2 = o2.height, /^((?!chrome|android).)*safari/i.test(navigator.userAgent) || (s2 = o2.offsetLeft, l2 = o2.offsetTop)), { width: r2, height: a2, x: s2 + rc(e2), y: l2 };
}
function sc(e2) {
var t2, n2 = Au(e2), o2 = oc(e2), r2 = (t2 = e2.ownerDocument) == null ? void 0 : t2.body, a2 = xu(n2.scrollWidth, n2.clientWidth, r2 ? r2.scrollWidth : 0, r2 ? r2.clientWidth : 0), s2 = xu(n2.scrollHeight, n2.clientHeight, r2 ? r2.scrollHeight : 0, r2 ? r2.clientHeight : 0), l2 = -o2.scrollLeft + rc(e2), i2 = -o2.scrollTop;
return Ou(r2 || n2).direction === "rtl" && (l2 += xu(n2.clientWidth, r2 ? r2.clientWidth : 0) - a2), { width: a2, height: s2, x: l2, y: i2 };
}
function lc(e2) {
var t2 = Ou(e2), n2 = t2.overflow, o2 = t2.overflowX, r2 = t2.overflowY;
return /auto|scroll|overlay|hidden/.test(n2 + r2 + o2);
}
function ic(e2) {
return ["html", "body", "#document"].indexOf(fu(e2)) >= 0 ? e2.ownerDocument.body : mu(e2) && lc(e2) ? e2 : ic(Bu(e2));
}
function uc(e2, t2) {
var n2;
t2 === void 0 && (t2 = []);
var o2 = ic(e2), r2 = o2 === ((n2 = e2.ownerDocument) == null ? void 0 : n2.body), a2 = pu(o2), s2 = r2 ? [a2].concat(a2.visualViewport || [], lc(o2) ? o2 : []) : o2, l2 = t2.concat(s2);
return r2 ? l2 : l2.concat(uc(Bu(s2)));
}
function cc(e2) {
return Object.assign({}, e2, { left: e2.x, top: e2.y, right: e2.x + e2.width, bottom: e2.y + e2.height });
}
function dc(e2) {
var t2 = ku(e2);
return t2.top = t2.top + e2.clientTop, t2.left = t2.left + e2.clientLeft, t2.bottom = t2.top + e2.clientHeight, t2.right = t2.left + e2.clientWidth, t2.width = e2.clientWidth, t2.height = e2.clientHeight, t2.x = t2.left, t2.y = t2.top, t2;
}
function fc(e2, t2) {
return t2 === Xi ? cc(ac(e2)) : vu(t2) ? dc(t2) : cc(sc(Au(e2)));
}
function pc(e2) {
var t2 = uc(Bu(e2)), n2 = ["absolute", "fixed"].indexOf(Ou(e2).position) >= 0, o2 = n2 && mu(e2) ? Iu(e2) : e2;
return vu(o2) ? t2.filter(function(e3) {
return vu(e3) && Eu(e3, o2) && fu(e3) !== "body";
}) : [];
}
function vc(e2, t2, n2) {
var o2 = t2 === "clippingParents" ? pc(e2) : [].concat(t2), r2 = [].concat(o2, [n2]), a2 = r2[0], s2 = r2.reduce(function(t3, n3) {
var o3 = fc(e2, n3);
return t3.top = xu(o3.top, t3.top), t3.right = Su(o3.right, t3.right), t3.bottom = Su(o3.bottom, t3.bottom), t3.left = xu(o3.left, t3.left), t3;
}, fc(e2, a2));
return s2.width = s2.right - s2.left, s2.height = s2.bottom - s2.top, s2.x = s2.left, s2.y = s2.top, s2;
}
function mc(e2) {
var t2 = e2.reference, n2 = e2.element, o2 = e2.placement, r2 = o2 ? wu(o2) : null, a2 = o2 ? Uu(o2) : null, s2 = t2.x + t2.width / 2 - n2.width / 2, l2 = t2.y + t2.height / 2 - n2.height / 2, i2;
switch (r2) {
case Di:
i2 = { x: s2, y: t2.y - n2.height };
break;
case Hi:
i2 = { x: s2, y: t2.y + t2.height };
break;
case Ui:
i2 = { x: t2.x + t2.width, y: l2 };
break;
case Wi:
i2 = { x: t2.x - n2.width, y: l2 };
break;
default:
i2 = { x: t2.x, y: t2.y };
}
var u2 = r2 ? Ru(r2) : null;
if (u2 != null) {
var c2 = u2 === "y" ? "height" : "width";
switch (a2) {
case Yi:
i2[u2] = i2[u2] - (t2[c2] / 2 - n2[c2] / 2);
break;
case Gi:
i2[u2] = i2[u2] + (t2[c2] / 2 - n2[c2] / 2);
break;
}
}
return i2;
}
function hc(e2, t2) {
t2 === void 0 && (t2 = {});
var n2 = t2, o2 = n2.placement, r2 = o2 === void 0 ? e2.placement : o2, a2 = n2.boundary, s2 = a2 === void 0 ? Zi : a2, l2 = n2.rootBoundary, i2 = l2 === void 0 ? Xi : l2, u2 = n2.elementContext, c2 = u2 === void 0 ? Ji : u2, d2 = n2.altBoundary, f2 = d2 === void 0 ? false : d2, p2 = n2.padding, v2 = p2 === void 0 ? 0 : p2, m2 = Pu(typeof v2 != "number" ? v2 : $u(v2, Ki)), h2 = c2 === Ji ? Qi : Ji, g2 = e2.rects.popper, b2 = e2.elements[f2 ? h2 : c2], y2 = vc(vu(b2) ? b2 : b2.contextElement || Au(e2.elements.popper), s2, i2), w2 = ku(e2.elements.reference), x2 = mc({ reference: w2, element: g2, strategy: "absolute", placement: r2 }), S2 = cc(Object.assign({}, g2, x2)), C2 = c2 === Ji ? S2 : w2, k2 = { top: y2.top - C2.top + m2.top, bottom: C2.bottom - y2.bottom + m2.bottom, left: y2.left - C2.left + m2.left, right: C2.right - y2.right + m2.right }, _2 = e2.modifiersData.offset;
if (c2 === Ji && _2) {
var E2 = _2[r2];
Object.keys(k2).forEach(function(e3) {
var t3 = [Ui, Hi].indexOf(e3) >= 0 ? 1 : -1, n3 = [Di, Hi].indexOf(e3) >= 0 ? "y" : "x";
k2[e3] += E2[n3] * t3;
});
}
return k2;
}
function gc(e2, t2) {
t2 === void 0 && (t2 = {});
var n2 = t2, o2 = n2.placement, r2 = n2.boundary, a2 = n2.rootBoundary, s2 = n2.padding, l2 = n2.flipVariations, i2 = n2.allowedAutoPlacements, u2 = i2 === void 0 ? tu : i2, c2 = Uu(o2), d2 = c2 ? l2 ? eu : eu.filter(function(e3) {
return Uu(e3) === c2;
}) : Ki, f2 = d2.filter(function(e3) {
return u2.indexOf(e3) >= 0;
});
f2.length === 0 && (f2 = d2);
var p2 = f2.reduce(function(t3, n3) {
return t3[n3] = hc(e2, { placement: n3, boundary: r2, rootBoundary: a2, padding: s2 })[wu(n3)], t3;
}, {});
return Object.keys(p2).sort(function(e3, t3) {
return p2[e3] - p2[t3];
});
}
function bc(e2) {
if (wu(e2) === qi) return [];
var t2 = ec(e2);
return [nc(e2), t2, nc(t2)];
}
function yc(e2) {
var t2 = e2.state, n2 = e2.options, o2 = e2.name;
if (!t2.modifiersData[o2]._skip) {
for (var r2 = n2.mainAxis, a2 = r2 === void 0 ? true : r2, s2 = n2.altAxis, l2 = s2 === void 0 ? true : s2, i2 = n2.fallbackPlacements, u2 = n2.padding, c2 = n2.boundary, d2 = n2.rootBoundary, f2 = n2.altBoundary, p2 = n2.flipVariations, v2 = p2 === void 0 ? true : p2, m2 = n2.allowedAutoPlacements, h2 = t2.options.placement, g2 = wu(h2), b2 = g2 === h2, y2 = i2 || (b2 || !v2 ? [ec(h2)] : bc(h2)), w2 = [h2].concat(y2).reduce(function(e3, n3) {
return e3.concat(wu(n3) === qi ? gc(t2, { placement: n3, boundary: c2, rootBoundary: d2, padding: u2, flipVariations: v2, allowedAutoPlacements: m2 }) : n3);
}, []), x2 = t2.rects.reference, S2 = t2.rects.popper, C2 = /* @__PURE__ */ new Map(), k2 = true, _2 = w2[0], E2 = 0; E2 < w2.length; E2++) {
var O2 = w2[E2], L2 = wu(O2), A2 = Uu(O2) === Yi, B2 = [Di, Hi].indexOf(L2) >= 0, M2 = B2 ? "width" : "height", T2 = hc(t2, { placement: O2, boundary: c2, rootBoundary: d2, altBoundary: f2, padding: u2 }), I2 = B2 ? A2 ? Ui : Wi : A2 ? Hi : Di;
x2[M2] > S2[M2] && (I2 = ec(I2));
var R2 = ec(I2), j2 = [];
if (a2 && j2.push(T2[L2] <= 0), l2 && j2.push(T2[I2] <= 0, T2[R2] <= 0), j2.every(function(e3) {
return e3;
})) {
_2 = O2, k2 = false;
break;
}
C2.set(O2, j2);
}
if (k2) for (var z2 = v2 ? 3 : 1, F2 = function(e3) {
var t3 = w2.find(function(t4) {
var n3 = C2.get(t4);
if (n3) return n3.slice(0, e3).every(function(e4) {
return e4;
});
});
if (t3) return _2 = t3, "break";
}, P2 = z2; P2 > 0; P2--) {
var $2 = F2(P2);
if ($2 === "break") break;
}
t2.placement !== _2 && (t2.modifiersData[o2]._skip = true, t2.placement = _2, t2.reset = true);
}
}
var wc = { name: "flip", enabled: true, phase: "main", fn: yc, requiresIfExists: ["offset"], data: { _skip: false } };
function xc(e2, t2, n2) {
return n2 === void 0 && (n2 = { x: 0, y: 0 }), { top: e2.top - t2.height - n2.y, right: e2.right - t2.width + n2.x, bottom: e2.bottom - t2.height + n2.y, left: e2.left - t2.width - n2.x };
}
function Sc(e2) {
return [Di, Ui, Hi, Wi].some(function(t2) {
return e2[t2] >= 0;
});
}
function Cc(e2) {
var t2 = e2.state, n2 = e2.name, o2 = t2.rects.reference, r2 = t2.rects.popper, a2 = t2.modifiersData.preventOverflow, s2 = hc(t2, { elementContext: "reference" }), l2 = hc(t2, { altBoundary: true }), i2 = xc(s2, o2), u2 = xc(l2, r2, a2), c2 = Sc(i2), d2 = Sc(u2);
t2.modifiersData[n2] = { referenceClippingOffsets: i2, popperEscapeOffsets: u2, isReferenceHidden: c2, hasPopperEscaped: d2 }, t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-reference-hidden": c2, "data-popper-escaped": d2 });
}
var kc = { name: "hide", enabled: true, phase: "main", requiresIfExists: ["preventOverflow"], fn: Cc };
function _c(e2, t2, n2) {
var o2 = wu(e2), r2 = [Wi, Di].indexOf(o2) >= 0 ? -1 : 1, a2 = typeof n2 == "function" ? n2(Object.assign({}, t2, { placement: e2 })) : n2, s2 = a2[0], l2 = a2[1];
return s2 = s2 || 0, l2 = (l2 || 0) * r2, [Wi, Ui].indexOf(o2) >= 0 ? { x: l2, y: s2 } : { x: s2, y: l2 };
}
function Ec(e2) {
var t2 = e2.state, n2 = e2.options, o2 = e2.name, r2 = n2.offset, a2 = r2 === void 0 ? [0, 0] : r2, s2 = tu.reduce(function(e3, n3) {
return e3[n3] = _c(n3, t2.rects, a2), e3;
}, {}), l2 = s2[t2.placement], i2 = l2.x, u2 = l2.y;
t2.modifiersData.popperOffsets != null && (t2.modifiersData.popperOffsets.x += i2, t2.modifiersData.popperOffsets.y += u2), t2.modifiersData[o2] = s2;
}
var Oc = { name: "offset", enabled: true, phase: "main", requires: ["popperOffsets"], fn: Ec };
function Lc(e2) {
var t2 = e2.state, n2 = e2.name;
t2.modifiersData[n2] = mc({ reference: t2.rects.reference, element: t2.rects.popper, strategy: "absolute", placement: t2.placement });
}
var Ac = { name: "popperOffsets", enabled: true, phase: "read", fn: Lc, data: {} };
function Bc(e2) {
return e2 === "x" ? "y" : "x";
}
function Mc(e2) {
var t2 = e2.state, n2 = e2.options, o2 = e2.name, r2 = n2.mainAxis, a2 = r2 === void 0 ? true : r2, s2 = n2.altAxis, l2 = s2 === void 0 ? false : s2, i2 = n2.boundary, u2 = n2.rootBoundary, c2 = n2.altBoundary, d2 = n2.padding, f2 = n2.tether, p2 = f2 === void 0 ? true : f2, v2 = n2.tetherOffset, m2 = v2 === void 0 ? 0 : v2, h2 = hc(t2, { boundary: i2, rootBoundary: u2, padding: d2, altBoundary: c2 }), g2 = wu(t2.placement), b2 = Uu(t2.placement), y2 = !b2, w2 = Ru(g2), x2 = Bc(w2), S2 = t2.modifiersData.popperOffsets, C2 = t2.rects.reference, k2 = t2.rects.popper, _2 = typeof m2 == "function" ? m2(Object.assign({}, t2.rects, { placement: t2.placement })) : m2, E2 = typeof _2 == "number" ? { mainAxis: _2, altAxis: _2 } : Object.assign({ mainAxis: 0, altAxis: 0 }, _2), O2 = t2.modifiersData.offset ? t2.modifiersData.offset[t2.placement] : null, L2 = { x: 0, y: 0 };
if (S2) {
if (a2) {
var A2, B2 = w2 === "y" ? Di : Wi, M2 = w2 === "y" ? Hi : Ui, T2 = w2 === "y" ? "height" : "width", I2 = S2[w2], R2 = I2 + h2[B2], j2 = I2 - h2[M2], z2 = p2 ? -k2[T2] / 2 : 0, F2 = b2 === Yi ? C2[T2] : k2[T2], P2 = b2 === Yi ? -k2[T2] : -C2[T2], $2 = t2.elements.arrow, N2 = p2 && $2 ? _u($2) : { width: 0, height: 0 }, V2 = t2.modifiersData["arrow#persistent"] ? t2.modifiersData["arrow#persistent"].padding : Fu(), D2 = V2[B2], H2 = V2[M2], U2 = ju(0, C2[T2], N2[T2]), W2 = y2 ? C2[T2] / 2 - z2 - U2 - D2 - E2.mainAxis : F2 - U2 - D2 - E2.mainAxis, q2 = y2 ? -C2[T2] / 2 + z2 + U2 + H2 + E2.mainAxis : P2 + U2 + H2 + E2.mainAxis, K2 = t2.elements.arrow && Iu(t2.elements.arrow), Y2 = K2 ? w2 === "y" ? K2.clientTop || 0 : K2.clientLeft || 0 : 0, G2 = (A2 = O2 == null ? void 0 : O2[w2]) != null ? A2 : 0, Z2 = I2 + W2 - G2 - Y2, X2 = I2 + q2 - G2, J2 = ju(p2 ? Su(R2, Z2) : R2, I2, p2 ? xu(j2, X2) : j2);
S2[w2] = J2, L2[w2] = J2 - I2;
}
if (l2) {
var Q2, ee2 = w2 === "x" ? Di : Wi, te2 = w2 === "x" ? Hi : Ui, ne2 = S2[x2], oe2 = x2 === "y" ? "height" : "width", re2 = ne2 + h2[ee2], ae2 = ne2 - h2[te2], se2 = [Di, Wi].indexOf(g2) !== -1, le2 = (Q2 = O2 == null ? void 0 : O2[x2]) != null ? Q2 : 0, ie2 = se2 ? re2 : ne2 - C2[oe2] - k2[oe2] - le2 + E2.altAxis, ue2 = se2 ? ne2 + C2[oe2] + k2[oe2] - le2 - E2.altAxis : ae2, ce2 = p2 && se2 ? zu(ie2, ne2, ue2) : ju(p2 ? ie2 : re2, ne2, p2 ? ue2 : ae2);
S2[x2] = ce2, L2[x2] = ce2 - ne2;
}
t2.modifiersData[o2] = L2;
}
}
var Tc = { name: "preventOverflow", enabled: true, phase: "main", fn: Mc, requiresIfExists: ["offset"] };
function Ic(e2) {
return { scrollLeft: e2.scrollLeft, scrollTop: e2.scrollTop };
}
function Rc(e2) {
return e2 === pu(e2) || !mu(e2) ? oc(e2) : Ic(e2);
}
function jc(e2) {
var t2 = e2.getBoundingClientRect(), n2 = Cu(t2.width) / e2.offsetWidth || 1, o2 = Cu(t2.height) / e2.offsetHeight || 1;
return n2 !== 1 || o2 !== 1;
}
function zc(e2, t2, n2) {
n2 === void 0 && (n2 = false);
var o2 = mu(t2), r2 = mu(t2) && jc(t2), a2 = Au(t2), s2 = ku(e2, r2), l2 = { scrollLeft: 0, scrollTop: 0 }, i2 = { x: 0, y: 0 };
return (o2 || !o2 && !n2) && ((fu(t2) !== "body" || lc(a2)) && (l2 = Rc(t2)), mu(t2) ? (i2 = ku(t2, true), i2.x += t2.clientLeft, i2.y += t2.clientTop) : a2 && (i2.x = rc(a2))), { x: s2.left + l2.scrollLeft - i2.x, y: s2.top + l2.scrollTop - i2.y, width: s2.width, height: s2.height };
}
function Fc(e2) {
var t2 = /* @__PURE__ */ new Map(), n2 = /* @__PURE__ */ new Set(), o2 = [];
e2.forEach(function(e3) {
t2.set(e3.name, e3);
});
function r2(e3) {
n2.add(e3.name);
var a2 = [].concat(e3.requires || [], e3.requiresIfExists || []);
a2.forEach(function(e4) {
if (!n2.has(e4)) {
var o3 = t2.get(e4);
o3 && r2(o3);
}
}), o2.push(e3);
}
return e2.forEach(function(e3) {
n2.has(e3.name) || r2(e3);
}), o2;
}
function Pc(e2) {
var t2 = Fc(e2);
return du.reduce(function(e3, n2) {
return e3.concat(t2.filter(function(e4) {
return e4.phase === n2;
}));
}, []);
}
function $c(e2) {
var t2;
return function() {
return t2 || (t2 = new Promise(function(n2) {
Promise.resolve().then(function() {
t2 = void 0, n2(e2());
});
})), t2;
};
}
function Nc(e2) {
var t2 = e2.reduce(function(e3, t3) {
var n2 = e3[t3.name];
return e3[t3.name] = n2 ? Object.assign({}, n2, t3, { options: Object.assign({}, n2.options, t3.options), data: Object.assign({}, n2.data, t3.data) }) : t3, e3;
}, {});
return Object.keys(t2).map(function(e3) {
return t2[e3];
});
}
var Vc = { placement: "bottom", modifiers: [], strategy: "absolute" };
function Dc() {
for (var e2 = arguments.length, t2 = new Array(e2), n2 = 0; n2 < e2; n2++) t2[n2] = arguments[n2];
return !t2.some(function(e3) {
return !(e3 && typeof e3.getBoundingClientRect == "function");
});
}
function Hc(e2) {
e2 === void 0 && (e2 = {});
var t2 = e2, n2 = t2.defaultModifiers, o2 = n2 === void 0 ? [] : n2, r2 = t2.defaultOptions, a2 = r2 === void 0 ? Vc : r2;
return function(e3, t3, n3) {
n3 === void 0 && (n3 = a2);
var r3 = { placement: "bottom", orderedModifiers: [], options: Object.assign({}, Vc, a2), modifiersData: {}, elements: { reference: e3, popper: t3 }, attributes: {}, styles: {} }, s2 = [], l2 = false, i2 = { state: r3, setOptions: function(n4) {
var s3 = typeof n4 == "function" ? n4(r3.options) : n4;
c2(), r3.options = Object.assign({}, a2, r3.options, s3), r3.scrollParents = { reference: vu(e3) ? uc(e3) : e3.contextElement ? uc(e3.contextElement) : [], popper: uc(t3) };
var l3 = Pc(Nc([].concat(o2, r3.options.modifiers)));
return r3.orderedModifiers = l3.filter(function(e4) {
return e4.enabled;
}), u2(), i2.update();
}, forceUpdate: function() {
if (!l2) {
var e4 = r3.elements, t4 = e4.reference, n4 = e4.popper;
if (Dc(t4, n4)) {
r3.rects = { reference: zc(t4, Iu(n4), r3.options.strategy === "fixed"), popper: _u(n4) }, r3.reset = false, r3.placement = r3.options.placement, r3.orderedModifiers.forEach(function(e5) {
return r3.modifiersData[e5.name] = Object.assign({}, e5.data);
});
for (var o3 = 0; o3 < r3.orderedModifiers.length; o3++) {
if (r3.reset === true) {
r3.reset = false, o3 = -1;
continue;
}
var a3 = r3.orderedModifiers[o3], s3 = a3.fn, u3 = a3.options, c3 = u3 === void 0 ? {} : u3, d2 = a3.name;
typeof s3 == "function" && (r3 = s3({ state: r3, options: c3, name: d2, instance: i2 }) || r3);
}
}
}
}, update: $c(function() {
return new Promise(function(e4) {
i2.forceUpdate(), e4(r3);
});
}), destroy: function() {
c2(), l2 = true;
} };
if (!Dc(e3, t3)) return i2;
i2.setOptions(n3).then(function(e4) {
!l2 && n3.onFirstUpdate && n3.onFirstUpdate(e4);
});
function u2() {
r3.orderedModifiers.forEach(function(e4) {
var t4 = e4.name, n4 = e4.options, o3 = n4 === void 0 ? {} : n4, a3 = e4.effect;
if (typeof a3 == "function") {
var l3 = a3({ state: r3, name: t4, instance: i2, options: o3 }), u3 = function() {
};
s2.push(l3 || u3);
}
});
}
function c2() {
s2.forEach(function(e4) {
return e4();
}), s2 = [];
}
return i2;
};
}
Hc();
var Uc = [Ju, Ac, Gu, yu];
Hc({ defaultModifiers: Uc });
var Wc = [Ju, Ac, Gu, yu, Oc, wc, Tc, Hu, kc], qc = Hc({ defaultModifiers: Wc });
const Kc = (e2, t2, n2 = {}) => {
const o2 = { name: "updateState", enabled: true, phase: "write", fn: ({ state: e3 }) => {
const t3 = Yc(e3);
Object.assign(l2.value, t3);
}, requires: ["computeStyles"] };
const r2 = computed(() => {
const { onFirstUpdate: e3, placement: t3, strategy: r3, modifiers: a3 } = unref(n2);
return { onFirstUpdate: e3, placement: t3 || "bottom", strategy: r3 || "absolute", modifiers: [...a3 || [], o2, { name: "applyStyles", enabled: false }] };
});
const a2 = shallowRef();
const l2 = ref({ styles: { popper: { position: unref(r2).strategy, left: "0", top: "0" }, arrow: { position: "absolute" } }, attributes: {} });
const c2 = () => {
if (!a2.value) return;
a2.value.destroy();
a2.value = void 0;
};
watch(r2, (e3) => {
const t3 = unref(a2);
if (t3) {
t3.setOptions(e3);
}
}, { deep: true });
watch([e2, t2], ([e3, t3]) => {
c2();
if (!e3 || !t3) return;
a2.value = qc(e3, t3, unref(r2));
});
onBeforeUnmount(() => {
c2();
});
return { state: computed(() => {
var e3;
return { ...((e3 = unref(a2)) == null ? void 0 : e3.state) || {} };
}), styles: computed(() => unref(l2).styles), attributes: computed(() => unref(l2).attributes), update: () => {
var e3;
return (e3 = unref(a2)) == null ? void 0 : e3.update();
}, forceUpdate: () => {
var e3;
return (e3 = unref(a2)) == null ? void 0 : e3.forceUpdate();
}, instanceRef: computed(() => unref(a2)) };
};
function Yc(e2) {
const t2 = Object.keys(e2.elements);
const n2 = Ts(t2.map((t3) => [t3, e2.styles[t3] || {}]));
const o2 = Ts(t2.map((t3) => [t3, e2.attributes[t3]]));
return { styles: n2, attributes: o2 };
}
const Gc = (e2) => {
if (!e2) {
return { onClick: ft, onMousedown: ft, onMouseup: ft };
}
let t2 = false;
let n2 = false;
const o2 = (o3) => {
if (t2 && n2) {
e2(o3);
}
t2 = n2 = false;
};
const r2 = (e3) => {
t2 = e3.target === e3.currentTarget;
};
const a2 = (e3) => {
n2 = e3.target === e3.currentTarget;
};
return { onClick: o2, onMousedown: r2, onMouseup: a2 };
};
function Zc() {
let e2;
const t2 = (t3, o2) => {
n2();
e2 = window.setTimeout(t3, o2);
};
const n2 = () => window.clearTimeout(e2);
Pe(() => n2());
return { registerTimeout: t2, cancelTimeout: n2 };
}
const Xc = { prefix: Math.floor(Math.random() * 1e4), current: 0 };
const Jc = Symbol("elIdInjection");
const Qc = () => getCurrentInstance() ? inject(Jc, Xc) : Xc;
const ed = (e2) => {
const t2 = Qc();
const n2 = ji();
const o2 = computed(() => unref(e2) || `${n2.value}-id-${t2.prefix}-${t2.current++}`);
return o2;
};
let td = [];
const nd = (e2) => {
const t2 = e2;
if (t2.key === di.esc) {
td.forEach((e3) => e3(t2));
}
};
const od = (e2) => {
onMounted(() => {
if (td.length === 0) {
document.addEventListener("keydown", nd);
}
if (Te) td.push(e2);
});
onBeforeUnmount(() => {
td = td.filter((t2) => t2 !== e2);
if (td.length === 0) {
if (Te) document.removeEventListener("keydown", nd);
}
});
};
let rd;
const ad = () => {
const e2 = ji();
const t2 = Qc();
const n2 = computed(() => `${e2.value}-popper-container-${t2.prefix}`);
const o2 = computed(() => `#${n2.value}`);
return { id: n2, selector: o2 };
};
const sd = (e2) => {
const t2 = document.createElement("div");
t2.id = e2;
document.body.appendChild(t2);
return t2;
};
const ld = () => {
const { id: e2, selector: t2 } = ad();
onBeforeMount(() => {
if (!Te) return;
if (!rd && !document.body.querySelector(t2.value)) {
rd = sd(e2.value);
}
});
return { id: e2, selector: t2 };
};
const id = ti({ showAfter: { type: Number, default: 0 }, hideAfter: { type: Number, default: 200 }, autoClose: { type: Number, default: 0 } });
const ud = ({ showAfter: e2, hideAfter: t2, autoClose: n2, open: o2, close: r2 }) => {
const { registerTimeout: a2 } = Zc();
const { registerTimeout: s2, cancelTimeout: l2 } = Zc();
const i2 = (t3) => {
a2(() => {
o2(t3);
const e3 = unref(n2);
if (Hs(e3) && e3 > 0) {
s2(() => {
r2(t3);
}, e3);
}
}, unref(e2));
};
const c2 = (e3) => {
l2();
a2(() => {
r2(e3);
}, unref(t2));
};
return { onOpen: i2, onClose: c2 };
};
const cd = Symbol("elForwardRef");
const dd = (e2) => {
const t2 = (t3) => {
e2.value = t3;
};
provide(cd, { setForwardRef: t2 });
};
const fd = (e2) => ({ mounted(t2) {
e2(t2);
}, updated(t2) {
e2(t2);
}, unmounted() {
e2(null);
} });
const pd = { current: 0 };
const vd = ref(0);
const md = 2e3;
const hd = Symbol("elZIndexContextKey");
const gd = Symbol("zIndexContextKey");
const bd = (e2) => {
const t2 = getCurrentInstance() ? inject(hd, pd) : pd;
const n2 = e2 || (getCurrentInstance() ? inject(gd, void 0) : void 0);
const o2 = computed(() => {
const e3 = unref(n2);
return Hs(e3) ? e3 : md;
});
const r2 = computed(() => o2.value + vd.value);
const a2 = () => {
t2.current++;
vd.value = t2.current;
return r2.value;
};
if (!Te && !inject(hd)) ;
return { initialZIndex: o2, currentZIndex: r2, nextZIndex: a2 };
};
function yd(e2) {
let t2;
function n2() {
if (e2.value == void 0) return;
const { selectionStart: n3, selectionEnd: o3, value: r2 } = e2.value;
if (n3 == null || o3 == null) return;
const a2 = r2.slice(0, Math.max(0, n3));
const s2 = r2.slice(Math.max(0, o3));
t2 = { selectionStart: n3, selectionEnd: o3, value: r2, beforeTxt: a2, afterTxt: s2 };
}
function o2() {
if (e2.value == void 0 || t2 == void 0) return;
const { value: n3 } = e2.value;
const { beforeTxt: o3, afterTxt: r2, selectionStart: a2 } = t2;
if (o3 == void 0 || r2 == void 0 || a2 == void 0) return;
let s2 = n3.length;
if (n3.endsWith(r2)) {
s2 = n3.length - r2.length;
} else if (n3.startsWith(o3)) {
s2 = o3.length;
} else {
const e3 = o3[a2 - 1];
const t3 = n3.indexOf(e3, a2 - 1);
if (t3 !== -1) {
s2 = t3 + 1;
}
}
e2.value.setSelectionRange(s2, s2);
}
return [n2, o2];
}
const wd = exports("w", ei({ type: String, values: mi, required: false }));
const xd = Symbol("size");
const Sd = () => {
const e2 = inject(xd, {});
return computed(() => unref(e2.size) || "");
};
function Cd(e2, { beforeFocus: t2, afterFocus: n2, beforeBlur: o2, afterBlur: r2 } = {}) {
const a2 = getCurrentInstance();
const { emit: s2 } = a2;
const u2 = shallowRef();
const c2 = ref(false);
const d2 = (e3) => {
const o3 = gt(t2) ? t2(e3) : false;
if (o3 || c2.value) return;
c2.value = true;
s2("focus", e3);
n2 == null ? void 0 : n2();
};
const f2 = (e3) => {
var t3;
const n3 = gt(o2) ? o2(e3) : false;
if (n3 || e3.relatedTarget && ((t3 = u2.value) == null ? void 0 : t3.contains(e3.relatedTarget))) return;
c2.value = false;
s2("blur", e3);
r2 == null ? void 0 : r2();
};
const p2 = () => {
var t3, n3;
if (((t3 = u2.value) == null ? void 0 : t3.contains(document.activeElement)) && u2.value !== document.activeElement) return;
(n3 = e2.value) == null ? void 0 : n3.focus();
};
watch(u2, (e3) => {
if (e3) {
e3.setAttribute("tabindex", "-1");
}
});
Ue(u2, "focus", d2, true);
Ue(u2, "blur", f2, true);
Ue(u2, "click", p2, true);
return { isFocused: c2, wrapperRef: u2, handleFocus: d2, handleBlur: f2 };
}
function kd({ afterComposition: e2, emit: t2 }) {
const n2 = ref(false);
const o2 = (e3) => {
t2 == null ? void 0 : t2("compositionstart", e3);
n2.value = true;
};
const r2 = (e3) => {
var o3;
t2 == null ? void 0 : t2("compositionupdate", e3);
const r3 = (o3 = e3.target) == null ? void 0 : o3.value;
const a3 = r3[r3.length - 1] || "";
n2.value = !bi(a3);
};
const a2 = (o3) => {
t2 == null ? void 0 : t2("compositionend", o3);
if (n2.value) {
n2.value = false;
nextTick(() => e2(o3));
}
};
const s2 = (e3) => {
e3.type === "compositionend" ? a2(e3) : r2(e3);
};
return { isComposing: n2, handleComposition: s2, handleCompositionStart: o2, handleCompositionUpdate: r2, handleCompositionEnd: a2 };
}
const _d = Symbol("emptyValuesContextKey");
const Ed = ["", void 0, null];
const Od = exports("b0", ti({ emptyValues: Array, valueOnClear: { type: [String, Number, Boolean, Function], default: void 0, validator: (e2) => gt(e2) ? !e2() : !e2 } }));
const Ld = exports("b1", (e2, t2) => {
const n2 = getCurrentInstance() ? inject(_d, ref({})) : ref({});
const o2 = computed(() => e2.emptyValues || n2.value.emptyValues || Ed);
const r2 = computed(() => {
if (gt(e2.valueOnClear)) {
return e2.valueOnClear();
} else if (e2.valueOnClear !== void 0) {
return e2.valueOnClear;
} else if (gt(n2.value.valueOnClear)) {
return n2.value.valueOnClear();
} else if (n2.value.valueOnClear !== void 0) {
return n2.value.valueOnClear;
}
return t2;
});
const a2 = (e3) => o2.value.includes(e3);
if (!o2.value.includes(r2.value)) ;
return { emptyValues: o2, valueOnClear: r2, isEmptyValue: a2 };
});
const Ad = ti({ ariaLabel: String, ariaOrientation: { type: String, values: ["horizontal", "vertical", "undefined"] }, ariaControls: String });
const Bd = exports("a", (e2) => $s(Ad, e2));
const Md = Symbol();
const Td = ref();
function Id(e2, t2 = void 0) {
const n2 = getCurrentInstance() ? inject(Md, Td) : Td;
if (e2) {
return computed(() => {
var o2, r2;
return (r2 = (o2 = n2.value) == null ? void 0 : o2[e2]) != null ? r2 : t2;
});
} else {
return n2;
}
}
function Rd(e2, t2) {
const n2 = Id();
const o2 = zi(e2, computed(() => {
var e3;
return ((e3 = n2.value) == null ? void 0 : e3.namespace) || Mi;
}));
const r2 = Bi(computed(() => {
var e3;
return (e3 = n2.value) == null ? void 0 : e3.locale;
}));
const a2 = bd(computed(() => {
var e3;
return ((e3 = n2.value) == null ? void 0 : e3.zIndex) || md;
}));
const l2 = computed(() => {
var e3;
return unref(t2) || ((e3 = n2.value) == null ? void 0 : e3.size) || "";
});
jd(computed(() => unref(n2) || {}));
return { ns: o2, locale: r2, zIndex: a2, size: l2 };
}
const jd = (e2, t2, n2 = false) => {
var o2;
const r2 = !!getCurrentInstance();
const a2 = r2 ? Id() : void 0;
const i2 = (o2 = void 0) != null ? o2 : r2 ? provide : void 0;
if (!i2) {
return;
}
const c2 = computed(() => {
const t3 = unref(e2);
if (!(a2 == null ? void 0 : a2.value)) return t3;
return zd(a2.value, t3);
});
i2(Md, c2);
i2(Ai, computed(() => c2.value.locale));
i2(Ri, computed(() => c2.value.namespace));
i2(gd, computed(() => c2.value.zIndex));
i2(xd, { size: computed(() => c2.value.size || "") });
i2(_d, computed(() => ({ emptyValues: c2.value.emptyValues, valueOnClear: c2.value.valueOnClear })));
if (n2 || !Td.value) {
Td.value = c2.value;
}
return c2;
};
const zd = (e2, t2) => {
const n2 = [.../* @__PURE__ */ new Set([...Ys(e2), ...Ys(t2)])];
const o2 = {};
for (const r2 of n2) {
o2[r2] = t2[r2] !== void 0 ? t2[r2] : e2[r2];
}
return o2;
};
const Fd = ti({ a11y: { type: Boolean, default: true }, locale: { type: Jl(Object) }, size: wd, button: { type: Jl(Object) }, experimentalFeatures: { type: Jl(Object) }, keyboardNavigation: { type: Boolean, default: true }, message: { type: Jl(Object) }, zIndex: Number, namespace: { type: String, default: "el" }, ...Od });
const Pd = {};
defineComponent({ name: "ElConfigProvider", props: Fd, setup(e2, { slots: t2 }) {
watch(() => e2.message, (e3) => {
Object.assign(Pd, e3 != null ? e3 : {});
}, { immediate: true, deep: true });
const n2 = jd(e2);
return () => renderSlot(t2, "default", { config: n2 == null ? void 0 : n2.value });
} });
var $d = exports("$", (e2, t2) => {
const n2 = e2.__vccOpts || e2;
for (const [e3, o2] of t2) {
n2[e3] = o2;
}
return n2;
});
const Nd = ti({ size: { type: Jl([Number, String]) }, color: { type: String } });
const Vd = defineComponent({ name: "ElIcon", inheritAttrs: false });
const Dd = defineComponent({ ...Vd, props: Nd, setup(e2) {
const o2 = e2;
const r2 = zi("icon");
const a2 = computed(() => {
const { size: e3, color: t2 } = o2;
if (!e3 && !t2) return {};
return { fontSize: Vs(e3) ? void 0 : rl(e3), "--color": t2 };
});
return (e3, o3) => (openBlock(), createElementBlock("i", mergeProps({ class: unref(r2).b(), style: unref(a2) }, e3.$attrs), [renderSlot(e3.$slots, "default")], 16));
} });
var Hd = $d(Dd, [["__file", "icon.vue"]]);
const Ud = exports("U", li(Hd));
const Wd = Symbol("formContextKey");
const qd = Symbol("formItemContextKey");
const Kd = exports("K", (e2, t2 = {}) => {
const n2 = ref(void 0);
const o2 = t2.prop ? n2 : Vi("size");
const r2 = t2.global ? n2 : Sd();
const a2 = t2.form ? { size: void 0 } : inject(Wd, void 0);
const l2 = t2.formItem ? { size: void 0 } : inject(qd, void 0);
return computed(() => o2.value || unref(e2) || (l2 == null ? void 0 : l2.size) || (a2 == null ? void 0 : a2.size) || r2.value || "");
});
const Yd = exports("Y", (e2) => {
const t2 = Vi("disabled");
const n2 = inject(Wd, void 0);
return computed(() => t2.value || unref(e2) || (n2 == null ? void 0 : n2.disabled) || false);
});
const Gd = exports("G", () => {
const e2 = inject(Wd, void 0);
const t2 = inject(qd, void 0);
return { form: e2, formItem: t2 };
});
const Zd = exports("Z", (e2, { formItemContext: t2, disableIdGeneration: n2, disableIdManagement: o2 }) => {
if (!n2) {
n2 = ref(false);
}
if (!o2) {
o2 = ref(false);
}
const r2 = ref();
let a2 = void 0;
const l2 = computed(() => {
var n3;
return !!(!(e2.label || e2.ariaLabel) && t2 && t2.inputIds && ((n3 = t2.inputIds) == null ? void 0 : n3.length) <= 1);
});
onMounted(() => {
a2 = watch([toRef(e2, "id"), n2], ([e3, n3]) => {
const a3 = e3 != null ? e3 : !n3 ? ed().value : void 0;
if (a3 !== r2.value) {
if (t2 == null ? void 0 : t2.removeInputId) {
r2.value && t2.removeInputId(r2.value);
if (!(o2 == null ? void 0 : o2.value) && !n3 && a3) {
t2.addInputId(a3);
}
}
r2.value = a3;
}
}, { immediate: true });
});
onUnmounted(() => {
a2 && a2();
if (t2 == null ? void 0 : t2.removeInputId) {
r2.value && t2.removeInputId(r2.value);
}
});
return { isLabeledByFormItem: l2, inputId: r2 };
});
let Xd = void 0;
const Jd = `
height:0 !important;
visibility:hidden !important;
${dt() ? "" : "overflow:hidden !important;"}
position:absolute !important;
z-index:-1000 !important;
top:0 !important;
right:0 !important;
`;
const Qd = ["letter-spacing", "line-height", "padding-top", "padding-bottom", "font-family", "font-weight", "font-size", "text-rendering", "text-transform", "width", "text-indent", "padding-left", "padding-right", "border-width", "box-sizing"];
function ef(e2) {
const t2 = window.getComputedStyle(e2);
const n2 = t2.getPropertyValue("box-sizing");
const o2 = Number.parseFloat(t2.getPropertyValue("padding-bottom")) + Number.parseFloat(t2.getPropertyValue("padding-top"));
const r2 = Number.parseFloat(t2.getPropertyValue("border-bottom-width")) + Number.parseFloat(t2.getPropertyValue("border-top-width"));
const a2 = Qd.map((e3) => `${e3}:${t2.getPropertyValue(e3)}`).join(";");
return { contextStyle: a2, paddingSize: o2, borderSize: r2, boxSizing: n2 };
}
function tf(e2, t2 = 1, n2) {
var o2;
if (!Xd) {
Xd = document.createElement("textarea");
document.body.appendChild(Xd);
}
const { paddingSize: r2, borderSize: a2, boxSizing: s2, contextStyle: l2 } = ef(e2);
Xd.setAttribute("style", `${l2};${Jd}`);
Xd.value = e2.value || e2.placeholder || "";
let i2 = Xd.scrollHeight;
const u2 = {};
if (s2 === "border-box") {
i2 = i2 + a2;
} else if (s2 === "content-box") {
i2 = i2 - r2;
}
Xd.value = "";
const c2 = Xd.scrollHeight - r2;
if (Hs(t2)) {
let e3 = c2 * t2;
if (s2 === "border-box") {
e3 = e3 + r2 + a2;
}
i2 = Math.max(e3, i2);
u2.minHeight = `${e3}px`;
}
if (Hs(n2)) {
let e3 = c2 * n2;
if (s2 === "border-box") {
e3 = e3 + r2 + a2;
}
i2 = Math.min(e3, i2);
}
u2.height = `${i2}px`;
(o2 = Xd.parentNode) == null ? void 0 : o2.removeChild(Xd);
Xd = void 0;
return u2;
}
const nf = ti({ id: { type: String, default: void 0 }, size: wd, disabled: Boolean, modelValue: { type: Jl([String, Number, Object]), default: "" }, maxlength: { type: [String, Number] }, minlength: { type: [String, Number] }, type: { type: String, default: "text" }, resize: { type: String, values: ["none", "both", "horizontal", "vertical"] }, autosize: { type: Jl([Boolean, Object]), default: false }, autocomplete: { type: String, default: "off" }, formatter: { type: Function }, parser: { type: Function }, placeholder: { type: String }, form: { type: String }, readonly: Boolean, clearable: Boolean, showPassword: Boolean, showWordLimit: Boolean, suffixIcon: { type: ni }, prefixIcon: { type: ni }, containerRole: { type: String, default: void 0 }, tabindex: { type: [String, Number], default: 0 }, validateEvent: { type: Boolean, default: true }, inputStyle: { type: Jl([Object, Array, String]), default: () => yi({}) }, autofocus: Boolean, rows: { type: Number, default: 2 }, ...Bd(["ariaLabel"]) });
const of = { [fi]: (e2) => bt(e2), input: (e2) => bt(e2), change: (e2) => bt(e2), focus: (e2) => e2 instanceof FocusEvent, blur: (e2) => e2 instanceof FocusEvent, clear: () => true, mouseleave: (e2) => e2 instanceof MouseEvent, mouseenter: (e2) => e2 instanceof MouseEvent, keydown: (e2) => e2 instanceof Event, compositionstart: (e2) => e2 instanceof CompositionEvent, compositionupdate: (e2) => e2 instanceof CompositionEvent, compositionend: (e2) => e2 instanceof CompositionEvent };
const rf = defineComponent({ name: "ElInput", inheritAttrs: false });
const af = defineComponent({ ...rf, props: nf, emits: of, setup(e2, { expose: r2, emit: a2 }) {
const l2 = e2;
const d2 = useAttrs();
const f2 = useSlots();
const p2 = computed(() => {
const e3 = {};
if (l2.containerRole === "combobox") {
e3["aria-haspopup"] = d2["aria-haspopup"];
e3["aria-owns"] = d2["aria-owns"];
e3["aria-expanded"] = d2["aria-expanded"];
}
return e3;
});
const m2 = computed(() => [l2.type === "textarea" ? V2.b() : N2.b(), N2.m(P2.value), N2.is("disabled", $2.value), N2.is("exceed", ie2.value), { [N2.b("group")]: f2.prepend || f2.append, [N2.m("prefix")]: f2.prefix || l2.prefixIcon, [N2.m("suffix")]: f2.suffix || l2.suffixIcon || l2.clearable || l2.showPassword, [N2.bm("suffix", "password-clear")]: re2.value && ae2.value, [N2.b("hidden")]: l2.type === "hidden" }, d2.class]);
const h2 = computed(() => [N2.e("wrapper"), N2.is("focus", Z2.value)]);
const b2 = Si({ excludeKeys: computed(() => Object.keys(p2.value)) });
const { form: y2, formItem: k2 } = Gd();
const { inputId: F2 } = Zd(l2, { formItemContext: k2 });
const P2 = Kd();
const $2 = Yd();
const N2 = zi("input");
const V2 = zi("textarea");
const D2 = shallowRef();
const H2 = shallowRef();
const U2 = ref(false);
const W2 = ref(false);
const q2 = ref();
const K2 = shallowRef(l2.inputStyle);
const Y2 = computed(() => D2.value || H2.value);
const { wrapperRef: G2, isFocused: Z2 } = Cd(Y2, { afterBlur() {
var e3;
if (l2.validateEvent) {
(e3 = k2 == null ? void 0 : k2.validate) == null ? void 0 : e3.call(k2, "blur").catch((e4) => Js());
}
} });
const X2 = computed(() => {
var e3;
return (e3 = y2 == null ? void 0 : y2.statusIcon) != null ? e3 : false;
});
const J2 = computed(() => (k2 == null ? void 0 : k2.validateState) || "");
const Q2 = computed(() => J2.value && si[J2.value]);
const ee2 = computed(() => W2.value ? Yl : Tl);
const te2 = computed(() => [d2.style]);
const ne2 = computed(() => [l2.inputStyle, K2.value, { resize: l2.resize }]);
const oe2 = computed(() => Rs(l2.modelValue) ? "" : String(l2.modelValue));
const re2 = computed(() => l2.clearable && !$2.value && !l2.readonly && !!oe2.value && (Z2.value || U2.value));
const ae2 = computed(() => l2.showPassword && !$2.value && !l2.readonly && !!oe2.value && (!!oe2.value || Z2.value));
const se2 = computed(() => l2.showWordLimit && !!l2.maxlength && (l2.type === "text" || l2.type === "textarea") && !$2.value && !l2.readonly && !l2.showPassword);
const le2 = computed(() => oe2.value.length);
const ie2 = computed(() => !!se2.value && le2.value > Number(l2.maxlength));
const ue2 = computed(() => !!f2.suffix || !!l2.suffixIcon || re2.value || l2.showPassword || se2.value || !!J2.value && X2.value);
const [ce2, de2] = yd(D2);
tt(H2, (e3) => {
ve2();
if (!se2.value || l2.resize !== "both") return;
const t2 = e3[0];
const { width: n2 } = t2.contentRect;
q2.value = { right: `calc(100% - ${n2 + 15 + 6}px)` };
});
const fe2 = () => {
const { type: e3, autosize: t2 } = l2;
if (!Te || e3 !== "textarea" || !H2.value) return;
if (t2) {
const e4 = yt(t2) ? t2.minRows : void 0;
const n2 = yt(t2) ? t2.maxRows : void 0;
const o2 = tf(H2.value, e4, n2);
K2.value = { overflowY: "hidden", ...o2 };
nextTick(() => {
H2.value.offsetHeight;
K2.value = o2;
});
} else {
K2.value = { minHeight: tf(H2.value).minHeight };
}
};
const pe2 = (e3) => {
let t2 = false;
return () => {
var n2;
if (t2 || !l2.autosize) return;
const o2 = ((n2 = H2.value) == null ? void 0 : n2.offsetParent) === null;
if (!o2) {
e3();
t2 = true;
}
};
};
const ve2 = pe2(fe2);
const me2 = () => {
const e3 = Y2.value;
const t2 = l2.formatter ? l2.formatter(oe2.value) : oe2.value;
if (!e3 || e3.value === t2) return;
e3.value = t2;
};
const he2 = async (e3) => {
ce2();
let { value: t2 } = e3.target;
if (l2.formatter) {
t2 = l2.parser ? l2.parser(t2) : t2;
}
if (be2.value) return;
if (t2 === oe2.value) {
me2();
return;
}
a2(fi, t2);
a2("input", t2);
await nextTick();
me2();
de2();
};
const ge2 = (e3) => {
a2("change", e3.target.value);
};
const { isComposing: be2, handleCompositionStart: ye2, handleCompositionUpdate: we2, handleCompositionEnd: xe2 } = kd({ emit: a2, afterComposition: he2 });
const Se2 = () => {
W2.value = !W2.value;
Ce2();
};
const Ce2 = async () => {
var e3;
await nextTick();
(e3 = Y2.value) == null ? void 0 : e3.focus();
};
const ke2 = () => {
var e3;
return (e3 = Y2.value) == null ? void 0 : e3.blur();
};
const _e2 = (e3) => {
U2.value = false;
a2("mouseleave", e3);
};
const Ee2 = (e3) => {
U2.value = true;
a2("mouseenter", e3);
};
const Oe2 = (e3) => {
a2("keydown", e3);
};
const Le2 = () => {
var e3;
(e3 = Y2.value) == null ? void 0 : e3.select();
};
const Ae2 = () => {
a2(fi, "");
a2("change", "");
a2("clear");
a2("input", "");
};
watch(() => l2.modelValue, () => {
var e3;
nextTick(() => fe2());
if (l2.validateEvent) {
(e3 = k2 == null ? void 0 : k2.validate) == null ? void 0 : e3.call(k2, "change").catch((e4) => Js());
}
});
watch(oe2, () => me2());
watch(() => l2.type, async () => {
await nextTick();
me2();
fe2();
});
onMounted(() => {
if (!l2.formatter && l2.parser) ;
me2();
nextTick(fe2);
});
r2({ input: D2, textarea: H2, ref: Y2, textareaStyle: ne2, autosize: toRef(l2, "autosize"), isComposing: be2, focus: Ce2, blur: ke2, select: Le2, clear: Ae2, resizeTextarea: fe2 });
return (e3, r3) => (openBlock(), createElementBlock("div", mergeProps(unref(p2), { class: [unref(m2), { [unref(N2).bm("group", "append")]: e3.$slots.append, [unref(N2).bm("group", "prepend")]: e3.$slots.prepend }], style: unref(te2), role: e3.containerRole, onMouseenter: Ee2, onMouseleave: _e2 }), [createCommentVNode(" input "), e3.type !== "textarea" ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [createCommentVNode(" prepend slot "), e3.$slots.prepend ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass(unref(N2).be("group", "prepend")) }, [renderSlot(e3.$slots, "prepend")], 2)) : createCommentVNode("v-if", true), createElementVNode("div", { ref_key: "wrapperRef", ref: G2, class: normalizeClass(unref(h2)) }, [createCommentVNode(" prefix slot "), e3.$slots.prefix || e3.prefixIcon ? (openBlock(), createElementBlock("span", { key: 0, class: normalizeClass(unref(N2).e("prefix")) }, [createElementVNode("span", { class: normalizeClass(unref(N2).e("prefix-inner")) }, [renderSlot(e3.$slots, "prefix"), e3.prefixIcon ? (openBlock(), createBlock(unref(Ud), { key: 0, class: normalizeClass(unref(N2).e("icon")) }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e3.prefixIcon)))]), _: 1 }, 8, ["class"])) : createCommentVNode("v-if", true)], 2)], 2)) : createCommentVNode("v-if", true), createElementVNode("input", mergeProps({ id: unref(F2), ref_key: "input", ref: D2, class: unref(N2).e("inner") }, unref(b2), { minlength: e3.minlength, maxlength: e3.maxlength, type: e3.showPassword ? W2.value ? "text" : "password" : e3.type, disabled: unref($2), readonly: e3.readonly, autocomplete: e3.autocomplete, tabindex: e3.tabindex, "aria-label": e3.ariaLabel, placeholder: e3.placeholder, style: e3.inputStyle, form: e3.form, autofocus: e3.autofocus, onCompositionstart: unref(ye2), onCompositionupdate: unref(we2), onCompositionend: unref(xe2), onInput: he2, onChange: ge2, onKeydown: Oe2 }), null, 16, ["id", "minlength", "maxlength", "type", "disabled", "readonly", "autocomplete", "tabindex", "aria-label", "placeholder", "form", "autofocus", "onCompositionstart", "onCompositionupdate", "onCompositionend"]), createCommentVNode(" suffix slot "), unref(ue2) ? (openBlock(), createElementBlock("span", { key: 1, class: normalizeClass(unref(N2).e("suffix")) }, [createElementVNode("span", { class: normalizeClass(unref(N2).e("suffix-inner")) }, [!unref(re2) || !unref(ae2) || !unref(se2) ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [renderSlot(e3.$slots, "suffix"), e3.suffixIcon ? (openBlock(), createBlock(unref(Ud), { key: 0, class: normalizeClass(unref(N2).e("icon")) }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e3.suffixIcon)))]), _: 1 }, 8, ["class"])) : createCommentVNode("v-if", true)], 64)) : createCommentVNode("v-if", true), unref(re2) ? (openBlock(), createBlock(unref(Ud), { key: 1, class: normalizeClass([unref(N2).e("icon"), unref(N2).e("clear")]), onMousedown: withModifiers(unref(ft), ["prevent"]), onClick: Ae2 }, { default: withCtx(() => [createVNode(unref(Sl))]), _: 1 }, 8, ["class", "onMousedown"])) : createCommentVNode("v-if", true), unref(ae2) ? (openBlock(), createBlock(unref(Ud), { key: 2, class: normalizeClass([unref(N2).e("icon"), unref(N2).e("password")]), onClick: Se2 }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(unref(ee2))))]), _: 1 }, 8, ["class"])) : createCommentVNode("v-if", true), unref(se2) ? (openBlock(), createElementBlock("span", { key: 3, class: normalizeClass(unref(N2).e("count")) }, [createElementVNode("span", { class: normalizeClass(unref(N2).e("count-inner")) }, toDisplayString(unref(le2)) + " / " + toDisplayString(e3.maxlength), 3)], 2)) : createCommentVNode("v-if", true), unref(J2) && unref(Q2) && unref(X2) ? (openBlock(), createBlock(unref(Ud), { key: 4, class: normalizeClass([unref(N2).e("icon"), unref(N2).e("validateIcon"), unref(N2).is("loading", unref(J2) === "validating")]) }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(unref(Q2))))]), _: 1 }, 8, ["class"])) : createCommentVNode("v-if", true)], 2)], 2)) : createCommentVNode("v-if", true)], 2), createCommentVNode(" append slot "), e3.$slots.append ? (openBlock(), createElementBlock("div", { key: 1, class: normalizeClass(unref(N2).be("group", "append")) }, [renderSlot(e3.$slots, "append")], 2)) : createCommentVNode("v-if", true)], 64)) : (openBlock(), createElementBlock(Fragment, { key: 1 }, [createCommentVNode(" textarea "), createElementVNode("textarea", mergeProps({ id: unref(F2), ref_key: "textarea", ref: H2, class: [unref(V2).e("inner"), unref(N2).is("focus", unref(Z2))] }, unref(b2), { minlength: e3.minlength, maxlength: e3.maxlength, tabindex: e3.tabindex, disabled: unref($2), readonly: e3.readonly, autocomplete: e3.autocomplete, style: unref(ne2), "aria-label": e3.ariaLabel, placeholder: e3.placeholder, form: e3.form, autofocus: e3.autofocus, rows: e3.rows, onCompositionstart: unref(ye2), onCompositionupdate: unref(we2), onCompositionend: unref(xe2), onInput: he2, onChange: ge2, onKeydown: Oe2 }), null, 16, ["id", "minlength", "maxlength", "tabindex", "disabled", "readonly", "autocomplete", "aria-label", "placeholder", "form", "autofocus", "rows", "onCompositionstart", "onCompositionupdate", "onCompositionend"]), unref(se2) ? (openBlock(), createElementBlock("span", { key: 0, style: normalizeStyle(q2.value), class: normalizeClass(unref(N2).e("count")) }, toDisplayString(unref(le2)) + " / " + toDisplayString(e3.maxlength), 7)) : createCommentVNode("v-if", true)], 64))], 16, ["role"]));
} });
var sf = $d(af, [["__file", "input.vue"]]);
const lf = exports("b", li(sf));
const uf = 4;
const cf = { vertical: { offset: "offsetHeight", scroll: "scrollTop", scrollSize: "scrollHeight", size: "height", key: "vertical", axis: "Y", client: "clientY", direction: "top" }, horizontal: { offset: "offsetWidth", scroll: "scrollLeft", scrollSize: "scrollWidth", size: "width", key: "horizontal", axis: "X", client: "clientX", direction: "left" } };
const df = ({ move: e2, size: t2, bar: n2 }) => ({ [n2.size]: t2, transform: `translate${n2.axis}(${e2}%)` });
const ff = Symbol("scrollbarContextKey");
const pf = ti({ vertical: Boolean, size: String, move: Number, ratio: { type: Number, required: true }, always: Boolean });
const vf = "Thumb";
const mf = defineComponent({ __name: "thumb", props: pf, setup(e2) {
const n2 = e2;
const r2 = inject(ff);
const a2 = zi("scrollbar");
if (!r2) Xs(vf, "can not inject scrollbar context");
const l2 = ref();
const i2 = ref();
const c2 = ref({});
const d2 = ref(false);
let m2 = false;
let h2 = false;
let g2 = Te ? document.onselectstart : null;
const b2 = computed(() => cf[n2.vertical ? "vertical" : "horizontal"]);
const y2 = computed(() => df({ size: n2.size, move: n2.move, bar: b2.value }));
const w2 = computed(() => l2.value[b2.value.offset] ** 2 / r2.wrapElement[b2.value.scrollSize] / n2.ratio / i2.value[b2.value.offset]);
const x2 = (e3) => {
var t2;
e3.stopPropagation();
if (e3.ctrlKey || [1, 2].includes(e3.button)) return;
(t2 = window.getSelection()) == null ? void 0 : t2.removeAllRanges();
k2(e3);
const n3 = e3.currentTarget;
if (!n3) return;
c2.value[b2.value.axis] = n3[b2.value.offset] - (e3[b2.value.client] - n3.getBoundingClientRect()[b2.value.direction]);
};
const S2 = (e3) => {
if (!i2.value || !l2.value || !r2.wrapElement) return;
const t2 = Math.abs(e3.target.getBoundingClientRect()[b2.value.direction] - e3[b2.value.client]);
const n3 = i2.value[b2.value.offset] / 2;
const o2 = (t2 - n3) * 100 * w2.value / l2.value[b2.value.offset];
r2.wrapElement[b2.value.scroll] = o2 * r2.wrapElement[b2.value.scrollSize] / 100;
};
const k2 = (e3) => {
e3.stopImmediatePropagation();
m2 = true;
document.addEventListener("mousemove", _2);
document.addEventListener("mouseup", E2);
g2 = document.onselectstart;
document.onselectstart = () => false;
};
const _2 = (e3) => {
if (!l2.value || !i2.value) return;
if (m2 === false) return;
const t2 = c2.value[b2.value.axis];
if (!t2) return;
const n3 = (l2.value.getBoundingClientRect()[b2.value.direction] - e3[b2.value.client]) * -1;
const o2 = i2.value[b2.value.offset] - t2;
const a3 = (n3 - o2) * 100 * w2.value / l2.value[b2.value.offset];
r2.wrapElement[b2.value.scroll] = a3 * r2.wrapElement[b2.value.scrollSize] / 100;
};
const E2 = () => {
m2 = false;
c2.value[b2.value.axis] = 0;
document.removeEventListener("mousemove", _2);
document.removeEventListener("mouseup", E2);
T2();
if (h2) d2.value = false;
};
const O2 = () => {
h2 = false;
d2.value = !!n2.size;
};
const L2 = () => {
h2 = true;
d2.value = m2;
};
onBeforeUnmount(() => {
T2();
document.removeEventListener("mouseup", E2);
});
const T2 = () => {
if (document.onselectstart !== g2) document.onselectstart = g2;
};
Ue(toRef(r2, "scrollbarElement"), "mousemove", O2);
Ue(toRef(r2, "scrollbarElement"), "mouseleave", L2);
return (e3, n3) => (openBlock(), createBlock(Transition, { name: unref(a2).b("fade"), persisted: "" }, { default: withCtx(() => [withDirectives(createElementVNode("div", { ref_key: "instance", ref: l2, class: normalizeClass([unref(a2).e("bar"), unref(a2).is(unref(b2).key)]), onMousedown: S2 }, [createElementVNode("div", { ref_key: "thumb", ref: i2, class: normalizeClass(unref(a2).e("thumb")), style: normalizeStyle(unref(y2)), onMousedown: x2 }, null, 38)], 34), [[vShow, e3.always || d2.value]])]), _: 1 }, 8, ["name"]));
} });
var hf = $d(mf, [["__file", "thumb.vue"]]);
const gf = ti({ always: { type: Boolean, default: true }, minSize: { type: Number, required: true } });
const bf = defineComponent({ __name: "bar", props: gf, setup(e2, { expose: o2 }) {
const r2 = e2;
const a2 = inject(ff);
const s2 = ref(0);
const l2 = ref(0);
const i2 = ref("");
const u2 = ref("");
const c2 = ref(1);
const d2 = ref(1);
const f2 = (e3) => {
if (e3) {
const t2 = e3.offsetHeight - uf;
const n2 = e3.offsetWidth - uf;
l2.value = e3.scrollTop * 100 / t2 * c2.value;
s2.value = e3.scrollLeft * 100 / n2 * d2.value;
}
};
const m2 = () => {
const e3 = a2 == null ? void 0 : a2.wrapElement;
if (!e3) return;
const t2 = e3.offsetHeight - uf;
const n2 = e3.offsetWidth - uf;
const o3 = t2 ** 2 / e3.scrollHeight;
const s3 = n2 ** 2 / e3.scrollWidth;
const l3 = Math.max(o3, r2.minSize);
const f3 = Math.max(s3, r2.minSize);
c2.value = o3 / (t2 - o3) / (l3 / (t2 - l3));
d2.value = s3 / (n2 - s3) / (f3 / (n2 - f3));
u2.value = l3 + uf < t2 ? `${l3}px` : "";
i2.value = f3 + uf < n2 ? `${f3}px` : "";
};
o2({ handleScroll: f2, update: m2 });
return (e3, o3) => (openBlock(), createElementBlock(Fragment, null, [createVNode(hf, { move: s2.value, ratio: d2.value, size: i2.value, always: e3.always }, null, 8, ["move", "ratio", "size", "always"]), createVNode(hf, { move: l2.value, ratio: c2.value, size: u2.value, vertical: "", always: e3.always }, null, 8, ["move", "ratio", "size", "always"])], 64));
} });
var yf = $d(bf, [["__file", "bar.vue"]]);
const wf = ti({ height: { type: [String, Number], default: "" }, maxHeight: { type: [String, Number], default: "" }, native: { type: Boolean, default: false }, wrapStyle: { type: Jl([String, Object, Array]), default: "" }, wrapClass: { type: [String, Array], default: "" }, viewClass: { type: [String, Array], default: "" }, viewStyle: { type: [String, Array, Object], default: "" }, noresize: Boolean, tag: { type: String, default: "div" }, always: Boolean, minSize: { type: Number, default: 20 }, id: String, role: String, ...Bd(["ariaLabel", "ariaOrientation"]) });
const xf = { scroll: ({ scrollTop: e2, scrollLeft: t2 }) => [e2, t2].every(Hs) };
const Sf = "ElScrollbar";
const Cf = defineComponent({ name: Sf });
const kf = defineComponent({ ...Cf, props: wf, emits: xf, setup(e2, { expose: r2, emit: a2 }) {
const l2 = e2;
const d2 = zi("scrollbar");
let f2 = void 0;
let p2 = void 0;
let m2 = 0;
let h2 = 0;
const g2 = ref();
const b2 = ref();
const S2 = ref();
const C2 = ref();
const k2 = computed(() => {
const e3 = {};
if (l2.height) e3.height = rl(l2.height);
if (l2.maxHeight) e3.maxHeight = rl(l2.maxHeight);
return [l2.wrapStyle, e3];
});
const _2 = computed(() => [l2.wrapClass, d2.e("wrap"), { [d2.em("wrap", "hidden-default")]: !l2.native }]);
const E2 = computed(() => [d2.e("view"), l2.viewClass]);
const L2 = () => {
var e3;
if (b2.value) {
(e3 = C2.value) == null ? void 0 : e3.handleScroll(b2.value);
m2 = b2.value.scrollTop;
h2 = b2.value.scrollLeft;
a2("scroll", { scrollTop: b2.value.scrollTop, scrollLeft: b2.value.scrollLeft });
}
};
function I2(e3, t2) {
if (yt(e3)) {
b2.value.scrollTo(e3);
} else if (Hs(e3) && Hs(t2)) {
b2.value.scrollTo(e3, t2);
}
}
const R2 = (e3) => {
if (!Hs(e3)) {
return;
}
b2.value.scrollTop = e3;
};
const j2 = (e3) => {
if (!Hs(e3)) {
return;
}
b2.value.scrollLeft = e3;
};
const F2 = () => {
var e3;
(e3 = C2.value) == null ? void 0 : e3.update();
};
watch(() => l2.noresize, (e3) => {
if (e3) {
f2 == null ? void 0 : f2();
p2 == null ? void 0 : p2();
} else {
({ stop: f2 } = tt(S2, F2));
p2 = Ue("resize", F2);
}
}, { immediate: true });
watch(() => [l2.maxHeight, l2.height], () => {
if (!l2.native) nextTick(() => {
var e3;
F2();
if (b2.value) {
(e3 = C2.value) == null ? void 0 : e3.handleScroll(b2.value);
}
});
});
provide(ff, reactive({ scrollbarElement: g2, wrapElement: b2 }));
onActivated(() => {
b2.value.scrollTop = m2;
b2.value.scrollLeft = h2;
});
onMounted(() => {
if (!l2.native) nextTick(() => {
F2();
});
});
onUpdated(() => F2());
r2({ wrapRef: b2, update: F2, scrollTo: I2, setScrollTop: R2, setScrollLeft: j2, handleScroll: L2 });
return (e3, r3) => (openBlock(), createElementBlock("div", { ref_key: "scrollbarRef", ref: g2, class: normalizeClass(unref(d2).b()) }, [createElementVNode("div", { ref_key: "wrapRef", ref: b2, class: normalizeClass(unref(_2)), style: normalizeStyle(unref(k2)), onScroll: L2 }, [(openBlock(), createBlock(resolveDynamicComponent(e3.tag), { id: e3.id, ref_key: "resizeRef", ref: S2, class: normalizeClass(unref(E2)), style: normalizeStyle(e3.viewStyle), role: e3.role, "aria-label": e3.ariaLabel, "aria-orientation": e3.ariaOrientation }, { default: withCtx(() => [renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "style", "role", "aria-label", "aria-orientation"]))], 38), !e3.native ? (openBlock(), createBlock(yf, { key: 0, ref_key: "barRef", ref: C2, always: e3.always, "min-size": e3.minSize }, null, 8, ["always", "min-size"])) : createCommentVNode("v-if", true)], 2));
} });
var _f = $d(kf, [["__file", "scrollbar.vue"]]);
const Ef = exports("o", li(_f));
const Of = Symbol("popper");
const Lf = Symbol("popperContent");
const Af = ["dialog", "grid", "group", "listbox", "menu", "navigation", "tooltip", "tree"];
const Bf = ti({ role: { type: String, values: Af, default: "tooltip" } });
const Mf = defineComponent({ name: "ElPopper", inheritAttrs: false });
const Tf = defineComponent({ ...Mf, props: Bf, setup(e2, { expose: t2 }) {
const n2 = e2;
const o2 = ref();
const r2 = ref();
const a2 = ref();
const l2 = ref();
const i2 = computed(() => n2.role);
const u2 = { triggerRef: o2, popperInstanceRef: r2, contentRef: a2, referenceRef: l2, role: i2 };
t2(u2);
provide(Of, u2);
return (e3, t3) => renderSlot(e3.$slots, "default");
} });
var If = $d(Tf, [["__file", "popper.vue"]]);
const Rf = ti({ arrowOffset: { type: Number, default: 5 } });
const jf = defineComponent({ name: "ElPopperArrow", inheritAttrs: false });
const zf = defineComponent({ ...jf, props: Rf, setup(e2, { expose: o2 }) {
const r2 = e2;
const a2 = zi("popper");
const { arrowOffset: s2, arrowRef: l2, arrowStyle: c2 } = inject(Lf, void 0);
watch(() => r2.arrowOffset, (e3) => {
s2.value = e3;
});
onBeforeUnmount(() => {
l2.value = void 0;
});
o2({ arrowRef: l2 });
return (e3, o3) => (openBlock(), createElementBlock("span", { ref_key: "arrowRef", ref: l2, class: normalizeClass(unref(a2).e("arrow")), style: normalizeStyle(unref(c2)), "data-popper-arrow": "" }, null, 6));
} });
var Ff = $d(zf, [["__file", "arrow.vue"]]);
const Pf = "ElOnlyChild";
const $f = defineComponent({ name: Pf, setup(e2, { slots: t2, attrs: n2 }) {
var o2;
const r2 = inject(cd);
const a2 = fd((o2 = r2 == null ? void 0 : r2.setForwardRef) != null ? o2 : ft);
return () => {
var e3;
const o3 = (e3 = t2.default) == null ? void 0 : e3.call(t2, n2);
if (!o3) return null;
if (o3.length > 1) {
return null;
}
const r3 = Nf(o3);
if (!r3) {
return null;
}
return withDirectives(cloneVNode(r3, n2), [[a2]]);
};
} });
function Nf(e2) {
if (!e2) return null;
const t2 = e2;
for (const e3 of t2) {
if (yt(e3)) {
switch (e3.type) {
case Comment:
continue;
case Text:
case "svg":
return Vf(e3);
case Fragment:
return Nf(e3.children);
default:
return e3;
}
}
return Vf(e3);
}
return null;
}
function Vf(e2) {
const t2 = zi("only-child");
return createVNode("span", { class: t2.e("content") }, [e2]);
}
const Df = ti({ virtualRef: { type: Jl(Object) }, virtualTriggering: Boolean, onMouseenter: { type: Jl(Function) }, onMouseleave: { type: Jl(Function) }, onClick: { type: Jl(Function) }, onKeydown: { type: Jl(Function) }, onFocus: { type: Jl(Function) }, onBlur: { type: Jl(Function) }, onContextmenu: { type: Jl(Function) }, id: String, open: Boolean });
const Hf = defineComponent({ name: "ElPopperTrigger", inheritAttrs: false });
const Uf = defineComponent({ ...Hf, props: Df, setup(e2, { expose: n2 }) {
const o2 = e2;
const { role: r2, triggerRef: a2 } = inject(Of, void 0);
dd(a2);
const l2 = computed(() => v2.value ? o2.id : void 0);
const d2 = computed(() => {
if (r2 && r2.value === "tooltip") {
return o2.open && o2.id ? o2.id : void 0;
}
return void 0;
});
const v2 = computed(() => {
if (r2 && r2.value !== "tooltip") {
return r2.value;
}
return void 0;
});
const m2 = computed(() => v2.value ? `${o2.open}` : void 0);
let h2 = void 0;
const g2 = ["onMouseenter", "onMouseleave", "onClick", "onKeydown", "onFocus", "onBlur", "onContextmenu"];
onMounted(() => {
watch(() => o2.virtualRef, (e3) => {
if (e3) {
a2.value = Ve(e3);
}
}, { immediate: true });
watch(a2, (e3, t2) => {
h2 == null ? void 0 : h2();
h2 = void 0;
if (Ws(e3)) {
g2.forEach((n3) => {
var r3;
const a3 = o2[n3];
if (a3) {
e3.addEventListener(n3.slice(2).toLowerCase(), a3);
(r3 = t2 == null ? void 0 : t2.removeEventListener) == null ? void 0 : r3.call(t2, n3.slice(2).toLowerCase(), a3);
}
});
h2 = watch([l2, d2, v2, m2], (t3) => {
["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((n3, o3) => {
Rs(t3[o3]) ? e3.removeAttribute(n3) : e3.setAttribute(n3, t3[o3]);
});
}, { immediate: true });
}
if (Ws(t2)) {
["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((e4) => t2.removeAttribute(e4));
}
}, { immediate: true });
});
onBeforeUnmount(() => {
h2 == null ? void 0 : h2();
h2 = void 0;
if (a2.value && Ws(a2.value)) {
const e3 = a2.value;
g2.forEach((t2) => {
const n3 = o2[t2];
if (n3) {
e3.removeEventListener(t2.slice(2).toLowerCase(), n3);
}
});
a2.value = void 0;
}
});
n2({ triggerRef: a2 });
return (e3, n3) => !e3.virtualTriggering ? (openBlock(), createBlock(unref($f), mergeProps({ key: 0 }, e3.$attrs, { "aria-controls": unref(l2), "aria-describedby": unref(d2), "aria-expanded": unref(m2), "aria-haspopup": unref(v2) }), { default: withCtx(() => [renderSlot(e3.$slots, "default")]), _: 3 }, 16, ["aria-controls", "aria-describedby", "aria-expanded", "aria-haspopup"])) : createCommentVNode("v-if", true);
} });
var Wf = $d(Uf, [["__file", "trigger.vue"]]);
const qf = "focus-trap.focus-after-trapped";
const Kf = "focus-trap.focus-after-released";
const Yf = "focus-trap.focusout-prevented";
const Gf = { cancelable: true, bubbles: false };
const Zf = { cancelable: true, bubbles: false };
const Xf = "focusAfterTrapped";
const Jf = "focusAfterReleased";
const Qf = Symbol("elFocusTrap");
const ep = ref();
const tp = ref(0);
const np = ref(0);
let op = 0;
const rp = (e2) => {
const t2 = [];
const n2 = document.createTreeWalker(e2, NodeFilter.SHOW_ELEMENT, { acceptNode: (e3) => {
const t3 = e3.tagName === "INPUT" && e3.type === "hidden";
if (e3.disabled || e3.hidden || t3) return NodeFilter.FILTER_SKIP;
return e3.tabIndex >= 0 || e3 === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP;
} });
while (n2.nextNode()) t2.push(n2.currentNode);
return t2;
};
const ap = (e2, t2) => {
for (const n2 of e2) {
if (!sp(n2, t2)) return n2;
}
};
const sp = (e2, t2) => {
if (getComputedStyle(e2).visibility === "hidden") return true;
while (e2) {
if (t2 && e2 === t2) return false;
if (getComputedStyle(e2).display === "none") return true;
e2 = e2.parentElement;
}
return false;
};
const lp = (e2) => {
const t2 = rp(e2);
const n2 = ap(t2, e2);
const o2 = ap(t2.reverse(), e2);
return [n2, o2];
};
const ip = (e2) => e2 instanceof HTMLInputElement && "select" in e2;
const up = (e2, t2) => {
if (e2 && e2.focus) {
const n2 = document.activeElement;
e2.focus({ preventScroll: true });
np.value = window.performance.now();
if (e2 !== n2 && ip(e2) && t2) {
e2.select();
}
}
};
function cp(e2, t2) {
const n2 = [...e2];
const o2 = e2.indexOf(t2);
if (o2 !== -1) {
n2.splice(o2, 1);
}
return n2;
}
const dp = () => {
let e2 = [];
const t2 = (t3) => {
const n3 = e2[0];
if (n3 && t3 !== n3) {
n3.pause();
}
e2 = cp(e2, t3);
e2.unshift(t3);
};
const n2 = (t3) => {
var n3, o2;
e2 = cp(e2, t3);
(o2 = (n3 = e2[0]) == null ? void 0 : n3.resume) == null ? void 0 : o2.call(n3);
};
return { push: t2, remove: n2 };
};
const fp = (e2, t2 = false) => {
const n2 = document.activeElement;
for (const o2 of e2) {
up(o2, t2);
if (document.activeElement !== n2) return;
}
};
const pp = dp();
const vp = () => tp.value > np.value;
const mp = () => {
ep.value = "pointer";
tp.value = window.performance.now();
};
const hp = () => {
ep.value = "keyboard";
tp.value = window.performance.now();
};
const gp = () => {
onMounted(() => {
if (op === 0) {
document.addEventListener("mousedown", mp);
document.addEventListener("touchstart", mp);
document.addEventListener("keydown", hp);
}
op++;
});
onBeforeUnmount(() => {
op--;
if (op <= 0) {
document.removeEventListener("mousedown", mp);
document.removeEventListener("touchstart", mp);
document.removeEventListener("keydown", hp);
}
});
return { focusReason: ep, lastUserFocusTimestamp: tp, lastAutomatedFocusTimestamp: np };
};
const bp = (e2) => new CustomEvent(Yf, { ...Zf, detail: e2 });
const yp = defineComponent({ name: "ElFocusTrap", inheritAttrs: false, props: { loop: Boolean, trapped: Boolean, focusTrapEl: Object, focusStartEl: { type: [Object, String], default: "first" } }, emits: [Xf, Jf, "focusin", "focusout", "focusout-prevented", "release-requested"], setup(e2, { emit: t2 }) {
const n2 = ref();
let o2;
let r2;
const { focusReason: a2 } = gp();
od((n3) => {
if (e2.trapped && !s2.paused) {
t2("release-requested", n3);
}
});
const s2 = { paused: false, pause() {
this.paused = true;
}, resume() {
this.paused = false;
} };
const l2 = (n3) => {
if (!e2.loop && !e2.trapped) return;
if (s2.paused) return;
const { key: o3, altKey: r3, ctrlKey: l3, metaKey: i2, currentTarget: u2, shiftKey: c2 } = n3;
const { loop: d3 } = e2;
const f2 = o3 === di.tab && !r3 && !l3 && !i2;
const p3 = document.activeElement;
if (f2 && p3) {
const e3 = u2;
const [o4, r4] = lp(e3);
const s3 = o4 && r4;
if (!s3) {
if (p3 === e3) {
const e4 = bp({ focusReason: a2.value });
t2("focusout-prevented", e4);
if (!e4.defaultPrevented) {
n3.preventDefault();
}
}
} else {
if (!c2 && p3 === r4) {
const e4 = bp({ focusReason: a2.value });
t2("focusout-prevented", e4);
if (!e4.defaultPrevented) {
n3.preventDefault();
if (d3) up(o4, true);
}
} else if (c2 && [o4, e3].includes(p3)) {
const e4 = bp({ focusReason: a2.value });
t2("focusout-prevented", e4);
if (!e4.defaultPrevented) {
n3.preventDefault();
if (d3) up(r4, true);
}
}
}
}
};
provide(Qf, { focusTrapRef: n2, onKeydown: l2 });
watch(() => e2.focusTrapEl, (e3) => {
if (e3) {
n2.value = e3;
}
}, { immediate: true });
watch([n2], ([e3], [t3]) => {
if (e3) {
e3.addEventListener("keydown", l2);
e3.addEventListener("focusin", m2);
e3.addEventListener("focusout", h2);
}
if (t3) {
t3.removeEventListener("keydown", l2);
t3.removeEventListener("focusin", m2);
t3.removeEventListener("focusout", h2);
}
});
const d2 = (e3) => {
t2(Xf, e3);
};
const p2 = (e3) => t2(Jf, e3);
const m2 = (a3) => {
const l3 = unref(n2);
if (!l3) return;
const i2 = a3.target;
const c2 = a3.relatedTarget;
const d3 = i2 && l3.contains(i2);
if (!e2.trapped) {
const e3 = c2 && l3.contains(c2);
if (!e3) {
o2 = c2;
}
}
if (d3) t2("focusin", a3);
if (s2.paused) return;
if (e2.trapped) {
if (d3) {
r2 = i2;
} else {
up(r2, true);
}
}
};
const h2 = (o3) => {
const l3 = unref(n2);
if (s2.paused || !l3) return;
if (e2.trapped) {
const n3 = o3.relatedTarget;
if (!Rs(n3) && !l3.contains(n3)) {
setTimeout(() => {
if (!s2.paused && e2.trapped) {
const e3 = bp({ focusReason: a2.value });
t2("focusout-prevented", e3);
if (!e3.defaultPrevented) {
up(r2, true);
}
}
}, 0);
}
} else {
const e3 = o3.target;
const n3 = e3 && l3.contains(e3);
if (!n3) t2("focusout", o3);
}
};
async function g2() {
await nextTick();
const t3 = unref(n2);
if (t3) {
pp.push(s2);
const n3 = t3.contains(document.activeElement) ? o2 : document.activeElement;
o2 = n3;
const r3 = t3.contains(n3);
if (!r3) {
const o3 = new Event(qf, Gf);
t3.addEventListener(qf, d2);
t3.dispatchEvent(o3);
if (!o3.defaultPrevented) {
nextTick(() => {
let o4 = e2.focusStartEl;
if (!bt(o4)) {
up(o4);
if (document.activeElement !== o4) {
o4 = "first";
}
}
if (o4 === "first") {
fp(rp(t3), true);
}
if (document.activeElement === n3 || o4 === "container") {
up(t3);
}
});
}
}
}
}
function b2() {
const e3 = unref(n2);
if (e3) {
e3.removeEventListener(qf, d2);
const t3 = new CustomEvent(Kf, { ...Gf, detail: { focusReason: a2.value } });
e3.addEventListener(Kf, p2);
e3.dispatchEvent(t3);
if (!t3.defaultPrevented && (a2.value == "keyboard" || !vp() || e3.contains(document.activeElement))) {
up(o2 != null ? o2 : document.body);
}
e3.removeEventListener(Kf, p2);
pp.remove(s2);
}
}
onMounted(() => {
if (e2.trapped) {
g2();
}
watch(() => e2.trapped, (e3) => {
if (e3) {
g2();
} else {
b2();
}
});
});
onBeforeUnmount(() => {
if (e2.trapped) {
b2();
}
if (n2.value) {
n2.value.removeEventListener("keydown", l2);
n2.value.removeEventListener("focusin", m2);
n2.value.removeEventListener("focusout", h2);
n2.value = void 0;
}
});
return { onKeydown: l2 };
} });
function wp(e2, t2, n2, o2, r2, a2) {
return renderSlot(e2.$slots, "default", { handleKeydown: e2.onKeydown });
}
var xp = exports("x", $d(yp, [["render", wp], ["__file", "focus-trap.vue"]]));
const Sp = ["fixed", "absolute"];
const Cp = ti({ boundariesPadding: { type: Number, default: 0 }, fallbackPlacements: { type: Jl(Array), default: void 0 }, gpuAcceleration: { type: Boolean, default: true }, offset: { type: Number, default: 12 }, placement: { type: String, values: tu, default: "bottom" }, popperOptions: { type: Jl(Object), default: () => ({}) }, strategy: { type: String, values: Sp, default: "absolute" } });
const kp = ti({ ...Cp, id: String, style: { type: Jl([String, Array, Object]) }, className: { type: Jl([String, Array, Object]) }, effect: { type: Jl(String), default: "dark" }, visible: Boolean, enterable: { type: Boolean, default: true }, pure: Boolean, focusOnShow: { type: Boolean, default: false }, trapping: { type: Boolean, default: false }, popperClass: { type: Jl([String, Array, Object]) }, popperStyle: { type: Jl([String, Array, Object]) }, referenceEl: { type: Jl(Object) }, triggerTargetEl: { type: Jl(Object) }, stopPopperMouseEvent: { type: Boolean, default: true }, virtualTriggering: Boolean, zIndex: Number, ...Bd(["ariaLabel"]) });
const _p = { mouseenter: (e2) => e2 instanceof MouseEvent, mouseleave: (e2) => e2 instanceof MouseEvent, focus: () => true, blur: () => true, close: () => true };
const Ep = (e2, t2 = []) => {
const { placement: n2, strategy: o2, popperOptions: r2 } = e2;
const a2 = { placement: n2, strategy: o2, ...r2, modifiers: [...Lp(e2), ...t2] };
Ap(a2, r2 == null ? void 0 : r2.modifiers);
return a2;
};
const Op = (e2) => {
if (!Te) return;
return Ve(e2);
};
function Lp(e2) {
const { offset: t2, gpuAcceleration: n2, fallbackPlacements: o2 } = e2;
return [{ name: "offset", options: { offset: [0, t2 != null ? t2 : 12] } }, { name: "preventOverflow", options: { padding: { top: 2, bottom: 2, left: 5, right: 5 } } }, { name: "flip", options: { padding: 5, fallbackPlacements: o2 } }, { name: "computeStyles", options: { gpuAcceleration: n2 } }];
}
function Ap(e2, t2) {
if (t2) {
e2.modifiers = [...e2.modifiers, ...t2 != null ? t2 : []];
}
}
const Bp = 0;
const Mp = (e2) => {
const { popperInstanceRef: t2, contentRef: n2, triggerRef: o2, role: r2 } = inject(Of, void 0);
const a2 = ref();
const l2 = ref();
const d2 = computed(() => ({ name: "eventListeners", enabled: !!e2.visible }));
const f2 = computed(() => {
var e3;
const t3 = unref(a2);
const n3 = (e3 = unref(l2)) != null ? e3 : Bp;
return { name: "arrow", enabled: !js(t3), options: { element: t3, padding: n3 } };
});
const m2 = computed(() => ({ onFirstUpdate: () => {
w2();
}, ...Ep(e2, [unref(f2), unref(d2)]) }));
const h2 = computed(() => Op(e2.referenceEl) || unref(o2));
const { attributes: g2, state: b2, styles: y2, update: w2, forceUpdate: x2, instanceRef: S2 } = Kc(h2, n2, m2);
watch(S2, (e3) => t2.value = e3);
onMounted(() => {
watch(() => {
var e3;
return (e3 = unref(h2)) == null ? void 0 : e3.getBoundingClientRect();
}, () => {
w2();
});
});
return { attributes: g2, arrowRef: a2, contentRef: n2, instanceRef: S2, state: b2, styles: y2, role: r2, forceUpdate: x2, update: w2 };
};
const Tp = (e2, { attributes: t2, styles: n2, role: o2 }) => {
const { nextZIndex: r2 } = bd();
const a2 = zi("popper");
const l2 = computed(() => unref(t2).popper);
const i2 = ref(Hs(e2.zIndex) ? e2.zIndex : r2());
const c2 = computed(() => [a2.b(), a2.is("pure", e2.pure), a2.is(e2.effect), e2.popperClass]);
const d2 = computed(() => [{ zIndex: unref(i2) }, unref(n2).popper, e2.popperStyle || {}]);
const f2 = computed(() => o2.value === "dialog" ? "false" : void 0);
const p2 = computed(() => unref(n2).arrow || {});
const m2 = () => {
i2.value = Hs(e2.zIndex) ? e2.zIndex : r2();
};
return { ariaModal: f2, arrowStyle: p2, contentAttrs: l2, contentClass: c2, contentStyle: d2, contentZIndex: i2, updateZIndex: m2 };
};
const Ip = (e2, t2) => {
const n2 = ref(false);
const o2 = ref();
const r2 = () => {
t2("focus");
};
const a2 = (e3) => {
var n3;
if (((n3 = e3.detail) == null ? void 0 : n3.focusReason) !== "pointer") {
o2.value = "first";
t2("blur");
}
};
const s2 = (t3) => {
if (e2.visible && !n2.value) {
if (t3.target) {
o2.value = t3.target;
}
n2.value = true;
}
};
const l2 = (t3) => {
if (!e2.trapping) {
if (t3.detail.focusReason === "pointer") {
t3.preventDefault();
}
n2.value = false;
}
};
const i2 = () => {
n2.value = false;
t2("close");
};
return { focusStartRef: o2, trapped: n2, onFocusAfterReleased: a2, onFocusAfterTrapped: r2, onFocusInTrap: s2, onFocusoutPrevented: l2, onReleaseRequested: i2 };
};
const Rp = defineComponent({ name: "ElPopperContent" });
const jp = defineComponent({ ...Rp, props: kp, emits: _p, setup(e2, { expose: o2, emit: r2 }) {
const a2 = e2;
const { focusStartRef: s2, trapped: l2, onFocusAfterReleased: d2, onFocusAfterTrapped: m2, onFocusInTrap: h2, onFocusoutPrevented: g2, onReleaseRequested: b2 } = Ip(a2, r2);
const { attributes: w2, arrowRef: C2, contentRef: k2, styles: _2, instanceRef: E2, role: O2, update: L2 } = Mp(a2);
const { ariaModal: A2, arrowStyle: B2, contentAttrs: T2, contentClass: I2, contentStyle: j2, updateZIndex: z2 } = Tp(a2, { styles: _2, attributes: w2, role: O2 });
const F2 = inject(qd, void 0);
const P2 = ref();
provide(Lf, { arrowStyle: B2, arrowRef: C2, arrowOffset: P2 });
if (F2) {
provide(qd, { ...F2, addInputId: ft, removeInputId: ft });
}
let $2 = void 0;
const N2 = (e3 = true) => {
L2();
e3 && z2();
};
const V2 = () => {
N2(false);
if (a2.visible && a2.focusOnShow) {
l2.value = true;
} else if (a2.visible === false) {
l2.value = false;
}
};
onMounted(() => {
watch(() => a2.triggerTargetEl, (e3, t2) => {
$2 == null ? void 0 : $2();
$2 = void 0;
const n2 = unref(e3 || k2.value);
const o3 = unref(t2 || k2.value);
if (Ws(n2)) {
$2 = watch([O2, () => a2.ariaLabel, A2, () => a2.id], (e4) => {
["role", "aria-label", "aria-modal", "id"].forEach((t3, o4) => {
Rs(e4[o4]) ? n2.removeAttribute(t3) : n2.setAttribute(t3, e4[o4]);
});
}, { immediate: true });
}
if (o3 !== n2 && Ws(o3)) {
["role", "aria-label", "aria-modal", "id"].forEach((e4) => {
o3.removeAttribute(e4);
});
}
}, { immediate: true });
watch(() => a2.visible, V2, { immediate: true });
});
onBeforeUnmount(() => {
$2 == null ? void 0 : $2();
$2 = void 0;
});
o2({ popperContentRef: k2, popperInstanceRef: E2, updatePopper: N2, contentStyle: j2 });
return (e3, o3) => (openBlock(), createElementBlock("div", mergeProps({ ref_key: "contentRef", ref: k2 }, unref(T2), { style: unref(j2), class: unref(I2), tabindex: "-1", onMouseenter: (t2) => e3.$emit("mouseenter", t2), onMouseleave: (t2) => e3.$emit("mouseleave", t2) }), [createVNode(unref(xp), { trapped: unref(l2), "trap-on-focus-in": true, "focus-trap-el": unref(k2), "focus-start-el": unref(s2), onFocusAfterTrapped: unref(m2), onFocusAfterReleased: unref(d2), onFocusin: unref(h2), onFocusoutPrevented: unref(g2), onReleaseRequested: unref(b2) }, { default: withCtx(() => [renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusin", "onFocusoutPrevented", "onReleaseRequested"])], 16, ["onMouseenter", "onMouseleave"]));
} });
var zp = $d(jp, [["__file", "content.vue"]]);
const Fp = li(If);
const Pp = exports("b6", Symbol("elTooltip"));
const $p = ti({ ...id, ...kp, appendTo: { type: Jl([String, Object]) }, content: { type: String, default: "" }, rawContent: Boolean, persistent: Boolean, visible: { type: Jl(Boolean), default: null }, transition: String, teleported: { type: Boolean, default: true }, disabled: Boolean, ...Bd(["ariaLabel"]) });
const Np = ti({ ...Df, disabled: Boolean, trigger: { type: Jl([String, Array]), default: "hover" }, triggerKeys: { type: Jl(Array), default: () => [di.enter, di.space] } });
const { useModelToggleProps: Vp, useModelToggleEmits: Dp, useModelToggle: Hp } = Ni("visible");
const Up = ti({ ...Bf, ...Vp, ...$p, ...Np, ...Rf, showArrow: { type: Boolean, default: true } });
const Wp = [...Dp, "before-show", "before-hide", "show", "hide", "open", "close"];
const qp = (e2, t2) => {
if (mt(e2)) {
return e2.includes(t2);
}
return e2 === t2;
};
const Kp = (e2, t2, n2) => (o2) => {
qp(unref(e2), t2) && n2(o2);
};
const Yp = defineComponent({ name: "ElTooltipTrigger" });
const Gp = defineComponent({ ...Yp, props: Np, setup(e2, { expose: n2 }) {
const o2 = e2;
const r2 = zi("tooltip");
const { controlled: a2, id: s2, open: l2, onOpen: i2, onClose: c2, onToggle: d2 } = inject(Pp, void 0);
const f2 = ref(null);
const m2 = () => {
if (unref(a2) || o2.disabled) {
return true;
}
};
const h2 = toRef(o2, "trigger");
const g2 = we(m2, Kp(h2, "hover", i2));
const b2 = we(m2, Kp(h2, "hover", c2));
const y2 = we(m2, Kp(h2, "click", (e3) => {
if (e3.button === 0) {
d2(e3);
}
}));
const w2 = we(m2, Kp(h2, "focus", i2));
const S2 = we(m2, Kp(h2, "focus", c2));
const k2 = we(m2, Kp(h2, "contextmenu", (e3) => {
e3.preventDefault();
d2(e3);
}));
const _2 = we(m2, (e3) => {
const { code: t2 } = e3;
if (o2.triggerKeys.includes(t2)) {
e3.preventDefault();
d2(e3);
}
});
n2({ triggerRef: f2 });
return (e3, n3) => (openBlock(), createBlock(unref(Wf), { id: unref(s2), "virtual-ref": e3.virtualRef, open: unref(l2), "virtual-triggering": e3.virtualTriggering, class: normalizeClass(unref(r2).e("trigger")), onBlur: unref(S2), onClick: unref(y2), onContextmenu: unref(k2), onFocus: unref(w2), onMouseenter: unref(g2), onMouseleave: unref(b2), onKeydown: unref(_2) }, { default: withCtx(() => [renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "virtual-ref", "open", "virtual-triggering", "class", "onBlur", "onClick", "onContextmenu", "onFocus", "onMouseenter", "onMouseleave", "onKeydown"]));
} });
var Zp = $d(Gp, [["__file", "trigger.vue"]]);
const Xp = ti({ to: { type: Jl([String, Object]), required: true }, disabled: Boolean });
const Jp = defineComponent({ __name: "teleport", props: Xp, setup(e2) {
return (e3, n2) => e3.disabled ? renderSlot(e3.$slots, "default", { key: 0 }) : (openBlock(), createBlock(Teleport, { key: 1, to: e3.to }, [renderSlot(e3.$slots, "default")], 8, ["to"]));
} });
var Qp = $d(Jp, [["__file", "teleport.vue"]]);
const ev = exports("e", li(Qp));
const tv = defineComponent({ name: "ElTooltipContent", inheritAttrs: false });
const nv = defineComponent({ ...tv, props: $p, setup(e2, { expose: n2 }) {
const o2 = e2;
const { selector: r2 } = ad();
const a2 = zi("tooltip");
const l2 = ref(null);
let c2;
const { controlled: d2, id: m2, open: h2, trigger: g2, onClose: b2, onOpen: y2, onShow: w2, onHide: C2, onBeforeShow: k2, onBeforeHide: _2 } = inject(Pp, void 0);
const E2 = computed(() => o2.transition || `${a2.namespace.value}-fade-in-linear`);
const L2 = computed(() => o2.persistent);
onBeforeUnmount(() => {
c2 == null ? void 0 : c2();
});
const A2 = computed(() => unref(L2) ? true : unref(h2));
const T2 = computed(() => o2.disabled ? false : unref(h2));
const I2 = computed(() => o2.appendTo || r2.value);
const j2 = computed(() => {
var e3;
return (e3 = o2.style) != null ? e3 : {};
});
const z2 = computed(() => !unref(h2));
const N2 = () => {
C2();
};
const V2 = () => {
if (unref(d2)) return true;
};
const D2 = we(V2, () => {
if (o2.enterable && unref(g2) === "hover") {
y2();
}
});
const H2 = we(V2, () => {
if (unref(g2) === "hover") {
b2();
}
});
const U2 = () => {
var e3, t2;
(t2 = (e3 = l2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3);
k2 == null ? void 0 : k2();
};
const W2 = () => {
_2 == null ? void 0 : _2();
};
const q2 = () => {
w2();
c2 = qe(computed(() => {
var e3;
return (e3 = l2.value) == null ? void 0 : e3.popperContentRef;
}), () => {
if (unref(d2)) return;
const e3 = unref(g2);
if (e3 !== "hover") {
b2();
}
});
};
const K2 = () => {
if (!o2.virtualTriggering) {
b2();
}
};
watch(() => unref(h2), (e3) => {
if (!e3) {
c2 == null ? void 0 : c2();
}
}, { flush: "post" });
watch(() => o2.content, () => {
var e3, t2;
(t2 = (e3 = l2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3);
});
n2({ contentRef: l2 });
return (e3, n3) => (openBlock(), createBlock(unref(ev), { disabled: !e3.teleported, to: unref(I2) }, { default: withCtx(() => [createVNode(Transition, { name: unref(E2), onAfterLeave: N2, onBeforeEnter: U2, onAfterEnter: q2, onBeforeLeave: W2 }, { default: withCtx(() => [unref(A2) ? withDirectives((openBlock(), createBlock(unref(zp), mergeProps({ key: 0, id: unref(m2), ref_key: "contentRef", ref: l2 }, e3.$attrs, { "aria-label": e3.ariaLabel, "aria-hidden": unref(z2), "boundaries-padding": e3.boundariesPadding, "fallback-placements": e3.fallbackPlacements, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, placement: e3.placement, "popper-options": e3.popperOptions, strategy: e3.strategy, effect: e3.effect, enterable: e3.enterable, pure: e3.pure, "popper-class": e3.popperClass, "popper-style": [e3.popperStyle, unref(j2)], "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, visible: unref(T2), "z-index": e3.zIndex, onMouseenter: unref(D2), onMouseleave: unref(H2), onBlur: K2, onClose: unref(b2) }), { default: withCtx(() => [renderSlot(e3.$slots, "default")]), _: 3 }, 16, ["id", "aria-label", "aria-hidden", "boundaries-padding", "fallback-placements", "gpu-acceleration", "offset", "placement", "popper-options", "strategy", "effect", "enterable", "pure", "popper-class", "popper-style", "reference-el", "trigger-target-el", "visible", "z-index", "onMouseenter", "onMouseleave", "onClose"])), [[vShow, unref(T2)]]) : createCommentVNode("v-if", true)]), _: 3 }, 8, ["name"])]), _: 3 }, 8, ["disabled", "to"]));
} });
var ov = $d(nv, [["__file", "content.vue"]]);
const rv = defineComponent({ name: "ElTooltip" });
const av = defineComponent({ ...rv, props: Up, emits: Wp, setup(e2, { expose: o2, emit: r2 }) {
const a2 = e2;
ld();
const l2 = ed();
const c2 = ref();
const d2 = ref();
const f2 = () => {
var e3;
const t2 = unref(c2);
if (t2) {
(e3 = t2.popperInstanceRef) == null ? void 0 : e3.update();
}
};
const p2 = ref(false);
const m2 = ref();
const { show: h2, hide: g2, hasUpdateHandler: b2 } = Hp({ indicator: p2, toggleReason: m2 });
const { onOpen: w2, onClose: S2 } = ud({ showAfter: toRef(a2, "showAfter"), hideAfter: toRef(a2, "hideAfter"), autoClose: toRef(a2, "autoClose"), open: h2, close: g2 });
const k2 = computed(() => Ds(a2.visible) && !b2.value);
provide(Pp, { controlled: k2, id: l2, open: readonly(p2), trigger: toRef(a2, "trigger"), onOpen: (e3) => {
w2(e3);
}, onClose: (e3) => {
S2(e3);
}, onToggle: (e3) => {
if (unref(p2)) {
S2(e3);
} else {
w2(e3);
}
}, onShow: () => {
r2("show", m2.value);
}, onHide: () => {
r2("hide", m2.value);
}, onBeforeShow: () => {
r2("before-show", m2.value);
}, onBeforeHide: () => {
r2("before-hide", m2.value);
}, updatePopper: f2 });
watch(() => a2.disabled, (e3) => {
if (e3 && p2.value) {
p2.value = false;
}
});
const _2 = (e3) => {
var t2, n2;
const o3 = (n2 = (t2 = d2.value) == null ? void 0 : t2.contentRef) == null ? void 0 : n2.popperContentRef;
const r3 = (e3 == null ? void 0 : e3.relatedTarget) || document.activeElement;
return o3 && o3.contains(r3);
};
onDeactivated(() => p2.value && g2());
o2({ popperRef: c2, contentRef: d2, isFocusInsideContent: _2, updatePopper: f2, onOpen: w2, onClose: S2, hide: g2 });
return (e3, o3) => (openBlock(), createBlock(unref(Fp), { ref_key: "popperRef", ref: c2, role: e3.role }, { default: withCtx(() => [createVNode(Zp, { disabled: e3.disabled, trigger: e3.trigger, "trigger-keys": e3.triggerKeys, "virtual-ref": e3.virtualRef, "virtual-triggering": e3.virtualTriggering }, { default: withCtx(() => [e3.$slots.default ? renderSlot(e3.$slots, "default", { key: 0 }) : createCommentVNode("v-if", true)]), _: 3 }, 8, ["disabled", "trigger", "trigger-keys", "virtual-ref", "virtual-triggering"]), createVNode(ov, { ref_key: "contentRef", ref: d2, "aria-label": e3.ariaLabel, "boundaries-padding": e3.boundariesPadding, content: e3.content, disabled: e3.disabled, effect: e3.effect, enterable: e3.enterable, "fallback-placements": e3.fallbackPlacements, "hide-after": e3.hideAfter, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, persistent: e3.persistent, "popper-class": e3.popperClass, "popper-style": e3.popperStyle, placement: e3.placement, "popper-options": e3.popperOptions, pure: e3.pure, "raw-content": e3.rawContent, "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, "show-after": e3.showAfter, strategy: e3.strategy, teleported: e3.teleported, transition: e3.transition, "virtual-triggering": e3.virtualTriggering, "z-index": e3.zIndex, "append-to": e3.appendTo }, { default: withCtx(() => [renderSlot(e3.$slots, "content", {}, () => [e3.rawContent ? (openBlock(), createElementBlock("span", { key: 0, innerHTML: e3.content }, null, 8, ["innerHTML"])) : (openBlock(), createElementBlock("span", { key: 1 }, toDisplayString(e3.content), 1))]), e3.showArrow ? (openBlock(), createBlock(unref(Ff), { key: 0, "arrow-offset": e3.arrowOffset }, null, 8, ["arrow-offset"])) : createCommentVNode("v-if", true)]), _: 3 }, 8, ["aria-label", "boundaries-padding", "content", "disabled", "effect", "enterable", "fallback-placements", "hide-after", "gpu-acceleration", "offset", "persistent", "popper-class", "popper-style", "placement", "popper-options", "pure", "raw-content", "reference-el", "trigger-target-el", "show-after", "strategy", "teleported", "transition", "virtual-triggering", "z-index", "append-to"])]), _: 3 }, 8, ["role"]));
} });
var sv = $d(av, [["__file", "tooltip.vue"]]);
const lv = exports("q", li(sv));
const iv = ti({ value: { type: [String, Number], default: "" }, max: { type: Number, default: 99 }, isDot: Boolean, hidden: Boolean, type: { type: String, values: ["primary", "success", "warning", "info", "danger"], default: "danger" }, showZero: { type: Boolean, default: true }, color: String, badgeStyle: { type: Jl([String, Object, Array]) }, offset: { type: Jl(Array), default: [0, 0] }, badgeClass: { type: String } });
const uv = defineComponent({ name: "ElBadge" });
const cv = defineComponent({ ...uv, props: iv, setup(e2, { expose: r2 }) {
const a2 = e2;
const l2 = zi("badge");
const i2 = computed(() => {
if (a2.isDot) return "";
if (Hs(a2.value) && Hs(a2.max)) {
if (a2.max < a2.value) {
return `${a2.max}+`;
}
return a2.value === 0 && !a2.showZero ? "" : `${a2.value}`;
}
return `${a2.value}`;
});
const c2 = computed(() => {
var e3, t2, n2, o2, r3;
return [{ backgroundColor: a2.color, marginRight: rl(-((t2 = (e3 = a2.offset) == null ? void 0 : e3[0]) != null ? t2 : 0)), marginTop: rl((o2 = (n2 = a2.offset) == null ? void 0 : n2[1]) != null ? o2 : 0) }, (r3 = a2.badgeStyle) != null ? r3 : {}];
});
r2({ content: i2 });
return (e3, r3) => (openBlock(), createElementBlock("div", { class: normalizeClass(unref(l2).b()) }, [renderSlot(e3.$slots, "default"), createVNode(Transition, { name: `${unref(l2).namespace.value}-zoom-in-center`, persisted: "" }, { default: withCtx(() => [withDirectives(createElementVNode("sup", { class: normalizeClass([unref(l2).e("content"), unref(l2).em("content", e3.type), unref(l2).is("fixed", !!e3.$slots.default), unref(l2).is("dot", e3.isDot), e3.badgeClass]), style: normalizeStyle(unref(c2)), textContent: toDisplayString(unref(i2)) }, null, 14, ["textContent"]), [[vShow, !e3.hidden && (unref(i2) || e3.isDot)]])]), _: 1 }, 8, ["name"])], 2));
} });
var dv = $d(cv, [["__file", "badge.vue"]]);
const fv = li(dv);
const pv = Symbol("buttonGroupContextKey");
const vv = (e2, t2) => {
Ci({ from: "type.text", replacement: "link", version: "3.0.0", scope: "props", ref: "https://element-plus.org/en-US/component/button.html#button-attributes" }, computed(() => e2.type === "text"));
const n2 = inject(pv, void 0);
const o2 = Id("button");
const { form: r2 } = Gd();
const a2 = Kd(computed(() => n2 == null ? void 0 : n2.size));
const l2 = Yd();
const i2 = ref();
const u2 = useSlots();
const c2 = computed(() => e2.type || (n2 == null ? void 0 : n2.type) || "");
const d2 = computed(() => {
var t3, n3, r3;
return (r3 = (n3 = e2.autoInsertSpace) != null ? n3 : (t3 = o2.value) == null ? void 0 : t3.autoInsertSpace) != null ? r3 : false;
});
const f2 = computed(() => {
if (e2.tag === "button") {
return { ariaDisabled: l2.value || e2.loading, disabled: l2.value || e2.loading, autofocus: e2.autofocus, type: e2.nativeType };
}
return {};
});
const m2 = computed(() => {
var e3;
const t3 = (e3 = u2.default) == null ? void 0 : e3.call(u2);
if (d2.value && (t3 == null ? void 0 : t3.length) === 1) {
const e4 = t3[0];
if ((e4 == null ? void 0 : e4.type) === Text) {
const t4 = e4.children;
return new RegExp("^\\p{Unified_Ideograph}{2}$", "u").test(t4.trim());
}
}
return false;
});
const h2 = (n3) => {
if (e2.nativeType === "reset") {
r2 == null ? void 0 : r2.resetFields();
}
t2("click", n3);
};
return { _disabled: l2, _size: a2, _type: c2, _ref: i2, _props: f2, shouldAddSpace: m2, handleClick: h2 };
};
const mv = ["default", "primary", "success", "warning", "info", "danger", "text", ""];
const hv = ["button", "submit", "reset"];
const gv = ti({ size: wd, disabled: Boolean, type: { type: String, values: mv, default: "" }, icon: { type: ni }, nativeType: { type: String, values: hv, default: "button" }, loading: Boolean, loadingIcon: { type: ni, default: () => zl }, plain: Boolean, text: Boolean, link: Boolean, bg: Boolean, autofocus: Boolean, round: Boolean, circle: Boolean, color: String, dark: Boolean, autoInsertSpace: { type: Boolean, default: void 0 }, tag: { type: Jl([String, Object]), default: "button" } });
const bv = { click: (e2) => e2 instanceof MouseEvent };
function yv(e2, t2) {
if (xv(e2)) {
e2 = "100%";
}
var n2 = Sv(e2);
e2 = t2 === 360 ? e2 : Math.min(t2, Math.max(0, parseFloat(e2)));
if (n2) {
e2 = parseInt(String(e2 * t2), 10) / 100;
}
if (Math.abs(e2 - t2) < 1e-6) {
return 1;
}
if (t2 === 360) {
e2 = (e2 < 0 ? e2 % t2 + t2 : e2 % t2) / parseFloat(String(t2));
} else {
e2 = e2 % t2 / parseFloat(String(t2));
}
return e2;
}
function wv(e2) {
return Math.min(1, Math.max(0, e2));
}
function xv(e2) {
return typeof e2 === "string" && e2.indexOf(".") !== -1 && parseFloat(e2) === 1;
}
function Sv(e2) {
return typeof e2 === "string" && e2.indexOf("%") !== -1;
}
function Cv(e2) {
e2 = parseFloat(e2);
if (isNaN(e2) || e2 < 0 || e2 > 1) {
e2 = 1;
}
return e2;
}
function kv(e2) {
if (e2 <= 1) {
return "".concat(Number(e2) * 100, "%");
}
return e2;
}
function _v(e2) {
return e2.length === 1 ? "0" + e2 : String(e2);
}
function Ev(e2, t2, n2) {
return { r: yv(e2, 255) * 255, g: yv(t2, 255) * 255, b: yv(n2, 255) * 255 };
}
function Ov(e2, t2, n2) {
e2 = yv(e2, 255);
t2 = yv(t2, 255);
n2 = yv(n2, 255);
var o2 = Math.max(e2, t2, n2);
var r2 = Math.min(e2, t2, n2);
var a2 = 0;
var s2 = 0;
var l2 = (o2 + r2) / 2;
if (o2 === r2) {
s2 = 0;
a2 = 0;
} else {
var i2 = o2 - r2;
s2 = l2 > 0.5 ? i2 / (2 - o2 - r2) : i2 / (o2 + r2);
switch (o2) {
case e2:
a2 = (t2 - n2) / i2 + (t2 < n2 ? 6 : 0);
break;
case t2:
a2 = (n2 - e2) / i2 + 2;
break;
case n2:
a2 = (e2 - t2) / i2 + 4;
break;
}
a2 /= 6;
}
return { h: a2, s: s2, l: l2 };
}
function Lv(e2, t2, n2) {
if (n2 < 0) {
n2 += 1;
}
if (n2 > 1) {
n2 -= 1;
}
if (n2 < 1 / 6) {
return e2 + (t2 - e2) * (6 * n2);
}
if (n2 < 1 / 2) {
return t2;
}
if (n2 < 2 / 3) {
return e2 + (t2 - e2) * (2 / 3 - n2) * 6;
}
return e2;
}
function Av(e2, t2, n2) {
var o2;
var r2;
var a2;
e2 = yv(e2, 360);
t2 = yv(t2, 100);
n2 = yv(n2, 100);
if (t2 === 0) {
r2 = n2;
a2 = n2;
o2 = n2;
} else {
var s2 = n2 < 0.5 ? n2 * (1 + t2) : n2 + t2 - n2 * t2;
var l2 = 2 * n2 - s2;
o2 = Lv(l2, s2, e2 + 1 / 3);
r2 = Lv(l2, s2, e2);
a2 = Lv(l2, s2, e2 - 1 / 3);
}
return { r: o2 * 255, g: r2 * 255, b: a2 * 255 };
}
function Bv(e2, t2, n2) {
e2 = yv(e2, 255);
t2 = yv(t2, 255);
n2 = yv(n2, 255);
var o2 = Math.max(e2, t2, n2);
var r2 = Math.min(e2, t2, n2);
var a2 = 0;
var s2 = o2;
var l2 = o2 - r2;
var i2 = o2 === 0 ? 0 : l2 / o2;
if (o2 === r2) {
a2 = 0;
} else {
switch (o2) {
case e2:
a2 = (t2 - n2) / l2 + (t2 < n2 ? 6 : 0);
break;
case t2:
a2 = (n2 - e2) / l2 + 2;
break;
case n2:
a2 = (e2 - t2) / l2 + 4;
break;
}
a2 /= 6;
}
return { h: a2, s: i2, v: s2 };
}
function Mv(e2, t2, n2) {
e2 = yv(e2, 360) * 6;
t2 = yv(t2, 100);
n2 = yv(n2, 100);
var o2 = Math.floor(e2);
var r2 = e2 - o2;
var a2 = n2 * (1 - t2);
var s2 = n2 * (1 - r2 * t2);
var l2 = n2 * (1 - (1 - r2) * t2);
var i2 = o2 % 6;
var u2 = [n2, s2, a2, a2, l2, n2][i2];
var c2 = [l2, n2, n2, s2, a2, a2][i2];
var d2 = [a2, a2, l2, n2, n2, s2][i2];
return { r: u2 * 255, g: c2 * 255, b: d2 * 255 };
}
function Tv(e2, t2, n2, o2) {
var r2 = [_v(Math.round(e2).toString(16)), _v(Math.round(t2).toString(16)), _v(Math.round(n2).toString(16))];
if (o2 && r2[0].startsWith(r2[0].charAt(1)) && r2[1].startsWith(r2[1].charAt(1)) && r2[2].startsWith(r2[2].charAt(1))) {
return r2[0].charAt(0) + r2[1].charAt(0) + r2[2].charAt(0);
}
return r2.join("");
}
function Iv(e2, t2, n2, o2, r2) {
var a2 = [_v(Math.round(e2).toString(16)), _v(Math.round(t2).toString(16)), _v(Math.round(n2).toString(16)), _v(Rv(o2))];
if (r2 && a2[0].startsWith(a2[0].charAt(1)) && a2[1].startsWith(a2[1].charAt(1)) && a2[2].startsWith(a2[2].charAt(1)) && a2[3].startsWith(a2[3].charAt(1))) {
return a2[0].charAt(0) + a2[1].charAt(0) + a2[2].charAt(0) + a2[3].charAt(0);
}
return a2.join("");
}
function Rv(e2) {
return Math.round(parseFloat(e2) * 255).toString(16);
}
function jv(e2) {
return zv(e2) / 255;
}
function zv(e2) {
return parseInt(e2, 16);
}
function Fv(e2) {
return { r: e2 >> 16, g: (e2 & 65280) >> 8, b: e2 & 255 };
}
var Pv = { aliceblue: "#f0f8ff", antiquewhite: "#faebd7", aqua: "#00ffff", aquamarine: "#7fffd4", azure: "#f0ffff", beige: "#f5f5dc", bisque: "#ffe4c4", black: "#000000", blanchedalmond: "#ffebcd", blue: "#0000ff", blueviolet: "#8a2be2", brown: "#a52a2a", burlywood: "#deb887", cadetblue: "#5f9ea0", chartreuse: "#7fff00", chocolate: "#d2691e", coral: "#ff7f50", cornflowerblue: "#6495ed", cornsilk: "#fff8dc", crimson: "#dc143c", cyan: "#00ffff", darkblue: "#00008b", darkcyan: "#008b8b", darkgoldenrod: "#b8860b", darkgray: "#a9a9a9", darkgreen: "#006400", darkgrey: "#a9a9a9", darkkhaki: "#bdb76b", darkmagenta: "#8b008b", darkolivegreen: "#556b2f", darkorange: "#ff8c00", darkorchid: "#9932cc", darkred: "#8b0000", darksalmon: "#e9967a", darkseagreen: "#8fbc8f", darkslateblue: "#483d8b", darkslategray: "#2f4f4f", darkslategrey: "#2f4f4f", darkturquoise: "#00ced1", darkviolet: "#9400d3", deeppink: "#ff1493", deepskyblue: "#00bfff", dimgray: "#696969", dimgrey: "#696969", dodgerblue: "#1e90ff", firebrick: "#b22222", floralwhite: "#fffaf0", forestgreen: "#228b22", fuchsia: "#ff00ff", gainsboro: "#dcdcdc", ghostwhite: "#f8f8ff", goldenrod: "#daa520", gold: "#ffd700", gray: "#808080", green: "#008000", greenyellow: "#adff2f", grey: "#808080", honeydew: "#f0fff0", hotpink: "#ff69b4", indianred: "#cd5c5c", indigo: "#4b0082", ivory: "#fffff0", khaki: "#f0e68c", lavenderblush: "#fff0f5", lavender: "#e6e6fa", lawngreen: "#7cfc00", lemonchiffon: "#fffacd", lightblue: "#add8e6", lightcoral: "#f08080", lightcyan: "#e0ffff", lightgoldenrodyellow: "#fafad2", lightgray: "#d3d3d3", lightgreen: "#90ee90", lightgrey: "#d3d3d3", lightpink: "#ffb6c1", lightsalmon: "#ffa07a", lightseagreen: "#20b2aa", lightskyblue: "#87cefa", lightslategray: "#778899", lightslategrey: "#778899", lightsteelblue: "#b0c4de", lightyellow: "#ffffe0", lime: "#00ff00", limegreen: "#32cd32", linen: "#faf0e6", magenta: "#ff00ff", maroon: "#800000", mediumaquamarine: "#66cdaa", mediumblue: "#0000cd", mediumorchid: "#ba55d3", mediumpurple: "#9370db", mediumseagreen: "#3cb371", mediumslateblue: "#7b68ee", mediumspringgreen: "#00fa9a", mediumturquoise: "#48d1cc", mediumvioletred: "#c71585", midnightblue: "#191970", mintcream: "#f5fffa", mistyrose: "#ffe4e1", moccasin: "#ffe4b5", navajowhite: "#ffdead", navy: "#000080", oldlace: "#fdf5e6", olive: "#808000", olivedrab: "#6b8e23", orange: "#ffa500", orangered: "#ff4500", orchid: "#da70d6", palegoldenrod: "#eee8aa", palegreen: "#98fb98", paleturquoise: "#afeeee", palevioletred: "#db7093", papayawhip: "#ffefd5", peachpuff: "#ffdab9", peru: "#cd853f", pink: "#ffc0cb", plum: "#dda0dd", powderblue: "#b0e0e6", purple: "#800080", rebeccapurple: "#663399", red: "#ff0000", rosybrown: "#bc8f8f", royalblue: "#4169e1", saddlebrown: "#8b4513", salmon: "#fa8072", sandybrown: "#f4a460", seagreen: "#2e8b57", seashell: "#fff5ee", sienna: "#a0522d", silver: "#c0c0c0", skyblue: "#87ceeb", slateblue: "#6a5acd", slategray: "#708090", slategrey: "#708090", snow: "#fffafa", springgreen: "#00ff7f", steelblue: "#4682b4", tan: "#d2b48c", teal: "#008080", thistle: "#d8bfd8", tomato: "#ff6347", turquoise: "#40e0d0", violet: "#ee82ee", wheat: "#f5deb3", white: "#ffffff", whitesmoke: "#f5f5f5", yellow: "#ffff00", yellowgreen: "#9acd32" };
function $v(e2) {
var t2 = { r: 0, g: 0, b: 0 };
var n2 = 1;
var o2 = null;
var r2 = null;
var a2 = null;
var s2 = false;
var l2 = false;
if (typeof e2 === "string") {
e2 = qv(e2);
}
if (typeof e2 === "object") {
if (Kv(e2.r) && Kv(e2.g) && Kv(e2.b)) {
t2 = Ev(e2.r, e2.g, e2.b);
s2 = true;
l2 = String(e2.r).substr(-1) === "%" ? "prgb" : "rgb";
} else if (Kv(e2.h) && Kv(e2.s) && Kv(e2.v)) {
o2 = kv(e2.s);
r2 = kv(e2.v);
t2 = Mv(e2.h, o2, r2);
s2 = true;
l2 = "hsv";
} else if (Kv(e2.h) && Kv(e2.s) && Kv(e2.l)) {
o2 = kv(e2.s);
a2 = kv(e2.l);
t2 = Av(e2.h, o2, a2);
s2 = true;
l2 = "hsl";
}
if (Object.prototype.hasOwnProperty.call(e2, "a")) {
n2 = e2.a;
}
}
n2 = Cv(n2);
return { ok: s2, format: e2.format || l2, r: Math.min(255, Math.max(t2.r, 0)), g: Math.min(255, Math.max(t2.g, 0)), b: Math.min(255, Math.max(t2.b, 0)), a: n2 };
}
var Nv = "[-\\+]?\\d+%?";
var Vv = "[-\\+]?\\d*\\.\\d+%?";
var Dv = "(?:".concat(Vv, ")|(?:").concat(Nv, ")");
var Hv = "[\\s|\\(]+(".concat(Dv, ")[,|\\s]+(").concat(Dv, ")[,|\\s]+(").concat(Dv, ")\\s*\\)?");
var Uv = "[\\s|\\(]+(".concat(Dv, ")[,|\\s]+(").concat(Dv, ")[,|\\s]+(").concat(Dv, ")[,|\\s]+(").concat(Dv, ")\\s*\\)?");
var Wv = { CSS_UNIT: new RegExp(Dv), rgb: new RegExp("rgb" + Hv), rgba: new RegExp("rgba" + Uv), hsl: new RegExp("hsl" + Hv), hsla: new RegExp("hsla" + Uv), hsv: new RegExp("hsv" + Hv), hsva: new RegExp("hsva" + Uv), hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/, hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/ };
function qv(e2) {
e2 = e2.trim().toLowerCase();
if (e2.length === 0) {
return false;
}
var t2 = false;
if (Pv[e2]) {
e2 = Pv[e2];
t2 = true;
} else if (e2 === "transparent") {
return { r: 0, g: 0, b: 0, a: 0, format: "name" };
}
var n2 = Wv.rgb.exec(e2);
if (n2) {
return { r: n2[1], g: n2[2], b: n2[3] };
}
n2 = Wv.rgba.exec(e2);
if (n2) {
return { r: n2[1], g: n2[2], b: n2[3], a: n2[4] };
}
n2 = Wv.hsl.exec(e2);
if (n2) {
return { h: n2[1], s: n2[2], l: n2[3] };
}
n2 = Wv.hsla.exec(e2);
if (n2) {
return { h: n2[1], s: n2[2], l: n2[3], a: n2[4] };
}
n2 = Wv.hsv.exec(e2);
if (n2) {
return { h: n2[1], s: n2[2], v: n2[3] };
}
n2 = Wv.hsva.exec(e2);
if (n2) {
return { h: n2[1], s: n2[2], v: n2[3], a: n2[4] };
}
n2 = Wv.hex8.exec(e2);
if (n2) {
return { r: zv(n2[1]), g: zv(n2[2]), b: zv(n2[3]), a: jv(n2[4]), format: t2 ? "name" : "hex8" };
}
n2 = Wv.hex6.exec(e2);
if (n2) {
return { r: zv(n2[1]), g: zv(n2[2]), b: zv(n2[3]), format: t2 ? "name" : "hex" };
}
n2 = Wv.hex4.exec(e2);
if (n2) {
return { r: zv(n2[1] + n2[1]), g: zv(n2[2] + n2[2]), b: zv(n2[3] + n2[3]), a: jv(n2[4] + n2[4]), format: t2 ? "name" : "hex8" };
}
n2 = Wv.hex3.exec(e2);
if (n2) {
return { r: zv(n2[1] + n2[1]), g: zv(n2[2] + n2[2]), b: zv(n2[3] + n2[3]), format: t2 ? "name" : "hex" };
}
return false;
}
function Kv(e2) {
return Boolean(Wv.CSS_UNIT.exec(String(e2)));
}
var Yv = function() {
function e2(t2, n2) {
if (t2 === void 0) {
t2 = "";
}
if (n2 === void 0) {
n2 = {};
}
var o2;
if (t2 instanceof e2) {
return t2;
}
if (typeof t2 === "number") {
t2 = Fv(t2);
}
this.originalInput = t2;
var r2 = $v(t2);
this.originalInput = t2;
this.r = r2.r;
this.g = r2.g;
this.b = r2.b;
this.a = r2.a;
this.roundA = Math.round(100 * this.a) / 100;
this.format = (o2 = n2.format) !== null && o2 !== void 0 ? o2 : r2.format;
this.gradientType = n2.gradientType;
if (this.r < 1) {
this.r = Math.round(this.r);
}
if (this.g < 1) {
this.g = Math.round(this.g);
}
if (this.b < 1) {
this.b = Math.round(this.b);
}
this.isValid = r2.ok;
}
e2.prototype.isDark = function() {
return this.getBrightness() < 128;
};
e2.prototype.isLight = function() {
return !this.isDark();
};
e2.prototype.getBrightness = function() {
var e3 = this.toRgb();
return (e3.r * 299 + e3.g * 587 + e3.b * 114) / 1e3;
};
e2.prototype.getLuminance = function() {
var e3 = this.toRgb();
var t2;
var n2;
var o2;
var r2 = e3.r / 255;
var a2 = e3.g / 255;
var s2 = e3.b / 255;
if (r2 <= 0.03928) {
t2 = r2 / 12.92;
} else {
t2 = Math.pow((r2 + 0.055) / 1.055, 2.4);
}
if (a2 <= 0.03928) {
n2 = a2 / 12.92;
} else {
n2 = Math.pow((a2 + 0.055) / 1.055, 2.4);
}
if (s2 <= 0.03928) {
o2 = s2 / 12.92;
} else {
o2 = Math.pow((s2 + 0.055) / 1.055, 2.4);
}
return 0.2126 * t2 + 0.7152 * n2 + 0.0722 * o2;
};
e2.prototype.getAlpha = function() {
return this.a;
};
e2.prototype.setAlpha = function(e3) {
this.a = Cv(e3);
this.roundA = Math.round(100 * this.a) / 100;
return this;
};
e2.prototype.isMonochrome = function() {
var e3 = this.toHsl().s;
return e3 === 0;
};
e2.prototype.toHsv = function() {
var e3 = Bv(this.r, this.g, this.b);
return { h: e3.h * 360, s: e3.s, v: e3.v, a: this.a };
};
e2.prototype.toHsvString = function() {
var e3 = Bv(this.r, this.g, this.b);
var t2 = Math.round(e3.h * 360);
var n2 = Math.round(e3.s * 100);
var o2 = Math.round(e3.v * 100);
return this.a === 1 ? "hsv(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%)") : "hsva(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%, ").concat(this.roundA, ")");
};
e2.prototype.toHsl = function() {
var e3 = Ov(this.r, this.g, this.b);
return { h: e3.h * 360, s: e3.s, l: e3.l, a: this.a };
};
e2.prototype.toHslString = function() {
var e3 = Ov(this.r, this.g, this.b);
var t2 = Math.round(e3.h * 360);
var n2 = Math.round(e3.s * 100);
var o2 = Math.round(e3.l * 100);
return this.a === 1 ? "hsl(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%)") : "hsla(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%, ").concat(this.roundA, ")");
};
e2.prototype.toHex = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return Tv(this.r, this.g, this.b, e3);
};
e2.prototype.toHexString = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return "#" + this.toHex(e3);
};
e2.prototype.toHex8 = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return Iv(this.r, this.g, this.b, this.a, e3);
};
e2.prototype.toHex8String = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return "#" + this.toHex8(e3);
};
e2.prototype.toHexShortString = function(e3) {
if (e3 === void 0) {
e3 = false;
}
return this.a === 1 ? this.toHexString(e3) : this.toHex8String(e3);
};
e2.prototype.toRgb = function() {
return { r: Math.round(this.r), g: Math.round(this.g), b: Math.round(this.b), a: this.a };
};
e2.prototype.toRgbString = function() {
var e3 = Math.round(this.r);
var t2 = Math.round(this.g);
var n2 = Math.round(this.b);
return this.a === 1 ? "rgb(".concat(e3, ", ").concat(t2, ", ").concat(n2, ")") : "rgba(".concat(e3, ", ").concat(t2, ", ").concat(n2, ", ").concat(this.roundA, ")");
};
e2.prototype.toPercentageRgb = function() {
var e3 = function(e4) {
return "".concat(Math.round(yv(e4, 255) * 100), "%");
};
return { r: e3(this.r), g: e3(this.g), b: e3(this.b), a: this.a };
};
e2.prototype.toPercentageRgbString = function() {
var e3 = function(e4) {
return Math.round(yv(e4, 255) * 100);
};
return this.a === 1 ? "rgb(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%)") : "rgba(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%, ").concat(this.roundA, ")");
};
e2.prototype.toName = function() {
if (this.a === 0) {
return "transparent";
}
if (this.a < 1) {
return false;
}
var e3 = "#" + Tv(this.r, this.g, this.b, false);
for (var t2 = 0, n2 = Object.entries(Pv); t2 < n2.length; t2++) {
var o2 = n2[t2], r2 = o2[0], a2 = o2[1];
if (e3 === a2) {
return r2;
}
}
return false;
};
e2.prototype.toString = function(e3) {
var t2 = Boolean(e3);
e3 = e3 !== null && e3 !== void 0 ? e3 : this.format;
var n2 = false;
var o2 = this.a < 1 && this.a >= 0;
var r2 = !t2 && o2 && (e3.startsWith("hex") || e3 === "name");
if (r2) {
if (e3 === "name" && this.a === 0) {
return this.toName();
}
return this.toRgbString();
}
if (e3 === "rgb") {
n2 = this.toRgbString();
}
if (e3 === "prgb") {
n2 = this.toPercentageRgbString();
}
if (e3 === "hex" || e3 === "hex6") {
n2 = this.toHexString();
}
if (e3 === "hex3") {
n2 = this.toHexString(true);
}
if (e3 === "hex4") {
n2 = this.toHex8String(true);
}
if (e3 === "hex8") {
n2 = this.toHex8String();
}
if (e3 === "name") {
n2 = this.toName();
}
if (e3 === "hsl") {
n2 = this.toHslString();
}
if (e3 === "hsv") {
n2 = this.toHsvString();
}
return n2 || this.toHexString();
};
e2.prototype.toNumber = function() {
return (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b);
};
e2.prototype.clone = function() {
return new e2(this.toString());
};
e2.prototype.lighten = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toHsl();
n2.l += t2 / 100;
n2.l = wv(n2.l);
return new e2(n2);
};
e2.prototype.brighten = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toRgb();
n2.r = Math.max(0, Math.min(255, n2.r - Math.round(255 * -(t2 / 100))));
n2.g = Math.max(0, Math.min(255, n2.g - Math.round(255 * -(t2 / 100))));
n2.b = Math.max(0, Math.min(255, n2.b - Math.round(255 * -(t2 / 100))));
return new e2(n2);
};
e2.prototype.darken = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toHsl();
n2.l -= t2 / 100;
n2.l = wv(n2.l);
return new e2(n2);
};
e2.prototype.tint = function(e3) {
if (e3 === void 0) {
e3 = 10;
}
return this.mix("white", e3);
};
e2.prototype.shade = function(e3) {
if (e3 === void 0) {
e3 = 10;
}
return this.mix("black", e3);
};
e2.prototype.desaturate = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toHsl();
n2.s -= t2 / 100;
n2.s = wv(n2.s);
return new e2(n2);
};
e2.prototype.saturate = function(t2) {
if (t2 === void 0) {
t2 = 10;
}
var n2 = this.toHsl();
n2.s += t2 / 100;
n2.s = wv(n2.s);
return new e2(n2);
};
e2.prototype.greyscale = function() {
return this.desaturate(100);
};
e2.prototype.spin = function(t2) {
var n2 = this.toHsl();
var o2 = (n2.h + t2) % 360;
n2.h = o2 < 0 ? 360 + o2 : o2;
return new e2(n2);
};
e2.prototype.mix = function(t2, n2) {
if (n2 === void 0) {
n2 = 50;
}
var o2 = this.toRgb();
var r2 = new e2(t2).toRgb();
var a2 = n2 / 100;
var s2 = { r: (r2.r - o2.r) * a2 + o2.r, g: (r2.g - o2.g) * a2 + o2.g, b: (r2.b - o2.b) * a2 + o2.b, a: (r2.a - o2.a) * a2 + o2.a };
return new e2(s2);
};
e2.prototype.analogous = function(t2, n2) {
if (t2 === void 0) {
t2 = 6;
}
if (n2 === void 0) {
n2 = 30;
}
var o2 = this.toHsl();
var r2 = 360 / n2;
var a2 = [this];
for (o2.h = (o2.h - (r2 * t2 >> 1) + 720) % 360; --t2; ) {
o2.h = (o2.h + r2) % 360;
a2.push(new e2(o2));
}
return a2;
};
e2.prototype.complement = function() {
var t2 = this.toHsl();
t2.h = (t2.h + 180) % 360;
return new e2(t2);
};
e2.prototype.monochromatic = function(t2) {
if (t2 === void 0) {
t2 = 6;
}
var n2 = this.toHsv();
var o2 = n2.h;
var r2 = n2.s;
var a2 = n2.v;
var s2 = [];
var l2 = 1 / t2;
while (t2--) {
s2.push(new e2({ h: o2, s: r2, v: a2 }));
a2 = (a2 + l2) % 1;
}
return s2;
};
e2.prototype.splitcomplement = function() {
var t2 = this.toHsl();
var n2 = t2.h;
return [this, new e2({ h: (n2 + 72) % 360, s: t2.s, l: t2.l }), new e2({ h: (n2 + 216) % 360, s: t2.s, l: t2.l })];
};
e2.prototype.onBackground = function(t2) {
var n2 = this.toRgb();
var o2 = new e2(t2).toRgb();
var r2 = n2.a + o2.a * (1 - n2.a);
return new e2({ r: (n2.r * n2.a + o2.r * o2.a * (1 - n2.a)) / r2, g: (n2.g * n2.a + o2.g * o2.a * (1 - n2.a)) / r2, b: (n2.b * n2.a + o2.b * o2.a * (1 - n2.a)) / r2, a: r2 });
};
e2.prototype.triad = function() {
return this.polyad(3);
};
e2.prototype.tetrad = function() {
return this.polyad(4);
};
e2.prototype.polyad = function(t2) {
var n2 = this.toHsl();
var o2 = n2.h;
var r2 = [this];
var a2 = 360 / t2;
for (var s2 = 1; s2 < t2; s2++) {
r2.push(new e2({ h: (o2 + s2 * a2) % 360, s: n2.s, l: n2.l }));
}
return r2;
};
e2.prototype.equals = function(t2) {
return this.toRgbString() === new e2(t2).toRgbString();
};
return e2;
}();
function Gv(e2, t2 = 20) {
return e2.mix("#141414", t2).toString();
}
function Zv(e2) {
const t2 = Yd();
const n2 = zi("button");
return computed(() => {
let o2 = {};
let r2 = e2.color;
if (r2) {
const a2 = r2.match(/var\((.*?)\)/);
if (a2) {
r2 = window.getComputedStyle(window.document.documentElement).getPropertyValue(a2[1]);
}
const s2 = new Yv(r2);
const l2 = e2.dark ? s2.tint(20).toString() : Gv(s2, 20);
if (e2.plain) {
o2 = n2.cssVarBlock({ "bg-color": e2.dark ? Gv(s2, 90) : s2.tint(90).toString(), "text-color": r2, "border-color": e2.dark ? Gv(s2, 50) : s2.tint(50).toString(), "hover-text-color": `var(${n2.cssVarName("color-white")})`, "hover-bg-color": r2, "hover-border-color": r2, "active-bg-color": l2, "active-text-color": `var(${n2.cssVarName("color-white")})`, "active-border-color": l2 });
if (t2.value) {
o2[n2.cssVarBlockName("disabled-bg-color")] = e2.dark ? Gv(s2, 90) : s2.tint(90).toString();
o2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? Gv(s2, 50) : s2.tint(50).toString();
o2[n2.cssVarBlockName("disabled-border-color")] = e2.dark ? Gv(s2, 80) : s2.tint(80).toString();
}
} else {
const a3 = e2.dark ? Gv(s2, 30) : s2.tint(30).toString();
const i2 = s2.isDark() ? `var(${n2.cssVarName("color-white")})` : `var(${n2.cssVarName("color-black")})`;
o2 = n2.cssVarBlock({ "bg-color": r2, "text-color": i2, "border-color": r2, "hover-bg-color": a3, "hover-text-color": i2, "hover-border-color": a3, "active-bg-color": l2, "active-border-color": l2 });
if (t2.value) {
const t3 = e2.dark ? Gv(s2, 50) : s2.tint(50).toString();
o2[n2.cssVarBlockName("disabled-bg-color")] = t3;
o2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? "rgba(255, 255, 255, 0.5)" : `var(${n2.cssVarName("color-white")})`;
o2[n2.cssVarBlockName("disabled-border-color")] = t3;
}
}
}
return o2;
});
}
const Xv = defineComponent({ name: "ElButton" });
const Jv = defineComponent({ ...Xv, props: gv, emits: bv, setup(e2, { expose: o2, emit: r2 }) {
const a2 = e2;
const l2 = Zv(a2);
const i2 = zi("button");
const { _ref: c2, _size: d2, _type: f2, _disabled: p2, _props: v2, shouldAddSpace: m2, handleClick: h2 } = vv(a2, r2);
const g2 = computed(() => [i2.b(), i2.m(f2.value), i2.m(d2.value), i2.is("disabled", p2.value), i2.is("loading", a2.loading), i2.is("plain", a2.plain), i2.is("round", a2.round), i2.is("circle", a2.circle), i2.is("text", a2.text), i2.is("link", a2.link), i2.is("has-bg", a2.bg)]);
o2({ ref: c2, size: d2, type: f2, disabled: p2, shouldAddSpace: m2 });
return (e3, o3) => (openBlock(), createBlock(resolveDynamicComponent(e3.tag), mergeProps({ ref_key: "_ref", ref: c2 }, unref(v2), { class: unref(g2), style: unref(l2), onClick: unref(h2) }), { default: withCtx(() => [e3.loading ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [e3.$slots.loading ? renderSlot(e3.$slots, "loading", { key: 0 }) : (openBlock(), createBlock(unref(Ud), { key: 1, class: normalizeClass(unref(i2).is("loading")) }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e3.loadingIcon)))]), _: 1 }, 8, ["class"]))], 64)) : e3.icon || e3.$slots.icon ? (openBlock(), createBlock(unref(Ud), { key: 1 }, { default: withCtx(() => [e3.icon ? (openBlock(), createBlock(resolveDynamicComponent(e3.icon), { key: 0 })) : renderSlot(e3.$slots, "icon", { key: 1 })]), _: 3 })) : createCommentVNode("v-if", true), e3.$slots.default ? (openBlock(), createElementBlock("span", { key: 2, class: normalizeClass({ [unref(i2).em("text", "expand")]: unref(m2) }) }, [renderSlot(e3.$slots, "default")], 2)) : createCommentVNode("v-if", true)]), _: 3 }, 16, ["class", "style", "onClick"]));
} });
var Qv = $d(Jv, [["__file", "button.vue"]]);
const em = { size: gv.size, type: gv.type };
const tm = defineComponent({ name: "ElButtonGroup" });
const nm = defineComponent({ ...tm, props: em, setup(e2) {
const o2 = e2;
provide(pv, reactive({ size: toRef(o2, "size"), type: toRef(o2, "type") }));
const r2 = zi("button");
return (e3, o3) => (openBlock(), createElementBlock("div", { class: normalizeClass(unref(r2).b("group")) }, [renderSlot(e3.$slots, "default")], 2));
} });
var om = $d(nm, [["__file", "button-group.vue"]]);
const rm = exports("aj", li(Qv, { ButtonGroup: om }));
ui(om);
const am = /* @__PURE__ */ new Map();
if (Te) {
let e2;
document.addEventListener("mousedown", (t2) => e2 = t2);
document.addEventListener("mouseup", (t2) => {
if (e2) {
for (const n2 of am.values()) {
for (const { documentHandler: o2 } of n2) {
o2(t2, e2);
}
}
e2 = void 0;
}
});
}
function sm(e2, t2) {
let n2 = [];
if (Array.isArray(t2.arg)) {
n2 = t2.arg;
} else if (Ws(t2.arg)) {
n2.push(t2.arg);
}
return function(o2, r2) {
const a2 = t2.instance.popperRef;
const s2 = o2.target;
const l2 = r2 == null ? void 0 : r2.target;
const i2 = !t2 || !t2.instance;
const u2 = !s2 || !l2;
const c2 = e2.contains(s2) || e2.contains(l2);
const d2 = e2 === s2;
const f2 = n2.length && n2.some((e3) => e3 == null ? void 0 : e3.contains(s2)) || n2.length && n2.includes(l2);
const p2 = a2 && (a2.contains(s2) || a2.contains(l2));
if (i2 || u2 || c2 || d2 || f2 || p2) {
return;
}
t2.value(o2, r2);
};
}
const lm = exports("s", { beforeMount(e2, t2) {
if (!am.has(e2)) {
am.set(e2, []);
}
am.get(e2).push({ documentHandler: sm(e2, t2), bindingFn: t2.value });
}, updated(e2, t2) {
if (!am.has(e2)) {
am.set(e2, []);
}
const n2 = am.get(e2);
const o2 = n2.findIndex((e3) => e3.bindingFn === t2.oldValue);
const r2 = { documentHandler: sm(e2, t2), bindingFn: t2.value };
if (o2 >= 0) {
n2.splice(o2, 1, r2);
} else {
n2.push(r2);
}
}, unmounted(e2) {
am.delete(e2);
} });
const im = 100;
const um = 600;
const cm = exports("c", { beforeMount(e2, t2) {
const n2 = t2.value;
const { interval: o2 = im, delay: r2 = um } = gt(n2) ? {} : n2;
let a2;
let s2;
const l2 = () => gt(n2) ? n2() : n2.handler();
const i2 = () => {
if (s2) {
clearTimeout(s2);
s2 = void 0;
}
if (a2) {
clearInterval(a2);
a2 = void 0;
}
};
e2.addEventListener("mousedown", (e3) => {
if (e3.button !== 0) return;
i2();
l2();
document.addEventListener("mouseup", () => i2(), { once: true });
s2 = setTimeout(() => {
a2 = setInterval(() => {
l2();
}, o2);
}, r2);
});
} });
const dm = { modelValue: { type: [Number, String, Boolean], default: void 0 }, label: { type: [String, Boolean, Number, Object], default: void 0 }, value: { type: [String, Boolean, Number, Object], default: void 0 }, indeterminate: Boolean, disabled: Boolean, checked: Boolean, name: { type: String, default: void 0 }, trueValue: { type: [String, Number], default: void 0 }, falseValue: { type: [String, Number], default: void 0 }, trueLabel: { type: [String, Number], default: void 0 }, falseLabel: { type: [String, Number], default: void 0 }, id: { type: String, default: void 0 }, border: Boolean, size: wd, tabindex: [String, Number], validateEvent: { type: Boolean, default: true }, ...Bd(["ariaControls"]) };
const fm = { [fi]: (e2) => bt(e2) || Hs(e2) || Ds(e2), change: (e2) => bt(e2) || Hs(e2) || Ds(e2) };
const pm = Symbol("checkboxGroupContextKey");
const vm = ({ model: e2, isChecked: t2 }) => {
const n2 = inject(pm, void 0);
const o2 = computed(() => {
var o3, r3;
const a2 = (o3 = n2 == null ? void 0 : n2.max) == null ? void 0 : o3.value;
const s2 = (r3 = n2 == null ? void 0 : n2.min) == null ? void 0 : r3.value;
return !Vs(a2) && e2.value.length >= a2 && !t2.value || !Vs(s2) && e2.value.length <= s2 && t2.value;
});
const r2 = Yd(computed(() => (n2 == null ? void 0 : n2.disabled.value) || o2.value));
return { isDisabled: r2, isLimitDisabled: o2 };
};
const mm = (e2, { model: t2, isLimitExceeded: n2, hasOwnLabel: o2, isDisabled: r2, isLabeledByFormItem: a2 }) => {
const u2 = inject(pm, void 0);
const { formItem: c2 } = Gd();
const { emit: d2 } = getCurrentInstance();
function f2(t3) {
var n3, o3, r3, a3;
return [true, e2.trueValue, e2.trueLabel].includes(t3) ? (o3 = (n3 = e2.trueValue) != null ? n3 : e2.trueLabel) != null ? o3 : true : (a3 = (r3 = e2.falseValue) != null ? r3 : e2.falseLabel) != null ? a3 : false;
}
function v2(e3, t3) {
d2("change", f2(e3), t3);
}
function m2(e3) {
if (n2.value) return;
const t3 = e3.target;
d2("change", f2(t3.checked), e3);
}
async function h2(s2) {
if (n2.value) return;
if (!o2.value && !r2.value && a2.value) {
const n3 = s2.composedPath();
const o3 = n3.some((e3) => e3.tagName === "LABEL");
if (!o3) {
t2.value = f2([false, e2.falseValue, e2.falseLabel].includes(t2.value));
await nextTick();
v2(t2.value, s2);
}
}
}
const g2 = computed(() => (u2 == null ? void 0 : u2.validateEvent) || e2.validateEvent);
watch(() => e2.modelValue, () => {
if (g2.value) {
c2 == null ? void 0 : c2.validate("change").catch((e3) => Js());
}
});
return { handleChange: m2, onClickRoot: h2 };
};
const hm = (e2) => {
const t2 = ref(false);
const { emit: n2 } = getCurrentInstance();
const o2 = inject(pm, void 0);
const r2 = computed(() => Vs(o2) === false);
const a2 = ref(false);
const i2 = computed({ get() {
var n3, a3;
return r2.value ? (n3 = o2 == null ? void 0 : o2.modelValue) == null ? void 0 : n3.value : (a3 = e2.modelValue) != null ? a3 : t2.value;
}, set(e3) {
var s2, l2;
if (r2.value && mt(e3)) {
a2.value = ((s2 = o2 == null ? void 0 : o2.max) == null ? void 0 : s2.value) !== void 0 && e3.length > (o2 == null ? void 0 : o2.max.value) && e3.length > i2.value.length;
a2.value === false && ((l2 = o2 == null ? void 0 : o2.changeEvent) == null ? void 0 : l2.call(o2, e3));
} else {
n2(fi, e3);
t2.value = e3;
}
} });
return { model: i2, isGroup: r2, isLimitExceeded: a2 };
};
const gm = (e2, t2, { model: n2 }) => {
const o2 = inject(pm, void 0);
const r2 = ref(false);
const a2 = computed(() => {
if (!qs(e2.value)) {
return e2.value;
}
return e2.label;
});
const l2 = computed(() => {
const t3 = n2.value;
if (Ds(t3)) {
return t3;
} else if (mt(t3)) {
if (yt(a2.value)) {
return t3.map(toRaw).some((e3) => Is(e3, a2.value));
} else {
return t3.map(toRaw).includes(a2.value);
}
} else if (t3 !== null && t3 !== void 0) {
return t3 === e2.trueValue || t3 === e2.trueLabel;
} else {
return !!t3;
}
});
const i2 = Kd(computed(() => {
var e3;
return (e3 = o2 == null ? void 0 : o2.size) == null ? void 0 : e3.value;
}), { prop: true });
const u2 = Kd(computed(() => {
var e3;
return (e3 = o2 == null ? void 0 : o2.size) == null ? void 0 : e3.value;
}));
const c2 = computed(() => !!t2.default || !qs(a2.value));
return { checkboxButtonSize: i2, isChecked: l2, isFocused: r2, checkboxSize: u2, hasOwnLabel: c2, actualValue: a2 };
};
const bm = (e2, t2) => {
const { formItem: n2 } = Gd();
const { model: o2, isGroup: r2, isLimitExceeded: a2 } = hm(e2);
const { isFocused: l2, isChecked: i2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, actualValue: f2 } = gm(e2, t2, { model: o2 });
const { isDisabled: p2 } = vm({ model: o2, isChecked: i2 });
const { inputId: v2, isLabeledByFormItem: m2 } = Zd(e2, { formItemContext: n2, disableIdGeneration: d2, disableIdManagement: r2 });
const { handleChange: h2, onClickRoot: g2 } = mm(e2, { model: o2, isLimitExceeded: a2, hasOwnLabel: d2, isDisabled: p2, isLabeledByFormItem: m2 });
const b2 = () => {
function t3() {
var t4, n3;
if (mt(o2.value) && !o2.value.includes(f2.value)) {
o2.value.push(f2.value);
} else {
o2.value = (n3 = (t4 = e2.trueValue) != null ? t4 : e2.trueLabel) != null ? n3 : true;
}
}
e2.checked && t3();
};
b2();
Ci({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, computed(() => r2.value && qs(e2.value)));
Ci({ from: "true-label", replacement: "true-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, computed(() => !!e2.trueLabel));
Ci({ from: "false-label", replacement: "false-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, computed(() => !!e2.falseLabel));
return { inputId: v2, isLabeledByFormItem: m2, isChecked: i2, isDisabled: p2, isFocused: l2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, model: o2, actualValue: f2, handleChange: h2, onClickRoot: g2 };
};
const ym = defineComponent({ name: "ElCheckbox" });
const wm = defineComponent({ ...ym, props: dm, emits: fm, setup(e2) {
const r2 = e2;
const a2 = useSlots();
const { inputId: l2, isLabeledByFormItem: i2, isChecked: c2, isDisabled: d2, isFocused: f2, checkboxSize: p2, hasOwnLabel: v2, model: h2, actualValue: g2, handleChange: b2, onClickRoot: y2 } = bm(r2, a2);
const w2 = zi("checkbox");
const S2 = computed(() => [w2.b(), w2.m(p2.value), w2.is("disabled", d2.value), w2.is("bordered", r2.border), w2.is("checked", c2.value)]);
const C2 = computed(() => [w2.e("input"), w2.is("disabled", d2.value), w2.is("checked", c2.value), w2.is("indeterminate", r2.indeterminate), w2.is("focus", f2.value)]);
return (e3, r3) => (openBlock(), createBlock(resolveDynamicComponent(!unref(v2) && unref(i2) ? "span" : "label"), { class: normalizeClass(unref(S2)), "aria-controls": e3.indeterminate ? e3.ariaControls : null, onClick: unref(y2) }, { default: withCtx(() => {
var r4, a3;
return [createElementVNode("span", { class: normalizeClass(unref(C2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? withDirectives((openBlock(), createElementBlock("input", { key: 0, id: unref(l2), "onUpdate:modelValue": (e4) => isRef(h2) ? h2.value = e4 : null, class: normalizeClass(unref(w2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, name: e3.name, tabindex: e3.tabindex, disabled: unref(d2), "true-value": (r4 = e3.trueValue) != null ? r4 : e3.trueLabel, "false-value": (a3 = e3.falseValue) != null ? a3 : e3.falseLabel, onChange: unref(b2), onFocus: (e4) => f2.value = true, onBlur: (e4) => f2.value = false, onClick: withModifiers(() => {
}, ["stop"]) }, null, 42, ["id", "onUpdate:modelValue", "indeterminate", "name", "tabindex", "disabled", "true-value", "false-value", "onChange", "onFocus", "onBlur", "onClick"])), [[vModelCheckbox, unref(h2)]]) : withDirectives((openBlock(), createElementBlock("input", { key: 1, id: unref(l2), "onUpdate:modelValue": (e4) => isRef(h2) ? h2.value = e4 : null, class: normalizeClass(unref(w2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, disabled: unref(d2), value: unref(g2), name: e3.name, tabindex: e3.tabindex, onChange: unref(b2), onFocus: (e4) => f2.value = true, onBlur: (e4) => f2.value = false, onClick: withModifiers(() => {
}, ["stop"]) }, null, 42, ["id", "onUpdate:modelValue", "indeterminate", "disabled", "value", "name", "tabindex", "onChange", "onFocus", "onBlur", "onClick"])), [[vModelCheckbox, unref(h2)]]), createElementVNode("span", { class: normalizeClass(unref(w2).e("inner")) }, null, 2)], 2), unref(v2) ? (openBlock(), createElementBlock("span", { key: 0, class: normalizeClass(unref(w2).e("label")) }, [renderSlot(e3.$slots, "default"), !e3.$slots.default ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [createTextVNode(toDisplayString(e3.label), 1)], 64)) : createCommentVNode("v-if", true)], 2)) : createCommentVNode("v-if", true)];
}), _: 3 }, 8, ["class", "aria-controls", "onClick"]));
} });
var xm = $d(wm, [["__file", "checkbox.vue"]]);
const Sm = defineComponent({ name: "ElCheckboxButton" });
const Cm = defineComponent({ ...Sm, props: dm, emits: fm, setup(e2) {
const o2 = e2;
const r2 = useSlots();
const { isFocused: a2, isChecked: l2, isDisabled: i2, checkboxButtonSize: c2, model: d2, actualValue: f2, handleChange: v2 } = bm(o2, r2);
const h2 = inject(pm, void 0);
const g2 = zi("checkbox");
const b2 = computed(() => {
var e3, t2, n2, o3;
const r3 = (t2 = (e3 = h2 == null ? void 0 : h2.fill) == null ? void 0 : e3.value) != null ? t2 : "";
return { backgroundColor: r3, borderColor: r3, color: (o3 = (n2 = h2 == null ? void 0 : h2.textColor) == null ? void 0 : n2.value) != null ? o3 : "", boxShadow: r3 ? `-1px 0 0 0 ${r3}` : void 0 };
});
const y2 = computed(() => [g2.b("button"), g2.bm("button", c2.value), g2.is("disabled", i2.value), g2.is("checked", l2.value), g2.is("focus", a2.value)]);
return (e3, o3) => {
var r3, s2;
return openBlock(), createElementBlock("label", { class: normalizeClass(unref(y2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? withDirectives((openBlock(), createElementBlock("input", { key: 0, "onUpdate:modelValue": (e4) => isRef(d2) ? d2.value = e4 : null, class: normalizeClass(unref(g2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: unref(i2), "true-value": (r3 = e3.trueValue) != null ? r3 : e3.trueLabel, "false-value": (s2 = e3.falseValue) != null ? s2 : e3.falseLabel, onChange: unref(v2), onFocus: (e4) => a2.value = true, onBlur: (e4) => a2.value = false, onClick: withModifiers(() => {
}, ["stop"]) }, null, 42, ["onUpdate:modelValue", "name", "tabindex", "disabled", "true-value", "false-value", "onChange", "onFocus", "onBlur", "onClick"])), [[vModelCheckbox, unref(d2)]]) : withDirectives((openBlock(), createElementBlock("input", { key: 1, "onUpdate:modelValue": (e4) => isRef(d2) ? d2.value = e4 : null, class: normalizeClass(unref(g2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: unref(i2), value: unref(f2), onChange: unref(v2), onFocus: (e4) => a2.value = true, onBlur: (e4) => a2.value = false, onClick: withModifiers(() => {
}, ["stop"]) }, null, 42, ["onUpdate:modelValue", "name", "tabindex", "disabled", "value", "onChange", "onFocus", "onBlur", "onClick"])), [[vModelCheckbox, unref(d2)]]), e3.$slots.default || e3.label ? (openBlock(), createElementBlock("span", { key: 2, class: normalizeClass(unref(g2).be("button", "inner")), style: normalizeStyle(unref(l2) ? unref(b2) : void 0) }, [renderSlot(e3.$slots, "default", {}, () => [createTextVNode(toDisplayString(e3.label), 1)])], 6)) : createCommentVNode("v-if", true)], 2);
};
} });
var km = $d(Cm, [["__file", "checkbox-button.vue"]]);
const _m = ti({ modelValue: { type: Jl(Array), default: () => [] }, disabled: Boolean, min: Number, max: Number, size: wd, fill: String, textColor: String, tag: { type: String, default: "div" }, validateEvent: { type: Boolean, default: true }, ...Bd(["ariaLabel"]) });
const Em = { [fi]: (e2) => mt(e2), change: (e2) => mt(e2) };
const Om = defineComponent({ name: "ElCheckboxGroup" });
const Lm = defineComponent({ ...Om, props: _m, emits: Em, setup(e2, { emit: n2 }) {
const o2 = e2;
const r2 = zi("checkbox");
const { formItem: a2 } = Gd();
const { inputId: l2, isLabeledByFormItem: c2 } = Zd(o2, { formItemContext: a2 });
const d2 = async (e3) => {
n2(fi, e3);
await nextTick();
n2("change", e3);
};
const f2 = computed({ get() {
return o2.modelValue;
}, set(e3) {
d2(e3);
} });
provide(pm, { ...$s(toRefs(o2), ["size", "min", "max", "disabled", "validateEvent", "fill", "textColor"]), modelValue: f2, changeEvent: d2 });
watch(() => o2.modelValue, () => {
if (o2.validateEvent) {
a2 == null ? void 0 : a2.validate("change").catch((e3) => Js());
}
});
return (e3, n3) => {
var o3;
return openBlock(), createBlock(resolveDynamicComponent(e3.tag), { id: unref(l2), class: normalizeClass(unref(r2).b("group")), role: "group", "aria-label": !unref(c2) ? e3.ariaLabel || "checkbox-group" : void 0, "aria-labelledby": unref(c2) ? (o3 = unref(a2)) == null ? void 0 : o3.labelId : void 0 }, { default: withCtx(() => [renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "aria-label", "aria-labelledby"]);
};
} });
var Am = $d(Lm, [["__file", "checkbox-group.vue"]]);
const Bm = exports("m", li(xm, { CheckboxButton: km, CheckboxGroup: Am }));
ui(km);
const Mm = exports("bd", ui(Am));
const Tm = ti({ modelValue: { type: [String, Number, Boolean], default: void 0 }, size: wd, disabled: Boolean, label: { type: [String, Number, Boolean], default: void 0 }, value: { type: [String, Number, Boolean], default: void 0 }, name: { type: String, default: void 0 } });
const Im = ti({ ...Tm, border: Boolean });
const Rm = { [fi]: (e2) => bt(e2) || Hs(e2) || Ds(e2), [pi]: (e2) => bt(e2) || Hs(e2) || Ds(e2) };
const jm = Symbol("radioGroupKey");
const zm = (e2, t2) => {
const n2 = ref();
const o2 = inject(jm, void 0);
const r2 = computed(() => !!o2);
const a2 = computed(() => {
if (!qs(e2.value)) {
return e2.value;
}
return e2.label;
});
const l2 = computed({ get() {
return r2.value ? o2.modelValue : e2.modelValue;
}, set(s2) {
if (r2.value) {
o2.changeEvent(s2);
} else {
t2 && t2(fi, s2);
}
n2.value.checked = e2.modelValue === a2.value;
} });
const i2 = Kd(computed(() => o2 == null ? void 0 : o2.size));
const u2 = Yd(computed(() => o2 == null ? void 0 : o2.disabled));
const c2 = ref(false);
const d2 = computed(() => u2.value || r2.value && l2.value !== a2.value ? -1 : 0);
Ci({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-radio", ref: "https://element-plus.org/en-US/component/radio.html" }, computed(() => r2.value && qs(e2.value)));
return { radioRef: n2, isGroup: r2, radioGroup: o2, focus: c2, size: i2, disabled: u2, tabIndex: d2, modelValue: l2, actualValue: a2 };
};
const Fm = defineComponent({ name: "ElRadio" });
const Pm = defineComponent({ ...Fm, props: Im, emits: Rm, setup(e2, { emit: r2 }) {
const a2 = e2;
const s2 = zi("radio");
const { radioRef: l2, radioGroup: i2, focus: c2, size: d2, disabled: f2, modelValue: p2, actualValue: v2 } = zm(a2, r2);
function h2() {
nextTick(() => r2("change", p2.value));
}
return (e3, r3) => {
var a3;
return openBlock(), createElementBlock("label", { class: normalizeClass([unref(s2).b(), unref(s2).is("disabled", unref(f2)), unref(s2).is("focus", unref(c2)), unref(s2).is("bordered", e3.border), unref(s2).is("checked", unref(p2) === unref(v2)), unref(s2).m(unref(d2))]) }, [createElementVNode("span", { class: normalizeClass([unref(s2).e("input"), unref(s2).is("disabled", unref(f2)), unref(s2).is("checked", unref(p2) === unref(v2))]) }, [withDirectives(createElementVNode("input", { ref_key: "radioRef", ref: l2, "onUpdate:modelValue": (e4) => isRef(p2) ? p2.value = e4 : null, class: normalizeClass(unref(s2).e("original")), value: unref(v2), name: e3.name || ((a3 = unref(i2)) == null ? void 0 : a3.name), disabled: unref(f2), checked: unref(p2) === unref(v2), type: "radio", onFocus: (e4) => c2.value = true, onBlur: (e4) => c2.value = false, onChange: h2, onClick: withModifiers(() => {
}, ["stop"]) }, null, 42, ["onUpdate:modelValue", "value", "name", "disabled", "checked", "onFocus", "onBlur", "onClick"]), [[vModelRadio, unref(p2)]]), createElementVNode("span", { class: normalizeClass(unref(s2).e("inner")) }, null, 2)], 2), createElementVNode("span", { class: normalizeClass(unref(s2).e("label")), onKeydown: withModifiers(() => {
}, ["stop"]) }, [renderSlot(e3.$slots, "default", {}, () => [createTextVNode(toDisplayString(e3.label), 1)])], 42, ["onKeydown"])], 2);
};
} });
var $m = $d(Pm, [["__file", "radio.vue"]]);
const Nm = ti({ ...Tm });
const Vm = defineComponent({ name: "ElRadioButton" });
const Dm = defineComponent({ ...Vm, props: Nm, setup(e2) {
const r2 = e2;
const a2 = zi("radio");
const { radioRef: l2, focus: i2, size: c2, disabled: d2, modelValue: f2, radioGroup: p2, actualValue: v2 } = zm(r2);
const h2 = computed(() => ({ backgroundColor: (p2 == null ? void 0 : p2.fill) || "", borderColor: (p2 == null ? void 0 : p2.fill) || "", boxShadow: (p2 == null ? void 0 : p2.fill) ? `-1px 0 0 0 ${p2.fill}` : "", color: (p2 == null ? void 0 : p2.textColor) || "" }));
return (e3, r3) => {
var s2;
return openBlock(), createElementBlock("label", { class: normalizeClass([unref(a2).b("button"), unref(a2).is("active", unref(f2) === unref(v2)), unref(a2).is("disabled", unref(d2)), unref(a2).is("focus", unref(i2)), unref(a2).bm("button", unref(c2))]) }, [withDirectives(createElementVNode("input", { ref_key: "radioRef", ref: l2, "onUpdate:modelValue": (e4) => isRef(f2) ? f2.value = e4 : null, class: normalizeClass(unref(a2).be("button", "original-radio")), value: unref(v2), type: "radio", name: e3.name || ((s2 = unref(p2)) == null ? void 0 : s2.name), disabled: unref(d2), onFocus: (e4) => i2.value = true, onBlur: (e4) => i2.value = false, onClick: withModifiers(() => {
}, ["stop"]) }, null, 42, ["onUpdate:modelValue", "value", "name", "disabled", "onFocus", "onBlur", "onClick"]), [[vModelRadio, unref(f2)]]), createElementVNode("span", { class: normalizeClass(unref(a2).be("button", "inner")), style: normalizeStyle(unref(f2) === unref(v2) ? unref(h2) : {}), onKeydown: withModifiers(() => {
}, ["stop"]) }, [renderSlot(e3.$slots, "default", {}, () => [createTextVNode(toDisplayString(e3.label), 1)])], 46, ["onKeydown"])], 2);
};
} });
var Hm = $d(Dm, [["__file", "radio-button.vue"]]);
const Um = ti({ id: { type: String, default: void 0 }, size: wd, disabled: Boolean, modelValue: { type: [String, Number, Boolean], default: void 0 }, fill: { type: String, default: "" }, textColor: { type: String, default: "" }, name: { type: String, default: void 0 }, validateEvent: { type: Boolean, default: true }, ...Bd(["ariaLabel"]) });
const Wm = Rm;
const qm = defineComponent({ name: "ElRadioGroup" });
const Km = defineComponent({ ...qm, props: Um, emits: Wm, setup(e2, { emit: o2 }) {
const r2 = e2;
const a2 = zi("radio");
const l2 = ed();
const d2 = ref();
const { formItem: f2 } = Gd();
const { inputId: p2, isLabeledByFormItem: m2 } = Zd(r2, { formItemContext: f2 });
const h2 = (e3) => {
o2(fi, e3);
nextTick(() => o2("change", e3));
};
onMounted(() => {
const e3 = d2.value.querySelectorAll("[type=radio]");
const t2 = e3[0];
if (!Array.from(e3).some((e4) => e4.checked) && t2) {
t2.tabIndex = 0;
}
});
const g2 = computed(() => r2.name || l2.value);
provide(jm, reactive({ ...toRefs(r2), changeEvent: h2, name: g2 }));
watch(() => r2.modelValue, () => {
if (r2.validateEvent) {
f2 == null ? void 0 : f2.validate("change").catch((e3) => Js());
}
});
return (e3, o3) => (openBlock(), createElementBlock("div", { id: unref(p2), ref_key: "radioGroupRef", ref: d2, class: normalizeClass(unref(a2).b("group")), role: "radiogroup", "aria-label": !unref(m2) ? e3.ariaLabel || "radio-group" : void 0, "aria-labelledby": unref(m2) ? unref(f2).labelId : void 0 }, [renderSlot(e3.$slots, "default")], 10, ["id", "aria-label", "aria-labelledby"]));
} });
var Ym = $d(Km, [["__file", "radio-group.vue"]]);
const Gm = exports("ak", li($m, { RadioButton: Hm, RadioGroup: Ym }));
const Zm = exports("al", ui(Ym));
const Xm = exports("ap", ui(Hm));
const Jm = ti({ mask: { type: Boolean, default: true }, customMaskEvent: Boolean, overlayClass: { type: Jl([String, Array, Object]) }, zIndex: { type: Jl([String, Number]) } });
const Qm = { click: (e2) => e2 instanceof MouseEvent };
const eh = "overlay";
var th = defineComponent({ name: "ElOverlay", props: Jm, emits: Qm, setup(e2, { slots: t2, emit: n2 }) {
const o2 = zi(eh);
const r2 = (e3) => {
n2("click", e3);
};
const { onClick: a2, onMousedown: s2, onMouseup: l2 } = Gc(e2.customMaskEvent ? void 0 : r2);
return () => e2.mask ? createVNode("div", { class: [o2.b(), e2.overlayClass], style: { zIndex: e2.zIndex }, onClick: a2, onMousedown: s2, onMouseup: l2 }, [renderSlot(t2, "default")], hi.STYLE | hi.CLASS | hi.PROPS, ["onClick", "onMouseup", "onMousedown"]) : h("div", { class: e2.overlayClass, style: { zIndex: e2.zIndex, position: "fixed", top: "0px", right: "0px", bottom: "0px", left: "0px" } }, [renderSlot(t2, "default")]);
} });
const nh = exports("n", th);
const oh = Symbol("dialogInjectionKey");
const rh = ti({ center: Boolean, alignCenter: Boolean, closeIcon: { type: ni }, draggable: Boolean, overflow: Boolean, fullscreen: Boolean, showClose: { type: Boolean, default: true }, title: { type: String, default: "" }, ariaLevel: { type: String, default: "2" } });
const ah = { close: () => true };
const sh = defineComponent({ name: "ElDialogContent" });
const lh = defineComponent({ ...sh, props: rh, emits: ah, setup(e2, { expose: r2 }) {
const a2 = e2;
const { t: l2 } = Bi();
const { Close: i2 } = oi;
const { dialogRef: c2, headerRef: d2, bodyId: f2, ns: v2, style: m2 } = inject(oh);
const { focusTrapRef: h2 } = inject(Qf);
const g2 = computed(() => [v2.b(), v2.is("fullscreen", a2.fullscreen), v2.is("draggable", a2.draggable), v2.is("align-center", a2.alignCenter), { [v2.m("center")]: a2.center }]);
const b2 = ci(h2, c2);
const y2 = computed(() => a2.draggable);
const w2 = computed(() => a2.overflow);
const { resetPostion: S2 } = ki(c2, d2, y2, w2);
r2({ resetPostion: S2 });
return (e3, r3) => (openBlock(), createElementBlock("div", { ref: unref(b2), class: normalizeClass(unref(g2)), style: normalizeStyle(unref(m2)), tabindex: "-1" }, [createElementVNode("header", { ref_key: "headerRef", ref: d2, class: normalizeClass([unref(v2).e("header"), { "show-close": e3.showClose }]) }, [renderSlot(e3.$slots, "header", {}, () => [createElementVNode("span", { role: "heading", "aria-level": e3.ariaLevel, class: normalizeClass(unref(v2).e("title")) }, toDisplayString(e3.title), 11, ["aria-level"])]), e3.showClose ? (openBlock(), createElementBlock("button", { key: 0, "aria-label": unref(l2)("el.dialog.close"), class: normalizeClass(unref(v2).e("headerbtn")), type: "button", onClick: (t2) => e3.$emit("close") }, [createVNode(unref(Ud), { class: normalizeClass(unref(v2).e("close")) }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(e3.closeIcon || unref(i2))))]), _: 1 }, 8, ["class"])], 10, ["aria-label", "onClick"])) : createCommentVNode("v-if", true)], 2), createElementVNode("div", { id: unref(f2), class: normalizeClass(unref(v2).e("body")) }, [renderSlot(e3.$slots, "default")], 10, ["id"]), e3.$slots.footer ? (openBlock(), createElementBlock("footer", { key: 0, class: normalizeClass(unref(v2).e("footer")) }, [renderSlot(e3.$slots, "footer")], 2)) : createCommentVNode("v-if", true)], 6));
} });
var ih = $d(lh, [["__file", "dialog-content.vue"]]);
const uh = exports("u", ti({ ...rh, appendToBody: Boolean, appendTo: { type: Jl([String, Object]), default: "body" }, beforeClose: { type: Jl(Function) }, destroyOnClose: Boolean, closeOnClickModal: { type: Boolean, default: true }, closeOnPressEscape: { type: Boolean, default: true }, lockScroll: { type: Boolean, default: true }, modal: { type: Boolean, default: true }, openDelay: { type: Number, default: 0 }, closeDelay: { type: Number, default: 0 }, top: { type: String }, modelValue: Boolean, modalClass: String, width: { type: [String, Number] }, zIndex: { type: Number }, trapFocus: Boolean, headerAriaLevel: { type: String, default: "2" } }));
const ch = exports("ae", { open: () => true, opened: () => true, close: () => true, closed: () => true, [fi]: (e2) => Ds(e2), openAutoFocus: () => true, closeAutoFocus: () => true });
const dh = exports("d", (e2, t2) => {
var n2;
const o2 = getCurrentInstance();
const r2 = o2.emit;
const { nextZIndex: a2 } = bd();
let u2 = "";
const d2 = ed();
const f2 = ed();
const p2 = ref(false);
const m2 = ref(false);
const h2 = ref(false);
const g2 = ref((n2 = e2.zIndex) != null ? n2 : a2());
let b2 = void 0;
let y2 = void 0;
const x2 = Id("namespace", Mi);
const S2 = computed(() => {
const t3 = {};
const n3 = `--${x2.value}-dialog`;
if (!e2.fullscreen) {
if (e2.top) {
t3[`${n3}-margin-top`] = e2.top;
}
if (e2.width) {
t3[`${n3}-width`] = rl(e2.width);
}
}
return t3;
});
const C2 = computed(() => {
if (e2.alignCenter) {
return { display: "flex" };
}
return {};
});
function k2() {
r2("opened");
}
function _2() {
r2("closed");
r2(fi, false);
if (e2.destroyOnClose) {
h2.value = false;
}
}
function E2() {
r2("close");
}
function O2() {
y2 == null ? void 0 : y2();
b2 == null ? void 0 : b2();
if (e2.openDelay && e2.openDelay > 0) {
({ stop: b2 } = Ne(() => M2(), e2.openDelay));
} else {
M2();
}
}
function L2() {
b2 == null ? void 0 : b2();
y2 == null ? void 0 : y2();
if (e2.closeDelay && e2.closeDelay > 0) {
({ stop: y2 } = Ne(() => T2(), e2.closeDelay));
} else {
T2();
}
}
function A2() {
function t3(e3) {
if (e3) return;
m2.value = true;
p2.value = false;
}
if (e2.beforeClose) {
e2.beforeClose(t3);
} else {
L2();
}
}
function B2() {
if (e2.closeOnClickModal) {
A2();
}
}
function M2() {
if (!Te) return;
p2.value = true;
}
function T2() {
p2.value = false;
}
function I2() {
r2("openAutoFocus");
}
function R2() {
r2("closeAutoFocus");
}
function j2(e3) {
var t3;
if (((t3 = e3.detail) == null ? void 0 : t3.focusReason) === "pointer") {
e3.preventDefault();
}
}
if (e2.lockScroll) {
Fi(p2);
}
function z2() {
if (e2.closeOnPressEscape) {
A2();
}
}
watch(() => e2.modelValue, (n3) => {
if (n3) {
m2.value = false;
O2();
h2.value = true;
g2.value = js(e2.zIndex) ? a2() : g2.value++;
nextTick(() => {
r2("open");
if (t2.value) {
t2.value.scrollTop = 0;
}
});
} else {
if (p2.value) {
L2();
}
}
});
watch(() => e2.fullscreen, (e3) => {
if (!t2.value) return;
if (e3) {
u2 = t2.value.style.transform;
t2.value.style.transform = "";
} else {
t2.value.style.transform = u2;
}
});
onMounted(() => {
if (e2.modelValue) {
p2.value = true;
h2.value = true;
O2();
}
});
return { afterEnter: k2, afterLeave: _2, beforeLeave: E2, handleClose: A2, onModalClick: B2, close: L2, doClose: T2, onOpenAutoFocus: I2, onCloseAutoFocus: R2, onCloseRequested: z2, onFocusoutPrevented: j2, titleId: d2, bodyId: f2, closed: m2, style: S2, overlayDialogStyle: C2, rendered: h2, visible: p2, zIndex: g2 };
});
const fh = defineComponent({ name: "ElDialog", inheritAttrs: false });
const ph = defineComponent({ ...fh, props: uh, emits: ch, setup(e2, { expose: n2 }) {
const r2 = e2;
const a2 = useSlots();
Ci({ scope: "el-dialog", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/dialog.html#slots" }, computed(() => !!a2.title));
const l2 = zi("dialog");
const i2 = ref();
const c2 = ref();
const d2 = ref();
const { visible: f2, titleId: p2, bodyId: m2, style: h2, overlayDialogStyle: g2, rendered: b2, zIndex: w2, afterEnter: C2, afterLeave: k2, beforeLeave: _2, handleClose: L2, onModalClick: T2, onOpenAutoFocus: I2, onCloseAutoFocus: j2, onCloseRequested: N2, onFocusoutPrevented: V2 } = dh(r2, i2);
provide(oh, { dialogRef: i2, headerRef: c2, bodyId: m2, ns: l2, rendered: b2, style: h2 });
const D2 = Gc(T2);
const H2 = computed(() => r2.draggable && !r2.fullscreen);
const U2 = () => {
d2.value.resetPostion();
};
n2({ visible: f2, dialogContentRef: d2, resetPostion: U2 });
return (e3, n3) => (openBlock(), createBlock(unref(ev), { to: e3.appendTo, disabled: e3.appendTo !== "body" ? false : !e3.appendToBody }, { default: withCtx(() => [createVNode(Transition, { name: "dialog-fade", onAfterEnter: unref(C2), onAfterLeave: unref(k2), onBeforeLeave: unref(_2), persisted: "" }, { default: withCtx(() => [withDirectives(createVNode(unref(nh), { "custom-mask-event": "", mask: e3.modal, "overlay-class": e3.modalClass, "z-index": unref(w2) }, { default: withCtx(() => [createElementVNode("div", { role: "dialog", "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? unref(p2) : void 0, "aria-describedby": unref(m2), class: normalizeClass(`${unref(l2).namespace.value}-overlay-dialog`), style: normalizeStyle(unref(g2)), onClick: unref(D2).onClick, onMousedown: unref(D2).onMousedown, onMouseup: unref(D2).onMouseup }, [createVNode(unref(xp), { loop: "", trapped: unref(f2), "focus-start-el": "container", onFocusAfterTrapped: unref(I2), onFocusAfterReleased: unref(j2), onFocusoutPrevented: unref(V2), onReleaseRequested: unref(N2) }, { default: withCtx(() => [unref(b2) ? (openBlock(), createBlock(ih, mergeProps({ key: 0, ref_key: "dialogContentRef", ref: d2 }, e3.$attrs, { center: e3.center, "align-center": e3.alignCenter, "close-icon": e3.closeIcon, draggable: unref(H2), overflow: e3.overflow, fullscreen: e3.fullscreen, "show-close": e3.showClose, title: e3.title, "aria-level": e3.headerAriaLevel, onClose: unref(L2) }), createSlots({ header: withCtx(() => [!e3.$slots.title ? renderSlot(e3.$slots, "header", { key: 0, close: unref(L2), titleId: unref(p2), titleClass: unref(l2).e("title") }) : renderSlot(e3.$slots, "title", { key: 1 })]), default: withCtx(() => [renderSlot(e3.$slots, "default")]), _: 2 }, [e3.$slots.footer ? { name: "footer", fn: withCtx(() => [renderSlot(e3.$slots, "footer")]) } : void 0]), 1040, ["center", "align-center", "close-icon", "draggable", "overflow", "fullscreen", "show-close", "title", "aria-level", "onClose"])) : createCommentVNode("v-if", true)]), _: 3 }, 8, ["trapped", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])], 46, ["aria-label", "aria-labelledby", "aria-describedby", "onClick", "onMousedown", "onMouseup"])]), _: 3 }, 8, ["mask", "overlay-class", "z-index"]), [[vShow, unref(f2)]])]), _: 3 }, 8, ["onAfterEnter", "onAfterLeave", "onBeforeLeave"])]), _: 3 }, 8, ["to", "disabled"]));
} });
var vh = $d(ph, [["__file", "dialog.vue"]]);
const mh = exports("am", li(vh));
const hh = ti({ direction: { type: String, values: ["horizontal", "vertical"], default: "horizontal" }, contentPosition: { type: String, values: ["left", "center", "right"], default: "center" }, borderStyle: { type: Jl(String), default: "solid" } });
const gh = defineComponent({ name: "ElDivider" });
const bh = defineComponent({ ...gh, props: hh, setup(e2) {
const o2 = e2;
const r2 = zi("divider");
const a2 = computed(() => r2.cssVar({ "border-style": o2.borderStyle }));
return (e3, o3) => (openBlock(), createElementBlock("div", { class: normalizeClass([unref(r2).b(), unref(r2).m(e3.direction)]), style: normalizeStyle(unref(a2)), role: "separator" }, [e3.$slots.default && e3.direction !== "vertical" ? (openBlock(), createElementBlock("div", { key: 0, class: normalizeClass([unref(r2).e("text"), unref(r2).is(e3.contentPosition)]) }, [renderSlot(e3.$slots, "default")], 2)) : createCommentVNode("v-if", true)], 6));
} });
var yh = $d(bh, [["__file", "divider.vue"]]);
const wh = exports("ao", li(yh));
function xh(t2) {
let n2;
const o2 = ref(false);
const r2 = reactive({ ...t2, originalPosition: "", originalOverflow: "", visible: false });
function a2(e2) {
r2.text = e2;
}
function s2() {
const e2 = r2.parent;
const t3 = f2.ns;
if (!e2.vLoadingAddClassList) {
let n3 = e2.getAttribute("loading-number");
n3 = Number.parseInt(n3) - 1;
if (!n3) {
nl(e2, t3.bm("parent", "relative"));
e2.removeAttribute("loading-number");
} else {
e2.setAttribute("loading-number", n3.toString());
}
nl(e2, t3.bm("parent", "hidden"));
}
l2();
d2.unmount();
}
function l2() {
var e2, t3;
(t3 = (e2 = f2.$el) == null ? void 0 : e2.parentNode) == null ? void 0 : t3.removeChild(f2.$el);
}
function i2() {
var e2;
if (t2.beforeClose && !t2.beforeClose()) return;
o2.value = true;
clearTimeout(n2);
n2 = setTimeout(u2, 400);
r2.visible = false;
(e2 = t2.closed) == null ? void 0 : e2.call(t2);
}
function u2() {
if (!o2.value) return;
const e2 = r2.parent;
o2.value = false;
e2.vLoadingAddClassList = void 0;
s2();
}
const c2 = defineComponent({ name: "ElLoading", setup(e2, { expose: t3 }) {
const { ns: n3, zIndex: o3 } = Rd("loading");
t3({ ns: n3, zIndex: o3 });
return () => {
const e3 = r2.spinner || r2.svg;
const t4 = h("svg", { class: "circular", viewBox: r2.svgViewBox ? r2.svgViewBox : "0 0 50 50", ...e3 ? { innerHTML: e3 } : {} }, [h("circle", { class: "path", cx: "25", cy: "25", r: "20", fill: "none" })]);
const o4 = r2.text ? h("p", { class: n3.b("text") }, [r2.text]) : void 0;
return h(Transition, { name: n3.b("fade"), onAfterLeave: u2 }, { default: withCtx(() => [withDirectives(createVNode("div", { style: { backgroundColor: r2.background || "" }, class: [n3.b("mask"), r2.customClass, r2.fullscreen ? "is-fullscreen" : ""] }, [h("div", { class: n3.b("spinner") }, [t4, o4])]), [[vShow, r2.visible]])]) });
};
} });
const d2 = createApp(c2);
const f2 = d2.mount(document.createElement("div"));
return { ...toRefs(r2), setText: a2, removeElLoadingChild: l2, close: i2, handleAfterLeave: u2, vm: f2, get $el() {
return f2.$el;
} };
}
let Sh = void 0;
const Ch = function(e2 = {}) {
if (!Te) return void 0;
const t2 = kh(e2);
if (t2.fullscreen && Sh) {
return Sh;
}
const n2 = xh({ ...t2, closed: () => {
var e3;
(e3 = t2.closed) == null ? void 0 : e3.call(t2);
if (t2.fullscreen) Sh = void 0;
} });
_h(t2, t2.parent, n2);
Eh(t2, t2.parent, n2);
t2.parent.vLoadingAddClassList = () => Eh(t2, t2.parent, n2);
let o2 = t2.parent.getAttribute("loading-number");
if (!o2) {
o2 = "1";
} else {
o2 = `${Number.parseInt(o2) + 1}`;
}
t2.parent.setAttribute("loading-number", o2);
t2.parent.appendChild(n2.$el);
nextTick(() => n2.visible.value = t2.visible);
if (t2.fullscreen) {
Sh = n2;
}
return n2;
};
const kh = (e2) => {
var t2, n2, o2, r2;
let a2;
if (bt(e2.target)) {
a2 = (t2 = document.querySelector(e2.target)) != null ? t2 : document.body;
} else {
a2 = e2.target || document.body;
}
return { parent: a2 === document.body || e2.body ? document.body : a2, background: e2.background || "", svg: e2.svg || "", svgViewBox: e2.svgViewBox || "", spinner: e2.spinner || false, text: e2.text || "", fullscreen: a2 === document.body && ((n2 = e2.fullscreen) != null ? n2 : true), lock: (o2 = e2.lock) != null ? o2 : false, customClass: e2.customClass || "", visible: (r2 = e2.visible) != null ? r2 : true, beforeClose: e2.beforeClose, closed: e2.closed, target: a2 };
};
const _h = async (e2, t2, n2) => {
const { nextZIndex: o2 } = n2.vm.zIndex || n2.vm._.exposed.zIndex;
const r2 = {};
if (e2.fullscreen) {
n2.originalPosition.value = ol(document.body, "position");
n2.originalOverflow.value = ol(document.body, "overflow");
r2.zIndex = o2();
} else if (e2.parent === document.body) {
n2.originalPosition.value = ol(document.body, "position");
await nextTick();
for (const t3 of ["top", "left"]) {
const n3 = t3 === "top" ? "scrollTop" : "scrollLeft";
r2[t3] = `${e2.target.getBoundingClientRect()[t3] + document.body[n3] + document.documentElement[n3] - Number.parseInt(ol(document.body, `margin-${t3}`), 10)}px`;
}
for (const t3 of ["height", "width"]) {
r2[t3] = `${e2.target.getBoundingClientRect()[t3]}px`;
}
} else {
n2.originalPosition.value = ol(t2, "position");
}
for (const [e3, t3] of Object.entries(r2)) {
n2.$el.style[e3] = t3;
}
};
const Eh = (e2, t2, n2) => {
const o2 = n2.vm.ns || n2.vm._.exposed.ns;
if (!["absolute", "fixed", "sticky"].includes(n2.originalPosition.value)) {
tl(t2, o2.bm("parent", "relative"));
} else {
nl(t2, o2.bm("parent", "relative"));
}
if (e2.fullscreen && e2.lock) {
tl(t2, o2.bm("parent", "hidden"));
} else {
nl(t2, o2.bm("parent", "hidden"));
}
};
const Oh = Symbol("ElLoading");
const Lh = (e2, t2) => {
var n2, o2, r2, a2;
const s2 = t2.instance;
const l2 = (e3) => yt(t2.value) ? t2.value[e3] : void 0;
const i2 = (e3) => {
const t3 = bt(e3) && (s2 == null ? void 0 : s2[e3]) || e3;
if (t3) return ref(t3);
else return t3;
};
const u2 = (t3) => i2(l2(t3) || e2.getAttribute(`element-loading-${Ot(t3)}`));
const c2 = (n2 = l2("fullscreen")) != null ? n2 : t2.modifiers.fullscreen;
const d2 = { text: u2("text"), svg: u2("svg"), svgViewBox: u2("svgViewBox"), spinner: u2("spinner"), background: u2("background"), customClass: u2("customClass"), fullscreen: c2, target: (o2 = l2("target")) != null ? o2 : c2 ? void 0 : e2, body: (r2 = l2("body")) != null ? r2 : t2.modifiers.body, lock: (a2 = l2("lock")) != null ? a2 : t2.modifiers.lock };
e2[Oh] = { options: d2, instance: Ch(d2) };
};
const Ah = (e2, t2) => {
for (const n2 of Object.keys(t2)) {
if (isRef(t2[n2])) t2[n2].value = e2[n2];
}
};
const Bh = exports("an", { mounted(e2, t2) {
if (t2.value) {
Lh(e2, t2);
}
}, updated(e2, t2) {
const n2 = e2[Oh];
if (t2.oldValue !== t2.value) {
if (t2.value && !t2.oldValue) {
Lh(e2, t2);
} else if (t2.value && t2.oldValue) {
if (yt(t2.value)) Ah(t2.value, n2.options);
} else {
n2 == null ? void 0 : n2.instance.close();
}
}
}, unmounted(e2) {
var t2;
(t2 = e2[Oh]) == null ? void 0 : t2.instance.close();
e2[Oh] = null;
} });
const Mh = ["success", "info", "warning", "error"];
const Th = yi({ customClass: "", center: false, dangerouslyUseHTMLString: false, duration: 3e3, icon: void 0, id: "", message: "", onClose: void 0, showClose: false, type: "info", plain: false, offset: 16, zIndex: 0, grouping: false, repeatNum: 1, appendTo: Te ? document.body : void 0 });
const Ih = ti({ customClass: { type: String, default: Th.customClass }, center: { type: Boolean, default: Th.center }, dangerouslyUseHTMLString: { type: Boolean, default: Th.dangerouslyUseHTMLString }, duration: { type: Number, default: Th.duration }, icon: { type: ni, default: Th.icon }, id: { type: String, default: Th.id }, message: { type: Jl([String, Object, Function]), default: Th.message }, onClose: { type: Jl(Function), default: Th.onClose }, showClose: { type: Boolean, default: Th.showClose }, type: { type: String, values: Mh, default: Th.type }, plain: { type: Boolean, default: Th.plain }, offset: { type: Number, default: Th.offset }, zIndex: { type: Number, default: Th.zIndex }, grouping: { type: Boolean, default: Th.grouping }, repeatNum: { type: Number, default: Th.repeatNum } });
const Rh = { destroy: () => true };
const jh = shallowReactive([]);
const zh = (e2) => {
const t2 = jh.findIndex((t3) => t3.id === e2);
const n2 = jh[t2];
let o2;
if (t2 > 0) {
o2 = jh[t2 - 1];
}
return { current: n2, prev: o2 };
};
const Fh = (e2) => {
const { prev: t2 } = zh(e2);
if (!t2) return 0;
return t2.vm.exposed.bottom.value;
};
const Ph = (e2, t2) => {
const n2 = jh.findIndex((t3) => t3.id === e2);
return n2 > 0 ? 16 : t2;
};
const $h = defineComponent({ name: "ElMessage" });
const Nh = defineComponent({ ...$h, props: Ih, emits: Rh, setup(e2, { expose: r2 }) {
const a2 = e2;
const { Close: l2 } = ri;
const { ns: d2, zIndex: f2 } = Rd("message");
const { currentZIndex: p2, nextZIndex: m2 } = f2;
const h2 = ref();
const g2 = ref(false);
const b2 = ref(0);
let y2 = void 0;
const w2 = computed(() => a2.type ? a2.type === "error" ? "danger" : a2.type : "info");
const S2 = computed(() => {
const e3 = a2.type;
return { [d2.bm("icon", e3)]: e3 && ai[e3] };
});
const C2 = computed(() => a2.icon || ai[a2.type] || "");
const k2 = computed(() => Fh(a2.id));
const _2 = computed(() => Ph(a2.id, a2.offset) + k2.value);
const E2 = computed(() => b2.value + _2.value);
const N2 = computed(() => ({ top: `${_2.value}px`, zIndex: p2.value }));
function V2() {
if (a2.duration === 0) return;
({ stop: y2 } = Ne(() => {
H2();
}, a2.duration));
}
function D2() {
y2 == null ? void 0 : y2();
}
function H2() {
g2.value = false;
}
function U2({ code: e3 }) {
if (e3 === di.esc) {
H2();
}
}
onMounted(() => {
V2();
m2();
g2.value = true;
});
watch(() => a2.repeatNum, () => {
D2();
V2();
});
Ue(document, "keydown", U2);
tt(h2, () => {
b2.value = h2.value.getBoundingClientRect().height;
});
r2({ visible: g2, bottom: E2, close: H2 });
return (e3, r3) => (openBlock(), createBlock(Transition, { name: unref(d2).b("fade"), onBeforeLeave: e3.onClose, onAfterLeave: (t2) => e3.$emit("destroy"), persisted: "" }, { default: withCtx(() => [withDirectives(createElementVNode("div", { id: e3.id, ref_key: "messageRef", ref: h2, class: normalizeClass([unref(d2).b(), { [unref(d2).m(e3.type)]: e3.type }, unref(d2).is("center", e3.center), unref(d2).is("closable", e3.showClose), unref(d2).is("plain", e3.plain), e3.customClass]), style: normalizeStyle(unref(N2)), role: "alert", onMouseenter: D2, onMouseleave: V2 }, [e3.repeatNum > 1 ? (openBlock(), createBlock(unref(fv), { key: 0, value: e3.repeatNum, type: unref(w2), class: normalizeClass(unref(d2).e("badge")) }, null, 8, ["value", "type", "class"])) : createCommentVNode("v-if", true), unref(C2) ? (openBlock(), createBlock(unref(Ud), { key: 1, class: normalizeClass([unref(d2).e("icon"), unref(S2)]) }, { default: withCtx(() => [(openBlock(), createBlock(resolveDynamicComponent(unref(C2))))]), _: 1 }, 8, ["class"])) : createCommentVNode("v-if", true), renderSlot(e3.$slots, "default", {}, () => [!e3.dangerouslyUseHTMLString ? (openBlock(), createElementBlock("p", { key: 0, class: normalizeClass(unref(d2).e("content")) }, toDisplayString(e3.message), 3)) : (openBlock(), createElementBlock(Fragment, { key: 1 }, [createCommentVNode(" Caution here, message could've been compromised, never use user's input as message "), createElementVNode("p", { class: normalizeClass(unref(d2).e("content")), innerHTML: e3.message }, null, 10, ["innerHTML"])], 2112))]), e3.showClose ? (openBlock(), createBlock(unref(Ud), { key: 2, class: normalizeClass(unref(d2).e("closeBtn")), onClick: withModifiers(H2, ["stop"]) }, { default: withCtx(() => [createVNode(unref(l2))]), _: 1 }, 8, ["class", "onClick"])) : createCommentVNode("v-if", true)], 46, ["id"]), [[vShow, g2.value]])]), _: 3 }, 8, ["name", "onBeforeLeave", "onAfterLeave"]));
} });
var Vh = $d(Nh, [["__file", "message.vue"]]);
let Dh = 1;
const Hh = (e2) => {
const t2 = !e2 || bt(e2) || isVNode(e2) || gt(e2) ? { message: e2 } : e2;
const n2 = { ...Th, ...t2 };
if (!n2.appendTo) {
n2.appendTo = document.body;
} else if (bt(n2.appendTo)) {
let e3 = document.querySelector(n2.appendTo);
if (!Ws(e3)) {
e3 = document.body;
}
n2.appendTo = e3;
}
return n2;
};
const Uh = (e2) => {
const t2 = jh.indexOf(e2);
if (t2 === -1) return;
jh.splice(t2, 1);
const { handler: n2 } = e2;
n2.close();
};
const Wh = ({ appendTo: e2, ...t2 }, n2) => {
const o2 = `message_${Dh++}`;
const r2 = t2.onClose;
const s2 = document.createElement("div");
const l2 = { ...t2, id: o2, onClose: () => {
r2 == null ? void 0 : r2();
Uh(d2);
}, onDestroy: () => {
render(null, s2);
} };
const i2 = createVNode(Vh, l2, gt(l2.message) || isVNode(l2.message) ? { default: gt(l2.message) ? l2.message : () => l2.message } : null);
i2.appContext = n2 || qh._context;
render(i2, s2);
e2.appendChild(s2.firstElementChild);
const u2 = i2.component;
const c2 = { close: () => {
u2.exposed.visible.value = false;
} };
const d2 = { id: o2, vnode: i2, vm: u2, handler: c2, props: i2.component.props };
return d2;
};
const qh = (e2 = {}, t2) => {
if (!Te) return { close: () => void 0 };
if (Hs(Pd.max) && jh.length >= Pd.max) {
return { close: () => void 0 };
}
const n2 = Hh(e2);
if (n2.grouping && jh.length) {
const e3 = jh.find(({ vnode: e4 }) => {
var t3;
return ((t3 = e4.props) == null ? void 0 : t3.message) === n2.message;
});
if (e3) {
e3.props.repeatNum += 1;
e3.props.type = n2.type;
return e3.handler;
}
}
const o2 = Wh(n2, t2);
jh.push(o2);
return o2.handler;
};
Mh.forEach((e2) => {
qh[e2] = (t2 = {}, n2) => {
const o2 = Hh(t2);
return qh({ ...o2, type: e2 }, n2);
};
});
function Kh(e2) {
for (const t2 of jh) {
if (!e2 || e2 === t2.props.type) {
t2.handler.close();
}
}
}
qh.closeAll = Kh;
qh._context = null;
const Yh = exports("a6", ii(qh, "$message"));
const Gh = exports("a4", defineStore("light-stick", () => {
const e2 = ref({ enabled: false, configList: [], completeDay: "", receiveDay: "" });
return { state: e2 };
}, { persist: true }));
const Zh = exports("bf", (e2) => {
let { url: t2 } = e2;
const { method: n2, params: o2, data: r2, responseType: a2, headers: s2 } = e2;
if ((n2 === "get" || n2 === "GET") && o2) {
t2 += `?${ge.stringify(o2)}`;
}
return new Promise((e3, o3) => {
i({ method: n2, url: t2, data: r2, responseType: a2 ? a2 : "json", headers: { "Content-Type": "application/x-www-form-urlencoded", ...s2 }, onload(t3) {
e3(t3);
}, onerror(e4) {
o3(e4);
} });
});
});
const Xh = "https://www.douyu.com";
const Jh = exports("a5", async () => {
const { response: e2 } = await Zh({ url: `${Xh}/member/cp/getFansBadgeList`, method: "get", responseType: "text" });
const t2 = /data-fans-room="(.+?)"[\s\S]+?data-anchor_name="(.+?)"/g;
let n2 = t2.exec(e2);
const o2 = [];
while (n2) {
o2.push({ rid: n2[1].trim(), name: n2[2] });
n2 = t2.exec(e2);
}
return o2;
});
const Qh = exports("bg", (e2) => Zh({ url: `${Xh}/member/cp/getPropTransactionList`, method: "get", params: e2 }));
const eg = exports("bh", (e2) => Zh({ url: `${Xh}/japi/prop/backpack/web/v2`, method: "get", params: e2, headers: { Referer: Xh } }));
const tg = exports("bi", (e2) => {
const t2 = new URLSearchParams();
for (const [n2, o2] of Object.entries(e2)) {
t2.append(n2, o2);
}
t2.append("bizExt", '{"yzxq":{}}');
return Zh({ url: `${Xh}/japi/prop/donate/mainsite/v2`, method: "post", data: t2, headers: { Referer: Xh } });
});
const ng = [".ActiviesExpanel-ExpandBtn", ".DyImg-content > img"];
const og = exports("a7", defineStore("page-end", () => {
const e2 = ref({ end: false });
setTimeout(() => {
e2.value.end = true;
}, 1e4);
new MutationObserver((t2, n2) => {
const o2 = ng.find((e3) => !document.querySelector(e3));
if (!o2 || e2.value.end) {
n2.disconnect();
e2.value.end = true;
}
}).observe(document, { childList: true, subtree: true });
return { state: e2 };
}, { persist: false }));
const rg = exports("a8", defineStore("page-config", () => {
const e2 = ref({});
const t2 = ref({});
const n2 = (n3, o2) => {
const { title: r2, hide: a2, have: s2 } = o2;
const l2 = e2.value[n3];
e2.value[n3] = { hide: l2 ? l2.hide : a2 };
t2.value[n3] = { title: r2, have: s2 };
};
return { infoState: t2, hideState: e2, addPageConfig: n2 };
}, { persist: { paths: ["hideState"] } }));
const ag = "DOUYUCRX";
const sg = exports("a9", defineStore("red-packet", () => {
const e2 = ref({ enabled: false });
watch(() => e2.value.enabled, (e3) => {
s[ag].redPacketEnabled = e3;
}, { immediate: true });
return { state: e2 };
}, { persist: true }));
const lg = "DOUYUCRX";
const ig = exports("aa", defineStore("gift-treasure", () => {
const e2 = ref({ enabled: false, preBoxId: "" });
s[lg].joinGiftTreasure = (t2, n2) => {
if (!e2.value.enabled) {
return;
}
if (!n2 || !n2.giftR || !n2.giftR.boxId) {
return;
}
const o2 = n2.giftR.boxId;
if (o2 === e2.value.preBoxId) {
return;
}
t2.reqJoin({ boxId: o2, checkBindPhone: 0 });
e2.value.preBoxId = o2;
};
return { state: e2 };
}, { persist: true }));
const ug = "DOUYUCRX";
const cg = exports("ab", defineStore("join-lottery", () => {
const e2 = ref({ enabled: false, resolveHide: false, rejectHide: false, closeResult: false });
const t2 = ref();
const n2 = ref();
let o2 = void 0;
s[ug].uLotteryStartChange = (e3) => {
t2.value = e3;
};
s[ug].uLotteryEndChange = (e3) => {
n2.value = e3;
};
s[ug].lotteryContainerChange = (e3) => {
o2 = e3;
};
const r2 = async () => {
if (!e2.value.enabled) {
return;
}
try {
await new Promise((e3, n3) => {
const o3 = t2.value;
if (!o3) {
return;
}
const r3 = o3.props.lotteryInfo.join_condition.lottery_range;
if (r3 >= 4) {
o3.happyLotteryServices.getUserDiamondInfo().subscribe((t3) => {
if (t3) {
o3.joinLottery();
e3();
} else {
n3();
}
});
return;
}
if (r3 <= 1 || o3.props.isFans) {
o3.joinLottery();
e3();
return;
}
n3();
});
if (e2.value.resolveHide) {
setTimeout(() => {
o2 == null ? void 0 : o2.closePanel();
}, 1e3);
}
} catch {
if (e2.value.rejectHide) {
setTimeout(() => {
o2 == null ? void 0 : o2.closePanel();
}, 1e3);
}
}
};
const a2 = () => {
const t3 = n2.value;
if (!e2.value.closeResult || !t3) {
return;
}
const r3 = t3.props;
const a3 = r3.win_list;
if (!a3 || a3.length === 0 || !r3.winNum) {
o2 == null ? void 0 : o2.closePanel();
}
};
watch(t2, r2);
watch(() => e2.value.enabled, r2);
watch(n2, a2);
watch(() => e2.value.closeResult, a2);
return { state: e2 };
}, { persist: { paths: ["state"] } }));
const dg = "DOUYUCRX";
const fg = exports("ac", defineStore("pageful", () => {
const e2 = ref({ layoutFull: false, videoFull: false });
s[dg].videoLayoutChange = (t2) => {
if (!e2.value.layoutFull && !e2.value.videoFull) {
return;
}
t2.clickPageful();
const n2 = document.querySelector(".layout-Player-asidetoggleButton");
const o2 = document.querySelector(".layout-Player-video");
if (e2.value.videoFull && n2 && o2 && o2.clientHeight !== document.documentElement.clientHeight && o2.clientWidth !== document.documentElement.clientWidth) {
n2.click();
}
};
watch(() => e2.value.layoutFull, (t2) => {
if (t2) {
e2.value.videoFull = false;
}
});
watch(() => e2.value.videoFull, (t2) => {
if (t2) {
e2.value.layoutFull = false;
}
});
return { state: e2 };
}, { persist: { paths: ["state"] } }));
})
};
}));
System.import("./__entry.js", "./");