您需要先安装一个扩展,例如 篡改猴、Greasemonkey 或 暴力猴,之后才能安装此脚本。
您需要先安装一个扩展,例如 篡改猴 或 暴力猴,之后才能安装此脚本。
您需要先安装一个扩展,例如 篡改猴 或 暴力猴,之后才能安装此脚本。
您需要先安装一个扩展,例如 篡改猴 或 Userscripts ,之后才能安装此脚本。
您需要先安装一款用户脚本管理器扩展,例如 Tampermonkey,才能安装此脚本。
您需要先安装用户脚本管理器扩展后才能安装此脚本。
斗鱼插件
当前为
// ==UserScript== // @name douyu-crx // @namespace npm/douyu-crx // @version 1.12 // @author monkey // @description 斗鱼插件 // @icon https://vitejs.dev/logo.svg // @match *://*.douyu.com/0* // @match *://*.douyu.com/1* // @match *://*.douyu.com/2* // @match *://*.douyu.com/3* // @match *://*.douyu.com/4* // @match *://*.douyu.com/5* // @match *://*.douyu.com/6* // @match *://*.douyu.com/7* // @match *://*.douyu.com/8* // @match *://*.douyu.com/9* // @match *://*.douyu.com/topic/* // @exclude *://*.douyu.com/topic/h5/* // @require https://lib.baomitu.com/vue/3.4.37/vue.global.prod.js // @require data:application/javascript,%3Bwindow.Vue%3DVue%3B // @require https://lib.baomitu.com/qs/6.13.0/qs.min.js // @require https://lib.baomitu.com/vue-demi/0.14.10/index.iife.min.js // @require https://lib.baomitu.com/pinia/2.2.1/pinia.iife.min.js // @require https://lib.baomitu.com/dayjs/1.11.12/dayjs.min.js // @connect doseeing.com // @connect douyu.com // @grant GM_addStyle // @grant GM_registerMenuCommand // @grant GM_xmlhttpRequest // @grant unsafeWindow // ==/UserScript== (e=>{if(typeof GM_addStyle=="function"){GM_addStyle(e);return}const r=document.createElement("style");r.textContent=e,document.head.append(r)})(' @charset "UTF-8";*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }.visible{visibility:visible}.static{position:static}.fixed{position:fixed}.absolute{position:absolute}.top-0{top:0}.z-\\[10000\\]{z-index:10000}.mb-4{margin-bottom:1rem}.ml-12{margin-left:3rem}.ml-2{margin-left:.5rem}.ml-5{margin-left:1.25rem}.flex{display:flex}.h-16{height:4rem}.h-20{height:5rem}.h-\\[30px\\]{height:30px}.h-\\[58vh\\]{height:58vh}.h-\\[80px\\]{height:80px}.w-16{width:4rem}.w-20{width:5rem}.w-56{width:14rem}.w-\\[254px\\]{width:254px}.w-\\[30px\\]{width:30px}.w-full{width:100%}.flex-1{flex:1 1 0%}.flex-none{flex:none}.transform{transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.cursor-default{cursor:default}.cursor-move{cursor:move}.cursor-pointer{cursor:pointer}.resize{resize:both}.flex-wrap{flex-wrap:wrap}.items-start{align-items:flex-start}.items-center{align-items:center}.justify-end{justify-content:flex-end}.justify-center{justify-content:center}.justify-between{justify-content:space-between}.overflow-auto{overflow:auto}.rounded-\\[6px\\]{border-radius:6px}.rounded-md{border-radius:.375rem}.rounded-xl{border-radius:.75rem}.border{border-width:1px}.p-\\[20px\\]{padding:20px}.pt-\\[5px\\]{padding-top:5px}.text-center{text-align:center}.text-3xl{font-size:1.875rem;line-height:2.25rem}.text-\\[14px\\]{font-size:14px}.text-xl{font-size:1.25rem;line-height:1.75rem}.font-black{font-weight:900}.font-bold{font-weight:700}.text-slate-400{--tw-text-opacity: 1;color:rgb(148 163 184 / var(--tw-text-opacity))}.text-white{--tw-text-opacity: 1;color:rgb(255 255 255 / var(--tw-text-opacity))}:root{--el-color-white: #ffffff;--el-color-black: #000000;--el-color-primary-rgb: 255, 119, 0;--el-color-success-rgb: 103, 194, 58;--el-color-warning-rgb: 230, 162, 60;--el-color-danger-rgb: 245, 108, 108;--el-color-error-rgb: 245, 108, 108;--el-color-info-rgb: 144, 147, 153;--el-font-size-extra-large: 20px;--el-font-size-large: 18px;--el-font-size-medium: 16px;--el-font-size-base: 14px;--el-font-size-small: 13px;--el-font-size-extra-small: 12px;--el-font-family: "Helvetica Neue", Helvetica, "PingFang SC", "Hiragino Sans GB", "Microsoft YaHei", "\u5FAE\u8F6F\u96C5\u9ED1", Arial, sans-serif;--el-font-weight-primary: 500;--el-font-line-height-primary: 24px;--el-index-normal: 1;--el-index-top: 1000;--el-index-popper: 2000;--el-border-radius-base: 4px;--el-border-radius-small: 2px;--el-border-radius-round: 20px;--el-border-radius-circle: 100%;--el-transition-duration: .3s;--el-transition-duration-fast: .2s;--el-transition-function-ease-in-out-bezier: cubic-bezier(.645, .045, .355, 1);--el-transition-function-fast-bezier: cubic-bezier(.23, 1, .32, 1);--el-transition-all: all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade: opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade: transform var(--el-transition-duration) var(--el-transition-function-fast-bezier), opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear: opacity var(--el-transition-duration-fast) linear;--el-transition-border: border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow: box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color: color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large: 40px;--el-component-size: 32px;--el-component-size-small: 24px;color-scheme:light;--el-color-primary: #f70;--el-color-primary-light-3: #ffa04d;--el-color-primary-light-5: #ffbb80;--el-color-primary-light-7: #ffd6b3;--el-color-primary-light-8: #ffe4cc;--el-color-primary-light-9: #fff1e6;--el-color-primary-dark-2: #cc5f00;--el-color-success: #67c23a;--el-color-success-light-3: #95d475;--el-color-success-light-5: #b3e19d;--el-color-success-light-7: #d1edc4;--el-color-success-light-8: #e1f3d8;--el-color-success-light-9: #f0f9eb;--el-color-success-dark-2: #529b2e;--el-color-warning: #e6a23c;--el-color-warning-light-3: #eebe77;--el-color-warning-light-5: #f3d19e;--el-color-warning-light-7: #f8e3c5;--el-color-warning-light-8: #faecd8;--el-color-warning-light-9: #fdf6ec;--el-color-warning-dark-2: #b88230;--el-color-danger: #f56c6c;--el-color-danger-light-3: #f89898;--el-color-danger-light-5: #fab6b6;--el-color-danger-light-7: #fcd3d3;--el-color-danger-light-8: #fde2e2;--el-color-danger-light-9: #fef0f0;--el-color-danger-dark-2: #c45656;--el-color-error: #f56c6c;--el-color-error-light-3: #f89898;--el-color-error-light-5: #fab6b6;--el-color-error-light-7: #fcd3d3;--el-color-error-light-8: #fde2e2;--el-color-error-light-9: #fef0f0;--el-color-error-dark-2: #c45656;--el-color-info: #909399;--el-color-info-light-3: #b1b3b8;--el-color-info-light-5: #c8c9cc;--el-color-info-light-7: #dedfe0;--el-color-info-light-8: #e9e9eb;--el-color-info-light-9: #f4f4f5;--el-color-info-dark-2: #73767a;--el-bg-color: #ffffff;--el-bg-color-page: #f2f3f5;--el-bg-color-overlay: #ffffff;--el-text-color-primary: #303133;--el-text-color-regular: #606266;--el-text-color-secondary: #909399;--el-text-color-placeholder: #a8abb2;--el-text-color-disabled: #c0c4cc;--el-border-color: #dcdfe6;--el-border-color-light: #e4e7ed;--el-border-color-lighter: #ebeef5;--el-border-color-extra-light: #f2f6fc;--el-border-color-dark: #d4d7de;--el-border-color-darker: #cdd0d6;--el-fill-color: #f0f2f5;--el-fill-color-light: #f5f7fa;--el-fill-color-lighter: #fafafa;--el-fill-color-extra-light: #fafcff;--el-fill-color-dark: #ebedf0;--el-fill-color-darker: #e6e8eb;--el-fill-color-blank: #ffffff;--el-box-shadow: 0px 12px 32px 4px rgba(0, 0, 0, .04), 0px 8px 20px rgba(0, 0, 0, .08);--el-box-shadow-light: 0px 0px 12px rgba(0, 0, 0, .12);--el-box-shadow-lighter: 0px 0px 6px rgba(0, 0, 0, .12);--el-box-shadow-dark: 0px 16px 48px 16px rgba(0, 0, 0, .08), 0px 12px 32px rgba(0, 0, 0, .12), 0px 8px 16px -8px rgba(0, 0, 0, .16);--el-disabled-bg-color: var(--el-fill-color-light);--el-disabled-text-color: var(--el-text-color-placeholder);--el-disabled-border-color: var(--el-border-color-light);--el-overlay-color: rgba(0, 0, 0, .8);--el-overlay-color-light: rgba(0, 0, 0, .7);--el-overlay-color-lighter: rgba(0, 0, 0, .5);--el-mask-color: rgba(255, 255, 255, .9);--el-mask-color-extra-light: rgba(255, 255, 255, .3);--el-border-width: 1px;--el-border-style: solid;--el-border-color-hover: var(--el-text-color-disabled);--el-border: var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey: var(--el-border-color)}.el-icon-loading{animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.el-icon{--color: inherit;height:1em;width:1em;line-height:1em;display:inline-flex;justify-content:center;align-items:center;position:relative;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}:root{--el-loading-spinner-size: 42px;--el-loading-fullscreen-spinner-size: 50px}.el-loading-parent--relative{position:relative!important}.el-loading-parent--hidden{overflow:hidden!important}.el-loading-mask{position:absolute;z-index:2000;background-color:var(--el-mask-color);margin:0;top:0;right:0;bottom:0;left:0;transition:opacity var(--el-transition-duration)}.el-loading-mask.is-fullscreen{position:fixed}.el-loading-mask.is-fullscreen .el-loading-spinner{margin-top:calc((0px - var(--el-loading-fullscreen-spinner-size)) / 2)}.el-loading-mask.is-fullscreen .el-loading-spinner .circular{height:var(--el-loading-fullscreen-spinner-size);width:var(--el-loading-fullscreen-spinner-size)}.el-loading-spinner{top:50%;margin-top:calc((0px - var(--el-loading-spinner-size)) / 2);width:100%;text-align:center;position:absolute}.el-loading-spinner .el-loading-text{color:var(--el-color-primary);margin:3px 0;font-size:14px}.el-loading-spinner .circular{display:inline;height:var(--el-loading-spinner-size);width:var(--el-loading-spinner-size);animation:loading-rotate 2s linear infinite}.el-loading-spinner .path{animation:loading-dash 1.5s ease-in-out infinite;stroke-dasharray:90,150;stroke-dashoffset:0;stroke-width:2;stroke:var(--el-color-primary);stroke-linecap:round}.el-loading-spinner i{color:var(--el-color-primary)}.el-loading-fade-enter-from,.el-loading-fade-leave-to{opacity:0}@keyframes loading-rotate{to{transform:rotate(360deg)}}@keyframes loading-dash{0%{stroke-dasharray:1,200;stroke-dashoffset:0}50%{stroke-dasharray:90,150;stroke-dashoffset:-40px}to{stroke-dasharray:90,150;stroke-dashoffset:-120px}}:root{--el-popup-modal-bg-color: var(--el-color-black);--el-popup-modal-opacity: .5}.v-modal-enter{animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-out{to{opacity:0}}.v-modal{position:fixed;left:0;top:0;width:100%;height:100%;opacity:var(--el-popup-modal-opacity);background:var(--el-popup-modal-bg-color)}.el-popup-parent--hidden{overflow:hidden}.el-dialog{--el-dialog-width: 50%;--el-dialog-margin-top: 15vh;--el-dialog-bg-color: var(--el-bg-color);--el-dialog-box-shadow: var(--el-box-shadow);--el-dialog-title-font-size: var(--el-font-size-large);--el-dialog-content-font-size: 14px;--el-dialog-font-line-height: var(--el-font-line-height-primary);--el-dialog-padding-primary: 16px;--el-dialog-border-radius: var(--el-border-radius-small);position:relative;margin:var(--el-dialog-margin-top, 15vh) auto 50px;background:var(--el-dialog-bg-color);border-radius:var(--el-dialog-border-radius);box-shadow:var(--el-dialog-box-shadow);box-sizing:border-box;padding:var(--el-dialog-padding-primary);width:var(--el-dialog-width, 50%);overflow-wrap:break-word}.el-dialog:focus{outline:none!important}.el-dialog.is-align-center{margin:auto}.el-dialog.is-fullscreen{--el-dialog-width: 100%;--el-dialog-margin-top: 0;margin-bottom:0;height:100%;overflow:auto}.el-dialog__wrapper{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto;margin:0}.el-dialog.is-draggable .el-dialog__header{cursor:move;-webkit-user-select:none;user-select:none}.el-dialog__header{padding-bottom:var(--el-dialog-padding-primary)}.el-dialog__header.show-close{padding-right:calc(var(--el-dialog-padding-primary) + var(--el-message-close-size, 16px))}.el-dialog__headerbtn{position:absolute;top:0;right:0;padding:0;width:48px;height:48px;background:transparent;border:none;outline:none;cursor:pointer;font-size:var(--el-message-close-size, 16px)}.el-dialog__headerbtn .el-dialog__close{color:var(--el-color-info);font-size:inherit}.el-dialog__headerbtn:focus .el-dialog__close,.el-dialog__headerbtn:hover .el-dialog__close{color:var(--el-color-primary)}.el-dialog__title{line-height:var(--el-dialog-font-line-height);font-size:var(--el-dialog-title-font-size);color:var(--el-text-color-primary)}.el-dialog__body{color:var(--el-text-color-regular);font-size:var(--el-dialog-content-font-size)}.el-dialog__footer{padding-top:var(--el-dialog-padding-primary);text-align:right;box-sizing:border-box}.el-dialog--center{text-align:center}.el-dialog--center .el-dialog__body{text-align:initial}.el-dialog--center .el-dialog__footer{text-align:inherit}.el-overlay-dialog{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto}.dialog-fade-enter-active{animation:modal-fade-in var(--el-transition-duration)}.dialog-fade-enter-active .el-overlay-dialog{animation:dialog-fade-in var(--el-transition-duration)}.dialog-fade-leave-active{animation:modal-fade-out var(--el-transition-duration)}.dialog-fade-leave-active .el-overlay-dialog{animation:dialog-fade-out var(--el-transition-duration)}@keyframes dialog-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@keyframes dialog-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}@keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}.el-overlay{position:fixed;top:0;right:0;bottom:0;left:0;z-index:2000;height:100%;background-color:var(--el-overlay-color-lighter);overflow:auto}.el-overlay .el-overlay-root{height:0}.el-scrollbar{--el-scrollbar-opacity: .3;--el-scrollbar-bg-color: var(--el-text-color-secondary);--el-scrollbar-hover-opacity: .5;--el-scrollbar-hover-bg-color: var(--el-text-color-secondary);overflow:hidden;position:relative;height:100%}.el-scrollbar__wrap{overflow:auto;height:100%}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{position:relative;display:block;width:0;height:0;cursor:pointer;border-radius:inherit;background-color:var(--el-scrollbar-bg-color, var(--el-text-color-secondary));transition:var(--el-transition-duration) background-color;opacity:var(--el-scrollbar-opacity, .3)}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color, var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity, .5)}.el-scrollbar__bar{position:absolute;right:2px;bottom:2px;z-index:1;border-radius:4px}.el-scrollbar__bar.is-vertical{width:6px;top:2px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity .34s ease-out}.el-scrollbar-fade-leave-active{transition:opacity .12s ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}.el-divider{position:relative}.el-divider--horizontal{display:block;height:1px;width:100%;margin:24px 0;border-top:1px var(--el-border-color) var(--el-border-style)}.el-divider--vertical{display:inline-block;width:1px;height:1em;margin:0 8px;vertical-align:middle;position:relative;border-left:1px var(--el-border-color) var(--el-border-style)}.el-divider__text{position:absolute;background-color:var(--el-bg-color);padding:0 20px;font-weight:500;color:var(--el-text-color-primary);font-size:14px}.el-divider__text.is-left{left:20px;transform:translateY(-50%)}.el-divider__text.is-center{left:50%;transform:translate(-50%) translateY(-50%)}.el-divider__text.is-right{right:20px;transform:translateY(-50%)}.el-date-table{font-size:12px;-webkit-user-select:none;user-select:none}.el-date-table.is-week-mode .el-date-table__row:hover .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table.is-week-mode .el-date-table__row:hover td.available:hover{color:var(--el-datepicker-text-color)}.el-date-table.is-week-mode .el-date-table__row:hover td:first-child .el-date-table-cell{margin-left:5px;border-top-left-radius:15px;border-bottom-left-radius:15px}.el-date-table.is-week-mode .el-date-table__row:hover td:last-child .el-date-table-cell{margin-right:5px;border-top-right-radius:15px;border-bottom-right-radius:15px}.el-date-table.is-week-mode .el-date-table__row.current .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td{width:32px;height:30px;padding:4px 0;box-sizing:border-box;text-align:center;cursor:pointer;position:relative}.el-date-table td .el-date-table-cell{height:30px;padding:3px 0;box-sizing:border-box}.el-date-table td .el-date-table-cell .el-date-table-cell__text{width:24px;height:24px;display:block;margin:0 auto;line-height:24px;position:absolute;left:50%;transform:translate(-50%);border-radius:50%}.el-date-table td.next-month,.el-date-table td.prev-month{color:var(--el-datepicker-off-text-color)}.el-date-table td.today{position:relative}.el-date-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-date-table td.today.start-date .el-date-table-cell__text,.el-date-table td.today.end-date .el-date-table-cell__text{color:#fff}.el-date-table td.available:hover{color:var(--el-datepicker-hover-text-color)}.el-date-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-date-table td.current:not(.disabled) .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-date-table td.current:not(.disabled):focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-date-table td.start-date .el-date-table-cell,.el-date-table td.end-date .el-date-table-cell{color:#fff}.el-date-table td.start-date .el-date-table-cell__text,.el-date-table td.end-date .el-date-table-cell__text{background-color:var(--el-datepicker-active-color)}.el-date-table td.start-date .el-date-table-cell{margin-left:5px;border-top-left-radius:15px;border-bottom-left-radius:15px}.el-date-table td.end-date .el-date-table-cell{margin-right:5px;border-top-right-radius:15px;border-bottom-right-radius:15px}.el-date-table td.disabled .el-date-table-cell{background-color:var(--el-fill-color-light);opacity:1;cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-date-table td.selected .el-date-table-cell{margin-left:5px;margin-right:5px;border-radius:15px}.el-date-table td.selected .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);color:#fff;border-radius:15px}.el-date-table td.week{font-size:80%;color:var(--el-datepicker-header-text-color)}.el-date-table td:focus{outline:none}.el-date-table th{padding:5px;color:var(--el-datepicker-header-text-color);font-weight:400;border-bottom:solid 1px var(--el-border-color-lighter)}.el-month-table{font-size:12px;margin:-1px;border-collapse:collapse}.el-month-table td{width:68px;text-align:center;padding:8px 0;cursor:pointer;position:relative}.el-month-table td .el-date-table-cell{height:48px;padding:6px 0;box-sizing:border-box}.el-month-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-month-table td.today.start-date .el-date-table-cell__text,.el-month-table td.today.end-date .el-date-table-cell__text{color:#fff}.el-month-table td.disabled .el-date-table-cell__text{background-color:var(--el-fill-color-light);cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-month-table td.disabled .el-date-table-cell__text:hover{color:var(--el-text-color-placeholder)}.el-month-table td .el-date-table-cell__text{width:54px;height:36px;display:block;line-height:36px;color:var(--el-datepicker-text-color);margin:0 auto;border-radius:18px;position:absolute;left:50%;transform:translate(-50%)}.el-month-table td .el-date-table-cell__text:hover{color:var(--el-datepicker-hover-text-color)}.el-month-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-month-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-month-table td.start-date .el-date-table-cell,.el-month-table td.end-date .el-date-table-cell{color:#fff}.el-month-table td.start-date .el-date-table-cell__text,.el-month-table td.end-date .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-month-table td.start-date .el-date-table-cell{margin-left:3px;border-top-left-radius:24px;border-bottom-left-radius:24px}.el-month-table td.end-date .el-date-table-cell{margin-right:3px;border-top-right-radius:24px;border-bottom-right-radius:24px}.el-month-table td.current:not(.disabled) .el-date-table-cell{border-radius:24px;margin-left:3px;margin-right:3px}.el-month-table td.current:not(.disabled) .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-month-table td:focus-visible{outline:none}.el-month-table td:focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-year-table{font-size:12px;margin:-1px;border-collapse:collapse}.el-year-table .el-icon{color:var(--el-datepicker-icon-color)}.el-year-table td{width:68px;text-align:center;padding:8px 0;cursor:pointer;position:relative}.el-year-table td .el-date-table-cell{height:48px;padding:6px 0;box-sizing:border-box}.el-year-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-year-table td.today.start-date .el-date-table-cell__text,.el-year-table td.today.end-date .el-date-table-cell__text{color:#fff}.el-year-table td.disabled .el-date-table-cell__text{background-color:var(--el-fill-color-light);cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-year-table td.disabled .el-date-table-cell__text:hover{color:var(--el-text-color-placeholder)}.el-year-table td .el-date-table-cell__text{width:60px;height:36px;display:block;line-height:36px;color:var(--el-datepicker-text-color);border-radius:18px;margin:0 auto;position:absolute;left:50%;transform:translate(-50%)}.el-year-table td .el-date-table-cell__text:hover{color:var(--el-datepicker-hover-text-color)}.el-year-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-year-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-year-table td.start-date .el-date-table-cell,.el-year-table td.end-date .el-date-table-cell{color:#fff}.el-year-table td.start-date .el-date-table-cell__text,.el-year-table td.end-date .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-year-table td.start-date .el-date-table-cell{border-top-left-radius:24px;border-bottom-left-radius:24px}.el-year-table td.end-date .el-date-table-cell{border-top-right-radius:24px;border-bottom-right-radius:24px}.el-year-table td.current:not(.disabled) .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-year-table td:focus-visible{outline:none}.el-year-table td:focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-time-spinner.has-seconds .el-time-spinner__wrapper{width:33.3%}.el-time-spinner__wrapper{max-height:192px;overflow:auto;display:inline-block;width:50%;vertical-align:top;position:relative}.el-time-spinner__wrapper.el-scrollbar__wrap:not(.el-scrollbar__wrap--hidden-default){padding-bottom:15px}.el-time-spinner__wrapper.is-arrow{box-sizing:border-box;text-align:center;overflow:hidden}.el-time-spinner__wrapper.is-arrow .el-time-spinner__list{transform:translateY(-32px)}.el-time-spinner__wrapper.is-arrow .el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:default}.el-time-spinner__arrow{font-size:12px;color:var(--el-text-color-secondary);position:absolute;left:0;width:100%;z-index:var(--el-index-normal);text-align:center;height:30px;line-height:30px;cursor:pointer}.el-time-spinner__arrow:hover{color:var(--el-color-primary)}.el-time-spinner__arrow.arrow-up{top:10px}.el-time-spinner__arrow.arrow-down{bottom:10px}.el-time-spinner__input.el-input{width:70%}.el-time-spinner__input.el-input .el-input__inner{padding:0;text-align:center}.el-time-spinner__list{padding:0;margin:0;list-style:none;text-align:center}.el-time-spinner__list:after,.el-time-spinner__list:before{content:"";display:block;width:100%;height:80px}.el-time-spinner__item{height:32px;line-height:32px;font-size:12px;color:var(--el-text-color-regular)}.el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:pointer}.el-time-spinner__item.is-active:not(.is-disabled){color:var(--el-text-color-primary);font-weight:700}.el-time-spinner__item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center top}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center bottom}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transition:var(--el-transition-md-fade);transform-origin:top left}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-leave-active,.el-collapse-transition-enter-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-picker__popper{--el-datepicker-border-color: var(--el-disabled-border-color)}.el-picker__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-datepicker-border-color);box-shadow:var(--el-box-shadow-light)}.el-picker__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-datepicker-border-color)}.el-picker__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-date-editor{--el-date-editor-width: 220px;--el-date-editor-monthrange-width: 300px;--el-date-editor-daterange-width: 350px;--el-date-editor-datetimerange-width: 400px;--el-input-text-color: var(--el-text-color-regular);--el-input-border: var(--el-border);--el-input-hover-border: var(--el-border-color-hover);--el-input-focus-border: var(--el-color-primary);--el-input-transparent-border: 0 0 0 1px transparent inset;--el-input-border-color: var(--el-border-color);--el-input-border-radius: var(--el-border-radius-base);--el-input-bg-color: var(--el-fill-color-blank);--el-input-icon-color: var(--el-text-color-placeholder);--el-input-placeholder-color: var(--el-text-color-placeholder);--el-input-hover-border-color: var(--el-border-color-hover);--el-input-clear-hover-color: var(--el-text-color-secondary);--el-input-focus-border-color: var(--el-color-primary);--el-input-width: 100%;position:relative;text-align:left;vertical-align:middle}.el-date-editor.el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-border-color, var(--el-border-color)) inset}.el-date-editor.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-date-editor.el-input,.el-date-editor.el-input__wrapper{width:var(--el-date-editor-width);height:var(--el-input-height, var(--el-component-size))}.el-date-editor--monthrange{--el-date-editor-width: var(--el-date-editor-monthrange-width)}.el-date-editor--daterange,.el-date-editor--timerange{--el-date-editor-width: var(--el-date-editor-daterange-width)}.el-date-editor--datetimerange{--el-date-editor-width: var(--el-date-editor-datetimerange-width)}.el-date-editor--dates .el-input__wrapper{text-overflow:ellipsis;white-space:nowrap}.el-date-editor .close-icon,.el-date-editor .clear-icon{cursor:pointer}.el-date-editor .clear-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__icon{height:inherit;font-size:14px;color:var(--el-text-color-placeholder);float:left}.el-date-editor .el-range__icon svg{vertical-align:middle}.el-date-editor .el-range-input{-webkit-appearance:none;-moz-appearance:none;appearance:none;border:none;outline:none;display:inline-block;height:30px;line-height:30px;margin:0;padding:0;width:39%;text-align:center;font-size:var(--el-font-size-base);color:var(--el-text-color-regular);background-color:transparent}.el-date-editor .el-range-input::placeholder{color:var(--el-text-color-placeholder)}.el-date-editor .el-range-separator{flex:1;display:inline-flex;justify-content:center;align-items:center;height:100%;padding:0 5px;margin:0;font-size:14px;overflow-wrap:break-word;color:var(--el-text-color-primary)}.el-date-editor .el-range__close-icon{font-size:14px;color:var(--el-text-color-placeholder);height:inherit;width:unset;cursor:pointer}.el-date-editor .el-range__close-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__close-icon svg{vertical-align:middle}.el-date-editor .el-range__close-icon--hidden{opacity:0;visibility:hidden}.el-range-editor.el-input__wrapper{display:inline-flex;align-items:center;padding:0 10px}.el-range-editor.is-active,.el-range-editor.is-active:hover{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-range-editor--large{line-height:var(--el-component-size-large)}.el-range-editor--large.el-input__wrapper{height:var(--el-component-size-large)}.el-range-editor--large .el-range-separator{line-height:40px;font-size:14px}.el-range-editor--large .el-range-input{height:38px;line-height:38px;font-size:14px}.el-range-editor--small{line-height:var(--el-component-size-small)}.el-range-editor--small.el-input__wrapper{height:var(--el-component-size-small)}.el-range-editor--small .el-range-separator{line-height:24px;font-size:12px}.el-range-editor--small .el-range-input{height:22px;line-height:22px;font-size:12px}.el-range-editor.is-disabled{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled:hover,.el-range-editor.is-disabled:focus{border-color:var(--el-disabled-border-color)}.el-range-editor.is-disabled input{background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled input::placeholder{color:var(--el-text-color-placeholder)}.el-range-editor.is-disabled .el-range-separator{color:var(--el-disabled-text-color)}.el-picker-panel{color:var(--el-text-color-regular);background:var(--el-bg-color-overlay);border-radius:var(--el-border-radius-base);line-height:30px}.el-picker-panel .el-time-panel{margin:5px 0;border:solid 1px var(--el-datepicker-border-color);background-color:var(--el-bg-color-overlay);box-shadow:var(--el-box-shadow-light)}.el-picker-panel__body:after,.el-picker-panel__body-wrapper:after{content:"";display:table;clear:both}.el-picker-panel__content{position:relative;margin:15px}.el-picker-panel__footer{border-top:1px solid var(--el-datepicker-inner-border-color);padding:4px 12px;text-align:right;background-color:var(--el-bg-color-overlay);position:relative;font-size:0}.el-picker-panel__shortcut{display:block;width:100%;border:0;background-color:transparent;line-height:28px;font-size:14px;color:var(--el-datepicker-text-color);padding-left:12px;text-align:left;outline:none;cursor:pointer}.el-picker-panel__shortcut:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__shortcut.active{background-color:#e6f1fe;color:var(--el-datepicker-active-color)}.el-picker-panel__btn{border:1px solid var(--el-fill-color-darker);color:var(--el-text-color-primary);line-height:24px;border-radius:2px;padding:0 20px;cursor:pointer;background-color:transparent;outline:none;font-size:12px}.el-picker-panel__btn[disabled]{color:var(--el-text-color-disabled);cursor:not-allowed}.el-picker-panel__icon-btn{font-size:12px;color:var(--el-datepicker-icon-color);border:0;background:transparent;cursor:pointer;outline:none;margin-top:8px}.el-picker-panel__icon-btn:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn:focus-visible{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn.is-disabled{color:var(--el-text-color-disabled)}.el-picker-panel__icon-btn.is-disabled:hover{cursor:not-allowed}.el-picker-panel__icon-btn .el-icon{cursor:pointer;font-size:inherit}.el-picker-panel__link-btn{vertical-align:middle}.el-picker-panel *[slot=sidebar],.el-picker-panel__sidebar{position:absolute;top:0;bottom:0;width:110px;border-right:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;padding-top:6px;background-color:var(--el-bg-color-overlay);overflow:auto}.el-picker-panel *[slot=sidebar]+.el-picker-panel__body,.el-picker-panel__sidebar+.el-picker-panel__body{margin-left:110px}.el-date-picker{--el-datepicker-text-color: var(--el-text-color-regular);--el-datepicker-off-text-color: var(--el-text-color-placeholder);--el-datepicker-header-text-color: var(--el-text-color-regular);--el-datepicker-icon-color: var(--el-text-color-primary);--el-datepicker-border-color: var(--el-disabled-border-color);--el-datepicker-inner-border-color: var(--el-border-color-light);--el-datepicker-inrange-bg-color: var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color: var(--el-border-color-extra-light);--el-datepicker-active-color: var(--el-color-primary);--el-datepicker-hover-text-color: var(--el-color-primary);width:322px}.el-date-picker.has-sidebar.has-time{width:434px}.el-date-picker.has-sidebar{width:438px}.el-date-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-picker .el-picker-panel__content{width:292px}.el-date-picker table{table-layout:fixed;width:100%}.el-date-picker__editor-wrap{position:relative;display:table-cell;padding:0 5px}.el-date-picker__time-header{position:relative;border-bottom:1px solid var(--el-datepicker-inner-border-color);font-size:12px;padding:8px 5px 5px;display:table;width:100%;box-sizing:border-box}.el-date-picker__header{margin:12px;text-align:center}.el-date-picker__header--bordered{margin-bottom:0;padding-bottom:12px;border-bottom:solid 1px var(--el-border-color-lighter)}.el-date-picker__header--bordered+.el-picker-panel__content{margin-top:0}.el-date-picker__header-label{font-size:16px;font-weight:500;padding:0 5px;line-height:22px;text-align:center;cursor:pointer;color:var(--el-text-color-regular)}.el-date-picker__header-label:hover{color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label:focus-visible{outline:none;color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label.active{color:var(--el-datepicker-active-color)}.el-date-picker__prev-btn{float:left}.el-date-picker__next-btn{float:right}.el-date-picker__time-wrap{padding:10px;text-align:center}.el-date-picker__time-label{float:left;cursor:pointer;line-height:30px;margin-left:10px}.el-date-picker .el-time-panel{position:absolute}.el-date-range-picker{--el-datepicker-text-color: var(--el-text-color-regular);--el-datepicker-off-text-color: var(--el-text-color-placeholder);--el-datepicker-header-text-color: var(--el-text-color-regular);--el-datepicker-icon-color: var(--el-text-color-primary);--el-datepicker-border-color: var(--el-disabled-border-color);--el-datepicker-inner-border-color: var(--el-border-color-light);--el-datepicker-inrange-bg-color: var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color: var(--el-border-color-extra-light);--el-datepicker-active-color: var(--el-color-primary);--el-datepicker-hover-text-color: var(--el-color-primary);width:646px}.el-date-range-picker.has-sidebar{width:756px}.el-date-range-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-range-picker table{table-layout:fixed;width:100%}.el-date-range-picker .el-picker-panel__body{min-width:513px}.el-date-range-picker .el-picker-panel__content{margin:0}.el-date-range-picker__header{position:relative;text-align:center;height:28px}.el-date-range-picker__header [class*=arrow-left]{float:left}.el-date-range-picker__header [class*=arrow-right]{float:right}.el-date-range-picker__header div{font-size:16px;font-weight:500;margin-right:50px}.el-date-range-picker__content{float:left;width:50%;box-sizing:border-box;margin:0;padding:16px}.el-date-range-picker__content.is-left{border-right:1px solid var(--el-datepicker-inner-border-color)}.el-date-range-picker__content .el-date-range-picker__header div{margin-left:50px;margin-right:50px}.el-date-range-picker__editors-wrap{box-sizing:border-box;display:table-cell}.el-date-range-picker__editors-wrap.is-right{text-align:right}.el-date-range-picker__time-header{position:relative;border-bottom:1px solid var(--el-datepicker-inner-border-color);font-size:12px;padding:8px 5px 5px;display:table;width:100%;box-sizing:border-box}.el-date-range-picker__time-header>.el-icon-arrow-right{font-size:20px;vertical-align:middle;display:table-cell;color:var(--el-datepicker-icon-color)}.el-date-range-picker__time-picker-wrap{position:relative;display:table-cell;padding:0 5px}.el-date-range-picker__time-picker-wrap .el-picker-panel{position:absolute;top:13px;right:0;z-index:1;background:#fff}.el-date-range-picker__time-picker-wrap .el-time-panel{position:absolute}.el-time-range-picker{width:354px;overflow:visible}.el-time-range-picker__content{position:relative;text-align:center;padding:10px;z-index:1}.el-time-range-picker__cell{box-sizing:border-box;margin:0;padding:4px 7px 7px;width:50%;display:inline-block}.el-time-range-picker__header{margin-bottom:5px;text-align:center;font-size:14px}.el-time-range-picker__body{border-radius:2px;border:1px solid var(--el-datepicker-border-color)}.el-time-panel{border-radius:2px;position:relative;width:180px;left:0;z-index:var(--el-index-top);-webkit-user-select:none;user-select:none;box-sizing:content-box}.el-time-panel__content{font-size:0;position:relative;overflow:hidden}.el-time-panel__content:after,.el-time-panel__content:before{content:"";top:50%;position:absolute;margin-top:-16px;height:32px;z-index:-1;left:0;right:0;box-sizing:border-box;padding-top:6px;text-align:left}.el-time-panel__content:after{left:50%;margin-left:12%;margin-right:12%}.el-time-panel__content:before{padding-left:50%;margin-right:12%;margin-left:12%;border-top:1px solid var(--el-border-color-light);border-bottom:1px solid var(--el-border-color-light)}.el-time-panel__content.has-seconds:after{left:66.6666666667%}.el-time-panel__content.has-seconds:before{padding-left:33.3333333333%}.el-time-panel__footer{border-top:1px solid var(--el-timepicker-inner-border-color, var(--el-border-color-light));padding:4px;height:36px;line-height:25px;text-align:right;box-sizing:border-box}.el-time-panel__btn{border:none;line-height:28px;padding:0 5px;margin:0 5px;cursor:pointer;background-color:transparent;outline:none;font-size:12px;color:var(--el-text-color-primary)}.el-time-panel__btn.confirm{font-weight:800;color:var(--el-timepicker-active-color, var(--el-color-primary))}.el-textarea{--el-input-text-color: var(--el-text-color-regular);--el-input-border: var(--el-border);--el-input-hover-border: var(--el-border-color-hover);--el-input-focus-border: var(--el-color-primary);--el-input-transparent-border: 0 0 0 1px transparent inset;--el-input-border-color: var(--el-border-color);--el-input-border-radius: var(--el-border-radius-base);--el-input-bg-color: var(--el-fill-color-blank);--el-input-icon-color: var(--el-text-color-placeholder);--el-input-placeholder-color: var(--el-text-color-placeholder);--el-input-hover-border-color: var(--el-border-color-hover);--el-input-clear-hover-color: var(--el-text-color-secondary);--el-input-focus-border-color: var(--el-color-primary);--el-input-width: 100%;position:relative;display:inline-block;width:100%;vertical-align:bottom;font-size:var(--el-font-size-base)}.el-textarea__inner{position:relative;display:block;resize:vertical;padding:5px 11px;line-height:1.5;box-sizing:border-box;width:100%;font-size:inherit;font-family:inherit;color:var(--el-input-text-color, var(--el-text-color-regular));background-color:var(--el-input-bg-color, var(--el-fill-color-blank));background-image:none;-webkit-appearance:none;box-shadow:0 0 0 1px var(--el-input-border-color, var(--el-border-color)) inset;border-radius:var(--el-input-border-radius, var(--el-border-radius-base));transition:var(--el-transition-box-shadow);border:none}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color, var(--el-text-color-placeholder))}.el-textarea__inner:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-textarea__inner:focus{outline:none;box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-textarea .el-input__count{color:var(--el-color-info);background:var(--el-fill-color-blank);position:absolute;font-size:12px;line-height:14px;bottom:5px;right:10px}.el-textarea.is-disabled .el-textarea__inner{box-shadow:0 0 0 1px var(--el-disabled-border-color) inset;background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color: var(--el-text-color-regular);--el-input-border: var(--el-border);--el-input-hover-border: var(--el-border-color-hover);--el-input-focus-border: var(--el-color-primary);--el-input-transparent-border: 0 0 0 1px transparent inset;--el-input-border-color: var(--el-border-color);--el-input-border-radius: var(--el-border-radius-base);--el-input-bg-color: var(--el-fill-color-blank);--el-input-icon-color: var(--el-text-color-placeholder);--el-input-placeholder-color: var(--el-text-color-placeholder);--el-input-hover-border-color: var(--el-border-color-hover);--el-input-clear-hover-color: var(--el-text-color-secondary);--el-input-focus-border-color: var(--el-color-primary);--el-input-width: 100%;--el-input-height: var(--el-component-size);position:relative;font-size:var(--el-font-size-base);display:inline-flex;width:var(--el-input-width);line-height:var(--el-input-height);box-sizing:border-box;vertical-align:middle}.el-input::-webkit-scrollbar{z-index:11;width:6px}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{border-radius:5px;width:6px;background:var(--el-text-color-disabled)}.el-input::-webkit-scrollbar-corner{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track-piece{background:var(--el-fill-color-blank);width:6px}.el-input .el-input__clear,.el-input .el-input__password{color:var(--el-input-icon-color);font-size:14px;cursor:pointer}.el-input .el-input__clear:hover,.el-input .el-input__password:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{height:100%;display:inline-flex;align-items:center;color:var(--el-color-info);font-size:12px}.el-input .el-input__count .el-input__count-inner{background:var(--el-fill-color-blank);line-height:initial;display:inline-block;padding-left:8px}.el-input__wrapper{display:inline-flex;flex-grow:1;align-items:center;justify-content:center;padding:1px 11px;background-color:var(--el-input-bg-color, var(--el-fill-color-blank));background-image:none;border-radius:var(--el-input-border-radius, var(--el-border-radius-base));cursor:text;transition:var(--el-transition-box-shadow);transform:translateZ(0);box-shadow:0 0 0 1px var(--el-input-border-color, var(--el-border-color)) inset}.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-input__inner{--el-input-inner-height: calc(var(--el-input-height, 32px) - 2px);width:100%;flex-grow:1;-webkit-appearance:none;color:var(--el-input-text-color, var(--el-text-color-regular));font-size:inherit;height:var(--el-input-inner-height);line-height:var(--el-input-inner-height);padding:0;outline:none;border:none;background:none;box-sizing:border-box}.el-input__inner:focus{outline:none}.el-input__inner::placeholder{color:var(--el-input-placeholder-color, var(--el-text-color-placeholder))}.el-input__inner[type=password]::-ms-reveal{display:none}.el-input__inner[type=number]{line-height:1}.el-input__prefix{display:inline-flex;white-space:nowrap;flex-shrink:0;flex-wrap:nowrap;height:100%;text-align:center;color:var(--el-input-icon-color, var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__prefix-inner{pointer-events:all;display:inline-flex;align-items:center;justify-content:center}.el-input__prefix-inner>:last-child{margin-right:8px}.el-input__prefix-inner>:first-child,.el-input__prefix-inner>:first-child.el-input__icon{margin-left:0}.el-input__suffix{display:inline-flex;white-space:nowrap;flex-shrink:0;flex-wrap:nowrap;height:100%;text-align:center;color:var(--el-input-icon-color, var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__suffix-inner{pointer-events:all;display:inline-flex;align-items:center;justify-content:center}.el-input__suffix-inner>:first-child{margin-left:8px}.el-input .el-input__icon{height:inherit;line-height:inherit;display:flex;justify-content:center;align-items:center;transition:all var(--el-transition-duration);margin-left:8px}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-color, ) inset}.el-input.is-disabled{cursor:not-allowed}.el-input.is-disabled .el-input__wrapper{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset}.el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color);-webkit-text-fill-color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--large{--el-input-height: var(--el-component-size-large);font-size:14px}.el-input--large .el-input__wrapper{padding:1px 15px}.el-input--large .el-input__inner{--el-input-inner-height: calc(var(--el-input-height, 40px) - 2px)}.el-input--small{--el-input-height: var(--el-component-size-small);font-size:12px}.el-input--small .el-input__wrapper{padding:1px 7px}.el-input--small .el-input__inner{--el-input-inner-height: calc(var(--el-input-height, 24px) - 2px)}.el-input-group{display:inline-flex;width:100%;align-items:stretch}.el-input-group__append,.el-input-group__prepend{background-color:var(--el-fill-color-light);color:var(--el-color-info);position:relative;display:inline-flex;align-items:center;justify-content:center;min-height:100%;border-radius:var(--el-input-border-radius);padding:0 20px;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:none}.el-input-group__append .el-select,.el-input-group__append .el-button,.el-input-group__prepend .el-select,.el-input-group__prepend .el-button{display:inline-block;margin:0 -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-select__wrapper,.el-input-group__append div.el-select:hover .el-select__wrapper,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-select__wrapper,.el-input-group__prepend div.el-select:hover .el-select__wrapper{border-color:transparent;background-color:transparent;color:inherit}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-right:0;border-top-right-radius:0;border-bottom-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group__append{border-left:0;border-top-left-radius:0;border-bottom-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--prepend>.el-input__wrapper{border-top-left-radius:0;border-bottom-left-radius:0}.el-input-group--prepend .el-input-group__prepend .el-select .el-select__wrapper{border-top-right-radius:0;border-bottom-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group--append>.el-input__wrapper{border-top-right-radius:0;border-bottom-right-radius:0}.el-input-group--append .el-input-group__append .el-select .el-select__wrapper{border-top-left-radius:0;border-bottom-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-hidden{display:none!important}.el-popper{--el-popper-border-radius: var(--el-popover-border-radius, 4px);position:absolute;border-radius:var(--el-popper-border-radius);padding:5px 11px;z-index:2000;font-size:12px;line-height:20px;min-width:10px;overflow-wrap:break-word;visibility:visible}.el-popper.is-dark{color:var(--el-bg-color);background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary)}.el-popper.is-dark .el-popper__arrow:before{border:1px solid var(--el-text-color-primary);background:var(--el-text-color-primary);right:0}.el-popper.is-light{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow:before{border:1px solid var(--el-border-color-light);background:var(--el-bg-color-overlay);right:0}.el-popper.is-pure{padding:0}.el-popper__arrow{position:absolute;width:10px;height:10px;z-index:-1}.el-popper__arrow:before{position:absolute;width:10px;height:10px;z-index:-1;content:" ";transform:rotate(45deg);background:var(--el-text-color-primary);box-sizing:border-box}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow:before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow:before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow:before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow:before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent!important;border-bottom-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent!important;border-top-color:transparent!important}.el-button{--el-button-font-weight: var(--el-font-weight-primary);--el-button-border-color: var(--el-border-color);--el-button-bg-color: var(--el-fill-color-blank);--el-button-text-color: var(--el-text-color-regular);--el-button-disabled-text-color: var(--el-disabled-text-color);--el-button-disabled-bg-color: var(--el-fill-color-blank);--el-button-disabled-border-color: var(--el-border-color-light);--el-button-divide-border-color: rgba(255, 255, 255, .5);--el-button-hover-text-color: var(--el-color-primary);--el-button-hover-bg-color: var(--el-color-primary-light-9);--el-button-hover-border-color: var(--el-color-primary-light-7);--el-button-active-text-color: var(--el-button-hover-text-color);--el-button-active-border-color: var(--el-color-primary);--el-button-active-bg-color: var(--el-button-hover-bg-color);--el-button-outline-color: var(--el-color-primary-light-5);--el-button-hover-link-text-color: var(--el-color-info);--el-button-active-color: var(--el-text-color-primary);display:inline-flex;justify-content:center;align-items:center;line-height:1;height:32px;white-space:nowrap;cursor:pointer;color:var(--el-button-text-color);text-align:center;box-sizing:border-box;outline:none;transition:.1s;font-weight:var(--el-button-font-weight);-webkit-user-select:none;user-select:none;vertical-align:middle;-webkit-appearance:none;background-color:var(--el-button-bg-color);border:var(--el-border);border-color:var(--el-button-border-color)}.el-button:hover{color:var(--el-button-hover-text-color);border-color:var(--el-button-hover-border-color);background-color:var(--el-button-hover-bg-color);outline:none}.el-button:active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:none}.el-button:focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button>span{display:inline-flex;align-items:center}.el-button+.el-button{margin-left:12px}.el-button{padding:8px 15px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button.is-round{padding:8px 15px}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-hover-text-color: var(--el-color-primary);--el-button-hover-bg-color: var(--el-fill-color-blank);--el-button-hover-border-color: var(--el-color-primary)}.el-button.is-active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:none}.el-button.is-disabled,.el-button.is-disabled:hover{color:var(--el-button-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color);border-color:var(--el-button-disabled-border-color)}.el-button.is-loading{position:relative;pointer-events:none}.el-button.is-loading:before{z-index:1;pointer-events:none;content:"";position:absolute;left:-1px;top:-1px;right:-1px;bottom:-1px;border-radius:inherit;background-color:var(--el-mask-color-extra-light)}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{width:32px;border-radius:50%;padding:8px}.el-button.is-text{color:var(--el-button-text-color);border:0 solid transparent;background-color:transparent}.el-button.is-text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important}.el-button.is-text:not(.is-disabled):hover{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled):focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button.is-text:not(.is-disabled):active{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled).is-has-bg:hover{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg:active{background-color:var(--el-fill-color-dark)}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button.is-link{border-color:transparent;color:var(--el-button-text-color);background:transparent;padding:2px;height:auto}.el-button.is-link:hover{color:var(--el-button-hover-link-text-color)}.el-button.is-link.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button.is-link:not(.is-disabled):hover{border-color:transparent;background-color:transparent}.el-button.is-link:not(.is-disabled):active{color:var(--el-button-active-color);border-color:transparent;background-color:transparent}.el-button--text{border-color:transparent;background:transparent;color:var(--el-color-primary);padding-left:0;padding-right:0}.el-button--text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button--text:not(.is-disabled):hover{color:var(--el-color-primary-light-3);border-color:transparent;background-color:transparent}.el-button--text:not(.is-disabled):active{color:var(--el-color-primary-dark-2);border-color:transparent;background-color:transparent}.el-button__link--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--primary{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-primary);--el-button-border-color: var(--el-color-primary);--el-button-outline-color: var(--el-color-primary-light-5);--el-button-active-color: var(--el-color-primary-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-primary-light-5);--el-button-hover-bg-color: var(--el-color-primary-light-3);--el-button-hover-border-color: var(--el-color-primary-light-3);--el-button-active-bg-color: var(--el-color-primary-dark-2);--el-button-active-border-color: var(--el-color-primary-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-primary-light-5);--el-button-disabled-border-color: var(--el-color-primary-light-5)}.el-button--primary.is-plain,.el-button--primary.is-text,.el-button--primary.is-link{--el-button-text-color: var(--el-color-primary);--el-button-bg-color: var(--el-color-primary-light-9);--el-button-border-color: var(--el-color-primary-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-primary);--el-button-hover-border-color: var(--el-color-primary);--el-button-active-text-color: var(--el-color-white)}.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:hover,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-text.is-disabled,.el-button--primary.is-text.is-disabled:hover,.el-button--primary.is-text.is-disabled:focus,.el-button--primary.is-text.is-disabled:active,.el-button--primary.is-link.is-disabled,.el-button--primary.is-link.is-disabled:hover,.el-button--primary.is-link.is-disabled:focus,.el-button--primary.is-link.is-disabled:active{color:var(--el-color-primary-light-5);background-color:var(--el-color-primary-light-9);border-color:var(--el-color-primary-light-8)}.el-button--success{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-success);--el-button-border-color: var(--el-color-success);--el-button-outline-color: var(--el-color-success-light-5);--el-button-active-color: var(--el-color-success-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-success-light-5);--el-button-hover-bg-color: var(--el-color-success-light-3);--el-button-hover-border-color: var(--el-color-success-light-3);--el-button-active-bg-color: var(--el-color-success-dark-2);--el-button-active-border-color: var(--el-color-success-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-success-light-5);--el-button-disabled-border-color: var(--el-color-success-light-5)}.el-button--success.is-plain,.el-button--success.is-text,.el-button--success.is-link{--el-button-text-color: var(--el-color-success);--el-button-bg-color: var(--el-color-success-light-9);--el-button-border-color: var(--el-color-success-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-success);--el-button-hover-border-color: var(--el-color-success);--el-button-active-text-color: var(--el-color-white)}.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:hover,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-text.is-disabled,.el-button--success.is-text.is-disabled:hover,.el-button--success.is-text.is-disabled:focus,.el-button--success.is-text.is-disabled:active,.el-button--success.is-link.is-disabled,.el-button--success.is-link.is-disabled:hover,.el-button--success.is-link.is-disabled:focus,.el-button--success.is-link.is-disabled:active{color:var(--el-color-success-light-5);background-color:var(--el-color-success-light-9);border-color:var(--el-color-success-light-8)}.el-button--warning{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-warning);--el-button-border-color: var(--el-color-warning);--el-button-outline-color: var(--el-color-warning-light-5);--el-button-active-color: var(--el-color-warning-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-warning-light-5);--el-button-hover-bg-color: var(--el-color-warning-light-3);--el-button-hover-border-color: var(--el-color-warning-light-3);--el-button-active-bg-color: var(--el-color-warning-dark-2);--el-button-active-border-color: var(--el-color-warning-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-warning-light-5);--el-button-disabled-border-color: var(--el-color-warning-light-5)}.el-button--warning.is-plain,.el-button--warning.is-text,.el-button--warning.is-link{--el-button-text-color: var(--el-color-warning);--el-button-bg-color: var(--el-color-warning-light-9);--el-button-border-color: var(--el-color-warning-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-warning);--el-button-hover-border-color: var(--el-color-warning);--el-button-active-text-color: var(--el-color-white)}.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:hover,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-text.is-disabled,.el-button--warning.is-text.is-disabled:hover,.el-button--warning.is-text.is-disabled:focus,.el-button--warning.is-text.is-disabled:active,.el-button--warning.is-link.is-disabled,.el-button--warning.is-link.is-disabled:hover,.el-button--warning.is-link.is-disabled:focus,.el-button--warning.is-link.is-disabled:active{color:var(--el-color-warning-light-5);background-color:var(--el-color-warning-light-9);border-color:var(--el-color-warning-light-8)}.el-button--danger{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-danger);--el-button-border-color: var(--el-color-danger);--el-button-outline-color: var(--el-color-danger-light-5);--el-button-active-color: var(--el-color-danger-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-danger-light-5);--el-button-hover-bg-color: var(--el-color-danger-light-3);--el-button-hover-border-color: var(--el-color-danger-light-3);--el-button-active-bg-color: var(--el-color-danger-dark-2);--el-button-active-border-color: var(--el-color-danger-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-danger-light-5);--el-button-disabled-border-color: var(--el-color-danger-light-5)}.el-button--danger.is-plain,.el-button--danger.is-text,.el-button--danger.is-link{--el-button-text-color: var(--el-color-danger);--el-button-bg-color: var(--el-color-danger-light-9);--el-button-border-color: var(--el-color-danger-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-danger);--el-button-hover-border-color: var(--el-color-danger);--el-button-active-text-color: var(--el-color-white)}.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:hover,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-text.is-disabled,.el-button--danger.is-text.is-disabled:hover,.el-button--danger.is-text.is-disabled:focus,.el-button--danger.is-text.is-disabled:active,.el-button--danger.is-link.is-disabled,.el-button--danger.is-link.is-disabled:hover,.el-button--danger.is-link.is-disabled:focus,.el-button--danger.is-link.is-disabled:active{color:var(--el-color-danger-light-5);background-color:var(--el-color-danger-light-9);border-color:var(--el-color-danger-light-8)}.el-button--info{--el-button-text-color: var(--el-color-white);--el-button-bg-color: var(--el-color-info);--el-button-border-color: var(--el-color-info);--el-button-outline-color: var(--el-color-info-light-5);--el-button-active-color: var(--el-color-info-dark-2);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-link-text-color: var(--el-color-info-light-5);--el-button-hover-bg-color: var(--el-color-info-light-3);--el-button-hover-border-color: var(--el-color-info-light-3);--el-button-active-bg-color: var(--el-color-info-dark-2);--el-button-active-border-color: var(--el-color-info-dark-2);--el-button-disabled-text-color: var(--el-color-white);--el-button-disabled-bg-color: var(--el-color-info-light-5);--el-button-disabled-border-color: var(--el-color-info-light-5)}.el-button--info.is-plain,.el-button--info.is-text,.el-button--info.is-link{--el-button-text-color: var(--el-color-info);--el-button-bg-color: var(--el-color-info-light-9);--el-button-border-color: var(--el-color-info-light-5);--el-button-hover-text-color: var(--el-color-white);--el-button-hover-bg-color: var(--el-color-info);--el-button-hover-border-color: var(--el-color-info);--el-button-active-text-color: var(--el-color-white)}.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:hover,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-text.is-disabled,.el-button--info.is-text.is-disabled:hover,.el-button--info.is-text.is-disabled:focus,.el-button--info.is-text.is-disabled:active,.el-button--info.is-link.is-disabled,.el-button--info.is-link.is-disabled:hover,.el-button--info.is-link.is-disabled:focus,.el-button--info.is-link.is-disabled:active{color:var(--el-color-info-light-5);background-color:var(--el-color-info-light-9);border-color:var(--el-color-info-light-8)}.el-button--large{--el-button-size: 40px;height:var(--el-button-size)}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large{padding:12px 19px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{width:var(--el-button-size);padding:12px}.el-button--small{--el-button-size: 24px;height:var(--el-button-size)}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small{padding:5px 11px;font-size:12px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{width:var(--el-button-size);padding:5px}.el-checkbox-group{font-size:0;line-height:0}.el-checkbox{--el-checkbox-font-size: 14px;--el-checkbox-font-weight: var(--el-font-weight-primary);--el-checkbox-text-color: var(--el-text-color-regular);--el-checkbox-input-height: 14px;--el-checkbox-input-width: 14px;--el-checkbox-border-radius: var(--el-border-radius-small);--el-checkbox-bg-color: var(--el-fill-color-blank);--el-checkbox-input-border: var(--el-border);--el-checkbox-disabled-border-color: var(--el-border-color);--el-checkbox-disabled-input-fill: var(--el-fill-color-light);--el-checkbox-disabled-icon-color: var(--el-text-color-placeholder);--el-checkbox-disabled-checked-input-fill: var(--el-border-color-extra-light);--el-checkbox-disabled-checked-input-border-color: var(--el-border-color);--el-checkbox-disabled-checked-icon-color: var(--el-text-color-placeholder);--el-checkbox-checked-text-color: var(--el-color-primary);--el-checkbox-checked-input-border-color: var(--el-color-primary);--el-checkbox-checked-bg-color: var(--el-color-primary);--el-checkbox-checked-icon-color: var(--el-color-white);--el-checkbox-input-border-color-hover: var(--el-color-primary);color:var(--el-checkbox-text-color);font-weight:var(--el-checkbox-font-weight);font-size:var(--el-font-size-base);position:relative;cursor:pointer;display:inline-flex;align-items:center;white-space:nowrap;-webkit-user-select:none;user-select:none;margin-right:30px;height:var(--el-checkbox-height, 32px)}.el-checkbox.is-disabled{cursor:not-allowed}.el-checkbox.is-bordered{padding:0 15px 0 9px;border-radius:var(--el-border-radius-base);border:var(--el-border);box-sizing:border-box}.el-checkbox.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-checkbox.is-bordered.is-disabled{border-color:var(--el-border-color-lighter)}.el-checkbox.is-bordered.el-checkbox--large{padding:0 19px 0 11px;border-radius:var(--el-border-radius-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__label{font-size:var(--el-font-size-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.is-bordered.el-checkbox--small{padding:0 11px 0 7px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox input:focus-visible+.el-checkbox__inner{outline:2px solid var(--el-checkbox-input-border-color-hover);outline-offset:1px;border-radius:var(--el-checkbox-border-radius)}.el-checkbox__input{white-space:nowrap;cursor:pointer;outline:none;display:inline-flex;position:relative}.el-checkbox__input.is-disabled .el-checkbox__inner{background-color:var(--el-checkbox-disabled-input-fill);border-color:var(--el-checkbox-disabled-border-color);cursor:not-allowed}.el-checkbox__input.is-disabled .el-checkbox__inner:after{cursor:not-allowed;border-color:var(--el-checkbox-disabled-icon-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-disabled-checked-icon-color);border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled+span.el-checkbox__label{color:var(--el-disabled-text-color);cursor:not-allowed}.el-checkbox__input.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-checked .el-checkbox__inner:after{transform:rotate(45deg) scaleY(1);border-color:var(--el-checkbox-checked-icon-color)}.el-checkbox__input.is-checked+.el-checkbox__label{color:var(--el-checkbox-checked-text-color)}.el-checkbox__input.is-focus:not(.is-checked) .el-checkbox__original:not(:focus-visible){border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__input.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:before{content:"";position:absolute;display:block;background-color:var(--el-checkbox-checked-icon-color);height:2px;transform:scale(.5);left:0;right:0;top:5px}.el-checkbox__input.is-indeterminate .el-checkbox__inner:after{display:none}.el-checkbox__inner{display:inline-block;position:relative;border:var(--el-checkbox-input-border);border-radius:var(--el-checkbox-border-radius);box-sizing:border-box;width:var(--el-checkbox-input-width);height:var(--el-checkbox-input-height);background-color:var(--el-checkbox-bg-color);z-index:var(--el-index-normal);transition:border-color .25s cubic-bezier(.71,-.46,.29,1.46),background-color .25s cubic-bezier(.71,-.46,.29,1.46),outline .25s cubic-bezier(.71,-.46,.29,1.46)}.el-checkbox__inner:hover{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__inner:after{box-sizing:content-box;content:"";border:1px solid transparent;border-left:0;border-top:0;height:7px;left:4px;position:absolute;top:1px;transform:rotate(45deg) scaleY(0);width:3px;transition:transform .15s ease-in .05s;transform-origin:center}.el-checkbox__original{opacity:0;outline:none;position:absolute;margin:0;width:0;height:0;z-index:-1}.el-checkbox__label{display:inline-block;padding-left:8px;line-height:1;font-size:var(--el-checkbox-font-size)}.el-checkbox.el-checkbox--large{height:40px}.el-checkbox.el-checkbox--large .el-checkbox__label{font-size:14px}.el-checkbox.el-checkbox--large .el-checkbox__inner{width:14px;height:14px}.el-checkbox.el-checkbox--small{height:24px}.el-checkbox.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.el-checkbox--small .el-checkbox__inner{width:12px;height:12px}.el-checkbox.el-checkbox--small .el-checkbox__input.is-indeterminate .el-checkbox__inner:before{top:4px}.el-checkbox.el-checkbox--small .el-checkbox__inner:after{width:2px;height:6px}.el-checkbox:last-of-type{margin-right:0}.el-radio-group{display:inline-flex;align-items:center;flex-wrap:wrap;font-size:0}.el-radio-button{--el-radio-button-checked-bg-color: var(--el-color-primary);--el-radio-button-checked-text-color: var(--el-color-white);--el-radio-button-checked-border-color: var(--el-color-primary);--el-radio-button-disabled-checked-fill: var(--el-border-color-extra-light);position:relative;display:inline-block;outline:none}.el-radio-button__inner{display:inline-block;line-height:1;white-space:nowrap;vertical-align:middle;background:var(--el-button-bg-color, var(--el-fill-color-blank));border:var(--el-border);font-weight:var(--el-button-font-weight, var(--el-font-weight-primary));border-left:0;color:var(--el-button-text-color, var(--el-text-color-regular));-webkit-appearance:none;text-align:center;box-sizing:border-box;outline:none;margin:0;position:relative;cursor:pointer;transition:var(--el-transition-all);-webkit-user-select:none;user-select:none;padding:8px 15px;font-size:var(--el-font-size-base);border-radius:0}.el-radio-button__inner.is-round{padding:8px 15px}.el-radio-button__inner:hover{color:var(--el-color-primary)}.el-radio-button__inner [class*=el-icon-]{line-height:.9}.el-radio-button__inner [class*=el-icon-]+span{margin-left:5px}.el-radio-button:first-child .el-radio-button__inner{border-left:var(--el-border);border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);box-shadow:none!important}.el-radio-button.is-active .el-radio-button__original-radio:not(:disabled)+.el-radio-button__inner{color:var(--el-radio-button-checked-text-color, var(--el-color-white));background-color:var(--el-radio-button-checked-bg-color, var(--el-color-primary));border-color:var(--el-radio-button-checked-border-color, var(--el-color-primary));box-shadow:-1px 0 0 0 var(--el-radio-button-checked-border-color, var(--el-color-primary))}.el-radio-button__original-radio{opacity:0;outline:none;position:absolute;z-index:-1}.el-radio-button__original-radio:focus-visible+.el-radio-button__inner{border-left:var(--el-border);border-left-color:var(--el-radio-button-checked-border-color, var(--el-color-primary));outline:2px solid var(--el-radio-button-checked-border-color);outline-offset:1px;z-index:2;border-radius:var(--el-border-radius-base);box-shadow:none}.el-radio-button__original-radio:disabled+.el-radio-button__inner{color:var(--el-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color, var(--el-fill-color-blank));border-color:var(--el-button-disabled-border-color, var(--el-border-color-light));box-shadow:none}.el-radio-button__original-radio:disabled:checked+.el-radio-button__inner{background-color:var(--el-radio-button-disabled-checked-fill)}.el-radio-button:last-child .el-radio-button__inner{border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0}.el-radio-button:first-child:last-child .el-radio-button__inner{border-radius:var(--el-border-radius-base)}.el-radio-button--large .el-radio-button__inner{padding:12px 19px;font-size:var(--el-font-size-base);border-radius:0}.el-radio-button--large .el-radio-button__inner.is-round{padding:12px 19px}.el-radio-button--small .el-radio-button__inner{padding:5px 11px;font-size:12px;border-radius:0}.el-radio-button--small .el-radio-button__inner.is-round{padding:5px 11px}.el-badge{--el-badge-bg-color: var(--el-color-danger);--el-badge-radius: 10px;--el-badge-font-size: 12px;--el-badge-padding: 6px;--el-badge-size: 18px;position:relative;vertical-align:middle;display:inline-block;width:fit-content}.el-badge__content{background-color:var(--el-badge-bg-color);border-radius:var(--el-badge-radius);color:var(--el-color-white);display:inline-flex;justify-content:center;align-items:center;font-size:var(--el-badge-font-size);height:var(--el-badge-size);padding:0 var(--el-badge-padding);white-space:nowrap;border:1px solid var(--el-bg-color)}.el-badge__content.is-fixed{position:absolute;top:0;right:calc(1px + var(--el-badge-size) / 2);transform:translateY(-50%) translate(100%);z-index:var(--el-index-normal)}.el-badge__content.is-fixed.is-dot{right:5px}.el-badge__content.is-dot{height:8px;width:8px;padding:0;right:0;border-radius:50%}.el-badge__content--primary{background-color:var(--el-color-primary)}.el-badge__content--success{background-color:var(--el-color-success)}.el-badge__content--warning{background-color:var(--el-color-warning)}.el-badge__content--info{background-color:var(--el-color-info)}.el-badge__content--danger{background-color:var(--el-color-danger)}.el-message{--el-message-bg-color: var(--el-color-info-light-9);--el-message-border-color: var(--el-border-color-lighter);--el-message-padding: 11px 15px;--el-message-close-size: 16px;--el-message-close-icon-color: var(--el-text-color-placeholder);--el-message-close-hover-color: var(--el-text-color-secondary);width:fit-content;max-width:calc(100% - 32px);box-sizing:border-box;border-radius:var(--el-border-radius-base);border-width:var(--el-border-width);border-style:var(--el-border-style);border-color:var(--el-message-border-color);position:fixed;left:50%;top:20px;transform:translate(-50%);background-color:var(--el-message-bg-color);transition:opacity var(--el-transition-duration),transform .4s,top .4s;padding:var(--el-message-padding);display:flex;align-items:center;gap:8px}.el-message.is-center{justify-content:center}.el-message.is-plain{background-color:var(--el-bg-color-overlay);border-color:var(--el-bg-color-overlay);box-shadow:var(--el-box-shadow-light)}.el-message p{margin:0}.el-message--success{--el-message-bg-color: var(--el-color-success-light-9);--el-message-border-color: var(--el-color-success-light-8);--el-message-text-color: var(--el-color-success)}.el-message--success .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--success{color:var(--el-message-text-color)}.el-message--info{--el-message-bg-color: var(--el-color-info-light-9);--el-message-border-color: var(--el-color-info-light-8);--el-message-text-color: var(--el-color-info)}.el-message--info .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--info{color:var(--el-message-text-color)}.el-message--warning{--el-message-bg-color: var(--el-color-warning-light-9);--el-message-border-color: var(--el-color-warning-light-8);--el-message-text-color: var(--el-color-warning)}.el-message--warning .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--warning{color:var(--el-message-text-color)}.el-message--error{--el-message-bg-color: var(--el-color-error-light-9);--el-message-border-color: var(--el-color-error-light-8);--el-message-text-color: var(--el-color-error)}.el-message--error .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--error{color:var(--el-message-text-color)}.el-message .el-message__badge{position:absolute;top:-8px;right:-8px}.el-message__content{padding:0;font-size:14px;line-height:1}.el-message__content:focus{outline-width:0}.el-message .el-message__closeBtn{cursor:pointer;color:var(--el-message-close-icon-color);font-size:var(--el-message-close-size)}.el-message .el-message__closeBtn:focus{outline-width:0}.el-message .el-message__closeBtn:hover{color:var(--el-message-close-hover-color)}.el-message-fade-enter-from,.el-message-fade-leave-to{opacity:0;transform:translate(-50%,-100%)}.el-drawer{--el-drawer-bg-color: var(--el-dialog-bg-color, var(--el-bg-color));--el-drawer-padding-primary: var(--el-dialog-padding-primary, 20px);position:absolute;box-sizing:border-box;background-color:var(--el-drawer-bg-color);display:flex;flex-direction:column;box-shadow:var(--el-box-shadow-dark);overflow:hidden;transition:all var(--el-transition-duration)}.el-drawer .rtl,.el-drawer .ltr,.el-drawer .ttb,.el-drawer .btt{transform:translate(0)}.el-drawer__sr-focus:focus{outline:none!important}.el-drawer__header{align-items:center;color:#72767b;display:flex;margin-bottom:32px;padding:var(--el-drawer-padding-primary);padding-bottom:0}.el-drawer__header>:first-child{flex:1}.el-drawer__title{margin:0;flex:1;line-height:inherit;font-size:16px}.el-drawer__footer{padding:var(--el-drawer-padding-primary);padding-top:10px;text-align:right}.el-drawer__close-btn{display:inline-flex;border:none;cursor:pointer;font-size:var(--el-font-size-extra-large);color:inherit;background-color:transparent;outline:none}.el-drawer__close-btn:focus i,.el-drawer__close-btn:hover i{color:var(--el-color-primary)}.el-drawer__body{flex:1;padding:var(--el-drawer-padding-primary);overflow:auto}.el-drawer__body>*{box-sizing:border-box}.el-drawer.ltr,.el-drawer.rtl{height:100%;top:0;bottom:0}.el-drawer.ttb,.el-drawer.btt{width:100%;left:0;right:0}.el-drawer.ltr{left:0}.el-drawer.rtl{right:0}.el-drawer.ttb{top:0}.el-drawer.btt{bottom:0}.el-drawer-fade-enter-active,.el-drawer-fade-leave-active{transition:all var(--el-transition-duration)}.el-drawer-fade-enter-from,.el-drawer-fade-enter-active,.el-drawer-fade-enter-to,.el-drawer-fade-leave-from,.el-drawer-fade-leave-active,.el-drawer-fade-leave-to{overflow:hidden!important}.el-drawer-fade-enter-from,.el-drawer-fade-leave-to{background-color:transparent!important}.el-drawer-fade-enter-from .rtl,.el-drawer-fade-leave-to .rtl{transform:translate(100%)}.el-drawer-fade-enter-from .ltr,.el-drawer-fade-leave-to .ltr{transform:translate(-100%)}.el-drawer-fade-enter-from .ttb,.el-drawer-fade-leave-to .ttb{transform:translateY(-100%)}.el-drawer-fade-enter-from .btt,.el-drawer-fade-leave-to .btt{transform:translateY(100%)}.setting-button{background-color:var(--el-color-primary)}.custom-modal{background-color:#0003}.el-switch{--el-switch-on-color: var(--el-color-primary);--el-switch-off-color: var(--el-border-color);display:inline-flex;align-items:center;position:relative;font-size:14px;line-height:20px;height:32px;vertical-align:middle}.el-switch.is-disabled .el-switch__core,.el-switch.is-disabled .el-switch__label{cursor:not-allowed}.el-switch__label{transition:var(--el-transition-duration-fast);height:20px;display:inline-block;font-size:14px;font-weight:500;cursor:pointer;vertical-align:middle;color:var(--el-text-color-primary)}.el-switch__label.is-active{color:var(--el-color-primary)}.el-switch__label--left{margin-right:10px}.el-switch__label--right{margin-left:10px}.el-switch__label *{line-height:1;font-size:14px;display:inline-block}.el-switch__label .el-icon{height:inherit}.el-switch__label .el-icon svg{vertical-align:middle}.el-switch__input{position:absolute;width:0;height:0;opacity:0;margin:0}.el-switch__input:focus-visible~.el-switch__core{outline:2px solid var(--el-switch-on-color);outline-offset:1px}.el-switch__core{display:inline-flex;position:relative;align-items:center;min-width:40px;height:20px;border:1px solid var(--el-switch-border-color, var(--el-switch-off-color));outline:none;border-radius:10px;box-sizing:border-box;background:var(--el-switch-off-color);cursor:pointer;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration)}.el-switch__core .el-switch__inner{width:100%;transition:all var(--el-transition-duration);height:16px;display:flex;justify-content:center;align-items:center;overflow:hidden;padding:0 4px 0 18px}.el-switch__core .el-switch__inner .is-icon,.el-switch__core .el-switch__inner .is-text{font-size:12px;color:var(--el-color-white);-webkit-user-select:none;user-select:none;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.el-switch__core .el-switch__action{position:absolute;left:1px;border-radius:var(--el-border-radius-circle);transition:all var(--el-transition-duration);width:16px;height:16px;background-color:var(--el-color-white);display:flex;justify-content:center;align-items:center;color:var(--el-switch-off-color)}.el-switch.is-checked .el-switch__core{border-color:var(--el-switch-border-color, var(--el-switch-on-color));background-color:var(--el-switch-on-color)}.el-switch.is-checked .el-switch__core .el-switch__action{left:calc(100% - 17px);color:var(--el-switch-on-color)}.el-switch.is-checked .el-switch__core .el-switch__inner{padding:0 18px 0 4px}.el-switch.is-disabled{opacity:.6}.el-switch--wide .el-switch__label.el-switch__label--left span{left:10px}.el-switch--wide .el-switch__label.el-switch__label--right span{right:10px}.el-switch .label-fade-enter-from,.el-switch .label-fade-leave-active{opacity:0}.el-switch--large{font-size:14px;line-height:24px;height:40px}.el-switch--large .el-switch__label{height:24px;font-size:14px}.el-switch--large .el-switch__label *{font-size:14px}.el-switch--large .el-switch__core{min-width:50px;height:24px;border-radius:12px}.el-switch--large .el-switch__core .el-switch__inner{height:20px;padding:0 6px 0 22px}.el-switch--large .el-switch__core .el-switch__action{width:20px;height:20px}.el-switch--large.is-checked .el-switch__core .el-switch__action{left:calc(100% - 21px)}.el-switch--large.is-checked .el-switch__core .el-switch__inner{padding:0 22px 0 6px}.el-switch--small{font-size:12px;line-height:16px;height:24px}.el-switch--small .el-switch__label{height:16px;font-size:12px}.el-switch--small .el-switch__label *{font-size:12px}.el-switch--small .el-switch__core{min-width:30px;height:16px;border-radius:8px}.el-switch--small .el-switch__core .el-switch__inner{height:12px;padding:0 2px 0 14px}.el-switch--small .el-switch__core .el-switch__action{width:12px;height:12px}.el-switch--small.is-checked .el-switch__core .el-switch__action{left:calc(100% - 13px)}.el-switch--small.is-checked .el-switch__core .el-switch__inner{padding:0 14px 0 2px}.el-tabs{--el-tabs-header-height: 40px;display:flex}.el-tabs__header{padding:0;position:relative;margin:0 0 15px;display:flex;align-items:center;justify-content:space-between}.el-tabs__header-vertical{flex-direction:column}.el-tabs__active-bar{position:absolute;bottom:0;left:0;height:2px;background-color:var(--el-color-primary);z-index:1;transition:width var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier),transform var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);list-style:none}.el-tabs__new-tab{display:flex;align-items:center;justify-content:center;border:1px solid var(--el-border-color);height:20px;width:20px;line-height:20px;margin:10px 0 10px 10px;border-radius:3px;text-align:center;font-size:12px;color:var(--el-text-color-primary);cursor:pointer;transition:all .15s}.el-tabs__new-tab .is-icon-plus{height:inherit;width:inherit;transform:scale(.8)}.el-tabs__new-tab .is-icon-plus svg{vertical-align:middle}.el-tabs__new-tab:hover{color:var(--el-color-primary)}.el-tabs__new-tab-vertical{margin-left:0}.el-tabs__nav-wrap{overflow:hidden;margin-bottom:-1px;position:relative;flex:1 auto}.el-tabs__nav-wrap:after{content:"";position:absolute;left:0;bottom:0;width:100%;height:2px;background-color:var(--el-border-color-light);z-index:var(--el-index-normal)}.el-tabs__nav-wrap.is-scrollable{padding:0 20px;box-sizing:border-box}.el-tabs__nav-scroll{overflow:hidden}.el-tabs__nav-next,.el-tabs__nav-prev{position:absolute;cursor:pointer;line-height:44px;font-size:12px;color:var(--el-text-color-secondary);width:20px;text-align:center}.el-tabs__nav-next{right:0}.el-tabs__nav-prev{left:0}.el-tabs__nav{display:flex;white-space:nowrap;position:relative;transition:transform var(--el-transition-duration);float:left;z-index:calc(var(--el-index-normal) + 1)}.el-tabs__nav.is-stretch{min-width:100%;display:flex}.el-tabs__nav.is-stretch>*{flex:1;text-align:center}.el-tabs__item{padding:0 20px;height:var(--el-tabs-header-height);box-sizing:border-box;display:flex;align-items:center;justify-content:center;list-style:none;font-size:var(--el-font-size-base);font-weight:500;color:var(--el-text-color-primary);position:relative}.el-tabs__item:focus,.el-tabs__item:focus:active{outline:none}.el-tabs__item:focus-visible{box-shadow:0 0 2px 2px var(--el-color-primary) inset;border-radius:3px}.el-tabs__item .is-icon-close{border-radius:50%;text-align:center;transition:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);margin-left:5px}.el-tabs__item .is-icon-close:before{transform:scale(.9);display:inline-block}.el-tabs__item .is-icon-close:hover{background-color:var(--el-text-color-placeholder);color:#fff}.el-tabs__item.is-active{color:var(--el-color-primary)}.el-tabs__item:hover{color:var(--el-color-primary);cursor:pointer}.el-tabs__item.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-tabs__content{overflow:hidden;position:relative;flex-grow:1}.el-tabs--top>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom>.el-tabs__header .el-tabs__item:nth-child(2){padding-left:0}.el-tabs--top>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom>.el-tabs__header .el-tabs__item:last-child{padding-right:0}.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2){padding-left:20px}.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:last-child{padding-right:20px}.el-tabs--card>.el-tabs__header{border-bottom:1px solid var(--el-border-color-light);height:var(--el-tabs-header-height)}.el-tabs--card>.el-tabs__header .el-tabs__nav-wrap:after{content:none}.el-tabs--card>.el-tabs__header .el-tabs__nav{border:1px solid var(--el-border-color-light);border-bottom:none;border-radius:4px 4px 0 0;box-sizing:border-box}.el-tabs--card>.el-tabs__header .el-tabs__active-bar{display:none}.el-tabs--card>.el-tabs__header .el-tabs__item .is-icon-close{position:relative;font-size:12px;width:0;height:14px;overflow:hidden;right:-2px;transform-origin:100% 50%}.el-tabs--card>.el-tabs__header .el-tabs__item{border-bottom:1px solid transparent;border-left:1px solid var(--el-border-color-light);transition:color var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier),padding var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier)}.el-tabs--card>.el-tabs__header .el-tabs__item:first-child{border-left:none}.el-tabs--card>.el-tabs__header .el-tabs__item.is-closable:hover{padding-left:13px;padding-right:13px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-closable:hover .is-icon-close{width:14px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active{border-bottom-color:var(--el-bg-color)}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active.is-closable{padding-left:20px;padding-right:20px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active.is-closable .is-icon-close{width:14px}.el-tabs--border-card{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color)}.el-tabs--border-card>.el-tabs__content{padding:15px}.el-tabs--border-card>.el-tabs__header{background-color:var(--el-fill-color-light);border-bottom:1px solid var(--el-border-color-light);margin:0}.el-tabs--border-card>.el-tabs__header .el-tabs__nav-wrap:after{content:none}.el-tabs--border-card>.el-tabs__header .el-tabs__item{transition:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);border:1px solid transparent;margin-top:-1px;color:var(--el-text-color-secondary)}.el-tabs--border-card>.el-tabs__header .el-tabs__item:first-child{margin-left:-1px}.el-tabs--border-card>.el-tabs__header .el-tabs__item+.el-tabs__item{margin-left:-1px}.el-tabs--border-card>.el-tabs__header .el-tabs__item.is-active{color:var(--el-color-primary);background-color:var(--el-bg-color-overlay);border-right-color:var(--el-border-color);border-left-color:var(--el-border-color)}.el-tabs--border-card>.el-tabs__header .el-tabs__item:not(.is-disabled):hover{color:var(--el-color-primary)}.el-tabs--border-card>.el-tabs__header .el-tabs__item.is-disabled{color:var(--el-disabled-text-color)}.el-tabs--border-card>.el-tabs__header .is-scrollable .el-tabs__item:first-child{margin-left:0}.el-tabs--bottom{flex-direction:column}.el-tabs--bottom .el-tabs__header.is-bottom{margin-bottom:0;margin-top:10px}.el-tabs--bottom.el-tabs--border-card .el-tabs__header.is-bottom{border-bottom:0;border-top:1px solid var(--el-border-color)}.el-tabs--bottom.el-tabs--border-card .el-tabs__nav-wrap.is-bottom{margin-top:-1px;margin-bottom:0}.el-tabs--bottom.el-tabs--border-card .el-tabs__item.is-bottom:not(.is-active){border:1px solid transparent}.el-tabs--bottom.el-tabs--border-card .el-tabs__item.is-bottom{margin:0 -1px -1px}.el-tabs--left,.el-tabs--right{overflow:hidden}.el-tabs--left .el-tabs__header.is-left,.el-tabs--left .el-tabs__header.is-right,.el-tabs--left .el-tabs__nav-wrap.is-left,.el-tabs--left .el-tabs__nav-wrap.is-right,.el-tabs--left .el-tabs__nav-scroll,.el-tabs--right .el-tabs__header.is-left,.el-tabs--right .el-tabs__header.is-right,.el-tabs--right .el-tabs__nav-wrap.is-left,.el-tabs--right .el-tabs__nav-wrap.is-right,.el-tabs--right .el-tabs__nav-scroll{height:100%}.el-tabs--left .el-tabs__active-bar.is-left,.el-tabs--left .el-tabs__active-bar.is-right,.el-tabs--right .el-tabs__active-bar.is-left,.el-tabs--right .el-tabs__active-bar.is-right{top:0;bottom:auto;width:2px;height:auto}.el-tabs--left .el-tabs__nav-wrap.is-left,.el-tabs--left .el-tabs__nav-wrap.is-right,.el-tabs--right .el-tabs__nav-wrap.is-left,.el-tabs--right .el-tabs__nav-wrap.is-right{margin-bottom:0}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next{height:30px;line-height:30px;width:100%;text-align:center;cursor:pointer}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev i,.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next i,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev i,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next i,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev i,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next i,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev i,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next i{transform:rotate(90deg)}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev{left:auto;top:0}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next{right:auto;bottom:0}.el-tabs--left .el-tabs__nav-wrap.is-left.is-scrollable,.el-tabs--left .el-tabs__nav-wrap.is-right.is-scrollable,.el-tabs--right .el-tabs__nav-wrap.is-left.is-scrollable,.el-tabs--right .el-tabs__nav-wrap.is-right.is-scrollable{padding:30px 0}.el-tabs--left .el-tabs__nav-wrap.is-left:after,.el-tabs--left .el-tabs__nav-wrap.is-right:after,.el-tabs--right .el-tabs__nav-wrap.is-left:after,.el-tabs--right .el-tabs__nav-wrap.is-right:after{height:100%;width:2px;bottom:auto;top:0}.el-tabs--left .el-tabs__nav.is-left,.el-tabs--left .el-tabs__nav.is-right,.el-tabs--right .el-tabs__nav.is-left,.el-tabs--right .el-tabs__nav.is-right{flex-direction:column}.el-tabs--left .el-tabs__item.is-left,.el-tabs--right .el-tabs__item.is-left{justify-content:flex-end}.el-tabs--left .el-tabs__item.is-right,.el-tabs--right .el-tabs__item.is-right{justify-content:flex-start}.el-tabs--left{flex-direction:row-reverse}.el-tabs--left .el-tabs__header.is-left{margin-bottom:0;margin-right:10px}.el-tabs--left .el-tabs__nav-wrap.is-left{margin-right:-1px}.el-tabs--left .el-tabs__nav-wrap.is-left:after{left:auto;right:0}.el-tabs--left .el-tabs__active-bar.is-left{right:0;left:auto}.el-tabs--left .el-tabs__item.is-left{text-align:right}.el-tabs--left.el-tabs--card .el-tabs__active-bar.is-left{display:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left{border-left:none;border-right:1px solid var(--el-border-color-light);border-bottom:none;border-top:1px solid var(--el-border-color-light);text-align:left}.el-tabs--left.el-tabs--card .el-tabs__item.is-left:first-child{border-right:1px solid var(--el-border-color-light);border-top:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active{border:1px solid var(--el-border-color-light);border-right-color:#fff;border-left:none;border-bottom:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active:first-child{border-top:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active:last-child{border-bottom:none}.el-tabs--left.el-tabs--card .el-tabs__nav{border-radius:4px 0 0 4px;border-bottom:1px solid var(--el-border-color-light);border-right:none}.el-tabs--left.el-tabs--card .el-tabs__new-tab{float:none}.el-tabs--left.el-tabs--border-card .el-tabs__header.is-left{border-right:1px solid var(--el-border-color)}.el-tabs--left.el-tabs--border-card .el-tabs__item.is-left{border:1px solid transparent;margin:-1px 0 -1px -1px}.el-tabs--left.el-tabs--border-card .el-tabs__item.is-left.is-active{border-color:transparent;border-top-color:#d1dbe5;border-bottom-color:#d1dbe5}.el-tabs--right .el-tabs__header.is-right{margin-bottom:0;margin-left:10px}.el-tabs--right .el-tabs__nav-wrap.is-right{margin-left:-1px}.el-tabs--right .el-tabs__nav-wrap.is-right:after{left:0;right:auto}.el-tabs--right .el-tabs__active-bar.is-right{left:0}.el-tabs--right.el-tabs--card .el-tabs__active-bar.is-right{display:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right{border-bottom:none;border-top:1px solid var(--el-border-color-light)}.el-tabs--right.el-tabs--card .el-tabs__item.is-right:first-child{border-left:1px solid var(--el-border-color-light);border-top:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active{border:1px solid var(--el-border-color-light);border-left-color:#fff;border-right:none;border-bottom:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active:first-child{border-top:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active:last-child{border-bottom:none}.el-tabs--right.el-tabs--card .el-tabs__nav{border-radius:0 4px 4px 0;border-bottom:1px solid var(--el-border-color-light);border-left:none}.el-tabs--right.el-tabs--border-card .el-tabs__header.is-right{border-left:1px solid var(--el-border-color)}.el-tabs--right.el-tabs--border-card .el-tabs__item.is-right{border:1px solid transparent;margin:-1px -1px -1px 0}.el-tabs--right.el-tabs--border-card .el-tabs__item.is-right.is-active{border-color:transparent;border-top-color:#d1dbe5;border-bottom-color:#d1dbe5}.el-tabs--top{flex-direction:column-reverse}.slideInRight-transition,.slideInLeft-transition{display:inline-block}.slideInRight-enter{animation:slideInRight-enter var(--el-transition-duration)}.slideInRight-leave{position:absolute;left:0;right:0;animation:slideInRight-leave var(--el-transition-duration)}.slideInLeft-enter{animation:slideInLeft-enter var(--el-transition-duration)}.slideInLeft-leave{position:absolute;left:0;right:0;animation:slideInLeft-leave var(--el-transition-duration)}@keyframes slideInRight-enter{0%{opacity:0;transform-origin:0 0;transform:translate(100%)}to{opacity:1;transform-origin:0 0;transform:translate(0)}}@keyframes slideInRight-leave{0%{transform-origin:0 0;transform:translate(0);opacity:1}to{transform-origin:0 0;transform:translate(100%);opacity:0}}@keyframes slideInLeft-enter{0%{opacity:0;transform-origin:0 0;transform:translate(-100%)}to{opacity:1;transform-origin:0 0;transform:translate(0)}}@keyframes slideInLeft-leave{0%{transform-origin:0 0;transform:translate(0);opacity:1}to{transform-origin:0 0;transform:translate(-100%);opacity:0}}.el-table{--el-table-border-color: var(--el-border-color-lighter);--el-table-border: 1px solid var(--el-table-border-color);--el-table-text-color: var(--el-text-color-regular);--el-table-header-text-color: var(--el-text-color-secondary);--el-table-row-hover-bg-color: var(--el-fill-color-light);--el-table-current-row-bg-color: var(--el-color-primary-light-9);--el-table-header-bg-color: var(--el-bg-color);--el-table-fixed-box-shadow: var(--el-box-shadow-light);--el-table-bg-color: var(--el-fill-color-blank);--el-table-tr-bg-color: var(--el-bg-color);--el-table-expanded-cell-bg-color: var(--el-fill-color-blank);--el-table-fixed-left-column: inset 10px 0 10px -10px rgba(0, 0, 0, .15);--el-table-fixed-right-column: inset -10px 0 10px -10px rgba(0, 0, 0, .15);--el-table-index: var(--el-index-normal);position:relative;overflow:hidden;box-sizing:border-box;height:fit-content;width:100%;max-width:100%;background-color:var(--el-table-bg-color);font-size:14px;color:var(--el-table-text-color)}.el-table__inner-wrapper{position:relative;display:flex;flex-direction:column;height:100%}.el-table__inner-wrapper:before{left:0;bottom:0;height:1px}.el-table tbody:focus-visible{outline:none}.el-table.has-footer.el-table--scrollable-y tr:last-child td.el-table__cell,.el-table.has-footer.el-table--fluid-height tr:last-child td.el-table__cell{border-bottom-color:transparent}.el-table__empty-block{position:sticky;left:0;min-height:60px;text-align:center;width:100%;display:flex;justify-content:center;align-items:center}.el-table__empty-text{line-height:60px;width:50%;color:var(--el-text-color-secondary)}.el-table__expand-column .cell{padding:0;text-align:center;-webkit-user-select:none;user-select:none}.el-table__expand-icon{position:relative;cursor:pointer;color:var(--el-text-color-regular);font-size:12px;transition:transform var(--el-transition-duration-fast) ease-in-out;height:20px}.el-table__expand-icon--expanded{transform:rotate(90deg)}.el-table__expand-icon>.el-icon{font-size:12px}.el-table__expanded-cell{background-color:var(--el-table-expanded-cell-bg-color)}.el-table__expanded-cell[class*=cell]{padding:20px 50px}.el-table__expanded-cell:hover{background-color:transparent!important}.el-table__placeholder{display:inline-block;width:20px}.el-table__append-wrapper{overflow:hidden}.el-table--fit{border-right:0;border-bottom:0}.el-table--fit .el-table__cell.gutter{border-right-width:1px}.el-table--fit .el-table__inner-wrapper:before{width:100%}.el-table thead{color:var(--el-table-header-text-color)}.el-table thead th{font-weight:600}.el-table thead.is-group th.el-table__cell{background:var(--el-fill-color-light)}.el-table .el-table__cell{padding:8px 0;min-width:0;box-sizing:border-box;text-overflow:ellipsis;vertical-align:middle;position:relative;text-align:left;z-index:var(--el-table-index)}.el-table .el-table__cell.is-center{text-align:center}.el-table .el-table__cell.is-right{text-align:right}.el-table .el-table__cell.gutter{width:15px;border-right-width:0;border-bottom-width:0;padding:0}.el-table .el-table__cell.is-hidden>*{visibility:hidden}.el-table .cell{box-sizing:border-box;overflow:hidden;text-overflow:ellipsis;white-space:normal;overflow-wrap:break-word;line-height:23px;padding:0 12px}.el-table .cell.el-tooltip{white-space:nowrap;min-width:50px}.el-table--large{font-size:var(--el-font-size-base)}.el-table--large .el-table__cell{padding:12px 0}.el-table--large .cell{padding:0 16px}.el-table--default{font-size:14px}.el-table--default .el-table__cell{padding:8px 0}.el-table--default .cell{padding:0 12px}.el-table--small{font-size:12px}.el-table--small .el-table__cell{padding:4px 0}.el-table--small .cell{padding:0 8px}.el-table tr{background-color:var(--el-table-tr-bg-color)}.el-table tr input[type=checkbox]{margin:0}.el-table th.el-table__cell.is-leaf,.el-table td.el-table__cell{border-bottom:var(--el-table-border)}.el-table th.el-table__cell.is-sortable{cursor:pointer}.el-table th.el-table__cell{background-color:var(--el-table-header-bg-color)}.el-table th.el-table__cell>.cell.highlight{color:var(--el-color-primary)}.el-table th.el-table__cell.required>div:before{display:inline-block;content:"";width:8px;height:8px;border-radius:50%;background:#ff4d51;margin-right:5px;vertical-align:middle}.el-table td.el-table__cell div{box-sizing:border-box}.el-table td.el-table__cell.gutter{width:0}.el-table--border:after,.el-table--border:before,.el-table--border .el-table__inner-wrapper:after,.el-table__inner-wrapper:before{content:"";position:absolute;background-color:var(--el-table-border-color);z-index:calc(var(--el-table-index) + 2)}.el-table--border .el-table__inner-wrapper:after{left:0;top:0;width:100%;height:1px;z-index:calc(var(--el-table-index) + 2)}.el-table--border:before{top:-1px;left:0;width:1px;height:100%}.el-table--border:after{top:-1px;right:0;width:1px;height:100%}.el-table--border .el-table__inner-wrapper{border-right:none;border-bottom:none}.el-table--border .el-table__footer-wrapper{position:relative;flex-shrink:0}.el-table--border .el-table__cell{border-right:var(--el-table-border)}.el-table--border th.el-table__cell.gutter:last-of-type{border-bottom:var(--el-table-border);border-bottom-width:1px}.el-table--border th.el-table__cell{border-bottom:var(--el-table-border)}.el-table--hidden{visibility:hidden}.el-table__header-wrapper,.el-table__body-wrapper,.el-table__footer-wrapper{width:100%}.el-table__header-wrapper tr td.el-table-fixed-column--left,.el-table__header-wrapper tr td.el-table-fixed-column--right,.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right,.el-table__body-wrapper tr td.el-table-fixed-column--left,.el-table__body-wrapper tr td.el-table-fixed-column--right,.el-table__body-wrapper tr th.el-table-fixed-column--left,.el-table__body-wrapper tr th.el-table-fixed-column--right,.el-table__footer-wrapper tr td.el-table-fixed-column--left,.el-table__footer-wrapper tr td.el-table-fixed-column--right,.el-table__footer-wrapper tr th.el-table-fixed-column--left,.el-table__footer-wrapper tr th.el-table-fixed-column--right{position:sticky!important;background:inherit;z-index:calc(var(--el-table-index) + 1)}.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column:before{content:"";position:absolute;top:0;width:10px;bottom:-1px;overflow-x:hidden;overflow-y:hidden;box-shadow:none;touch-action:none;pointer-events:none}.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column:before{left:-10px}.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column:before{right:-10px;box-shadow:none}.el-table__header-wrapper tr td.el-table__fixed-right-patch,.el-table__header-wrapper tr th.el-table__fixed-right-patch,.el-table__body-wrapper tr td.el-table__fixed-right-patch,.el-table__body-wrapper tr th.el-table__fixed-right-patch,.el-table__footer-wrapper tr td.el-table__fixed-right-patch,.el-table__footer-wrapper tr th.el-table__fixed-right-patch{position:sticky!important;z-index:calc(var(--el-table-index) + 1);background:#fff;right:0}.el-table__header-wrapper{flex-shrink:0}.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table__header,.el-table__body,.el-table__footer{table-layout:fixed;border-collapse:separate}.el-table__header-wrapper{overflow:hidden}.el-table__header-wrapper tbody td.el-table__cell{background-color:var(--el-table-row-hover-bg-color);color:var(--el-table-text-color)}.el-table__footer-wrapper{overflow:hidden;flex-shrink:0}.el-table__footer-wrapper tfoot td.el-table__cell{background-color:var(--el-table-row-hover-bg-color);color:var(--el-table-text-color)}.el-table__header-wrapper .el-table-column--selection>.cell,.el-table__body-wrapper .el-table-column--selection>.cell{display:inline-flex;align-items:center;height:23px}.el-table__header-wrapper .el-table-column--selection .el-checkbox,.el-table__body-wrapper .el-table-column--selection .el-checkbox{height:unset}.el-table.is-scrolling-left .el-table-fixed-column--right.is-first-column:before{box-shadow:var(--el-table-fixed-right-column)}.el-table.is-scrolling-left.el-table--border .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:var(--el-table-border)}.el-table.is-scrolling-left th.el-table-fixed-column--left{background-color:var(--el-table-header-bg-color)}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column:before{box-shadow:var(--el-table-fixed-left-column)}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-right th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-middle .el-table-fixed-column--right.is-first-column:before{box-shadow:var(--el-table-fixed-right-column)}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column:before{box-shadow:var(--el-table-fixed-left-column)}.el-table.is-scrolling-none .el-table-fixed-column--left.is-first-column:before,.el-table.is-scrolling-none .el-table-fixed-column--left.is-last-column:before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-first-column:before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-last-column:before{box-shadow:none}.el-table.is-scrolling-none th.el-table-fixed-column--left,.el-table.is-scrolling-none th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table__body-wrapper{overflow:hidden;position:relative;flex:1}.el-table__body-wrapper .el-scrollbar__bar{z-index:calc(var(--el-table-index) + 2)}.el-table .caret-wrapper{display:inline-flex;flex-direction:column;align-items:center;height:14px;width:24px;vertical-align:middle;cursor:pointer;overflow:initial;position:relative}.el-table .sort-caret{width:0;height:0;border:solid 5px transparent;position:absolute;left:7px}.el-table .sort-caret.ascending{border-bottom-color:var(--el-text-color-placeholder);top:-5px}.el-table .sort-caret.descending{border-top-color:var(--el-text-color-placeholder);bottom:-3px}.el-table .ascending .sort-caret.ascending{border-bottom-color:var(--el-color-primary)}.el-table .descending .sort-caret.descending{border-top-color:var(--el-color-primary)}.el-table .hidden-columns{visibility:hidden;position:absolute;z-index:-1}.el-table--striped .el-table__body tr.el-table__row--striped td.el-table__cell{background:var(--el-fill-color-lighter)}.el-table--striped .el-table__body tr.el-table__row--striped.current-row td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table__body tr.hover-row>td.el-table__cell,.el-table__body tr.hover-row.current-row>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped.current-row>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table__body tr>td.hover-cell{background-color:var(--el-table-row-hover-bg-color)}.el-table__body tr.current-row>td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table.el-table--scrollable-y .el-table__body-header{position:sticky;top:0;z-index:calc(var(--el-table-index) + 2)}.el-table.el-table--scrollable-y .el-table__body-footer{position:sticky;bottom:0;z-index:calc(var(--el-table-index) + 2)}.el-table__column-resize-proxy{position:absolute;left:200px;top:0;bottom:0;width:0;border-left:var(--el-table-border);z-index:calc(var(--el-table-index) + 9)}.el-table__column-filter-trigger{display:inline-block;cursor:pointer}.el-table__column-filter-trigger i{color:var(--el-color-info);font-size:14px;vertical-align:middle}.el-table__border-left-patch{top:0;left:0;width:1px;height:100%;z-index:calc(var(--el-table-index) + 2);position:absolute;background-color:var(--el-table-border-color)}.el-table__border-bottom-patch{left:0;height:1px;z-index:calc(var(--el-table-index) + 2);position:absolute;background-color:var(--el-table-border-color)}.el-table__border-right-patch{top:0;height:100%;width:1px;z-index:calc(var(--el-table-index) + 2);position:absolute;background-color:var(--el-table-border-color)}.el-table--enable-row-transition .el-table__body td.el-table__cell{transition:background-color .25s ease}.el-table--enable-row-hover .el-table__body tr:hover>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table [class*=el-table__row--level] .el-table__expand-icon{display:inline-block;width:12px;line-height:12px;height:12px;text-align:center;margin-right:8px}.el-table .el-table.el-table--border .el-table__cell{border-right:var(--el-table-border)}.el-table:not(.el-table--border) .el-table__cell{border-right:none}.el-table:not(.el-table--border)>.el-table__inner-wrapper:after{content:none}.el-radio{--el-radio-font-size: var(--el-font-size-base);--el-radio-text-color: var(--el-text-color-regular);--el-radio-font-weight: var(--el-font-weight-primary);--el-radio-input-height: 14px;--el-radio-input-width: 14px;--el-radio-input-border-radius: var(--el-border-radius-circle);--el-radio-input-bg-color: var(--el-fill-color-blank);--el-radio-input-border: var(--el-border);--el-radio-input-border-color: var(--el-border-color);--el-radio-input-border-color-hover: var(--el-color-primary);color:var(--el-radio-text-color);font-weight:var(--el-radio-font-weight);position:relative;cursor:pointer;display:inline-flex;align-items:center;white-space:nowrap;outline:none;font-size:var(--el-font-size-base);-webkit-user-select:none;user-select:none;margin-right:30px;height:32px}.el-radio.el-radio--large{height:40px}.el-radio.el-radio--small{height:24px}.el-radio.is-bordered{padding:0 15px 0 9px;border-radius:var(--el-border-radius-base);border:var(--el-border);box-sizing:border-box}.el-radio.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-radio.is-bordered.is-disabled{cursor:not-allowed;border-color:var(--el-border-color-lighter)}.el-radio.is-bordered.el-radio--large{padding:0 19px 0 11px;border-radius:var(--el-border-radius-base)}.el-radio.is-bordered.el-radio--large .el-radio__label{font-size:var(--el-font-size-base)}.el-radio.is-bordered.el-radio--large .el-radio__inner{height:14px;width:14px}.el-radio.is-bordered.el-radio--small{padding:0 11px 0 7px;border-radius:var(--el-border-radius-base)}.el-radio.is-bordered.el-radio--small .el-radio__label{font-size:12px}.el-radio.is-bordered.el-radio--small .el-radio__inner{height:12px;width:12px}.el-radio:last-child{margin-right:0}.el-radio__input{white-space:nowrap;cursor:pointer;outline:none;display:inline-flex;position:relative;vertical-align:middle}.el-radio__input.is-disabled .el-radio__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);cursor:not-allowed}.el-radio__input.is-disabled .el-radio__inner:after{cursor:not-allowed;background-color:var(--el-disabled-bg-color)}.el-radio__input.is-disabled .el-radio__inner+.el-radio__label{cursor:not-allowed}.el-radio__input.is-disabled.is-checked .el-radio__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color)}.el-radio__input.is-disabled.is-checked .el-radio__inner:after{background-color:var(--el-text-color-placeholder)}.el-radio__input.is-disabled+span.el-radio__label{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-radio__input.is-checked .el-radio__inner{border-color:var(--el-color-primary);background:var(--el-color-primary)}.el-radio__input.is-checked .el-radio__inner:after{transform:translate(-50%,-50%) scale(1)}.el-radio__input.is-checked+.el-radio__label{color:var(--el-color-primary)}.el-radio__input.is-focus .el-radio__inner{border-color:var(--el-radio-input-border-color-hover)}.el-radio__inner{border:var(--el-radio-input-border);border-radius:var(--el-radio-input-border-radius);width:var(--el-radio-input-width);height:var(--el-radio-input-height);background-color:var(--el-radio-input-bg-color);position:relative;cursor:pointer;display:inline-block;box-sizing:border-box}.el-radio__inner:hover{border-color:var(--el-radio-input-border-color-hover)}.el-radio__inner:after{width:4px;height:4px;border-radius:var(--el-radio-input-border-radius);background-color:var(--el-color-white);content:"";position:absolute;left:50%;top:50%;transform:translate(-50%,-50%) scale(0);transition:transform .15s ease-in}.el-radio__original{opacity:0;outline:none;position:absolute;z-index:-1;top:0;left:0;right:0;bottom:0;margin:0}.el-radio__original:focus-visible+.el-radio__inner{outline:2px solid var(--el-radio-input-border-color-hover);outline-offset:1px;border-radius:var(--el-radio-input-border-radius)}.el-radio:focus:not(:focus-visible):not(.is-focus):not(:active):not(.is-disabled) .el-radio__inner{box-shadow:0 0 2px 2px var(--el-radio-input-border-color-hover)}.el-radio__label{font-size:var(--el-radio-font-size);padding-left:8px}.el-radio.el-radio--large .el-radio__label{font-size:14px}.el-radio.el-radio--large .el-radio__inner{width:14px;height:14px}.el-radio.el-radio--small .el-radio__label{font-size:12px}.el-radio.el-radio--small .el-radio__inner{width:12px;height:12px}.el-input-number{position:relative;display:inline-flex;width:150px;line-height:30px}.el-input-number .el-input__wrapper{padding-left:42px;padding-right:42px}.el-input-number .el-input__inner{-webkit-appearance:none;-moz-appearance:textfield;text-align:center;line-height:1}.el-input-number .el-input__inner::-webkit-inner-spin-button,.el-input-number .el-input__inner::-webkit-outer-spin-button{margin:0;-webkit-appearance:none}.el-input-number__increase,.el-input-number__decrease{display:flex;justify-content:center;align-items:center;height:auto;position:absolute;z-index:1;top:1px;bottom:1px;width:32px;background:var(--el-fill-color-light);color:var(--el-text-color-regular);cursor:pointer;font-size:13px;-webkit-user-select:none;user-select:none}.el-input-number__increase:hover,.el-input-number__decrease:hover{color:var(--el-color-primary)}.el-input-number__increase:hover~.el-input:not(.is-disabled) .el-input__wrapper,.el-input-number__decrease:hover~.el-input:not(.is-disabled) .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-border-color, var(--el-color-primary)) inset}.el-input-number__increase.is-disabled,.el-input-number__decrease.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-input-number__increase{right:1px;border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0;border-left:var(--el-border)}.el-input-number__decrease{left:1px;border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);border-right:var(--el-border)}.el-input-number.is-disabled .el-input-number__increase,.el-input-number.is-disabled .el-input-number__decrease{border-color:var(--el-disabled-border-color);color:var(--el-disabled-border-color)}.el-input-number.is-disabled .el-input-number__increase:hover,.el-input-number.is-disabled .el-input-number__decrease:hover{color:var(--el-disabled-border-color);cursor:not-allowed}.el-input-number--large{width:180px;line-height:38px}.el-input-number--large .el-input-number__increase,.el-input-number--large .el-input-number__decrease{width:40px;font-size:14px}.el-input-number--large .el-input--large .el-input__wrapper{padding-left:47px;padding-right:47px}.el-input-number--small{width:120px;line-height:22px}.el-input-number--small .el-input-number__increase,.el-input-number--small .el-input-number__decrease{width:24px;font-size:12px}.el-input-number--small .el-input--small .el-input__wrapper{padding-left:31px;padding-right:31px}.el-input-number--small .el-input-number__increase [class*=el-icon],.el-input-number--small .el-input-number__decrease [class*=el-icon]{transform:scale(.9)}.el-input-number.is-without-controls .el-input__wrapper{padding-left:15px;padding-right:15px}.el-input-number.is-controls-right .el-input__wrapper{padding-left:15px;padding-right:42px}.el-input-number.is-controls-right .el-input-number__increase,.el-input-number.is-controls-right .el-input-number__decrease{--el-input-number-controls-height: 15px;height:var(--el-input-number-controls-height);line-height:var(--el-input-number-controls-height)}.el-input-number.is-controls-right .el-input-number__increase [class*=el-icon],.el-input-number.is-controls-right .el-input-number__decrease [class*=el-icon]{transform:scale(.8)}.el-input-number.is-controls-right .el-input-number__increase{bottom:auto;left:auto;border-radius:0 var(--el-border-radius-base) 0 0;border-bottom:var(--el-border)}.el-input-number.is-controls-right .el-input-number__decrease{right:1px;top:auto;left:auto;border-right:none;border-left:var(--el-border);border-radius:0 0 var(--el-border-radius-base) 0}.el-input-number.is-controls-right[class*=large] [class*=increase],.el-input-number.is-controls-right[class*=large] [class*=decrease]{--el-input-number-controls-height: 19px}.el-input-number.is-controls-right[class*=small] [class*=increase],.el-input-number.is-controls-right[class*=small] [class*=decrease]{--el-input-number-controls-height: 11px}.el-table-column--selection .cell{padding-left:14px;padding-right:14px}.el-table-filter{border:solid 1px var(--el-border-color-lighter);border-radius:2px;background-color:#fff;box-shadow:var(--el-box-shadow-light);box-sizing:border-box}.el-table-filter__list{padding:5px 0;margin:0;list-style:none;min-width:100px}.el-table-filter__list-item{line-height:36px;padding:0 10px;cursor:pointer;font-size:var(--el-font-size-base)}.el-table-filter__list-item:hover{background-color:var(--el-color-primary-light-9);color:var(--el-color-primary)}.el-table-filter__list-item.is-active{background-color:var(--el-color-primary);color:#fff}.el-table-filter__content{min-width:100px}.el-table-filter__bottom{border-top:1px solid var(--el-border-color-lighter);padding:8px}.el-table-filter__bottom button{background:transparent;border:none;color:var(--el-text-color-regular);cursor:pointer;font-size:var(--el-font-size-small);padding:0 3px}.el-table-filter__bottom button:hover{color:var(--el-color-primary)}.el-table-filter__bottom button:focus{outline:none}.el-table-filter__bottom button.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-table-filter__wrap{max-height:280px}.el-table-filter__checkbox-group{padding:10px}.el-table-filter__checkbox-group label.el-checkbox{display:flex;align-items:center;margin-right:5px;margin-bottom:12px;margin-left:5px;height:unset}.el-table-filter__checkbox-group .el-checkbox:last-child{margin-bottom:0}.el-tag{--el-tag-font-size: 12px;--el-tag-border-radius: 4px;--el-tag-border-radius-rounded: 9999px;background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);color:var(--el-tag-text-color);display:inline-flex;justify-content:center;align-items:center;vertical-align:middle;height:24px;padding:0 9px;font-size:var(--el-tag-font-size);line-height:1;border-width:1px;border-style:solid;border-radius:var(--el-tag-border-radius);box-sizing:border-box;white-space:nowrap;--el-icon-size: 14px;--el-tag-bg-color: var(--el-color-primary-light-9);--el-tag-border-color: var(--el-color-primary-light-8);--el-tag-hover-color: var(--el-color-primary)}.el-tag.el-tag--primary{--el-tag-bg-color: var(--el-color-primary-light-9);--el-tag-border-color: var(--el-color-primary-light-8);--el-tag-hover-color: var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-bg-color: var(--el-color-success-light-9);--el-tag-border-color: var(--el-color-success-light-8);--el-tag-hover-color: var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-bg-color: var(--el-color-warning-light-9);--el-tag-border-color: var(--el-color-warning-light-8);--el-tag-hover-color: var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-bg-color: var(--el-color-danger-light-9);--el-tag-border-color: var(--el-color-danger-light-8);--el-tag-hover-color: var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-bg-color: var(--el-color-error-light-9);--el-tag-border-color: var(--el-color-error-light-8);--el-tag-hover-color: var(--el-color-error)}.el-tag.el-tag--info{--el-tag-bg-color: var(--el-color-info-light-9);--el-tag-border-color: var(--el-color-info-light-8);--el-tag-hover-color: var(--el-color-info)}.el-tag.is-hit{border-color:var(--el-color-primary)}.el-tag.is-round{border-radius:var(--el-tag-border-radius-rounded)}.el-tag .el-tag__close{flex-shrink:0;color:var(--el-tag-text-color)}.el-tag .el-tag__close:hover{color:var(--el-color-white);background-color:var(--el-tag-hover-color)}.el-tag.el-tag--primary{--el-tag-text-color: var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-text-color: var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-text-color: var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-text-color: var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-text-color: var(--el-color-error)}.el-tag.el-tag--info{--el-tag-text-color: var(--el-color-info)}.el-tag .el-icon{border-radius:50%;cursor:pointer;font-size:calc(var(--el-icon-size) - 2px);height:var(--el-icon-size);width:var(--el-icon-size)}.el-tag .el-tag__close{margin-left:6px}.el-tag--dark{--el-tag-text-color: var(--el-color-white);--el-tag-bg-color: var(--el-color-primary);--el-tag-border-color: var(--el-color-primary);--el-tag-hover-color: var(--el-color-primary-light-3)}.el-tag--dark.el-tag--primary{--el-tag-bg-color: var(--el-color-primary);--el-tag-border-color: var(--el-color-primary);--el-tag-hover-color: var(--el-color-primary-light-3)}.el-tag--dark.el-tag--success{--el-tag-bg-color: var(--el-color-success);--el-tag-border-color: var(--el-color-success);--el-tag-hover-color: var(--el-color-success-light-3)}.el-tag--dark.el-tag--warning{--el-tag-bg-color: var(--el-color-warning);--el-tag-border-color: var(--el-color-warning);--el-tag-hover-color: var(--el-color-warning-light-3)}.el-tag--dark.el-tag--danger{--el-tag-bg-color: var(--el-color-danger);--el-tag-border-color: var(--el-color-danger);--el-tag-hover-color: var(--el-color-danger-light-3)}.el-tag--dark.el-tag--error{--el-tag-bg-color: var(--el-color-error);--el-tag-border-color: var(--el-color-error);--el-tag-hover-color: var(--el-color-error-light-3)}.el-tag--dark.el-tag--info{--el-tag-bg-color: var(--el-color-info);--el-tag-border-color: var(--el-color-info);--el-tag-hover-color: var(--el-color-info-light-3)}.el-tag--dark.el-tag--primary,.el-tag--dark.el-tag--success,.el-tag--dark.el-tag--warning,.el-tag--dark.el-tag--danger,.el-tag--dark.el-tag--error,.el-tag--dark.el-tag--info{--el-tag-text-color: var(--el-color-white)}.el-tag--plain,.el-tag--plain.el-tag--primary{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-primary-light-5);--el-tag-hover-color: var(--el-color-primary)}.el-tag--plain.el-tag--success{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-success-light-5);--el-tag-hover-color: var(--el-color-success)}.el-tag--plain.el-tag--warning{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-warning-light-5);--el-tag-hover-color: var(--el-color-warning)}.el-tag--plain.el-tag--danger{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-danger-light-5);--el-tag-hover-color: var(--el-color-danger)}.el-tag--plain.el-tag--error{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-error-light-5);--el-tag-hover-color: var(--el-color-error)}.el-tag--plain.el-tag--info{--el-tag-bg-color: var(--el-fill-color-blank);--el-tag-border-color: var(--el-color-info-light-5);--el-tag-hover-color: var(--el-color-info)}.el-tag.is-closable{padding-right:5px}.el-tag--large{padding:0 11px;height:32px;--el-icon-size: 16px}.el-tag--large .el-tag__close{margin-left:8px}.el-tag--large.is-closable{padding-right:7px}.el-tag--small{padding:0 7px;height:20px;--el-icon-size: 12px}.el-tag--small .el-tag__close{margin-left:4px}.el-tag--small.is-closable{padding-right:3px}.el-tag--small .el-icon-close{transform:scale(.8)}.el-tag.el-tag--primary.is-hit{border-color:var(--el-color-primary)}.el-tag.el-tag--success.is-hit{border-color:var(--el-color-success)}.el-tag.el-tag--warning.is-hit{border-color:var(--el-color-warning)}.el-tag.el-tag--danger.is-hit{border-color:var(--el-color-danger)}.el-tag.el-tag--error.is-hit{border-color:var(--el-color-error)}.el-tag.el-tag--info.is-hit{border-color:var(--el-color-info)}.el-message{z-index:99999!important}.danmu-btn-modifier{position:absolute;text-align:center;line-height:27px;margin:265px auto 0 14px;height:25px;width:204px;color:#fff;cursor:pointer;border-radius:15px;background:#ec6839}.danmu-btn-modifier:hover{background:#ef843d}[class*=danmudiv]{height:300px!important;background-color:#fff!important;background-image:none!important;border:1px solid #d7d7d7!important;border-radius:5px!important} '); (function (vue, ue, ce, vueDemi, pinia) { 'use strict'; var __defProp = Object.defineProperty; var __getOwnPropNames = Object.getOwnPropertyNames; var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value; var __commonJS = (cb, mod) => function __require() { return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports; }; var __publicField = (obj, key, value) => __defNormalProp(obj, typeof key !== "symbol" ? key + "" : key, value); var require_main_001 = __commonJS({ "main-DGil-vTG.js"(exports, module) { class Ee { constructor() { __publicField(this, "isTimeEnd", false); __publicField(this, "timeLimit", 10 * 1e3); __publicField(this, "pageEndSelectors", [".ActiviesExpanel-ExpandBtn", ".DyImg-content > img"]); } observe() { setTimeout(() => { this.isTimeEnd = true; }, this.timeLimit); return new Promise((e2) => { new MutationObserver((t2, n2) => { const o2 = this.pageEndSelectors.find((e3) => !document.querySelector(e3)); if (!o2 || this.isTimeEnd) { n2.disconnect(); e2(); } }).observe(document, { childList: true, subtree: true }); }); } } const _e = (e2, t2, { checkForDefaultPrevented: n2 = true } = {}) => { const o2 = (o3) => { const a2 = e2 == null ? void 0 : e2(o3); if (n2 === false || !a2) { return t2 == null ? void 0 : t2(o3); } }; return o2; }; var Oe = Object.defineProperty; var Me = Object.defineProperties; var Le = Object.getOwnPropertyDescriptors; var De = Object.getOwnPropertySymbols; var Ae = Object.prototype.hasOwnProperty; var Re = Object.prototype.propertyIsEnumerable; var $e = (e2, t2, n2) => t2 in e2 ? Oe(e2, t2, { enumerable: true, configurable: true, writable: true, value: n2 }) : e2[t2] = n2; var Te = (e2, t2) => { for (var n2 in t2 || (t2 = {})) if (Ae.call(t2, n2)) $e(e2, n2, t2[n2]); if (De) for (var n2 of De(t2)) { if (Re.call(t2, n2)) $e(e2, n2, t2[n2]); } return e2; }; var Pe = (e2, t2) => Me(e2, Le(t2)); function Ne(e2, t2) { var n2; const o2 = vueDemi.shallowRef(); vueDemi.watchEffect(() => { o2.value = e2(); }, Pe(Te({}, t2), { flush: (n2 = void 0) != null ? n2 : "sync" })); return vueDemi.readonly(o2); } var Ie; const Be = typeof window !== "undefined"; const Ve = (e2) => typeof e2 === "string"; const Fe = () => { }; const je = Be && ((Ie = window == null ? void 0 : window.navigator) == null ? void 0 : Ie.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent); function ze(e2) { return typeof e2 === "function" ? e2() : vueDemi.unref(e2); } function He(e2) { return e2; } function We(e2) { if (vueDemi.getCurrentScope()) { vueDemi.onScopeDispose(e2); return true; } return false; } function Ye(e2, t2 = true) { if (vueDemi.getCurrentInstance()) vueDemi.onMounted(e2); else if (t2) e2(); else vueDemi.nextTick(e2); } function Ue(e2, t2, n2 = {}) { const { immediate: o2 = true } = n2; const a2 = vueDemi.ref(false); let r2 = null; function l2() { if (r2) { clearTimeout(r2); r2 = null; } } function s2() { a2.value = false; l2(); } function i2(...n3) { l2(); a2.value = true; r2 = setTimeout(() => { a2.value = false; r2 = null; e2(...n3); }, ze(t2)); } if (o2) { a2.value = true; if (Be) i2(); } We(s2); return { isPending: vueDemi.readonly(a2), start: i2, stop: s2 }; } function Ke(e2) { var t2; const n2 = ze(e2); return (t2 = n2 == null ? void 0 : n2.$el) != null ? t2 : n2; } const qe = Be ? window : void 0; const Ge = Be ? window.document : void 0; function Xe(...e2) { let t2; let n2; let o2; let a2; if (Ve(e2[0]) || Array.isArray(e2[0])) { [n2, o2, a2] = e2; t2 = qe; } else { [t2, n2, o2, a2] = e2; } if (!t2) return Fe; if (!Array.isArray(n2)) n2 = [n2]; if (!Array.isArray(o2)) o2 = [o2]; const r2 = []; const l2 = () => { r2.forEach((e3) => e3()); r2.length = 0; }; const s2 = (e3, t3, n3, o3) => { e3.addEventListener(t3, n3, o3); return () => e3.removeEventListener(t3, n3, o3); }; const i2 = vueDemi.watch(() => [Ke(t2), ze(a2)], ([e3, t3]) => { l2(); if (!e3) return; r2.push(...n2.flatMap((n3) => o2.map((o3) => s2(e3, n3, o3, t3)))); }, { immediate: true, flush: "post" }); const u2 = () => { i2(); l2(); }; We(u2); return u2; } let Ze = false; function Je(e2, t2, n2 = {}) { const { window: o2 = qe, ignore: a2 = [], capture: r2 = true, detectIframe: l2 = false } = n2; if (!o2) return; if (je && !Ze) { Ze = true; Array.from(o2.document.body.children).forEach((e3) => e3.addEventListener("click", Fe)); } let s2 = true; const i2 = (e3) => a2.some((t3) => { if (typeof t3 === "string") { return Array.from(o2.document.querySelectorAll(t3)).some((t4) => t4 === e3.target || e3.composedPath().includes(t4)); } else { const n3 = Ke(t3); return n3 && (e3.target === n3 || e3.composedPath().includes(n3)); } }); const u2 = (n3) => { const o3 = Ke(e2); if (!o3 || o3 === n3.target || n3.composedPath().includes(o3)) return; if (n3.detail === 0) s2 = !i2(n3); if (!s2) { s2 = true; return; } t2(n3); }; const c2 = [Xe(o2, "click", u2, { passive: true, capture: r2 }), Xe(o2, "pointerdown", (t3) => { const n3 = Ke(e2); if (n3) s2 = !t3.composedPath().includes(n3) && !i2(t3); }, { passive: true }), l2 && Xe(o2, "blur", (n3) => { var a3; const r3 = Ke(e2); if (((a3 = o2.document.activeElement) == null ? void 0 : a3.tagName) === "IFRAME" && !(r3 == null ? void 0 : r3.contains(o2.document.activeElement))) t2(n3); })].filter(Boolean); const d2 = () => c2.forEach((e3) => e3()); return d2; } function Qe(e2, t2 = false) { const n2 = vueDemi.ref(); const o2 = () => n2.value = Boolean(e2()); o2(); Ye(o2, t2); return n2; } const et = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {}; const tt = "__vueuse_ssr_handlers__"; et[tt] = et[tt] || {}; function nt({ document: e2 = Ge } = {}) { if (!e2) return vueDemi.ref("visible"); const t2 = vueDemi.ref(e2.visibilityState); Xe(e2, "visibilitychange", () => { t2.value = e2.visibilityState; }); return t2; } var ot = Object.getOwnPropertySymbols; var at = Object.prototype.hasOwnProperty; var rt = Object.prototype.propertyIsEnumerable; var lt = (e2, t2) => { var n2 = {}; for (var o2 in e2) if (at.call(e2, o2) && t2.indexOf(o2) < 0) n2[o2] = e2[o2]; if (e2 != null && ot) for (var o2 of ot(e2)) { if (t2.indexOf(o2) < 0 && rt.call(e2, o2)) n2[o2] = e2[o2]; } return n2; }; function st(e2, t2, n2 = {}) { const o2 = n2, { window: a2 = qe } = o2, r2 = lt(o2, ["window"]); let l2; const s2 = Qe(() => a2 && "ResizeObserver" in a2); const i2 = () => { if (l2) { l2.disconnect(); l2 = void 0; } }; const u2 = vueDemi.watch(() => Ke(e2), (e3) => { i2(); if (s2.value && a2 && e3) { l2 = new ResizeObserver(t2); l2.observe(e3, r2); } }, { immediate: true, flush: "post" }); const c2 = () => { i2(); u2(); }; We(c2); return { isSupported: s2, stop: c2 }; } var it; (function(e2) { e2["UP"] = "UP"; e2["RIGHT"] = "RIGHT"; e2["DOWN"] = "DOWN"; e2["LEFT"] = "LEFT"; e2["NONE"] = "NONE"; })(it || (it = {})); var ut = Object.defineProperty; var ct = Object.getOwnPropertySymbols; var dt = Object.prototype.hasOwnProperty; var ft = Object.prototype.propertyIsEnumerable; var pt = (e2, t2, n2) => t2 in e2 ? ut(e2, t2, { enumerable: true, configurable: true, writable: true, value: n2 }) : e2[t2] = n2; var vt = (e2, t2) => { for (var n2 in t2 || (t2 = {})) if (dt.call(t2, n2)) pt(e2, n2, t2[n2]); if (ct) for (var n2 of ct(t2)) { if (ft.call(t2, n2)) pt(e2, n2, t2[n2]); } return e2; }; const mt = { easeInSine: [0.12, 0, 0.39, 0], easeOutSine: [0.61, 1, 0.88, 1], easeInOutSine: [0.37, 0, 0.63, 1], easeInQuad: [0.11, 0, 0.5, 0], easeOutQuad: [0.5, 1, 0.89, 1], easeInOutQuad: [0.45, 0, 0.55, 1], easeInCubic: [0.32, 0, 0.67, 0], easeOutCubic: [0.33, 1, 0.68, 1], easeInOutCubic: [0.65, 0, 0.35, 1], easeInQuart: [0.5, 0, 0.75, 0], easeOutQuart: [0.25, 1, 0.5, 1], easeInOutQuart: [0.76, 0, 0.24, 1], easeInQuint: [0.64, 0, 0.78, 0], easeOutQuint: [0.22, 1, 0.36, 1], easeInOutQuint: [0.83, 0, 0.17, 1], easeInExpo: [0.7, 0, 0.84, 0], easeOutExpo: [0.16, 1, 0.3, 1], easeInOutExpo: [0.87, 0, 0.13, 1], easeInCirc: [0.55, 0, 1, 0.45], easeOutCirc: [0, 0.55, 0.45, 1], easeInOutCirc: [0.85, 0, 0.15, 1], easeInBack: [0.36, 0, 0.66, -0.56], easeOutBack: [0.34, 1.56, 0.64, 1], easeInOutBack: [0.68, -0.6, 0.32, 1.6] }; vt({ linear: He }, mt); function ht({ window: e2 = qe } = {}) { if (!e2) return vueDemi.ref(false); const t2 = vueDemi.ref(e2.document.hasFocus()); Xe(e2, "blur", () => { t2.value = false; }); Xe(e2, "focus", () => { t2.value = true; }); return t2; } const gt = () => Be && /firefox/i.test(window.navigator.userAgent); const yt = () => { }; const bt = Object.prototype.hasOwnProperty; const wt = (e2, t2) => bt.call(e2, t2); const xt = Array.isArray; const kt = (e2) => Mt(e2) === "[object Date]"; const Ct = (e2) => typeof e2 === "function"; const St = (e2) => typeof e2 === "string"; const Et = (e2) => e2 !== null && typeof e2 === "object"; const _t = (e2) => (Et(e2) || Ct(e2)) && Ct(e2.then) && Ct(e2.catch); const Ot = Object.prototype.toString; const Mt = (e2) => Ot.call(e2); const Lt = (e2) => { const t2 = /* @__PURE__ */ Object.create(null); return (n2) => { const o2 = t2[n2]; return o2 || (t2[n2] = e2(n2)); }; }; const Dt = /-(\w)/g; const At = Lt((e2) => e2.replace(Dt, (e3, t2) => t2 ? t2.toUpperCase() : "")); const Rt = /\B([A-Z])/g; const $t = Lt((e2) => e2.replace(Rt, "-$1").toLowerCase()); const Tt = Lt((e2) => e2.charAt(0).toUpperCase() + e2.slice(1)); var Pt = typeof global == "object" && global && global.Object === Object && global; var Nt = typeof self == "object" && self && self.Object === Object && self; var It = Pt || Nt || Function("return this")(); var Bt = It.Symbol; var Vt = Object.prototype; var Ft = Vt.hasOwnProperty; var jt = Vt.toString; var zt = Bt ? Bt.toStringTag : void 0; function Ht(e2) { var t2 = Ft.call(e2, zt), n2 = e2[zt]; try { e2[zt] = void 0; var o2 = true; } catch (e3) { } var a2 = jt.call(e2); if (o2) { if (t2) { e2[zt] = n2; } else { delete e2[zt]; } } return a2; } var Wt = Object.prototype; var Yt = Wt.toString; function Ut(e2) { return Yt.call(e2); } var Kt = "[object Null]", qt = "[object Undefined]"; var Gt = Bt ? Bt.toStringTag : void 0; function Xt(e2) { if (e2 == null) { return e2 === void 0 ? qt : Kt; } return Gt && Gt in Object(e2) ? Ht(e2) : Ut(e2); } function Zt(e2) { return e2 != null && typeof e2 == "object"; } var Jt = "[object Symbol]"; function Qt(e2) { return typeof e2 == "symbol" || Zt(e2) && Xt(e2) == Jt; } function en(e2, t2) { var n2 = -1, o2 = e2 == null ? 0 : e2.length, a2 = Array(o2); while (++n2 < o2) { a2[n2] = t2(e2[n2], n2, e2); } return a2; } var tn = Array.isArray; var nn = 1 / 0; var on = Bt ? Bt.prototype : void 0, an = on ? on.toString : void 0; function rn(e2) { if (typeof e2 == "string") { return e2; } if (tn(e2)) { return en(e2, rn) + ""; } if (Qt(e2)) { return an ? an.call(e2) : ""; } var t2 = e2 + ""; return t2 == "0" && 1 / e2 == -nn ? "-0" : t2; } var ln = /\s/; function sn(e2) { var t2 = e2.length; while (t2-- && ln.test(e2.charAt(t2))) { } return t2; } var un = /^\s+/; function cn(e2) { return e2 ? e2.slice(0, sn(e2) + 1).replace(un, "") : e2; } function dn(e2) { var t2 = typeof e2; return e2 != null && (t2 == "object" || t2 == "function"); } var fn = 0 / 0; var pn = /^[-+]0x[0-9a-f]+$/i; var vn = /^0b[01]+$/i; var mn = /^0o[0-7]+$/i; var hn = parseInt; function gn(e2) { if (typeof e2 == "number") { return e2; } if (Qt(e2)) { return fn; } if (dn(e2)) { var t2 = typeof e2.valueOf == "function" ? e2.valueOf() : e2; e2 = dn(t2) ? t2 + "" : t2; } if (typeof e2 != "string") { return e2 === 0 ? e2 : +e2; } e2 = cn(e2); var n2 = vn.test(e2); return n2 || mn.test(e2) ? hn(e2.slice(2), n2 ? 2 : 8) : pn.test(e2) ? fn : +e2; } function yn(e2) { return e2; } var bn = "[object AsyncFunction]", wn = "[object Function]", xn = "[object GeneratorFunction]", kn = "[object Proxy]"; function Cn(e2) { if (!dn(e2)) { return false; } var t2 = Xt(e2); return t2 == wn || t2 == xn || t2 == bn || t2 == kn; } var Sn = It["__core-js_shared__"]; var En = function() { var e2 = /[^.]+$/.exec(Sn && Sn.keys && Sn.keys.IE_PROTO || ""); return e2 ? "Symbol(src)_1." + e2 : ""; }(); function _n(e2) { return !!En && En in e2; } var On = Function.prototype; var Mn = On.toString; function Ln(e2) { if (e2 != null) { try { return Mn.call(e2); } catch (e3) { } try { return e2 + ""; } catch (e3) { } } return ""; } var Dn = /[\\^$.*+?()[\]{}|]/g; var An = /^\[object .+?Constructor\]$/; var Rn = Function.prototype, $n = Object.prototype; var Tn = Rn.toString; var Pn = $n.hasOwnProperty; var Nn = RegExp("^" + Tn.call(Pn).replace(Dn, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$"); function In(e2) { if (!dn(e2) || _n(e2)) { return false; } var t2 = Cn(e2) ? Nn : An; return t2.test(Ln(e2)); } function Bn(e2, t2) { return e2 == null ? void 0 : e2[t2]; } function Vn(e2, t2) { var n2 = Bn(e2, t2); return In(n2) ? n2 : void 0; } var Fn = Vn(It, "WeakMap"); var jn = Object.create; var zn = /* @__PURE__ */ function() { function e2() { } return function(t2) { if (!dn(t2)) { return {}; } if (jn) { return jn(t2); } e2.prototype = t2; var n2 = new e2(); e2.prototype = void 0; return n2; }; }(); function Hn(e2, t2, n2) { switch (n2.length) { case 0: return e2.call(t2); case 1: return e2.call(t2, n2[0]); case 2: return e2.call(t2, n2[0], n2[1]); case 3: return e2.call(t2, n2[0], n2[1], n2[2]); } return e2.apply(t2, n2); } function Wn(e2, t2) { var n2 = -1, o2 = e2.length; t2 || (t2 = Array(o2)); while (++n2 < o2) { t2[n2] = e2[n2]; } return t2; } var Yn = 800, Un = 16; var Kn = Date.now; function qn(e2) { var t2 = 0, n2 = 0; return function() { var o2 = Kn(), a2 = Un - (o2 - n2); n2 = o2; if (a2 > 0) { if (++t2 >= Yn) { return arguments[0]; } } else { t2 = 0; } return e2.apply(void 0, arguments); }; } function Gn(e2) { return function() { return e2; }; } var Xn = function() { try { var e2 = Vn(Object, "defineProperty"); e2({}, "", {}); return e2; } catch (e3) { } }(); var Zn = !Xn ? yn : function(e2, t2) { return Xn(e2, "toString", { configurable: true, enumerable: false, value: Gn(t2), writable: true }); }; var Jn = qn(Zn); var Qn = 9007199254740991; var eo = /^(?:0|[1-9]\d*)$/; function to(e2, t2) { var n2 = typeof e2; t2 = t2 == null ? Qn : t2; return !!t2 && (n2 == "number" || n2 != "symbol" && eo.test(e2)) && (e2 > -1 && e2 % 1 == 0 && e2 < t2); } function no(e2, t2, n2) { if (t2 == "__proto__" && Xn) { Xn(e2, t2, { configurable: true, enumerable: true, value: n2, writable: true }); } else { e2[t2] = n2; } } function oo(e2, t2) { return e2 === t2 || e2 !== e2 && t2 !== t2; } var ao = Object.prototype; var ro = ao.hasOwnProperty; function lo(e2, t2, n2) { var o2 = e2[t2]; if (!(ro.call(e2, t2) && oo(o2, n2)) || n2 === void 0 && !(t2 in e2)) { no(e2, t2, n2); } } function so(e2, t2, n2, o2) { var a2 = !n2; n2 || (n2 = {}); var r2 = -1, l2 = t2.length; while (++r2 < l2) { var s2 = t2[r2]; var i2 = void 0; if (i2 === void 0) { i2 = e2[s2]; } if (a2) { no(n2, s2, i2); } else { lo(n2, s2, i2); } } return n2; } var io = Math.max; function uo(e2, t2, n2) { t2 = io(t2 === void 0 ? e2.length - 1 : t2, 0); return function() { var o2 = arguments, a2 = -1, r2 = io(o2.length - t2, 0), l2 = Array(r2); while (++a2 < r2) { l2[a2] = o2[t2 + a2]; } a2 = -1; var s2 = Array(t2 + 1); while (++a2 < t2) { s2[a2] = o2[a2]; } s2[t2] = n2(l2); return Hn(e2, this, s2); }; } function co(e2, t2) { return Jn(uo(e2, t2, yn), e2 + ""); } var fo = 9007199254740991; function po(e2) { return typeof e2 == "number" && e2 > -1 && e2 % 1 == 0 && e2 <= fo; } function vo(e2) { return e2 != null && po(e2.length) && !Cn(e2); } function mo(e2, t2, n2) { if (!dn(n2)) { return false; } var o2 = typeof t2; if (o2 == "number" ? vo(n2) && to(t2, n2.length) : o2 == "string" && t2 in n2) { return oo(n2[t2], e2); } return false; } function ho(e2) { return co(function(t2, n2) { var o2 = -1, a2 = n2.length, r2 = a2 > 1 ? n2[a2 - 1] : void 0, l2 = a2 > 2 ? n2[2] : void 0; r2 = e2.length > 3 && typeof r2 == "function" ? (a2--, r2) : void 0; if (l2 && mo(n2[0], n2[1], l2)) { r2 = a2 < 3 ? void 0 : r2; a2 = 1; } t2 = Object(t2); while (++o2 < a2) { var s2 = n2[o2]; if (s2) { e2(t2, s2, o2, r2); } } return t2; }); } var go = Object.prototype; function yo(e2) { var t2 = e2 && e2.constructor, n2 = typeof t2 == "function" && t2.prototype || go; return e2 === n2; } function bo(e2, t2) { var n2 = -1, o2 = Array(e2); while (++n2 < e2) { o2[n2] = t2(n2); } return o2; } var wo = "[object Arguments]"; function xo(e2) { return Zt(e2) && Xt(e2) == wo; } var ko = Object.prototype; var Co = ko.hasOwnProperty; var So = ko.propertyIsEnumerable; var Eo = xo(/* @__PURE__ */ function() { return arguments; }()) ? xo : function(e2) { return Zt(e2) && Co.call(e2, "callee") && !So.call(e2, "callee"); }; function _o() { return false; } var Oo = typeof exports == "object" && exports && !exports.nodeType && exports; var Mo = Oo && typeof module == "object" && module && !module.nodeType && module; var Lo = Mo && Mo.exports === Oo; var Do = Lo ? It.Buffer : void 0; var Ao = Do ? Do.isBuffer : void 0; var Ro = Ao || _o; var $o = "[object Arguments]", To = "[object Array]", Po = "[object Boolean]", No = "[object Date]", Io = "[object Error]", Bo = "[object Function]", Vo = "[object Map]", Fo = "[object Number]", jo = "[object Object]", zo = "[object RegExp]", Ho = "[object Set]", Wo = "[object String]", Yo = "[object WeakMap]"; var Uo = "[object ArrayBuffer]", Ko = "[object DataView]", qo = "[object Float32Array]", Go = "[object Float64Array]", Xo = "[object Int8Array]", Zo = "[object Int16Array]", Jo = "[object Int32Array]", Qo = "[object Uint8Array]", ea = "[object Uint8ClampedArray]", ta = "[object Uint16Array]", na = "[object Uint32Array]"; var oa = {}; oa[qo] = oa[Go] = oa[Xo] = oa[Zo] = oa[Jo] = oa[Qo] = oa[ea] = oa[ta] = oa[na] = true; oa[$o] = oa[To] = oa[Uo] = oa[Po] = oa[Ko] = oa[No] = oa[Io] = oa[Bo] = oa[Vo] = oa[Fo] = oa[jo] = oa[zo] = oa[Ho] = oa[Wo] = oa[Yo] = false; function aa(e2) { return Zt(e2) && po(e2.length) && !!oa[Xt(e2)]; } function ra(e2) { return function(t2) { return e2(t2); }; } var la = typeof exports == "object" && exports && !exports.nodeType && exports; var sa = la && typeof module == "object" && module && !module.nodeType && module; var ia = sa && sa.exports === la; var ua = ia && Pt.process; var ca = function() { try { var e2 = sa && sa.require && sa.require("util").types; if (e2) { return e2; } return ua && ua.binding && ua.binding("util"); } catch (e3) { } }(); var da = ca && ca.isTypedArray; var fa = da ? ra(da) : aa; var pa = Object.prototype; var va = pa.hasOwnProperty; function ma(e2, t2) { var n2 = tn(e2), o2 = !n2 && Eo(e2), a2 = !n2 && !o2 && Ro(e2), r2 = !n2 && !o2 && !a2 && fa(e2), l2 = n2 || o2 || a2 || r2, s2 = l2 ? bo(e2.length, String) : [], i2 = s2.length; for (var u2 in e2) { if ((t2 || va.call(e2, u2)) && !(l2 && (u2 == "length" || a2 && (u2 == "offset" || u2 == "parent") || r2 && (u2 == "buffer" || u2 == "byteLength" || u2 == "byteOffset") || to(u2, i2)))) { s2.push(u2); } } return s2; } function ha(e2, t2) { return function(n2) { return e2(t2(n2)); }; } var ga = ha(Object.keys, Object); var ya = Object.prototype; var ba = ya.hasOwnProperty; function wa(e2) { if (!yo(e2)) { return ga(e2); } var t2 = []; for (var n2 in Object(e2)) { if (ba.call(e2, n2) && n2 != "constructor") { t2.push(n2); } } return t2; } function xa(e2) { return vo(e2) ? ma(e2) : wa(e2); } function ka(e2) { var t2 = []; if (e2 != null) { for (var n2 in Object(e2)) { t2.push(n2); } } return t2; } var Ca = Object.prototype; var Sa = Ca.hasOwnProperty; function Ea(e2) { if (!dn(e2)) { return ka(e2); } var t2 = yo(e2), n2 = []; for (var o2 in e2) { if (!(o2 == "constructor" && (t2 || !Sa.call(e2, o2)))) { n2.push(o2); } } return n2; } function _a(e2) { return vo(e2) ? ma(e2, true) : Ea(e2); } var Oa = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, Ma = /^\w*$/; function La(e2, t2) { if (tn(e2)) { return false; } var n2 = typeof e2; if (n2 == "number" || n2 == "symbol" || n2 == "boolean" || e2 == null || Qt(e2)) { return true; } return Ma.test(e2) || !Oa.test(e2) || t2 != null && e2 in Object(t2); } var Da = Vn(Object, "create"); function Aa() { this.__data__ = Da ? Da(null) : {}; this.size = 0; } function Ra(e2) { var t2 = this.has(e2) && delete this.__data__[e2]; this.size -= t2 ? 1 : 0; return t2; } var $a = "__lodash_hash_undefined__"; var Ta = Object.prototype; var Pa = Ta.hasOwnProperty; function Na(e2) { var t2 = this.__data__; if (Da) { var n2 = t2[e2]; return n2 === $a ? void 0 : n2; } return Pa.call(t2, e2) ? t2[e2] : void 0; } var Ia = Object.prototype; var Ba = Ia.hasOwnProperty; function Va(e2) { var t2 = this.__data__; return Da ? t2[e2] !== void 0 : Ba.call(t2, e2); } var Fa = "__lodash_hash_undefined__"; function ja(e2, t2) { var n2 = this.__data__; this.size += this.has(e2) ? 0 : 1; n2[e2] = Da && t2 === void 0 ? Fa : t2; return this; } function za(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length; this.clear(); while (++t2 < n2) { var o2 = e2[t2]; this.set(o2[0], o2[1]); } } za.prototype.clear = Aa; za.prototype["delete"] = Ra; za.prototype.get = Na; za.prototype.has = Va; za.prototype.set = ja; function Ha() { this.__data__ = []; this.size = 0; } function Wa(e2, t2) { var n2 = e2.length; while (n2--) { if (oo(e2[n2][0], t2)) { return n2; } } return -1; } var Ya = Array.prototype; var Ua = Ya.splice; function Ka(e2) { var t2 = this.__data__, n2 = Wa(t2, e2); if (n2 < 0) { return false; } var o2 = t2.length - 1; if (n2 == o2) { t2.pop(); } else { Ua.call(t2, n2, 1); } --this.size; return true; } function qa(e2) { var t2 = this.__data__, n2 = Wa(t2, e2); return n2 < 0 ? void 0 : t2[n2][1]; } function Ga(e2) { return Wa(this.__data__, e2) > -1; } function Xa(e2, t2) { var n2 = this.__data__, o2 = Wa(n2, e2); if (o2 < 0) { ++this.size; n2.push([e2, t2]); } else { n2[o2][1] = t2; } return this; } function Za(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length; this.clear(); while (++t2 < n2) { var o2 = e2[t2]; this.set(o2[0], o2[1]); } } Za.prototype.clear = Ha; Za.prototype["delete"] = Ka; Za.prototype.get = qa; Za.prototype.has = Ga; Za.prototype.set = Xa; var Ja = Vn(It, "Map"); function Qa() { this.size = 0; this.__data__ = { hash: new za(), map: new (Ja || Za)(), string: new za() }; } function er(e2) { var t2 = typeof e2; return t2 == "string" || t2 == "number" || t2 == "symbol" || t2 == "boolean" ? e2 !== "__proto__" : e2 === null; } function tr(e2, t2) { var n2 = e2.__data__; return er(t2) ? n2[typeof t2 == "string" ? "string" : "hash"] : n2.map; } function nr(e2) { var t2 = tr(this, e2)["delete"](e2); this.size -= t2 ? 1 : 0; return t2; } function or(e2) { return tr(this, e2).get(e2); } function ar(e2) { return tr(this, e2).has(e2); } function rr(e2, t2) { var n2 = tr(this, e2), o2 = n2.size; n2.set(e2, t2); this.size += n2.size == o2 ? 0 : 1; return this; } function lr(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length; this.clear(); while (++t2 < n2) { var o2 = e2[t2]; this.set(o2[0], o2[1]); } } lr.prototype.clear = Qa; lr.prototype["delete"] = nr; lr.prototype.get = or; lr.prototype.has = ar; lr.prototype.set = rr; var sr = "Expected a function"; function ir(e2, t2) { if (typeof e2 != "function" || t2 != null && typeof t2 != "function") { throw new TypeError(sr); } var n2 = function() { var o2 = arguments, a2 = t2 ? t2.apply(this, o2) : o2[0], r2 = n2.cache; if (r2.has(a2)) { return r2.get(a2); } var l2 = e2.apply(this, o2); n2.cache = r2.set(a2, l2) || r2; return l2; }; n2.cache = new (ir.Cache || lr)(); return n2; } ir.Cache = lr; var ur = 500; function cr(e2) { var t2 = ir(e2, function(e3) { if (n2.size === ur) { n2.clear(); } return e3; }); var n2 = t2.cache; return t2; } var dr = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; var fr = /\\(\\)?/g; var pr = cr(function(e2) { var t2 = []; if (e2.charCodeAt(0) === 46) { t2.push(""); } e2.replace(dr, function(e3, n2, o2, a2) { t2.push(o2 ? a2.replace(fr, "$1") : n2 || e3); }); return t2; }); function vr(e2) { return e2 == null ? "" : rn(e2); } function mr(e2, t2) { if (tn(e2)) { return e2; } return La(e2, t2) ? [e2] : pr(vr(e2)); } var hr = 1 / 0; function gr(e2) { if (typeof e2 == "string" || Qt(e2)) { return e2; } var t2 = e2 + ""; return t2 == "0" && 1 / e2 == -hr ? "-0" : t2; } function yr(e2, t2) { t2 = mr(t2, e2); var n2 = 0, o2 = t2.length; while (e2 != null && n2 < o2) { e2 = e2[gr(t2[n2++])]; } return n2 && n2 == o2 ? e2 : void 0; } function br(e2, t2, n2) { var o2 = e2 == null ? void 0 : yr(e2, t2); return o2 === void 0 ? n2 : o2; } function wr(e2, t2) { var n2 = -1, o2 = t2.length, a2 = e2.length; while (++n2 < o2) { e2[a2 + n2] = t2[n2]; } return e2; } var xr = Bt ? Bt.isConcatSpreadable : void 0; function kr(e2) { return tn(e2) || Eo(e2) || !!(xr && e2 && e2[xr]); } function Cr(e2, t2, n2, o2, a2) { var r2 = -1, l2 = e2.length; n2 || (n2 = kr); a2 || (a2 = []); while (++r2 < l2) { var s2 = e2[r2]; if (n2(s2)) { { wr(a2, s2); } } else { a2[a2.length] = s2; } } return a2; } function Sr(e2) { var t2 = e2 == null ? 0 : e2.length; return t2 ? Cr(e2) : []; } function Er(e2) { return Jn(uo(e2, void 0, Sr), e2 + ""); } var _r = ha(Object.getPrototypeOf, Object); var Or = "[object Object]"; var Mr = Function.prototype, Lr = Object.prototype; var Dr = Mr.toString; var Ar = Lr.hasOwnProperty; var Rr = Dr.call(Object); function $r(e2) { if (!Zt(e2) || Xt(e2) != Or) { return false; } var t2 = _r(e2); if (t2 === null) { return true; } var n2 = Ar.call(t2, "constructor") && t2.constructor; return typeof n2 == "function" && n2 instanceof n2 && Dr.call(n2) == Rr; } function Tr() { this.__data__ = new Za(); this.size = 0; } function Pr(e2) { var t2 = this.__data__, n2 = t2["delete"](e2); this.size = t2.size; return n2; } function Nr(e2) { return this.__data__.get(e2); } function Ir(e2) { return this.__data__.has(e2); } var Br = 200; function Vr(e2, t2) { var n2 = this.__data__; if (n2 instanceof Za) { var o2 = n2.__data__; if (!Ja || o2.length < Br - 1) { o2.push([e2, t2]); this.size = ++n2.size; return this; } n2 = this.__data__ = new lr(o2); } n2.set(e2, t2); this.size = n2.size; return this; } function Fr(e2) { var t2 = this.__data__ = new Za(e2); this.size = t2.size; } Fr.prototype.clear = Tr; Fr.prototype["delete"] = Pr; Fr.prototype.get = Nr; Fr.prototype.has = Ir; Fr.prototype.set = Vr; var jr = typeof exports == "object" && exports && !exports.nodeType && exports; var zr = jr && typeof module == "object" && module && !module.nodeType && module; var Hr = zr && zr.exports === jr; var Wr = Hr ? It.Buffer : void 0; Wr ? Wr.allocUnsafe : void 0; function Yr(e2, t2) { { return e2.slice(); } } function Ur(e2, t2) { var n2 = -1, o2 = e2 == null ? 0 : e2.length, a2 = 0, r2 = []; while (++n2 < o2) { var l2 = e2[n2]; if (t2(l2, n2, e2)) { r2[a2++] = l2; } } return r2; } function Kr() { return []; } var qr = Object.prototype; var Gr = qr.propertyIsEnumerable; var Xr = Object.getOwnPropertySymbols; var Zr = !Xr ? Kr : function(e2) { if (e2 == null) { return []; } e2 = Object(e2); return Ur(Xr(e2), function(t2) { return Gr.call(e2, t2); }); }; function Jr(e2, t2, n2) { var o2 = t2(e2); return tn(e2) ? o2 : wr(o2, n2(e2)); } function Qr(e2) { return Jr(e2, xa, Zr); } var el = Vn(It, "DataView"); var tl = Vn(It, "Promise"); var nl = Vn(It, "Set"); var ol = "[object Map]", al = "[object Object]", rl = "[object Promise]", ll = "[object Set]", sl = "[object WeakMap]"; var il = "[object DataView]"; var ul = Ln(el), cl = Ln(Ja), dl = Ln(tl), fl = Ln(nl), pl = Ln(Fn); var vl = Xt; if (el && vl(new el(new ArrayBuffer(1))) != il || Ja && vl(new Ja()) != ol || tl && vl(tl.resolve()) != rl || nl && vl(new nl()) != ll || Fn && vl(new Fn()) != sl) { vl = function(e2) { var t2 = Xt(e2), n2 = t2 == al ? e2.constructor : void 0, o2 = n2 ? Ln(n2) : ""; if (o2) { switch (o2) { case ul: return il; case cl: return ol; case dl: return rl; case fl: return ll; case pl: return sl; } } return t2; }; } var ml = It.Uint8Array; function hl(e2) { var t2 = new e2.constructor(e2.byteLength); new ml(t2).set(new ml(e2)); return t2; } function gl(e2, t2) { var n2 = hl(e2.buffer); return new e2.constructor(n2, e2.byteOffset, e2.length); } function yl(e2) { return typeof e2.constructor == "function" && !yo(e2) ? zn(_r(e2)) : {}; } var bl = "__lodash_hash_undefined__"; function wl(e2) { this.__data__.set(e2, bl); return this; } function xl(e2) { return this.__data__.has(e2); } function kl(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length; this.__data__ = new lr(); while (++t2 < n2) { this.add(e2[t2]); } } kl.prototype.add = kl.prototype.push = wl; kl.prototype.has = xl; function Cl(e2, t2) { var n2 = -1, o2 = e2 == null ? 0 : e2.length; while (++n2 < o2) { if (t2(e2[n2], n2, e2)) { return true; } } return false; } function Sl(e2, t2) { return e2.has(t2); } var El = 1, _l = 2; function Ol(e2, t2, n2, o2, a2, r2) { var l2 = n2 & El, s2 = e2.length, i2 = t2.length; if (s2 != i2 && !(l2 && i2 > s2)) { return false; } var u2 = r2.get(e2); var c2 = r2.get(t2); if (u2 && c2) { return u2 == t2 && c2 == e2; } var d2 = -1, f2 = true, p2 = n2 & _l ? new kl() : void 0; r2.set(e2, t2); r2.set(t2, e2); while (++d2 < s2) { var v2 = e2[d2], m2 = t2[d2]; if (o2) { var h2 = l2 ? o2(m2, v2, d2, t2, e2, r2) : o2(v2, m2, d2, e2, t2, r2); } if (h2 !== void 0) { if (h2) { continue; } f2 = false; break; } if (p2) { if (!Cl(t2, function(e3, t3) { if (!Sl(p2, t3) && (v2 === e3 || a2(v2, e3, n2, o2, r2))) { return p2.push(t3); } })) { f2 = false; break; } } else if (!(v2 === m2 || a2(v2, m2, n2, o2, r2))) { f2 = false; break; } } r2["delete"](e2); r2["delete"](t2); return f2; } function Ml(e2) { var t2 = -1, n2 = Array(e2.size); e2.forEach(function(e3, o2) { n2[++t2] = [o2, e3]; }); return n2; } function Ll(e2) { var t2 = -1, n2 = Array(e2.size); e2.forEach(function(e3) { n2[++t2] = e3; }); return n2; } var Dl = 1, Al = 2; var Rl = "[object Boolean]", $l = "[object Date]", Tl = "[object Error]", Pl = "[object Map]", Nl = "[object Number]", Il = "[object RegExp]", Bl = "[object Set]", Vl = "[object String]", Fl = "[object Symbol]"; var jl = "[object ArrayBuffer]", zl = "[object DataView]"; var Hl = Bt ? Bt.prototype : void 0, Wl = Hl ? Hl.valueOf : void 0; function Yl(e2, t2, n2, o2, a2, r2, l2) { switch (n2) { case zl: if (e2.byteLength != t2.byteLength || e2.byteOffset != t2.byteOffset) { return false; } e2 = e2.buffer; t2 = t2.buffer; case jl: if (e2.byteLength != t2.byteLength || !r2(new ml(e2), new ml(t2))) { return false; } return true; case Rl: case $l: case Nl: return oo(+e2, +t2); case Tl: return e2.name == t2.name && e2.message == t2.message; case Il: case Vl: return e2 == t2 + ""; case Pl: var s2 = Ml; case Bl: var i2 = o2 & Dl; s2 || (s2 = Ll); if (e2.size != t2.size && !i2) { return false; } var u2 = l2.get(e2); if (u2) { return u2 == t2; } o2 |= Al; l2.set(e2, t2); var c2 = Ol(s2(e2), s2(t2), o2, a2, r2, l2); l2["delete"](e2); return c2; case Fl: if (Wl) { return Wl.call(e2) == Wl.call(t2); } } return false; } var Ul = 1; var Kl = Object.prototype; var ql = Kl.hasOwnProperty; function Gl(e2, t2, n2, o2, a2, r2) { var l2 = n2 & Ul, s2 = Qr(e2), i2 = s2.length, u2 = Qr(t2), c2 = u2.length; if (i2 != c2 && !l2) { return false; } var d2 = i2; while (d2--) { var f2 = s2[d2]; if (!(l2 ? f2 in t2 : ql.call(t2, f2))) { return false; } } var p2 = r2.get(e2); var v2 = r2.get(t2); if (p2 && v2) { return p2 == t2 && v2 == e2; } var m2 = true; r2.set(e2, t2); r2.set(t2, e2); var h2 = l2; while (++d2 < i2) { f2 = s2[d2]; var g2 = e2[f2], y2 = t2[f2]; if (o2) { var b2 = l2 ? o2(y2, g2, f2, t2, e2, r2) : o2(g2, y2, f2, e2, t2, r2); } if (!(b2 === void 0 ? g2 === y2 || a2(g2, y2, n2, o2, r2) : b2)) { m2 = false; break; } h2 || (h2 = f2 == "constructor"); } if (m2 && !h2) { var w2 = e2.constructor, x2 = t2.constructor; if (w2 != x2 && ("constructor" in e2 && "constructor" in t2) && !(typeof w2 == "function" && w2 instanceof w2 && typeof x2 == "function" && x2 instanceof x2)) { m2 = false; } } r2["delete"](e2); r2["delete"](t2); return m2; } var Xl = 1; var Zl = "[object Arguments]", Jl = "[object Array]", Ql = "[object Object]"; var es = Object.prototype; var ts = es.hasOwnProperty; function ns(e2, t2, n2, o2, a2, r2) { var l2 = tn(e2), s2 = tn(t2), i2 = l2 ? Jl : vl(e2), u2 = s2 ? Jl : vl(t2); i2 = i2 == Zl ? Ql : i2; u2 = u2 == Zl ? Ql : u2; var c2 = i2 == Ql, d2 = u2 == Ql, f2 = i2 == u2; if (f2 && Ro(e2)) { if (!Ro(t2)) { return false; } l2 = true; c2 = false; } if (f2 && !c2) { r2 || (r2 = new Fr()); return l2 || fa(e2) ? Ol(e2, t2, n2, o2, a2, r2) : Yl(e2, t2, i2, n2, o2, a2, r2); } if (!(n2 & Xl)) { var p2 = c2 && ts.call(e2, "__wrapped__"), v2 = d2 && ts.call(t2, "__wrapped__"); if (p2 || v2) { var m2 = p2 ? e2.value() : e2, h2 = v2 ? t2.value() : t2; r2 || (r2 = new Fr()); return a2(m2, h2, n2, o2, r2); } } if (!f2) { return false; } r2 || (r2 = new Fr()); return Gl(e2, t2, n2, o2, a2, r2); } function os(e2, t2, n2, o2, a2) { if (e2 === t2) { return true; } if (e2 == null || t2 == null || !Zt(e2) && !Zt(t2)) { return e2 !== e2 && t2 !== t2; } return ns(e2, t2, n2, o2, os, a2); } var as = 1, rs = 2; function ls(e2, t2, n2, o2) { var a2 = n2.length, r2 = a2; if (e2 == null) { return !r2; } e2 = Object(e2); while (a2--) { var l2 = n2[a2]; if (l2[2] ? l2[1] !== e2[l2[0]] : !(l2[0] in e2)) { return false; } } while (++a2 < r2) { l2 = n2[a2]; var s2 = l2[0], i2 = e2[s2], u2 = l2[1]; if (l2[2]) { if (i2 === void 0 && !(s2 in e2)) { return false; } } else { var c2 = new Fr(); var d2; if (!(d2 === void 0 ? os(u2, i2, as | rs, o2, c2) : d2)) { return false; } } } return true; } function ss(e2) { return e2 === e2 && !dn(e2); } function is(e2) { var t2 = xa(e2), n2 = t2.length; while (n2--) { var o2 = t2[n2], a2 = e2[o2]; t2[n2] = [o2, a2, ss(a2)]; } return t2; } function us(e2, t2) { return function(n2) { if (n2 == null) { return false; } return n2[e2] === t2 && (t2 !== void 0 || e2 in Object(n2)); }; } function cs(e2) { var t2 = is(e2); if (t2.length == 1 && t2[0][2]) { return us(t2[0][0], t2[0][1]); } return function(n2) { return n2 === e2 || ls(n2, e2, t2); }; } function ds(e2, t2) { return e2 != null && t2 in Object(e2); } function fs(e2, t2, n2) { t2 = mr(t2, e2); var o2 = -1, a2 = t2.length, r2 = false; while (++o2 < a2) { var l2 = gr(t2[o2]); if (!(r2 = e2 != null && n2(e2, l2))) { break; } e2 = e2[l2]; } if (r2 || ++o2 != a2) { return r2; } a2 = e2 == null ? 0 : e2.length; return !!a2 && po(a2) && to(l2, a2) && (tn(e2) || Eo(e2)); } function ps(e2, t2) { return e2 != null && fs(e2, t2, ds); } var vs = 1, ms = 2; function hs(e2, t2) { if (La(e2) && ss(t2)) { return us(gr(e2), t2); } return function(n2) { var o2 = br(n2, e2); return o2 === void 0 && o2 === t2 ? ps(n2, e2) : os(t2, o2, vs | ms); }; } function gs(e2) { return function(t2) { return t2 == null ? void 0 : t2[e2]; }; } function ys(e2) { return function(t2) { return yr(t2, e2); }; } function bs(e2) { return La(e2) ? gs(gr(e2)) : ys(e2); } function ws(e2) { if (typeof e2 == "function") { return e2; } if (e2 == null) { return yn; } if (typeof e2 == "object") { return tn(e2) ? hs(e2[0], e2[1]) : cs(e2); } return bs(e2); } function xs(e2) { return function(e3, t2, n2) { var o2 = -1, a2 = Object(e3), r2 = n2(e3), l2 = r2.length; while (l2--) { var s2 = r2[++o2]; if (t2(a2[s2], s2, a2) === false) { break; } } return e3; }; } var ks = xs(); function Cs(e2, t2) { return e2 && ks(e2, t2, xa); } function Ss(e2, t2) { return function(t3, n2) { if (t3 == null) { return t3; } if (!vo(t3)) { return e2(t3, n2); } var o2 = t3.length, a2 = -1, r2 = Object(t3); while (++a2 < o2) { if (n2(r2[a2], a2, r2) === false) { break; } } return t3; }; } var Es = Ss(Cs); var _s = function() { return It.Date.now(); }; var Os = "Expected a function"; var Ms = Math.max, Ls = Math.min; function Ds(e2, t2, n2) { var o2, a2, r2, l2, s2, i2, u2 = 0, c2 = false, d2 = false, f2 = true; if (typeof e2 != "function") { throw new TypeError(Os); } t2 = gn(t2) || 0; if (dn(n2)) { c2 = !!n2.leading; d2 = "maxWait" in n2; r2 = d2 ? Ms(gn(n2.maxWait) || 0, t2) : r2; f2 = "trailing" in n2 ? !!n2.trailing : f2; } function p2(t3) { var n3 = o2, r3 = a2; o2 = a2 = void 0; u2 = t3; l2 = e2.apply(r3, n3); return l2; } function v2(e3) { u2 = e3; s2 = setTimeout(g2, t2); return c2 ? p2(e3) : l2; } function m2(e3) { var n3 = e3 - i2, o3 = e3 - u2, a3 = t2 - n3; return d2 ? Ls(a3, r2 - o3) : a3; } function h2(e3) { var n3 = e3 - i2, o3 = e3 - u2; return i2 === void 0 || n3 >= t2 || n3 < 0 || d2 && o3 >= r2; } function g2() { var e3 = _s(); if (h2(e3)) { return y2(e3); } s2 = setTimeout(g2, m2(e3)); } function y2(e3) { s2 = void 0; if (f2 && o2) { return p2(e3); } o2 = a2 = void 0; return l2; } function b2() { if (s2 !== void 0) { clearTimeout(s2); } u2 = 0; o2 = i2 = a2 = s2 = void 0; } function w2() { return s2 === void 0 ? l2 : y2(_s()); } function x2() { var e3 = _s(), n3 = h2(e3); o2 = arguments; a2 = this; i2 = e3; if (n3) { if (s2 === void 0) { return v2(i2); } if (d2) { clearTimeout(s2); s2 = setTimeout(g2, t2); return p2(i2); } } if (s2 === void 0) { s2 = setTimeout(g2, t2); } return l2; } x2.cancel = b2; x2.flush = w2; return x2; } function As(e2, t2, n2) { if (n2 !== void 0 && !oo(e2[t2], n2) || n2 === void 0 && !(t2 in e2)) { no(e2, t2, n2); } } function Rs(e2) { return Zt(e2) && vo(e2); } function $s(e2, t2) { if (t2 === "constructor" && typeof e2[t2] === "function") { return; } if (t2 == "__proto__") { return; } return e2[t2]; } function Ts(e2) { return so(e2, _a(e2)); } function Ps(e2, t2, n2, o2, a2, r2, l2) { var s2 = $s(e2, n2), i2 = $s(t2, n2), u2 = l2.get(i2); if (u2) { As(e2, n2, u2); return; } var c2 = r2 ? r2(s2, i2, n2 + "", e2, t2, l2) : void 0; var d2 = c2 === void 0; if (d2) { var f2 = tn(i2), p2 = !f2 && Ro(i2), v2 = !f2 && !p2 && fa(i2); c2 = i2; if (f2 || p2 || v2) { if (tn(s2)) { c2 = s2; } else if (Rs(s2)) { c2 = Wn(s2); } else if (p2) { d2 = false; c2 = Yr(i2); } else if (v2) { d2 = false; c2 = gl(i2); } else { c2 = []; } } else if ($r(i2) || Eo(i2)) { c2 = s2; if (Eo(s2)) { c2 = Ts(s2); } else if (!dn(s2) || Cn(s2)) { c2 = yl(i2); } } else { d2 = false; } } if (d2) { l2.set(i2, c2); a2(c2, i2, o2, r2, l2); l2["delete"](i2); } As(e2, n2, c2); } function Ns(e2, t2, n2, o2, a2) { if (e2 === t2) { return; } ks(t2, function(r2, l2) { a2 || (a2 = new Fr()); if (dn(r2)) { Ps(e2, t2, l2, n2, Ns, o2, a2); } else { var s2 = o2 ? o2($s(e2, l2), r2, l2 + "", e2, t2, a2) : void 0; if (s2 === void 0) { s2 = r2; } As(e2, l2, s2); } }, _a); } function Is(e2, t2) { var n2 = -1, o2 = vo(e2) ? Array(e2.length) : []; Es(e2, function(e3, a2, r2) { o2[++n2] = t2(e3, a2, r2); }); return o2; } function Bs(e2, t2) { var n2 = tn(e2) ? en : Is; return n2(e2, ws(t2)); } function Vs(e2, t2) { return Cr(Bs(e2, t2)); } function Fs(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length, o2 = {}; while (++t2 < n2) { var a2 = e2[t2]; o2[a2[0]] = a2[1]; } return o2; } function js(e2, t2) { return os(e2, t2); } function zs(e2) { return e2 == null; } function Hs(e2) { return e2 === void 0; } var Ws = ho(function(e2, t2, n2) { Ns(e2, t2, n2); }); function Ys(e2, t2, n2, o2) { if (!dn(e2)) { return e2; } t2 = mr(t2, e2); var a2 = -1, r2 = t2.length, l2 = r2 - 1, s2 = e2; while (s2 != null && ++a2 < r2) { var i2 = gr(t2[a2]), u2 = n2; if (i2 === "__proto__" || i2 === "constructor" || i2 === "prototype") { return e2; } if (a2 != l2) { var c2 = s2[i2]; u2 = void 0; if (u2 === void 0) { u2 = dn(c2) ? c2 : to(t2[a2 + 1]) ? [] : {}; } } lo(s2, i2, u2); s2 = s2[i2]; } return e2; } function Us(e2, t2, n2) { var o2 = -1, a2 = t2.length, r2 = {}; while (++o2 < a2) { var l2 = t2[o2], s2 = yr(e2, l2); if (n2(s2, l2)) { Ys(r2, mr(l2, e2), s2); } } return r2; } function Ks(e2, t2) { return Us(e2, t2, function(t3, n2) { return ps(e2, n2); }); } var qs = Er(function(e2, t2) { return e2 == null ? {} : Ks(e2, t2); }); function Gs(e2, t2, n2) { return e2 == null ? e2 : Ys(e2, t2, n2); } const Xs = (e2) => e2 === void 0; const Zs = (e2) => typeof e2 === "boolean"; const Js = (e2) => typeof e2 === "number"; const Qs = (e2) => !e2 && e2 !== 0 || xt(e2) && e2.length === 0 || Et(e2) && !Object.keys(e2).length; const ei = (e2) => { if (typeof Element === "undefined") return false; return e2 instanceof Element; }; const ti = (e2) => zs(e2); const ni = (e2) => { if (!St(e2)) { return false; } return !Number.isNaN(Number(e2)); }; const oi = (e2) => Be ? window.requestAnimationFrame(e2) : setTimeout(e2, 16); const ai = (e2) => Tt(e2); const ri = (e2) => Object.keys(e2); const li = (e2, t2, n2) => ({ get value() { return br(e2, t2, n2); }, set value(n3) { Gs(e2, t2, n3); } }); class si extends Error { constructor(e2) { super(e2); this.name = "ElementPlusError"; } } function ii(e2, t2) { throw new si(`[${e2}] ${t2}`); } function ui(e2, t2) { } const ci = (e2 = "") => e2.split(" ").filter((e3) => !!e3.trim()); const di = (e2, t2) => { if (!e2 || !t2) return false; if (t2.includes(" ")) throw new Error("className should not contain space."); return e2.classList.contains(t2); }; const fi = (e2, t2) => { if (!e2 || !t2.trim()) return; e2.classList.add(...ci(t2)); }; const pi = (e2, t2) => { if (!e2 || !t2.trim()) return; e2.classList.remove(...ci(t2)); }; const vi = (e2, t2) => { var n2; if (!Be || !e2 || !t2) return ""; let o2 = At(t2); if (o2 === "float") o2 = "cssFloat"; try { const t3 = e2.style[o2]; if (t3) return t3; const a2 = (n2 = document.defaultView) == null ? void 0 : n2.getComputedStyle(e2, ""); return a2 ? a2[o2] : ""; } catch (t3) { return e2.style[o2]; } }; function mi(e2, t2 = "px") { if (!e2) return ""; if (Js(e2) || ni(e2)) { return `${e2}${t2}`; } else if (St(e2)) { return e2; } } let hi; const gi = (e2) => { var t2; if (!Be) return 0; if (hi !== void 0) return hi; const n2 = document.createElement("div"); n2.className = `${e2}-scrollbar__wrap`; n2.style.visibility = "hidden"; n2.style.width = "100px"; n2.style.position = "absolute"; n2.style.top = "-9999px"; document.body.appendChild(n2); const o2 = n2.offsetWidth; n2.style.overflow = "scroll"; const a2 = document.createElement("div"); a2.style.width = "100%"; n2.appendChild(a2); const r2 = a2.offsetWidth; (t2 = n2.parentNode) == null ? void 0 : t2.removeChild(n2); hi = o2 - r2; return hi; }; /*! Element Plus Icons Vue v2.3.1 */ var yi = vue.defineComponent({ name: "ArrowDown", __name: "arrow-down", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M831.872 340.864 512 652.672 192.128 340.864a30.592 30.592 0 0 0-42.752 0 29.12 29.12 0 0 0 0 41.6L489.664 714.24a32 32 0 0 0 44.672 0l340.288-331.712a29.12 29.12 0 0 0 0-41.728 30.592 30.592 0 0 0-42.752 0z" })])); } }); var bi = yi; var wi = vue.defineComponent({ name: "ArrowLeft", __name: "arrow-left", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M609.408 149.376 277.76 489.6a32 32 0 0 0 0 44.672l331.648 340.352a29.12 29.12 0 0 0 41.728 0 30.592 30.592 0 0 0 0-42.752L339.264 511.936l311.872-319.872a30.592 30.592 0 0 0 0-42.688 29.12 29.12 0 0 0-41.728 0z" })])); } }); var xi = wi; var ki = vue.defineComponent({ name: "ArrowRight", __name: "arrow-right", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M340.864 149.312a30.592 30.592 0 0 0 0 42.752L652.736 512 340.864 831.872a30.592 30.592 0 0 0 0 42.752 29.12 29.12 0 0 0 41.728 0L714.24 534.336a32 32 0 0 0 0-44.672L382.592 149.376a29.12 29.12 0 0 0-41.728 0z" })])); } }); var Ci = ki; var Si = vue.defineComponent({ name: "ArrowUp", __name: "arrow-up", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m488.832 344.32-339.84 356.672a32 32 0 0 0 0 44.16l.384.384a29.44 29.44 0 0 0 42.688 0l320-335.872 319.872 335.872a29.44 29.44 0 0 0 42.688 0l.384-.384a32 32 0 0 0 0-44.16L535.168 344.32a32 32 0 0 0-46.336 0" })])); } }); var Ei = Si; var _i = vue.defineComponent({ name: "Calendar", __name: "calendar", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M128 384v512h768V192H768v32a32 32 0 1 1-64 0v-32H320v32a32 32 0 0 1-64 0v-32H128v128h768v64zm192-256h384V96a32 32 0 1 1 64 0v32h160a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h160V96a32 32 0 0 1 64 0zm-32 384h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64" })])); } }); var Oi = _i; var Mi = vue.defineComponent({ name: "CircleCheck", __name: "circle-check", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M745.344 361.344a32 32 0 0 1 45.312 45.312l-288 288a32 32 0 0 1-45.312 0l-160-160a32 32 0 1 1 45.312-45.312L480 626.752l265.344-265.408z" })])); } }); var Li = Mi; var Di = vue.defineComponent({ name: "CircleCloseFilled", __name: "circle-close-filled", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m0 393.664L407.936 353.6a38.4 38.4 0 1 0-54.336 54.336L457.664 512 353.6 616.064a38.4 38.4 0 1 0 54.336 54.336L512 566.336 616.064 670.4a38.4 38.4 0 1 0 54.336-54.336L566.336 512 670.4 407.936a38.4 38.4 0 1 0-54.336-54.336z" })])); } }); var Ai = Di; var Ri = vue.defineComponent({ name: "CircleClose", __name: "circle-close", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m466.752 512-90.496-90.496a32 32 0 0 1 45.248-45.248L512 466.752l90.496-90.496a32 32 0 1 1 45.248 45.248L557.248 512l90.496 90.496a32 32 0 1 1-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 0 1-45.248-45.248z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" })])); } }); var $i = Ri; var Ti = vue.defineComponent({ name: "Clock", __name: "clock", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M480 256a32 32 0 0 1 32 32v256a32 32 0 0 1-64 0V288a32 32 0 0 1 32-32" }), vue.createElementVNode("path", { fill: "currentColor", d: "M480 512h256q32 0 32 32t-32 32H480q-32 0-32-32t32-32" })])); } }); var Pi = Ti; var Ni = vue.defineComponent({ name: "Close", __name: "close", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z" })])); } }); var Ii = Ni; var Bi = vue.defineComponent({ name: "DArrowLeft", __name: "d-arrow-left", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M529.408 149.376a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L259.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L197.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224zm256 0a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L515.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L453.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224z" })])); } }); var Vi = Bi; var Fi = vue.defineComponent({ name: "DArrowRight", __name: "d-arrow-right", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M452.864 149.312a29.12 29.12 0 0 1 41.728.064L826.24 489.664a32 32 0 0 1 0 44.672L494.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L764.736 512 452.864 192a30.592 30.592 0 0 1 0-42.688m-256 0a29.12 29.12 0 0 1 41.728.064L570.24 489.664a32 32 0 0 1 0 44.672L238.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L508.736 512 196.864 192a30.592 30.592 0 0 1 0-42.688z" })])); } }); var ji = Fi; var zi = vue.defineComponent({ name: "Hide", __name: "hide", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M876.8 156.8c0-9.6-3.2-16-9.6-22.4-6.4-6.4-12.8-9.6-22.4-9.6-9.6 0-16 3.2-22.4 9.6L736 220.8c-64-32-137.6-51.2-224-60.8-160 16-288 73.6-377.6 176C44.8 438.4 0 496 0 512s48 73.6 134.4 176c22.4 25.6 44.8 48 73.6 67.2l-86.4 89.6c-6.4 6.4-9.6 12.8-9.6 22.4 0 9.6 3.2 16 9.6 22.4 6.4 6.4 12.8 9.6 22.4 9.6 9.6 0 16-3.2 22.4-9.6l704-710.4c3.2-6.4 6.4-12.8 6.4-22.4Zm-646.4 528c-76.8-70.4-128-128-153.6-172.8 28.8-48 80-105.6 153.6-172.8C304 272 400 230.4 512 224c64 3.2 124.8 19.2 176 44.8l-54.4 54.4C598.4 300.8 560 288 512 288c-64 0-115.2 22.4-160 64s-64 96-64 160c0 48 12.8 89.6 35.2 124.8L256 707.2c-9.6-6.4-19.2-16-25.6-22.4Zm140.8-96c-12.8-22.4-19.2-48-19.2-76.8 0-44.8 16-83.2 48-112 32-28.8 67.2-48 112-48 28.8 0 54.4 6.4 73.6 19.2zM889.599 336c-12.8-16-28.8-28.8-41.6-41.6l-48 48c73.6 67.2 124.8 124.8 150.4 169.6-28.8 48-80 105.6-153.6 172.8-73.6 67.2-172.8 108.8-284.8 115.2-51.2-3.2-99.2-12.8-140.8-28.8l-48 48c57.6 22.4 118.4 38.4 188.8 44.8 160-16 288-73.6 377.6-176C979.199 585.6 1024 528 1024 512s-48.001-73.6-134.401-176Z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M511.998 672c-12.8 0-25.6-3.2-38.4-6.4l-51.2 51.2c28.8 12.8 57.6 19.2 89.6 19.2 64 0 115.2-22.4 160-64 41.6-41.6 64-96 64-160 0-32-6.4-64-19.2-89.6l-51.2 51.2c3.2 12.8 6.4 25.6 6.4 38.4 0 44.8-16 83.2-48 112-32 28.8-67.2 48-112 48Z" })])); } }); var Hi = zi; var Wi = vue.defineComponent({ name: "InfoFilled", __name: "info-filled", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896.064A448 448 0 0 1 512 64m67.2 275.072c33.28 0 60.288-23.104 60.288-57.344s-27.072-57.344-60.288-57.344c-33.28 0-60.16 23.104-60.16 57.344s26.88 57.344 60.16 57.344M590.912 699.2c0-6.848 2.368-24.64 1.024-34.752l-52.608 60.544c-10.88 11.456-24.512 19.392-30.912 17.28a12.992 12.992 0 0 1-8.256-14.72l87.68-276.992c7.168-35.136-12.544-67.2-54.336-71.296-44.096 0-108.992 44.736-148.48 101.504 0 6.784-1.28 23.68.064 33.792l52.544-60.608c10.88-11.328 23.552-19.328 29.952-17.152a12.8 12.8 0 0 1 7.808 16.128L388.48 728.576c-10.048 32.256 8.96 63.872 55.04 71.04 67.84 0 107.904-43.648 147.456-100.416z" })])); } }); var Yi = Wi; var Ui = vue.defineComponent({ name: "Loading", __name: "loading", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32m0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32m448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32m-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32M195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0m-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z" })])); } }); var Ki = Ui; var qi = vue.defineComponent({ name: "Minus", __name: "minus", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M128 544h768a32 32 0 1 0 0-64H128a32 32 0 0 0 0 64" })])); } }); var Gi = qi; var Xi = vue.defineComponent({ name: "Plus", __name: "plus", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M480 480V128a32 32 0 0 1 64 0v352h352a32 32 0 1 1 0 64H544v352a32 32 0 1 1-64 0V544H128a32 32 0 0 1 0-64z" })])); } }); var Zi = Xi; var Ji = vue.defineComponent({ name: "Rank", __name: "rank", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m186.496 544 41.408 41.344a32 32 0 1 1-45.248 45.312l-96-96a32 32 0 0 1 0-45.312l96-96a32 32 0 1 1 45.248 45.312L186.496 480h290.816V186.432l-41.472 41.472a32 32 0 1 1-45.248-45.184l96-96.128a32 32 0 0 1 45.312 0l96 96.064a32 32 0 0 1-45.248 45.184l-41.344-41.28V480H832l-41.344-41.344a32 32 0 0 1 45.248-45.312l96 96a32 32 0 0 1 0 45.312l-96 96a32 32 0 0 1-45.248-45.312L832 544H541.312v293.44l41.344-41.28a32 32 0 1 1 45.248 45.248l-96 96a32 32 0 0 1-45.312 0l-96-96a32 32 0 1 1 45.312-45.248l41.408 41.408V544H186.496z" })])); } }); var Qi = Ji; var eu = vue.defineComponent({ name: "Setting", __name: "setting", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M600.704 64a32 32 0 0 1 30.464 22.208l35.2 109.376c14.784 7.232 28.928 15.36 42.432 24.512l112.384-24.192a32 32 0 0 1 34.432 15.36L944.32 364.8a32 32 0 0 1-4.032 37.504l-77.12 85.12a357.12 357.12 0 0 1 0 49.024l77.12 85.248a32 32 0 0 1 4.032 37.504l-88.704 153.6a32 32 0 0 1-34.432 15.296L708.8 803.904c-13.44 9.088-27.648 17.28-42.368 24.512l-35.264 109.376A32 32 0 0 1 600.704 960H423.296a32 32 0 0 1-30.464-22.208L357.696 828.48a351.616 351.616 0 0 1-42.56-24.64l-112.32 24.256a32 32 0 0 1-34.432-15.36L79.68 659.2a32 32 0 0 1 4.032-37.504l77.12-85.248a357.12 357.12 0 0 1 0-48.896l-77.12-85.248A32 32 0 0 1 79.68 364.8l88.704-153.6a32 32 0 0 1 34.432-15.296l112.32 24.256c13.568-9.152 27.776-17.408 42.56-24.64l35.2-109.312A32 32 0 0 1 423.232 64H600.64zm-23.424 64H446.72l-36.352 113.088-24.512 11.968a294.113 294.113 0 0 0-34.816 20.096l-22.656 15.36-116.224-25.088-65.28 113.152 79.68 88.192-1.92 27.136a293.12 293.12 0 0 0 0 40.192l1.92 27.136-79.808 88.192 65.344 113.152 116.224-25.024 22.656 15.296a294.113 294.113 0 0 0 34.816 20.096l24.512 11.968L446.72 896h130.688l36.48-113.152 24.448-11.904a288.282 288.282 0 0 0 34.752-20.096l22.592-15.296 116.288 25.024 65.28-113.152-79.744-88.192 1.92-27.136a293.12 293.12 0 0 0 0-40.256l-1.92-27.136 79.808-88.128-65.344-113.152-116.288 24.96-22.592-15.232a287.616 287.616 0 0 0-34.752-20.096l-24.448-11.904L577.344 128zM512 320a192 192 0 1 1 0 384 192 192 0 0 1 0-384m0 64a128 128 0 1 0 0 256 128 128 0 0 0 0-256" })])); } }); var tu = eu; var nu = vue.defineComponent({ name: "SuccessFilled", __name: "success-filled", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m-55.808 536.384-99.52-99.584a38.4 38.4 0 1 0-54.336 54.336l126.72 126.72a38.272 38.272 0 0 0 54.336 0l262.4-262.464a38.4 38.4 0 1 0-54.272-54.336z" })])); } }); var ou = nu; var au = vue.defineComponent({ name: "View", __name: "view", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352m0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 1 1 0 448 224 224 0 0 1 0-448m0 64a160.192 160.192 0 0 0-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160" })])); } }); var ru = au; var lu = vue.defineComponent({ name: "WarningFilled", __name: "warning-filled", setup(e2) { return (e3, a2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m0 192a58.432 58.432 0 0 0-58.24 63.744l23.36 256.384a35.072 35.072 0 0 0 69.76 0l23.296-256.384A58.432 58.432 0 0 0 512 256m0 512a51.2 51.2 0 1 0 0-102.4 51.2 51.2 0 0 0 0 102.4" })])); } }); var su = lu; const iu = "__epPropKey"; const uu = (e2) => e2; const cu = (e2) => Et(e2) && !!e2[iu]; const du = (e2, t2) => { if (!Et(e2) || cu(e2)) return e2; const { values: n2, required: o2, default: r2, type: l2, validator: s2 } = e2; const i2 = n2 || s2 ? (o3) => { let l3 = false; let i3 = []; if (n2) { i3 = Array.from(n2); if (wt(e2, "default")) { i3.push(r2); } l3 || (l3 = i3.includes(o3)); } if (s2) l3 || (l3 = s2(o3)); if (!l3 && i3.length > 0) { const e3 = [...new Set(i3)].map((e4) => JSON.stringify(e4)).join(", "); vue.warn(`Invalid prop: validation failed${t2 ? ` for prop "${t2}"` : ""}. Expected one of [${e3}], got value ${JSON.stringify(o3)}.`); } return l3; } : void 0; const u2 = { type: l2, required: !!o2, validator: i2, [iu]: true }; if (wt(e2, "default")) u2.default = r2; return u2; }; const fu = (e2) => Fs(Object.entries(e2).map(([e3, t2]) => [e3, du(t2, e3)])); const pu = uu([String, Object, Function]); const vu = { Close: Ii }; const mu = { Close: Ii, SuccessFilled: ou, InfoFilled: Yi, WarningFilled: su, CircleCloseFilled: Ai }; const hu = { success: ou, warning: su, error: Ai, info: Yi }; const gu = { validating: Ki, success: Li, error: $i }; const yu = (e2, t2) => { e2.install = (n2) => { for (const o2 of [e2, ...Object.values(t2 != null ? t2 : {})]) { n2.component(o2.name, o2); } }; if (t2) { for (const [n2, o2] of Object.entries(t2)) { e2[n2] = o2; } } return e2; }; const bu = (e2, t2) => { e2.install = (n2) => { e2._context = n2._context; n2.config.globalProperties[t2] = e2; }; return e2; }; const wu = (e2) => { e2.install = yt; return e2; }; const xu = (...e2) => (t2) => { e2.forEach((e3) => { if (Ct(e3)) { e3(t2); } else { e3.value = t2; } }); }; const ku = { tab: "Tab", enter: "Enter", space: "Space", left: "ArrowLeft", up: "ArrowUp", right: "ArrowRight", down: "ArrowDown", esc: "Escape", delete: "Delete", backspace: "Backspace", numpadEnter: "NumpadEnter", pageUp: "PageUp", pageDown: "PageDown", home: "Home", end: "End" }; const Cu = ["year", "years", "month", "months", "date", "dates", "week", "datetime", "datetimerange", "daterange", "monthrange", "yearrange"]; const Su = "update:modelValue"; const Eu = "change"; const _u = "input"; const Ou = ["", "default", "small", "large"]; const Mu = (e2) => ["", ...Ou].includes(e2); var Lu = ((e2) => { e2[e2["TEXT"] = 1] = "TEXT"; e2[e2["CLASS"] = 2] = "CLASS"; e2[e2["STYLE"] = 4] = "STYLE"; e2[e2["PROPS"] = 8] = "PROPS"; e2[e2["FULL_PROPS"] = 16] = "FULL_PROPS"; e2[e2["HYDRATE_EVENTS"] = 32] = "HYDRATE_EVENTS"; e2[e2["STABLE_FRAGMENT"] = 64] = "STABLE_FRAGMENT"; e2[e2["KEYED_FRAGMENT"] = 128] = "KEYED_FRAGMENT"; e2[e2["UNKEYED_FRAGMENT"] = 256] = "UNKEYED_FRAGMENT"; e2[e2["NEED_PATCH"] = 512] = "NEED_PATCH"; e2[e2["DYNAMIC_SLOTS"] = 1024] = "DYNAMIC_SLOTS"; e2[e2["HOISTED"] = -1] = "HOISTED"; e2[e2["BAIL"] = -2] = "BAIL"; return e2; })(Lu || {}); const Du = (e2) => { const t2 = xt(e2) ? e2 : [e2]; const n2 = []; t2.forEach((e3) => { var t3; if (xt(e3)) { n2.push(...Du(e3)); } else if (vue.isVNode(e3) && xt(e3.children)) { n2.push(...Du(e3.children)); } else { n2.push(e3); if (vue.isVNode(e3) && ((t3 = e3.component) == null ? void 0 : t3.subTree)) { n2.push(...Du(e3.component.subTree)); } } }); return n2; }; const Au = (e2) => { if (!e2 && e2 !== 0) return []; return Array.isArray(e2) ? e2 : [e2]; }; const Ru = (e2) => /([\uAC00-\uD7AF\u3130-\u318F])+/gi.test(e2); const $u = (e2) => e2; const Tu = ["class", "style"]; const Pu = /^on[A-Z]/; const Nu = (e2 = {}) => { const { excludeListeners: t2 = false, excludeKeys: n2 } = e2; const o2 = vue.computed(() => ((n2 == null ? void 0 : n2.value) || []).concat(Tu)); const a2 = vue.getCurrentInstance(); if (!a2) { return vue.computed(() => ({})); } return vue.computed(() => { var e3; return Fs(Object.entries((e3 = a2.proxy) == null ? void 0 : e3.$attrs).filter(([e4]) => !o2.value.includes(e4) && !(t2 && Pu.test(e4)))); }); }; const Iu = ({ from: e2, replacement: t2, scope: n2, version: o2, ref: a2, type: r2 = "API" }, l2) => { vue.watch(() => vue.unref(l2), (e3) => { }, { immediate: true }); }; const Bu = (e2, t2, n2, o2) => { let a2 = { offsetX: 0, offsetY: 0 }; const r2 = (t3) => { const n3 = t3.clientX; const r3 = t3.clientY; const { offsetX: l3, offsetY: s3 } = a2; const i3 = e2.value.getBoundingClientRect(); const u2 = i3.left; const c2 = i3.top; const d2 = i3.width; const f2 = i3.height; const p2 = document.documentElement.clientWidth; const v2 = document.documentElement.clientHeight; const m2 = -u2 + l3; const h2 = -c2 + s3; const g2 = p2 - u2 - d2 + l3; const y2 = v2 - c2 - f2 + s3; const b2 = (t4) => { let i4 = l3 + t4.clientX - n3; let u3 = s3 + t4.clientY - r3; if (!(o2 == null ? void 0 : o2.value)) { i4 = Math.min(Math.max(i4, m2), g2); u3 = Math.min(Math.max(u3, h2), y2); } a2 = { offsetX: i4, offsetY: u3 }; if (e2.value) { e2.value.style.transform = `translate(${mi(i4)}, ${mi(u3)})`; } }; const w2 = () => { document.removeEventListener("mousemove", b2); document.removeEventListener("mouseup", w2); }; document.addEventListener("mousemove", b2); document.addEventListener("mouseup", w2); }; const l2 = () => { if (t2.value && e2.value) { t2.value.addEventListener("mousedown", r2); } }; const s2 = () => { if (t2.value && e2.value) { t2.value.removeEventListener("mousedown", r2); } }; const i2 = () => { a2 = { offsetX: 0, offsetY: 0 }; if (e2.value) { e2.value.style.transform = "none"; } }; vue.onMounted(() => { vue.watchEffect(() => { if (n2.value) { l2(); } else { s2(); } }); }); vue.onBeforeUnmount(() => { s2(); }); return { resetPostion: i2 }; }; var Vu = { name: "en", el: { breadcrumb: { label: "Breadcrumb" }, colorpicker: { confirm: "OK", clear: "Clear", defaultLabel: "color picker", description: "current color is {color}. press enter to select a new color.", alphaLabel: "pick alpha value" }, datepicker: { now: "Now", today: "Today", cancel: "Cancel", clear: "Clear", confirm: "OK", dateTablePrompt: "Use the arrow keys and enter to select the day of the month", monthTablePrompt: "Use the arrow keys and enter to select the month", yearTablePrompt: "Use the arrow keys and enter to select the year", selectedDate: "Selected date", selectDate: "Select date", selectTime: "Select time", startDate: "Start Date", startTime: "Start Time", endDate: "End Date", endTime: "End Time", prevYear: "Previous Year", nextYear: "Next Year", prevMonth: "Previous Month", nextMonth: "Next Month", year: "", month1: "January", month2: "February", month3: "March", month4: "April", month5: "May", month6: "June", month7: "July", month8: "August", month9: "September", month10: "October", month11: "November", month12: "December", week: "week", weeks: { sun: "Sun", mon: "Mon", tue: "Tue", wed: "Wed", thu: "Thu", fri: "Fri", sat: "Sat" }, weeksFull: { sun: "Sunday", mon: "Monday", tue: "Tuesday", wed: "Wednesday", thu: "Thursday", fri: "Friday", sat: "Saturday" }, months: { jan: "Jan", feb: "Feb", mar: "Mar", apr: "Apr", may: "May", jun: "Jun", jul: "Jul", aug: "Aug", sep: "Sep", oct: "Oct", nov: "Nov", dec: "Dec" } }, inputNumber: { decrease: "decrease number", increase: "increase number" }, select: { loading: "Loading", noMatch: "No matching data", noData: "No data", placeholder: "Select" }, mention: { loading: "Loading" }, dropdown: { toggleDropdown: "Toggle Dropdown" }, cascader: { noMatch: "No matching data", loading: "Loading", placeholder: "Select", noData: "No data" }, pagination: { goto: "Go to", pagesize: "/page", total: "Total {total}", pageClassifier: "", page: "Page", prev: "Go to previous page", next: "Go to next page", currentPage: "page {pager}", prevPages: "Previous {pager} pages", nextPages: "Next {pager} pages", deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details" }, dialog: { close: "Close this dialog" }, drawer: { close: "Close this dialog" }, messagebox: { title: "Message", confirm: "OK", cancel: "Cancel", error: "Illegal input", close: "Close this dialog" }, upload: { deleteTip: "press delete to remove", delete: "Delete", preview: "Preview", continue: "Continue" }, slider: { defaultLabel: "slider between {min} and {max}", defaultRangeStartLabel: "pick start value", defaultRangeEndLabel: "pick end value" }, table: { emptyText: "No Data", confirmFilter: "Confirm", resetFilter: "Reset", clearFilter: "All", sumText: "Sum" }, tour: { next: "Next", previous: "Previous", finish: "Finish" }, tree: { emptyText: "No Data" }, transfer: { noMatch: "No matching data", noData: "No data", titles: ["List 1", "List 2"], filterPlaceholder: "Enter keyword", noCheckedFormat: "{total} items", hasCheckedFormat: "{checked}/{total} checked" }, image: { error: "FAILED" }, pageHeader: { title: "Back" }, popconfirm: { confirmButtonText: "Yes", cancelButtonText: "No" }, carousel: { leftArrow: "Carousel arrow left", rightArrow: "Carousel arrow right", indicator: "Carousel switch to index {index}" } } }; const Fu = (e2) => (t2, n2) => ju(t2, n2, vue.unref(e2)); const ju = (e2, t2, n2) => br(n2, e2, e2).replace(/\{(\w+)\}/g, (e3, n3) => { var o2; return `${(o2 = t2 == null ? void 0 : t2[n3]) != null ? o2 : `{${n3}}`}`; }); const zu = (e2) => { const t2 = vue.computed(() => vue.unref(e2).name); const n2 = vue.isRef(e2) ? e2 : vue.ref(e2); return { lang: t2, locale: n2, t: Fu(e2) }; }; const Hu = Symbol("localeContextKey"); const Wu = (e2) => { const t2 = e2 || vue.inject(Hu, vue.ref()); return zu(vue.computed(() => t2.value || Vu)); }; const Yu = "el"; const Uu = "is-"; const Ku = (e2, t2, n2, o2, a2) => { let r2 = `${e2}-${t2}`; if (n2) { r2 += `-${n2}`; } if (o2) { r2 += `__${o2}`; } if (a2) { r2 += `--${a2}`; } return r2; }; const qu = Symbol("namespaceContextKey"); const Gu = (e2) => { const t2 = e2 || (vue.getCurrentInstance() ? vue.inject(qu, vue.ref(Yu)) : vue.ref(Yu)); const n2 = vue.computed(() => vue.unref(t2) || Yu); return n2; }; const Xu = (e2, t2) => { const n2 = Gu(t2); const o2 = (t3 = "") => Ku(n2.value, e2, t3, "", ""); const a2 = (t3) => t3 ? Ku(n2.value, e2, "", t3, "") : ""; const r2 = (t3) => t3 ? Ku(n2.value, e2, "", "", t3) : ""; const l2 = (t3, o3) => t3 && o3 ? Ku(n2.value, e2, t3, o3, "") : ""; const s2 = (t3, o3) => t3 && o3 ? Ku(n2.value, e2, "", t3, o3) : ""; const i2 = (t3, o3) => t3 && o3 ? Ku(n2.value, e2, t3, "", o3) : ""; const u2 = (t3, o3, a3) => t3 && o3 && a3 ? Ku(n2.value, e2, t3, o3, a3) : ""; const c2 = (e3, ...t3) => { const n3 = t3.length >= 1 ? t3[0] : true; return e3 && n3 ? `${Uu}${e3}` : ""; }; const d2 = (e3) => { const t3 = {}; for (const o3 in e3) { if (e3[o3]) { t3[`--${n2.value}-${o3}`] = e3[o3]; } } return t3; }; const f2 = (t3) => { const o3 = {}; for (const a3 in t3) { if (t3[a3]) { o3[`--${n2.value}-${e2}-${a3}`] = t3[a3]; } } return o3; }; const p2 = (e3) => `--${n2.value}-${e3}`; const v2 = (t3) => `--${n2.value}-${e2}-${t3}`; return { namespace: n2, b: o2, e: a2, m: r2, be: l2, em: s2, bm: i2, bem: u2, is: c2, cssVar: d2, cssVarName: p2, cssVarBlock: f2, cssVarBlockName: v2 }; }; const Zu = (e2, t2 = {}) => { if (!vue.isRef(e2)) { ii("[useLockscreen]", "You need to pass a ref param to this function"); } const n2 = t2.ns || Xu("popup"); const o2 = vue.computed(() => n2.bm("parent", "hidden")); if (!Be || di(document.body, o2.value)) { return; } let a2 = 0; let r2 = false; let s2 = "0"; const u2 = () => { setTimeout(() => { pi(document == null ? void 0 : document.body, o2.value); if (r2 && document) { document.body.style.width = s2; } }, 200); }; vue.watch(e2, (e3) => { if (!e3) { u2(); return; } r2 = !di(document.body, o2.value); if (r2) { s2 = document.body.style.width; } a2 = gi(n2.namespace.value); const t3 = document.documentElement.clientHeight < document.body.scrollHeight; const l2 = vi(document.body, "overflowY"); if (a2 > 0 && (t3 || l2 === "scroll") && r2) { document.body.style.width = `calc(100% - ${a2}px)`; } fi(document.body, o2.value); }); vue.onScopeDispose(() => u2()); }; const Ju = du({ type: uu(Boolean), default: null }); const Qu = du({ type: uu(Function) }); const ec = (e2) => { const t2 = `update:${e2}`; const n2 = `onUpdate:${e2}`; const o2 = [t2]; const a2 = { [e2]: Ju, [n2]: Qu }; const r2 = ({ indicator: o3, toggleReason: a3, shouldHideWhenRouteChanges: r3, shouldProceed: u2, onShow: d2, onHide: f2 }) => { const p2 = vue.getCurrentInstance(); const { emit: v2 } = p2; const m2 = p2.props; const h2 = vue.computed(() => Ct(m2[n2])); const g2 = vue.computed(() => m2[e2] === null); const y2 = (e3) => { if (o3.value === true) { return; } o3.value = true; if (a3) { a3.value = e3; } if (Ct(d2)) { d2(e3); } }; const b2 = (e3) => { if (o3.value === false) { return; } o3.value = false; if (a3) { a3.value = e3; } if (Ct(f2)) { f2(e3); } }; const w2 = (e3) => { if (m2.disabled === true || Ct(u2) && !u2()) return; const n3 = h2.value && Be; if (n3) { v2(t2, true); } if (g2.value || !n3) { y2(e3); } }; const x2 = (e3) => { if (m2.disabled === true || !Be) return; const n3 = h2.value && Be; if (n3) { v2(t2, false); } if (g2.value || !n3) { b2(e3); } }; const k2 = (e3) => { if (!Zs(e3)) return; if (m2.disabled && e3) { if (h2.value) { v2(t2, false); } } else if (o3.value !== e3) { if (e3) { y2(); } else { b2(); } } }; const C2 = () => { if (o3.value) { x2(); } else { w2(); } }; vue.watch(() => m2[e2], k2); if (r3 && p2.appContext.config.globalProperties.$route !== void 0) { vue.watch(() => ({ ...p2.proxy.$route }), () => { if (r3.value && o3.value) { x2(); } }); } vue.onMounted(() => { k2(m2[e2]); }); return { hide: x2, show: w2, toggle: C2, hasUpdateHandler: h2 }; }; return { useModelToggle: r2, useModelToggleProps: a2, useModelToggleEmits: o2 }; }; const tc = (e2) => { const t2 = vue.getCurrentInstance(); return vue.computed(() => { var n2, o2; return (o2 = (n2 = t2 == null ? void 0 : t2.proxy) == null ? void 0 : n2.$props) == null ? void 0 : o2[e2]; }); }; var nc = "top", oc = "bottom", ac = "right", rc = "left", lc = "auto", sc = [nc, oc, ac, rc], ic = "start", uc = "end", cc = "clippingParents", dc = "viewport", fc = "popper", pc = "reference", vc = sc.reduce(function(e2, t2) { return e2.concat([t2 + "-" + ic, t2 + "-" + uc]); }, []), mc = [].concat(sc, [lc]).reduce(function(e2, t2) { return e2.concat([t2, t2 + "-" + ic, t2 + "-" + uc]); }, []), hc = "beforeRead", gc = "read", yc = "afterRead", bc = "beforeMain", wc = "main", xc = "afterMain", kc = "beforeWrite", Cc = "write", Sc = "afterWrite", Ec = [hc, gc, yc, bc, wc, xc, kc, Cc, Sc]; function _c(e2) { return e2 ? (e2.nodeName || "").toLowerCase() : null; } function Oc(e2) { if (e2 == null) return window; if (e2.toString() !== "[object Window]") { var t2 = e2.ownerDocument; return t2 && t2.defaultView || window; } return e2; } function Mc(e2) { var t2 = Oc(e2).Element; return e2 instanceof t2 || e2 instanceof Element; } function Lc(e2) { var t2 = Oc(e2).HTMLElement; return e2 instanceof t2 || e2 instanceof HTMLElement; } function Dc(e2) { if (typeof ShadowRoot == "undefined") return false; var t2 = Oc(e2).ShadowRoot; return e2 instanceof t2 || e2 instanceof ShadowRoot; } function Ac(e2) { var t2 = e2.state; Object.keys(t2.elements).forEach(function(e3) { var n2 = t2.styles[e3] || {}, o2 = t2.attributes[e3] || {}, a2 = t2.elements[e3]; !Lc(a2) || !_c(a2) || (Object.assign(a2.style, n2), Object.keys(o2).forEach(function(e4) { var t3 = o2[e4]; t3 === false ? a2.removeAttribute(e4) : a2.setAttribute(e4, t3 === true ? "" : t3); })); }); } function Rc(e2) { var t2 = e2.state, n2 = { popper: { position: t2.options.strategy, left: "0", top: "0", margin: "0" }, arrow: { position: "absolute" }, reference: {} }; return Object.assign(t2.elements.popper.style, n2.popper), t2.styles = n2, t2.elements.arrow && Object.assign(t2.elements.arrow.style, n2.arrow), function() { Object.keys(t2.elements).forEach(function(e3) { var o2 = t2.elements[e3], a2 = t2.attributes[e3] || {}, r2 = Object.keys(t2.styles.hasOwnProperty(e3) ? t2.styles[e3] : n2[e3]), l2 = r2.reduce(function(e4, t3) { return e4[t3] = "", e4; }, {}); !Lc(o2) || !_c(o2) || (Object.assign(o2.style, l2), Object.keys(a2).forEach(function(e4) { o2.removeAttribute(e4); })); }); }; } var $c = { name: "applyStyles", enabled: true, phase: "write", fn: Ac, effect: Rc, requires: ["computeStyles"] }; function Tc(e2) { return e2.split("-")[0]; } var Pc = Math.max, Nc = Math.min, Ic = Math.round; function Bc(e2, t2) { t2 === void 0 && (t2 = false); var n2 = e2.getBoundingClientRect(), o2 = 1, a2 = 1; if (Lc(e2) && t2) { var r2 = e2.offsetHeight, l2 = e2.offsetWidth; l2 > 0 && (o2 = Ic(n2.width) / l2 || 1), r2 > 0 && (a2 = Ic(n2.height) / r2 || 1); } return { width: n2.width / o2, height: n2.height / a2, top: n2.top / a2, right: n2.right / o2, bottom: n2.bottom / a2, left: n2.left / o2, x: n2.left / o2, y: n2.top / a2 }; } function Vc(e2) { var t2 = Bc(e2), n2 = e2.offsetWidth, o2 = e2.offsetHeight; return Math.abs(t2.width - n2) <= 1 && (n2 = t2.width), Math.abs(t2.height - o2) <= 1 && (o2 = t2.height), { x: e2.offsetLeft, y: e2.offsetTop, width: n2, height: o2 }; } function Fc(e2, t2) { var n2 = t2.getRootNode && t2.getRootNode(); if (e2.contains(t2)) return true; if (n2 && Dc(n2)) { var o2 = t2; do { if (o2 && e2.isSameNode(o2)) return true; o2 = o2.parentNode || o2.host; } while (o2); } return false; } function jc(e2) { return Oc(e2).getComputedStyle(e2); } function zc(e2) { return ["table", "td", "th"].indexOf(_c(e2)) >= 0; } function Hc(e2) { return ((Mc(e2) ? e2.ownerDocument : e2.document) || window.document).documentElement; } function Wc(e2) { return _c(e2) === "html" ? e2 : e2.assignedSlot || e2.parentNode || (Dc(e2) ? e2.host : null) || Hc(e2); } function Yc(e2) { return !Lc(e2) || jc(e2).position === "fixed" ? null : e2.offsetParent; } function Uc(e2) { var t2 = navigator.userAgent.toLowerCase().indexOf("firefox") !== -1, n2 = navigator.userAgent.indexOf("Trident") !== -1; if (n2 && Lc(e2)) { var o2 = jc(e2); if (o2.position === "fixed") return null; } var a2 = Wc(e2); for (Dc(a2) && (a2 = a2.host); Lc(a2) && ["html", "body"].indexOf(_c(a2)) < 0; ) { var r2 = jc(a2); if (r2.transform !== "none" || r2.perspective !== "none" || r2.contain === "paint" || ["transform", "perspective"].indexOf(r2.willChange) !== -1 || t2 && r2.willChange === "filter" || t2 && r2.filter && r2.filter !== "none") return a2; a2 = a2.parentNode; } return null; } function Kc(e2) { for (var t2 = Oc(e2), n2 = Yc(e2); n2 && zc(n2) && jc(n2).position === "static"; ) n2 = Yc(n2); return n2 && (_c(n2) === "html" || _c(n2) === "body" && jc(n2).position === "static") ? t2 : n2 || Uc(e2) || t2; } function qc(e2) { return ["top", "bottom"].indexOf(e2) >= 0 ? "x" : "y"; } function Gc(e2, t2, n2) { return Pc(e2, Nc(t2, n2)); } function Xc(e2, t2, n2) { var o2 = Gc(e2, t2, n2); return o2 > n2 ? n2 : o2; } function Zc() { return { top: 0, right: 0, bottom: 0, left: 0 }; } function Jc(e2) { return Object.assign({}, Zc(), e2); } function Qc(e2, t2) { return t2.reduce(function(t3, n2) { return t3[n2] = e2, t3; }, {}); } var ed = function(e2, t2) { return e2 = typeof e2 == "function" ? e2(Object.assign({}, t2.rects, { placement: t2.placement })) : e2, Jc(typeof e2 != "number" ? e2 : Qc(e2, sc)); }; function td(e2) { var t2, n2 = e2.state, o2 = e2.name, a2 = e2.options, r2 = n2.elements.arrow, l2 = n2.modifiersData.popperOffsets, s2 = Tc(n2.placement), i2 = qc(s2), u2 = [rc, ac].indexOf(s2) >= 0, c2 = u2 ? "height" : "width"; if (!(!r2 || !l2)) { var d2 = ed(a2.padding, n2), f2 = Vc(r2), p2 = i2 === "y" ? nc : rc, v2 = i2 === "y" ? oc : ac, m2 = n2.rects.reference[c2] + n2.rects.reference[i2] - l2[i2] - n2.rects.popper[c2], h2 = l2[i2] - n2.rects.reference[i2], g2 = Kc(r2), y2 = g2 ? i2 === "y" ? g2.clientHeight || 0 : g2.clientWidth || 0 : 0, b2 = m2 / 2 - h2 / 2, w2 = d2[p2], x2 = y2 - f2[c2] - d2[v2], k2 = y2 / 2 - f2[c2] / 2 + b2, C2 = Gc(w2, k2, x2), S2 = i2; n2.modifiersData[o2] = (t2 = {}, t2[S2] = C2, t2.centerOffset = C2 - k2, t2); } } function nd(e2) { var t2 = e2.state, n2 = e2.options, o2 = n2.element, a2 = o2 === void 0 ? "[data-popper-arrow]" : o2; a2 != null && (typeof a2 == "string" && (a2 = t2.elements.popper.querySelector(a2), !a2) || !Fc(t2.elements.popper, a2) || (t2.elements.arrow = a2)); } var od = { name: "arrow", enabled: true, phase: "main", fn: td, effect: nd, requires: ["popperOffsets"], requiresIfExists: ["preventOverflow"] }; function ad(e2) { return e2.split("-")[1]; } var rd = { top: "auto", right: "auto", bottom: "auto", left: "auto" }; function ld(e2) { var t2 = e2.x, n2 = e2.y, o2 = window, a2 = o2.devicePixelRatio || 1; return { x: Ic(t2 * a2) / a2 || 0, y: Ic(n2 * a2) / a2 || 0 }; } function sd(e2) { var t2, n2 = e2.popper, o2 = e2.popperRect, a2 = e2.placement, r2 = e2.variation, l2 = e2.offsets, s2 = e2.position, i2 = e2.gpuAcceleration, u2 = e2.adaptive, c2 = e2.roundOffsets, d2 = e2.isFixed, f2 = l2.x, p2 = f2 === void 0 ? 0 : f2, v2 = l2.y, m2 = v2 === void 0 ? 0 : v2, h2 = typeof c2 == "function" ? c2({ x: p2, y: m2 }) : { x: p2, y: m2 }; p2 = h2.x, m2 = h2.y; var g2 = l2.hasOwnProperty("x"), y2 = l2.hasOwnProperty("y"), b2 = rc, w2 = nc, x2 = window; if (u2) { var k2 = Kc(n2), C2 = "clientHeight", S2 = "clientWidth"; if (k2 === Oc(n2) && (k2 = Hc(n2), jc(k2).position !== "static" && s2 === "absolute" && (C2 = "scrollHeight", S2 = "scrollWidth")), k2 = k2, a2 === nc || (a2 === rc || a2 === ac) && r2 === uc) { w2 = oc; var E2 = d2 && k2 === x2 && x2.visualViewport ? x2.visualViewport.height : k2[C2]; m2 -= E2 - o2.height, m2 *= i2 ? 1 : -1; } if (a2 === rc || (a2 === nc || a2 === oc) && r2 === uc) { b2 = ac; var _2 = d2 && k2 === x2 && x2.visualViewport ? x2.visualViewport.width : k2[S2]; p2 -= _2 - o2.width, p2 *= i2 ? 1 : -1; } } var O2 = Object.assign({ position: s2 }, u2 && rd), M2 = c2 === true ? ld({ x: p2, y: m2 }) : { x: p2, y: m2 }; if (p2 = M2.x, m2 = M2.y, i2) { var L2; return Object.assign({}, O2, (L2 = {}, L2[w2] = y2 ? "0" : "", L2[b2] = g2 ? "0" : "", L2.transform = (x2.devicePixelRatio || 1) <= 1 ? "translate(" + p2 + "px, " + m2 + "px)" : "translate3d(" + p2 + "px, " + m2 + "px, 0)", L2)); } return Object.assign({}, O2, (t2 = {}, t2[w2] = y2 ? m2 + "px" : "", t2[b2] = g2 ? p2 + "px" : "", t2.transform = "", t2)); } function id(e2) { var t2 = e2.state, n2 = e2.options, o2 = n2.gpuAcceleration, a2 = o2 === void 0 ? true : o2, r2 = n2.adaptive, l2 = r2 === void 0 ? true : r2, s2 = n2.roundOffsets, i2 = s2 === void 0 ? true : s2, u2 = { placement: Tc(t2.placement), variation: ad(t2.placement), popper: t2.elements.popper, popperRect: t2.rects.popper, gpuAcceleration: a2, isFixed: t2.options.strategy === "fixed" }; t2.modifiersData.popperOffsets != null && (t2.styles.popper = Object.assign({}, t2.styles.popper, sd(Object.assign({}, u2, { offsets: t2.modifiersData.popperOffsets, position: t2.options.strategy, adaptive: l2, roundOffsets: i2 })))), t2.modifiersData.arrow != null && (t2.styles.arrow = Object.assign({}, t2.styles.arrow, sd(Object.assign({}, u2, { offsets: t2.modifiersData.arrow, position: "absolute", adaptive: false, roundOffsets: i2 })))), t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-placement": t2.placement }); } var ud = { name: "computeStyles", enabled: true, phase: "beforeWrite", fn: id, data: {} }, cd = { passive: true }; function dd(e2) { var t2 = e2.state, n2 = e2.instance, o2 = e2.options, a2 = o2.scroll, r2 = a2 === void 0 ? true : a2, l2 = o2.resize, s2 = l2 === void 0 ? true : l2, i2 = Oc(t2.elements.popper), u2 = [].concat(t2.scrollParents.reference, t2.scrollParents.popper); return r2 && u2.forEach(function(e3) { e3.addEventListener("scroll", n2.update, cd); }), s2 && i2.addEventListener("resize", n2.update, cd), function() { r2 && u2.forEach(function(e3) { e3.removeEventListener("scroll", n2.update, cd); }), s2 && i2.removeEventListener("resize", n2.update, cd); }; } var fd = { name: "eventListeners", enabled: true, phase: "write", fn: function() { }, effect: dd, data: {} }, pd = { left: "right", right: "left", bottom: "top", top: "bottom" }; function vd(e2) { return e2.replace(/left|right|bottom|top/g, function(e3) { return pd[e3]; }); } var md = { start: "end", end: "start" }; function hd(e2) { return e2.replace(/start|end/g, function(e3) { return md[e3]; }); } function gd(e2) { var t2 = Oc(e2), n2 = t2.pageXOffset, o2 = t2.pageYOffset; return { scrollLeft: n2, scrollTop: o2 }; } function yd(e2) { return Bc(Hc(e2)).left + gd(e2).scrollLeft; } function bd(e2) { var t2 = Oc(e2), n2 = Hc(e2), o2 = t2.visualViewport, a2 = n2.clientWidth, r2 = n2.clientHeight, l2 = 0, s2 = 0; return o2 && (a2 = o2.width, r2 = o2.height, /^((?!chrome|android).)*safari/i.test(navigator.userAgent) || (l2 = o2.offsetLeft, s2 = o2.offsetTop)), { width: a2, height: r2, x: l2 + yd(e2), y: s2 }; } function wd(e2) { var t2, n2 = Hc(e2), o2 = gd(e2), a2 = (t2 = e2.ownerDocument) == null ? void 0 : t2.body, r2 = Pc(n2.scrollWidth, n2.clientWidth, a2 ? a2.scrollWidth : 0, a2 ? a2.clientWidth : 0), l2 = Pc(n2.scrollHeight, n2.clientHeight, a2 ? a2.scrollHeight : 0, a2 ? a2.clientHeight : 0), s2 = -o2.scrollLeft + yd(e2), i2 = -o2.scrollTop; return jc(a2 || n2).direction === "rtl" && (s2 += Pc(n2.clientWidth, a2 ? a2.clientWidth : 0) - r2), { width: r2, height: l2, x: s2, y: i2 }; } function xd(e2) { var t2 = jc(e2), n2 = t2.overflow, o2 = t2.overflowX, a2 = t2.overflowY; return /auto|scroll|overlay|hidden/.test(n2 + a2 + o2); } function kd(e2) { return ["html", "body", "#document"].indexOf(_c(e2)) >= 0 ? e2.ownerDocument.body : Lc(e2) && xd(e2) ? e2 : kd(Wc(e2)); } function Cd(e2, t2) { var n2; t2 === void 0 && (t2 = []); var o2 = kd(e2), a2 = o2 === ((n2 = e2.ownerDocument) == null ? void 0 : n2.body), r2 = Oc(o2), l2 = a2 ? [r2].concat(r2.visualViewport || [], xd(o2) ? o2 : []) : o2, s2 = t2.concat(l2); return a2 ? s2 : s2.concat(Cd(Wc(l2))); } function Sd(e2) { return Object.assign({}, e2, { left: e2.x, top: e2.y, right: e2.x + e2.width, bottom: e2.y + e2.height }); } function Ed(e2) { var t2 = Bc(e2); return t2.top = t2.top + e2.clientTop, t2.left = t2.left + e2.clientLeft, t2.bottom = t2.top + e2.clientHeight, t2.right = t2.left + e2.clientWidth, t2.width = e2.clientWidth, t2.height = e2.clientHeight, t2.x = t2.left, t2.y = t2.top, t2; } function _d(e2, t2) { return t2 === dc ? Sd(bd(e2)) : Mc(t2) ? Ed(t2) : Sd(wd(Hc(e2))); } function Od(e2) { var t2 = Cd(Wc(e2)), n2 = ["absolute", "fixed"].indexOf(jc(e2).position) >= 0, o2 = n2 && Lc(e2) ? Kc(e2) : e2; return Mc(o2) ? t2.filter(function(e3) { return Mc(e3) && Fc(e3, o2) && _c(e3) !== "body"; }) : []; } function Md(e2, t2, n2) { var o2 = t2 === "clippingParents" ? Od(e2) : [].concat(t2), a2 = [].concat(o2, [n2]), r2 = a2[0], l2 = a2.reduce(function(t3, n3) { var o3 = _d(e2, n3); return t3.top = Pc(o3.top, t3.top), t3.right = Nc(o3.right, t3.right), t3.bottom = Nc(o3.bottom, t3.bottom), t3.left = Pc(o3.left, t3.left), t3; }, _d(e2, r2)); return l2.width = l2.right - l2.left, l2.height = l2.bottom - l2.top, l2.x = l2.left, l2.y = l2.top, l2; } function Ld(e2) { var t2 = e2.reference, n2 = e2.element, o2 = e2.placement, a2 = o2 ? Tc(o2) : null, r2 = o2 ? ad(o2) : null, l2 = t2.x + t2.width / 2 - n2.width / 2, s2 = t2.y + t2.height / 2 - n2.height / 2, i2; switch (a2) { case nc: i2 = { x: l2, y: t2.y - n2.height }; break; case oc: i2 = { x: l2, y: t2.y + t2.height }; break; case ac: i2 = { x: t2.x + t2.width, y: s2 }; break; case rc: i2 = { x: t2.x - n2.width, y: s2 }; break; default: i2 = { x: t2.x, y: t2.y }; } var u2 = a2 ? qc(a2) : null; if (u2 != null) { var c2 = u2 === "y" ? "height" : "width"; switch (r2) { case ic: i2[u2] = i2[u2] - (t2[c2] / 2 - n2[c2] / 2); break; case uc: i2[u2] = i2[u2] + (t2[c2] / 2 - n2[c2] / 2); break; } } return i2; } function Dd(e2, t2) { t2 === void 0 && (t2 = {}); var n2 = t2, o2 = n2.placement, a2 = o2 === void 0 ? e2.placement : o2, r2 = n2.boundary, l2 = r2 === void 0 ? cc : r2, s2 = n2.rootBoundary, i2 = s2 === void 0 ? dc : s2, u2 = n2.elementContext, c2 = u2 === void 0 ? fc : u2, d2 = n2.altBoundary, f2 = d2 === void 0 ? false : d2, p2 = n2.padding, v2 = p2 === void 0 ? 0 : p2, m2 = Jc(typeof v2 != "number" ? v2 : Qc(v2, sc)), h2 = c2 === fc ? pc : fc, g2 = e2.rects.popper, y2 = e2.elements[f2 ? h2 : c2], b2 = Md(Mc(y2) ? y2 : y2.contextElement || Hc(e2.elements.popper), l2, i2), w2 = Bc(e2.elements.reference), x2 = Ld({ reference: w2, element: g2, strategy: "absolute", placement: a2 }), k2 = Sd(Object.assign({}, g2, x2)), C2 = c2 === fc ? k2 : w2, S2 = { top: b2.top - C2.top + m2.top, bottom: C2.bottom - b2.bottom + m2.bottom, left: b2.left - C2.left + m2.left, right: C2.right - b2.right + m2.right }, E2 = e2.modifiersData.offset; if (c2 === fc && E2) { var _2 = E2[a2]; Object.keys(S2).forEach(function(e3) { var t3 = [ac, oc].indexOf(e3) >= 0 ? 1 : -1, n3 = [nc, oc].indexOf(e3) >= 0 ? "y" : "x"; S2[e3] += _2[n3] * t3; }); } return S2; } function Ad(e2, t2) { t2 === void 0 && (t2 = {}); var n2 = t2, o2 = n2.placement, a2 = n2.boundary, r2 = n2.rootBoundary, l2 = n2.padding, s2 = n2.flipVariations, i2 = n2.allowedAutoPlacements, u2 = i2 === void 0 ? mc : i2, c2 = ad(o2), d2 = c2 ? s2 ? vc : vc.filter(function(e3) { return ad(e3) === c2; }) : sc, f2 = d2.filter(function(e3) { return u2.indexOf(e3) >= 0; }); f2.length === 0 && (f2 = d2); var p2 = f2.reduce(function(t3, n3) { return t3[n3] = Dd(e2, { placement: n3, boundary: a2, rootBoundary: r2, padding: l2 })[Tc(n3)], t3; }, {}); return Object.keys(p2).sort(function(e3, t3) { return p2[e3] - p2[t3]; }); } function Rd(e2) { if (Tc(e2) === lc) return []; var t2 = vd(e2); return [hd(e2), t2, hd(t2)]; } function $d(e2) { var t2 = e2.state, n2 = e2.options, o2 = e2.name; if (!t2.modifiersData[o2]._skip) { for (var a2 = n2.mainAxis, r2 = a2 === void 0 ? true : a2, l2 = n2.altAxis, s2 = l2 === void 0 ? true : l2, i2 = n2.fallbackPlacements, u2 = n2.padding, c2 = n2.boundary, d2 = n2.rootBoundary, f2 = n2.altBoundary, p2 = n2.flipVariations, v2 = p2 === void 0 ? true : p2, m2 = n2.allowedAutoPlacements, h2 = t2.options.placement, g2 = Tc(h2), y2 = g2 === h2, b2 = i2 || (y2 || !v2 ? [vd(h2)] : Rd(h2)), w2 = [h2].concat(b2).reduce(function(e3, n3) { return e3.concat(Tc(n3) === lc ? Ad(t2, { placement: n3, boundary: c2, rootBoundary: d2, padding: u2, flipVariations: v2, allowedAutoPlacements: m2 }) : n3); }, []), x2 = t2.rects.reference, k2 = t2.rects.popper, C2 = /* @__PURE__ */ new Map(), S2 = true, E2 = w2[0], _2 = 0; _2 < w2.length; _2++) { var O2 = w2[_2], M2 = Tc(O2), L2 = ad(O2) === ic, D2 = [nc, oc].indexOf(M2) >= 0, A2 = D2 ? "width" : "height", R2 = Dd(t2, { placement: O2, boundary: c2, rootBoundary: d2, altBoundary: f2, padding: u2 }), $2 = D2 ? L2 ? ac : rc : L2 ? oc : nc; x2[A2] > k2[A2] && ($2 = vd($2)); var T2 = vd($2), P2 = []; if (r2 && P2.push(R2[M2] <= 0), s2 && P2.push(R2[$2] <= 0, R2[T2] <= 0), P2.every(function(e3) { return e3; })) { E2 = O2, S2 = false; break; } C2.set(O2, P2); } if (S2) for (var N2 = v2 ? 3 : 1, I2 = function(e3) { var t3 = w2.find(function(t4) { var n3 = C2.get(t4); if (n3) return n3.slice(0, e3).every(function(e4) { return e4; }); }); if (t3) return E2 = t3, "break"; }, B2 = N2; B2 > 0; B2--) { var V2 = I2(B2); if (V2 === "break") break; } t2.placement !== E2 && (t2.modifiersData[o2]._skip = true, t2.placement = E2, t2.reset = true); } } var Td = { name: "flip", enabled: true, phase: "main", fn: $d, requiresIfExists: ["offset"], data: { _skip: false } }; function Pd(e2, t2, n2) { return n2 === void 0 && (n2 = { x: 0, y: 0 }), { top: e2.top - t2.height - n2.y, right: e2.right - t2.width + n2.x, bottom: e2.bottom - t2.height + n2.y, left: e2.left - t2.width - n2.x }; } function Nd(e2) { return [nc, ac, oc, rc].some(function(t2) { return e2[t2] >= 0; }); } function Id(e2) { var t2 = e2.state, n2 = e2.name, o2 = t2.rects.reference, a2 = t2.rects.popper, r2 = t2.modifiersData.preventOverflow, l2 = Dd(t2, { elementContext: "reference" }), s2 = Dd(t2, { altBoundary: true }), i2 = Pd(l2, o2), u2 = Pd(s2, a2, r2), c2 = Nd(i2), d2 = Nd(u2); t2.modifiersData[n2] = { referenceClippingOffsets: i2, popperEscapeOffsets: u2, isReferenceHidden: c2, hasPopperEscaped: d2 }, t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-reference-hidden": c2, "data-popper-escaped": d2 }); } var Bd = { name: "hide", enabled: true, phase: "main", requiresIfExists: ["preventOverflow"], fn: Id }; function Vd(e2, t2, n2) { var o2 = Tc(e2), a2 = [rc, nc].indexOf(o2) >= 0 ? -1 : 1, r2 = typeof n2 == "function" ? n2(Object.assign({}, t2, { placement: e2 })) : n2, l2 = r2[0], s2 = r2[1]; return l2 = l2 || 0, s2 = (s2 || 0) * a2, [rc, ac].indexOf(o2) >= 0 ? { x: s2, y: l2 } : { x: l2, y: s2 }; } function Fd(e2) { var t2 = e2.state, n2 = e2.options, o2 = e2.name, a2 = n2.offset, r2 = a2 === void 0 ? [0, 0] : a2, l2 = mc.reduce(function(e3, n3) { return e3[n3] = Vd(n3, t2.rects, r2), e3; }, {}), s2 = l2[t2.placement], i2 = s2.x, u2 = s2.y; t2.modifiersData.popperOffsets != null && (t2.modifiersData.popperOffsets.x += i2, t2.modifiersData.popperOffsets.y += u2), t2.modifiersData[o2] = l2; } var jd = { name: "offset", enabled: true, phase: "main", requires: ["popperOffsets"], fn: Fd }; function zd(e2) { var t2 = e2.state, n2 = e2.name; t2.modifiersData[n2] = Ld({ reference: t2.rects.reference, element: t2.rects.popper, strategy: "absolute", placement: t2.placement }); } var Hd = { name: "popperOffsets", enabled: true, phase: "read", fn: zd, data: {} }; function Wd(e2) { return e2 === "x" ? "y" : "x"; } function Yd(e2) { var t2 = e2.state, n2 = e2.options, o2 = e2.name, a2 = n2.mainAxis, r2 = a2 === void 0 ? true : a2, l2 = n2.altAxis, s2 = l2 === void 0 ? false : l2, i2 = n2.boundary, u2 = n2.rootBoundary, c2 = n2.altBoundary, d2 = n2.padding, f2 = n2.tether, p2 = f2 === void 0 ? true : f2, v2 = n2.tetherOffset, m2 = v2 === void 0 ? 0 : v2, h2 = Dd(t2, { boundary: i2, rootBoundary: u2, padding: d2, altBoundary: c2 }), g2 = Tc(t2.placement), y2 = ad(t2.placement), b2 = !y2, w2 = qc(g2), x2 = Wd(w2), k2 = t2.modifiersData.popperOffsets, C2 = t2.rects.reference, S2 = t2.rects.popper, E2 = typeof m2 == "function" ? m2(Object.assign({}, t2.rects, { placement: t2.placement })) : m2, _2 = typeof E2 == "number" ? { mainAxis: E2, altAxis: E2 } : Object.assign({ mainAxis: 0, altAxis: 0 }, E2), O2 = t2.modifiersData.offset ? t2.modifiersData.offset[t2.placement] : null, M2 = { x: 0, y: 0 }; if (k2) { if (r2) { var L2, D2 = w2 === "y" ? nc : rc, A2 = w2 === "y" ? oc : ac, R2 = w2 === "y" ? "height" : "width", $2 = k2[w2], T2 = $2 + h2[D2], P2 = $2 - h2[A2], N2 = p2 ? -S2[R2] / 2 : 0, I2 = y2 === ic ? C2[R2] : S2[R2], B2 = y2 === ic ? -S2[R2] : -C2[R2], V2 = t2.elements.arrow, F2 = p2 && V2 ? Vc(V2) : { width: 0, height: 0 }, j2 = t2.modifiersData["arrow#persistent"] ? t2.modifiersData["arrow#persistent"].padding : Zc(), z2 = j2[D2], H2 = j2[A2], W2 = Gc(0, C2[R2], F2[R2]), Y2 = b2 ? C2[R2] / 2 - N2 - W2 - z2 - _2.mainAxis : I2 - W2 - z2 - _2.mainAxis, U2 = b2 ? -C2[R2] / 2 + N2 + W2 + H2 + _2.mainAxis : B2 + W2 + H2 + _2.mainAxis, K2 = t2.elements.arrow && Kc(t2.elements.arrow), q2 = K2 ? w2 === "y" ? K2.clientTop || 0 : K2.clientLeft || 0 : 0, G2 = (L2 = O2 == null ? void 0 : O2[w2]) != null ? L2 : 0, X2 = $2 + Y2 - G2 - q2, Z2 = $2 + U2 - G2, J2 = Gc(p2 ? Nc(T2, X2) : T2, $2, p2 ? Pc(P2, Z2) : P2); k2[w2] = J2, M2[w2] = J2 - $2; } if (s2) { var Q2, ee2 = w2 === "x" ? nc : rc, te2 = w2 === "x" ? oc : ac, ne2 = k2[x2], oe2 = x2 === "y" ? "height" : "width", ae2 = ne2 + h2[ee2], re2 = ne2 - h2[te2], le2 = [nc, rc].indexOf(g2) !== -1, se2 = (Q2 = O2 == null ? void 0 : O2[x2]) != null ? Q2 : 0, ie2 = le2 ? ae2 : ne2 - C2[oe2] - S2[oe2] - se2 + _2.altAxis, ue2 = le2 ? ne2 + C2[oe2] + S2[oe2] - se2 - _2.altAxis : re2, ce2 = p2 && le2 ? Xc(ie2, ne2, ue2) : Gc(p2 ? ie2 : ae2, ne2, p2 ? ue2 : re2); k2[x2] = ce2, M2[x2] = ce2 - ne2; } t2.modifiersData[o2] = M2; } } var Ud = { name: "preventOverflow", enabled: true, phase: "main", fn: Yd, requiresIfExists: ["offset"] }; function Kd(e2) { return { scrollLeft: e2.scrollLeft, scrollTop: e2.scrollTop }; } function qd(e2) { return e2 === Oc(e2) || !Lc(e2) ? gd(e2) : Kd(e2); } function Gd(e2) { var t2 = e2.getBoundingClientRect(), n2 = Ic(t2.width) / e2.offsetWidth || 1, o2 = Ic(t2.height) / e2.offsetHeight || 1; return n2 !== 1 || o2 !== 1; } function Xd(e2, t2, n2) { n2 === void 0 && (n2 = false); var o2 = Lc(t2), a2 = Lc(t2) && Gd(t2), r2 = Hc(t2), l2 = Bc(e2, a2), s2 = { scrollLeft: 0, scrollTop: 0 }, i2 = { x: 0, y: 0 }; return (o2 || !o2 && !n2) && ((_c(t2) !== "body" || xd(r2)) && (s2 = qd(t2)), Lc(t2) ? (i2 = Bc(t2, true), i2.x += t2.clientLeft, i2.y += t2.clientTop) : r2 && (i2.x = yd(r2))), { x: l2.left + s2.scrollLeft - i2.x, y: l2.top + s2.scrollTop - i2.y, width: l2.width, height: l2.height }; } function Zd(e2) { var t2 = /* @__PURE__ */ new Map(), n2 = /* @__PURE__ */ new Set(), o2 = []; e2.forEach(function(e3) { t2.set(e3.name, e3); }); function a2(e3) { n2.add(e3.name); var r2 = [].concat(e3.requires || [], e3.requiresIfExists || []); r2.forEach(function(e4) { if (!n2.has(e4)) { var o3 = t2.get(e4); o3 && a2(o3); } }), o2.push(e3); } return e2.forEach(function(e3) { n2.has(e3.name) || a2(e3); }), o2; } function Jd(e2) { var t2 = Zd(e2); return Ec.reduce(function(e3, n2) { return e3.concat(t2.filter(function(e4) { return e4.phase === n2; })); }, []); } function Qd(e2) { var t2; return function() { return t2 || (t2 = new Promise(function(n2) { Promise.resolve().then(function() { t2 = void 0, n2(e2()); }); })), t2; }; } function ef(e2) { var t2 = e2.reduce(function(e3, t3) { var n2 = e3[t3.name]; return e3[t3.name] = n2 ? Object.assign({}, n2, t3, { options: Object.assign({}, n2.options, t3.options), data: Object.assign({}, n2.data, t3.data) }) : t3, e3; }, {}); return Object.keys(t2).map(function(e3) { return t2[e3]; }); } var tf = { placement: "bottom", modifiers: [], strategy: "absolute" }; function nf() { for (var e2 = arguments.length, t2 = new Array(e2), n2 = 0; n2 < e2; n2++) t2[n2] = arguments[n2]; return !t2.some(function(e3) { return !(e3 && typeof e3.getBoundingClientRect == "function"); }); } function of(e2) { e2 === void 0 && (e2 = {}); var t2 = e2, n2 = t2.defaultModifiers, o2 = n2 === void 0 ? [] : n2, a2 = t2.defaultOptions, r2 = a2 === void 0 ? tf : a2; return function(e3, t3, n3) { n3 === void 0 && (n3 = r2); var a3 = { placement: "bottom", orderedModifiers: [], options: Object.assign({}, tf, r2), modifiersData: {}, elements: { reference: e3, popper: t3 }, attributes: {}, styles: {} }, l2 = [], s2 = false, i2 = { state: a3, setOptions: function(n4) { var l3 = typeof n4 == "function" ? n4(a3.options) : n4; c2(), a3.options = Object.assign({}, r2, a3.options, l3), a3.scrollParents = { reference: Mc(e3) ? Cd(e3) : e3.contextElement ? Cd(e3.contextElement) : [], popper: Cd(t3) }; var s3 = Jd(ef([].concat(o2, a3.options.modifiers))); return a3.orderedModifiers = s3.filter(function(e4) { return e4.enabled; }), u2(), i2.update(); }, forceUpdate: function() { if (!s2) { var e4 = a3.elements, t4 = e4.reference, n4 = e4.popper; if (nf(t4, n4)) { a3.rects = { reference: Xd(t4, Kc(n4), a3.options.strategy === "fixed"), popper: Vc(n4) }, a3.reset = false, a3.placement = a3.options.placement, a3.orderedModifiers.forEach(function(e5) { return a3.modifiersData[e5.name] = Object.assign({}, e5.data); }); for (var o3 = 0; o3 < a3.orderedModifiers.length; o3++) { if (a3.reset === true) { a3.reset = false, o3 = -1; continue; } var r3 = a3.orderedModifiers[o3], l3 = r3.fn, u3 = r3.options, c3 = u3 === void 0 ? {} : u3, d2 = r3.name; typeof l3 == "function" && (a3 = l3({ state: a3, options: c3, name: d2, instance: i2 }) || a3); } } } }, update: Qd(function() { return new Promise(function(e4) { i2.forceUpdate(), e4(a3); }); }), destroy: function() { c2(), s2 = true; } }; if (!nf(e3, t3)) return i2; i2.setOptions(n3).then(function(e4) { !s2 && n3.onFirstUpdate && n3.onFirstUpdate(e4); }); function u2() { a3.orderedModifiers.forEach(function(e4) { var t4 = e4.name, n4 = e4.options, o3 = n4 === void 0 ? {} : n4, r3 = e4.effect; if (typeof r3 == "function") { var s3 = r3({ state: a3, name: t4, instance: i2, options: o3 }), u3 = function() { }; l2.push(s3 || u3); } }); } function c2() { l2.forEach(function(e4) { return e4(); }), l2 = []; } return i2; }; } of(); var af = [fd, Hd, ud, $c]; of({ defaultModifiers: af }); var rf = [fd, Hd, ud, $c, jd, Td, Ud, od, Bd], lf = of({ defaultModifiers: rf }); const sf = (e2, t2, n2 = {}) => { const o2 = { name: "updateState", enabled: true, phase: "write", fn: ({ state: e3 }) => { const t3 = uf(e3); Object.assign(s2.value, t3); }, requires: ["computeStyles"] }; const a2 = vue.computed(() => { const { onFirstUpdate: e3, placement: t3, strategy: a3, modifiers: r3 } = vue.unref(n2); return { onFirstUpdate: e3, placement: t3 || "bottom", strategy: a3 || "absolute", modifiers: [...r3 || [], o2, { name: "applyStyles", enabled: false }] }; }); const r2 = vue.shallowRef(); const s2 = vue.ref({ styles: { popper: { position: vue.unref(a2).strategy, left: "0", top: "0" }, arrow: { position: "absolute" } }, attributes: {} }); const c2 = () => { if (!r2.value) return; r2.value.destroy(); r2.value = void 0; }; vue.watch(a2, (e3) => { const t3 = vue.unref(r2); if (t3) { t3.setOptions(e3); } }, { deep: true }); vue.watch([e2, t2], ([e3, t3]) => { c2(); if (!e3 || !t3) return; r2.value = lf(e3, t3, vue.unref(a2)); }); vue.onBeforeUnmount(() => { c2(); }); return { state: vue.computed(() => { var e3; return { ...((e3 = vue.unref(r2)) == null ? void 0 : e3.state) || {} }; }), styles: vue.computed(() => vue.unref(s2).styles), attributes: vue.computed(() => vue.unref(s2).attributes), update: () => { var e3; return (e3 = vue.unref(r2)) == null ? void 0 : e3.update(); }, forceUpdate: () => { var e3; return (e3 = vue.unref(r2)) == null ? void 0 : e3.forceUpdate(); }, instanceRef: vue.computed(() => vue.unref(r2)) }; }; function uf(e2) { const t2 = Object.keys(e2.elements); const n2 = Fs(t2.map((t3) => [t3, e2.styles[t3] || {}])); const o2 = Fs(t2.map((t3) => [t3, e2.attributes[t3]])); return { styles: n2, attributes: o2 }; } const cf = (e2) => { if (!e2) { return { onClick: yt, onMousedown: yt, onMouseup: yt }; } let t2 = false; let n2 = false; const o2 = (o3) => { if (t2 && n2) { e2(o3); } t2 = n2 = false; }; const a2 = (e3) => { t2 = e3.target === e3.currentTarget; }; const r2 = (e3) => { n2 = e3.target === e3.currentTarget; }; return { onClick: o2, onMousedown: a2, onMouseup: r2 }; }; function df() { let e2; const t2 = (t3, o2) => { n2(); e2 = window.setTimeout(t3, o2); }; const n2 = () => window.clearTimeout(e2); We(() => n2()); return { registerTimeout: t2, cancelTimeout: n2 }; } const ff = { prefix: Math.floor(Math.random() * 1e4), current: 0 }; const pf = Symbol("elIdInjection"); const vf = () => vue.getCurrentInstance() ? vue.inject(pf, ff) : ff; const mf = (e2) => { const t2 = vf(); const n2 = Gu(); const o2 = vue.computed(() => vue.unref(e2) || `${n2.value}-id-${t2.prefix}-${t2.current++}`); return o2; }; let hf = []; const gf = (e2) => { const t2 = e2; if (t2.key === ku.esc) { hf.forEach((e3) => e3(t2)); } }; const yf = (e2) => { vue.onMounted(() => { if (hf.length === 0) { document.addEventListener("keydown", gf); } if (Be) hf.push(e2); }); vue.onBeforeUnmount(() => { hf = hf.filter((t2) => t2 !== e2); if (hf.length === 0) { if (Be) document.removeEventListener("keydown", gf); } }); }; let bf; const wf = () => { const e2 = Gu(); const t2 = vf(); const n2 = vue.computed(() => `${e2.value}-popper-container-${t2.prefix}`); const o2 = vue.computed(() => `#${n2.value}`); return { id: n2, selector: o2 }; }; const xf = (e2) => { const t2 = document.createElement("div"); t2.id = e2; document.body.appendChild(t2); return t2; }; const kf = () => { const { id: e2, selector: t2 } = wf(); vue.onBeforeMount(() => { if (!Be) return; if (!bf && !document.body.querySelector(t2.value)) { bf = xf(e2.value); } }); return { id: e2, selector: t2 }; }; const Cf = fu({ showAfter: { type: Number, default: 0 }, hideAfter: { type: Number, default: 200 }, autoClose: { type: Number, default: 0 } }); const Sf = ({ showAfter: e2, hideAfter: t2, autoClose: n2, open: o2, close: a2 }) => { const { registerTimeout: r2 } = df(); const { registerTimeout: l2, cancelTimeout: s2 } = df(); const i2 = (t3) => { r2(() => { o2(t3); const e3 = vue.unref(n2); if (Js(e3) && e3 > 0) { l2(() => { a2(t3); }, e3); } }, vue.unref(e2)); }; const c2 = (e3) => { s2(); r2(() => { a2(e3); }, vue.unref(t2)); }; return { onOpen: i2, onClose: c2 }; }; const Ef = Symbol("elForwardRef"); const _f = (e2) => { const t2 = (t3) => { e2.value = t3; }; vue.provide(Ef, { setForwardRef: t2 }); }; const Of = (e2) => ({ mounted(t2) { e2(t2); }, updated(t2) { e2(t2); }, unmounted() { e2(null); } }); const Mf = { current: 0 }; const Lf = vue.ref(0); const Df = 2e3; const Af = Symbol("elZIndexContextKey"); const Rf = Symbol("zIndexContextKey"); const $f = (e2) => { const t2 = vue.getCurrentInstance() ? vue.inject(Af, Mf) : Mf; const n2 = e2 || (vue.getCurrentInstance() ? vue.inject(Rf, void 0) : void 0); const o2 = vue.computed(() => { const e3 = vue.unref(n2); return Js(e3) ? e3 : Df; }); const a2 = vue.computed(() => o2.value + Lf.value); const r2 = () => { t2.current++; Lf.value = t2.current; return a2.value; }; if (!Be && !vue.inject(Af)) ; return { initialZIndex: o2, currentZIndex: a2, nextZIndex: r2 }; }; function Tf(e2) { let t2; function n2() { if (e2.value == void 0) return; const { selectionStart: n3, selectionEnd: o3, value: a2 } = e2.value; if (n3 == null || o3 == null) return; const r2 = a2.slice(0, Math.max(0, n3)); const l2 = a2.slice(Math.max(0, o3)); t2 = { selectionStart: n3, selectionEnd: o3, value: a2, beforeTxt: r2, afterTxt: l2 }; } function o2() { if (e2.value == void 0 || t2 == void 0) return; const { value: n3 } = e2.value; const { beforeTxt: o3, afterTxt: a2, selectionStart: r2 } = t2; if (o3 == void 0 || a2 == void 0 || r2 == void 0) return; let l2 = n3.length; if (n3.endsWith(a2)) { l2 = n3.length - a2.length; } else if (n3.startsWith(o3)) { l2 = o3.length; } else { const e3 = o3[r2 - 1]; const t3 = n3.indexOf(e3, r2 - 1); if (t3 !== -1) { l2 = t3 + 1; } } e2.value.setSelectionRange(l2, l2); } return [n2, o2]; } const Pf = (e2, t2, n2) => { const o2 = Du(e2.subTree).filter((e3) => { var n3; return vue.isVNode(e3) && ((n3 = e3.type) == null ? void 0 : n3.name) === t2 && !!e3.component; }); const a2 = o2.map((e3) => e3.component.uid); return a2.map((e3) => n2[e3]).filter((e3) => !!e3); }; const Nf = (e2, t2) => { const n2 = {}; const o2 = vue.shallowRef([]); const a2 = (a3) => { n2[a3.uid] = a3; o2.value = Pf(e2, t2, n2); }; const r2 = (e3) => { delete n2[e3]; o2.value = o2.value.filter((t3) => t3.uid !== e3); }; return { children: o2, addChild: a2, removeChild: r2 }; }; const If = du({ type: String, values: Ou, required: false }); const Bf = Symbol("size"); const Vf = () => { const e2 = vue.inject(Bf, {}); return vue.computed(() => vue.unref(e2.size) || ""); }; function Ff(e2, { beforeFocus: t2, afterFocus: n2, beforeBlur: o2, afterBlur: a2 } = {}) { const r2 = vue.getCurrentInstance(); const { emit: l2 } = r2; const u2 = vue.shallowRef(); const c2 = vue.ref(false); const d2 = (e3) => { const o3 = Ct(t2) ? t2(e3) : false; if (o3 || c2.value) return; c2.value = true; l2("focus", e3); n2 == null ? void 0 : n2(); }; const f2 = (e3) => { var t3; const n3 = Ct(o2) ? o2(e3) : false; if (n3 || e3.relatedTarget && ((t3 = u2.value) == null ? void 0 : t3.contains(e3.relatedTarget))) return; c2.value = false; l2("blur", e3); a2 == null ? void 0 : a2(); }; const p2 = () => { var t3, n3; if (((t3 = u2.value) == null ? void 0 : t3.contains(document.activeElement)) && u2.value !== document.activeElement) return; (n3 = e2.value) == null ? void 0 : n3.focus(); }; vue.watch(u2, (e3) => { if (e3) { e3.setAttribute("tabindex", "-1"); } }); Xe(u2, "focus", d2, true); Xe(u2, "blur", f2, true); Xe(u2, "click", p2, true); return { isFocused: c2, wrapperRef: u2, handleFocus: d2, handleBlur: f2 }; } function jf({ afterComposition: e2, emit: t2 }) { const n2 = vue.ref(false); const o2 = (e3) => { t2 == null ? void 0 : t2("compositionstart", e3); n2.value = true; }; const a2 = (e3) => { var o3; t2 == null ? void 0 : t2("compositionupdate", e3); const a3 = (o3 = e3.target) == null ? void 0 : o3.value; const r3 = a3[a3.length - 1] || ""; n2.value = !Ru(r3); }; const r2 = (o3) => { t2 == null ? void 0 : t2("compositionend", o3); if (n2.value) { n2.value = false; vue.nextTick(() => e2(o3)); } }; const l2 = (e3) => { e3.type === "compositionend" ? r2(e3) : a2(e3); }; return { isComposing: n2, handleComposition: l2, handleCompositionStart: o2, handleCompositionUpdate: a2, handleCompositionEnd: r2 }; } const zf = Symbol("emptyValuesContextKey"); const Hf = ["", void 0, null]; const Wf = fu({ emptyValues: Array, valueOnClear: { type: [String, Number, Boolean, Function], default: void 0, validator: (e2) => Ct(e2) ? !e2() : !e2 } }); const Yf = (e2, t2) => { const n2 = vue.getCurrentInstance() ? vue.inject(zf, vue.ref({})) : vue.ref({}); const o2 = vue.computed(() => e2.emptyValues || n2.value.emptyValues || Hf); const a2 = vue.computed(() => { if (Ct(e2.valueOnClear)) { return e2.valueOnClear(); } else if (e2.valueOnClear !== void 0) { return e2.valueOnClear; } else if (Ct(n2.value.valueOnClear)) { return n2.value.valueOnClear(); } else if (n2.value.valueOnClear !== void 0) { return n2.value.valueOnClear; } return t2; }); const r2 = (e3) => o2.value.includes(e3); if (!o2.value.includes(a2.value)) ; return { emptyValues: o2, valueOnClear: a2, isEmptyValue: r2 }; }; const Uf = fu({ ariaLabel: String, ariaOrientation: { type: String, values: ["horizontal", "vertical", "undefined"] }, ariaControls: String }); const Kf = (e2) => qs(Uf, e2); const qf = Symbol(); const Gf = vue.ref(); function Xf(e2, t2 = void 0) { const n2 = vue.getCurrentInstance() ? vue.inject(qf, Gf) : Gf; if (e2) { return vue.computed(() => { var o2, a2; return (a2 = (o2 = n2.value) == null ? void 0 : o2[e2]) != null ? a2 : t2; }); } else { return n2; } } function Zf(e2, t2) { const n2 = Xf(); const o2 = Xu(e2, vue.computed(() => { var e3; return ((e3 = n2.value) == null ? void 0 : e3.namespace) || Yu; })); const a2 = Wu(vue.computed(() => { var e3; return (e3 = n2.value) == null ? void 0 : e3.locale; })); const r2 = $f(vue.computed(() => { var e3; return ((e3 = n2.value) == null ? void 0 : e3.zIndex) || Df; })); const s2 = vue.computed(() => { var e3; return vue.unref(t2) || ((e3 = n2.value) == null ? void 0 : e3.size) || ""; }); Jf(vue.computed(() => vue.unref(n2) || {})); return { ns: o2, locale: a2, zIndex: r2, size: s2 }; } const Jf = (e2, t2, n2 = false) => { var o2; const a2 = !!vue.getCurrentInstance(); const r2 = a2 ? Xf() : void 0; const i2 = (o2 = void 0) != null ? o2 : a2 ? vue.provide : void 0; if (!i2) { return; } const c2 = vue.computed(() => { const t3 = vue.unref(e2); if (!(r2 == null ? void 0 : r2.value)) return t3; return Qf(r2.value, t3); }); i2(qf, c2); i2(Hu, vue.computed(() => c2.value.locale)); i2(qu, vue.computed(() => c2.value.namespace)); i2(Rf, vue.computed(() => c2.value.zIndex)); i2(Bf, { size: vue.computed(() => c2.value.size || "") }); i2(zf, vue.computed(() => ({ emptyValues: c2.value.emptyValues, valueOnClear: c2.value.valueOnClear }))); if (n2 || !Gf.value) { Gf.value = c2.value; } return c2; }; const Qf = (e2, t2) => { const n2 = [.../* @__PURE__ */ new Set([...ri(e2), ...ri(t2)])]; const o2 = {}; for (const a2 of n2) { o2[a2] = t2[a2] !== void 0 ? t2[a2] : e2[a2]; } return o2; }; const ep = fu({ a11y: { type: Boolean, default: true }, locale: { type: uu(Object) }, size: If, button: { type: uu(Object) }, experimentalFeatures: { type: uu(Object) }, keyboardNavigation: { type: Boolean, default: true }, message: { type: uu(Object) }, zIndex: Number, namespace: { type: String, default: "el" }, ...Wf }); const tp = {}; vue.defineComponent({ name: "ElConfigProvider", props: ep, setup(e2, { slots: t2 }) { vue.watch(() => e2.message, (e3) => { Object.assign(tp, e3 != null ? e3 : {}); }, { immediate: true, deep: true }); const n2 = Jf(e2); return () => vue.renderSlot(t2, "default", { config: n2 == null ? void 0 : n2.value }); } }); var np = (e2, t2) => { const n2 = e2.__vccOpts || e2; for (const [e3, o2] of t2) { n2[e3] = o2; } return n2; }; const op = fu({ size: { type: uu([Number, String]) }, color: { type: String } }); const ap = vue.defineComponent({ name: "ElIcon", inheritAttrs: false }); const rp = vue.defineComponent({ ...ap, props: op, setup(e2) { const o2 = e2; const a2 = Xu("icon"); const r2 = vue.computed(() => { const { size: e3, color: t2 } = o2; if (!e3 && !t2) return {}; return { fontSize: Xs(e3) ? void 0 : mi(e3), "--color": t2 }; }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("i", vue.mergeProps({ class: vue.unref(a2).b(), style: vue.unref(r2) }, e3.$attrs), [vue.renderSlot(e3.$slots, "default")], 16)); } }); var lp = np(rp, [["__file", "icon.vue"]]); const sp = yu(lp); const ip = Symbol("formContextKey"); const up = Symbol("formItemContextKey"); const cp = (e2, t2 = {}) => { const n2 = vue.ref(void 0); const o2 = t2.prop ? n2 : tc("size"); const a2 = t2.global ? n2 : Vf(); const r2 = t2.form ? { size: void 0 } : vue.inject(ip, void 0); const s2 = t2.formItem ? { size: void 0 } : vue.inject(up, void 0); return vue.computed(() => o2.value || vue.unref(e2) || (s2 == null ? void 0 : s2.size) || (r2 == null ? void 0 : r2.size) || a2.value || ""); }; const dp = (e2) => { const t2 = tc("disabled"); const n2 = vue.inject(ip, void 0); return vue.computed(() => t2.value || vue.unref(e2) || (n2 == null ? void 0 : n2.disabled) || false); }; const fp = () => { const e2 = vue.inject(ip, void 0); const t2 = vue.inject(up, void 0); return { form: e2, formItem: t2 }; }; const pp = (e2, { formItemContext: t2, disableIdGeneration: n2, disableIdManagement: o2 }) => { if (!n2) { n2 = vue.ref(false); } if (!o2) { o2 = vue.ref(false); } const a2 = vue.ref(); let r2 = void 0; const s2 = vue.computed(() => { var n3; return !!(!(e2.label || e2.ariaLabel) && t2 && t2.inputIds && ((n3 = t2.inputIds) == null ? void 0 : n3.length) <= 1); }); vue.onMounted(() => { r2 = vue.watch([vue.toRef(e2, "id"), n2], ([e3, n3]) => { const r3 = e3 != null ? e3 : !n3 ? mf().value : void 0; if (r3 !== a2.value) { if (t2 == null ? void 0 : t2.removeInputId) { a2.value && t2.removeInputId(a2.value); if (!(o2 == null ? void 0 : o2.value) && !n3 && r3) { t2.addInputId(r3); } } a2.value = r3; } }, { immediate: true }); }); vue.onUnmounted(() => { r2 && r2(); if (t2 == null ? void 0 : t2.removeInputId) { a2.value && t2.removeInputId(a2.value); } }); return { isLabeledByFormItem: s2, inputId: a2 }; }; let vp = void 0; const mp = ` height:0 !important; visibility:hidden !important; ${gt() ? "" : "overflow:hidden !important;"} position:absolute !important; z-index:-1000 !important; top:0 !important; right:0 !important; `; const hp = ["letter-spacing", "line-height", "padding-top", "padding-bottom", "font-family", "font-weight", "font-size", "text-rendering", "text-transform", "width", "text-indent", "padding-left", "padding-right", "border-width", "box-sizing"]; function gp(e2) { const t2 = window.getComputedStyle(e2); const n2 = t2.getPropertyValue("box-sizing"); const o2 = Number.parseFloat(t2.getPropertyValue("padding-bottom")) + Number.parseFloat(t2.getPropertyValue("padding-top")); const a2 = Number.parseFloat(t2.getPropertyValue("border-bottom-width")) + Number.parseFloat(t2.getPropertyValue("border-top-width")); const r2 = hp.map((e3) => `${e3}:${t2.getPropertyValue(e3)}`).join(";"); return { contextStyle: r2, paddingSize: o2, borderSize: a2, boxSizing: n2 }; } function yp(e2, t2 = 1, n2) { var o2; if (!vp) { vp = document.createElement("textarea"); document.body.appendChild(vp); } const { paddingSize: a2, borderSize: r2, boxSizing: l2, contextStyle: s2 } = gp(e2); vp.setAttribute("style", `${s2};${mp}`); vp.value = e2.value || e2.placeholder || ""; let i2 = vp.scrollHeight; const u2 = {}; if (l2 === "border-box") { i2 = i2 + r2; } else if (l2 === "content-box") { i2 = i2 - a2; } vp.value = ""; const c2 = vp.scrollHeight - a2; if (Js(t2)) { let e3 = c2 * t2; if (l2 === "border-box") { e3 = e3 + a2 + r2; } i2 = Math.max(e3, i2); u2.minHeight = `${e3}px`; } if (Js(n2)) { let e3 = c2 * n2; if (l2 === "border-box") { e3 = e3 + a2 + r2; } i2 = Math.min(e3, i2); } u2.height = `${i2}px`; (o2 = vp.parentNode) == null ? void 0 : o2.removeChild(vp); vp = void 0; return u2; } const bp = fu({ id: { type: String, default: void 0 }, size: If, disabled: Boolean, modelValue: { type: uu([String, Number, Object]), default: "" }, maxlength: { type: [String, Number] }, minlength: { type: [String, Number] }, type: { type: String, default: "text" }, resize: { type: String, values: ["none", "both", "horizontal", "vertical"] }, autosize: { type: uu([Boolean, Object]), default: false }, autocomplete: { type: String, default: "off" }, formatter: { type: Function }, parser: { type: Function }, placeholder: { type: String }, form: { type: String }, readonly: Boolean, clearable: Boolean, showPassword: Boolean, showWordLimit: Boolean, suffixIcon: { type: pu }, prefixIcon: { type: pu }, containerRole: { type: String, default: void 0 }, tabindex: { type: [String, Number], default: 0 }, validateEvent: { type: Boolean, default: true }, inputStyle: { type: uu([Object, Array, String]), default: () => $u({}) }, autofocus: Boolean, rows: { type: Number, default: 2 }, ...Kf(["ariaLabel"]) }); const wp = { [Su]: (e2) => St(e2), input: (e2) => St(e2), change: (e2) => St(e2), focus: (e2) => e2 instanceof FocusEvent, blur: (e2) => e2 instanceof FocusEvent, clear: () => true, mouseleave: (e2) => e2 instanceof MouseEvent, mouseenter: (e2) => e2 instanceof MouseEvent, keydown: (e2) => e2 instanceof Event, compositionstart: (e2) => e2 instanceof CompositionEvent, compositionupdate: (e2) => e2 instanceof CompositionEvent, compositionend: (e2) => e2 instanceof CompositionEvent }; const xp = vue.defineComponent({ name: "ElInput", inheritAttrs: false }); const kp = vue.defineComponent({ ...xp, props: bp, emits: wp, setup(e2, { expose: a2, emit: r2 }) { const s2 = e2; const d2 = vue.useAttrs(); const f2 = vue.useSlots(); const p2 = vue.computed(() => { const e3 = {}; if (s2.containerRole === "combobox") { e3["aria-haspopup"] = d2["aria-haspopup"]; e3["aria-owns"] = d2["aria-owns"]; e3["aria-expanded"] = d2["aria-expanded"]; } return e3; }); const m2 = vue.computed(() => [s2.type === "textarea" ? j2.b() : F2.b(), F2.m(B2.value), F2.is("disabled", V2.value), F2.is("exceed", ie2.value), { [F2.b("group")]: f2.prepend || f2.append, [F2.m("prefix")]: f2.prefix || s2.prefixIcon, [F2.m("suffix")]: f2.suffix || s2.suffixIcon || s2.clearable || s2.showPassword, [F2.bm("suffix", "password-clear")]: ae2.value && re2.value, [F2.b("hidden")]: s2.type === "hidden" }, d2.class]); const h2 = vue.computed(() => [F2.e("wrapper"), F2.is("focus", X2.value)]); const y2 = Nu({ excludeKeys: vue.computed(() => Object.keys(p2.value)) }); const { form: b2, formItem: S2 } = fp(); const { inputId: I2 } = pp(s2, { formItemContext: S2 }); const B2 = cp(); const V2 = dp(); const F2 = Xu("input"); const j2 = Xu("textarea"); const z2 = vue.shallowRef(); const H2 = vue.shallowRef(); const W2 = vue.ref(false); const Y2 = vue.ref(false); const U2 = vue.ref(); const K2 = vue.shallowRef(s2.inputStyle); const q2 = vue.computed(() => z2.value || H2.value); const { wrapperRef: G2, isFocused: X2 } = Ff(q2, { afterBlur() { var e3; if (s2.validateEvent) { (e3 = S2 == null ? void 0 : S2.validate) == null ? void 0 : e3.call(S2, "blur").catch((e4) => ui()); } } }); const Z2 = vue.computed(() => { var e3; return (e3 = b2 == null ? void 0 : b2.statusIcon) != null ? e3 : false; }); const J2 = vue.computed(() => (S2 == null ? void 0 : S2.validateState) || ""); const Q2 = vue.computed(() => J2.value && gu[J2.value]); const ee2 = vue.computed(() => Y2.value ? ru : Hi); const te2 = vue.computed(() => [d2.style]); const ne2 = vue.computed(() => [s2.inputStyle, K2.value, { resize: s2.resize }]); const oe2 = vue.computed(() => zs(s2.modelValue) ? "" : String(s2.modelValue)); const ae2 = vue.computed(() => s2.clearable && !V2.value && !s2.readonly && !!oe2.value && (X2.value || W2.value)); const re2 = vue.computed(() => s2.showPassword && !V2.value && !s2.readonly && !!oe2.value && (!!oe2.value || X2.value)); const le2 = vue.computed(() => s2.showWordLimit && !!s2.maxlength && (s2.type === "text" || s2.type === "textarea") && !V2.value && !s2.readonly && !s2.showPassword); const se2 = vue.computed(() => oe2.value.length); const ie2 = vue.computed(() => !!le2.value && se2.value > Number(s2.maxlength)); const ue2 = vue.computed(() => !!f2.suffix || !!s2.suffixIcon || ae2.value || s2.showPassword || le2.value || !!J2.value && Z2.value); const [ce2, de2] = Tf(z2); st(H2, (e3) => { ve2(); if (!le2.value || s2.resize !== "both") return; const t2 = e3[0]; const { width: n2 } = t2.contentRect; U2.value = { right: `calc(100% - ${n2 + 15 + 6}px)` }; }); const fe2 = () => { const { type: e3, autosize: t2 } = s2; if (!Be || e3 !== "textarea" || !H2.value) return; if (t2) { const e4 = Et(t2) ? t2.minRows : void 0; const n2 = Et(t2) ? t2.maxRows : void 0; const o2 = yp(H2.value, e4, n2); K2.value = { overflowY: "hidden", ...o2 }; vue.nextTick(() => { H2.value.offsetHeight; K2.value = o2; }); } else { K2.value = { minHeight: yp(H2.value).minHeight }; } }; const pe2 = (e3) => { let t2 = false; return () => { var n2; if (t2 || !s2.autosize) return; const o2 = ((n2 = H2.value) == null ? void 0 : n2.offsetParent) === null; if (!o2) { e3(); t2 = true; } }; }; const ve2 = pe2(fe2); const me2 = () => { const e3 = q2.value; const t2 = s2.formatter ? s2.formatter(oe2.value) : oe2.value; if (!e3 || e3.value === t2) return; e3.value = t2; }; const he2 = async (e3) => { ce2(); let { value: t2 } = e3.target; if (s2.formatter) { t2 = s2.parser ? s2.parser(t2) : t2; } if (ye2.value) return; if (t2 === oe2.value) { me2(); return; } r2(Su, t2); r2("input", t2); await vue.nextTick(); me2(); de2(); }; const ge2 = (e3) => { r2("change", e3.target.value); }; const { isComposing: ye2, handleCompositionStart: be2, handleCompositionUpdate: we2, handleCompositionEnd: xe2 } = jf({ emit: r2, afterComposition: he2 }); const ke2 = () => { Y2.value = !Y2.value; Ce2(); }; const Ce2 = async () => { var e3; await vue.nextTick(); (e3 = q2.value) == null ? void 0 : e3.focus(); }; const Se2 = () => { var e3; return (e3 = q2.value) == null ? void 0 : e3.blur(); }; const Ee2 = (e3) => { W2.value = false; r2("mouseleave", e3); }; const _e2 = (e3) => { W2.value = true; r2("mouseenter", e3); }; const Oe2 = (e3) => { r2("keydown", e3); }; const Me2 = () => { var e3; (e3 = q2.value) == null ? void 0 : e3.select(); }; const Le2 = () => { r2(Su, ""); r2("change", ""); r2("clear"); r2("input", ""); }; vue.watch(() => s2.modelValue, () => { var e3; vue.nextTick(() => fe2()); if (s2.validateEvent) { (e3 = S2 == null ? void 0 : S2.validate) == null ? void 0 : e3.call(S2, "change").catch((e4) => ui()); } }); vue.watch(oe2, () => me2()); vue.watch(() => s2.type, async () => { await vue.nextTick(); me2(); fe2(); }); vue.onMounted(() => { if (!s2.formatter && s2.parser) ; me2(); vue.nextTick(fe2); }); a2({ input: z2, textarea: H2, ref: q2, textareaStyle: ne2, autosize: vue.toRef(s2, "autosize"), isComposing: ye2, focus: Ce2, blur: Se2, select: Me2, clear: Le2, resizeTextarea: fe2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", vue.mergeProps(vue.unref(p2), { class: [vue.unref(m2), { [vue.unref(F2).bm("group", "append")]: e3.$slots.append, [vue.unref(F2).bm("group", "prepend")]: e3.$slots.prepend }], style: vue.unref(te2), role: e3.containerRole, onMouseenter: _e2, onMouseleave: Ee2 }), [vue.createCommentVNode(" input "), e3.type !== "textarea" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createCommentVNode(" prepend slot "), e3.$slots.prepend ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(F2).be("group", "prepend")) }, [vue.renderSlot(e3.$slots, "prepend")], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { ref_key: "wrapperRef", ref: G2, class: vue.normalizeClass(vue.unref(h2)) }, [vue.createCommentVNode(" prefix slot "), e3.$slots.prefix || e3.prefixIcon ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(F2).e("prefix")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(F2).e("prefix-inner")) }, [vue.renderSlot(e3.$slots, "prefix"), e3.prefixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0, class: vue.normalizeClass(vue.unref(F2).e("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.prefixIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 2)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", vue.mergeProps({ id: vue.unref(I2), ref_key: "input", ref: z2, class: vue.unref(F2).e("inner") }, vue.unref(y2), { minlength: e3.minlength, maxlength: e3.maxlength, type: e3.showPassword ? Y2.value ? "text" : "password" : e3.type, disabled: vue.unref(V2), readonly: e3.readonly, autocomplete: e3.autocomplete, tabindex: e3.tabindex, "aria-label": e3.ariaLabel, placeholder: e3.placeholder, style: e3.inputStyle, form: e3.form, autofocus: e3.autofocus, onCompositionstart: vue.unref(be2), onCompositionupdate: vue.unref(we2), onCompositionend: vue.unref(xe2), onInput: he2, onChange: ge2, onKeydown: Oe2 }), null, 16, ["id", "minlength", "maxlength", "type", "disabled", "readonly", "autocomplete", "tabindex", "aria-label", "placeholder", "form", "autofocus", "onCompositionstart", "onCompositionupdate", "onCompositionend"]), vue.createCommentVNode(" suffix slot "), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(F2).e("suffix")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(F2).e("suffix-inner")) }, [!vue.unref(ae2) || !vue.unref(re2) || !vue.unref(le2) ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.renderSlot(e3.$slots, "suffix"), e3.suffixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0, class: vue.normalizeClass(vue.unref(F2).e("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.suffixIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 64)) : vue.createCommentVNode("v-if", true), vue.unref(ae2) ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 1, class: vue.normalizeClass([vue.unref(F2).e("icon"), vue.unref(F2).e("clear")]), onMousedown: vue.withModifiers(vue.unref(yt), ["prevent"]), onClick: Le2 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref($i))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.unref(re2) ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 2, class: vue.normalizeClass([vue.unref(F2).e("icon"), vue.unref(F2).e("password")]), onClick: ke2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ee2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.unref(le2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 3, class: vue.normalizeClass(vue.unref(F2).e("count")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(F2).e("count-inner")) }, vue.toDisplayString(vue.unref(se2)) + " / " + vue.toDisplayString(e3.maxlength), 3)], 2)) : vue.createCommentVNode("v-if", true), vue.unref(J2) && vue.unref(Q2) && vue.unref(Z2) ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 4, class: vue.normalizeClass([vue.unref(F2).e("icon"), vue.unref(F2).e("validateIcon"), vue.unref(F2).is("loading", vue.unref(J2) === "validating")]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(Q2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 2)], 2)) : vue.createCommentVNode("v-if", true)], 2), vue.createCommentVNode(" append slot "), e3.$slots.append ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass(vue.unref(F2).be("group", "append")) }, [vue.renderSlot(e3.$slots, "append")], 2)) : vue.createCommentVNode("v-if", true)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createCommentVNode(" textarea "), vue.createElementVNode("textarea", vue.mergeProps({ id: vue.unref(I2), ref_key: "textarea", ref: H2, class: [vue.unref(j2).e("inner"), vue.unref(F2).is("focus", vue.unref(X2))] }, vue.unref(y2), { minlength: e3.minlength, maxlength: e3.maxlength, tabindex: e3.tabindex, disabled: vue.unref(V2), readonly: e3.readonly, autocomplete: e3.autocomplete, style: vue.unref(ne2), "aria-label": e3.ariaLabel, placeholder: e3.placeholder, form: e3.form, autofocus: e3.autofocus, rows: e3.rows, onCompositionstart: vue.unref(be2), onCompositionupdate: vue.unref(we2), onCompositionend: vue.unref(xe2), onInput: he2, onChange: ge2, onKeydown: Oe2 }), null, 16, ["id", "minlength", "maxlength", "tabindex", "disabled", "readonly", "autocomplete", "aria-label", "placeholder", "form", "autofocus", "rows", "onCompositionstart", "onCompositionupdate", "onCompositionend"]), vue.unref(le2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, style: vue.normalizeStyle(U2.value), class: vue.normalizeClass(vue.unref(F2).e("count")) }, vue.toDisplayString(vue.unref(se2)) + " / " + vue.toDisplayString(e3.maxlength), 7)) : vue.createCommentVNode("v-if", true)], 64))], 16, ["role"])); } }); var Cp = np(kp, [["__file", "input.vue"]]); const Sp = yu(Cp); const Ep = 4; const _p = { vertical: { offset: "offsetHeight", scroll: "scrollTop", scrollSize: "scrollHeight", size: "height", key: "vertical", axis: "Y", client: "clientY", direction: "top" }, horizontal: { offset: "offsetWidth", scroll: "scrollLeft", scrollSize: "scrollWidth", size: "width", key: "horizontal", axis: "X", client: "clientX", direction: "left" } }; const Op = ({ move: e2, size: t2, bar: n2 }) => ({ [n2.size]: t2, transform: `translate${n2.axis}(${e2}%)` }); const Mp = Symbol("scrollbarContextKey"); const Lp = fu({ vertical: Boolean, size: String, move: Number, ratio: { type: Number, required: true }, always: Boolean }); const Dp = "Thumb"; const Ap = vue.defineComponent({ __name: "thumb", props: Lp, setup(e2) { const n2 = e2; const a2 = vue.inject(Mp); const r2 = Xu("scrollbar"); if (!a2) ii(Dp, "can not inject scrollbar context"); const s2 = vue.ref(); const i2 = vue.ref(); const c2 = vue.ref({}); const d2 = vue.ref(false); let m2 = false; let h2 = false; let g2 = Be ? document.onselectstart : null; const y2 = vue.computed(() => _p[n2.vertical ? "vertical" : "horizontal"]); const b2 = vue.computed(() => Op({ size: n2.size, move: n2.move, bar: y2.value })); const w2 = vue.computed(() => s2.value[y2.value.offset] ** 2 / a2.wrapElement[y2.value.scrollSize] / n2.ratio / i2.value[y2.value.offset]); const x2 = (e3) => { var t2; e3.stopPropagation(); if (e3.ctrlKey || [1, 2].includes(e3.button)) return; (t2 = window.getSelection()) == null ? void 0 : t2.removeAllRanges(); S2(e3); const n3 = e3.currentTarget; if (!n3) return; c2.value[y2.value.axis] = n3[y2.value.offset] - (e3[y2.value.client] - n3.getBoundingClientRect()[y2.value.direction]); }; const k2 = (e3) => { if (!i2.value || !s2.value || !a2.wrapElement) return; const t2 = Math.abs(e3.target.getBoundingClientRect()[y2.value.direction] - e3[y2.value.client]); const n3 = i2.value[y2.value.offset] / 2; const o2 = (t2 - n3) * 100 * w2.value / s2.value[y2.value.offset]; a2.wrapElement[y2.value.scroll] = o2 * a2.wrapElement[y2.value.scrollSize] / 100; }; const S2 = (e3) => { e3.stopImmediatePropagation(); m2 = true; document.addEventListener("mousemove", E2); document.addEventListener("mouseup", _2); g2 = document.onselectstart; document.onselectstart = () => false; }; const E2 = (e3) => { if (!s2.value || !i2.value) return; if (m2 === false) return; const t2 = c2.value[y2.value.axis]; if (!t2) return; const n3 = (s2.value.getBoundingClientRect()[y2.value.direction] - e3[y2.value.client]) * -1; const o2 = i2.value[y2.value.offset] - t2; const r3 = (n3 - o2) * 100 * w2.value / s2.value[y2.value.offset]; a2.wrapElement[y2.value.scroll] = r3 * a2.wrapElement[y2.value.scrollSize] / 100; }; const _2 = () => { m2 = false; c2.value[y2.value.axis] = 0; document.removeEventListener("mousemove", E2); document.removeEventListener("mouseup", _2); R2(); if (h2) d2.value = false; }; const O2 = () => { h2 = false; d2.value = !!n2.size; }; const M2 = () => { h2 = true; d2.value = m2; }; vue.onBeforeUnmount(() => { R2(); document.removeEventListener("mouseup", _2); }); const R2 = () => { if (document.onselectstart !== g2) document.onselectstart = g2; }; Xe(vue.toRef(a2, "scrollbarElement"), "mousemove", O2); Xe(vue.toRef(a2, "scrollbarElement"), "mouseleave", M2); return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(r2).b("fade"), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createElementVNode("div", { ref_key: "instance", ref: s2, class: vue.normalizeClass([vue.unref(r2).e("bar"), vue.unref(r2).is(vue.unref(y2).key)]), onMousedown: k2 }, [vue.createElementVNode("div", { ref_key: "thumb", ref: i2, class: vue.normalizeClass(vue.unref(r2).e("thumb")), style: vue.normalizeStyle(vue.unref(b2)), onMousedown: x2 }, null, 38)], 34), [[vue.vShow, e3.always || d2.value]])]), _: 1 }, 8, ["name"])); } }); var Rp = np(Ap, [["__file", "thumb.vue"]]); const $p = fu({ always: { type: Boolean, default: true }, minSize: { type: Number, required: true } }); const Tp = vue.defineComponent({ __name: "bar", props: $p, setup(e2, { expose: o2 }) { const a2 = e2; const r2 = vue.inject(Mp); const l2 = vue.ref(0); const s2 = vue.ref(0); const i2 = vue.ref(""); const u2 = vue.ref(""); const c2 = vue.ref(1); const d2 = vue.ref(1); const f2 = (e3) => { if (e3) { const t2 = e3.offsetHeight - Ep; const n2 = e3.offsetWidth - Ep; s2.value = e3.scrollTop * 100 / t2 * c2.value; l2.value = e3.scrollLeft * 100 / n2 * d2.value; } }; const m2 = () => { const e3 = r2 == null ? void 0 : r2.wrapElement; if (!e3) return; const t2 = e3.offsetHeight - Ep; const n2 = e3.offsetWidth - Ep; const o3 = t2 ** 2 / e3.scrollHeight; const l3 = n2 ** 2 / e3.scrollWidth; const s3 = Math.max(o3, a2.minSize); const f3 = Math.max(l3, a2.minSize); c2.value = o3 / (t2 - o3) / (s3 / (t2 - s3)); d2.value = l3 / (n2 - l3) / (f3 / (n2 - f3)); u2.value = s3 + Ep < t2 ? `${s3}px` : ""; i2.value = f3 + Ep < n2 ? `${f3}px` : ""; }; o2({ handleScroll: f2, update: m2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [vue.createVNode(Rp, { move: l2.value, ratio: d2.value, size: i2.value, always: e3.always }, null, 8, ["move", "ratio", "size", "always"]), vue.createVNode(Rp, { move: s2.value, ratio: c2.value, size: u2.value, vertical: "", always: e3.always }, null, 8, ["move", "ratio", "size", "always"])], 64)); } }); var Pp = np(Tp, [["__file", "bar.vue"]]); const Np = fu({ height: { type: [String, Number], default: "" }, maxHeight: { type: [String, Number], default: "" }, native: { type: Boolean, default: false }, wrapStyle: { type: uu([String, Object, Array]), default: "" }, wrapClass: { type: [String, Array], default: "" }, viewClass: { type: [String, Array], default: "" }, viewStyle: { type: [String, Array, Object], default: "" }, noresize: Boolean, tag: { type: String, default: "div" }, always: Boolean, minSize: { type: Number, default: 20 }, id: String, role: String, ...Kf(["ariaLabel", "ariaOrientation"]) }); const Ip = { scroll: ({ scrollTop: e2, scrollLeft: t2 }) => [e2, t2].every(Js) }; const Bp = "ElScrollbar"; const Vp = vue.defineComponent({ name: Bp }); const Fp = vue.defineComponent({ ...Vp, props: Np, emits: Ip, setup(e2, { expose: a2, emit: r2 }) { const s2 = e2; const d2 = Xu("scrollbar"); let f2 = void 0; let p2 = void 0; let m2 = 0; let h2 = 0; const g2 = vue.ref(); const y2 = vue.ref(); const k2 = vue.ref(); const C2 = vue.ref(); const S2 = vue.computed(() => { const e3 = {}; if (s2.height) e3.height = mi(s2.height); if (s2.maxHeight) e3.maxHeight = mi(s2.maxHeight); return [s2.wrapStyle, e3]; }); const E2 = vue.computed(() => [s2.wrapClass, d2.e("wrap"), { [d2.em("wrap", "hidden-default")]: !s2.native }]); const _2 = vue.computed(() => [d2.e("view"), s2.viewClass]); const M2 = () => { var e3; if (y2.value) { (e3 = C2.value) == null ? void 0 : e3.handleScroll(y2.value); m2 = y2.value.scrollTop; h2 = y2.value.scrollLeft; r2("scroll", { scrollTop: y2.value.scrollTop, scrollLeft: y2.value.scrollLeft }); } }; function $2(e3, t2) { if (Et(e3)) { y2.value.scrollTo(e3); } else if (Js(e3) && Js(t2)) { y2.value.scrollTo(e3, t2); } } const T2 = (e3) => { if (!Js(e3)) { return; } y2.value.scrollTop = e3; }; const P2 = (e3) => { if (!Js(e3)) { return; } y2.value.scrollLeft = e3; }; const I2 = () => { var e3; (e3 = C2.value) == null ? void 0 : e3.update(); }; vue.watch(() => s2.noresize, (e3) => { if (e3) { f2 == null ? void 0 : f2(); p2 == null ? void 0 : p2(); } else { ({ stop: f2 } = st(k2, I2)); p2 = Xe("resize", I2); } }, { immediate: true }); vue.watch(() => [s2.maxHeight, s2.height], () => { if (!s2.native) vue.nextTick(() => { var e3; I2(); if (y2.value) { (e3 = C2.value) == null ? void 0 : e3.handleScroll(y2.value); } }); }); vue.provide(Mp, vue.reactive({ scrollbarElement: g2, wrapElement: y2 })); vue.onActivated(() => { y2.value.scrollTop = m2; y2.value.scrollLeft = h2; }); vue.onMounted(() => { if (!s2.native) vue.nextTick(() => { I2(); }); }); vue.onUpdated(() => I2()); a2({ wrapRef: y2, update: I2, scrollTo: $2, setScrollTop: T2, setScrollLeft: P2, handleScroll: M2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { ref_key: "scrollbarRef", ref: g2, class: vue.normalizeClass(vue.unref(d2).b()) }, [vue.createElementVNode("div", { ref_key: "wrapRef", ref: y2, class: vue.normalizeClass(vue.unref(E2)), style: vue.normalizeStyle(vue.unref(S2)), onScroll: M2 }, [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), { id: e3.id, ref_key: "resizeRef", ref: k2, class: vue.normalizeClass(vue.unref(_2)), style: vue.normalizeStyle(e3.viewStyle), role: e3.role, "aria-label": e3.ariaLabel, "aria-orientation": e3.ariaOrientation }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "style", "role", "aria-label", "aria-orientation"]))], 38), !e3.native ? (vue.openBlock(), vue.createBlock(Pp, { key: 0, ref_key: "barRef", ref: C2, always: e3.always, "min-size": e3.minSize }, null, 8, ["always", "min-size"])) : vue.createCommentVNode("v-if", true)], 2)); } }); var jp = np(Fp, [["__file", "scrollbar.vue"]]); const zp = yu(jp); const Hp = Symbol("popper"); const Wp = Symbol("popperContent"); const Yp = ["dialog", "grid", "group", "listbox", "menu", "navigation", "tooltip", "tree"]; const Up = fu({ role: { type: String, values: Yp, default: "tooltip" } }); const Kp = vue.defineComponent({ name: "ElPopper", inheritAttrs: false }); const qp = vue.defineComponent({ ...Kp, props: Up, setup(e2, { expose: t2 }) { const n2 = e2; const o2 = vue.ref(); const a2 = vue.ref(); const r2 = vue.ref(); const s2 = vue.ref(); const i2 = vue.computed(() => n2.role); const u2 = { triggerRef: o2, popperInstanceRef: a2, contentRef: r2, referenceRef: s2, role: i2 }; t2(u2); vue.provide(Hp, u2); return (e3, t3) => vue.renderSlot(e3.$slots, "default"); } }); var Gp = np(qp, [["__file", "popper.vue"]]); const Xp = fu({ arrowOffset: { type: Number, default: 5 } }); const Zp = vue.defineComponent({ name: "ElPopperArrow", inheritAttrs: false }); const Jp = vue.defineComponent({ ...Zp, props: Xp, setup(e2, { expose: o2 }) { const a2 = e2; const r2 = Xu("popper"); const { arrowOffset: l2, arrowRef: s2, arrowStyle: c2 } = vue.inject(Wp, void 0); vue.watch(() => a2.arrowOffset, (e3) => { l2.value = e3; }); vue.onBeforeUnmount(() => { s2.value = void 0; }); o2({ arrowRef: s2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("span", { ref_key: "arrowRef", ref: s2, class: vue.normalizeClass(vue.unref(r2).e("arrow")), style: vue.normalizeStyle(vue.unref(c2)), "data-popper-arrow": "" }, null, 6)); } }); var Qp = np(Jp, [["__file", "arrow.vue"]]); const ev = "ElOnlyChild"; const tv = vue.defineComponent({ name: ev, setup(e2, { slots: t2, attrs: n2 }) { var o2; const a2 = vue.inject(Ef); const r2 = Of((o2 = a2 == null ? void 0 : a2.setForwardRef) != null ? o2 : yt); return () => { var e3; const o3 = (e3 = t2.default) == null ? void 0 : e3.call(t2, n2); if (!o3) return null; if (o3.length > 1) { return null; } const a3 = nv(o3); if (!a3) { return null; } return vue.withDirectives(vue.cloneVNode(a3, n2), [[r2]]); }; } }); function nv(e2) { if (!e2) return null; const t2 = e2; for (const e3 of t2) { if (Et(e3)) { switch (e3.type) { case vue.Comment: continue; case vue.Text: case "svg": return ov(e3); case vue.Fragment: return nv(e3.children); default: return e3; } } return ov(e3); } return null; } function ov(e2) { const t2 = Xu("only-child"); return vue.createVNode("span", { class: t2.e("content") }, [e2]); } const av = fu({ virtualRef: { type: uu(Object) }, virtualTriggering: Boolean, onMouseenter: { type: uu(Function) }, onMouseleave: { type: uu(Function) }, onClick: { type: uu(Function) }, onKeydown: { type: uu(Function) }, onFocus: { type: uu(Function) }, onBlur: { type: uu(Function) }, onContextmenu: { type: uu(Function) }, id: String, open: Boolean }); const rv = vue.defineComponent({ name: "ElPopperTrigger", inheritAttrs: false }); const lv = vue.defineComponent({ ...rv, props: av, setup(e2, { expose: n2 }) { const o2 = e2; const { role: a2, triggerRef: r2 } = vue.inject(Hp, void 0); _f(r2); const s2 = vue.computed(() => v2.value ? o2.id : void 0); const d2 = vue.computed(() => { if (a2 && a2.value === "tooltip") { return o2.open && o2.id ? o2.id : void 0; } return void 0; }); const v2 = vue.computed(() => { if (a2 && a2.value !== "tooltip") { return a2.value; } return void 0; }); const m2 = vue.computed(() => v2.value ? `${o2.open}` : void 0); let h2 = void 0; const g2 = ["onMouseenter", "onMouseleave", "onClick", "onKeydown", "onFocus", "onBlur", "onContextmenu"]; vue.onMounted(() => { vue.watch(() => o2.virtualRef, (e3) => { if (e3) { r2.value = Ke(e3); } }, { immediate: true }); vue.watch(r2, (e3, t2) => { h2 == null ? void 0 : h2(); h2 = void 0; if (ei(e3)) { g2.forEach((n3) => { var a3; const r3 = o2[n3]; if (r3) { e3.addEventListener(n3.slice(2).toLowerCase(), r3); (a3 = t2 == null ? void 0 : t2.removeEventListener) == null ? void 0 : a3.call(t2, n3.slice(2).toLowerCase(), r3); } }); h2 = vue.watch([s2, d2, v2, m2], (t3) => { ["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((n3, o3) => { zs(t3[o3]) ? e3.removeAttribute(n3) : e3.setAttribute(n3, t3[o3]); }); }, { immediate: true }); } if (ei(t2)) { ["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((e4) => t2.removeAttribute(e4)); } }, { immediate: true }); }); vue.onBeforeUnmount(() => { h2 == null ? void 0 : h2(); h2 = void 0; if (r2.value && ei(r2.value)) { const e3 = r2.value; g2.forEach((t2) => { const n3 = o2[t2]; if (n3) { e3.removeEventListener(t2.slice(2).toLowerCase(), n3); } }); r2.value = void 0; } }); n2({ triggerRef: r2 }); return (e3, n3) => !e3.virtualTriggering ? (vue.openBlock(), vue.createBlock(vue.unref(tv), vue.mergeProps({ key: 0 }, e3.$attrs, { "aria-controls": vue.unref(s2), "aria-describedby": vue.unref(d2), "aria-expanded": vue.unref(m2), "aria-haspopup": vue.unref(v2) }), { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 16, ["aria-controls", "aria-describedby", "aria-expanded", "aria-haspopup"])) : vue.createCommentVNode("v-if", true); } }); var sv = np(lv, [["__file", "trigger.vue"]]); const iv = "focus-trap.focus-after-trapped"; const uv = "focus-trap.focus-after-released"; const cv = "focus-trap.focusout-prevented"; const dv = { cancelable: true, bubbles: false }; const fv = { cancelable: true, bubbles: false }; const pv = "focusAfterTrapped"; const vv = "focusAfterReleased"; const mv = Symbol("elFocusTrap"); const hv = vue.ref(); const gv = vue.ref(0); const yv = vue.ref(0); let bv = 0; const wv = (e2) => { const t2 = []; const n2 = document.createTreeWalker(e2, NodeFilter.SHOW_ELEMENT, { acceptNode: (e3) => { const t3 = e3.tagName === "INPUT" && e3.type === "hidden"; if (e3.disabled || e3.hidden || t3) return NodeFilter.FILTER_SKIP; return e3.tabIndex >= 0 || e3 === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP; } }); while (n2.nextNode()) t2.push(n2.currentNode); return t2; }; const xv = (e2, t2) => { for (const n2 of e2) { if (!kv(n2, t2)) return n2; } }; const kv = (e2, t2) => { if (getComputedStyle(e2).visibility === "hidden") return true; while (e2) { if (t2 && e2 === t2) return false; if (getComputedStyle(e2).display === "none") return true; e2 = e2.parentElement; } return false; }; const Cv = (e2) => { const t2 = wv(e2); const n2 = xv(t2, e2); const o2 = xv(t2.reverse(), e2); return [n2, o2]; }; const Sv = (e2) => e2 instanceof HTMLInputElement && "select" in e2; const Ev = (e2, t2) => { if (e2 && e2.focus) { const n2 = document.activeElement; e2.focus({ preventScroll: true }); yv.value = window.performance.now(); if (e2 !== n2 && Sv(e2) && t2) { e2.select(); } } }; function _v(e2, t2) { const n2 = [...e2]; const o2 = e2.indexOf(t2); if (o2 !== -1) { n2.splice(o2, 1); } return n2; } const Ov = () => { let e2 = []; const t2 = (t3) => { const n3 = e2[0]; if (n3 && t3 !== n3) { n3.pause(); } e2 = _v(e2, t3); e2.unshift(t3); }; const n2 = (t3) => { var n3, o2; e2 = _v(e2, t3); (o2 = (n3 = e2[0]) == null ? void 0 : n3.resume) == null ? void 0 : o2.call(n3); }; return { push: t2, remove: n2 }; }; const Mv = (e2, t2 = false) => { const n2 = document.activeElement; for (const o2 of e2) { Ev(o2, t2); if (document.activeElement !== n2) return; } }; const Lv = Ov(); const Dv = () => gv.value > yv.value; const Av = () => { hv.value = "pointer"; gv.value = window.performance.now(); }; const Rv = () => { hv.value = "keyboard"; gv.value = window.performance.now(); }; const $v = () => { vue.onMounted(() => { if (bv === 0) { document.addEventListener("mousedown", Av); document.addEventListener("touchstart", Av); document.addEventListener("keydown", Rv); } bv++; }); vue.onBeforeUnmount(() => { bv--; if (bv <= 0) { document.removeEventListener("mousedown", Av); document.removeEventListener("touchstart", Av); document.removeEventListener("keydown", Rv); } }); return { focusReason: hv, lastUserFocusTimestamp: gv, lastAutomatedFocusTimestamp: yv }; }; const Tv = (e2) => new CustomEvent(cv, { ...fv, detail: e2 }); const Pv = vue.defineComponent({ name: "ElFocusTrap", inheritAttrs: false, props: { loop: Boolean, trapped: Boolean, focusTrapEl: Object, focusStartEl: { type: [Object, String], default: "first" } }, emits: [pv, vv, "focusin", "focusout", "focusout-prevented", "release-requested"], setup(e2, { emit: t2 }) { const n2 = vue.ref(); let o2; let a2; const { focusReason: r2 } = $v(); yf((n3) => { if (e2.trapped && !l2.paused) { t2("release-requested", n3); } }); const l2 = { paused: false, pause() { this.paused = true; }, resume() { this.paused = false; } }; const s2 = (n3) => { if (!e2.loop && !e2.trapped) return; if (l2.paused) return; const { key: o3, altKey: a3, ctrlKey: s3, metaKey: i2, currentTarget: u2, shiftKey: c2 } = n3; const { loop: d3 } = e2; const f2 = o3 === ku.tab && !a3 && !s3 && !i2; const p3 = document.activeElement; if (f2 && p3) { const e3 = u2; const [o4, a4] = Cv(e3); const l3 = o4 && a4; if (!l3) { if (p3 === e3) { const e4 = Tv({ focusReason: r2.value }); t2("focusout-prevented", e4); if (!e4.defaultPrevented) { n3.preventDefault(); } } } else { if (!c2 && p3 === a4) { const e4 = Tv({ focusReason: r2.value }); t2("focusout-prevented", e4); if (!e4.defaultPrevented) { n3.preventDefault(); if (d3) Ev(o4, true); } } else if (c2 && [o4, e3].includes(p3)) { const e4 = Tv({ focusReason: r2.value }); t2("focusout-prevented", e4); if (!e4.defaultPrevented) { n3.preventDefault(); if (d3) Ev(a4, true); } } } } }; vue.provide(mv, { focusTrapRef: n2, onKeydown: s2 }); vue.watch(() => e2.focusTrapEl, (e3) => { if (e3) { n2.value = e3; } }, { immediate: true }); vue.watch([n2], ([e3], [t3]) => { if (e3) { e3.addEventListener("keydown", s2); e3.addEventListener("focusin", m2); e3.addEventListener("focusout", h2); } if (t3) { t3.removeEventListener("keydown", s2); t3.removeEventListener("focusin", m2); t3.removeEventListener("focusout", h2); } }); const d2 = (e3) => { t2(pv, e3); }; const p2 = (e3) => t2(vv, e3); const m2 = (r3) => { const s3 = vue.unref(n2); if (!s3) return; const i2 = r3.target; const c2 = r3.relatedTarget; const d3 = i2 && s3.contains(i2); if (!e2.trapped) { const e3 = c2 && s3.contains(c2); if (!e3) { o2 = c2; } } if (d3) t2("focusin", r3); if (l2.paused) return; if (e2.trapped) { if (d3) { a2 = i2; } else { Ev(a2, true); } } }; const h2 = (o3) => { const s3 = vue.unref(n2); if (l2.paused || !s3) return; if (e2.trapped) { const n3 = o3.relatedTarget; if (!zs(n3) && !s3.contains(n3)) { setTimeout(() => { if (!l2.paused && e2.trapped) { const e3 = Tv({ focusReason: r2.value }); t2("focusout-prevented", e3); if (!e3.defaultPrevented) { Ev(a2, true); } } }, 0); } } else { const e3 = o3.target; const n3 = e3 && s3.contains(e3); if (!n3) t2("focusout", o3); } }; async function g2() { await vue.nextTick(); const t3 = vue.unref(n2); if (t3) { Lv.push(l2); const n3 = t3.contains(document.activeElement) ? o2 : document.activeElement; o2 = n3; const a3 = t3.contains(n3); if (!a3) { const o3 = new Event(iv, dv); t3.addEventListener(iv, d2); t3.dispatchEvent(o3); if (!o3.defaultPrevented) { vue.nextTick(() => { let o4 = e2.focusStartEl; if (!St(o4)) { Ev(o4); if (document.activeElement !== o4) { o4 = "first"; } } if (o4 === "first") { Mv(wv(t3), true); } if (document.activeElement === n3 || o4 === "container") { Ev(t3); } }); } } } } function y2() { const e3 = vue.unref(n2); if (e3) { e3.removeEventListener(iv, d2); const t3 = new CustomEvent(uv, { ...dv, detail: { focusReason: r2.value } }); e3.addEventListener(uv, p2); e3.dispatchEvent(t3); if (!t3.defaultPrevented && (r2.value == "keyboard" || !Dv() || e3.contains(document.activeElement))) { Ev(o2 != null ? o2 : document.body); } e3.removeEventListener(uv, p2); Lv.remove(l2); } } vue.onMounted(() => { if (e2.trapped) { g2(); } vue.watch(() => e2.trapped, (e3) => { if (e3) { g2(); } else { y2(); } }); }); vue.onBeforeUnmount(() => { if (e2.trapped) { y2(); } if (n2.value) { n2.value.removeEventListener("keydown", s2); n2.value.removeEventListener("focusin", m2); n2.value.removeEventListener("focusout", h2); n2.value = void 0; } }); return { onKeydown: s2 }; } }); function Nv(e2, t2, n2, o2, a2, r2) { return vue.renderSlot(e2.$slots, "default", { handleKeydown: e2.onKeydown }); } var Iv = np(Pv, [["render", Nv], ["__file", "focus-trap.vue"]]); const Bv = ["fixed", "absolute"]; const Vv = fu({ boundariesPadding: { type: Number, default: 0 }, fallbackPlacements: { type: uu(Array), default: void 0 }, gpuAcceleration: { type: Boolean, default: true }, offset: { type: Number, default: 12 }, placement: { type: String, values: mc, default: "bottom" }, popperOptions: { type: uu(Object), default: () => ({}) }, strategy: { type: String, values: Bv, default: "absolute" } }); const Fv = fu({ ...Vv, id: String, style: { type: uu([String, Array, Object]) }, className: { type: uu([String, Array, Object]) }, effect: { type: uu(String), default: "dark" }, visible: Boolean, enterable: { type: Boolean, default: true }, pure: Boolean, focusOnShow: { type: Boolean, default: false }, trapping: { type: Boolean, default: false }, popperClass: { type: uu([String, Array, Object]) }, popperStyle: { type: uu([String, Array, Object]) }, referenceEl: { type: uu(Object) }, triggerTargetEl: { type: uu(Object) }, stopPopperMouseEvent: { type: Boolean, default: true }, virtualTriggering: Boolean, zIndex: Number, ...Kf(["ariaLabel"]) }); const jv = { mouseenter: (e2) => e2 instanceof MouseEvent, mouseleave: (e2) => e2 instanceof MouseEvent, focus: () => true, blur: () => true, close: () => true }; const zv = (e2, t2 = []) => { const { placement: n2, strategy: o2, popperOptions: a2 } = e2; const r2 = { placement: n2, strategy: o2, ...a2, modifiers: [...Wv(e2), ...t2] }; Yv(r2, a2 == null ? void 0 : a2.modifiers); return r2; }; const Hv = (e2) => { if (!Be) return; return Ke(e2); }; function Wv(e2) { const { offset: t2, gpuAcceleration: n2, fallbackPlacements: o2 } = e2; return [{ name: "offset", options: { offset: [0, t2 != null ? t2 : 12] } }, { name: "preventOverflow", options: { padding: { top: 2, bottom: 2, left: 5, right: 5 } } }, { name: "flip", options: { padding: 5, fallbackPlacements: o2 } }, { name: "computeStyles", options: { gpuAcceleration: n2 } }]; } function Yv(e2, t2) { if (t2) { e2.modifiers = [...e2.modifiers, ...t2 != null ? t2 : []]; } } const Uv = 0; const Kv = (e2) => { const { popperInstanceRef: t2, contentRef: n2, triggerRef: o2, role: a2 } = vue.inject(Hp, void 0); const r2 = vue.ref(); const s2 = vue.ref(); const d2 = vue.computed(() => ({ name: "eventListeners", enabled: !!e2.visible })); const f2 = vue.computed(() => { var e3; const t3 = vue.unref(r2); const n3 = (e3 = vue.unref(s2)) != null ? e3 : Uv; return { name: "arrow", enabled: !Hs(t3), options: { element: t3, padding: n3 } }; }); const m2 = vue.computed(() => ({ onFirstUpdate: () => { w2(); }, ...zv(e2, [vue.unref(f2), vue.unref(d2)]) })); const h2 = vue.computed(() => Hv(e2.referenceEl) || vue.unref(o2)); const { attributes: g2, state: y2, styles: b2, update: w2, forceUpdate: x2, instanceRef: k2 } = sf(h2, n2, m2); vue.watch(k2, (e3) => t2.value = e3); vue.onMounted(() => { vue.watch(() => { var e3; return (e3 = vue.unref(h2)) == null ? void 0 : e3.getBoundingClientRect(); }, () => { w2(); }); }); return { attributes: g2, arrowRef: r2, contentRef: n2, instanceRef: k2, state: y2, styles: b2, role: a2, forceUpdate: x2, update: w2 }; }; const qv = (e2, { attributes: t2, styles: n2, role: o2 }) => { const { nextZIndex: a2 } = $f(); const r2 = Xu("popper"); const s2 = vue.computed(() => vue.unref(t2).popper); const i2 = vue.ref(Js(e2.zIndex) ? e2.zIndex : a2()); const c2 = vue.computed(() => [r2.b(), r2.is("pure", e2.pure), r2.is(e2.effect), e2.popperClass]); const d2 = vue.computed(() => [{ zIndex: vue.unref(i2) }, vue.unref(n2).popper, e2.popperStyle || {}]); const f2 = vue.computed(() => o2.value === "dialog" ? "false" : void 0); const p2 = vue.computed(() => vue.unref(n2).arrow || {}); const m2 = () => { i2.value = Js(e2.zIndex) ? e2.zIndex : a2(); }; return { ariaModal: f2, arrowStyle: p2, contentAttrs: s2, contentClass: c2, contentStyle: d2, contentZIndex: i2, updateZIndex: m2 }; }; const Gv = (e2, t2) => { const n2 = vue.ref(false); const o2 = vue.ref(); const a2 = () => { t2("focus"); }; const r2 = (e3) => { var n3; if (((n3 = e3.detail) == null ? void 0 : n3.focusReason) !== "pointer") { o2.value = "first"; t2("blur"); } }; const l2 = (t3) => { if (e2.visible && !n2.value) { if (t3.target) { o2.value = t3.target; } n2.value = true; } }; const s2 = (t3) => { if (!e2.trapping) { if (t3.detail.focusReason === "pointer") { t3.preventDefault(); } n2.value = false; } }; const i2 = () => { n2.value = false; t2("close"); }; return { focusStartRef: o2, trapped: n2, onFocusAfterReleased: r2, onFocusAfterTrapped: a2, onFocusInTrap: l2, onFocusoutPrevented: s2, onReleaseRequested: i2 }; }; const Xv = vue.defineComponent({ name: "ElPopperContent" }); const Zv = vue.defineComponent({ ...Xv, props: Fv, emits: jv, setup(e2, { expose: o2, emit: a2 }) { const r2 = e2; const { focusStartRef: l2, trapped: s2, onFocusAfterReleased: d2, onFocusAfterTrapped: m2, onFocusInTrap: h2, onFocusoutPrevented: g2, onReleaseRequested: y2 } = Gv(r2, a2); const { attributes: w2, arrowRef: C2, contentRef: S2, styles: E2, instanceRef: _2, role: O2, update: M2 } = Kv(r2); const { ariaModal: L2, arrowStyle: D2, contentAttrs: R2, contentClass: $2, contentStyle: P2, updateZIndex: N2 } = qv(r2, { styles: E2, attributes: w2, role: O2 }); const I2 = vue.inject(up, void 0); const B2 = vue.ref(); vue.provide(Wp, { arrowStyle: D2, arrowRef: C2, arrowOffset: B2 }); if (I2) { vue.provide(up, { ...I2, addInputId: yt, removeInputId: yt }); } let V2 = void 0; const F2 = (e3 = true) => { M2(); e3 && N2(); }; const j2 = () => { F2(false); if (r2.visible && r2.focusOnShow) { s2.value = true; } else if (r2.visible === false) { s2.value = false; } }; vue.onMounted(() => { vue.watch(() => r2.triggerTargetEl, (e3, t2) => { V2 == null ? void 0 : V2(); V2 = void 0; const n2 = vue.unref(e3 || S2.value); const o3 = vue.unref(t2 || S2.value); if (ei(n2)) { V2 = vue.watch([O2, () => r2.ariaLabel, L2, () => r2.id], (e4) => { ["role", "aria-label", "aria-modal", "id"].forEach((t3, o4) => { zs(e4[o4]) ? n2.removeAttribute(t3) : n2.setAttribute(t3, e4[o4]); }); }, { immediate: true }); } if (o3 !== n2 && ei(o3)) { ["role", "aria-label", "aria-modal", "id"].forEach((e4) => { o3.removeAttribute(e4); }); } }, { immediate: true }); vue.watch(() => r2.visible, j2, { immediate: true }); }); vue.onBeforeUnmount(() => { V2 == null ? void 0 : V2(); V2 = void 0; }); o2({ popperContentRef: S2, popperInstanceRef: _2, updatePopper: F2, contentStyle: P2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", vue.mergeProps({ ref_key: "contentRef", ref: S2 }, vue.unref(R2), { style: vue.unref(P2), class: vue.unref($2), tabindex: "-1", onMouseenter: (t2) => e3.$emit("mouseenter", t2), onMouseleave: (t2) => e3.$emit("mouseleave", t2) }), [vue.createVNode(vue.unref(Iv), { trapped: vue.unref(s2), "trap-on-focus-in": true, "focus-trap-el": vue.unref(S2), "focus-start-el": vue.unref(l2), onFocusAfterTrapped: vue.unref(m2), onFocusAfterReleased: vue.unref(d2), onFocusin: vue.unref(h2), onFocusoutPrevented: vue.unref(g2), onReleaseRequested: vue.unref(y2) }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusin", "onFocusoutPrevented", "onReleaseRequested"])], 16, ["onMouseenter", "onMouseleave"])); } }); var Jv = np(Zv, [["__file", "content.vue"]]); const Qv = yu(Gp); const em = Symbol("elTooltip"); const tm = fu({ ...Cf, ...Fv, appendTo: { type: uu([String, Object]) }, content: { type: String, default: "" }, rawContent: Boolean, persistent: Boolean, visible: { type: uu(Boolean), default: null }, transition: String, teleported: { type: Boolean, default: true }, disabled: Boolean, ...Kf(["ariaLabel"]) }); const nm = fu({ ...av, disabled: Boolean, trigger: { type: uu([String, Array]), default: "hover" }, triggerKeys: { type: uu(Array), default: () => [ku.enter, ku.space] } }); const { useModelToggleProps: om, useModelToggleEmits: am, useModelToggle: rm } = ec("visible"); const lm = fu({ ...Up, ...om, ...tm, ...nm, ...Xp, showArrow: { type: Boolean, default: true } }); const sm = [...am, "before-show", "before-hide", "show", "hide", "open", "close"]; const im = (e2, t2) => { if (xt(e2)) { return e2.includes(t2); } return e2 === t2; }; const um = (e2, t2, n2) => (o2) => { im(vue.unref(e2), t2) && n2(o2); }; const cm = vue.defineComponent({ name: "ElTooltipTrigger" }); const dm = vue.defineComponent({ ...cm, props: nm, setup(e2, { expose: n2 }) { const o2 = e2; const a2 = Xu("tooltip"); const { controlled: r2, id: l2, open: s2, onOpen: i2, onClose: c2, onToggle: d2 } = vue.inject(em, void 0); const f2 = vue.ref(null); const m2 = () => { if (vue.unref(r2) || o2.disabled) { return true; } }; const h2 = vue.toRef(o2, "trigger"); const g2 = _e(m2, um(h2, "hover", i2)); const y2 = _e(m2, um(h2, "hover", c2)); const b2 = _e(m2, um(h2, "click", (e3) => { if (e3.button === 0) { d2(e3); } })); const w2 = _e(m2, um(h2, "focus", i2)); const k2 = _e(m2, um(h2, "focus", c2)); const S2 = _e(m2, um(h2, "contextmenu", (e3) => { e3.preventDefault(); d2(e3); })); const E2 = _e(m2, (e3) => { const { code: t2 } = e3; if (o2.triggerKeys.includes(t2)) { e3.preventDefault(); d2(e3); } }); n2({ triggerRef: f2 }); return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.unref(sv), { id: vue.unref(l2), "virtual-ref": e3.virtualRef, open: vue.unref(s2), "virtual-triggering": e3.virtualTriggering, class: vue.normalizeClass(vue.unref(a2).e("trigger")), onBlur: vue.unref(k2), onClick: vue.unref(b2), onContextmenu: vue.unref(S2), onFocus: vue.unref(w2), onMouseenter: vue.unref(g2), onMouseleave: vue.unref(y2), onKeydown: vue.unref(E2) }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "virtual-ref", "open", "virtual-triggering", "class", "onBlur", "onClick", "onContextmenu", "onFocus", "onMouseenter", "onMouseleave", "onKeydown"])); } }); var fm = np(dm, [["__file", "trigger.vue"]]); const pm = fu({ to: { type: uu([String, Object]), required: true }, disabled: Boolean }); const vm = vue.defineComponent({ __name: "teleport", props: pm, setup(e2) { return (e3, n2) => e3.disabled ? vue.renderSlot(e3.$slots, "default", { key: 0 }) : (vue.openBlock(), vue.createBlock(vue.Teleport, { key: 1, to: e3.to }, [vue.renderSlot(e3.$slots, "default")], 8, ["to"])); } }); var mm = np(vm, [["__file", "teleport.vue"]]); const hm = yu(mm); const gm = vue.defineComponent({ name: "ElTooltipContent", inheritAttrs: false }); const ym = vue.defineComponent({ ...gm, props: tm, setup(e2, { expose: n2 }) { const o2 = e2; const { selector: a2 } = wf(); const r2 = Xu("tooltip"); const s2 = vue.ref(null); let c2; const { controlled: d2, id: m2, open: h2, trigger: g2, onClose: y2, onOpen: b2, onShow: w2, onHide: C2, onBeforeShow: S2, onBeforeHide: E2 } = vue.inject(em, void 0); const _2 = vue.computed(() => o2.transition || `${r2.namespace.value}-fade-in-linear`); const M2 = vue.computed(() => o2.persistent); vue.onBeforeUnmount(() => { c2 == null ? void 0 : c2(); }); const L2 = vue.computed(() => vue.unref(M2) ? true : vue.unref(h2)); const R2 = vue.computed(() => o2.disabled ? false : vue.unref(h2)); const $2 = vue.computed(() => o2.appendTo || a2.value); const P2 = vue.computed(() => { var e3; return (e3 = o2.style) != null ? e3 : {}; }); const N2 = vue.computed(() => !vue.unref(h2)); const F2 = () => { C2(); }; const j2 = () => { if (vue.unref(d2)) return true; }; const z2 = _e(j2, () => { if (o2.enterable && vue.unref(g2) === "hover") { b2(); } }); const H2 = _e(j2, () => { if (vue.unref(g2) === "hover") { y2(); } }); const W2 = () => { var e3, t2; (t2 = (e3 = s2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3); S2 == null ? void 0 : S2(); }; const Y2 = () => { E2 == null ? void 0 : E2(); }; const U2 = () => { w2(); c2 = Je(vue.computed(() => { var e3; return (e3 = s2.value) == null ? void 0 : e3.popperContentRef; }), () => { if (vue.unref(d2)) return; const e3 = vue.unref(g2); if (e3 !== "hover") { y2(); } }); }; const K2 = () => { if (!o2.virtualTriggering) { y2(); } }; vue.watch(() => vue.unref(h2), (e3) => { if (!e3) { c2 == null ? void 0 : c2(); } }, { flush: "post" }); vue.watch(() => o2.content, () => { var e3, t2; (t2 = (e3 = s2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3); }); n2({ contentRef: s2 }); return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.unref(hm), { disabled: !e3.teleported, to: vue.unref($2) }, { default: vue.withCtx(() => [vue.createVNode(vue.Transition, { name: vue.unref(_2), onAfterLeave: F2, onBeforeEnter: W2, onAfterEnter: U2, onBeforeLeave: Y2 }, { default: vue.withCtx(() => [vue.unref(L2) ? vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(Jv), vue.mergeProps({ key: 0, id: vue.unref(m2), ref_key: "contentRef", ref: s2 }, e3.$attrs, { "aria-label": e3.ariaLabel, "aria-hidden": vue.unref(N2), "boundaries-padding": e3.boundariesPadding, "fallback-placements": e3.fallbackPlacements, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, placement: e3.placement, "popper-options": e3.popperOptions, strategy: e3.strategy, effect: e3.effect, enterable: e3.enterable, pure: e3.pure, "popper-class": e3.popperClass, "popper-style": [e3.popperStyle, vue.unref(P2)], "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, visible: vue.unref(R2), "z-index": e3.zIndex, onMouseenter: vue.unref(z2), onMouseleave: vue.unref(H2), onBlur: K2, onClose: vue.unref(y2) }), { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 16, ["id", "aria-label", "aria-hidden", "boundaries-padding", "fallback-placements", "gpu-acceleration", "offset", "placement", "popper-options", "strategy", "effect", "enterable", "pure", "popper-class", "popper-style", "reference-el", "trigger-target-el", "visible", "z-index", "onMouseenter", "onMouseleave", "onClose"])), [[vue.vShow, vue.unref(R2)]]) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["name"])]), _: 3 }, 8, ["disabled", "to"])); } }); var bm = np(ym, [["__file", "content.vue"]]); const wm = vue.defineComponent({ name: "ElTooltip" }); const xm = vue.defineComponent({ ...wm, props: lm, emits: sm, setup(e2, { expose: o2, emit: a2 }) { const r2 = e2; kf(); const s2 = mf(); const c2 = vue.ref(); const d2 = vue.ref(); const f2 = () => { var e3; const t2 = vue.unref(c2); if (t2) { (e3 = t2.popperInstanceRef) == null ? void 0 : e3.update(); } }; const p2 = vue.ref(false); const m2 = vue.ref(); const { show: h2, hide: g2, hasUpdateHandler: y2 } = rm({ indicator: p2, toggleReason: m2 }); const { onOpen: w2, onClose: k2 } = Sf({ showAfter: vue.toRef(r2, "showAfter"), hideAfter: vue.toRef(r2, "hideAfter"), autoClose: vue.toRef(r2, "autoClose"), open: h2, close: g2 }); const S2 = vue.computed(() => Zs(r2.visible) && !y2.value); vue.provide(em, { controlled: S2, id: s2, open: vue.readonly(p2), trigger: vue.toRef(r2, "trigger"), onOpen: (e3) => { w2(e3); }, onClose: (e3) => { k2(e3); }, onToggle: (e3) => { if (vue.unref(p2)) { k2(e3); } else { w2(e3); } }, onShow: () => { a2("show", m2.value); }, onHide: () => { a2("hide", m2.value); }, onBeforeShow: () => { a2("before-show", m2.value); }, onBeforeHide: () => { a2("before-hide", m2.value); }, updatePopper: f2 }); vue.watch(() => r2.disabled, (e3) => { if (e3 && p2.value) { p2.value = false; } }); const E2 = (e3) => { var t2, n2; const o3 = (n2 = (t2 = d2.value) == null ? void 0 : t2.contentRef) == null ? void 0 : n2.popperContentRef; const a3 = (e3 == null ? void 0 : e3.relatedTarget) || document.activeElement; return o3 && o3.contains(a3); }; vue.onDeactivated(() => p2.value && g2()); o2({ popperRef: c2, contentRef: d2, isFocusInsideContent: E2, updatePopper: f2, onOpen: w2, onClose: k2, hide: g2 }); return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.unref(Qv), { ref_key: "popperRef", ref: c2, role: e3.role }, { default: vue.withCtx(() => [vue.createVNode(fm, { disabled: e3.disabled, trigger: e3.trigger, "trigger-keys": e3.triggerKeys, "virtual-ref": e3.virtualRef, "virtual-triggering": e3.virtualTriggering }, { default: vue.withCtx(() => [e3.$slots.default ? vue.renderSlot(e3.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["disabled", "trigger", "trigger-keys", "virtual-ref", "virtual-triggering"]), vue.createVNode(bm, { ref_key: "contentRef", ref: d2, "aria-label": e3.ariaLabel, "boundaries-padding": e3.boundariesPadding, content: e3.content, disabled: e3.disabled, effect: e3.effect, enterable: e3.enterable, "fallback-placements": e3.fallbackPlacements, "hide-after": e3.hideAfter, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, persistent: e3.persistent, "popper-class": e3.popperClass, "popper-style": e3.popperStyle, placement: e3.placement, "popper-options": e3.popperOptions, pure: e3.pure, "raw-content": e3.rawContent, "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, "show-after": e3.showAfter, strategy: e3.strategy, teleported: e3.teleported, transition: e3.transition, "virtual-triggering": e3.virtualTriggering, "z-index": e3.zIndex, "append-to": e3.appendTo }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "content", {}, () => [e3.rawContent ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, innerHTML: e3.content }, null, 8, ["innerHTML"])) : (vue.openBlock(), vue.createElementBlock("span", { key: 1 }, vue.toDisplayString(e3.content), 1))]), e3.showArrow ? (vue.openBlock(), vue.createBlock(vue.unref(Qp), { key: 0, "arrow-offset": e3.arrowOffset }, null, 8, ["arrow-offset"])) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["aria-label", "boundaries-padding", "content", "disabled", "effect", "enterable", "fallback-placements", "hide-after", "gpu-acceleration", "offset", "persistent", "popper-class", "popper-style", "placement", "popper-options", "pure", "raw-content", "reference-el", "trigger-target-el", "show-after", "strategy", "teleported", "transition", "virtual-triggering", "z-index", "append-to"])]), _: 3 }, 8, ["role"])); } }); var km = np(xm, [["__file", "tooltip.vue"]]); const Cm = yu(km); const Sm = fu({ value: { type: [String, Number], default: "" }, max: { type: Number, default: 99 }, isDot: Boolean, hidden: Boolean, type: { type: String, values: ["primary", "success", "warning", "info", "danger"], default: "danger" }, showZero: { type: Boolean, default: true }, color: String, badgeStyle: { type: uu([String, Object, Array]) }, offset: { type: uu(Array), default: [0, 0] }, badgeClass: { type: String } }); const Em = vue.defineComponent({ name: "ElBadge" }); const _m = vue.defineComponent({ ...Em, props: Sm, setup(e2, { expose: a2 }) { const r2 = e2; const s2 = Xu("badge"); const i2 = vue.computed(() => { if (r2.isDot) return ""; if (Js(r2.value) && Js(r2.max)) { if (r2.max < r2.value) { return `${r2.max}+`; } return r2.value === 0 && !r2.showZero ? "" : `${r2.value}`; } return `${r2.value}`; }); const c2 = vue.computed(() => { var e3, t2, n2, o2, a3; return [{ backgroundColor: r2.color, marginRight: mi(-((t2 = (e3 = r2.offset) == null ? void 0 : e3[0]) != null ? t2 : 0)), marginTop: mi((o2 = (n2 = r2.offset) == null ? void 0 : n2[1]) != null ? o2 : 0) }, (a3 = r2.badgeStyle) != null ? a3 : {}]; }); a2({ content: i2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(vue.unref(s2).b()) }, [vue.renderSlot(e3.$slots, "default"), vue.createVNode(vue.Transition, { name: `${vue.unref(s2).namespace.value}-zoom-in-center`, persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createElementVNode("sup", { class: vue.normalizeClass([vue.unref(s2).e("content"), vue.unref(s2).em("content", e3.type), vue.unref(s2).is("fixed", !!e3.$slots.default), vue.unref(s2).is("dot", e3.isDot), e3.badgeClass]), style: vue.normalizeStyle(vue.unref(c2)), textContent: vue.toDisplayString(vue.unref(i2)) }, null, 14, ["textContent"]), [[vue.vShow, !e3.hidden && (vue.unref(i2) || e3.isDot)]])]), _: 1 }, 8, ["name"])], 2)); } }); var Om = np(_m, [["__file", "badge.vue"]]); const Mm = yu(Om); const Lm = Symbol("buttonGroupContextKey"); const Dm = (e2, t2) => { Iu({ from: "type.text", replacement: "link", version: "3.0.0", scope: "props", ref: "https://element-plus.org/en-US/component/button.html#button-attributes" }, vue.computed(() => e2.type === "text")); const n2 = vue.inject(Lm, void 0); const o2 = Xf("button"); const { form: a2 } = fp(); const r2 = cp(vue.computed(() => n2 == null ? void 0 : n2.size)); const s2 = dp(); const i2 = vue.ref(); const u2 = vue.useSlots(); const c2 = vue.computed(() => e2.type || (n2 == null ? void 0 : n2.type) || ""); const d2 = vue.computed(() => { var t3, n3, a3; return (a3 = (n3 = e2.autoInsertSpace) != null ? n3 : (t3 = o2.value) == null ? void 0 : t3.autoInsertSpace) != null ? a3 : false; }); const f2 = vue.computed(() => { if (e2.tag === "button") { return { ariaDisabled: s2.value || e2.loading, disabled: s2.value || e2.loading, autofocus: e2.autofocus, type: e2.nativeType }; } return {}; }); const m2 = vue.computed(() => { var e3; const t3 = (e3 = u2.default) == null ? void 0 : e3.call(u2); if (d2.value && (t3 == null ? void 0 : t3.length) === 1) { const e4 = t3[0]; if ((e4 == null ? void 0 : e4.type) === vue.Text) { const t4 = e4.children; return new RegExp("^\\p{Unified_Ideograph}{2}$", "u").test(t4.trim()); } } return false; }); const h2 = (n3) => { if (e2.nativeType === "reset") { a2 == null ? void 0 : a2.resetFields(); } t2("click", n3); }; return { _disabled: s2, _size: r2, _type: c2, _ref: i2, _props: f2, shouldAddSpace: m2, handleClick: h2 }; }; const Am = ["default", "primary", "success", "warning", "info", "danger", "text", ""]; const Rm = ["button", "submit", "reset"]; const $m = fu({ size: If, disabled: Boolean, type: { type: String, values: Am, default: "" }, icon: { type: pu }, nativeType: { type: String, values: Rm, default: "button" }, loading: Boolean, loadingIcon: { type: pu, default: () => Ki }, plain: Boolean, text: Boolean, link: Boolean, bg: Boolean, autofocus: Boolean, round: Boolean, circle: Boolean, color: String, dark: Boolean, autoInsertSpace: { type: Boolean, default: void 0 }, tag: { type: uu([String, Object]), default: "button" } }); const Tm = { click: (e2) => e2 instanceof MouseEvent }; function Pm(e2, t2) { if (Im(e2)) { e2 = "100%"; } var n2 = Bm(e2); e2 = t2 === 360 ? e2 : Math.min(t2, Math.max(0, parseFloat(e2))); if (n2) { e2 = parseInt(String(e2 * t2), 10) / 100; } if (Math.abs(e2 - t2) < 1e-6) { return 1; } if (t2 === 360) { e2 = (e2 < 0 ? e2 % t2 + t2 : e2 % t2) / parseFloat(String(t2)); } else { e2 = e2 % t2 / parseFloat(String(t2)); } return e2; } function Nm(e2) { return Math.min(1, Math.max(0, e2)); } function Im(e2) { return typeof e2 === "string" && e2.indexOf(".") !== -1 && parseFloat(e2) === 1; } function Bm(e2) { return typeof e2 === "string" && e2.indexOf("%") !== -1; } function Vm(e2) { e2 = parseFloat(e2); if (isNaN(e2) || e2 < 0 || e2 > 1) { e2 = 1; } return e2; } function Fm(e2) { if (e2 <= 1) { return "".concat(Number(e2) * 100, "%"); } return e2; } function jm(e2) { return e2.length === 1 ? "0" + e2 : String(e2); } function zm(e2, t2, n2) { return { r: Pm(e2, 255) * 255, g: Pm(t2, 255) * 255, b: Pm(n2, 255) * 255 }; } function Hm(e2, t2, n2) { e2 = Pm(e2, 255); t2 = Pm(t2, 255); n2 = Pm(n2, 255); var o2 = Math.max(e2, t2, n2); var a2 = Math.min(e2, t2, n2); var r2 = 0; var l2 = 0; var s2 = (o2 + a2) / 2; if (o2 === a2) { l2 = 0; r2 = 0; } else { var i2 = o2 - a2; l2 = s2 > 0.5 ? i2 / (2 - o2 - a2) : i2 / (o2 + a2); switch (o2) { case e2: r2 = (t2 - n2) / i2 + (t2 < n2 ? 6 : 0); break; case t2: r2 = (n2 - e2) / i2 + 2; break; case n2: r2 = (e2 - t2) / i2 + 4; break; } r2 /= 6; } return { h: r2, s: l2, l: s2 }; } function Wm(e2, t2, n2) { if (n2 < 0) { n2 += 1; } if (n2 > 1) { n2 -= 1; } if (n2 < 1 / 6) { return e2 + (t2 - e2) * (6 * n2); } if (n2 < 1 / 2) { return t2; } if (n2 < 2 / 3) { return e2 + (t2 - e2) * (2 / 3 - n2) * 6; } return e2; } function Ym(e2, t2, n2) { var o2; var a2; var r2; e2 = Pm(e2, 360); t2 = Pm(t2, 100); n2 = Pm(n2, 100); if (t2 === 0) { a2 = n2; r2 = n2; o2 = n2; } else { var l2 = n2 < 0.5 ? n2 * (1 + t2) : n2 + t2 - n2 * t2; var s2 = 2 * n2 - l2; o2 = Wm(s2, l2, e2 + 1 / 3); a2 = Wm(s2, l2, e2); r2 = Wm(s2, l2, e2 - 1 / 3); } return { r: o2 * 255, g: a2 * 255, b: r2 * 255 }; } function Um(e2, t2, n2) { e2 = Pm(e2, 255); t2 = Pm(t2, 255); n2 = Pm(n2, 255); var o2 = Math.max(e2, t2, n2); var a2 = Math.min(e2, t2, n2); var r2 = 0; var l2 = o2; var s2 = o2 - a2; var i2 = o2 === 0 ? 0 : s2 / o2; if (o2 === a2) { r2 = 0; } else { switch (o2) { case e2: r2 = (t2 - n2) / s2 + (t2 < n2 ? 6 : 0); break; case t2: r2 = (n2 - e2) / s2 + 2; break; case n2: r2 = (e2 - t2) / s2 + 4; break; } r2 /= 6; } return { h: r2, s: i2, v: l2 }; } function Km(e2, t2, n2) { e2 = Pm(e2, 360) * 6; t2 = Pm(t2, 100); n2 = Pm(n2, 100); var o2 = Math.floor(e2); var a2 = e2 - o2; var r2 = n2 * (1 - t2); var l2 = n2 * (1 - a2 * t2); var s2 = n2 * (1 - (1 - a2) * t2); var i2 = o2 % 6; var u2 = [n2, l2, r2, r2, s2, n2][i2]; var c2 = [s2, n2, n2, l2, r2, r2][i2]; var d2 = [r2, r2, s2, n2, n2, l2][i2]; return { r: u2 * 255, g: c2 * 255, b: d2 * 255 }; } function qm(e2, t2, n2, o2) { var a2 = [jm(Math.round(e2).toString(16)), jm(Math.round(t2).toString(16)), jm(Math.round(n2).toString(16))]; if (o2 && a2[0].startsWith(a2[0].charAt(1)) && a2[1].startsWith(a2[1].charAt(1)) && a2[2].startsWith(a2[2].charAt(1))) { return a2[0].charAt(0) + a2[1].charAt(0) + a2[2].charAt(0); } return a2.join(""); } function Gm(e2, t2, n2, o2, a2) { var r2 = [jm(Math.round(e2).toString(16)), jm(Math.round(t2).toString(16)), jm(Math.round(n2).toString(16)), jm(Xm(o2))]; if (a2 && r2[0].startsWith(r2[0].charAt(1)) && r2[1].startsWith(r2[1].charAt(1)) && r2[2].startsWith(r2[2].charAt(1)) && r2[3].startsWith(r2[3].charAt(1))) { return r2[0].charAt(0) + r2[1].charAt(0) + r2[2].charAt(0) + r2[3].charAt(0); } return r2.join(""); } function Xm(e2) { return Math.round(parseFloat(e2) * 255).toString(16); } function Zm(e2) { return Jm(e2) / 255; } function Jm(e2) { return parseInt(e2, 16); } function Qm(e2) { return { r: e2 >> 16, g: (e2 & 65280) >> 8, b: e2 & 255 }; } var eh = { aliceblue: "#f0f8ff", antiquewhite: "#faebd7", aqua: "#00ffff", aquamarine: "#7fffd4", azure: "#f0ffff", beige: "#f5f5dc", bisque: "#ffe4c4", black: "#000000", blanchedalmond: "#ffebcd", blue: "#0000ff", blueviolet: "#8a2be2", brown: "#a52a2a", burlywood: "#deb887", cadetblue: "#5f9ea0", chartreuse: "#7fff00", chocolate: "#d2691e", coral: "#ff7f50", cornflowerblue: "#6495ed", cornsilk: "#fff8dc", crimson: "#dc143c", cyan: "#00ffff", darkblue: "#00008b", darkcyan: "#008b8b", darkgoldenrod: "#b8860b", darkgray: "#a9a9a9", darkgreen: "#006400", darkgrey: "#a9a9a9", darkkhaki: "#bdb76b", darkmagenta: "#8b008b", darkolivegreen: "#556b2f", darkorange: "#ff8c00", darkorchid: "#9932cc", darkred: "#8b0000", darksalmon: "#e9967a", darkseagreen: "#8fbc8f", darkslateblue: "#483d8b", darkslategray: "#2f4f4f", darkslategrey: "#2f4f4f", darkturquoise: "#00ced1", darkviolet: "#9400d3", deeppink: "#ff1493", deepskyblue: "#00bfff", dimgray: "#696969", dimgrey: "#696969", dodgerblue: "#1e90ff", firebrick: "#b22222", floralwhite: "#fffaf0", forestgreen: "#228b22", fuchsia: "#ff00ff", gainsboro: "#dcdcdc", ghostwhite: "#f8f8ff", goldenrod: "#daa520", gold: "#ffd700", gray: "#808080", green: "#008000", greenyellow: "#adff2f", grey: "#808080", honeydew: "#f0fff0", hotpink: "#ff69b4", indianred: "#cd5c5c", indigo: "#4b0082", ivory: "#fffff0", khaki: "#f0e68c", lavenderblush: "#fff0f5", lavender: "#e6e6fa", lawngreen: "#7cfc00", lemonchiffon: "#fffacd", lightblue: "#add8e6", lightcoral: "#f08080", lightcyan: "#e0ffff", lightgoldenrodyellow: "#fafad2", lightgray: "#d3d3d3", lightgreen: "#90ee90", lightgrey: "#d3d3d3", lightpink: "#ffb6c1", lightsalmon: "#ffa07a", lightseagreen: "#20b2aa", lightskyblue: "#87cefa", lightslategray: "#778899", lightslategrey: "#778899", lightsteelblue: "#b0c4de", lightyellow: "#ffffe0", lime: "#00ff00", limegreen: "#32cd32", linen: "#faf0e6", magenta: "#ff00ff", maroon: "#800000", mediumaquamarine: "#66cdaa", mediumblue: "#0000cd", mediumorchid: "#ba55d3", mediumpurple: "#9370db", mediumseagreen: "#3cb371", mediumslateblue: "#7b68ee", mediumspringgreen: "#00fa9a", mediumturquoise: "#48d1cc", mediumvioletred: "#c71585", midnightblue: "#191970", mintcream: "#f5fffa", mistyrose: "#ffe4e1", moccasin: "#ffe4b5", navajowhite: "#ffdead", navy: "#000080", oldlace: "#fdf5e6", olive: "#808000", olivedrab: "#6b8e23", orange: "#ffa500", orangered: "#ff4500", orchid: "#da70d6", palegoldenrod: "#eee8aa", palegreen: "#98fb98", paleturquoise: "#afeeee", palevioletred: "#db7093", papayawhip: "#ffefd5", peachpuff: "#ffdab9", peru: "#cd853f", pink: "#ffc0cb", plum: "#dda0dd", powderblue: "#b0e0e6", purple: "#800080", rebeccapurple: "#663399", red: "#ff0000", rosybrown: "#bc8f8f", royalblue: "#4169e1", saddlebrown: "#8b4513", salmon: "#fa8072", sandybrown: "#f4a460", seagreen: "#2e8b57", seashell: "#fff5ee", sienna: "#a0522d", silver: "#c0c0c0", skyblue: "#87ceeb", slateblue: "#6a5acd", slategray: "#708090", slategrey: "#708090", snow: "#fffafa", springgreen: "#00ff7f", steelblue: "#4682b4", tan: "#d2b48c", teal: "#008080", thistle: "#d8bfd8", tomato: "#ff6347", turquoise: "#40e0d0", violet: "#ee82ee", wheat: "#f5deb3", white: "#ffffff", whitesmoke: "#f5f5f5", yellow: "#ffff00", yellowgreen: "#9acd32" }; function th(e2) { var t2 = { r: 0, g: 0, b: 0 }; var n2 = 1; var o2 = null; var a2 = null; var r2 = null; var l2 = false; var s2 = false; if (typeof e2 === "string") { e2 = ih(e2); } if (typeof e2 === "object") { if (uh(e2.r) && uh(e2.g) && uh(e2.b)) { t2 = zm(e2.r, e2.g, e2.b); l2 = true; s2 = String(e2.r).substr(-1) === "%" ? "prgb" : "rgb"; } else if (uh(e2.h) && uh(e2.s) && uh(e2.v)) { o2 = Fm(e2.s); a2 = Fm(e2.v); t2 = Km(e2.h, o2, a2); l2 = true; s2 = "hsv"; } else if (uh(e2.h) && uh(e2.s) && uh(e2.l)) { o2 = Fm(e2.s); r2 = Fm(e2.l); t2 = Ym(e2.h, o2, r2); l2 = true; s2 = "hsl"; } if (Object.prototype.hasOwnProperty.call(e2, "a")) { n2 = e2.a; } } n2 = Vm(n2); return { ok: l2, format: e2.format || s2, r: Math.min(255, Math.max(t2.r, 0)), g: Math.min(255, Math.max(t2.g, 0)), b: Math.min(255, Math.max(t2.b, 0)), a: n2 }; } var nh = "[-\\+]?\\d+%?"; var oh = "[-\\+]?\\d*\\.\\d+%?"; var ah = "(?:".concat(oh, ")|(?:").concat(nh, ")"); var rh = "[\\s|\\(]+(".concat(ah, ")[,|\\s]+(").concat(ah, ")[,|\\s]+(").concat(ah, ")\\s*\\)?"); var lh = "[\\s|\\(]+(".concat(ah, ")[,|\\s]+(").concat(ah, ")[,|\\s]+(").concat(ah, ")[,|\\s]+(").concat(ah, ")\\s*\\)?"); var sh = { CSS_UNIT: new RegExp(ah), rgb: new RegExp("rgb" + rh), rgba: new RegExp("rgba" + lh), hsl: new RegExp("hsl" + rh), hsla: new RegExp("hsla" + lh), hsv: new RegExp("hsv" + rh), hsva: new RegExp("hsva" + lh), hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/, hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/ }; function ih(e2) { e2 = e2.trim().toLowerCase(); if (e2.length === 0) { return false; } var t2 = false; if (eh[e2]) { e2 = eh[e2]; t2 = true; } else if (e2 === "transparent") { return { r: 0, g: 0, b: 0, a: 0, format: "name" }; } var n2 = sh.rgb.exec(e2); if (n2) { return { r: n2[1], g: n2[2], b: n2[3] }; } n2 = sh.rgba.exec(e2); if (n2) { return { r: n2[1], g: n2[2], b: n2[3], a: n2[4] }; } n2 = sh.hsl.exec(e2); if (n2) { return { h: n2[1], s: n2[2], l: n2[3] }; } n2 = sh.hsla.exec(e2); if (n2) { return { h: n2[1], s: n2[2], l: n2[3], a: n2[4] }; } n2 = sh.hsv.exec(e2); if (n2) { return { h: n2[1], s: n2[2], v: n2[3] }; } n2 = sh.hsva.exec(e2); if (n2) { return { h: n2[1], s: n2[2], v: n2[3], a: n2[4] }; } n2 = sh.hex8.exec(e2); if (n2) { return { r: Jm(n2[1]), g: Jm(n2[2]), b: Jm(n2[3]), a: Zm(n2[4]), format: t2 ? "name" : "hex8" }; } n2 = sh.hex6.exec(e2); if (n2) { return { r: Jm(n2[1]), g: Jm(n2[2]), b: Jm(n2[3]), format: t2 ? "name" : "hex" }; } n2 = sh.hex4.exec(e2); if (n2) { return { r: Jm(n2[1] + n2[1]), g: Jm(n2[2] + n2[2]), b: Jm(n2[3] + n2[3]), a: Zm(n2[4] + n2[4]), format: t2 ? "name" : "hex8" }; } n2 = sh.hex3.exec(e2); if (n2) { return { r: Jm(n2[1] + n2[1]), g: Jm(n2[2] + n2[2]), b: Jm(n2[3] + n2[3]), format: t2 ? "name" : "hex" }; } return false; } function uh(e2) { return Boolean(sh.CSS_UNIT.exec(String(e2))); } var ch = function() { function e2(t2, n2) { if (t2 === void 0) { t2 = ""; } if (n2 === void 0) { n2 = {}; } var o2; if (t2 instanceof e2) { return t2; } if (typeof t2 === "number") { t2 = Qm(t2); } this.originalInput = t2; var a2 = th(t2); this.originalInput = t2; this.r = a2.r; this.g = a2.g; this.b = a2.b; this.a = a2.a; this.roundA = Math.round(100 * this.a) / 100; this.format = (o2 = n2.format) !== null && o2 !== void 0 ? o2 : a2.format; this.gradientType = n2.gradientType; if (this.r < 1) { this.r = Math.round(this.r); } if (this.g < 1) { this.g = Math.round(this.g); } if (this.b < 1) { this.b = Math.round(this.b); } this.isValid = a2.ok; } e2.prototype.isDark = function() { return this.getBrightness() < 128; }; e2.prototype.isLight = function() { return !this.isDark(); }; e2.prototype.getBrightness = function() { var e3 = this.toRgb(); return (e3.r * 299 + e3.g * 587 + e3.b * 114) / 1e3; }; e2.prototype.getLuminance = function() { var e3 = this.toRgb(); var t2; var n2; var o2; var a2 = e3.r / 255; var r2 = e3.g / 255; var l2 = e3.b / 255; if (a2 <= 0.03928) { t2 = a2 / 12.92; } else { t2 = Math.pow((a2 + 0.055) / 1.055, 2.4); } if (r2 <= 0.03928) { n2 = r2 / 12.92; } else { n2 = Math.pow((r2 + 0.055) / 1.055, 2.4); } if (l2 <= 0.03928) { o2 = l2 / 12.92; } else { o2 = Math.pow((l2 + 0.055) / 1.055, 2.4); } return 0.2126 * t2 + 0.7152 * n2 + 0.0722 * o2; }; e2.prototype.getAlpha = function() { return this.a; }; e2.prototype.setAlpha = function(e3) { this.a = Vm(e3); this.roundA = Math.round(100 * this.a) / 100; return this; }; e2.prototype.isMonochrome = function() { var e3 = this.toHsl().s; return e3 === 0; }; e2.prototype.toHsv = function() { var e3 = Um(this.r, this.g, this.b); return { h: e3.h * 360, s: e3.s, v: e3.v, a: this.a }; }; e2.prototype.toHsvString = function() { var e3 = Um(this.r, this.g, this.b); var t2 = Math.round(e3.h * 360); var n2 = Math.round(e3.s * 100); var o2 = Math.round(e3.v * 100); return this.a === 1 ? "hsv(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%)") : "hsva(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%, ").concat(this.roundA, ")"); }; e2.prototype.toHsl = function() { var e3 = Hm(this.r, this.g, this.b); return { h: e3.h * 360, s: e3.s, l: e3.l, a: this.a }; }; e2.prototype.toHslString = function() { var e3 = Hm(this.r, this.g, this.b); var t2 = Math.round(e3.h * 360); var n2 = Math.round(e3.s * 100); var o2 = Math.round(e3.l * 100); return this.a === 1 ? "hsl(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%)") : "hsla(".concat(t2, ", ").concat(n2, "%, ").concat(o2, "%, ").concat(this.roundA, ")"); }; e2.prototype.toHex = function(e3) { if (e3 === void 0) { e3 = false; } return qm(this.r, this.g, this.b, e3); }; e2.prototype.toHexString = function(e3) { if (e3 === void 0) { e3 = false; } return "#" + this.toHex(e3); }; e2.prototype.toHex8 = function(e3) { if (e3 === void 0) { e3 = false; } return Gm(this.r, this.g, this.b, this.a, e3); }; e2.prototype.toHex8String = function(e3) { if (e3 === void 0) { e3 = false; } return "#" + this.toHex8(e3); }; e2.prototype.toHexShortString = function(e3) { if (e3 === void 0) { e3 = false; } return this.a === 1 ? this.toHexString(e3) : this.toHex8String(e3); }; e2.prototype.toRgb = function() { return { r: Math.round(this.r), g: Math.round(this.g), b: Math.round(this.b), a: this.a }; }; e2.prototype.toRgbString = function() { var e3 = Math.round(this.r); var t2 = Math.round(this.g); var n2 = Math.round(this.b); return this.a === 1 ? "rgb(".concat(e3, ", ").concat(t2, ", ").concat(n2, ")") : "rgba(".concat(e3, ", ").concat(t2, ", ").concat(n2, ", ").concat(this.roundA, ")"); }; e2.prototype.toPercentageRgb = function() { var e3 = function(e4) { return "".concat(Math.round(Pm(e4, 255) * 100), "%"); }; return { r: e3(this.r), g: e3(this.g), b: e3(this.b), a: this.a }; }; e2.prototype.toPercentageRgbString = function() { var e3 = function(e4) { return Math.round(Pm(e4, 255) * 100); }; return this.a === 1 ? "rgb(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%)") : "rgba(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%, ").concat(this.roundA, ")"); }; e2.prototype.toName = function() { if (this.a === 0) { return "transparent"; } if (this.a < 1) { return false; } var e3 = "#" + qm(this.r, this.g, this.b, false); for (var t2 = 0, n2 = Object.entries(eh); t2 < n2.length; t2++) { var o2 = n2[t2], a2 = o2[0], r2 = o2[1]; if (e3 === r2) { return a2; } } return false; }; e2.prototype.toString = function(e3) { var t2 = Boolean(e3); e3 = e3 !== null && e3 !== void 0 ? e3 : this.format; var n2 = false; var o2 = this.a < 1 && this.a >= 0; var a2 = !t2 && o2 && (e3.startsWith("hex") || e3 === "name"); if (a2) { if (e3 === "name" && this.a === 0) { return this.toName(); } return this.toRgbString(); } if (e3 === "rgb") { n2 = this.toRgbString(); } if (e3 === "prgb") { n2 = this.toPercentageRgbString(); } if (e3 === "hex" || e3 === "hex6") { n2 = this.toHexString(); } if (e3 === "hex3") { n2 = this.toHexString(true); } if (e3 === "hex4") { n2 = this.toHex8String(true); } if (e3 === "hex8") { n2 = this.toHex8String(); } if (e3 === "name") { n2 = this.toName(); } if (e3 === "hsl") { n2 = this.toHslString(); } if (e3 === "hsv") { n2 = this.toHsvString(); } return n2 || this.toHexString(); }; e2.prototype.toNumber = function() { return (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b); }; e2.prototype.clone = function() { return new e2(this.toString()); }; e2.prototype.lighten = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toHsl(); n2.l += t2 / 100; n2.l = Nm(n2.l); return new e2(n2); }; e2.prototype.brighten = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toRgb(); n2.r = Math.max(0, Math.min(255, n2.r - Math.round(255 * -(t2 / 100)))); n2.g = Math.max(0, Math.min(255, n2.g - Math.round(255 * -(t2 / 100)))); n2.b = Math.max(0, Math.min(255, n2.b - Math.round(255 * -(t2 / 100)))); return new e2(n2); }; e2.prototype.darken = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toHsl(); n2.l -= t2 / 100; n2.l = Nm(n2.l); return new e2(n2); }; e2.prototype.tint = function(e3) { if (e3 === void 0) { e3 = 10; } return this.mix("white", e3); }; e2.prototype.shade = function(e3) { if (e3 === void 0) { e3 = 10; } return this.mix("black", e3); }; e2.prototype.desaturate = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toHsl(); n2.s -= t2 / 100; n2.s = Nm(n2.s); return new e2(n2); }; e2.prototype.saturate = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toHsl(); n2.s += t2 / 100; n2.s = Nm(n2.s); return new e2(n2); }; e2.prototype.greyscale = function() { return this.desaturate(100); }; e2.prototype.spin = function(t2) { var n2 = this.toHsl(); var o2 = (n2.h + t2) % 360; n2.h = o2 < 0 ? 360 + o2 : o2; return new e2(n2); }; e2.prototype.mix = function(t2, n2) { if (n2 === void 0) { n2 = 50; } var o2 = this.toRgb(); var a2 = new e2(t2).toRgb(); var r2 = n2 / 100; var l2 = { r: (a2.r - o2.r) * r2 + o2.r, g: (a2.g - o2.g) * r2 + o2.g, b: (a2.b - o2.b) * r2 + o2.b, a: (a2.a - o2.a) * r2 + o2.a }; return new e2(l2); }; e2.prototype.analogous = function(t2, n2) { if (t2 === void 0) { t2 = 6; } if (n2 === void 0) { n2 = 30; } var o2 = this.toHsl(); var a2 = 360 / n2; var r2 = [this]; for (o2.h = (o2.h - (a2 * t2 >> 1) + 720) % 360; --t2; ) { o2.h = (o2.h + a2) % 360; r2.push(new e2(o2)); } return r2; }; e2.prototype.complement = function() { var t2 = this.toHsl(); t2.h = (t2.h + 180) % 360; return new e2(t2); }; e2.prototype.monochromatic = function(t2) { if (t2 === void 0) { t2 = 6; } var n2 = this.toHsv(); var o2 = n2.h; var a2 = n2.s; var r2 = n2.v; var l2 = []; var s2 = 1 / t2; while (t2--) { l2.push(new e2({ h: o2, s: a2, v: r2 })); r2 = (r2 + s2) % 1; } return l2; }; e2.prototype.splitcomplement = function() { var t2 = this.toHsl(); var n2 = t2.h; return [this, new e2({ h: (n2 + 72) % 360, s: t2.s, l: t2.l }), new e2({ h: (n2 + 216) % 360, s: t2.s, l: t2.l })]; }; e2.prototype.onBackground = function(t2) { var n2 = this.toRgb(); var o2 = new e2(t2).toRgb(); var a2 = n2.a + o2.a * (1 - n2.a); return new e2({ r: (n2.r * n2.a + o2.r * o2.a * (1 - n2.a)) / a2, g: (n2.g * n2.a + o2.g * o2.a * (1 - n2.a)) / a2, b: (n2.b * n2.a + o2.b * o2.a * (1 - n2.a)) / a2, a: a2 }); }; e2.prototype.triad = function() { return this.polyad(3); }; e2.prototype.tetrad = function() { return this.polyad(4); }; e2.prototype.polyad = function(t2) { var n2 = this.toHsl(); var o2 = n2.h; var a2 = [this]; var r2 = 360 / t2; for (var l2 = 1; l2 < t2; l2++) { a2.push(new e2({ h: (o2 + l2 * r2) % 360, s: n2.s, l: n2.l })); } return a2; }; e2.prototype.equals = function(t2) { return this.toRgbString() === new e2(t2).toRgbString(); }; return e2; }(); function dh(e2, t2 = 20) { return e2.mix("#141414", t2).toString(); } function fh(e2) { const t2 = dp(); const n2 = Xu("button"); return vue.computed(() => { let o2 = {}; let a2 = e2.color; if (a2) { const r2 = a2.match(/var\((.*?)\)/); if (r2) { a2 = window.getComputedStyle(window.document.documentElement).getPropertyValue(r2[1]); } const l2 = new ch(a2); const s2 = e2.dark ? l2.tint(20).toString() : dh(l2, 20); if (e2.plain) { o2 = n2.cssVarBlock({ "bg-color": e2.dark ? dh(l2, 90) : l2.tint(90).toString(), "text-color": a2, "border-color": e2.dark ? dh(l2, 50) : l2.tint(50).toString(), "hover-text-color": `var(${n2.cssVarName("color-white")})`, "hover-bg-color": a2, "hover-border-color": a2, "active-bg-color": s2, "active-text-color": `var(${n2.cssVarName("color-white")})`, "active-border-color": s2 }); if (t2.value) { o2[n2.cssVarBlockName("disabled-bg-color")] = e2.dark ? dh(l2, 90) : l2.tint(90).toString(); o2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? dh(l2, 50) : l2.tint(50).toString(); o2[n2.cssVarBlockName("disabled-border-color")] = e2.dark ? dh(l2, 80) : l2.tint(80).toString(); } } else { const r3 = e2.dark ? dh(l2, 30) : l2.tint(30).toString(); const i2 = l2.isDark() ? `var(${n2.cssVarName("color-white")})` : `var(${n2.cssVarName("color-black")})`; o2 = n2.cssVarBlock({ "bg-color": a2, "text-color": i2, "border-color": a2, "hover-bg-color": r3, "hover-text-color": i2, "hover-border-color": r3, "active-bg-color": s2, "active-border-color": s2 }); if (t2.value) { const t3 = e2.dark ? dh(l2, 50) : l2.tint(50).toString(); o2[n2.cssVarBlockName("disabled-bg-color")] = t3; o2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? "rgba(255, 255, 255, 0.5)" : `var(${n2.cssVarName("color-white")})`; o2[n2.cssVarBlockName("disabled-border-color")] = t3; } } } return o2; }); } const ph = vue.defineComponent({ name: "ElButton" }); const vh = vue.defineComponent({ ...ph, props: $m, emits: Tm, setup(e2, { expose: o2, emit: a2 }) { const r2 = e2; const s2 = fh(r2); const i2 = Xu("button"); const { _ref: c2, _size: d2, _type: f2, _disabled: p2, _props: v2, shouldAddSpace: m2, handleClick: h2 } = Dm(r2, a2); const g2 = vue.computed(() => [i2.b(), i2.m(f2.value), i2.m(d2.value), i2.is("disabled", p2.value), i2.is("loading", r2.loading), i2.is("plain", r2.plain), i2.is("round", r2.round), i2.is("circle", r2.circle), i2.is("text", r2.text), i2.is("link", r2.link), i2.is("has-bg", r2.bg)]); o2({ ref: c2, size: d2, type: f2, disabled: p2, shouldAddSpace: m2 }); return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), vue.mergeProps({ ref_key: "_ref", ref: c2 }, vue.unref(v2), { class: vue.unref(g2), style: vue.unref(s2), onClick: vue.unref(h2) }), { default: vue.withCtx(() => [e3.loading ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [e3.$slots.loading ? vue.renderSlot(e3.$slots, "loading", { key: 0 }) : (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 1, class: vue.normalizeClass(vue.unref(i2).is("loading")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.loadingIcon)))]), _: 1 }, 8, ["class"]))], 64)) : e3.icon || e3.$slots.icon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 1 }, { default: vue.withCtx(() => [e3.icon ? (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.icon), { key: 0 })) : vue.renderSlot(e3.$slots, "icon", { key: 1 })]), _: 3 })) : vue.createCommentVNode("v-if", true), e3.$slots.default ? (vue.openBlock(), vue.createElementBlock("span", { key: 2, class: vue.normalizeClass({ [vue.unref(i2).em("text", "expand")]: vue.unref(m2) }) }, [vue.renderSlot(e3.$slots, "default")], 2)) : vue.createCommentVNode("v-if", true)]), _: 3 }, 16, ["class", "style", "onClick"])); } }); var mh = np(vh, [["__file", "button.vue"]]); const hh = { size: $m.size, type: $m.type }; const gh = vue.defineComponent({ name: "ElButtonGroup" }); const yh = vue.defineComponent({ ...gh, props: hh, setup(e2) { const o2 = e2; vue.provide(Lm, vue.reactive({ size: vue.toRef(o2, "size"), type: vue.toRef(o2, "type") })); const a2 = Xu("button"); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(vue.unref(a2).b("group")) }, [vue.renderSlot(e3.$slots, "default")], 2)); } }); var bh = np(yh, [["__file", "button-group.vue"]]); const wh = yu(mh, { ButtonGroup: bh }); wu(bh); var xh = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {}; function kh(e2) { return e2 && e2.__esModule && Object.prototype.hasOwnProperty.call(e2, "default") ? e2["default"] : e2; } var Ch = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(xh, function() { var e3 = { LTS: "h:mm:ss A", LT: "h:mm A", L: "MM/DD/YYYY", LL: "MMMM D, YYYY", LLL: "MMMM D, YYYY h:mm A", LLLL: "dddd, MMMM D, YYYY h:mm A" }, t3 = /(\[[^[]*\])|([-_:/.,()\s]+)|(A|a|YYYY|YY?|MM?M?M?|Do|DD?|hh?|HH?|mm?|ss?|S{1,3}|z|ZZ?)/g, n2 = /\d\d/, o2 = /\d\d?/, a2 = /\d*[^-_:/,()\s\d]+/, r2 = {}, l2 = function(e4) { return (e4 = +e4) + (e4 > 68 ? 1900 : 2e3); }; var s2 = function(e4) { return function(t4) { this[e4] = +t4; }; }, i2 = [/[+-]\d\d:?(\d\d)?|Z/, function(e4) { (this.zone || (this.zone = {})).offset = function(e5) { if (!e5) return 0; if ("Z" === e5) return 0; var t4 = e5.match(/([+-]|\d\d)/g), n3 = 60 * t4[1] + (+t4[2] || 0); return 0 === n3 ? 0 : "+" === t4[0] ? -n3 : n3; }(e4); }], u2 = function(e4) { var t4 = r2[e4]; return t4 && (t4.indexOf ? t4 : t4.s.concat(t4.f)); }, c2 = function(e4, t4) { var n3, o3 = r2.meridiem; if (o3) { for (var a3 = 1; a3 <= 24; a3 += 1) if (e4.indexOf(o3(a3, 0, t4)) > -1) { n3 = a3 > 12; break; } } else n3 = e4 === (t4 ? "pm" : "PM"); return n3; }, d2 = { A: [a2, function(e4) { this.afternoon = c2(e4, false); }], a: [a2, function(e4) { this.afternoon = c2(e4, true); }], S: [/\d/, function(e4) { this.milliseconds = 100 * +e4; }], SS: [n2, function(e4) { this.milliseconds = 10 * +e4; }], SSS: [/\d{3}/, function(e4) { this.milliseconds = +e4; }], s: [o2, s2("seconds")], ss: [o2, s2("seconds")], m: [o2, s2("minutes")], mm: [o2, s2("minutes")], H: [o2, s2("hours")], h: [o2, s2("hours")], HH: [o2, s2("hours")], hh: [o2, s2("hours")], D: [o2, s2("day")], DD: [n2, s2("day")], Do: [a2, function(e4) { var t4 = r2.ordinal, n3 = e4.match(/\d+/); if (this.day = n3[0], t4) for (var o3 = 1; o3 <= 31; o3 += 1) t4(o3).replace(/\[|\]/g, "") === e4 && (this.day = o3); }], M: [o2, s2("month")], MM: [n2, s2("month")], MMM: [a2, function(e4) { var t4 = u2("months"), n3 = (u2("monthsShort") || t4.map(function(e5) { return e5.slice(0, 3); })).indexOf(e4) + 1; if (n3 < 1) throw new Error(); this.month = n3 % 12 || n3; }], MMMM: [a2, function(e4) { var t4 = u2("months").indexOf(e4) + 1; if (t4 < 1) throw new Error(); this.month = t4 % 12 || t4; }], Y: [/[+-]?\d+/, s2("year")], YY: [n2, function(e4) { this.year = l2(e4); }], YYYY: [/\d{4}/, s2("year")], Z: i2, ZZ: i2 }; function f2(n3) { var o3, a3; o3 = n3, a3 = r2 && r2.formats; for (var l3 = (n3 = o3.replace(/(\[[^\]]+])|(LTS?|l{1,4}|L{1,4})/g, function(t4, n4, o4) { var r3 = o4 && o4.toUpperCase(); return n4 || a3[o4] || e3[o4] || a3[r3].replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e4, t5, n5) { return t5 || n5.slice(1); }); })).match(t3), s3 = l3.length, i3 = 0; i3 < s3; i3 += 1) { var u3 = l3[i3], c3 = d2[u3], f3 = c3 && c3[0], p2 = c3 && c3[1]; l3[i3] = p2 ? { regex: f3, parser: p2 } : u3.replace(/^\[|\]$/g, ""); } return function(e4) { for (var t4 = {}, n4 = 0, o4 = 0; n4 < s3; n4 += 1) { var a4 = l3[n4]; if ("string" == typeof a4) o4 += a4.length; else { var r3 = a4.regex, i4 = a4.parser, u4 = e4.slice(o4), c4 = r3.exec(u4)[0]; i4.call(t4, c4), e4 = e4.replace(c4, ""); } } return function(e5) { var t5 = e5.afternoon; if (void 0 !== t5) { var n5 = e5.hours; t5 ? n5 < 12 && (e5.hours += 12) : 12 === n5 && (e5.hours = 0), delete e5.afternoon; } }(t4), t4; }; } return function(e4, t4, n3) { n3.p.customParseFormat = true, e4 && e4.parseTwoDigitYear && (l2 = e4.parseTwoDigitYear); var o3 = t4.prototype, a3 = o3.parse; o3.parse = function(e5) { var t5 = e5.date, o4 = e5.utc, l3 = e5.args; this.$u = o4; var s3 = l3[1]; if ("string" == typeof s3) { var i3 = true === l3[2], u3 = true === l3[3], c3 = i3 || u3, d3 = l3[2]; u3 && (d3 = l3[2]), r2 = this.$locale(), !i3 && d3 && (r2 = n3.Ls[d3]), this.$d = function(e6, t6, n4) { try { if (["x", "X"].indexOf(t6) > -1) return new Date(("X" === t6 ? 1e3 : 1) * e6); var o5 = f2(t6)(e6), a4 = o5.year, r3 = o5.month, l4 = o5.day, s4 = o5.hours, i4 = o5.minutes, u4 = o5.seconds, c4 = o5.milliseconds, d4 = o5.zone, p3 = /* @__PURE__ */ new Date(), v3 = l4 || (a4 || r3 ? 1 : p3.getDate()), m3 = a4 || p3.getFullYear(), h2 = 0; a4 && !r3 || (h2 = r3 > 0 ? r3 - 1 : p3.getMonth()); var g2 = s4 || 0, y2 = i4 || 0, b2 = u4 || 0, w2 = c4 || 0; return d4 ? new Date(Date.UTC(m3, h2, v3, g2, y2, b2, w2 + 60 * d4.offset * 1e3)) : n4 ? new Date(Date.UTC(m3, h2, v3, g2, y2, b2, w2)) : new Date(m3, h2, v3, g2, y2, b2, w2); } catch (e7) { return /* @__PURE__ */ new Date(""); } }(t5, s3, o4), this.init(), d3 && true !== d3 && (this.$L = this.locale(d3).$L), c3 && t5 != this.format(s3) && (this.$d = /* @__PURE__ */ new Date("")), r2 = {}; } else if (s3 instanceof Array) for (var p2 = s3.length, v2 = 1; v2 <= p2; v2 += 1) { l3[1] = s3[v2 - 1]; var m2 = n3.apply(this, l3); if (m2.isValid()) { this.$d = m2.$d, this.$L = m2.$L, this.init(); break; } v2 === p2 && (this.$d = /* @__PURE__ */ new Date("")); } else a3.call(this, e5); }; }; }); })(Ch); var Sh = Ch.exports; const Eh = kh(Sh); const _h = ["hours", "minutes", "seconds"]; const Oh = "HH:mm:ss"; const Mh = "YYYY-MM-DD"; const Lh = { date: Mh, dates: Mh, week: "gggg[w]ww", year: "YYYY", years: "YYYY", month: "YYYY-MM", months: "YYYY-MM", datetime: `${Mh} ${Oh}`, monthrange: "YYYY-MM", yearrange: "YYYY", daterange: Mh, datetimerange: `${Mh} ${Oh}` }; const Dh = (e2, t2) => [e2 > 0 ? e2 - 1 : void 0, e2, e2 < t2 ? e2 + 1 : void 0]; const Ah = (e2) => Array.from(Array.from({ length: e2 }).keys()); const Rh = (e2) => e2.replace(/\W?m{1,2}|\W?ZZ/g, "").replace(/\W?h{1,2}|\W?s{1,3}|\W?a/gi, "").trim(); const $h = (e2) => e2.replace(/\W?D{1,2}|\W?Do|\W?d{1,4}|\W?M{1,4}|\W?Y{2,4}/g, "").trim(); const Th = function(e2, t2) { const n2 = kt(e2); const o2 = kt(t2); if (n2 && o2) { return e2.getTime() === t2.getTime(); } if (!n2 && !o2) { return e2 === t2; } return false; }; const Ph = function(e2, t2) { const n2 = xt(e2); const o2 = xt(t2); if (n2 && o2) { if (e2.length !== t2.length) { return false; } return e2.every((e3, n3) => Th(e3, t2[n3])); } if (!n2 && !o2) { return Th(e2, t2); } return false; }; const Nh = function(e2, t2, n2) { const o2 = Qs(t2) || t2 === "x" ? ue(e2).locale(n2) : ue(e2, t2).locale(n2); return o2.isValid() ? o2 : void 0; }; const Ih = function(e2, t2, n2) { if (Qs(t2)) return e2; if (t2 === "x") return +e2; return ue(e2).locale(n2).format(t2); }; const Bh = (e2, t2) => { var n2; const o2 = []; const a2 = t2 == null ? void 0 : t2(); for (let t3 = 0; t3 < e2; t3++) { o2.push((n2 = a2 == null ? void 0 : a2.includes(t3)) != null ? n2 : false); } return o2; }; const Vh = fu({ disabledHours: { type: uu(Function) }, disabledMinutes: { type: uu(Function) }, disabledSeconds: { type: uu(Function) } }); const Fh = fu({ visible: Boolean, actualVisible: { type: Boolean, default: void 0 }, format: { type: String, default: "" } }); const jh = fu({ id: { type: uu([Array, String]) }, name: { type: uu([Array, String]), default: "" }, popperClass: { type: String, default: "" }, format: String, valueFormat: String, dateFormat: String, timeFormat: String, type: { type: String, default: "" }, clearable: { type: Boolean, default: true }, clearIcon: { type: uu([String, Object]), default: $i }, editable: { type: Boolean, default: true }, prefixIcon: { type: uu([String, Object]), default: "" }, size: If, readonly: Boolean, disabled: Boolean, placeholder: { type: String, default: "" }, popperOptions: { type: uu(Object), default: () => ({}) }, modelValue: { type: uu([Date, Array, String, Number]), default: "" }, rangeSeparator: { type: String, default: "-" }, startPlaceholder: String, endPlaceholder: String, defaultValue: { type: uu([Date, Array]) }, defaultTime: { type: uu([Date, Array]) }, isRange: Boolean, ...Vh, disabledDate: { type: Function }, cellClassName: { type: Function }, shortcuts: { type: Array, default: () => [] }, arrowControl: Boolean, tabindex: { type: uu([String, Number]), default: 0 }, validateEvent: { type: Boolean, default: true }, unlinkPanels: Boolean, ...Wf, ...Kf(["ariaLabel"]) }); const zh = vue.defineComponent({ name: "Picker" }); const Hh = vue.defineComponent({ ...zh, props: jh, emits: ["update:modelValue", "change", "focus", "blur", "clear", "calendar-change", "panel-change", "visible-change", "keydown"], setup(e2, { expose: a2, emit: r2 }) { const s2 = e2; const c2 = vue.useAttrs(); const { lang: d2 } = Wu(); const m2 = Xu("date"); const h2 = Xu("input"); const g2 = Xu("range"); const { form: y2, formItem: C2 } = fp(); const S2 = vue.inject("ElPopperOptions", {}); const { valueOnClear: _2 } = Yf(s2, null); const M2 = vue.ref(); const T2 = vue.ref(); const I2 = vue.ref(false); const B2 = vue.ref(false); const V2 = vue.ref(null); let F2 = false; let j2 = false; const z2 = vue.computed(() => [m2.b("editor"), m2.bm("editor", s2.type), h2.e("wrapper"), m2.is("disabled", se2.value), m2.is("active", I2.value), g2.b("editor"), Se2 ? g2.bm("editor", Se2.value) : "", c2.class]); const H2 = vue.computed(() => [h2.e("icon"), g2.e("close-icon"), !he2.value ? g2.e("close-icon--hidden") : ""]); vue.watch(I2, (e3) => { if (!e3) { Me2.value = null; vue.nextTick(() => { W2(s2.modelValue); }); } else { vue.nextTick(() => { if (e3) { V2.value = s2.modelValue; } }); } }); const W2 = (e3, t2) => { if (t2 || !Ph(e3, V2.value)) { r2("change", e3); s2.validateEvent && (C2 == null ? void 0 : C2.validate("change").catch((e4) => ui())); } }; const Y2 = (e3) => { if (!Ph(s2.modelValue, e3)) { let t2; if (xt(e3)) { t2 = e3.map((e4) => Ih(e4, s2.valueFormat, d2.value)); } else if (e3) { t2 = Ih(e3, s2.valueFormat, d2.value); } r2("update:modelValue", e3 ? t2 : e3, d2.value); } }; const U2 = (e3) => { r2("keydown", e3); }; const K2 = vue.computed(() => { if (T2.value) { const e3 = Ce2.value ? T2.value : T2.value.$el; return Array.from(e3.querySelectorAll("input")); } return []; }); const q2 = (e3, t2, n2) => { const o2 = K2.value; if (!o2.length) return; if (!n2 || n2 === "min") { o2[0].setSelectionRange(e3, t2); o2[0].focus(); } else if (n2 === "max") { o2[1].setSelectionRange(e3, t2); o2[1].focus(); } }; const G2 = () => { oe2(true, true); vue.nextTick(() => { j2 = false; }); }; const X2 = (e3 = "", t2 = false) => { if (!t2) { j2 = true; } I2.value = t2; let n2; if (xt(e3)) { n2 = e3.map((e4) => e4.toDate()); } else { n2 = e3 ? e3.toDate() : e3; } Me2.value = null; Y2(n2); }; const Z2 = () => { B2.value = true; }; const J2 = () => { r2("visible-change", true); }; const Q2 = (e3) => { if ((e3 == null ? void 0 : e3.key) === ku.esc) { oe2(true, true); } }; const ee2 = () => { B2.value = false; I2.value = false; j2 = false; r2("visible-change", false); }; const te2 = () => { I2.value = true; }; const ne2 = () => { I2.value = false; }; const oe2 = (e3 = true, t2 = false) => { j2 = t2; const [n2, o2] = vue.unref(K2); let a3 = n2; if (!e3 && Ce2.value) { a3 = o2; } if (a3) { a3.focus(); } }; const ae2 = (e3) => { if (s2.readonly || se2.value || I2.value || j2) { return; } I2.value = true; r2("focus", e3); }; let re2 = void 0; const le2 = (e3) => { const t2 = async () => { setTimeout(() => { var n2; if (re2 === t2) { if (!(((n2 = M2.value) == null ? void 0 : n2.isFocusInsideContent()) && !F2) && K2.value.filter((e4) => e4.contains(document.activeElement)).length === 0) { Le2(); I2.value = false; r2("blur", e3); s2.validateEvent && (C2 == null ? void 0 : C2.validate("blur").catch((e4) => ui())); } F2 = false; } }, 0); }; re2 = t2; t2(); }; const se2 = vue.computed(() => s2.disabled || (y2 == null ? void 0 : y2.disabled)); const ie2 = vue.computed(() => { let e3; if (ye2.value) { if (Ve2.value.getDefaultValue) { e3 = Ve2.value.getDefaultValue(); } } else { if (xt(s2.modelValue)) { e3 = s2.modelValue.map((e4) => Nh(e4, s2.valueFormat, d2.value)); } else { e3 = Nh(s2.modelValue, s2.valueFormat, d2.value); } } if (Ve2.value.getRangeAvailableTime) { const t2 = Ve2.value.getRangeAvailableTime(e3); if (!js(t2, e3)) { e3 = t2; Y2(xt(e3) ? e3.map((e4) => e4.toDate()) : e3.toDate()); } } if (xt(e3) && e3.some((e4) => !e4)) { e3 = []; } return e3; }); const ue2 = vue.computed(() => { if (!Ve2.value.panelReady) return ""; const e3 = Ae2(ie2.value); if (xt(Me2.value)) { return [Me2.value[0] || e3 && e3[0] || "", Me2.value[1] || e3 && e3[1] || ""]; } else if (Me2.value !== null) { return Me2.value; } if (!de2.value && ye2.value) return ""; if (!I2.value && ye2.value) return ""; if (e3) { return fe2.value || pe2.value || ve2.value ? e3.join(", ") : e3; } return ""; }); const ce2 = vue.computed(() => s2.type.includes("time")); const de2 = vue.computed(() => s2.type.startsWith("time")); const fe2 = vue.computed(() => s2.type === "dates"); const pe2 = vue.computed(() => s2.type === "months"); const ve2 = vue.computed(() => s2.type === "years"); const me2 = vue.computed(() => s2.prefixIcon || (ce2.value ? Pi : Oi)); const he2 = vue.ref(false); const ge2 = (e3) => { if (s2.readonly || se2.value) return; if (he2.value) { e3.stopPropagation(); G2(); if (Ve2.value.handleClear) { Ve2.value.handleClear(); } else { Y2(_2.value); } W2(_2.value, true); he2.value = false; I2.value = false; } r2("clear"); }; const ye2 = vue.computed(() => { const { modelValue: e3 } = s2; return !e3 || xt(e3) && !e3.filter(Boolean).length; }); const be2 = async (e3) => { var t2; if (s2.readonly || se2.value) return; if (((t2 = e3.target) == null ? void 0 : t2.tagName) !== "INPUT" || K2.value.includes(document.activeElement)) { I2.value = true; } }; const we2 = () => { if (s2.readonly || se2.value) return; if (!ye2.value && s2.clearable) { he2.value = true; } }; const xe2 = () => { he2.value = false; }; const ke2 = (e3) => { var t2; if (s2.readonly || se2.value) return; if (((t2 = e3.touches[0].target) == null ? void 0 : t2.tagName) !== "INPUT" || K2.value.includes(document.activeElement)) { I2.value = true; } }; const Ce2 = vue.computed(() => s2.type.includes("range")); const Se2 = cp(); const Ee2 = vue.computed(() => { var e3, t2; return (t2 = (e3 = vue.unref(M2)) == null ? void 0 : e3.popperRef) == null ? void 0 : t2.contentRef; }); const _e2 = vue.computed(() => { var e3; if (vue.unref(Ce2)) { return vue.unref(T2); } return (e3 = vue.unref(T2)) == null ? void 0 : e3.$el; }); const Oe2 = Je(_e2, (e3) => { const t2 = vue.unref(Ee2); const n2 = vue.unref(_e2); if (t2 && (e3.target === t2 || e3.composedPath().includes(t2)) || e3.target === n2 || e3.composedPath().includes(n2)) return; I2.value = false; }); vue.onBeforeUnmount(() => { Oe2 == null ? void 0 : Oe2(); }); const Me2 = vue.ref(null); const Le2 = () => { if (Me2.value) { const e3 = De2(ue2.value); if (e3) { if (Re2(e3)) { Y2(xt(e3) ? e3.map((e4) => e4.toDate()) : e3.toDate()); Me2.value = null; } } } if (Me2.value === "") { Y2(_2.value); W2(_2.value); Me2.value = null; } }; const De2 = (e3) => { if (!e3) return null; return Ve2.value.parseUserInput(e3); }; const Ae2 = (e3) => { if (!e3) return null; return Ve2.value.formatToString(e3); }; const Re2 = (e3) => Ve2.value.isValidValue(e3); const $e2 = async (e3) => { if (s2.readonly || se2.value) return; const { code: t2 } = e3; U2(e3); if (t2 === ku.esc) { if (I2.value === true) { I2.value = false; e3.preventDefault(); e3.stopPropagation(); } return; } if (t2 === ku.down) { if (Ve2.value.handleFocusPicker) { e3.preventDefault(); e3.stopPropagation(); } if (I2.value === false) { I2.value = true; await vue.nextTick(); } if (Ve2.value.handleFocusPicker) { Ve2.value.handleFocusPicker(); return; } } if (t2 === ku.tab) { F2 = true; return; } if (t2 === ku.enter || t2 === ku.numpadEnter) { if (Me2.value === null || Me2.value === "" || Re2(De2(ue2.value))) { Le2(); I2.value = false; } e3.stopPropagation(); return; } if (Me2.value) { e3.stopPropagation(); return; } if (Ve2.value.handleKeydownInput) { Ve2.value.handleKeydownInput(e3); } }; const Te2 = (e3) => { Me2.value = e3; if (!I2.value) { I2.value = true; } }; const Pe2 = (e3) => { const t2 = e3.target; if (Me2.value) { Me2.value = [t2.value, Me2.value[1]]; } else { Me2.value = [t2.value, null]; } }; const Ne2 = (e3) => { const t2 = e3.target; if (Me2.value) { Me2.value = [Me2.value[0], t2.value]; } else { Me2.value = [null, t2.value]; } }; const Ie2 = () => { var e3; const t2 = Me2.value; const n2 = De2(t2 && t2[0]); const o2 = vue.unref(ie2); if (n2 && n2.isValid()) { Me2.value = [Ae2(n2), ((e3 = ue2.value) == null ? void 0 : e3[1]) || null]; const t3 = [n2, o2 && (o2[1] || null)]; if (Re2(t3)) { Y2(t3); Me2.value = null; } } }; const Be2 = () => { var e3; const t2 = vue.unref(Me2); const n2 = De2(t2 && t2[1]); const o2 = vue.unref(ie2); if (n2 && n2.isValid()) { Me2.value = [((e3 = vue.unref(ue2)) == null ? void 0 : e3[0]) || null, Ae2(n2)]; const t3 = [o2 && o2[0], n2]; if (Re2(t3)) { Y2(t3); Me2.value = null; } } }; const Ve2 = vue.ref({}); const Fe2 = (e3) => { Ve2.value[e3[0]] = e3[1]; Ve2.value.panelReady = true; }; const je2 = (e3) => { r2("calendar-change", e3); }; const ze2 = (e3, t2, n2) => { r2("panel-change", e3, t2, n2); }; vue.provide("EP_PICKER_BASE", { props: s2 }); a2({ focus: oe2, handleFocusInput: ae2, handleBlurInput: le2, handleOpen: te2, handleClose: ne2, onPick: X2 }); return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.unref(Cm), vue.mergeProps({ ref_key: "refPopper", ref: M2, visible: I2.value, effect: "light", pure: "", trigger: "click" }, e3.$attrs, { role: "dialog", teleported: "", transition: `${vue.unref(m2).namespace.value}-zoom-in-top`, "popper-class": [`${vue.unref(m2).namespace.value}-picker__popper`, e3.popperClass], "popper-options": vue.unref(S2), "fallback-placements": ["bottom", "top", "right", "left"], "gpu-acceleration": false, "stop-popper-mouse-event": false, "hide-after": 0, persistent: "", onBeforeShow: Z2, onShow: J2, onHide: ee2 }), { default: vue.withCtx(() => [!vue.unref(Ce2) ? (vue.openBlock(), vue.createBlock(vue.unref(Sp), { key: 0, id: e3.id, ref_key: "inputRef", ref: T2, "container-role": "combobox", "model-value": vue.unref(ue2), name: e3.name, size: vue.unref(Se2), disabled: vue.unref(se2), placeholder: e3.placeholder, class: vue.normalizeClass([vue.unref(m2).b("editor"), vue.unref(m2).bm("editor", e3.type), e3.$attrs.class]), style: vue.normalizeStyle(e3.$attrs.style), readonly: !e3.editable || e3.readonly || vue.unref(fe2) || vue.unref(pe2) || vue.unref(ve2) || e3.type === "week", "aria-label": e3.ariaLabel, tabindex: e3.tabindex, "validate-event": false, onInput: Te2, onFocus: ae2, onBlur: le2, onKeydown: $e2, onChange: Le2, onMousedown: be2, onMouseenter: we2, onMouseleave: xe2, onTouchstartPassive: ke2, onClick: vue.withModifiers(() => { }, ["stop"]) }, { prefix: vue.withCtx(() => [vue.unref(me2) ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0, class: vue.normalizeClass(vue.unref(h2).e("icon")), onMousedown: vue.withModifiers(be2, ["prevent"]), onTouchstartPassive: ke2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(me2))))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true)]), suffix: vue.withCtx(() => [he2.value && e3.clearIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0, class: vue.normalizeClass(`${vue.unref(h2).e("icon")} clear-icon`), onClick: vue.withModifiers(ge2, ["stop"]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.clearIcon)))]), _: 1 }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true)]), _: 1 }, 8, ["id", "model-value", "name", "size", "disabled", "placeholder", "class", "style", "readonly", "aria-label", "tabindex", "onKeydown", "onClick"])) : (vue.openBlock(), vue.createElementBlock("div", { key: 1, ref_key: "inputRef", ref: T2, class: vue.normalizeClass(vue.unref(z2)), style: vue.normalizeStyle(e3.$attrs.style), onClick: ae2, onMouseenter: we2, onMouseleave: xe2, onTouchstartPassive: ke2, onKeydown: $e2 }, [vue.unref(me2) ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0, class: vue.normalizeClass([vue.unref(h2).e("icon"), vue.unref(g2).e("icon")]), onMousedown: vue.withModifiers(be2, ["prevent"]), onTouchstartPassive: ke2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(me2))))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", { id: e3.id && e3.id[0], autocomplete: "off", name: e3.name && e3.name[0], placeholder: e3.startPlaceholder, value: vue.unref(ue2) && vue.unref(ue2)[0], disabled: vue.unref(se2), readonly: !e3.editable || e3.readonly, class: vue.normalizeClass(vue.unref(g2).b("input")), onMousedown: be2, onInput: Pe2, onChange: Ie2, onFocus: ae2, onBlur: le2 }, null, 42, ["id", "name", "placeholder", "value", "disabled", "readonly"]), vue.renderSlot(e3.$slots, "range-separator", {}, () => [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(g2).b("separator")) }, vue.toDisplayString(e3.rangeSeparator), 3)]), vue.createElementVNode("input", { id: e3.id && e3.id[1], autocomplete: "off", name: e3.name && e3.name[1], placeholder: e3.endPlaceholder, value: vue.unref(ue2) && vue.unref(ue2)[1], disabled: vue.unref(se2), readonly: !e3.editable || e3.readonly, class: vue.normalizeClass(vue.unref(g2).b("input")), onMousedown: be2, onFocus: ae2, onBlur: le2, onInput: Ne2, onChange: Be2 }, null, 42, ["id", "name", "placeholder", "value", "disabled", "readonly"]), e3.clearIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 1, class: vue.normalizeClass(vue.unref(H2)), onClick: ge2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.clearIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 38))]), content: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default", { visible: I2.value, actualVisible: B2.value, parsedValue: vue.unref(ie2), format: e3.format, dateFormat: e3.dateFormat, timeFormat: e3.timeFormat, unlinkPanels: e3.unlinkPanels, type: e3.type, defaultValue: e3.defaultValue, onPick: X2, onSelectRange: q2, onSetPickerOption: Fe2, onCalendarChange: je2, onPanelChange: ze2, onKeydown: Q2, onMousedown: vue.withModifiers(() => { }, ["stop"]) })]), _: 3 }, 16, ["visible", "transition", "popper-class", "popper-options"])); } }); var Wh = np(Hh, [["__file", "picker.vue"]]); const Yh = fu({ ...Fh, datetimeRole: String, parsedValue: { type: uu(Object) } }); const Uh = ({ getAvailableHours: e2, getAvailableMinutes: t2, getAvailableSeconds: n2 }) => { const o2 = (o3, a3, r3, l2) => { const s2 = { hour: e2, minute: t2, second: n2 }; let i2 = o3; ["hour", "minute", "second"].forEach((e3) => { if (s2[e3]) { let t3; const n3 = s2[e3]; switch (e3) { case "minute": { t3 = n3(i2.hour(), a3, l2); break; } case "second": { t3 = n3(i2.hour(), i2.minute(), a3, l2); break; } default: { t3 = n3(a3, l2); break; } } if ((t3 == null ? void 0 : t3.length) && !t3.includes(i2[e3]())) { const n4 = r3 ? 0 : t3.length - 1; i2 = i2[e3](t3[n4]); } } }); return i2; }; const a2 = {}; const r2 = ([e3, t3]) => { a2[e3] = t3; }; return { timePickerOptions: a2, getAvailableTime: o2, onSetOption: r2 }; }; const Kh = (e2) => { const t2 = (e3, t3) => e3 || t3; const n2 = (e3) => e3 !== true; return e2.map(t2).filter(n2); }; const qh = (e2, t2, n2) => { const o2 = (t3, n3) => Bh(24, e2 && (() => e2 == null ? void 0 : e2(t3, n3))); const a2 = (e3, n3, o3) => Bh(60, t2 && (() => t2 == null ? void 0 : t2(e3, n3, o3))); const r2 = (e3, t3, o3, a3) => Bh(60, n2 && (() => n2 == null ? void 0 : n2(e3, t3, o3, a3))); return { getHoursList: o2, getMinutesList: a2, getSecondsList: r2 }; }; const Gh = (e2, t2, n2) => { const { getHoursList: o2, getMinutesList: a2, getSecondsList: r2 } = qh(e2, t2, n2); const l2 = (e3, t3) => Kh(o2(e3, t3)); const s2 = (e3, t3, n3) => Kh(a2(e3, t3, n3)); const i2 = (e3, t3, n3, o3) => Kh(r2(e3, t3, n3, o3)); return { getAvailableHours: l2, getAvailableMinutes: s2, getAvailableSeconds: i2 }; }; const Xh = (e2) => { const t2 = vue.ref(e2.parsedValue); vue.watch(() => e2.visible, (n2) => { if (!n2) { t2.value = e2.parsedValue; } }); return t2; }; const Zh = /* @__PURE__ */ new Map(); if (Be) { let e2; document.addEventListener("mousedown", (t2) => e2 = t2); document.addEventListener("mouseup", (t2) => { if (e2) { for (const n2 of Zh.values()) { for (const { documentHandler: o2 } of n2) { o2(t2, e2); } } e2 = void 0; } }); } function Jh(e2, t2) { let n2 = []; if (Array.isArray(t2.arg)) { n2 = t2.arg; } else if (ei(t2.arg)) { n2.push(t2.arg); } return function(o2, a2) { const r2 = t2.instance.popperRef; const l2 = o2.target; const s2 = a2 == null ? void 0 : a2.target; const i2 = !t2 || !t2.instance; const u2 = !l2 || !s2; const c2 = e2.contains(l2) || e2.contains(s2); const d2 = e2 === l2; const f2 = n2.length && n2.some((e3) => e3 == null ? void 0 : e3.contains(l2)) || n2.length && n2.includes(s2); const p2 = r2 && (r2.contains(l2) || r2.contains(s2)); if (i2 || u2 || c2 || d2 || f2 || p2) { return; } t2.value(o2, a2); }; } const Qh = { beforeMount(e2, t2) { if (!Zh.has(e2)) { Zh.set(e2, []); } Zh.get(e2).push({ documentHandler: Jh(e2, t2), bindingFn: t2.value }); }, updated(e2, t2) { if (!Zh.has(e2)) { Zh.set(e2, []); } const n2 = Zh.get(e2); const o2 = n2.findIndex((e3) => e3.bindingFn === t2.oldValue); const a2 = { documentHandler: Jh(e2, t2), bindingFn: t2.value }; if (o2 >= 0) { n2.splice(o2, 1, a2); } else { n2.push(a2); } }, unmounted(e2) { Zh.delete(e2); } }; const eg = 100; const tg = 600; const ng = { beforeMount(e2, t2) { const n2 = t2.value; const { interval: o2 = eg, delay: a2 = tg } = Ct(n2) ? {} : n2; let r2; let l2; const s2 = () => Ct(n2) ? n2() : n2.handler(); const i2 = () => { if (l2) { clearTimeout(l2); l2 = void 0; } if (r2) { clearInterval(r2); r2 = void 0; } }; e2.addEventListener("mousedown", (e3) => { if (e3.button !== 0) return; i2(); s2(); document.addEventListener("mouseup", () => i2(), { once: true }); l2 = setTimeout(() => { r2 = setInterval(() => { s2(); }, o2); }, a2); }); } }; var og = false, ag, rg, lg, sg, ig, ug, cg, dg, fg, pg, vg, mg, hg, gg, yg; function bg() { if (!og) { og = true; var e2 = navigator.userAgent, t2 = /(?:MSIE.(\d+\.\d+))|(?:(?:Firefox|GranParadiso|Iceweasel).(\d+\.\d+))|(?:Opera(?:.+Version.|.)(\d+\.\d+))|(?:AppleWebKit.(\d+(?:\.\d+)?))|(?:Trident\/\d+\.\d+.*rv:(\d+\.\d+))/.exec(e2), n2 = /(Mac OS X)|(Windows)|(Linux)/.exec(e2); if (mg = /\b(iPhone|iP[ao]d)/.exec(e2), hg = /\b(iP[ao]d)/.exec(e2), pg = /Android/i.exec(e2), gg = /FBAN\/\w+;/i.exec(e2), yg = /Mobile/i.exec(e2), vg = !!/Win64/.exec(e2), t2) { ag = t2[1] ? parseFloat(t2[1]) : t2[5] ? parseFloat(t2[5]) : NaN, ag && document && document.documentMode && (ag = document.documentMode); var o2 = /(?:Trident\/(\d+.\d+))/.exec(e2); ug = o2 ? parseFloat(o2[1]) + 4 : ag, rg = t2[2] ? parseFloat(t2[2]) : NaN, lg = t2[3] ? parseFloat(t2[3]) : NaN, sg = t2[4] ? parseFloat(t2[4]) : NaN, sg ? (t2 = /(?:Chrome\/(\d+\.\d+))/.exec(e2), ig = t2 && t2[1] ? parseFloat(t2[1]) : NaN) : ig = NaN; } else ag = rg = lg = ig = sg = NaN; if (n2) { if (n2[1]) { var a2 = /(?:Mac OS X (\d+(?:[._]\d+)?))/.exec(e2); cg = a2 ? parseFloat(a2[1].replace("_", ".")) : true; } else cg = false; dg = !!n2[2], fg = !!n2[3]; } else cg = dg = fg = false; } } var wg = { ie: function() { return bg() || ag; }, ieCompatibilityMode: function() { return bg() || ug > ag; }, ie64: function() { return wg.ie() && vg; }, firefox: function() { return bg() || rg; }, opera: function() { return bg() || lg; }, webkit: function() { return bg() || sg; }, safari: function() { return wg.webkit(); }, chrome: function() { return bg() || ig; }, windows: function() { return bg() || dg; }, osx: function() { return bg() || cg; }, linux: function() { return bg() || fg; }, iphone: function() { return bg() || mg; }, mobile: function() { return bg() || mg || hg || pg || yg; }, nativeApp: function() { return bg() || gg; }, android: function() { return bg() || pg; }, ipad: function() { return bg() || hg; } }, xg = wg; var kg = !!(typeof window < "u" && window.document && window.document.createElement), Cg = { canUseDOM: kg, canUseWorkers: typeof Worker < "u", canUseEventListeners: kg && !!(window.addEventListener || window.attachEvent), canUseViewport: kg && !!window.screen, isInWorker: !kg }, Sg = Cg; var Eg; Sg.canUseDOM && (Eg = document.implementation && document.implementation.hasFeature && document.implementation.hasFeature("", "") !== true); function _g(e2, t2) { if (!Sg.canUseDOM || t2 && !("addEventListener" in document)) return false; var n2 = "on" + e2, o2 = n2 in document; if (!o2) { var a2 = document.createElement("div"); a2.setAttribute(n2, "return;"), o2 = typeof a2[n2] == "function"; } return !o2 && Eg && e2 === "wheel" && (o2 = document.implementation.hasFeature("Events.wheel", "3.0")), o2; } var Og = _g; var Mg = 10, Lg = 40, Dg = 800; function Ag(e2) { var t2 = 0, n2 = 0, o2 = 0, a2 = 0; return "detail" in e2 && (n2 = e2.detail), "wheelDelta" in e2 && (n2 = -e2.wheelDelta / 120), "wheelDeltaY" in e2 && (n2 = -e2.wheelDeltaY / 120), "wheelDeltaX" in e2 && (t2 = -e2.wheelDeltaX / 120), "axis" in e2 && e2.axis === e2.HORIZONTAL_AXIS && (t2 = n2, n2 = 0), o2 = t2 * Mg, a2 = n2 * Mg, "deltaY" in e2 && (a2 = e2.deltaY), "deltaX" in e2 && (o2 = e2.deltaX), (o2 || a2) && e2.deltaMode && (e2.deltaMode == 1 ? (o2 *= Lg, a2 *= Lg) : (o2 *= Dg, a2 *= Dg)), o2 && !t2 && (t2 = o2 < 1 ? -1 : 1), a2 && !n2 && (n2 = a2 < 1 ? -1 : 1), { spinX: t2, spinY: n2, pixelX: o2, pixelY: a2 }; } Ag.getEventType = function() { return xg.firefox() ? "DOMMouseScroll" : Og("wheel") ? "wheel" : "mousewheel"; }; var Rg = Ag; /** * Checks if an event is supported in the current execution environment. * * NOTE: This will not work correctly for non-generic events such as `change`, * `reset`, `load`, `error`, and `select`. * * Borrows from Modernizr. * * @param {string} eventNameSuffix Event name, e.g. "click". * @param {?boolean} capture Check if the capture phase is supported. * @return {boolean} True if the event is supported. * @internal * @license Modernizr 3.0.0pre (Custom Build) | MIT */ const $g = function(e2, t2) { if (e2 && e2.addEventListener) { const n2 = function(e3) { const n3 = Rg(e3); t2 && Reflect.apply(t2, this, [e3, n3]); }; e2.addEventListener("wheel", n2, { passive: true }); } }; const Tg = { beforeMount(e2, t2) { $g(e2, t2.value); } }; const Pg = fu({ role: { type: String, required: true }, spinnerDate: { type: uu(Object), required: true }, showSeconds: { type: Boolean, default: true }, arrowControl: Boolean, amPmMode: { type: uu(String), default: "" }, ...Vh }); const Ng = vue.defineComponent({ __name: "basic-time-spinner", props: Pg, emits: ["change", "select-range", "set-option"], setup(e2, { emit: a2 }) { const r2 = e2; const s2 = Xu("time"); const { getHoursList: d2, getMinutesList: f2, getSecondsList: p2 } = qh(r2.disabledHours, r2.disabledMinutes, r2.disabledSeconds); let m2 = false; const h2 = vue.ref(); const g2 = vue.ref(); const y2 = vue.ref(); const b2 = vue.ref(); const x2 = { hours: g2, minutes: y2, seconds: b2 }; const k2 = vue.computed(() => r2.showSeconds ? _h : _h.slice(0, 2)); const C2 = vue.computed(() => { const { spinnerDate: e3 } = r2; const t2 = e3.hour(); const n2 = e3.minute(); const o2 = e3.second(); return { hours: t2, minutes: n2, seconds: o2 }; }); const S2 = vue.computed(() => { const { hours: e3, minutes: t2 } = vue.unref(C2); return { hours: d2(r2.role), minutes: f2(e3, r2.role), seconds: p2(e3, t2, r2.role) }; }); const E2 = vue.computed(() => { const { hours: e3, minutes: t2, seconds: n2 } = vue.unref(C2); return { hours: Dh(e3, 23), minutes: Dh(t2, 59), seconds: Dh(n2, 59) }; }); const _2 = Ds((e3) => { m2 = false; N2(e3); }, 200); const R2 = (e3) => { const t2 = !!r2.amPmMode; if (!t2) return ""; const n2 = r2.amPmMode === "A"; let o2 = e3 < 12 ? " am" : " pm"; if (n2) o2 = o2.toUpperCase(); return o2; }; const $2 = (e3) => { let t2; switch (e3) { case "hours": t2 = [0, 2]; break; case "minutes": t2 = [3, 5]; break; case "seconds": t2 = [6, 8]; break; } const [n2, o2] = t2; a2("select-range", n2, o2); h2.value = e3; }; const N2 = (e3) => { F2(e3, vue.unref(C2)[e3]); }; const I2 = () => { N2("hours"); N2("minutes"); N2("seconds"); }; const V2 = (e3) => e3.querySelector(`.${s2.namespace.value}-scrollbar__wrap`); const F2 = (e3, t2) => { if (r2.arrowControl) return; const n2 = vue.unref(x2[e3]); if (n2 && n2.$el) { V2(n2.$el).scrollTop = Math.max(0, t2 * j2(e3)); } }; const j2 = (e3) => { const t2 = vue.unref(x2[e3]); const n2 = t2 == null ? void 0 : t2.$el.querySelector("li"); if (n2) { return Number.parseFloat(vi(n2, "height")) || 0; } return 0; }; const z2 = () => { W2(1); }; const H2 = () => { W2(-1); }; const W2 = (e3) => { if (!h2.value) { $2("hours"); } const t2 = h2.value; const n2 = vue.unref(C2)[t2]; const o2 = h2.value === "hours" ? 24 : 60; const a3 = Y2(t2, n2, e3, o2); U2(t2, a3); F2(t2, a3); vue.nextTick(() => $2(t2)); }; const Y2 = (e3, t2, n2, o2) => { let a3 = (t2 + n2 + o2) % o2; const r3 = vue.unref(S2)[e3]; while (r3[a3] && a3 !== t2) { a3 = (a3 + n2 + o2) % o2; } return a3; }; const U2 = (e3, t2) => { const n2 = vue.unref(S2)[e3]; const o2 = n2[t2]; if (o2) return; const { hours: l2, minutes: s3, seconds: i2 } = vue.unref(C2); let c2; switch (e3) { case "hours": c2 = r2.spinnerDate.hour(t2).minute(s3).second(i2); break; case "minutes": c2 = r2.spinnerDate.hour(l2).minute(t2).second(i2); break; case "seconds": c2 = r2.spinnerDate.hour(l2).minute(s3).second(t2); break; } a2("change", c2); }; const K2 = (e3, { value: t2, disabled: n2 }) => { if (!n2) { U2(e3, t2); $2(e3); F2(e3, t2); } }; const q2 = (e3) => { m2 = true; _2(e3); const t2 = Math.min(Math.round((V2(vue.unref(x2[e3]).$el).scrollTop - (Z2(e3) * 0.5 - 10) / j2(e3) + 3) / j2(e3)), e3 === "hours" ? 23 : 59); U2(e3, t2); }; const Z2 = (e3) => vue.unref(x2[e3]).$el.offsetHeight; const J2 = () => { const e3 = (e4) => { const t2 = vue.unref(x2[e4]); if (t2 && t2.$el) { V2(t2.$el).onscroll = () => { q2(e4); }; } }; e3("hours"); e3("minutes"); e3("seconds"); }; vue.onMounted(() => { vue.nextTick(() => { !r2.arrowControl && J2(); I2(); if (r2.role === "start") $2("hours"); }); }); const Q2 = (e3, t2) => { x2[t2].value = e3; }; a2("set-option", [`${r2.role}_scrollDown`, W2]); a2("set-option", [`${r2.role}_emitSelectRange`, $2]); vue.watch(() => r2.spinnerDate, () => { if (m2) return; I2(); }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(s2).b("spinner"), { "has-seconds": e3.showSeconds }]) }, [!e3.arrowControl ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 0 }, vue.renderList(vue.unref(k2), (o2) => (vue.openBlock(), vue.createBlock(vue.unref(zp), { key: o2, ref_for: true, ref: (e4) => Q2(e4, o2), class: vue.normalizeClass(vue.unref(s2).be("spinner", "wrapper")), "wrap-style": "max-height: inherit;", "view-class": vue.unref(s2).be("spinner", "list"), noresize: "", tag: "ul", onMouseenter: (e4) => $2(o2), onMousemove: (e4) => N2(o2) }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(S2)[o2], (a4, r3) => (vue.openBlock(), vue.createElementBlock("li", { key: r3, class: vue.normalizeClass([vue.unref(s2).be("spinner", "item"), vue.unref(s2).is("active", r3 === vue.unref(C2)[o2]), vue.unref(s2).is("disabled", a4)]), onClick: (e4) => K2(o2, { value: r3, disabled: a4 }) }, [o2 === "hours" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(("0" + (e3.amPmMode ? r3 % 12 || 12 : r3)).slice(-2)) + vue.toDisplayString(R2(r3)), 1)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createTextVNode(vue.toDisplayString(("0" + r3).slice(-2)), 1)], 64))], 10, ["onClick"]))), 128))]), _: 2 }, 1032, ["class", "view-class", "onMouseenter", "onMousemove"]))), 128)) : vue.createCommentVNode("v-if", true), e3.arrowControl ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 1 }, vue.renderList(vue.unref(k2), (a4) => (vue.openBlock(), vue.createElementBlock("div", { key: a4, class: vue.normalizeClass([vue.unref(s2).be("spinner", "wrapper"), vue.unref(s2).is("arrow")]), onMouseenter: (e4) => $2(a4) }, [vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(sp), { class: vue.normalizeClass(["arrow-up", vue.unref(s2).be("spinner", "arrow")]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ei))]), _: 1 }, 8, ["class"])), [[vue.unref(ng), H2]]), vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(sp), { class: vue.normalizeClass(["arrow-down", vue.unref(s2).be("spinner", "arrow")]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(bi))]), _: 1 }, 8, ["class"])), [[vue.unref(ng), z2]]), vue.createElementVNode("ul", { class: vue.normalizeClass(vue.unref(s2).be("spinner", "list")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(E2)[a4], (o2, r3) => (vue.openBlock(), vue.createElementBlock("li", { key: r3, class: vue.normalizeClass([vue.unref(s2).be("spinner", "item"), vue.unref(s2).is("active", o2 === vue.unref(C2)[a4]), vue.unref(s2).is("disabled", vue.unref(S2)[a4][o2])]) }, [typeof o2 === "number" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [a4 === "hours" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(("0" + (e3.amPmMode ? o2 % 12 || 12 : o2)).slice(-2)) + vue.toDisplayString(R2(o2)), 1)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createTextVNode(vue.toDisplayString(("0" + o2).slice(-2)), 1)], 64))], 64)) : vue.createCommentVNode("v-if", true)], 2))), 128))], 2)], 42, ["onMouseenter"]))), 128)) : vue.createCommentVNode("v-if", true)], 2)); } }); var Ig = np(Ng, [["__file", "basic-time-spinner.vue"]]); const Bg = vue.defineComponent({ __name: "panel-time-pick", props: Yh, emits: ["pick", "select-range", "set-picker-option"], setup(e2, { emit: a2 }) { const r2 = e2; const s2 = vue.inject("EP_PICKER_BASE"); const { arrowControl: i2, disabledHours: c2, disabledMinutes: d2, disabledSeconds: f2, defaultValue: m2 } = s2.props; const { getAvailableHours: h2, getAvailableMinutes: g2, getAvailableSeconds: y2 } = Gh(c2, d2, f2); const b2 = Xu("time"); const { t: w2, lang: x2 } = Wu(); const k2 = vue.ref([0, 2]); const C2 = Xh(r2); const S2 = vue.computed(() => Xs(r2.actualVisible) ? `${b2.namespace.value}-zoom-in-top` : ""); const E2 = vue.computed(() => r2.format.includes("ss")); const _2 = vue.computed(() => { if (r2.format.includes("A")) return "A"; if (r2.format.includes("a")) return "a"; return ""; }); const M2 = (e3) => { const t2 = ue(e3).locale(x2.value); const n2 = W2(t2); return t2.isSame(n2); }; const R2 = () => { a2("pick", C2.value, false); }; const $2 = (e3 = false, t2 = false) => { if (t2) return; a2("pick", r2.parsedValue, e3); }; const N2 = (e3) => { if (!r2.visible) { return; } const t2 = W2(e3).millisecond(0); a2("pick", t2, true); }; const B2 = (e3, t2) => { a2("select-range", e3, t2); k2.value = [e3, t2]; }; const V2 = (e3) => { const t2 = [0, 3].concat(E2.value ? [6] : []); const n2 = ["hours", "minutes"].concat(E2.value ? ["seconds"] : []); const o2 = t2.indexOf(k2.value[0]); const a3 = (o2 + e3 + t2.length) % t2.length; j2["start_emitSelectRange"](n2[a3]); }; const F2 = (e3) => { const t2 = e3.code; const { left: n2, right: o2, up: a3, down: r3 } = ku; if ([n2, o2].includes(t2)) { const o3 = t2 === n2 ? -1 : 1; V2(o3); e3.preventDefault(); return; } if ([a3, r3].includes(t2)) { const n3 = t2 === a3 ? -1 : 1; j2["start_scrollDown"](n3); e3.preventDefault(); return; } }; const { timePickerOptions: j2, onSetOption: z2, getAvailableTime: H2 } = Uh({ getAvailableHours: h2, getAvailableMinutes: g2, getAvailableSeconds: y2 }); const W2 = (e3) => H2(e3, r2.datetimeRole || "", true); const Y2 = (e3) => { if (!e3) return null; return ue(e3, r2.format).locale(x2.value); }; const U2 = (e3) => { if (!e3) return null; return e3.format(r2.format); }; const K2 = () => ue(m2).locale(x2.value); a2("set-picker-option", ["isValidValue", M2]); a2("set-picker-option", ["formatToString", U2]); a2("set-picker-option", ["parseUserInput", Y2]); a2("set-picker-option", ["handleKeydownInput", F2]); a2("set-picker-option", ["getRangeAvailableTime", W2]); a2("set-picker-option", ["getDefaultValue", K2]); return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(S2) }, { default: vue.withCtx(() => [e3.actualVisible || e3.visible ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(b2).b("panel")) }, [vue.createElementVNode("div", { class: vue.normalizeClass([vue.unref(b2).be("panel", "content"), { "has-seconds": vue.unref(E2) }]) }, [vue.createVNode(Ig, { ref: "spinner", role: e3.datetimeRole || "start", "arrow-control": vue.unref(i2), "show-seconds": vue.unref(E2), "am-pm-mode": vue.unref(_2), "spinner-date": e3.parsedValue, "disabled-hours": vue.unref(c2), "disabled-minutes": vue.unref(d2), "disabled-seconds": vue.unref(f2), onChange: N2, onSetOption: vue.unref(z2), onSelectRange: B2 }, null, 8, ["role", "arrow-control", "show-seconds", "am-pm-mode", "spinner-date", "disabled-hours", "disabled-minutes", "disabled-seconds", "onSetOption"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(b2).be("panel", "footer")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(b2).be("panel", "btn"), "cancel"]), onClick: R2 }, vue.toDisplayString(vue.unref(w2)("el.datepicker.cancel")), 3), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(b2).be("panel", "btn"), "confirm"]), onClick: (e4) => $2() }, vue.toDisplayString(vue.unref(w2)("el.datepicker.confirm")), 11, ["onClick"])], 2)], 2)) : vue.createCommentVNode("v-if", true)]), _: 1 }, 8, ["name"])); } }); var Vg = np(Bg, [["__file", "panel-time-pick.vue"]]); var Fg = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(xh, function() { return function(e3, t3, n2) { var o2 = t3.prototype, a2 = function(e4) { return e4 && (e4.indexOf ? e4 : e4.s); }, r2 = function(e4, t4, n3, o3, r3) { var l3 = e4.name ? e4 : e4.$locale(), s3 = a2(l3[t4]), i3 = a2(l3[n3]), u2 = s3 || i3.map(function(e5) { return e5.slice(0, o3); }); if (!r3) return u2; var c2 = l3.weekStart; return u2.map(function(e5, t5) { return u2[(t5 + (c2 || 0)) % 7]; }); }, l2 = function() { return n2.Ls[n2.locale()]; }, s2 = function(e4, t4) { return e4.formats[t4] || function(e5) { return e5.replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e6, t5, n3) { return t5 || n3.slice(1); }); }(e4.formats[t4.toUpperCase()]); }, i2 = function() { var e4 = this; return { months: function(t4) { return t4 ? t4.format("MMMM") : r2(e4, "months"); }, monthsShort: function(t4) { return t4 ? t4.format("MMM") : r2(e4, "monthsShort", "months", 3); }, firstDayOfWeek: function() { return e4.$locale().weekStart || 0; }, weekdays: function(t4) { return t4 ? t4.format("dddd") : r2(e4, "weekdays"); }, weekdaysMin: function(t4) { return t4 ? t4.format("dd") : r2(e4, "weekdaysMin", "weekdays", 2); }, weekdaysShort: function(t4) { return t4 ? t4.format("ddd") : r2(e4, "weekdaysShort", "weekdays", 3); }, longDateFormat: function(t4) { return s2(e4.$locale(), t4); }, meridiem: this.$locale().meridiem, ordinal: this.$locale().ordinal }; }; o2.localeData = function() { return i2.bind(this)(); }, n2.localeData = function() { var e4 = l2(); return { firstDayOfWeek: function() { return e4.weekStart || 0; }, weekdays: function() { return n2.weekdays(); }, weekdaysShort: function() { return n2.weekdaysShort(); }, weekdaysMin: function() { return n2.weekdaysMin(); }, months: function() { return n2.months(); }, monthsShort: function() { return n2.monthsShort(); }, longDateFormat: function(t4) { return s2(e4, t4); }, meridiem: e4.meridiem, ordinal: e4.ordinal }; }, n2.months = function() { return r2(l2(), "months"); }, n2.monthsShort = function() { return r2(l2(), "monthsShort", "months", 3); }, n2.weekdays = function(e4) { return r2(l2(), "weekdays", null, null, e4); }, n2.weekdaysShort = function(e4) { return r2(l2(), "weekdaysShort", "weekdays", 3, e4); }, n2.weekdaysMin = function(e4) { return r2(l2(), "weekdaysMin", "weekdays", 2, e4); }; }; }); })(Fg); var jg = Fg.exports; const zg = kh(jg); const Hg = { modelValue: { type: [Number, String, Boolean], default: void 0 }, label: { type: [String, Boolean, Number, Object], default: void 0 }, value: { type: [String, Boolean, Number, Object], default: void 0 }, indeterminate: Boolean, disabled: Boolean, checked: Boolean, name: { type: String, default: void 0 }, trueValue: { type: [String, Number], default: void 0 }, falseValue: { type: [String, Number], default: void 0 }, trueLabel: { type: [String, Number], default: void 0 }, falseLabel: { type: [String, Number], default: void 0 }, id: { type: String, default: void 0 }, border: Boolean, size: If, tabindex: [String, Number], validateEvent: { type: Boolean, default: true }, ...Kf(["ariaControls"]) }; const Wg = { [Su]: (e2) => St(e2) || Js(e2) || Zs(e2), change: (e2) => St(e2) || Js(e2) || Zs(e2) }; const Yg = Symbol("checkboxGroupContextKey"); const Ug = ({ model: e2, isChecked: t2 }) => { const n2 = vue.inject(Yg, void 0); const o2 = vue.computed(() => { var o3, a3; const r2 = (o3 = n2 == null ? void 0 : n2.max) == null ? void 0 : o3.value; const l2 = (a3 = n2 == null ? void 0 : n2.min) == null ? void 0 : a3.value; return !Xs(r2) && e2.value.length >= r2 && !t2.value || !Xs(l2) && e2.value.length <= l2 && t2.value; }); const a2 = dp(vue.computed(() => (n2 == null ? void 0 : n2.disabled.value) || o2.value)); return { isDisabled: a2, isLimitDisabled: o2 }; }; const Kg = (e2, { model: t2, isLimitExceeded: n2, hasOwnLabel: o2, isDisabled: a2, isLabeledByFormItem: r2 }) => { const u2 = vue.inject(Yg, void 0); const { formItem: c2 } = fp(); const { emit: d2 } = vue.getCurrentInstance(); function f2(t3) { var n3, o3, a3, r3; return [true, e2.trueValue, e2.trueLabel].includes(t3) ? (o3 = (n3 = e2.trueValue) != null ? n3 : e2.trueLabel) != null ? o3 : true : (r3 = (a3 = e2.falseValue) != null ? a3 : e2.falseLabel) != null ? r3 : false; } function v2(e3, t3) { d2("change", f2(e3), t3); } function m2(e3) { if (n2.value) return; const t3 = e3.target; d2("change", f2(t3.checked), e3); } async function h2(l2) { if (n2.value) return; if (!o2.value && !a2.value && r2.value) { const n3 = l2.composedPath(); const o3 = n3.some((e3) => e3.tagName === "LABEL"); if (!o3) { t2.value = f2([false, e2.falseValue, e2.falseLabel].includes(t2.value)); await vue.nextTick(); v2(t2.value, l2); } } } const g2 = vue.computed(() => (u2 == null ? void 0 : u2.validateEvent) || e2.validateEvent); vue.watch(() => e2.modelValue, () => { if (g2.value) { c2 == null ? void 0 : c2.validate("change").catch((e3) => ui()); } }); return { handleChange: m2, onClickRoot: h2 }; }; const qg = (e2) => { const t2 = vue.ref(false); const { emit: n2 } = vue.getCurrentInstance(); const o2 = vue.inject(Yg, void 0); const a2 = vue.computed(() => Xs(o2) === false); const r2 = vue.ref(false); const i2 = vue.computed({ get() { var n3, r3; return a2.value ? (n3 = o2 == null ? void 0 : o2.modelValue) == null ? void 0 : n3.value : (r3 = e2.modelValue) != null ? r3 : t2.value; }, set(e3) { var l2, s2; if (a2.value && xt(e3)) { r2.value = ((l2 = o2 == null ? void 0 : o2.max) == null ? void 0 : l2.value) !== void 0 && e3.length > (o2 == null ? void 0 : o2.max.value) && e3.length > i2.value.length; r2.value === false && ((s2 = o2 == null ? void 0 : o2.changeEvent) == null ? void 0 : s2.call(o2, e3)); } else { n2(Su, e3); t2.value = e3; } } }); return { model: i2, isGroup: a2, isLimitExceeded: r2 }; }; const Gg = (e2, t2, { model: n2 }) => { const o2 = vue.inject(Yg, void 0); const a2 = vue.ref(false); const r2 = vue.computed(() => { if (!ti(e2.value)) { return e2.value; } return e2.label; }); const s2 = vue.computed(() => { const t3 = n2.value; if (Zs(t3)) { return t3; } else if (xt(t3)) { if (Et(r2.value)) { return t3.map(vue.toRaw).some((e3) => js(e3, r2.value)); } else { return t3.map(vue.toRaw).includes(r2.value); } } else if (t3 !== null && t3 !== void 0) { return t3 === e2.trueValue || t3 === e2.trueLabel; } else { return !!t3; } }); const i2 = cp(vue.computed(() => { var e3; return (e3 = o2 == null ? void 0 : o2.size) == null ? void 0 : e3.value; }), { prop: true }); const u2 = cp(vue.computed(() => { var e3; return (e3 = o2 == null ? void 0 : o2.size) == null ? void 0 : e3.value; })); const c2 = vue.computed(() => !!t2.default || !ti(r2.value)); return { checkboxButtonSize: i2, isChecked: s2, isFocused: a2, checkboxSize: u2, hasOwnLabel: c2, actualValue: r2 }; }; const Xg = (e2, t2) => { const { formItem: n2 } = fp(); const { model: o2, isGroup: a2, isLimitExceeded: r2 } = qg(e2); const { isFocused: s2, isChecked: i2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, actualValue: f2 } = Gg(e2, t2, { model: o2 }); const { isDisabled: p2 } = Ug({ model: o2, isChecked: i2 }); const { inputId: v2, isLabeledByFormItem: m2 } = pp(e2, { formItemContext: n2, disableIdGeneration: d2, disableIdManagement: a2 }); const { handleChange: h2, onClickRoot: g2 } = Kg(e2, { model: o2, isLimitExceeded: r2, hasOwnLabel: d2, isDisabled: p2, isLabeledByFormItem: m2 }); const y2 = () => { function t3() { var t4, n3; if (xt(o2.value) && !o2.value.includes(f2.value)) { o2.value.push(f2.value); } else { o2.value = (n3 = (t4 = e2.trueValue) != null ? t4 : e2.trueLabel) != null ? n3 : true; } } e2.checked && t3(); }; y2(); Iu({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => a2.value && ti(e2.value))); Iu({ from: "true-label", replacement: "true-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.trueLabel)); Iu({ from: "false-label", replacement: "false-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.falseLabel)); return { inputId: v2, isLabeledByFormItem: m2, isChecked: i2, isDisabled: p2, isFocused: s2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, model: o2, actualValue: f2, handleChange: h2, onClickRoot: g2 }; }; const Zg = vue.defineComponent({ name: "ElCheckbox" }); const Jg = vue.defineComponent({ ...Zg, props: Hg, emits: Wg, setup(e2) { const a2 = e2; const r2 = vue.useSlots(); const { inputId: s2, isLabeledByFormItem: i2, isChecked: c2, isDisabled: d2, isFocused: f2, checkboxSize: p2, hasOwnLabel: v2, model: h2, actualValue: g2, handleChange: y2, onClickRoot: b2 } = Xg(a2, r2); const w2 = Xu("checkbox"); const k2 = vue.computed(() => [w2.b(), w2.m(p2.value), w2.is("disabled", d2.value), w2.is("bordered", a2.border), w2.is("checked", c2.value)]); const C2 = vue.computed(() => [w2.e("input"), w2.is("disabled", d2.value), w2.is("checked", c2.value), w2.is("indeterminate", a2.indeterminate), w2.is("focus", f2.value)]); return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(!vue.unref(v2) && vue.unref(i2) ? "span" : "label"), { class: vue.normalizeClass(vue.unref(k2)), "aria-controls": e3.indeterminate ? e3.ariaControls : null, onClick: vue.unref(b2) }, { default: vue.withCtx(() => { var a4, r3; return [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(C2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 0, id: vue.unref(s2), "onUpdate:modelValue": (e4) => vue.isRef(h2) ? h2.value = e4 : null, class: vue.normalizeClass(vue.unref(w2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(d2), "true-value": (a4 = e3.trueValue) != null ? a4 : e3.trueLabel, "false-value": (r3 = e3.falseValue) != null ? r3 : e3.falseLabel, onChange: vue.unref(y2), onFocus: (e4) => f2.value = true, onBlur: (e4) => f2.value = false, onClick: vue.withModifiers(() => { }, ["stop"]) }, null, 42, ["id", "onUpdate:modelValue", "indeterminate", "name", "tabindex", "disabled", "true-value", "false-value", "onChange", "onFocus", "onBlur", "onClick"])), [[vue.vModelCheckbox, vue.unref(h2)]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 1, id: vue.unref(s2), "onUpdate:modelValue": (e4) => vue.isRef(h2) ? h2.value = e4 : null, class: vue.normalizeClass(vue.unref(w2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, disabled: vue.unref(d2), value: vue.unref(g2), name: e3.name, tabindex: e3.tabindex, onChange: vue.unref(y2), onFocus: (e4) => f2.value = true, onBlur: (e4) => f2.value = false, onClick: vue.withModifiers(() => { }, ["stop"]) }, null, 42, ["id", "onUpdate:modelValue", "indeterminate", "disabled", "value", "name", "tabindex", "onChange", "onFocus", "onBlur", "onClick"])), [[vue.vModelCheckbox, vue.unref(h2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(w2).e("inner")) }, null, 2)], 2), vue.unref(v2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(w2).e("label")) }, [vue.renderSlot(e3.$slots, "default"), !e3.$slots.default ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(e3.label), 1)], 64)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true)]; }), _: 3 }, 8, ["class", "aria-controls", "onClick"])); } }); var Qg = np(Jg, [["__file", "checkbox.vue"]]); const ey = vue.defineComponent({ name: "ElCheckboxButton" }); const ty = vue.defineComponent({ ...ey, props: Hg, emits: Wg, setup(e2) { const o2 = e2; const a2 = vue.useSlots(); const { isFocused: r2, isChecked: s2, isDisabled: i2, checkboxButtonSize: c2, model: d2, actualValue: f2, handleChange: v2 } = Xg(o2, a2); const h2 = vue.inject(Yg, void 0); const g2 = Xu("checkbox"); const y2 = vue.computed(() => { var e3, t2, n2, o3; const a3 = (t2 = (e3 = h2 == null ? void 0 : h2.fill) == null ? void 0 : e3.value) != null ? t2 : ""; return { backgroundColor: a3, borderColor: a3, color: (o3 = (n2 = h2 == null ? void 0 : h2.textColor) == null ? void 0 : n2.value) != null ? o3 : "", boxShadow: a3 ? `-1px 0 0 0 ${a3}` : void 0 }; }); const b2 = vue.computed(() => [g2.b("button"), g2.bm("button", c2.value), g2.is("disabled", i2.value), g2.is("checked", s2.value), g2.is("focus", r2.value)]); return (e3, o3) => { var a3, l2; return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass(vue.unref(b2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 0, "onUpdate:modelValue": (e4) => vue.isRef(d2) ? d2.value = e4 : null, class: vue.normalizeClass(vue.unref(g2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(i2), "true-value": (a3 = e3.trueValue) != null ? a3 : e3.trueLabel, "false-value": (l2 = e3.falseValue) != null ? l2 : e3.falseLabel, onChange: vue.unref(v2), onFocus: (e4) => r2.value = true, onBlur: (e4) => r2.value = false, onClick: vue.withModifiers(() => { }, ["stop"]) }, null, 42, ["onUpdate:modelValue", "name", "tabindex", "disabled", "true-value", "false-value", "onChange", "onFocus", "onBlur", "onClick"])), [[vue.vModelCheckbox, vue.unref(d2)]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 1, "onUpdate:modelValue": (e4) => vue.isRef(d2) ? d2.value = e4 : null, class: vue.normalizeClass(vue.unref(g2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(i2), value: vue.unref(f2), onChange: vue.unref(v2), onFocus: (e4) => r2.value = true, onBlur: (e4) => r2.value = false, onClick: vue.withModifiers(() => { }, ["stop"]) }, null, 42, ["onUpdate:modelValue", "name", "tabindex", "disabled", "value", "onChange", "onFocus", "onBlur", "onClick"])), [[vue.vModelCheckbox, vue.unref(d2)]]), e3.$slots.default || e3.label ? (vue.openBlock(), vue.createElementBlock("span", { key: 2, class: vue.normalizeClass(vue.unref(g2).be("button", "inner")), style: vue.normalizeStyle(vue.unref(s2) ? vue.unref(y2) : void 0) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 6)) : vue.createCommentVNode("v-if", true)], 2); }; } }); var ny = np(ty, [["__file", "checkbox-button.vue"]]); const oy = fu({ modelValue: { type: uu(Array), default: () => [] }, disabled: Boolean, min: Number, max: Number, size: If, fill: String, textColor: String, tag: { type: String, default: "div" }, validateEvent: { type: Boolean, default: true }, ...Kf(["ariaLabel"]) }); const ay = { [Su]: (e2) => xt(e2), change: (e2) => xt(e2) }; const ry = vue.defineComponent({ name: "ElCheckboxGroup" }); const ly = vue.defineComponent({ ...ry, props: oy, emits: ay, setup(e2, { emit: n2 }) { const o2 = e2; const a2 = Xu("checkbox"); const { formItem: r2 } = fp(); const { inputId: s2, isLabeledByFormItem: c2 } = pp(o2, { formItemContext: r2 }); const d2 = async (e3) => { n2(Su, e3); await vue.nextTick(); n2("change", e3); }; const f2 = vue.computed({ get() { return o2.modelValue; }, set(e3) { d2(e3); } }); vue.provide(Yg, { ...qs(vue.toRefs(o2), ["size", "min", "max", "disabled", "validateEvent", "fill", "textColor"]), modelValue: f2, changeEvent: d2 }); vue.watch(() => o2.modelValue, () => { if (o2.validateEvent) { r2 == null ? void 0 : r2.validate("change").catch((e3) => ui()); } }); return (e3, n3) => { var o3; return vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), { id: vue.unref(s2), class: vue.normalizeClass(vue.unref(a2).b("group")), role: "group", "aria-label": !vue.unref(c2) ? e3.ariaLabel || "checkbox-group" : void 0, "aria-labelledby": vue.unref(c2) ? (o3 = vue.unref(r2)) == null ? void 0 : o3.labelId : void 0 }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "aria-label", "aria-labelledby"]); }; } }); var sy = np(ly, [["__file", "checkbox-group.vue"]]); const iy = yu(Qg, { CheckboxButton: ny, CheckboxGroup: sy }); wu(ny); const uy = wu(sy); const cy = fu({ modelValue: { type: [String, Number, Boolean], default: void 0 }, size: If, disabled: Boolean, label: { type: [String, Number, Boolean], default: void 0 }, value: { type: [String, Number, Boolean], default: void 0 }, name: { type: String, default: void 0 } }); const dy = fu({ ...cy, border: Boolean }); const fy = { [Su]: (e2) => St(e2) || Js(e2) || Zs(e2), [Eu]: (e2) => St(e2) || Js(e2) || Zs(e2) }; const py = Symbol("radioGroupKey"); const vy = (e2, t2) => { const n2 = vue.ref(); const o2 = vue.inject(py, void 0); const a2 = vue.computed(() => !!o2); const r2 = vue.computed(() => { if (!ti(e2.value)) { return e2.value; } return e2.label; }); const s2 = vue.computed({ get() { return a2.value ? o2.modelValue : e2.modelValue; }, set(l2) { if (a2.value) { o2.changeEvent(l2); } else { t2 && t2(Su, l2); } n2.value.checked = e2.modelValue === r2.value; } }); const i2 = cp(vue.computed(() => o2 == null ? void 0 : o2.size)); const u2 = dp(vue.computed(() => o2 == null ? void 0 : o2.disabled)); const c2 = vue.ref(false); const d2 = vue.computed(() => u2.value || a2.value && s2.value !== r2.value ? -1 : 0); Iu({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-radio", ref: "https://element-plus.org/en-US/component/radio.html" }, vue.computed(() => a2.value && ti(e2.value))); return { radioRef: n2, isGroup: a2, radioGroup: o2, focus: c2, size: i2, disabled: u2, tabIndex: d2, modelValue: s2, actualValue: r2 }; }; const my = vue.defineComponent({ name: "ElRadio" }); const hy = vue.defineComponent({ ...my, props: dy, emits: fy, setup(e2, { emit: a2 }) { const r2 = e2; const l2 = Xu("radio"); const { radioRef: s2, radioGroup: i2, focus: c2, size: d2, disabled: f2, modelValue: p2, actualValue: v2 } = vy(r2, a2); function h2() { vue.nextTick(() => a2("change", p2.value)); } return (e3, a3) => { var r3; return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass([vue.unref(l2).b(), vue.unref(l2).is("disabled", vue.unref(f2)), vue.unref(l2).is("focus", vue.unref(c2)), vue.unref(l2).is("bordered", e3.border), vue.unref(l2).is("checked", vue.unref(p2) === vue.unref(v2)), vue.unref(l2).m(vue.unref(d2))]) }, [vue.createElementVNode("span", { class: vue.normalizeClass([vue.unref(l2).e("input"), vue.unref(l2).is("disabled", vue.unref(f2)), vue.unref(l2).is("checked", vue.unref(p2) === vue.unref(v2))]) }, [vue.withDirectives(vue.createElementVNode("input", { ref_key: "radioRef", ref: s2, "onUpdate:modelValue": (e4) => vue.isRef(p2) ? p2.value = e4 : null, class: vue.normalizeClass(vue.unref(l2).e("original")), value: vue.unref(v2), name: e3.name || ((r3 = vue.unref(i2)) == null ? void 0 : r3.name), disabled: vue.unref(f2), checked: vue.unref(p2) === vue.unref(v2), type: "radio", onFocus: (e4) => c2.value = true, onBlur: (e4) => c2.value = false, onChange: h2, onClick: vue.withModifiers(() => { }, ["stop"]) }, null, 42, ["onUpdate:modelValue", "value", "name", "disabled", "checked", "onFocus", "onBlur", "onClick"]), [[vue.vModelRadio, vue.unref(p2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).e("inner")) }, null, 2)], 2), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).e("label")), onKeydown: vue.withModifiers(() => { }, ["stop"]) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 42, ["onKeydown"])], 2); }; } }); var gy = np(hy, [["__file", "radio.vue"]]); const yy = fu({ ...cy }); const by = vue.defineComponent({ name: "ElRadioButton" }); const wy = vue.defineComponent({ ...by, props: yy, setup(e2) { const a2 = e2; const r2 = Xu("radio"); const { radioRef: s2, focus: i2, size: c2, disabled: d2, modelValue: f2, radioGroup: p2, actualValue: v2 } = vy(a2); const h2 = vue.computed(() => ({ backgroundColor: (p2 == null ? void 0 : p2.fill) || "", borderColor: (p2 == null ? void 0 : p2.fill) || "", boxShadow: (p2 == null ? void 0 : p2.fill) ? `-1px 0 0 0 ${p2.fill}` : "", color: (p2 == null ? void 0 : p2.textColor) || "" })); return (e3, a3) => { var l2; return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass([vue.unref(r2).b("button"), vue.unref(r2).is("active", vue.unref(f2) === vue.unref(v2)), vue.unref(r2).is("disabled", vue.unref(d2)), vue.unref(r2).is("focus", vue.unref(i2)), vue.unref(r2).bm("button", vue.unref(c2))]) }, [vue.withDirectives(vue.createElementVNode("input", { ref_key: "radioRef", ref: s2, "onUpdate:modelValue": (e4) => vue.isRef(f2) ? f2.value = e4 : null, class: vue.normalizeClass(vue.unref(r2).be("button", "original-radio")), value: vue.unref(v2), type: "radio", name: e3.name || ((l2 = vue.unref(p2)) == null ? void 0 : l2.name), disabled: vue.unref(d2), onFocus: (e4) => i2.value = true, onBlur: (e4) => i2.value = false, onClick: vue.withModifiers(() => { }, ["stop"]) }, null, 42, ["onUpdate:modelValue", "value", "name", "disabled", "onFocus", "onBlur", "onClick"]), [[vue.vModelRadio, vue.unref(f2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(r2).be("button", "inner")), style: vue.normalizeStyle(vue.unref(f2) === vue.unref(v2) ? vue.unref(h2) : {}), onKeydown: vue.withModifiers(() => { }, ["stop"]) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 46, ["onKeydown"])], 2); }; } }); var xy = np(wy, [["__file", "radio-button.vue"]]); const ky = fu({ id: { type: String, default: void 0 }, size: If, disabled: Boolean, modelValue: { type: [String, Number, Boolean], default: void 0 }, fill: { type: String, default: "" }, textColor: { type: String, default: "" }, name: { type: String, default: void 0 }, validateEvent: { type: Boolean, default: true }, ...Kf(["ariaLabel"]) }); const Cy = fy; const Sy = vue.defineComponent({ name: "ElRadioGroup" }); const Ey = vue.defineComponent({ ...Sy, props: ky, emits: Cy, setup(e2, { emit: o2 }) { const a2 = e2; const r2 = Xu("radio"); const s2 = mf(); const d2 = vue.ref(); const { formItem: f2 } = fp(); const { inputId: p2, isLabeledByFormItem: m2 } = pp(a2, { formItemContext: f2 }); const h2 = (e3) => { o2(Su, e3); vue.nextTick(() => o2("change", e3)); }; vue.onMounted(() => { const e3 = d2.value.querySelectorAll("[type=radio]"); const t2 = e3[0]; if (!Array.from(e3).some((e4) => e4.checked) && t2) { t2.tabIndex = 0; } }); const g2 = vue.computed(() => a2.name || s2.value); vue.provide(py, vue.reactive({ ...vue.toRefs(a2), changeEvent: h2, name: g2 })); vue.watch(() => a2.modelValue, () => { if (a2.validateEvent) { f2 == null ? void 0 : f2.validate("change").catch((e3) => ui()); } }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { id: vue.unref(p2), ref_key: "radioGroupRef", ref: d2, class: vue.normalizeClass(vue.unref(r2).b("group")), role: "radiogroup", "aria-label": !vue.unref(m2) ? e3.ariaLabel || "radio-group" : void 0, "aria-labelledby": vue.unref(m2) ? vue.unref(f2).labelId : void 0 }, [vue.renderSlot(e3.$slots, "default")], 10, ["id", "aria-label", "aria-labelledby"])); } }); var _y = np(Ey, [["__file", "radio-group.vue"]]); const Oy = yu(gy, { RadioButton: xy, RadioGroup: _y }); const My = wu(_y); const Ly = wu(xy); var Dy = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(xh, function() { return function(e3, t3) { var n2 = t3.prototype, o2 = n2.format; n2.format = function(e4) { var t4 = this, n3 = this.$locale(); if (!this.isValid()) return o2.bind(this)(e4); var a2 = this.$utils(), r2 = (e4 || "YYYY-MM-DDTHH:mm:ssZ").replace(/\[([^\]]+)]|Q|wo|ww|w|WW|W|zzz|z|gggg|GGGG|Do|X|x|k{1,2}|S/g, function(e5) { switch (e5) { case "Q": return Math.ceil((t4.$M + 1) / 3); case "Do": return n3.ordinal(t4.$D); case "gggg": return t4.weekYear(); case "GGGG": return t4.isoWeekYear(); case "wo": return n3.ordinal(t4.week(), "W"); case "w": case "ww": return a2.s(t4.week(), "w" === e5 ? 1 : 2, "0"); case "W": case "WW": return a2.s(t4.isoWeek(), "W" === e5 ? 1 : 2, "0"); case "k": case "kk": return a2.s(String(0 === t4.$H ? 24 : t4.$H), "k" === e5 ? 1 : 2, "0"); case "X": return Math.floor(t4.$d.getTime() / 1e3); case "x": return t4.$d.getTime(); case "z": return "[" + t4.offsetName() + "]"; case "zzz": return "[" + t4.offsetName("long") + "]"; default: return e5; } }); return o2.bind(this)(r2); }; }; }); })(Dy); var Ay = Dy.exports; const Ry = kh(Ay); var $y = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(xh, function() { var e3 = "week", t3 = "year"; return function(n2, o2, a2) { var r2 = o2.prototype; r2.week = function(n3) { if (void 0 === n3 && (n3 = null), null !== n3) return this.add(7 * (n3 - this.week()), "day"); var o3 = this.$locale().yearStart || 1; if (11 === this.month() && this.date() > 25) { var r3 = a2(this).startOf(t3).add(1, t3).date(o3), l2 = a2(this).endOf(e3); if (r3.isBefore(l2)) return 1; } var s2 = a2(this).startOf(t3).date(o3).startOf(e3).subtract(1, "millisecond"), i2 = this.diff(s2, e3, true); return i2 < 0 ? a2(this).startOf("week").week() : Math.ceil(i2); }, r2.weeks = function(e4) { return void 0 === e4 && (e4 = null), this.week(e4); }; }; }); })($y); var Ty = $y.exports; const Py = kh(Ty); var Ny = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(xh, function() { return function(e3, t3) { t3.prototype.weekYear = function() { var e4 = this.month(), t4 = this.week(), n2 = this.year(); return 1 === t4 && 11 === e4 ? n2 + 1 : 0 === e4 && t4 >= 52 ? n2 - 1 : n2; }; }; }); })(Ny); var Iy = Ny.exports; const By = kh(Iy); var Vy = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(xh, function() { return function(e3, t3, n2) { t3.prototype.dayOfYear = function(e4) { var t4 = Math.round((n2(this).startOf("day") - n2(this).startOf("year")) / 864e5) + 1; return null == e4 ? t4 : this.add(e4 - t4, "day"); }; }; }); })(Vy); var Fy = Vy.exports; const jy = kh(Fy); var zy = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(xh, function() { return function(e3, t3) { t3.prototype.isSameOrAfter = function(e4, t4) { return this.isSame(e4, t4) || this.isAfter(e4, t4); }; }; }); })(zy); var Hy = zy.exports; const Wy = kh(Hy); var Yy = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(xh, function() { return function(e3, t3) { t3.prototype.isSameOrBefore = function(e4, t4) { return this.isSame(e4, t4) || this.isBefore(e4, t4); }; }; }); })(Yy); var Uy = Yy.exports; const Ky = kh(Uy); const qy = Symbol(); const Gy = fu({ ...jh, type: { type: uu(String), default: "date" } }); const Xy = ["date", "dates", "year", "years", "month", "months", "week", "range"]; const Zy = fu({ disabledDate: { type: uu(Function) }, date: { type: uu(Object), required: true }, minDate: { type: uu(Object) }, maxDate: { type: uu(Object) }, parsedValue: { type: uu([Object, Array]) }, rangeState: { type: uu(Object), default: () => ({ endDate: null, selecting: false }) } }); const Jy = fu({ type: { type: uu(String), required: true, values: Cu }, dateFormat: String, timeFormat: String }); const Qy = fu({ unlinkPanels: Boolean, parsedValue: { type: uu(Array) } }); const eb = (e2) => ({ type: String, values: Xy, default: e2 }); const tb = fu({ ...Jy, parsedValue: { type: uu([Object, Array]) }, visible: { type: Boolean }, format: { type: String, default: "" } }); const nb = fu({ ...Zy, cellClassName: { type: uu(Function) }, showWeekNumber: Boolean, selectionMode: eb("date") }); const ob = ["changerange", "pick", "select"]; const ab = (e2) => { if (!xt(e2)) return false; const [t2, n2] = e2; return ue.isDayjs(t2) && ue.isDayjs(n2) && t2.isSameOrBefore(n2); }; const rb = (e2, { lang: t2, unit: n2, unlinkPanels: o2 }) => { let a2; if (xt(e2)) { let [a3, r2] = e2.map((e3) => ue(e3).locale(t2)); if (!o2) { r2 = a3.add(1, n2); } return [a3, r2]; } else if (e2) { a2 = ue(e2); } else { a2 = ue(); } a2 = a2.locale(t2); return [a2, a2.add(1, n2)]; }; const lb = (e2, t2, { columnIndexOffset: n2, startDate: o2, nextEndDate: a2, now: r2, unit: l2, relativeDateGetter: s2, setCellMetadata: i2, setRowMetadata: u2 }) => { for (let c2 = 0; c2 < e2.row; c2++) { const d2 = t2[c2]; for (let t3 = 0; t3 < e2.column; t3++) { let u3 = d2[t3 + n2]; if (!u3) { u3 = { row: c2, column: t3, type: "normal", inRange: false, start: false, end: false }; } const f2 = c2 * e2.column + t3; const p2 = s2(f2); u3.dayjs = p2; u3.date = p2.toDate(); u3.timestamp = p2.valueOf(); u3.type = "normal"; u3.inRange = !!(o2 && p2.isSameOrAfter(o2, l2) && a2 && p2.isSameOrBefore(a2, l2)) || !!(o2 && p2.isSameOrBefore(o2, l2) && a2 && p2.isSameOrAfter(a2, l2)); if (o2 == null ? void 0 : o2.isSameOrAfter(a2)) { u3.start = !!a2 && p2.isSame(a2, l2); u3.end = o2 && p2.isSame(o2, l2); } else { u3.start = !!o2 && p2.isSame(o2, l2); u3.end = !!a2 && p2.isSame(a2, l2); } const v2 = p2.isSame(r2, l2); if (v2) { u3.type = "today"; } i2 == null ? void 0 : i2(u3, { rowIndex: c2, columnIndex: t3 }); d2[t3 + n2] = u3; } u2 == null ? void 0 : u2(d2); } }; const sb = (e2 = "") => ["normal", "today"].includes(e2); const ib = (e2, t2) => { const { lang: n2 } = Wu(); const o2 = vue.ref(); const a2 = vue.ref(); const r2 = vue.ref(); const s2 = vue.ref(); const c2 = vue.ref([[], [], [], [], [], []]); let d2 = false; const f2 = e2.date.$locale().weekStart || 7; const p2 = e2.date.locale("en").localeData().weekdaysShort().map((e3) => e3.toLowerCase()); const m2 = vue.computed(() => f2 > 3 ? 7 - f2 : -f2); const h2 = vue.computed(() => { const t3 = e2.date.startOf("month"); return t3.subtract(t3.day() || 7, "day"); }); const g2 = vue.computed(() => p2.concat(p2).slice(f2, f2 + 7)); const y2 = vue.computed(() => Sr(vue.unref(E2)).some((e3) => e3.isCurrent)); const b2 = vue.computed(() => { const t3 = e2.date.startOf("month"); const n3 = t3.day() || 7; const o3 = t3.daysInMonth(); const a3 = t3.subtract(1, "month").daysInMonth(); return { startOfMonthDay: n3, dateCountOfMonth: o3, dateCountOfLastMonth: a3 }; }); const x2 = vue.computed(() => e2.selectionMode === "dates" ? Au(e2.parsedValue) : []); const k2 = (e3, { count: t3, rowIndex: n3, columnIndex: o3 }) => { const { startOfMonthDay: a3, dateCountOfMonth: r3, dateCountOfLastMonth: l2 } = vue.unref(b2); const s3 = vue.unref(m2); if (n3 >= 0 && n3 <= 1) { const r4 = a3 + s3 < 0 ? 7 + a3 + s3 : a3 + s3; if (o3 + n3 * 7 >= r4) { e3.text = t3; return true; } else { e3.text = l2 - (r4 - o3 % 7) + 1 + n3 * 7; e3.type = "prev-month"; } } else { if (t3 <= r3) { e3.text = t3; } else { e3.text = t3 - r3; e3.type = "next-month"; } return true; } return false; }; const C2 = (t3, { columnIndex: n3, rowIndex: o3 }, a3) => { const { disabledDate: r3, cellClassName: l2 } = e2; const s3 = vue.unref(x2); const i2 = k2(t3, { count: a3, rowIndex: o3, columnIndex: n3 }); const c3 = t3.dayjs.toDate(); t3.selected = s3.find((e3) => e3.isSame(t3.dayjs, "day")); t3.isSelected = !!t3.selected; t3.isCurrent = O2(t3); t3.disabled = r3 == null ? void 0 : r3(c3); t3.customClass = l2 == null ? void 0 : l2(c3); return i2; }; const S2 = (t3) => { if (e2.selectionMode === "week") { const [n3, o3] = e2.showWeekNumber ? [1, 7] : [0, 6]; const a3 = V2(t3[n3 + 1]); t3[n3].inRange = a3; t3[n3].start = a3; t3[o3].inRange = a3; t3[o3].end = a3; } }; const E2 = vue.computed(() => { const { minDate: t3, maxDate: o3, rangeState: a3, showWeekNumber: r3 } = e2; const l2 = vue.unref(m2); const s3 = vue.unref(c2); const i2 = "day"; let d3 = 1; if (r3) { for (let e3 = 0; e3 < 6; e3++) { if (!s3[e3][0]) { s3[e3][0] = { type: "week", text: vue.unref(h2).add(e3 * 7 + 1, i2).week() }; } } } lb({ row: 6, column: 7 }, s3, { startDate: t3, columnIndexOffset: r3 ? 1 : 0, nextEndDate: a3.endDate || o3 || a3.selecting && t3 || null, now: ue().locale(vue.unref(n2)).startOf(i2), unit: i2, relativeDateGetter: (e3) => vue.unref(h2).add(e3 - l2, i2), setCellMetadata: (...e3) => { if (C2(...e3, d3)) { d3 += 1; } }, setRowMetadata: S2 }); return s3; }); vue.watch(() => e2.date, async () => { var e3; if ((e3 = vue.unref(o2)) == null ? void 0 : e3.contains(document.activeElement)) { await vue.nextTick(); await _2(); } }); const _2 = async () => { var e3; return (e3 = vue.unref(a2)) == null ? void 0 : e3.focus(); }; const O2 = (t3) => e2.selectionMode === "date" && sb(t3.type) && M2(t3, e2.parsedValue); const M2 = (t3, o3) => { if (!o3) return false; return ue(o3).locale(vue.unref(n2)).isSame(e2.date.date(Number(t3.text)), "day"); }; const L2 = (t3, n3) => { const o3 = t3 * 7 + (n3 - (e2.showWeekNumber ? 1 : 0)) - vue.unref(m2); return vue.unref(h2).add(o3, "day"); }; const D2 = (n3) => { var o3; if (!e2.rangeState.selecting) return; let a3 = n3.target; if (a3.tagName === "SPAN") { a3 = (o3 = a3.parentNode) == null ? void 0 : o3.parentNode; } if (a3.tagName === "DIV") { a3 = a3.parentNode; } if (a3.tagName !== "TD") return; const l2 = a3.parentNode.rowIndex - 1; const i2 = a3.cellIndex; if (vue.unref(E2)[l2][i2].disabled) return; if (l2 !== vue.unref(r2) || i2 !== vue.unref(s2)) { r2.value = l2; s2.value = i2; t2("changerange", { selecting: true, endDate: L2(l2, i2) }); } }; const A2 = (e3) => !vue.unref(y2) && (e3 == null ? void 0 : e3.text) === 1 && e3.type === "normal" || e3.isCurrent; const R2 = (t3) => { if (d2 || vue.unref(y2) || e2.selectionMode !== "date") return; B2(t3, true); }; const $2 = (e3) => { const t3 = e3.target.closest("td"); if (!t3) return; d2 = true; }; const T2 = (e3) => { const t3 = e3.target.closest("td"); if (!t3) return; d2 = false; }; const P2 = (n3) => { if (!e2.rangeState.selecting || !e2.minDate) { t2("pick", { minDate: n3, maxDate: null }); t2("select", true); } else { if (n3 >= e2.minDate) { t2("pick", { minDate: e2.minDate, maxDate: n3 }); } else { t2("pick", { minDate: n3, maxDate: e2.minDate }); } t2("select", false); } }; const N2 = (e3) => { const n3 = e3.week(); const o3 = `${e3.year()}w${n3}`; t2("pick", { year: e3.year(), week: n3, value: o3, date: e3.startOf("week") }); }; const I2 = (n3, o3) => { const a3 = o3 ? Au(e2.parsedValue).filter((e3) => (e3 == null ? void 0 : e3.valueOf()) !== n3.valueOf()) : Au(e2.parsedValue).concat([n3]); t2("pick", a3); }; const B2 = (n3, o3 = false) => { const a3 = n3.target.closest("td"); if (!a3) return; const r3 = a3.parentNode.rowIndex - 1; const l2 = a3.cellIndex; const s3 = vue.unref(E2)[r3][l2]; if (s3.disabled || s3.type === "week") return; const i2 = L2(r3, l2); switch (e2.selectionMode) { case "range": { P2(i2); break; } case "date": { t2("pick", i2, o3); break; } case "week": { N2(i2); break; } case "dates": { I2(i2, !!s3.selected); break; } } }; const V2 = (t3) => { if (e2.selectionMode !== "week") return false; let n3 = e2.date.startOf("day"); if (t3.type === "prev-month") { n3 = n3.subtract(1, "month"); } if (t3.type === "next-month") { n3 = n3.add(1, "month"); } n3 = n3.date(Number.parseInt(t3.text, 10)); if (e2.parsedValue && !Array.isArray(e2.parsedValue)) { const t4 = (e2.parsedValue.day() - f2 + 7) % 7 - 1; const o3 = e2.parsedValue.subtract(t4, "day"); return o3.isSame(n3, "day"); } return false; }; return { WEEKS: g2, rows: E2, tbodyRef: o2, currentCellRef: a2, focus: _2, isCurrent: O2, isWeekActive: V2, isSelectedCell: A2, handlePickDate: B2, handleMouseUp: T2, handleMouseDown: $2, handleMouseMove: D2, handleFocus: R2 }; }; const ub = (e2, { isCurrent: t2, isWeekActive: n2 }) => { const o2 = Xu("date-table"); const { t: a2 } = Wu(); const r2 = vue.computed(() => [o2.b(), { "is-week-mode": e2.selectionMode === "week" }]); const s2 = vue.computed(() => a2("el.datepicker.dateTablePrompt")); const i2 = vue.computed(() => a2("el.datepicker.week")); const u2 = (n3) => { const o3 = []; if (sb(n3.type) && !n3.disabled) { o3.push("available"); if (n3.type === "today") { o3.push("today"); } } else { o3.push(n3.type); } if (t2(n3)) { o3.push("current"); } if (n3.inRange && (sb(n3.type) || e2.selectionMode === "week")) { o3.push("in-range"); if (n3.start) { o3.push("start-date"); } if (n3.end) { o3.push("end-date"); } } if (n3.disabled) { o3.push("disabled"); } if (n3.selected) { o3.push("selected"); } if (n3.customClass) { o3.push(n3.customClass); } return o3.join(" "); }; const c2 = (e3) => [o2.e("row"), { current: n2(e3) }]; return { tableKls: r2, tableLabel: s2, weekLabel: i2, getCellClasses: u2, getRowKls: c2, t: a2 }; }; const cb = fu({ cell: { type: uu(Object) } }); var db = vue.defineComponent({ name: "ElDatePickerCell", props: cb, setup(e2) { const t2 = Xu("date-table-cell"); const { slots: n2 } = vue.inject(qy); return () => { const { cell: o2 } = e2; return vue.renderSlot(n2, "default", { ...o2 }, () => { var e3; return [vue.createVNode("div", { class: t2.b() }, [vue.createVNode("span", { class: t2.e("text") }, [(e3 = o2 == null ? void 0 : o2.renderText) != null ? e3 : o2 == null ? void 0 : o2.text])])]; }); }; } }); const fb = vue.defineComponent({ __name: "basic-date-table", props: nb, emits: ob, setup(e2, { expose: a2, emit: r2 }) { const l2 = e2; const { WEEKS: s2, rows: i2, tbodyRef: c2, currentCellRef: d2, focus: f2, isCurrent: p2, isWeekActive: v2, isSelectedCell: m2, handlePickDate: h2, handleMouseUp: g2, handleMouseDown: y2, handleMouseMove: b2, handleFocus: w2 } = ib(l2, r2); const { tableLabel: x2, tableKls: k2, weekLabel: C2, getCellClasses: S2, getRowKls: E2, t: _2 } = ub(l2, { isCurrent: p2, isWeekActive: v2 }); a2({ focus: f2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("table", { "aria-label": vue.unref(x2), class: vue.normalizeClass(vue.unref(k2)), cellspacing: "0", cellpadding: "0", role: "grid", onClick: vue.unref(h2), onMousemove: vue.unref(b2), onMousedown: vue.withModifiers(vue.unref(y2), ["prevent"]), onMouseup: vue.unref(g2) }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: c2 }, [vue.createElementVNode("tr", null, [e3.showWeekNumber ? (vue.openBlock(), vue.createElementBlock("th", { key: 0, scope: "col" }, vue.toDisplayString(vue.unref(C2)), 1)) : vue.createCommentVNode("v-if", true), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(s2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("th", { key: o2, "aria-label": vue.unref(_2)("el.datepicker.weeksFull." + e4), scope: "col" }, vue.toDisplayString(vue.unref(_2)("el.datepicker.weeks." + e4)), 9, ["aria-label"]))), 128))]), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(i2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("tr", { key: o2, class: vue.normalizeClass(vue.unref(E2)(e4[1])) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, a4) => (vue.openBlock(), vue.createElementBlock("td", { key: `${o2}.${a4}`, ref_for: true, ref: (t2) => vue.unref(m2)(e5) && (d2.value = t2), class: vue.normalizeClass(vue.unref(S2)(e5)), "aria-current": e5.isCurrent ? "date" : void 0, "aria-selected": e5.isCurrent, tabindex: vue.unref(m2)(e5) ? 0 : -1, onFocus: vue.unref(w2) }, [vue.createVNode(vue.unref(db), { cell: e5 }, null, 8, ["cell"])], 42, ["aria-current", "aria-selected", "tabindex", "onFocus"]))), 128))], 2))), 128))], 512)], 42, ["aria-label", "onClick", "onMousemove", "onMousedown", "onMouseup"])); } }); var pb = np(fb, [["__file", "basic-date-table.vue"]]); const vb = fu({ ...Zy, selectionMode: eb("month") }); const mb = vue.defineComponent({ __name: "basic-month-table", props: vb, emits: ["changerange", "pick", "select"], setup(e2, { expose: a2, emit: r2 }) { const s2 = e2; const c2 = (e3, t2, n2) => { const o2 = ue().locale(n2).startOf("month").month(t2).year(e3); const a3 = o2.daysInMonth(); return Ah(a3).map((e4) => o2.add(e4, "day").toDate()); }; const d2 = Xu("month-table"); const { t: f2, lang: p2 } = Wu(); const m2 = vue.ref(); const h2 = vue.ref(); const g2 = vue.ref(s2.date.locale("en").localeData().monthsShort().map((e3) => e3.toLowerCase())); const y2 = vue.ref([[], [], []]); const b2 = vue.ref(); const x2 = vue.ref(); const k2 = vue.computed(() => { var e3, t2; const n2 = y2.value; const o2 = ue().locale(p2.value).startOf("month"); for (let a3 = 0; a3 < 3; a3++) { const r3 = n2[a3]; for (let n3 = 0; n3 < 4; n3++) { const l2 = r3[n3] || (r3[n3] = { row: a3, column: n3, type: "normal", inRange: false, start: false, end: false, text: -1, disabled: false }); l2.type = "normal"; const i2 = a3 * 4 + n3; const u2 = s2.date.startOf("year").month(i2); const c3 = s2.rangeState.endDate || s2.maxDate || s2.rangeState.selecting && s2.minDate || null; l2.inRange = !!(s2.minDate && u2.isSameOrAfter(s2.minDate, "month") && c3 && u2.isSameOrBefore(c3, "month")) || !!(s2.minDate && u2.isSameOrBefore(s2.minDate, "month") && c3 && u2.isSameOrAfter(c3, "month")); if ((e3 = s2.minDate) == null ? void 0 : e3.isSameOrAfter(c3)) { l2.start = !!(c3 && u2.isSame(c3, "month")); l2.end = s2.minDate && u2.isSame(s2.minDate, "month"); } else { l2.start = !!(s2.minDate && u2.isSame(s2.minDate, "month")); l2.end = !!(c3 && u2.isSame(c3, "month")); } const d3 = o2.isSame(u2); if (d3) { l2.type = "today"; } l2.text = i2; l2.disabled = ((t2 = s2.disabledDate) == null ? void 0 : t2.call(s2, u2.toDate())) || false; } } return n2; }); const C2 = () => { var e3; (e3 = h2.value) == null ? void 0 : e3.focus(); }; const S2 = (e3) => { const t2 = {}; const n2 = s2.date.year(); const o2 = /* @__PURE__ */ new Date(); const a3 = e3.text; t2.disabled = s2.disabledDate ? c2(n2, a3, p2.value).every(s2.disabledDate) : false; t2.current = Au(s2.parsedValue).findIndex((e4) => ue.isDayjs(e4) && e4.year() === n2 && e4.month() === a3) >= 0; t2.today = o2.getFullYear() === n2 && o2.getMonth() === a3; if (e3.inRange) { t2["in-range"] = true; if (e3.start) { t2["start-date"] = true; } if (e3.end) { t2["end-date"] = true; } } return t2; }; const E2 = (e3) => { const t2 = s2.date.year(); const n2 = e3.text; return Au(s2.date).findIndex((e4) => e4.year() === t2 && e4.month() === n2) >= 0; }; const _2 = (e3) => { var t2; if (!s2.rangeState.selecting) return; let n2 = e3.target; if (n2.tagName === "SPAN") { n2 = (t2 = n2.parentNode) == null ? void 0 : t2.parentNode; } if (n2.tagName === "DIV") { n2 = n2.parentNode; } if (n2.tagName !== "TD") return; const o2 = n2.parentNode.rowIndex; const a3 = n2.cellIndex; if (k2.value[o2][a3].disabled) return; if (o2 !== b2.value || a3 !== x2.value) { b2.value = o2; x2.value = a3; r2("changerange", { selecting: true, endDate: s2.date.startOf("year").month(o2 * 4 + a3) }); } }; const O2 = (e3) => { var t2; const n2 = (t2 = e3.target) == null ? void 0 : t2.closest("td"); if ((n2 == null ? void 0 : n2.tagName) !== "TD") return; if (di(n2, "disabled")) return; const o2 = n2.cellIndex; const a3 = n2.parentNode.rowIndex; const l2 = a3 * 4 + o2; const i2 = s2.date.startOf("year").month(l2); if (s2.selectionMode === "months") { if (e3.type === "keydown") { r2("pick", Au(s2.parsedValue), false); return; } const t3 = s2.date.startOf("month").month(l2); const o3 = di(n2, "current") ? Au(s2.parsedValue).filter((e4) => Number(e4) !== Number(t3)) : Au(s2.parsedValue).concat([ue(t3)]); r2("pick", o3); } else if (s2.selectionMode === "range") { if (!s2.rangeState.selecting) { r2("pick", { minDate: i2, maxDate: null }); r2("select", true); } else { if (s2.minDate && i2 >= s2.minDate) { r2("pick", { minDate: s2.minDate, maxDate: i2 }); } else { r2("pick", { minDate: i2, maxDate: s2.minDate }); } r2("select", false); } } else { r2("pick", l2); } }; vue.watch(() => s2.date, async () => { var e3, t2; if ((e3 = m2.value) == null ? void 0 : e3.contains(document.activeElement)) { await vue.nextTick(); (t2 = h2.value) == null ? void 0 : t2.focus(); } }); a2({ focus: C2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("table", { role: "grid", "aria-label": vue.unref(f2)("el.datepicker.monthTablePrompt"), class: vue.normalizeClass(vue.unref(d2).b()), onClick: O2, onMousemove: _2 }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: m2 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(k2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("tr", { key: o2 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, o3) => (vue.openBlock(), vue.createElementBlock("td", { key: o3, ref_for: true, ref: (t2) => E2(e5) && (h2.value = t2), class: vue.normalizeClass(S2(e5)), "aria-selected": `${E2(e5)}`, "aria-label": vue.unref(f2)(`el.datepicker.month${+e5.text + 1}`), tabindex: E2(e5) ? 0 : -1, onKeydown: [vue.withKeys(vue.withModifiers(O2, ["prevent", "stop"]), ["space"]), vue.withKeys(vue.withModifiers(O2, ["prevent", "stop"]), ["enter"])] }, [vue.createVNode(vue.unref(db), { cell: { ...e5, renderText: vue.unref(f2)("el.datepicker.months." + g2.value[e5.text]) } }, null, 8, ["cell"])], 42, ["aria-selected", "aria-label", "tabindex", "onKeydown"]))), 128))]))), 128))], 512)], 42, ["aria-label"])); } }); var hb = np(mb, [["__file", "basic-month-table.vue"]]); const gb = fu({ ...Zy, selectionMode: eb("year") }); const yb = vue.defineComponent({ __name: "basic-year-table", props: gb, emits: ["changerange", "pick", "select"], setup(e2, { expose: a2, emit: r2 }) { const s2 = e2; const c2 = (e3, t2) => { const n2 = ue(String(e3)).locale(t2).startOf("year"); const o2 = n2.endOf("year"); const a3 = o2.dayOfYear(); return Ah(a3).map((e4) => n2.add(e4, "day").toDate()); }; const d2 = Xu("year-table"); const { t: f2, lang: p2 } = Wu(); const m2 = vue.ref(); const h2 = vue.ref(); const g2 = vue.computed(() => Math.floor(s2.date.year() / 10) * 10); const y2 = vue.ref([[], [], []]); const b2 = vue.ref(); const x2 = vue.ref(); const k2 = vue.computed(() => { var e3; const t2 = y2.value; const n2 = ue().locale(p2.value).startOf("year"); for (let o2 = 0; o2 < 3; o2++) { const a3 = t2[o2]; for (let t3 = 0; t3 < 4; t3++) { if (o2 * 4 + t3 >= 10) { break; } let r3 = a3[t3]; if (!r3) { r3 = { row: o2, column: t3, type: "normal", inRange: false, start: false, end: false, text: -1, disabled: false }; } r3.type = "normal"; const l2 = o2 * 4 + t3 + g2.value; const i2 = ue().year(l2); const u2 = s2.rangeState.endDate || s2.maxDate || s2.rangeState.selecting && s2.minDate || null; r3.inRange = !!(s2.minDate && i2.isSameOrAfter(s2.minDate, "year") && u2 && i2.isSameOrBefore(u2, "year")) || !!(s2.minDate && i2.isSameOrBefore(s2.minDate, "year") && u2 && i2.isSameOrAfter(u2, "year")); if ((e3 = s2.minDate) == null ? void 0 : e3.isSameOrAfter(u2)) { r3.start = !!(u2 && i2.isSame(u2, "year")); r3.end = !!(s2.minDate && i2.isSame(s2.minDate, "year")); } else { r3.start = !!(s2.minDate && i2.isSame(s2.minDate, "year")); r3.end = !!(u2 && i2.isSame(u2, "year")); } const c3 = n2.isSame(i2); if (c3) { r3.type = "today"; } r3.text = l2; const d3 = i2.toDate(); r3.disabled = s2.disabledDate && s2.disabledDate(d3) || false; a3[t3] = r3; } } return t2; }); const C2 = () => { var e3; (e3 = h2.value) == null ? void 0 : e3.focus(); }; const S2 = (e3) => { const t2 = {}; const n2 = ue().locale(p2.value); const o2 = e3.text; t2.disabled = s2.disabledDate ? c2(o2, p2.value).every(s2.disabledDate) : false; t2.today = n2.year() === o2; t2.current = Au(s2.parsedValue).findIndex((e4) => e4.year() === o2) >= 0; if (e3.inRange) { t2["in-range"] = true; if (e3.start) { t2["start-date"] = true; } if (e3.end) { t2["end-date"] = true; } } return t2; }; const E2 = (e3) => { const t2 = e3.text; return Au(s2.date).findIndex((e4) => e4.year() === t2) >= 0; }; const _2 = (e3) => { var t2; const n2 = (t2 = e3.target) == null ? void 0 : t2.closest("td"); if (!n2 || !n2.textContent || di(n2, "disabled")) return; const o2 = n2.cellIndex; const a3 = n2.parentNode.rowIndex; const l2 = a3 * 4 + o2 + g2.value; const i2 = ue().year(l2); if (s2.selectionMode === "range") { if (!s2.rangeState.selecting) { r2("pick", { minDate: i2, maxDate: null }); r2("select", true); } else { if (s2.minDate && i2 >= s2.minDate) { r2("pick", { minDate: s2.minDate, maxDate: i2 }); } else { r2("pick", { minDate: i2, maxDate: s2.minDate }); } r2("select", false); } } else if (s2.selectionMode === "years") { if (e3.type === "keydown") { r2("pick", Au(s2.parsedValue), false); return; } const t3 = di(n2, "current") ? Au(s2.parsedValue).filter((e4) => (e4 == null ? void 0 : e4.year()) !== l2) : Au(s2.parsedValue).concat([i2]); r2("pick", t3); } else { r2("pick", l2); } }; const O2 = (e3) => { var t2; if (!s2.rangeState.selecting) return; const n2 = (t2 = e3.target) == null ? void 0 : t2.closest("td"); if (!n2) return; const o2 = n2.parentNode.rowIndex; const a3 = n2.cellIndex; if (k2.value[o2][a3].disabled) return; if (o2 !== b2.value || a3 !== x2.value) { b2.value = o2; x2.value = a3; r2("changerange", { selecting: true, endDate: ue().year(g2.value).add(o2 * 4 + a3, "year") }); } }; vue.watch(() => s2.date, async () => { var e3, t2; if ((e3 = m2.value) == null ? void 0 : e3.contains(document.activeElement)) { await vue.nextTick(); (t2 = h2.value) == null ? void 0 : t2.focus(); } }); a2({ focus: C2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("table", { role: "grid", "aria-label": vue.unref(f2)("el.datepicker.yearTablePrompt"), class: vue.normalizeClass(vue.unref(d2).b()), onClick: _2, onMousemove: O2 }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: m2 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(k2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("tr", { key: o2 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, a4) => (vue.openBlock(), vue.createElementBlock("td", { key: `${o2}_${a4}`, ref_for: true, ref: (t2) => E2(e5) && (h2.value = t2), class: vue.normalizeClass(["available", S2(e5)]), "aria-selected": E2(e5), "aria-label": String(e5.text), tabindex: E2(e5) ? 0 : -1, onKeydown: [vue.withKeys(vue.withModifiers(_2, ["prevent", "stop"]), ["space"]), vue.withKeys(vue.withModifiers(_2, ["prevent", "stop"]), ["enter"])] }, [vue.createVNode(vue.unref(db), { cell: e5 }, null, 8, ["cell"])], 42, ["aria-selected", "aria-label", "tabindex", "onKeydown"]))), 128))]))), 128))], 512)], 42, ["aria-label"])); } }); var bb = np(yb, [["__file", "basic-year-table.vue"]]); const wb = vue.defineComponent({ __name: "panel-date-pick", props: tb, emits: ["pick", "set-picker-option", "panel-change"], setup(e2, { emit: a2 }) { const r2 = e2; const s2 = (e3, t2, n2) => true; const c2 = Xu("picker-panel"); const d2 = Xu("date-picker"); const f2 = vue.useAttrs(); const m2 = vue.useSlots(); const { t: h2, lang: g2 } = Wu(); const y2 = vue.inject("EP_PICKER_BASE"); const b2 = vue.inject(em); const { shortcuts: k2, disabledDate: S2, cellClassName: R2, defaultTime: $2 } = y2.props; const N2 = vue.toRef(y2.props, "defaultValue"); const I2 = vue.ref(); const F2 = vue.ref(ue().locale(g2.value)); const j2 = vue.ref(false); let z2 = false; const H2 = vue.computed(() => ue($2).locale(g2.value)); const W2 = vue.computed(() => F2.value.month()); const Y2 = vue.computed(() => F2.value.year()); const U2 = vue.ref([]); const K2 = vue.ref(null); const q2 = vue.ref(null); const Z2 = (e3) => U2.value.length > 0 ? s2(e3, U2.value, r2.format || "HH:mm:ss") : true; const J2 = (e3) => { if ($2 && !Ce2.value && !j2.value && !z2) { return H2.value.year(e3.year()).month(e3.month()).date(e3.date()); } if (me2.value) return e3.millisecond(0); return e3.startOf("day"); }; const Q2 = (e3, ...t2) => { if (!e3) { a2("pick", e3, ...t2); } else if (xt(e3)) { const n2 = e3.map(J2); a2("pick", n2, ...t2); } else { a2("pick", J2(e3), ...t2); } K2.value = null; q2.value = null; j2.value = false; z2 = false; }; const ee2 = async (e3, t2) => { if (se2.value === "date") { e3 = e3; let n2 = r2.parsedValue ? r2.parsedValue.year(e3.year()).month(e3.month()).date(e3.date()) : e3; if (!Z2(n2)) { n2 = U2.value[0][0].year(e3.year()).month(e3.month()).date(e3.date()); } F2.value = n2; Q2(n2, me2.value || t2); if (r2.type === "datetime") { await vue.nextTick(); Ne2(); } } else if (se2.value === "week") { Q2(e3.date); } else if (se2.value === "dates") { Q2(e3, true); } }; const ne2 = (e3) => { const t2 = e3 ? "add" : "subtract"; F2.value = F2.value[t2](1, "month"); Ve2("month"); }; const oe2 = (e3) => { const t2 = F2.value; const n2 = e3 ? "add" : "subtract"; F2.value = ae2.value === "year" ? t2[n2](10, "year") : t2[n2](1, "year"); Ve2("year"); }; const ae2 = vue.ref("date"); const re2 = vue.computed(() => { const e3 = h2("el.datepicker.year"); if (ae2.value === "year") { const t2 = Math.floor(Y2.value / 10) * 10; if (e3) { return `${t2} ${e3} - ${t2 + 9} ${e3}`; } return `${t2} - ${t2 + 9}`; } return `${Y2.value} ${e3}`; }); const le2 = (e3) => { const t2 = Ct(e3.value) ? e3.value() : e3.value; if (t2) { z2 = true; Q2(ue(t2).locale(g2.value)); return; } if (e3.onClick) { e3.onClick({ attrs: f2, slots: m2, emit: a2 }); } }; const se2 = vue.computed(() => { const { type: e3 } = r2; if (["week", "month", "months", "year", "years", "dates"].includes(e3)) return e3; return "date"; }); const ie2 = vue.computed(() => se2.value === "dates" || se2.value === "months" || se2.value === "years"); const ce2 = vue.computed(() => se2.value === "date" ? ae2.value : se2.value); const de2 = vue.computed(() => !!k2.length); const fe2 = async (e3, t2) => { if (se2.value === "month") { F2.value = F2.value.startOf("month").month(e3); Q2(F2.value, false); } else if (se2.value === "months") { Q2(e3, t2 != null ? t2 : true); } else { F2.value = F2.value.startOf("month").month(e3); ae2.value = "date"; if (["month", "year", "date", "week"].includes(se2.value)) { Q2(F2.value, true); await vue.nextTick(); Ne2(); } } Ve2("month"); }; const pe2 = async (e3, t2) => { if (se2.value === "year") { F2.value = F2.value.startOf("year").year(e3); Q2(F2.value, false); } else if (se2.value === "years") { Q2(e3, t2 != null ? t2 : true); } else { F2.value = F2.value.year(e3); ae2.value = "month"; if (["month", "year", "date", "week"].includes(se2.value)) { Q2(F2.value, true); await vue.nextTick(); Ne2(); } } Ve2("year"); }; const ve2 = async (e3) => { ae2.value = e3; await vue.nextTick(); Ne2(); }; const me2 = vue.computed(() => r2.type === "datetime" || r2.type === "datetimerange"); const he2 = vue.computed(() => { const e3 = me2.value || se2.value === "dates"; const t2 = se2.value === "years"; const n2 = se2.value === "months"; const o2 = ae2.value === "date"; const a3 = ae2.value === "year"; const r3 = ae2.value === "month"; return e3 && o2 || t2 && a3 || n2 && r3; }); const ge2 = vue.computed(() => { if (!S2) return false; if (!r2.parsedValue) return true; if (xt(r2.parsedValue)) { return S2(r2.parsedValue[0].toDate()); } return S2(r2.parsedValue.toDate()); }); const ye2 = () => { if (ie2.value) { Q2(r2.parsedValue); } else { let e3 = r2.parsedValue; if (!e3) { const t2 = ue($2).locale(g2.value); const n2 = Pe2(); e3 = t2.year(n2.year()).month(n2.month()).date(n2.date()); } F2.value = e3; Q2(e3); } }; const be2 = vue.computed(() => { if (!S2) return false; return S2(ue().locale(g2.value).toDate()); }); const we2 = () => { const e3 = ue().locale(g2.value); const t2 = e3.toDate(); j2.value = true; if ((!S2 || !S2(t2)) && Z2(t2)) { F2.value = ue().locale(g2.value); Q2(F2.value); } }; const xe2 = vue.computed(() => r2.timeFormat || $h(r2.format)); const ke2 = vue.computed(() => r2.dateFormat || Rh(r2.format)); const Ce2 = vue.computed(() => { if (q2.value) return q2.value; if (!r2.parsedValue && !N2.value) return; return (r2.parsedValue || F2.value).format(xe2.value); }); const Se2 = vue.computed(() => { if (K2.value) return K2.value; if (!r2.parsedValue && !N2.value) return; return (r2.parsedValue || F2.value).format(ke2.value); }); const Ee2 = vue.ref(false); const _e2 = () => { Ee2.value = true; }; const Oe2 = () => { Ee2.value = false; }; const Me2 = (e3) => ({ hour: e3.hour(), minute: e3.minute(), second: e3.second(), year: e3.year(), month: e3.month(), date: e3.date() }); const Le2 = (e3, t2, n2) => { const { hour: o2, minute: a3, second: l2 } = Me2(e3); const s3 = r2.parsedValue ? r2.parsedValue.hour(o2).minute(a3).second(l2) : e3; F2.value = s3; Q2(F2.value, true); if (!n2) { Ee2.value = t2; } }; const De2 = (e3) => { const t2 = ue(e3, xe2.value).locale(g2.value); if (t2.isValid() && Z2(t2)) { const { year: e4, month: n2, date: o2 } = Me2(F2.value); F2.value = t2.year(e4).month(n2).date(o2); q2.value = null; Ee2.value = false; Q2(F2.value, true); } }; const Ae2 = (e3) => { const t2 = ue(e3, ke2.value).locale(g2.value); if (t2.isValid()) { if (S2 && S2(t2.toDate())) { return; } const { hour: e4, minute: n2, second: o2 } = Me2(F2.value); F2.value = t2.hour(e4).minute(n2).second(o2); K2.value = null; Q2(F2.value, true); } }; const Re2 = (e3) => ue.isDayjs(e3) && e3.isValid() && (S2 ? !S2(e3.toDate()) : true); const $e2 = (e3) => xt(e3) ? e3.map((e4) => e4.format(r2.format)) : e3.format(r2.format); const Te2 = (e3) => ue(e3, r2.format).locale(g2.value); const Pe2 = () => { const e3 = ue(N2.value).locale(g2.value); if (!N2.value) { const e4 = H2.value; return ue().hour(e4.hour()).minute(e4.minute()).second(e4.second()).locale(g2.value); } return e3; }; const Ne2 = async () => { var e3; if (["week", "month", "year", "date"].includes(se2.value)) { (e3 = I2.value) == null ? void 0 : e3.focus(); if (se2.value === "week") { Be2(ku.down); } } }; const Ie2 = (e3) => { const { code: t2 } = e3; const n2 = [ku.up, ku.down, ku.left, ku.right, ku.home, ku.end, ku.pageUp, ku.pageDown]; if (n2.includes(t2)) { Be2(t2); e3.stopPropagation(); e3.preventDefault(); } if ([ku.enter, ku.space, ku.numpadEnter].includes(t2) && K2.value === null && q2.value === null) { e3.preventDefault(); Q2(F2.value, false); } }; const Be2 = (e3) => { var t2; const { up: n2, down: o2, left: r3, right: l2, home: s3, end: i2, pageUp: u2, pageDown: c3 } = ku; const d3 = { year: { [n2]: -4, [o2]: 4, [r3]: -1, [l2]: 1, offset: (e4, t3) => e4.setFullYear(e4.getFullYear() + t3) }, month: { [n2]: -4, [o2]: 4, [r3]: -1, [l2]: 1, offset: (e4, t3) => e4.setMonth(e4.getMonth() + t3) }, week: { [n2]: -1, [o2]: 1, [r3]: -1, [l2]: 1, offset: (e4, t3) => e4.setDate(e4.getDate() + t3 * 7) }, date: { [n2]: -7, [o2]: 7, [r3]: -1, [l2]: 1, [s3]: (e4) => -e4.getDay(), [i2]: (e4) => -e4.getDay() + 6, [u2]: (e4) => -new Date(e4.getFullYear(), e4.getMonth(), 0).getDate(), [c3]: (e4) => new Date(e4.getFullYear(), e4.getMonth() + 1, 0).getDate(), offset: (e4, t3) => e4.setDate(e4.getDate() + t3) } }; const f3 = F2.value.toDate(); while (Math.abs(F2.value.diff(f3, "year", true)) < 1) { const n3 = d3[ce2.value]; if (!n3) return; n3.offset(f3, Ct(n3[e3]) ? n3[e3](f3) : (t2 = n3[e3]) != null ? t2 : 0); if (S2 && S2(f3)) { break; } const o3 = ue(f3).locale(g2.value); F2.value = o3; a2("pick", o3, true); break; } }; const Ve2 = (e3) => { a2("panel-change", F2.value.toDate(), e3, ae2.value); }; vue.watch(() => se2.value, (e3) => { if (["month", "year"].includes(e3)) { ae2.value = e3; return; } else if (e3 === "years") { ae2.value = "year"; return; } else if (e3 === "months") { ae2.value = "month"; return; } ae2.value = "date"; }, { immediate: true }); vue.watch(() => ae2.value, () => { b2 == null ? void 0 : b2.updatePopper(); }); vue.watch(() => N2.value, (e3) => { if (e3) { F2.value = Pe2(); } }, { immediate: true }); vue.watch(() => r2.parsedValue, (e3) => { if (e3) { if (ie2.value) return; if (Array.isArray(e3)) return; F2.value = e3; } else { F2.value = Pe2(); } }, { immediate: true }); a2("set-picker-option", ["isValidValue", Re2]); a2("set-picker-option", ["formatToString", $e2]); a2("set-picker-option", ["parseUserInput", Te2]); a2("set-picker-option", ["handleFocusPicker", Ne2]); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(c2).b(), vue.unref(d2).b(), { "has-sidebar": e3.$slots.sidebar || vue.unref(de2), "has-time": vue.unref(me2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(c2).e("sidebar")) }), vue.unref(de2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(c2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(k2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("button", { key: o2, type: "button", class: vue.normalizeClass(vue.unref(c2).e("shortcut")), onClick: (t2) => le2(e4) }, vue.toDisplayString(e4.text), 11, ["onClick"]))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("body")) }, [vue.unref(me2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("time-header")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("editor-wrap")) }, [vue.createVNode(vue.unref(Sp), { placeholder: vue.unref(h2)("el.datepicker.selectDate"), "model-value": vue.unref(Se2), size: "small", "validate-event": false, onInput: (e4) => K2.value = e4, onChange: Ae2 }, null, 8, ["placeholder", "model-value", "onInput"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(d2).e("editor-wrap")) }, [vue.createVNode(vue.unref(Sp), { placeholder: vue.unref(h2)("el.datepicker.selectTime"), "model-value": vue.unref(Ce2), size: "small", "validate-event": false, onFocus: _e2, onInput: (e4) => q2.value = e4, onChange: De2 }, null, 8, ["placeholder", "model-value", "onInput"]), vue.createVNode(vue.unref(Vg), { visible: Ee2.value, format: vue.unref(xe2), "parsed-value": F2.value, onPick: Le2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(Qh), Oe2]])], 2)) : vue.createCommentVNode("v-if", true), vue.withDirectives(vue.createElementVNode("div", { class: vue.normalizeClass([vue.unref(d2).e("header"), (ae2.value === "year" || ae2.value === "month") && vue.unref(d2).e("header--bordered")]) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("prev-btn")) }, [vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.prevYear`), class: vue.normalizeClass(["d-arrow-left", vue.unref(c2).e("icon-btn")]), onClick: (e4) => oe2(false) }, [vue.renderSlot(e3.$slots, "prev-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })])], 10, ["aria-label", "onClick"]), vue.withDirectives(vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.prevMonth`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "arrow-left"]), onClick: (e4) => ne2(false) }, [vue.renderSlot(e3.$slots, "prev-month", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(xi))]), _: 1 })])], 10, ["aria-label", "onClick"]), [[vue.vShow, ae2.value === "date"]])], 2), vue.createElementVNode("span", { role: "button", class: vue.normalizeClass(vue.unref(d2).e("header-label")), "aria-live": "polite", tabindex: "0", onKeydown: vue.withKeys((e4) => ve2("year"), ["enter"]), onClick: (e4) => ve2("year") }, vue.toDisplayString(vue.unref(re2)), 43, ["onKeydown", "onClick"]), vue.withDirectives(vue.createElementVNode("span", { role: "button", "aria-live": "polite", tabindex: "0", class: vue.normalizeClass([vue.unref(d2).e("header-label"), { active: ae2.value === "month" }]), onKeydown: vue.withKeys((e4) => ve2("month"), ["enter"]), onClick: (e4) => ve2("month") }, vue.toDisplayString(vue.unref(h2)(`el.datepicker.month${vue.unref(W2) + 1}`)), 43, ["onKeydown", "onClick"]), [[vue.vShow, ae2.value === "date"]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("next-btn")) }, [vue.withDirectives(vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.nextMonth`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "arrow-right"]), onClick: (e4) => ne2(true) }, [vue.renderSlot(e3.$slots, "next-month", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ci))]), _: 1 })])], 10, ["aria-label", "onClick"]), [[vue.vShow, ae2.value === "date"]]), vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.nextYear`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "d-arrow-right"]), onClick: (e4) => oe2(true) }, [vue.renderSlot(e3.$slots, "next-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ji))]), _: 1 })])], 10, ["aria-label", "onClick"])], 2)], 2), [[vue.vShow, ae2.value !== "time"]]), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("content")), onKeydown: Ie2 }, [ae2.value === "date" ? (vue.openBlock(), vue.createBlock(pb, { key: 0, ref_key: "currentViewRef", ref: I2, "selection-mode": vue.unref(se2), date: F2.value, "parsed-value": e3.parsedValue, "disabled-date": vue.unref(S2), "cell-class-name": vue.unref(R2), onPick: ee2 }, null, 8, ["selection-mode", "date", "parsed-value", "disabled-date", "cell-class-name"])) : vue.createCommentVNode("v-if", true), ae2.value === "year" ? (vue.openBlock(), vue.createBlock(bb, { key: 1, ref_key: "currentViewRef", ref: I2, "selection-mode": vue.unref(se2), date: F2.value, "disabled-date": vue.unref(S2), "parsed-value": e3.parsedValue, onPick: pe2 }, null, 8, ["selection-mode", "date", "disabled-date", "parsed-value"])) : vue.createCommentVNode("v-if", true), ae2.value === "month" ? (vue.openBlock(), vue.createBlock(hb, { key: 2, ref_key: "currentViewRef", ref: I2, "selection-mode": vue.unref(se2), date: F2.value, "parsed-value": e3.parsedValue, "disabled-date": vue.unref(S2), onPick: fe2 }, null, 8, ["selection-mode", "date", "parsed-value", "disabled-date"])) : vue.createCommentVNode("v-if", true)], 34)], 2)], 2), vue.withDirectives(vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("footer")) }, [vue.withDirectives(vue.createVNode(vue.unref(wh), { text: "", size: "small", class: vue.normalizeClass(vue.unref(c2).e("link-btn")), disabled: vue.unref(be2), onClick: we2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(h2)("el.datepicker.now")), 1)]), _: 1 }, 8, ["class", "disabled"]), [[vue.vShow, !vue.unref(ie2)]]), vue.createVNode(vue.unref(wh), { plain: "", size: "small", class: vue.normalizeClass(vue.unref(c2).e("link-btn")), disabled: vue.unref(ge2), onClick: ye2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(h2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled"])], 2), [[vue.vShow, vue.unref(he2)]])], 2)); } }); var xb = np(wb, [["__file", "panel-date-pick.vue"]]); const kb = fu({ ...Jy, ...Qy, visible: Boolean }); const Cb = (e2) => { const { emit: t2 } = vue.getCurrentInstance(); const n2 = vue.useAttrs(); const o2 = vue.useSlots(); const a2 = (a3) => { const r2 = Ct(a3.value) ? a3.value() : a3.value; if (r2) { t2("pick", [ue(r2[0]).locale(e2.value), ue(r2[1]).locale(e2.value)]); return; } if (a3.onClick) { a3.onClick({ attrs: n2, slots: o2, emit: t2 }); } }; return a2; }; const Sb = (e2, { defaultValue: t2, leftDate: n2, rightDate: o2, unit: a2, onParsedValueChanged: r2 }) => { const { emit: l2 } = vue.getCurrentInstance(); const { pickerNs: c2 } = vue.inject(qy); const d2 = Xu("date-range-picker"); const { t: f2, lang: m2 } = Wu(); const h2 = Cb(m2); const g2 = vue.ref(); const y2 = vue.ref(); const b2 = vue.ref({ endDate: null, selecting: false }); const w2 = (e3) => { b2.value = e3; }; const x2 = (e3 = false) => { const t3 = vue.unref(g2); const n3 = vue.unref(y2); if (ab([t3, n3])) { l2("pick", [t3, n3], e3); } }; const k2 = (e3) => { b2.value.selecting = e3; if (!e3) { b2.value.endDate = null; } }; const C2 = (e3) => { if (xt(e3) && e3.length === 2) { const [t3, o3] = e3; g2.value = t3; n2.value = t3; y2.value = o3; r2(vue.unref(g2), vue.unref(y2)); } else { S2(); } }; const S2 = () => { const [r3, l3] = rb(vue.unref(t2), { lang: vue.unref(m2), unit: a2, unlinkPanels: e2.unlinkPanels }); g2.value = void 0; y2.value = void 0; n2.value = r3; o2.value = l3; }; vue.watch(t2, (e3) => { if (e3) { S2(); } }, { immediate: true }); vue.watch(() => e2.parsedValue, C2, { immediate: true }); return { minDate: g2, maxDate: y2, rangeState: b2, lang: m2, ppNs: c2, drpNs: d2, handleChangeRange: w2, handleRangeConfirm: x2, handleShortcutClick: h2, onSelect: k2, onReset: C2, t: f2 }; }; const Eb = "month"; const _b = vue.defineComponent({ __name: "panel-date-range", props: kb, emits: ["pick", "set-picker-option", "calendar-change", "panel-change"], setup(e2, { emit: a2 }) { const r2 = e2; const s2 = vue.inject("EP_PICKER_BASE"); const { disabledDate: c2, cellClassName: d2, defaultTime: f2, clearable: m2 } = s2.props; const h2 = vue.toRef(s2.props, "format"); const g2 = vue.toRef(s2.props, "shortcuts"); const y2 = vue.toRef(s2.props, "defaultValue"); const { lang: b2 } = Wu(); const w2 = vue.ref(ue().locale(b2.value)); const k2 = vue.ref(ue().locale(b2.value).add(1, Eb)); const { minDate: S2, maxDate: E2, rangeState: _2, ppNs: R2, drpNs: $2, handleChangeRange: N2, handleRangeConfirm: I2, handleShortcutClick: V2, onSelect: F2, onReset: j2, t: z2 } = Sb(r2, { defaultValue: y2, leftDate: w2, rightDate: k2, unit: Eb, onParsedValueChanged: Ne2 }); vue.watch(() => r2.visible, (e3) => { if (!e3 && _2.value.selecting) { j2(r2.parsedValue); F2(false); } }); const H2 = vue.ref({ min: null, max: null }); const W2 = vue.ref({ min: null, max: null }); const Y2 = vue.computed(() => `${w2.value.year()} ${z2("el.datepicker.year")} ${z2(`el.datepicker.month${w2.value.month() + 1}`)}`); const U2 = vue.computed(() => `${k2.value.year()} ${z2("el.datepicker.year")} ${z2(`el.datepicker.month${k2.value.month() + 1}`)}`); const K2 = vue.computed(() => w2.value.year()); const q2 = vue.computed(() => w2.value.month()); const Z2 = vue.computed(() => k2.value.year()); const J2 = vue.computed(() => k2.value.month()); const Q2 = vue.computed(() => !!g2.value.length); const ee2 = vue.computed(() => { if (H2.value.min !== null) return H2.value.min; if (S2.value) return S2.value.format(re2.value); return ""; }); const te2 = vue.computed(() => { if (H2.value.max !== null) return H2.value.max; if (E2.value || S2.value) return (E2.value || S2.value).format(re2.value); return ""; }); const ne2 = vue.computed(() => { if (W2.value.min !== null) return W2.value.min; if (S2.value) return S2.value.format(ae2.value); return ""; }); const oe2 = vue.computed(() => { if (W2.value.max !== null) return W2.value.max; if (E2.value || S2.value) return (E2.value || S2.value).format(ae2.value); return ""; }); const ae2 = vue.computed(() => r2.timeFormat || $h(h2.value)); const re2 = vue.computed(() => r2.dateFormat || Rh(h2.value)); const le2 = (e3) => ab(e3) && (c2 ? !c2(e3[0].toDate()) && !c2(e3[1].toDate()) : true); const se2 = () => { w2.value = w2.value.subtract(1, "year"); if (!r2.unlinkPanels) { k2.value = w2.value.add(1, "month"); } he2("year"); }; const ie2 = () => { w2.value = w2.value.subtract(1, "month"); if (!r2.unlinkPanels) { k2.value = w2.value.add(1, "month"); } he2("month"); }; const ce2 = () => { if (!r2.unlinkPanels) { w2.value = w2.value.add(1, "year"); k2.value = w2.value.add(1, "month"); } else { k2.value = k2.value.add(1, "year"); } he2("year"); }; const de2 = () => { if (!r2.unlinkPanels) { w2.value = w2.value.add(1, "month"); k2.value = w2.value.add(1, "month"); } else { k2.value = k2.value.add(1, "month"); } he2("month"); }; const fe2 = () => { w2.value = w2.value.add(1, "year"); he2("year"); }; const pe2 = () => { w2.value = w2.value.add(1, "month"); he2("month"); }; const ve2 = () => { k2.value = k2.value.subtract(1, "year"); he2("year"); }; const me2 = () => { k2.value = k2.value.subtract(1, "month"); he2("month"); }; const he2 = (e3) => { a2("panel-change", [w2.value.toDate(), k2.value.toDate()], e3); }; const ge2 = vue.computed(() => { const e3 = (q2.value + 1) % 12; const t2 = q2.value + 1 >= 12 ? 1 : 0; return r2.unlinkPanels && new Date(K2.value + t2, e3) < new Date(Z2.value, J2.value); }); const ye2 = vue.computed(() => r2.unlinkPanels && Z2.value * 12 + J2.value - (K2.value * 12 + q2.value + 1) >= 12); const be2 = vue.computed(() => !(S2.value && E2.value && !_2.value.selecting && ab([S2.value, E2.value]))); const we2 = vue.computed(() => r2.type === "datetime" || r2.type === "datetimerange"); const xe2 = (e3, t2) => { if (!e3) return; if (f2) { const n2 = ue(f2[t2] || f2).locale(b2.value); return n2.year(e3.year()).month(e3.month()).date(e3.date()); } return e3; }; const ke2 = (e3, t2 = true) => { const n2 = e3.minDate; const o2 = e3.maxDate; const r3 = xe2(n2, 0); const l2 = xe2(o2, 1); if (E2.value === l2 && S2.value === r3) { return; } a2("calendar-change", [n2.toDate(), o2 && o2.toDate()]); E2.value = l2; S2.value = r3; if (!t2 || we2.value) return; I2(); }; const Ce2 = vue.ref(false); const Se2 = vue.ref(false); const Ee2 = () => { Ce2.value = false; }; const _e2 = () => { Se2.value = false; }; const Oe2 = (e3, t2) => { H2.value[t2] = e3; const n2 = ue(e3, re2.value).locale(b2.value); if (n2.isValid()) { if (c2 && c2(n2.toDate())) { return; } if (t2 === "min") { w2.value = n2; S2.value = (S2.value || w2.value).year(n2.year()).month(n2.month()).date(n2.date()); if (!r2.unlinkPanels && (!E2.value || E2.value.isBefore(S2.value))) { k2.value = n2.add(1, "month"); E2.value = S2.value.add(1, "month"); } } else { k2.value = n2; E2.value = (E2.value || k2.value).year(n2.year()).month(n2.month()).date(n2.date()); if (!r2.unlinkPanels && (!S2.value || S2.value.isAfter(E2.value))) { w2.value = n2.subtract(1, "month"); S2.value = E2.value.subtract(1, "month"); } } } }; const Me2 = (e3, t2) => { H2.value[t2] = null; }; const Le2 = (e3, t2) => { W2.value[t2] = e3; const n2 = ue(e3, ae2.value).locale(b2.value); if (n2.isValid()) { if (t2 === "min") { Ce2.value = true; S2.value = (S2.value || w2.value).hour(n2.hour()).minute(n2.minute()).second(n2.second()); } else { Se2.value = true; E2.value = (E2.value || k2.value).hour(n2.hour()).minute(n2.minute()).second(n2.second()); k2.value = E2.value; } } }; const De2 = (e3, t2) => { W2.value[t2] = null; if (t2 === "min") { w2.value = S2.value; Ce2.value = false; if (!E2.value || E2.value.isBefore(S2.value)) { E2.value = S2.value; } } else { k2.value = E2.value; Se2.value = false; if (E2.value && E2.value.isBefore(S2.value)) { S2.value = E2.value; } } }; const Ae2 = (e3, t2, n2) => { if (W2.value.min) return; if (e3) { w2.value = e3; S2.value = (S2.value || w2.value).hour(e3.hour()).minute(e3.minute()).second(e3.second()); } if (!n2) { Ce2.value = t2; } if (!E2.value || E2.value.isBefore(S2.value)) { E2.value = S2.value; k2.value = e3; } }; const Re2 = (e3, t2, n2) => { if (W2.value.max) return; if (e3) { k2.value = e3; E2.value = (E2.value || k2.value).hour(e3.hour()).minute(e3.minute()).second(e3.second()); } if (!n2) { Se2.value = t2; } if (E2.value && E2.value.isBefore(S2.value)) { S2.value = E2.value; } }; const $e2 = () => { w2.value = rb(vue.unref(y2), { lang: vue.unref(b2), unit: "month", unlinkPanels: r2.unlinkPanels })[0]; k2.value = w2.value.add(1, "month"); E2.value = void 0; S2.value = void 0; a2("pick", null); }; const Te2 = (e3) => xt(e3) ? e3.map((e4) => e4.format(h2.value)) : e3.format(h2.value); const Pe2 = (e3) => xt(e3) ? e3.map((e4) => ue(e4, h2.value).locale(b2.value)) : ue(e3, h2.value).locale(b2.value); function Ne2(e3, t2) { if (r2.unlinkPanels && t2) { const n2 = (e3 == null ? void 0 : e3.year()) || 0; const o2 = (e3 == null ? void 0 : e3.month()) || 0; const a3 = t2.year(); const r3 = t2.month(); k2.value = n2 === a3 && o2 === r3 ? t2.add(1, Eb) : t2; } else { k2.value = w2.value.add(1, Eb); if (t2) { k2.value = k2.value.hour(t2.hour()).minute(t2.minute()).second(t2.second()); } } } a2("set-picker-option", ["isValidValue", le2]); a2("set-picker-option", ["parseUserInput", Pe2]); a2("set-picker-option", ["formatToString", Te2]); a2("set-picker-option", ["handleClear", $e2]); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(R2).b(), vue.unref($2).b(), { "has-sidebar": e3.$slots.sidebar || vue.unref(Q2), "has-time": vue.unref(we2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(R2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(R2).e("sidebar")) }), vue.unref(Q2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(R2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(g2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("button", { key: o2, type: "button", class: vue.normalizeClass(vue.unref(R2).e("shortcut")), onClick: (t2) => vue.unref(V2)(e4) }, vue.toDisplayString(e4.text), 11, ["onClick"]))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(R2).e("body")) }, [vue.unref(we2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref($2).e("time-header")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref($2).e("editors-wrap")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref($2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Sp), { size: "small", disabled: vue.unref(_2).selecting, placeholder: vue.unref(z2)("el.datepicker.startDate"), class: vue.normalizeClass(vue.unref($2).e("editor")), "model-value": vue.unref(ee2), "validate-event": false, onInput: (e4) => Oe2(e4, "min"), onChange: (e4) => Me2(e4, "min") }, null, 8, ["disabled", "placeholder", "class", "model-value", "onInput", "onChange"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref($2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Sp), { size: "small", class: vue.normalizeClass(vue.unref($2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(z2)("el.datepicker.startTime"), "model-value": vue.unref(ne2), "validate-event": false, onFocus: (e4) => Ce2.value = true, onInput: (e4) => Le2(e4, "min"), onChange: (e4) => De2(e4, "min") }, null, 8, ["class", "disabled", "placeholder", "model-value", "onFocus", "onInput", "onChange"]), vue.createVNode(vue.unref(Vg), { visible: Ce2.value, format: vue.unref(ae2), "datetime-role": "start", "parsed-value": w2.value, onPick: Ae2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(Qh), Ee2]])], 2), vue.createElementVNode("span", null, [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ci))]), _: 1 })]), vue.createElementVNode("span", { class: vue.normalizeClass([vue.unref($2).e("editors-wrap"), "is-right"]) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref($2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Sp), { size: "small", class: vue.normalizeClass(vue.unref($2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(z2)("el.datepicker.endDate"), "model-value": vue.unref(te2), readonly: !vue.unref(S2), "validate-event": false, onInput: (e4) => Oe2(e4, "max"), onChange: (e4) => Me2(e4, "max") }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly", "onInput", "onChange"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref($2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Sp), { size: "small", class: vue.normalizeClass(vue.unref($2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(z2)("el.datepicker.endTime"), "model-value": vue.unref(oe2), readonly: !vue.unref(S2), "validate-event": false, onFocus: (e4) => vue.unref(S2) && (Se2.value = true), onInput: (e4) => Le2(e4, "max"), onChange: (e4) => De2(e4, "max") }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly", "onFocus", "onInput", "onChange"]), vue.createVNode(vue.unref(Vg), { "datetime-role": "end", visible: Se2.value, format: vue.unref(ae2), "parsed-value": k2.value, onPick: Re2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(Qh), _e2]])], 2)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(R2).e("content"), vue.unref($2).e("content")], "is-left"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref($2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(R2).e("icon-btn"), "d-arrow-left"]), "aria-label": vue.unref(z2)(`el.datepicker.prevYear`), onClick: se2 }, [vue.renderSlot(e3.$slots, "prev-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })])], 10, ["aria-label"]), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(R2).e("icon-btn"), "arrow-left"]), "aria-label": vue.unref(z2)(`el.datepicker.prevMonth`), onClick: ie2 }, [vue.renderSlot(e3.$slots, "prev-month", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(xi))]), _: 1 })])], 10, ["aria-label"]), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(ye2), class: vue.normalizeClass([[vue.unref(R2).e("icon-btn"), { "is-disabled": !vue.unref(ye2) }], "d-arrow-right"]), "aria-label": vue.unref(z2)(`el.datepicker.nextYear`), onClick: fe2 }, [vue.renderSlot(e3.$slots, "next-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ji))]), _: 1 })])], 10, ["disabled", "aria-label"])) : vue.createCommentVNode("v-if", true), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 1, type: "button", disabled: !vue.unref(ge2), class: vue.normalizeClass([[vue.unref(R2).e("icon-btn"), { "is-disabled": !vue.unref(ge2) }], "arrow-right"]), "aria-label": vue.unref(z2)(`el.datepicker.nextMonth`), onClick: pe2 }, [vue.renderSlot(e3.$slots, "next-month", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ci))]), _: 1 })])], 10, ["disabled", "aria-label"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(Y2)), 1)], 2), vue.createVNode(pb, { "selection-mode": "range", date: w2.value, "min-date": vue.unref(S2), "max-date": vue.unref(E2), "range-state": vue.unref(_2), "disabled-date": vue.unref(c2), "cell-class-name": vue.unref(d2), onChangerange: vue.unref(N2), onPick: ke2, onSelect: vue.unref(F2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(R2).e("content"), vue.unref($2).e("content")], "is-right"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref($2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(ye2), class: vue.normalizeClass([[vue.unref(R2).e("icon-btn"), { "is-disabled": !vue.unref(ye2) }], "d-arrow-left"]), "aria-label": vue.unref(z2)(`el.datepicker.prevYear`), onClick: ve2 }, [vue.renderSlot(e3.$slots, "prev-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })])], 10, ["disabled", "aria-label"])) : vue.createCommentVNode("v-if", true), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 1, type: "button", disabled: !vue.unref(ge2), class: vue.normalizeClass([[vue.unref(R2).e("icon-btn"), { "is-disabled": !vue.unref(ge2) }], "arrow-left"]), "aria-label": vue.unref(z2)(`el.datepicker.prevMonth`), onClick: me2 }, [vue.renderSlot(e3.$slots, "prev-month", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(xi))]), _: 1 })])], 10, ["disabled", "aria-label"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(z2)(`el.datepicker.nextYear`), class: vue.normalizeClass([vue.unref(R2).e("icon-btn"), "d-arrow-right"]), onClick: ce2 }, [vue.renderSlot(e3.$slots, "next-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ji))]), _: 1 })])], 10, ["aria-label"]), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(R2).e("icon-btn"), "arrow-right"]), "aria-label": vue.unref(z2)(`el.datepicker.nextMonth`), onClick: de2 }, [vue.renderSlot(e3.$slots, "next-month", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ci))]), _: 1 })])], 10, ["aria-label"]), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(U2)), 1)], 2), vue.createVNode(pb, { "selection-mode": "range", date: k2.value, "min-date": vue.unref(S2), "max-date": vue.unref(E2), "range-state": vue.unref(_2), "disabled-date": vue.unref(c2), "cell-class-name": vue.unref(d2), onChangerange: vue.unref(N2), onPick: ke2, onSelect: vue.unref(F2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2)], 2)], 2), vue.unref(we2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(R2).e("footer")) }, [vue.unref(m2) ? (vue.openBlock(), vue.createBlock(vue.unref(wh), { key: 0, text: "", size: "small", class: vue.normalizeClass(vue.unref(R2).e("link-btn")), onClick: $e2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(z2)("el.datepicker.clear")), 1)]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.createVNode(vue.unref(wh), { plain: "", size: "small", class: vue.normalizeClass(vue.unref(R2).e("link-btn")), disabled: vue.unref(be2), onClick: (e4) => vue.unref(I2)(false) }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(z2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled", "onClick"])], 2)) : vue.createCommentVNode("v-if", true)], 2)); } }); var Ob = np(_b, [["__file", "panel-date-range.vue"]]); const Mb = fu({ ...Qy }); const Lb = ["pick", "set-picker-option", "calendar-change"]; const Db = ({ unlinkPanels: e2, leftDate: t2, rightDate: n2 }) => { const { t: o2 } = Wu(); const a2 = () => { t2.value = t2.value.subtract(1, "year"); if (!e2.value) { n2.value = n2.value.subtract(1, "year"); } }; const r2 = () => { if (!e2.value) { t2.value = t2.value.add(1, "year"); } n2.value = n2.value.add(1, "year"); }; const s2 = () => { t2.value = t2.value.add(1, "year"); }; const i2 = () => { n2.value = n2.value.subtract(1, "year"); }; const u2 = vue.computed(() => `${t2.value.year()} ${o2("el.datepicker.year")}`); const c2 = vue.computed(() => `${n2.value.year()} ${o2("el.datepicker.year")}`); const d2 = vue.computed(() => t2.value.year()); const f2 = vue.computed(() => n2.value.year() === t2.value.year() ? t2.value.year() + 1 : n2.value.year()); return { leftPrevYear: a2, rightNextYear: r2, leftNextYear: s2, rightPrevYear: i2, leftLabel: u2, rightLabel: c2, leftYear: d2, rightYear: f2 }; }; const Ab = "year"; const Rb = vue.defineComponent({ name: "DatePickerMonthRange" }); const $b = vue.defineComponent({ ...Rb, props: Mb, emits: Lb, setup(e2, { emit: a2 }) { const r2 = e2; const { lang: s2 } = Wu(); const i2 = vue.inject("EP_PICKER_BASE"); const { shortcuts: c2, disabledDate: d2 } = i2.props; const f2 = vue.toRef(i2.props, "format"); const m2 = vue.toRef(i2.props, "defaultValue"); const h2 = vue.ref(ue().locale(s2.value)); const g2 = vue.ref(ue().locale(s2.value).add(1, Ab)); const { minDate: y2, maxDate: b2, rangeState: w2, ppNs: k2, drpNs: S2, handleChangeRange: E2, handleRangeConfirm: _2, handleShortcutClick: D2, onSelect: R2 } = Sb(r2, { defaultValue: m2, leftDate: h2, rightDate: g2, unit: Ab, onParsedValueChanged: X2 }); const $2 = vue.computed(() => !!c2.length); const { leftPrevYear: N2, rightNextYear: I2, leftNextYear: B2, rightPrevYear: V2, leftLabel: F2, rightLabel: j2, leftYear: z2, rightYear: H2 } = Db({ unlinkPanels: vue.toRef(r2, "unlinkPanels"), leftDate: h2, rightDate: g2 }); const W2 = vue.computed(() => r2.unlinkPanels && H2.value > z2.value + 1); const Y2 = (e3, t2 = true) => { const n2 = e3.minDate; const o2 = e3.maxDate; if (b2.value === o2 && y2.value === n2) { return; } a2("calendar-change", [n2.toDate(), o2 && o2.toDate()]); b2.value = o2; y2.value = n2; if (!t2) return; _2(); }; const U2 = () => { h2.value = rb(vue.unref(m2), { lang: vue.unref(s2), unit: "year", unlinkPanels: r2.unlinkPanels })[0]; g2.value = h2.value.add(1, "year"); a2("pick", null); }; const K2 = (e3) => xt(e3) ? e3.map((e4) => e4.format(f2.value)) : e3.format(f2.value); const q2 = (e3) => xt(e3) ? e3.map((e4) => ue(e4, f2.value).locale(s2.value)) : ue(e3, f2.value).locale(s2.value); function X2(e3, t2) { if (r2.unlinkPanels && t2) { const n2 = (e3 == null ? void 0 : e3.year()) || 0; const o2 = t2.year(); g2.value = n2 === o2 ? t2.add(1, Ab) : t2; } else { g2.value = h2.value.add(1, Ab); } } a2("set-picker-option", ["isValidValue", ab]); a2("set-picker-option", ["formatToString", K2]); a2("set-picker-option", ["parseUserInput", q2]); a2("set-picker-option", ["handleClear", U2]); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(k2).b(), vue.unref(S2).b(), { "has-sidebar": Boolean(e3.$slots.sidebar) || vue.unref($2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(k2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(k2).e("sidebar")) }), vue.unref($2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(k2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(c2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("button", { key: o2, type: "button", class: vue.normalizeClass(vue.unref(k2).e("shortcut")), onClick: (t2) => vue.unref(D2)(e4) }, vue.toDisplayString(e4.text), 11, ["onClick"]))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(k2).e("body")) }, [vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(k2).e("content"), vue.unref(S2).e("content")], "is-left"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(S2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(k2).e("icon-btn"), "d-arrow-left"]), onClick: vue.unref(N2) }, [vue.renderSlot(e3.$slots, "prev-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })])], 10, ["onClick"]), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(W2), class: vue.normalizeClass([[vue.unref(k2).e("icon-btn"), { [vue.unref(k2).is("disabled")]: !vue.unref(W2) }], "d-arrow-right"]), onClick: vue.unref(B2) }, [vue.renderSlot(e3.$slots, "next-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ji))]), _: 1 })])], 10, ["disabled", "onClick"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(F2)), 1)], 2), vue.createVNode(hb, { "selection-mode": "range", date: h2.value, "min-date": vue.unref(y2), "max-date": vue.unref(b2), "range-state": vue.unref(w2), "disabled-date": vue.unref(d2), onChangerange: vue.unref(E2), onPick: Y2, onSelect: vue.unref(R2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(k2).e("content"), vue.unref(S2).e("content")], "is-right"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(S2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(W2), class: vue.normalizeClass([[vue.unref(k2).e("icon-btn"), { "is-disabled": !vue.unref(W2) }], "d-arrow-left"]), onClick: vue.unref(V2) }, [vue.renderSlot(e3.$slots, "prev-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })])], 10, ["disabled", "onClick"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(k2).e("icon-btn"), "d-arrow-right"]), onClick: vue.unref(I2) }, [vue.renderSlot(e3.$slots, "next-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ji))]), _: 1 })])], 10, ["onClick"]), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(j2)), 1)], 2), vue.createVNode(hb, { "selection-mode": "range", date: g2.value, "min-date": vue.unref(y2), "max-date": vue.unref(b2), "range-state": vue.unref(w2), "disabled-date": vue.unref(d2), onChangerange: vue.unref(E2), onPick: Y2, onSelect: vue.unref(R2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2)], 2)], 2)], 2)); } }); var Tb = np($b, [["__file", "panel-month-range.vue"]]); const Pb = fu({ ...Qy }); const Nb = ["pick", "set-picker-option", "calendar-change"]; const Ib = ({ unlinkPanels: e2, leftDate: t2, rightDate: n2 }) => { const o2 = () => { t2.value = t2.value.subtract(10, "year"); if (!e2.value) { n2.value = n2.value.subtract(10, "year"); } }; const a2 = () => { if (!e2.value) { t2.value = t2.value.add(10, "year"); } n2.value = n2.value.add(10, "year"); }; const r2 = () => { t2.value = t2.value.add(10, "year"); }; const s2 = () => { n2.value = n2.value.subtract(10, "year"); }; const i2 = vue.computed(() => { const e3 = Math.floor(t2.value.year() / 10) * 10; return `${e3}-${e3 + 9}`; }); const u2 = vue.computed(() => { const e3 = Math.floor(n2.value.year() / 10) * 10; return `${e3}-${e3 + 9}`; }); const c2 = vue.computed(() => { const e3 = Math.floor(t2.value.year() / 10) * 10 + 9; return e3; }); const d2 = vue.computed(() => { const e3 = Math.floor(n2.value.year() / 10) * 10; return e3; }); return { leftPrevYear: o2, rightNextYear: a2, leftNextYear: r2, rightPrevYear: s2, leftLabel: i2, rightLabel: u2, leftYear: c2, rightYear: d2 }; }; const Bb = "year"; const Vb = vue.defineComponent({ name: "DatePickerYearRange" }); const Fb = vue.defineComponent({ ...Vb, props: Pb, emits: Nb, setup(e2, { emit: a2 }) { const r2 = e2; const { lang: s2 } = Wu(); const c2 = vue.ref(ue().locale(s2.value)); const d2 = vue.ref(c2.value.add(10, "year")); const { pickerNs: f2 } = vue.inject(qy); const m2 = Xu("date-range-picker"); const h2 = vue.computed(() => !!K2.length); const g2 = vue.computed(() => [f2.b(), m2.b(), { "has-sidebar": Boolean(vue.useSlots().sidebar) || h2.value }]); const y2 = vue.computed(() => ({ content: [f2.e("content"), m2.e("content"), "is-left"], arrowLeftBtn: [f2.e("icon-btn"), "d-arrow-left"], arrowRightBtn: [f2.e("icon-btn"), { [f2.is("disabled")]: !B2.value }, "d-arrow-right"] })); const b2 = vue.computed(() => ({ content: [f2.e("content"), m2.e("content"), "is-right"], arrowLeftBtn: [f2.e("icon-btn"), { "is-disabled": !B2.value }, "d-arrow-left"], arrowRightBtn: [f2.e("icon-btn"), "d-arrow-right"] })); const w2 = Cb(s2); const { leftPrevYear: k2, rightNextYear: S2, leftNextYear: E2, rightPrevYear: D2, leftLabel: R2, rightLabel: $2, leftYear: N2, rightYear: I2 } = Ib({ unlinkPanels: vue.toRef(r2, "unlinkPanels"), leftDate: c2, rightDate: d2 }); const B2 = vue.computed(() => r2.unlinkPanels && I2.value > N2.value + 1); const V2 = vue.ref(); const F2 = vue.ref(); const j2 = vue.ref({ endDate: null, selecting: false }); const z2 = (e3) => { j2.value = e3; }; const H2 = (e3, t2 = true) => { const n2 = e3.minDate; const o2 = e3.maxDate; if (F2.value === o2 && V2.value === n2) { return; } a2("calendar-change", [n2.toDate(), o2 && o2.toDate()]); F2.value = o2; V2.value = n2; if (!t2) return; W2(); }; const W2 = (e3 = false) => { if (ab([V2.value, F2.value])) { a2("pick", [V2.value, F2.value], e3); } }; const Y2 = (e3) => { j2.value.selecting = e3; if (!e3) { j2.value.endDate = null; } }; const U2 = vue.inject("EP_PICKER_BASE"); const { shortcuts: K2, disabledDate: q2 } = U2.props; const X2 = vue.toRef(U2.props, "format"); const Z2 = vue.toRef(U2.props, "defaultValue"); const J2 = () => { let e3; if (xt(Z2.value)) { const e4 = ue(Z2.value[0]); let t2 = ue(Z2.value[1]); if (!r2.unlinkPanels) { t2 = e4.add(10, Bb); } return [e4, t2]; } else if (Z2.value) { e3 = ue(Z2.value); } else { e3 = ue(); } e3 = e3.locale(s2.value); return [e3, e3.add(10, Bb)]; }; vue.watch(() => Z2.value, (e3) => { if (e3) { const e4 = J2(); c2.value = e4[0]; d2.value = e4[1]; } }, { immediate: true }); vue.watch(() => r2.parsedValue, (e3) => { if (e3 && e3.length === 2) { V2.value = e3[0]; F2.value = e3[1]; c2.value = V2.value; if (r2.unlinkPanels && F2.value) { const e4 = V2.value.year(); const t2 = F2.value.year(); d2.value = e4 === t2 ? F2.value.add(10, "year") : F2.value; } else { d2.value = c2.value.add(10, "year"); } } else { const e4 = J2(); V2.value = void 0; F2.value = void 0; c2.value = e4[0]; d2.value = e4[1]; } }, { immediate: true }); const Q2 = (e3) => xt(e3) ? e3.map((e4) => ue(e4, X2.value).locale(s2.value)) : ue(e3, X2.value).locale(s2.value); const ee2 = (e3) => xt(e3) ? e3.map((e4) => e4.format(X2.value)) : e3.format(X2.value); const te2 = (e3) => ab(e3) && (q2 ? !q2(e3[0].toDate()) && !q2(e3[1].toDate()) : true); const ne2 = () => { const e3 = J2(); c2.value = e3[0]; d2.value = e3[1]; F2.value = void 0; V2.value = void 0; a2("pick", null); }; a2("set-picker-option", ["isValidValue", te2]); a2("set-picker-option", ["parseUserInput", Q2]); a2("set-picker-option", ["formatToString", ee2]); a2("set-picker-option", ["handleClear", ne2]); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(vue.unref(g2)) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(f2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(f2).e("sidebar")) }), vue.unref(h2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(f2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(K2), (e4, o2) => (vue.openBlock(), vue.createElementBlock("button", { key: o2, type: "button", class: vue.normalizeClass(vue.unref(f2).e("shortcut")), onClick: (t2) => vue.unref(w2)(e4) }, vue.toDisplayString(e4.text), 11, ["onClick"]))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(f2).e("body")) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(y2).content) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(m2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass(vue.unref(y2).arrowLeftBtn), onClick: vue.unref(k2) }, [vue.renderSlot(e3.$slots, "prev-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })])], 10, ["onClick"]), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(B2), class: vue.normalizeClass(vue.unref(y2).arrowRightBtn), onClick: vue.unref(E2) }, [vue.renderSlot(e3.$slots, "next-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ji))]), _: 1 })])], 10, ["disabled", "onClick"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(R2)), 1)], 2), vue.createVNode(bb, { "selection-mode": "range", date: c2.value, "min-date": V2.value, "max-date": F2.value, "range-state": j2.value, "disabled-date": vue.unref(q2), onChangerange: z2, onPick: H2, onSelect: Y2 }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(b2).content) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(m2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(B2), class: vue.normalizeClass(vue.unref(b2).arrowLeftBtn), onClick: vue.unref(D2) }, [vue.renderSlot(e3.$slots, "prev-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Vi))]), _: 1 })])], 10, ["disabled", "onClick"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass(vue.unref(b2).arrowRightBtn), onClick: vue.unref(S2) }, [vue.renderSlot(e3.$slots, "next-year", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ji))]), _: 1 })])], 10, ["onClick"]), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref($2)), 1)], 2), vue.createVNode(bb, { "selection-mode": "range", date: d2.value, "min-date": V2.value, "max-date": F2.value, "range-state": j2.value, "disabled-date": vue.unref(q2), onChangerange: z2, onPick: H2, onSelect: Y2 }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date"])], 2)], 2)], 2)], 2)); } }); var jb = np(Fb, [["__file", "panel-year-range.vue"]]); const zb = function(e2) { switch (e2) { case "daterange": case "datetimerange": { return Ob; } case "monthrange": { return Tb; } case "yearrange": { return jb; } default: { return xb; } } }; ue.extend(zg); ue.extend(Ry); ue.extend(Eh); ue.extend(Py); ue.extend(By); ue.extend(jy); ue.extend(Wy); ue.extend(Ky); var Hb = vue.defineComponent({ name: "ElDatePicker", install: null, props: Gy, emits: ["update:modelValue"], setup(e2, { expose: t2, emit: n2, slots: o2 }) { const a2 = Xu("picker-panel"); vue.provide("ElPopperOptions", vue.reactive(vue.toRef(e2, "popperOptions"))); vue.provide(qy, { slots: o2, pickerNs: a2 }); const r2 = vue.ref(); const l2 = { focus: (e3 = true) => { var t3; (t3 = r2.value) == null ? void 0 : t3.focus(e3); }, handleOpen: () => { var e3; (e3 = r2.value) == null ? void 0 : e3.handleOpen(); }, handleClose: () => { var e3; (e3 = r2.value) == null ? void 0 : e3.handleClose(); } }; t2(l2); const s2 = (e3) => { n2("update:modelValue", e3); }; return () => { var t3; const n3 = (t3 = e2.format) != null ? t3 : Lh[e2.type] || Mh; const a3 = zb(e2.type); return vue.createVNode(Wh, vue.mergeProps(e2, { format: n3, type: e2.type, ref: r2, "onUpdate:modelValue": s2 }), { default: (e3) => vue.createVNode(a3, e3, { "prev-month": o2["prev-month"], "next-month": o2["next-month"], "prev-year": o2["prev-year"], "next-year": o2["next-year"] }), "range-separator": o2["range-separator"] }); }; } }); const Wb = yu(Hb); const Yb = fu({ mask: { type: Boolean, default: true }, customMaskEvent: Boolean, overlayClass: { type: uu([String, Array, Object]) }, zIndex: { type: uu([String, Number]) } }); const Ub = { click: (e2) => e2 instanceof MouseEvent }; const Kb = "overlay"; var qb = vue.defineComponent({ name: "ElOverlay", props: Yb, emits: Ub, setup(e2, { slots: t2, emit: n2 }) { const o2 = Xu(Kb); const a2 = (e3) => { n2("click", e3); }; const { onClick: r2, onMousedown: l2, onMouseup: s2 } = cf(e2.customMaskEvent ? void 0 : a2); return () => e2.mask ? vue.createVNode("div", { class: [o2.b(), e2.overlayClass], style: { zIndex: e2.zIndex }, onClick: r2, onMousedown: l2, onMouseup: s2 }, [vue.renderSlot(t2, "default")], Lu.STYLE | Lu.CLASS | Lu.PROPS, ["onClick", "onMouseup", "onMousedown"]) : vue.h("div", { class: e2.overlayClass, style: { zIndex: e2.zIndex, position: "fixed", top: "0px", right: "0px", bottom: "0px", left: "0px" } }, [vue.renderSlot(t2, "default")]); } }); const Gb = qb; const Xb = Symbol("dialogInjectionKey"); const Zb = fu({ center: Boolean, alignCenter: Boolean, closeIcon: { type: pu }, draggable: Boolean, overflow: Boolean, fullscreen: Boolean, showClose: { type: Boolean, default: true }, title: { type: String, default: "" }, ariaLevel: { type: String, default: "2" } }); const Jb = { close: () => true }; const Qb = vue.defineComponent({ name: "ElDialogContent" }); const ew = vue.defineComponent({ ...Qb, props: Zb, emits: Jb, setup(e2, { expose: a2 }) { const r2 = e2; const { t: s2 } = Wu(); const { Close: i2 } = vu; const { dialogRef: c2, headerRef: d2, bodyId: f2, ns: v2, style: m2 } = vue.inject(Xb); const { focusTrapRef: h2 } = vue.inject(mv); const g2 = vue.computed(() => [v2.b(), v2.is("fullscreen", r2.fullscreen), v2.is("draggable", r2.draggable), v2.is("align-center", r2.alignCenter), { [v2.m("center")]: r2.center }]); const y2 = xu(h2, c2); const b2 = vue.computed(() => r2.draggable); const w2 = vue.computed(() => r2.overflow); const { resetPostion: k2 } = Bu(c2, d2, b2, w2); a2({ resetPostion: k2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { ref: vue.unref(y2), class: vue.normalizeClass(vue.unref(g2)), style: vue.normalizeStyle(vue.unref(m2)), tabindex: "-1" }, [vue.createElementVNode("header", { ref_key: "headerRef", ref: d2, class: vue.normalizeClass([vue.unref(v2).e("header"), { "show-close": e3.showClose }]) }, [vue.renderSlot(e3.$slots, "header", {}, () => [vue.createElementVNode("span", { role: "heading", "aria-level": e3.ariaLevel, class: vue.normalizeClass(vue.unref(v2).e("title")) }, vue.toDisplayString(e3.title), 11, ["aria-level"])]), e3.showClose ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, "aria-label": vue.unref(s2)("el.dialog.close"), class: vue.normalizeClass(vue.unref(v2).e("headerbtn")), type: "button", onClick: (t2) => e3.$emit("close") }, [vue.createVNode(vue.unref(sp), { class: vue.normalizeClass(vue.unref(v2).e("close")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.closeIcon || vue.unref(i2))))]), _: 1 }, 8, ["class"])], 10, ["aria-label", "onClick"])) : vue.createCommentVNode("v-if", true)], 2), vue.createElementVNode("div", { id: vue.unref(f2), class: vue.normalizeClass(vue.unref(v2).e("body")) }, [vue.renderSlot(e3.$slots, "default")], 10, ["id"]), e3.$slots.footer ? (vue.openBlock(), vue.createElementBlock("footer", { key: 0, class: vue.normalizeClass(vue.unref(v2).e("footer")) }, [vue.renderSlot(e3.$slots, "footer")], 2)) : vue.createCommentVNode("v-if", true)], 6)); } }); var tw = np(ew, [["__file", "dialog-content.vue"]]); const nw = fu({ ...Zb, appendToBody: Boolean, appendTo: { type: uu([String, Object]), default: "body" }, beforeClose: { type: uu(Function) }, destroyOnClose: Boolean, closeOnClickModal: { type: Boolean, default: true }, closeOnPressEscape: { type: Boolean, default: true }, lockScroll: { type: Boolean, default: true }, modal: { type: Boolean, default: true }, openDelay: { type: Number, default: 0 }, closeDelay: { type: Number, default: 0 }, top: { type: String }, modelValue: Boolean, modalClass: String, width: { type: [String, Number] }, zIndex: { type: Number }, trapFocus: Boolean, headerAriaLevel: { type: String, default: "2" } }); const ow = { open: () => true, opened: () => true, close: () => true, closed: () => true, [Su]: (e2) => Zs(e2), openAutoFocus: () => true, closeAutoFocus: () => true }; const aw = (e2, t2) => { var n2; const o2 = vue.getCurrentInstance(); const a2 = o2.emit; const { nextZIndex: r2 } = $f(); let u2 = ""; const d2 = mf(); const f2 = mf(); const p2 = vue.ref(false); const m2 = vue.ref(false); const h2 = vue.ref(false); const g2 = vue.ref((n2 = e2.zIndex) != null ? n2 : r2()); let y2 = void 0; let b2 = void 0; const x2 = Xf("namespace", Yu); const k2 = vue.computed(() => { const t3 = {}; const n3 = `--${x2.value}-dialog`; if (!e2.fullscreen) { if (e2.top) { t3[`${n3}-margin-top`] = e2.top; } if (e2.width) { t3[`${n3}-width`] = mi(e2.width); } } return t3; }); const C2 = vue.computed(() => { if (e2.alignCenter) { return { display: "flex" }; } return {}; }); function S2() { a2("opened"); } function E2() { a2("closed"); a2(Su, false); if (e2.destroyOnClose) { h2.value = false; } } function _2() { a2("close"); } function O2() { b2 == null ? void 0 : b2(); y2 == null ? void 0 : y2(); if (e2.openDelay && e2.openDelay > 0) { ({ stop: y2 } = Ue(() => A2(), e2.openDelay)); } else { A2(); } } function M2() { y2 == null ? void 0 : y2(); b2 == null ? void 0 : b2(); if (e2.closeDelay && e2.closeDelay > 0) { ({ stop: b2 } = Ue(() => R2(), e2.closeDelay)); } else { R2(); } } function L2() { function t3(e3) { if (e3) return; m2.value = true; p2.value = false; } if (e2.beforeClose) { e2.beforeClose(t3); } else { M2(); } } function D2() { if (e2.closeOnClickModal) { L2(); } } function A2() { if (!Be) return; p2.value = true; } function R2() { p2.value = false; } function $2() { a2("openAutoFocus"); } function T2() { a2("closeAutoFocus"); } function P2(e3) { var t3; if (((t3 = e3.detail) == null ? void 0 : t3.focusReason) === "pointer") { e3.preventDefault(); } } if (e2.lockScroll) { Zu(p2); } function N2() { if (e2.closeOnPressEscape) { L2(); } } vue.watch(() => e2.modelValue, (n3) => { if (n3) { m2.value = false; O2(); h2.value = true; g2.value = Hs(e2.zIndex) ? r2() : g2.value++; vue.nextTick(() => { a2("open"); if (t2.value) { t2.value.scrollTop = 0; } }); } else { if (p2.value) { M2(); } } }); vue.watch(() => e2.fullscreen, (e3) => { if (!t2.value) return; if (e3) { u2 = t2.value.style.transform; t2.value.style.transform = ""; } else { t2.value.style.transform = u2; } }); vue.onMounted(() => { if (e2.modelValue) { p2.value = true; h2.value = true; O2(); } }); return { afterEnter: S2, afterLeave: E2, beforeLeave: _2, handleClose: L2, onModalClick: D2, close: M2, doClose: R2, onOpenAutoFocus: $2, onCloseAutoFocus: T2, onCloseRequested: N2, onFocusoutPrevented: P2, titleId: d2, bodyId: f2, closed: m2, style: k2, overlayDialogStyle: C2, rendered: h2, visible: p2, zIndex: g2 }; }; const rw = vue.defineComponent({ name: "ElDialog", inheritAttrs: false }); const lw = vue.defineComponent({ ...rw, props: nw, emits: ow, setup(e2, { expose: n2 }) { const a2 = e2; const r2 = vue.useSlots(); Iu({ scope: "el-dialog", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/dialog.html#slots" }, vue.computed(() => !!r2.title)); const s2 = Xu("dialog"); const i2 = vue.ref(); const c2 = vue.ref(); const d2 = vue.ref(); const { visible: f2, titleId: p2, bodyId: m2, style: h2, overlayDialogStyle: g2, rendered: y2, zIndex: w2, afterEnter: C2, afterLeave: S2, beforeLeave: E2, handleClose: M2, onModalClick: R2, onOpenAutoFocus: $2, onCloseAutoFocus: P2, onCloseRequested: F2, onFocusoutPrevented: j2 } = aw(a2, i2); vue.provide(Xb, { dialogRef: i2, headerRef: c2, bodyId: m2, ns: s2, rendered: y2, style: h2 }); const z2 = cf(R2); const H2 = vue.computed(() => a2.draggable && !a2.fullscreen); const W2 = () => { d2.value.resetPostion(); }; n2({ visible: f2, dialogContentRef: d2, resetPostion: W2 }); return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.unref(hm), { to: e3.appendTo, disabled: e3.appendTo !== "body" ? false : !e3.appendToBody }, { default: vue.withCtx(() => [vue.createVNode(vue.Transition, { name: "dialog-fade", onAfterEnter: vue.unref(C2), onAfterLeave: vue.unref(S2), onBeforeLeave: vue.unref(E2), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode(vue.unref(Gb), { "custom-mask-event": "", mask: e3.modal, "overlay-class": e3.modalClass, "z-index": vue.unref(w2) }, { default: vue.withCtx(() => [vue.createElementVNode("div", { role: "dialog", "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? vue.unref(p2) : void 0, "aria-describedby": vue.unref(m2), class: vue.normalizeClass(`${vue.unref(s2).namespace.value}-overlay-dialog`), style: vue.normalizeStyle(vue.unref(g2)), onClick: vue.unref(z2).onClick, onMousedown: vue.unref(z2).onMousedown, onMouseup: vue.unref(z2).onMouseup }, [vue.createVNode(vue.unref(Iv), { loop: "", trapped: vue.unref(f2), "focus-start-el": "container", onFocusAfterTrapped: vue.unref($2), onFocusAfterReleased: vue.unref(P2), onFocusoutPrevented: vue.unref(j2), onReleaseRequested: vue.unref(F2) }, { default: vue.withCtx(() => [vue.unref(y2) ? (vue.openBlock(), vue.createBlock(tw, vue.mergeProps({ key: 0, ref_key: "dialogContentRef", ref: d2 }, e3.$attrs, { center: e3.center, "align-center": e3.alignCenter, "close-icon": e3.closeIcon, draggable: vue.unref(H2), overflow: e3.overflow, fullscreen: e3.fullscreen, "show-close": e3.showClose, title: e3.title, "aria-level": e3.headerAriaLevel, onClose: vue.unref(M2) }), vue.createSlots({ header: vue.withCtx(() => [!e3.$slots.title ? vue.renderSlot(e3.$slots, "header", { key: 0, close: vue.unref(M2), titleId: vue.unref(p2), titleClass: vue.unref(s2).e("title") }) : vue.renderSlot(e3.$slots, "title", { key: 1 })]), default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 2 }, [e3.$slots.footer ? { name: "footer", fn: vue.withCtx(() => [vue.renderSlot(e3.$slots, "footer")]) } : void 0]), 1040, ["center", "align-center", "close-icon", "draggable", "overflow", "fullscreen", "show-close", "title", "aria-level", "onClose"])) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["trapped", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])], 46, ["aria-label", "aria-labelledby", "aria-describedby", "onClick", "onMousedown", "onMouseup"])]), _: 3 }, 8, ["mask", "overlay-class", "z-index"]), [[vue.vShow, vue.unref(f2)]])]), _: 3 }, 8, ["onAfterEnter", "onAfterLeave", "onBeforeLeave"])]), _: 3 }, 8, ["to", "disabled"])); } }); var sw = np(lw, [["__file", "dialog.vue"]]); const iw = yu(sw); const uw = fu({ direction: { type: String, values: ["horizontal", "vertical"], default: "horizontal" }, contentPosition: { type: String, values: ["left", "center", "right"], default: "center" }, borderStyle: { type: uu(String), default: "solid" } }); const cw = vue.defineComponent({ name: "ElDivider" }); const dw = vue.defineComponent({ ...cw, props: uw, setup(e2) { const o2 = e2; const a2 = Xu("divider"); const r2 = vue.computed(() => a2.cssVar({ "border-style": o2.borderStyle })); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(a2).b(), vue.unref(a2).m(e3.direction)]), style: vue.normalizeStyle(vue.unref(r2)), role: "separator" }, [e3.$slots.default && e3.direction !== "vertical" ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass([vue.unref(a2).e("text"), vue.unref(a2).is(e3.contentPosition)]) }, [vue.renderSlot(e3.$slots, "default")], 2)) : vue.createCommentVNode("v-if", true)], 6)); } }); var fw = np(dw, [["__file", "divider.vue"]]); const pw = yu(fw); const vw = fu({ ...nw, direction: { type: String, default: "rtl", values: ["ltr", "rtl", "ttb", "btt"] }, size: { type: [String, Number], default: "30%" }, withHeader: { type: Boolean, default: true }, modalFade: { type: Boolean, default: true }, headerAriaLevel: { type: String, default: "2" } }); const mw = ow; const hw = vue.defineComponent({ name: "ElDrawer", inheritAttrs: false }); const gw = vue.defineComponent({ ...hw, props: vw, emits: mw, setup(e2, { expose: a2 }) { const r2 = e2; const s2 = vue.useSlots(); Iu({ scope: "el-drawer", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/drawer.html#slots" }, vue.computed(() => !!s2.title)); const i2 = vue.ref(); const c2 = vue.ref(); const d2 = Xu("drawer"); const { t: f2 } = Wu(); const { afterEnter: p2, afterLeave: m2, beforeLeave: h2, visible: g2, rendered: y2, titleId: b2, bodyId: w2, zIndex: C2, onModalClick: S2, onOpenAutoFocus: E2, onCloseAutoFocus: M2, onFocusoutPrevented: R2, onCloseRequested: N2, handleClose: F2 } = aw(r2, i2); const j2 = vue.computed(() => r2.direction === "rtl" || r2.direction === "ltr"); const z2 = vue.computed(() => mi(r2.size)); a2({ handleClose: F2, afterEnter: p2, afterLeave: m2 }); return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.unref(hm), { to: e3.appendTo, disabled: e3.appendTo !== "body" ? false : !e3.appendToBody }, { default: vue.withCtx(() => [vue.createVNode(vue.Transition, { name: vue.unref(d2).b("fade"), onAfterEnter: vue.unref(p2), onAfterLeave: vue.unref(m2), onBeforeLeave: vue.unref(h2), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode(vue.unref(Gb), { mask: e3.modal, "overlay-class": e3.modalClass, "z-index": vue.unref(C2), onClick: vue.unref(S2) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Iv), { loop: "", trapped: vue.unref(g2), "focus-trap-el": i2.value, "focus-start-el": c2.value, onFocusAfterTrapped: vue.unref(E2), onFocusAfterReleased: vue.unref(M2), onFocusoutPrevented: vue.unref(R2), onReleaseRequested: vue.unref(N2) }, { default: vue.withCtx(() => [vue.createElementVNode("div", vue.mergeProps({ ref_key: "drawerRef", ref: i2, "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? vue.unref(b2) : void 0, "aria-describedby": vue.unref(w2) }, e3.$attrs, { class: [vue.unref(d2).b(), e3.direction, vue.unref(g2) && "open"], style: vue.unref(j2) ? "width: " + vue.unref(z2) : "height: " + vue.unref(z2), role: "dialog", onClick: vue.withModifiers(() => { }, ["stop"]) }), [vue.createElementVNode("span", { ref_key: "focusStartRef", ref: c2, class: vue.normalizeClass(vue.unref(d2).e("sr-focus")), tabindex: "-1" }, null, 2), e3.withHeader ? (vue.openBlock(), vue.createElementBlock("header", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("header")) }, [!e3.$slots.title ? vue.renderSlot(e3.$slots, "header", { key: 0, close: vue.unref(F2), titleId: vue.unref(b2), titleClass: vue.unref(d2).e("title") }, () => [!e3.$slots.title ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, id: vue.unref(b2), role: "heading", "aria-level": e3.headerAriaLevel, class: vue.normalizeClass(vue.unref(d2).e("title")) }, vue.toDisplayString(e3.title), 11, ["id", "aria-level"])) : vue.createCommentVNode("v-if", true)]) : vue.renderSlot(e3.$slots, "title", { key: 1 }, () => [vue.createCommentVNode(" DEPRECATED SLOT ")]), e3.showClose ? (vue.openBlock(), vue.createElementBlock("button", { key: 2, "aria-label": vue.unref(f2)("el.drawer.close"), class: vue.normalizeClass(vue.unref(d2).e("close-btn")), type: "button", onClick: vue.unref(F2) }, [vue.createVNode(vue.unref(sp), { class: vue.normalizeClass(vue.unref(d2).e("close")) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ii))]), _: 1 }, 8, ["class"])], 10, ["aria-label", "onClick"])) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.unref(y2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, id: vue.unref(w2), class: vue.normalizeClass(vue.unref(d2).e("body")) }, [vue.renderSlot(e3.$slots, "default")], 10, ["id"])) : vue.createCommentVNode("v-if", true), e3.$slots.footer ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass(vue.unref(d2).e("footer")) }, [vue.renderSlot(e3.$slots, "footer")], 2)) : vue.createCommentVNode("v-if", true)], 16, ["aria-label", "aria-labelledby", "aria-describedby", "onClick"])]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])]), _: 3 }, 8, ["mask", "overlay-class", "z-index", "onClick"]), [[vue.vShow, vue.unref(g2)]])]), _: 3 }, 8, ["name", "onAfterEnter", "onAfterLeave", "onBeforeLeave"])]), _: 3 }, 8, ["to", "disabled"])); } }); var yw = np(gw, [["__file", "drawer.vue"]]); const bw = yu(yw); const ww = fu({ id: { type: String, default: void 0 }, step: { type: Number, default: 1 }, stepStrictly: Boolean, max: { type: Number, default: Number.POSITIVE_INFINITY }, min: { type: Number, default: Number.NEGATIVE_INFINITY }, modelValue: Number, readonly: Boolean, disabled: Boolean, size: If, controls: { type: Boolean, default: true }, controlsPosition: { type: String, default: "", values: ["", "right"] }, valueOnClear: { type: [String, Number, null], validator: (e2) => e2 === null || Js(e2) || ["min", "max"].includes(e2), default: null }, name: String, placeholder: String, precision: { type: Number, validator: (e2) => e2 >= 0 && e2 === Number.parseInt(`${e2}`, 10) }, validateEvent: { type: Boolean, default: true }, ...Kf(["ariaLabel"]) }); const xw = { [Eu]: (e2, t2) => t2 !== e2, blur: (e2) => e2 instanceof FocusEvent, focus: (e2) => e2 instanceof FocusEvent, [_u]: (e2) => Js(e2) || zs(e2), [Su]: (e2) => Js(e2) || zs(e2) }; const kw = vue.defineComponent({ name: "ElInputNumber" }); const Cw = vue.defineComponent({ ...kw, props: ww, emits: xw, setup(e2, { expose: o2, emit: a2 }) { const r2 = e2; const { t: s2 } = Wu(); const d2 = Xu("input-number"); const f2 = vue.ref(); const p2 = vue.reactive({ currentValue: r2.modelValue, userInput: null }); const { formItem: m2 } = fp(); const h2 = vue.computed(() => Js(r2.modelValue) && r2.modelValue <= r2.min); const g2 = vue.computed(() => Js(r2.modelValue) && r2.modelValue >= r2.max); const y2 = vue.computed(() => { const e3 = E2(r2.step); if (!Xs(r2.precision)) { if (e3 > r2.precision) ; return r2.precision; } else { return Math.max(E2(r2.modelValue), e3); } }); const b2 = vue.computed(() => r2.controls && r2.controlsPosition === "right"); const w2 = cp(); const k2 = dp(); const C2 = vue.computed(() => { if (p2.userInput !== null) { return p2.userInput; } let e3 = p2.currentValue; if (zs(e3)) return ""; if (Js(e3)) { if (Number.isNaN(e3)) return ""; if (!Xs(r2.precision)) { e3 = e3.toFixed(r2.precision); } } return e3; }); const S2 = (e3, t2) => { if (Xs(t2)) t2 = y2.value; if (t2 === 0) return Math.round(e3); let n2 = String(e3); const o3 = n2.indexOf("."); if (o3 === -1) return e3; const a3 = n2.replace(".", "").split(""); const r3 = a3[o3 + t2]; if (!r3) return e3; const l2 = n2.length; if (n2.charAt(l2 - 1) === "5") { n2 = `${n2.slice(0, Math.max(0, l2 - 1))}6`; } return Number.parseFloat(Number(n2).toFixed(t2)); }; const E2 = (e3) => { if (zs(e3)) return 0; const t2 = e3.toString(); const n2 = t2.indexOf("."); let o3 = 0; if (n2 !== -1) { o3 = t2.length - n2 - 1; } return o3; }; const _2 = (e3, t2 = 1) => { if (!Js(e3)) return p2.currentValue; return S2(e3 + r2.step * t2); }; const M2 = () => { if (r2.readonly || k2.value || g2.value) return; const e3 = Number(C2.value) || 0; const t2 = _2(e3); N2(t2); a2(_u, p2.currentValue); U2(); }; const R2 = () => { if (r2.readonly || k2.value || h2.value) return; const e3 = Number(C2.value) || 0; const t2 = _2(e3, -1); N2(t2); a2(_u, p2.currentValue); U2(); }; const P2 = (e3, t2) => { const { max: n2, min: o3, step: l2, precision: s3, stepStrictly: i2, valueOnClear: u2 } = r2; if (n2 < o3) { ii("InputNumber", "min should not be greater than max."); } let c2 = Number(e3); if (zs(e3) || Number.isNaN(c2)) { return null; } if (e3 === "") { if (u2 === null) { return null; } c2 = St(u2) ? { min: o3, max: n2 }[u2] : u2; } if (i2) { c2 = S2(Math.round(c2 / l2) * l2, s3); } if (!Xs(s3)) { c2 = S2(c2, s3); } if (c2 > n2 || c2 < o3) { c2 = c2 > n2 ? n2 : o3; t2 && a2(Su, c2); } return c2; }; const N2 = (e3, t2 = true) => { var n2; const o3 = p2.currentValue; const l2 = P2(e3); if (!t2) { a2(Su, l2); return; } if (o3 === l2 && e3) return; p2.userInput = null; a2(Su, l2); if (o3 !== l2) { a2(Eu, l2, o3); } if (r2.validateEvent) { (n2 = m2 == null ? void 0 : m2.validate) == null ? void 0 : n2.call(m2, "change").catch((e4) => ui()); } p2.currentValue = l2; }; const I2 = (e3) => { p2.userInput = e3; const t2 = e3 === "" ? null : Number(e3); a2(_u, t2); N2(t2, false); }; const V2 = (e3) => { const t2 = e3 !== "" ? Number(e3) : ""; if (Js(t2) && !Number.isNaN(t2) || e3 === "") { N2(t2); } U2(); p2.userInput = null; }; const j2 = () => { var e3, t2; (t2 = (e3 = f2.value) == null ? void 0 : e3.focus) == null ? void 0 : t2.call(e3); }; const H2 = () => { var e3, t2; (t2 = (e3 = f2.value) == null ? void 0 : e3.blur) == null ? void 0 : t2.call(e3); }; const W2 = (e3) => { a2("focus", e3); }; const Y2 = (e3) => { var t2; p2.userInput = null; a2("blur", e3); if (r2.validateEvent) { (t2 = m2 == null ? void 0 : m2.validate) == null ? void 0 : t2.call(m2, "blur").catch((e4) => ui()); } }; const U2 = () => { if (p2.currentValue !== r2.modelValue) { p2.currentValue = r2.modelValue; } }; const K2 = (e3) => { if (document.activeElement === e3.target) e3.preventDefault(); }; vue.watch(() => r2.modelValue, (e3, t2) => { const n2 = P2(e3, true); if (p2.userInput === null && n2 !== t2) { p2.currentValue = n2; } }, { immediate: true }); vue.onMounted(() => { var e3; const { min: t2, max: n2, modelValue: o3 } = r2; const l2 = (e3 = f2.value) == null ? void 0 : e3.input; l2.setAttribute("role", "spinbutton"); if (Number.isFinite(n2)) { l2.setAttribute("aria-valuemax", String(n2)); } else { l2.removeAttribute("aria-valuemax"); } if (Number.isFinite(t2)) { l2.setAttribute("aria-valuemin", String(t2)); } else { l2.removeAttribute("aria-valuemin"); } l2.setAttribute("aria-valuenow", p2.currentValue || p2.currentValue === 0 ? String(p2.currentValue) : ""); l2.setAttribute("aria-disabled", String(k2.value)); if (!Js(o3) && o3 != null) { let e4 = Number(o3); if (Number.isNaN(e4)) { e4 = null; } a2(Su, e4); } l2.addEventListener("wheel", K2, { passive: false }); }); vue.onUpdated(() => { var e3, t2; const n2 = (e3 = f2.value) == null ? void 0 : e3.input; n2 == null ? void 0 : n2.setAttribute("aria-valuenow", `${(t2 = p2.currentValue) != null ? t2 : ""}`); }); o2({ focus: j2, blur: H2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(d2).b(), vue.unref(d2).m(vue.unref(w2)), vue.unref(d2).is("disabled", vue.unref(k2)), vue.unref(d2).is("without-controls", !e3.controls), vue.unref(d2).is("controls-right", vue.unref(b2))]), onDragstart: vue.withModifiers(() => { }, ["prevent"]) }, [e3.controls ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { key: 0, role: "button", "aria-label": vue.unref(s2)("el.inputNumber.decrease"), class: vue.normalizeClass([vue.unref(d2).e("decrease"), vue.unref(d2).is("disabled", vue.unref(h2))]), onKeydown: vue.withKeys(R2, ["enter"]) }, [vue.renderSlot(e3.$slots, "decrease-icon", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.unref(b2) ? (vue.openBlock(), vue.createBlock(vue.unref(bi), { key: 0 })) : (vue.openBlock(), vue.createBlock(vue.unref(Gi), { key: 1 }))]), _: 1 })])], 42, ["aria-label", "onKeydown"])), [[vue.unref(ng), R2]]) : vue.createCommentVNode("v-if", true), e3.controls ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { key: 1, role: "button", "aria-label": vue.unref(s2)("el.inputNumber.increase"), class: vue.normalizeClass([vue.unref(d2).e("increase"), vue.unref(d2).is("disabled", vue.unref(g2))]), onKeydown: vue.withKeys(M2, ["enter"]) }, [vue.renderSlot(e3.$slots, "increase-icon", {}, () => [vue.createVNode(vue.unref(sp), null, { default: vue.withCtx(() => [vue.unref(b2) ? (vue.openBlock(), vue.createBlock(vue.unref(Ei), { key: 0 })) : (vue.openBlock(), vue.createBlock(vue.unref(Zi), { key: 1 }))]), _: 1 })])], 42, ["aria-label", "onKeydown"])), [[vue.unref(ng), M2]]) : vue.createCommentVNode("v-if", true), vue.createVNode(vue.unref(Sp), { id: e3.id, ref_key: "input", ref: f2, type: "number", step: e3.step, "model-value": vue.unref(C2), placeholder: e3.placeholder, readonly: e3.readonly, disabled: vue.unref(k2), size: vue.unref(w2), max: e3.max, min: e3.min, name: e3.name, "aria-label": e3.ariaLabel, "validate-event": false, onKeydown: [vue.withKeys(vue.withModifiers(M2, ["prevent"]), ["up"]), vue.withKeys(vue.withModifiers(R2, ["prevent"]), ["down"])], onBlur: Y2, onFocus: W2, onInput: I2, onChange: V2 }, null, 8, ["id", "step", "model-value", "placeholder", "readonly", "disabled", "size", "max", "min", "name", "aria-label", "onKeydown"])], 42, ["onDragstart"])); } }); var Sw = np(Cw, [["__file", "input-number.vue"]]); const Ew = yu(Sw); const _w = fu({ modelValue: { type: [Boolean, String, Number], default: false }, disabled: Boolean, loading: Boolean, size: { type: String, validator: Mu }, width: { type: [String, Number], default: "" }, inlinePrompt: Boolean, inactiveActionIcon: { type: pu }, activeActionIcon: { type: pu }, activeIcon: { type: pu }, inactiveIcon: { type: pu }, activeText: { type: String, default: "" }, inactiveText: { type: String, default: "" }, activeValue: { type: [Boolean, String, Number], default: true }, inactiveValue: { type: [Boolean, String, Number], default: false }, name: { type: String, default: "" }, validateEvent: { type: Boolean, default: true }, beforeChange: { type: uu(Function) }, id: String, tabindex: { type: [String, Number] }, ...Kf(["ariaLabel"]) }); const Ow = { [Su]: (e2) => Zs(e2) || St(e2) || Js(e2), [Eu]: (e2) => Zs(e2) || St(e2) || Js(e2), [_u]: (e2) => Zs(e2) || St(e2) || Js(e2) }; const Mw = "ElSwitch"; const Lw = vue.defineComponent({ name: Mw }); const Dw = vue.defineComponent({ ...Lw, props: _w, emits: Ow, setup(e2, { expose: a2, emit: r2 }) { const s2 = e2; const { formItem: d2 } = fp(); const f2 = cp(); const p2 = Xu("switch"); const { inputId: m2 } = pp(s2, { formItemContext: d2 }); const h2 = dp(vue.computed(() => s2.loading)); const g2 = vue.ref(s2.modelValue !== false); const y2 = vue.ref(); const b2 = vue.ref(); const k2 = vue.computed(() => [p2.b(), p2.m(f2.value), p2.is("disabled", h2.value), p2.is("checked", M2.value)]); const C2 = vue.computed(() => [p2.e("label"), p2.em("label", "left"), p2.is("active", !M2.value)]); const S2 = vue.computed(() => [p2.e("label"), p2.em("label", "right"), p2.is("active", M2.value)]); const E2 = vue.computed(() => ({ width: mi(s2.width) })); vue.watch(() => s2.modelValue, () => { g2.value = true; }); const _2 = vue.computed(() => g2.value ? s2.modelValue : false); const M2 = vue.computed(() => _2.value === s2.activeValue); if (![s2.activeValue, s2.inactiveValue].includes(_2.value)) { r2(Su, s2.inactiveValue); r2(Eu, s2.inactiveValue); r2(_u, s2.inactiveValue); } vue.watch(M2, (e3) => { var t2; y2.value.checked = e3; if (s2.validateEvent) { (t2 = d2 == null ? void 0 : d2.validate) == null ? void 0 : t2.call(d2, "change").catch((e4) => ui()); } }); const I2 = () => { const e3 = M2.value ? s2.inactiveValue : s2.activeValue; r2(Su, e3); r2(Eu, e3); r2(_u, e3); vue.nextTick(() => { y2.value.checked = M2.value; }); }; const B2 = () => { if (h2.value) return; const { beforeChange: e3 } = s2; if (!e3) { I2(); return; } const t2 = e3(); const n2 = [_t(t2), Zs(t2)].includes(true); if (!n2) { ii(Mw, "beforeChange must return type `Promise<boolean>` or `boolean`"); } if (_t(t2)) { t2.then((e4) => { if (e4) { I2(); } }).catch((e4) => { }); } else if (t2) { I2(); } }; const V2 = () => { var e3, t2; (t2 = (e3 = y2.value) == null ? void 0 : e3.focus) == null ? void 0 : t2.call(e3); }; vue.onMounted(() => { y2.value.checked = M2.value; }); a2({ focus: V2, checked: M2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(vue.unref(k2)), onClick: vue.withModifiers(B2, ["prevent"]) }, [vue.createElementVNode("input", { id: vue.unref(m2), ref_key: "input", ref: y2, class: vue.normalizeClass(vue.unref(p2).e("input")), type: "checkbox", role: "switch", "aria-checked": vue.unref(M2), "aria-disabled": vue.unref(h2), "aria-label": e3.ariaLabel, name: e3.name, "true-value": e3.activeValue, "false-value": e3.inactiveValue, disabled: vue.unref(h2), tabindex: e3.tabindex, onChange: I2, onKeydown: vue.withKeys(B2, ["enter"]) }, null, 42, ["id", "aria-checked", "aria-disabled", "aria-label", "name", "true-value", "false-value", "disabled", "tabindex", "onKeydown"]), !e3.inlinePrompt && (e3.inactiveIcon || e3.inactiveText) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(C2)) }, [e3.inactiveIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.inactiveIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true), !e3.inactiveIcon && e3.inactiveText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, "aria-hidden": vue.unref(M2) }, vue.toDisplayString(e3.inactiveText), 9, ["aria-hidden"])) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("span", { ref_key: "core", ref: b2, class: vue.normalizeClass(vue.unref(p2).e("core")), style: vue.normalizeStyle(vue.unref(E2)) }, [e3.inlinePrompt ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(p2).e("inner")) }, [e3.activeIcon || e3.inactiveIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0, class: vue.normalizeClass(vue.unref(p2).is("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(M2) ? e3.activeIcon : e3.inactiveIcon)))]), _: 1 }, 8, ["class"])) : e3.activeText || e3.inactiveText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(p2).is("text")), "aria-hidden": !vue.unref(M2) }, vue.toDisplayString(vue.unref(M2) ? e3.activeText : e3.inactiveText), 11, ["aria-hidden"])) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(p2).e("action")) }, [e3.loading ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0, class: vue.normalizeClass(vue.unref(p2).is("loading")) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Ki))]), _: 1 }, 8, ["class"])) : vue.unref(M2) ? vue.renderSlot(e3.$slots, "active-action", { key: 1 }, () => [e3.activeActionIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.activeActionIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true)]) : !vue.unref(M2) ? vue.renderSlot(e3.$slots, "inactive-action", { key: 2 }, () => [e3.inactiveActionIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.inactiveActionIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true)]) : vue.createCommentVNode("v-if", true)], 2)], 6), !e3.inlinePrompt && (e3.activeIcon || e3.activeText) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(S2)) }, [e3.activeIcon ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.activeIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true), !e3.activeIcon && e3.activeText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, "aria-hidden": !vue.unref(M2) }, vue.toDisplayString(e3.activeText), 9, ["aria-hidden"])) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true)], 10, ["onClick"])); } }); var Aw = np(Dw, [["__file", "switch.vue"]]); const Rw = yu(Aw); const $w = function(e2) { var t2; return (t2 = e2.target) == null ? void 0 : t2.closest("td"); }; const Tw = function(e2, t2, n2, o2, a2) { if (!t2 && !o2 && (!a2 || Array.isArray(a2) && !a2.length)) { return e2; } if (typeof n2 === "string") { n2 = n2 === "descending" ? -1 : 1; } else { n2 = n2 && n2 < 0 ? -1 : 1; } const r2 = o2 ? null : function(n3, o3) { if (a2) { if (!Array.isArray(a2)) { a2 = [a2]; } return a2.map((t3) => { if (typeof t3 === "string") { return br(n3, t3); } else { return t3(n3, o3, e2); } }); } if (t2 !== "$key") { if (Et(n3) && "$value" in n3) n3 = n3.$value; } return [Et(n3) ? br(n3, t2) : n3]; }; const l2 = function(e3, t3) { if (o2) { return o2(e3.value, t3.value); } for (let n3 = 0, o3 = e3.key.length; n3 < o3; n3++) { if (e3.key[n3] < t3.key[n3]) { return -1; } if (e3.key[n3] > t3.key[n3]) { return 1; } } return 0; }; return e2.map((e3, t3) => ({ value: e3, index: t3, key: r2 ? r2(e3, t3) : null })).sort((e3, t3) => { let o3 = l2(e3, t3); if (!o3) { o3 = e3.index - t3.index; } return o3 * +n2; }).map((e3) => e3.value); }; const Pw = function(e2, t2) { let n2 = null; e2.columns.forEach((e3) => { if (e3.id === t2) { n2 = e3; } }); return n2; }; const Nw = function(e2, t2) { let n2 = null; for (let o2 = 0; o2 < e2.columns.length; o2++) { const a2 = e2.columns[o2]; if (a2.columnKey === t2) { n2 = a2; break; } } if (!n2) ii("ElTable", `No column matching with column-key: ${t2}`); return n2; }; const Iw = function(e2, t2, n2) { const o2 = (t2.className || "").match(new RegExp(`${n2}-table_[^\\s]+`, "gm")); if (o2) { return Pw(e2, o2[0]); } return null; }; const Bw = (e2, t2) => { if (!e2) throw new Error("Row is required when get row identity"); if (typeof t2 === "string") { if (!t2.includes(".")) { return `${e2[t2]}`; } const n2 = t2.split("."); let o2 = e2; for (const e3 of n2) { o2 = o2[e3]; } return `${o2}`; } else if (typeof t2 === "function") { return t2.call(null, e2); } }; const Vw = function(e2, t2) { const n2 = {}; (e2 || []).forEach((e3, o2) => { n2[Bw(e3, t2)] = { row: e3, index: o2 }; }); return n2; }; function Fw(e2, t2) { const n2 = {}; let o2; for (o2 in e2) { n2[o2] = e2[o2]; } for (o2 in t2) { if (wt(t2, o2)) { const e3 = t2[o2]; if (typeof e3 !== "undefined") { n2[o2] = e3; } } } return n2; } function jw(e2) { if (e2 === "") return e2; if (e2 !== void 0) { e2 = Number.parseInt(e2, 10); if (Number.isNaN(e2)) { e2 = ""; } } return e2; } function zw(e2) { if (e2 === "") return e2; if (e2 !== void 0) { e2 = jw(e2); if (Number.isNaN(e2)) { e2 = 80; } } return e2; } function Hw(e2) { if (typeof e2 === "number") { return e2; } if (typeof e2 === "string") { if (/^\d+(?:px)?$/.test(e2)) { return Number.parseInt(e2, 10); } else { return e2; } } return null; } function Ww(...e2) { if (e2.length === 0) { return (e3) => e3; } if (e2.length === 1) { return e2[0]; } return e2.reduce((e3, t2) => (...n2) => e3(t2(...n2))); } function Yw(e2, t2, n2, o2, a2, r2) { let l2 = r2 != null ? r2 : 0; let s2 = false; const i2 = e2.indexOf(t2); const u2 = i2 !== -1; const c2 = a2 == null ? void 0 : a2.call(null, t2, r2); const d2 = (n3) => { if (n3 === "add") { e2.push(t2); } else { e2.splice(i2, 1); } s2 = true; }; const f2 = (e3) => { let t3 = 0; const n3 = (o2 == null ? void 0 : o2.children) && e3[o2.children]; if (n3 && xt(n3)) { t3 += n3.length; n3.forEach((e4) => { t3 += f2(e4); }); } return t3; }; if (!a2 || c2) { if (Zs(n2)) { if (n2 && !u2) { d2("add"); } else if (!n2 && u2) { d2("remove"); } } else { u2 ? d2("remove") : d2("add"); } } if (!(o2 == null ? void 0 : o2.checkStrictly) && (o2 == null ? void 0 : o2.children) && xt(t2[o2.children])) { t2[o2.children].forEach((t3) => { Yw(e2, t3, n2 != null ? n2 : !u2, o2, a2, l2 + 1); l2 += f2(t3) + 1; }); } return s2; } function Uw(e2, t2, n2 = "children", o2 = "hasChildren") { const a2 = (e3) => !(Array.isArray(e3) && e3.length); function r2(e3, l2, s2) { t2(e3, l2, s2); l2.forEach((e4) => { if (e4[o2]) { t2(e4, null, s2 + 1); return; } const l3 = e4[n2]; if (!a2(l3)) { r2(e4, l3, s2 + 1); } }); } e2.forEach((e3) => { if (e3[o2]) { t2(e3, null, 0); return; } const l2 = e3[n2]; if (!a2(l2)) { r2(e3, l2, 0); } }); } let Kw = null; function qw(e2, t2, n2, o2) { if ((Kw == null ? void 0 : Kw.trigger) === n2) { return; } Kw == null ? void 0 : Kw(); const a2 = o2 == null ? void 0 : o2.refs.tableWrapper; const r2 = a2 == null ? void 0 : a2.dataset.prefix; const l2 = { strategy: "fixed", ...e2.popperOptions }; const s2 = vue.createVNode(Cm, { content: t2, virtualTriggering: true, virtualRef: n2, appendTo: a2, placement: "top", transition: "none", offset: 0, hideAfter: 0, ...e2, popperOptions: l2, onHide: () => { Kw == null ? void 0 : Kw(); } }); s2.appContext = { ...o2.appContext, ...o2 }; const i2 = document.createElement("div"); vue.render(s2, i2); s2.component.exposed.onOpen(); const u2 = a2 == null ? void 0 : a2.querySelector(`.${r2}-scrollbar__wrap`); Kw = () => { vue.render(null, i2); u2 == null ? void 0 : u2.removeEventListener("scroll", Kw); Kw = null; }; Kw.trigger = n2; u2 == null ? void 0 : u2.addEventListener("scroll", Kw); } function Gw(e2) { if (e2.children) { return Vs(e2.children, Gw); } else { return [e2]; } } function Xw(e2, t2) { return e2 + t2.colSpan; } const Zw = (e2, t2, n2, o2) => { let a2 = 0; let r2 = e2; const l2 = n2.states.columns.value; if (o2) { const t3 = Gw(o2[e2]); const n3 = l2.slice(0, l2.indexOf(t3[0])); a2 = n3.reduce(Xw, 0); r2 = a2 + t3.reduce(Xw, 0) - 1; } else { a2 = e2; } let s2; switch (t2) { case "left": if (r2 < n2.states.fixedLeafColumnsLength.value) { s2 = "left"; } break; case "right": if (a2 >= l2.length - n2.states.rightFixedLeafColumnsLength.value) { s2 = "right"; } break; default: if (r2 < n2.states.fixedLeafColumnsLength.value) { s2 = "left"; } else if (a2 >= l2.length - n2.states.rightFixedLeafColumnsLength.value) { s2 = "right"; } } return s2 ? { direction: s2, start: a2, after: r2 } : {}; }; const Jw = (e2, t2, n2, o2, a2, r2 = 0) => { const l2 = []; const { direction: s2, start: i2, after: u2 } = Zw(t2, n2, o2, a2); if (s2) { const t3 = s2 === "left"; l2.push(`${e2}-fixed-column--${s2}`); if (t3 && u2 + r2 === o2.states.fixedLeafColumnsLength.value - 1) { l2.push("is-last-column"); } else if (!t3 && i2 - r2 === o2.states.columns.value.length - o2.states.rightFixedLeafColumnsLength.value) { l2.push("is-first-column"); } } return l2; }; function Qw(e2, t2) { return e2 + (t2.realWidth === null || Number.isNaN(t2.realWidth) ? Number(t2.width) : t2.realWidth); } const ex = (e2, t2, n2, o2) => { const { direction: a2, start: r2 = 0, after: l2 = 0 } = Zw(e2, t2, n2, o2); if (!a2) { return; } const s2 = {}; const i2 = a2 === "left"; const u2 = n2.states.columns.value; if (i2) { s2.left = u2.slice(0, r2).reduce(Qw, 0); } else { s2.right = u2.slice(l2 + 1).reverse().reduce(Qw, 0); } return s2; }; const tx = (e2, t2) => { if (!e2) return; if (!Number.isNaN(e2[t2])) { e2[t2] = `${e2[t2]}px`; } }; function nx(e2) { const t2 = vue.getCurrentInstance(); const n2 = vue.ref(false); const o2 = vue.ref([]); const a2 = () => { const t3 = e2.data.value || []; const a3 = e2.rowKey.value; if (n2.value) { o2.value = t3.slice(); } else if (a3) { const e3 = Vw(o2.value, a3); o2.value = t3.reduce((t4, n3) => { const o3 = Bw(n3, a3); const r3 = e3[o3]; if (r3) { t4.push(n3); } return t4; }, []); } else { o2.value = []; } }; const r2 = (e3, n3) => { const a3 = Yw(o2.value, e3, n3); if (a3) { t2.emit("expand-change", e3, o2.value.slice()); } }; const l2 = (n3) => { t2.store.assertRowKey(); const a3 = e2.data.value || []; const r3 = e2.rowKey.value; const l3 = Vw(a3, r3); o2.value = n3.reduce((e3, t3) => { const n4 = l3[t3]; if (n4) { e3.push(n4.row); } return e3; }, []); }; const i2 = (t3) => { const n3 = e2.rowKey.value; if (n3) { const e3 = Vw(o2.value, n3); return !!e3[Bw(t3, n3)]; } return o2.value.includes(t3); }; return { updateExpandRows: a2, toggleRowExpansion: r2, setExpandRowKeys: l2, isRowExpanded: i2, states: { expandRows: o2, defaultExpandAll: n2 } }; } function ox(e2) { const t2 = vue.getCurrentInstance(); const n2 = vue.ref(null); const o2 = vue.ref(null); const a2 = (e3) => { t2.store.assertRowKey(); n2.value = e3; l2(e3); }; const r2 = () => { n2.value = null; }; const l2 = (n3) => { const { data: a3, rowKey: r3 } = e2; let l3 = null; if (r3.value) { l3 = (vue.unref(a3) || []).find((e3) => Bw(e3, r3.value) === n3); } o2.value = l3; t2.emit("current-change", o2.value, null); }; const i2 = (e3) => { const n3 = o2.value; if (e3 && e3 !== n3) { o2.value = e3; t2.emit("current-change", o2.value, n3); return; } if (!e3 && n3) { o2.value = null; t2.emit("current-change", null, n3); } }; const c2 = () => { const a3 = e2.rowKey.value; const s2 = e2.data.value || []; const i3 = o2.value; if (!s2.includes(i3) && i3) { if (a3) { const e3 = Bw(i3, a3); l2(e3); } else { o2.value = null; } if (o2.value === null) { t2.emit("current-change", null, i3); } } else if (n2.value) { l2(n2.value); r2(); } }; return { setCurrentRowKey: a2, restoreCurrentRowKey: r2, setCurrentRowByKey: l2, updateCurrentRow: i2, updateCurrentRowData: c2, states: { _currentRowKey: n2, currentRow: o2 } }; } function ax(e2) { const t2 = vue.ref([]); const n2 = vue.ref({}); const o2 = vue.ref(16); const a2 = vue.ref(false); const r2 = vue.ref({}); const c2 = vue.ref("hasChildren"); const d2 = vue.ref("children"); const f2 = vue.ref(false); const p2 = vue.getCurrentInstance(); const m2 = vue.computed(() => { if (!e2.rowKey.value) return {}; const t3 = e2.data.value || []; return g2(t3); }); const h2 = vue.computed(() => { const t3 = e2.rowKey.value; const n3 = Object.keys(r2.value); const o3 = {}; if (!n3.length) return o3; n3.forEach((e3) => { if (r2.value[e3].length) { const n4 = { children: [] }; r2.value[e3].forEach((e4) => { const a3 = Bw(e4, t3); n4.children.push(a3); if (e4[c2.value] && !o3[a3]) { o3[a3] = { children: [] }; } }); o3[e3] = n4; } }); return o3; }); const g2 = (t3) => { const n3 = e2.rowKey.value; const o3 = {}; Uw(t3, (e3, t4, r3) => { const l2 = Bw(e3, n3); if (Array.isArray(t4)) { o3[l2] = { children: t4.map((e4) => Bw(e4, n3)), level: r3 }; } else if (a2.value) { o3[l2] = { children: [], lazy: true, level: r3 }; } }, d2.value, c2.value); return o3; }; const y2 = (e3 = false, o3 = ((e4) => (e4 = p2.store) == null ? void 0 : e4.states.defaultExpandAll.value)()) => { var r3; const l2 = m2.value; const s2 = h2.value; const i2 = Object.keys(l2); const c3 = {}; if (i2.length) { const r4 = vue.unref(n2); const d3 = []; const f3 = (n3, a3) => { if (e3) { if (t2.value) { return o3 || t2.value.includes(a3); } else { return !!(o3 || (n3 == null ? void 0 : n3.expanded)); } } else { const e4 = o3 || t2.value && t2.value.includes(a3); return !!((n3 == null ? void 0 : n3.expanded) || e4); } }; i2.forEach((e4) => { const t3 = r4[e4]; const n3 = { ...l2[e4] }; n3.expanded = f3(t3, e4); if (n3.lazy) { const { loaded: o4 = false, loading: a3 = false } = t3 || {}; n3.loaded = !!o4; n3.loading = !!a3; d3.push(e4); } c3[e4] = n3; }); const p3 = Object.keys(s2); if (a2.value && p3.length && d3.length) { p3.forEach((e4) => { const t3 = r4[e4]; const n3 = s2[e4].children; if (d3.includes(e4)) { if (c3[e4].children.length !== 0) { throw new Error("[ElTable]children must be an empty array."); } c3[e4].children = n3; } else { const { loaded: o4 = false, loading: a3 = false } = t3 || {}; c3[e4] = { lazy: true, loaded: !!o4, loading: !!a3, expanded: f3(t3, e4), children: n3, level: "" }; } }); } } n2.value = c3; (r3 = p2.store) == null ? void 0 : r3.updateTableScrollY(); }; vue.watch(() => t2.value, () => { y2(true); }); vue.watch(() => m2.value, () => { y2(); }); vue.watch(() => h2.value, () => { y2(); }); const b2 = (e3) => { t2.value = e3; y2(); }; const w2 = (t3, o3) => { p2.store.assertRowKey(); const a3 = e2.rowKey.value; const r3 = Bw(t3, a3); const l2 = r3 && n2.value[r3]; if (r3 && l2 && "expanded" in l2) { const e3 = l2.expanded; o3 = typeof o3 === "undefined" ? !l2.expanded : o3; n2.value[r3].expanded = o3; if (e3 !== o3) { p2.emit("expand-change", t3, o3); } p2.store.updateTableScrollY(); } }; const x2 = (t3) => { p2.store.assertRowKey(); const o3 = e2.rowKey.value; const r3 = Bw(t3, o3); const l2 = n2.value[r3]; if (a2.value && l2 && "loaded" in l2 && !l2.loaded) { k2(t3, r3, l2); } else { w2(t3, void 0); } }; const k2 = (e3, t3, o3) => { const { load: a3 } = p2.props; if (a3 && !n2.value[t3].loaded) { n2.value[t3].loading = true; a3(e3, o3, (o4) => { if (!Array.isArray(o4)) { throw new TypeError("[ElTable] data must be an array"); } n2.value[t3].loading = false; n2.value[t3].loaded = true; n2.value[t3].expanded = true; if (o4.length) { r2.value[t3] = o4; } p2.emit("expand-change", e3, true); }); } }; return { loadData: k2, loadOrToggle: x2, toggleTreeExpansion: w2, updateTreeExpandKeys: b2, updateTreeData: y2, normalize: g2, states: { expandRowKeys: t2, treeData: n2, indent: o2, lazy: a2, lazyTreeNodeMap: r2, lazyColumnIdentifier: c2, childrenColumnName: d2, checkStrictly: f2 } }; } const rx = (e2, t2) => { const n2 = t2.sortingColumn; if (!n2 || typeof n2.sortable === "string") { return e2; } return Tw(e2, t2.sortProp, t2.sortOrder, n2.sortMethod, n2.sortBy); }; const lx = (e2) => { const t2 = []; e2.forEach((e3) => { if (e3.children && e3.children.length > 0) { t2.push.apply(t2, lx(e3.children)); } else { t2.push(e3); } }); return t2; }; function sx() { var e2; const t2 = vue.getCurrentInstance(); const { size: n2 } = vue.toRefs((e2 = t2.proxy) == null ? void 0 : e2.$props); const o2 = vue.ref(null); const a2 = vue.ref([]); const r2 = vue.ref([]); const l2 = vue.ref(false); const c2 = vue.ref([]); const d2 = vue.ref([]); const f2 = vue.ref([]); const p2 = vue.ref([]); const m2 = vue.ref([]); const h2 = vue.ref([]); const g2 = vue.ref([]); const y2 = vue.ref([]); const b2 = []; const w2 = vue.ref(0); const x2 = vue.ref(0); const k2 = vue.ref(0); const C2 = vue.ref(false); const S2 = vue.ref([]); const E2 = vue.ref(false); const _2 = vue.ref(false); const O2 = vue.ref(null); const M2 = vue.ref({}); const L2 = vue.ref(null); const D2 = vue.ref(null); const A2 = vue.ref(null); const R2 = vue.ref(null); const $2 = vue.ref(null); vue.watch(a2, () => t2.state && I2(false), { deep: true }); const T2 = () => { if (!o2.value) throw new Error("[ElTable] prop row-key is required"); }; const P2 = (e3) => { var t3; (t3 = e3.children) == null ? void 0 : t3.forEach((t4) => { t4.fixed = e3.fixed; P2(t4); }); }; const N2 = () => { c2.value.forEach((e4) => { P2(e4); }); p2.value = c2.value.filter((e4) => e4.fixed === true || e4.fixed === "left"); m2.value = c2.value.filter((e4) => e4.fixed === "right"); if (p2.value.length > 0 && c2.value[0] && c2.value[0].type === "selection" && !c2.value[0].fixed) { c2.value[0].fixed = true; p2.value.unshift(c2.value[0]); } const e3 = c2.value.filter((e4) => !e4.fixed); d2.value = [].concat(p2.value).concat(e3).concat(m2.value); const t3 = lx(e3); const n3 = lx(p2.value); const o3 = lx(m2.value); w2.value = t3.length; x2.value = n3.length; k2.value = o3.length; f2.value = [].concat(n3).concat(t3).concat(o3); l2.value = p2.value.length > 0 || m2.value.length > 0; }; const I2 = (e3, n3 = false) => { if (e3) { N2(); } if (n3) { t2.state.doLayout(); } else { t2.state.debouncedUpdateLayout(); } }; const B2 = (e3) => S2.value.includes(e3); const V2 = () => { C2.value = false; const e3 = S2.value; S2.value = []; if (e3.length) { t2.emit("selection-change", []); } }; const F2 = () => { let e3; if (o2.value) { e3 = []; const t3 = Vw(S2.value, o2.value); const n3 = Vw(a2.value, o2.value); for (const o3 in t3) { if (wt(t3, o3) && !n3[o3]) { e3.push(t3[o3].row); } } } else { e3 = S2.value.filter((e4) => !a2.value.includes(e4)); } if (e3.length) { const n3 = S2.value.filter((t3) => !e3.includes(t3)); S2.value = n3; t2.emit("selection-change", n3.slice()); } }; const j2 = () => (S2.value || []).slice(); const z2 = (e3, n3, o3 = true) => { var a3, r3, l3, s2; const i2 = { children: (r3 = (a3 = t2 == null ? void 0 : t2.store) == null ? void 0 : a3.states) == null ? void 0 : r3.childrenColumnName.value, checkStrictly: (s2 = (l3 = t2 == null ? void 0 : t2.store) == null ? void 0 : l3.states) == null ? void 0 : s2.checkStrictly.value }; const u2 = Yw(S2.value, e3, n3, i2, O2.value); if (u2) { const n4 = (S2.value || []).slice(); if (o3) { t2.emit("select", n4, e3); } t2.emit("selection-change", n4); } }; const H2 = () => { var e3, n3; const o3 = _2.value ? !C2.value : !(C2.value || S2.value.length); C2.value = o3; let r3 = false; let l3 = 0; const s2 = (n3 = (e3 = t2 == null ? void 0 : t2.store) == null ? void 0 : e3.states) == null ? void 0 : n3.rowKey.value; const { childrenColumnName: i2 } = t2.store.states; const u2 = { children: i2.value, checkStrictly: false }; a2.value.forEach((e4, t3) => { const n4 = t3 + l3; if (Yw(S2.value, e4, o3, u2, O2.value, n4)) { r3 = true; } l3 += U2(Bw(e4, s2)); }); if (r3) { t2.emit("selection-change", S2.value ? S2.value.slice() : []); } t2.emit("select-all", (S2.value || []).slice()); }; const W2 = () => { const e3 = Vw(S2.value, o2.value); a2.value.forEach((t3) => { const n3 = Bw(t3, o2.value); const a3 = e3[n3]; if (a3) { S2.value[a3.index] = t3; } }); }; const Y2 = () => { var e3; if (((e3 = a2.value) == null ? void 0 : e3.length) === 0) { C2.value = false; return; } const { childrenColumnName: n3 } = t2.store.states; const r3 = o2.value ? Vw(S2.value, o2.value) : void 0; let l3 = 0; let s2 = 0; const i2 = (e4) => { if (r3) { return !!r3[Bw(e4, o2.value)]; } else { return S2.value.includes(e4); } }; const u2 = (e4) => { var t3; for (const o3 of e4) { const e5 = O2.value && O2.value.call(null, o3, l3); if (!i2(o3)) { if (!O2.value || e5) { return false; } } else { s2++; } l3++; if (((t3 = o3[n3.value]) == null ? void 0 : t3.length) && !u2(o3[n3.value])) { return false; } } return true; }; const c3 = u2(a2.value || []); C2.value = s2 === 0 ? false : c3; }; const U2 = (e3) => { var n3; if (!t2 || !t2.store) return 0; const { treeData: o3 } = t2.store.states; let a3 = 0; const r3 = (n3 = o3.value[e3]) == null ? void 0 : n3.children; if (r3) { a3 += r3.length; r3.forEach((e4) => { a3 += U2(e4); }); } return a3; }; const K2 = (e3, t3) => { if (!Array.isArray(e3)) { e3 = [e3]; } const n3 = {}; e3.forEach((e4) => { M2.value[e4.id] = t3; n3[e4.columnKey || e4.id] = t3; }); return n3; }; const q2 = (e3, t3, n3) => { if (D2.value && D2.value !== e3) { D2.value.order = null; } D2.value = e3; A2.value = t3; R2.value = n3; }; const G2 = () => { let e3 = vue.unref(r2); Object.keys(M2.value).forEach((t3) => { const n3 = M2.value[t3]; if (!n3 || n3.length === 0) return; const o3 = Pw({ columns: f2.value }, t3); if (o3 && o3.filterMethod) { e3 = e3.filter((e4) => n3.some((t4) => o3.filterMethod.call(null, t4, e4, o3))); } }); L2.value = e3; }; const X2 = () => { a2.value = rx(L2.value, { sortingColumn: D2.value, sortProp: A2.value, sortOrder: R2.value }); }; const Z2 = (e3 = void 0) => { if (!(e3 && e3.filter)) { G2(); } X2(); }; const J2 = (e3) => { const { tableHeaderRef: n3 } = t2.refs; if (!n3) return; const o3 = Object.assign({}, n3.filterPanels); const a3 = Object.keys(o3); if (!a3.length) return; if (typeof e3 === "string") { e3 = [e3]; } if (Array.isArray(e3)) { const n4 = e3.map((e4) => Nw({ columns: f2.value }, e4)); a3.forEach((e4) => { const t3 = n4.find((t4) => t4.id === e4); if (t3) { t3.filteredValue = []; } }); t2.store.commit("filterChange", { column: n4, values: [], silent: true, multi: true }); } else { a3.forEach((e4) => { const t3 = f2.value.find((t4) => t4.id === e4); if (t3) { t3.filteredValue = []; } }); M2.value = {}; t2.store.commit("filterChange", { column: {}, values: [], silent: true }); } }; const ee2 = () => { if (!D2.value) return; q2(null, null, null); t2.store.commit("changeSortCondition", { silent: true }); }; const { setExpandRowKeys: te2, toggleRowExpansion: ne2, updateExpandRows: oe2, states: ae2, isRowExpanded: re2 } = nx({ data: a2, rowKey: o2 }); const { updateTreeExpandKeys: le2, toggleTreeExpansion: se2, updateTreeData: ie2, loadOrToggle: ue2, states: ce2 } = ax({ data: a2, rowKey: o2 }); const { updateCurrentRowData: de2, updateCurrentRow: fe2, setCurrentRowKey: pe2, states: ve2 } = ox({ data: a2, rowKey: o2 }); const me2 = (e3) => { te2(e3); le2(e3); }; const he2 = (e3, t3) => { const n3 = f2.value.some(({ type: e4 }) => e4 === "expand"); if (n3) { ne2(e3, t3); } else { se2(e3, t3); } }; return { assertRowKey: T2, updateColumns: N2, scheduleLayout: I2, isSelected: B2, clearSelection: V2, cleanSelection: F2, getSelectionRows: j2, toggleRowSelection: z2, _toggleAllSelection: H2, toggleAllSelection: null, updateSelectionByRowKey: W2, updateAllSelected: Y2, updateFilters: K2, updateCurrentRow: fe2, updateSort: q2, execFilter: G2, execSort: X2, execQuery: Z2, clearFilter: J2, clearSort: ee2, toggleRowExpansion: ne2, setExpandRowKeysAdapter: me2, setCurrentRowKey: pe2, toggleRowExpansionAdapter: he2, isRowExpanded: re2, updateExpandRows: oe2, updateCurrentRowData: de2, loadOrToggle: ue2, updateTreeData: ie2, states: { tableSize: n2, rowKey: o2, data: a2, _data: r2, isComplex: l2, _columns: c2, originColumns: d2, columns: f2, fixedColumns: p2, rightFixedColumns: m2, leafColumns: h2, fixedLeafColumns: g2, rightFixedLeafColumns: y2, updateOrderFns: b2, leafColumnsLength: w2, fixedLeafColumnsLength: x2, rightFixedLeafColumnsLength: k2, isAllSelected: C2, selection: S2, reserveSelection: E2, selectOnIndeterminate: _2, selectable: O2, filters: M2, filteredData: L2, sortingColumn: D2, sortProp: A2, sortOrder: R2, hoverRow: $2, ...ae2, ...ce2, ...ve2 } }; } function ix(e2, t2) { return e2.map((e3) => { var n2; if (e3.id === t2.id) { return t2; } else if ((n2 = e3.children) == null ? void 0 : n2.length) { e3.children = ix(e3.children, t2); } return e3; }); } function ux(e2) { e2.forEach((e3) => { var t2, n2; e3.no = (t2 = e3.getColumnIndex) == null ? void 0 : t2.call(e3); if ((n2 = e3.children) == null ? void 0 : n2.length) { ux(e3.children); } }); e2.sort((e3, t2) => e3.no - t2.no); } function cx() { const e2 = vue.getCurrentInstance(); const t2 = sx(); const n2 = Xu("table"); const o2 = { setData(t3, n3) { const o3 = vue.unref(t3._data) !== n3; t3.data.value = n3; t3._data.value = n3; e2.store.execQuery(); e2.store.updateCurrentRowData(); e2.store.updateExpandRows(); e2.store.updateTreeData(e2.store.states.defaultExpandAll.value); if (vue.unref(t3.reserveSelection)) { e2.store.assertRowKey(); e2.store.updateSelectionByRowKey(); } else { if (o3) { e2.store.clearSelection(); } else { e2.store.cleanSelection(); } } e2.store.updateAllSelected(); if (e2.$ready) { e2.store.scheduleLayout(); } }, insertColumn(t3, n3, o3, a3) { const r3 = vue.unref(t3._columns); let l2 = []; if (!o3) { r3.push(n3); l2 = r3; } else { if (o3 && !o3.children) { o3.children = []; } o3.children.push(n3); l2 = ix(r3, o3); } ux(l2); t3._columns.value = l2; t3.updateOrderFns.push(a3); if (n3.type === "selection") { t3.selectable.value = n3.selectable; t3.reserveSelection.value = n3.reserveSelection; } if (e2.$ready) { e2.store.updateColumns(); e2.store.scheduleLayout(); } }, updateColumnOrder(t3, n3) { var o3; const a3 = (o3 = n3.getColumnIndex) == null ? void 0 : o3.call(n3); if (a3 === n3.no) return; ux(t3._columns.value); if (e2.$ready) { e2.store.updateColumns(); } }, removeColumn(t3, n3, o3, a3) { const r3 = vue.unref(t3._columns) || []; if (o3) { o3.children.splice(o3.children.findIndex((e3) => e3.id === n3.id), 1); vue.nextTick(() => { var e3; if (((e3 = o3.children) == null ? void 0 : e3.length) === 0) { delete o3.children; } }); t3._columns.value = ix(r3, o3); } else { const e3 = r3.indexOf(n3); if (e3 > -1) { r3.splice(e3, 1); t3._columns.value = r3; } } const l2 = t3.updateOrderFns.indexOf(a3); l2 > -1 && t3.updateOrderFns.splice(l2, 1); if (e2.$ready) { e2.store.updateColumns(); e2.store.scheduleLayout(); } }, sort(t3, n3) { const { prop: o3, order: a3, init: r3 } = n3; if (o3) { const n4 = vue.unref(t3.columns).find((e3) => e3.property === o3); if (n4) { n4.order = a3; e2.store.updateSort(n4, o3, a3); e2.store.commit("changeSortCondition", { init: r3 }); } } }, changeSortCondition(t3, n3) { const { sortingColumn: o3, sortProp: a3, sortOrder: r3 } = t3; const l2 = vue.unref(o3), s2 = vue.unref(a3), i2 = vue.unref(r3); if (i2 === null) { t3.sortingColumn.value = null; t3.sortProp.value = null; } const c2 = { filter: true }; e2.store.execQuery(c2); if (!n3 || !(n3.silent || n3.init)) { e2.emit("sort-change", { column: l2, prop: s2, order: i2 }); } e2.store.updateTableScrollY(); }, filterChange(t3, n3) { const { column: o3, values: a3, silent: r3 } = n3; const l2 = e2.store.updateFilters(o3, a3); e2.store.execQuery(); if (!r3) { e2.emit("filter-change", l2); } e2.store.updateTableScrollY(); }, toggleAllSelection() { e2.store.toggleAllSelection(); }, rowSelectedChanged(t3, n3) { e2.store.toggleRowSelection(n3); e2.store.updateAllSelected(); }, setHoverRow(e3, t3) { e3.hoverRow.value = t3; }, setCurrentRow(t3, n3) { e2.store.updateCurrentRow(n3); } }; const a2 = function(t3, ...n3) { const o3 = e2.store.mutations; if (o3[t3]) { o3[t3].apply(e2, [e2.store.states].concat(n3)); } else { throw new Error(`Action not found: ${t3}`); } }; const r2 = function() { vue.nextTick(() => e2.layout.updateScrollY.apply(e2.layout)); }; return { ns: n2, ...t2, mutations: o2, commit: a2, updateTableScrollY: r2 }; } const dx = { rowKey: "rowKey", defaultExpandAll: "defaultExpandAll", selectOnIndeterminate: "selectOnIndeterminate", indent: "indent", lazy: "lazy", data: "data", ["treeProps.hasChildren"]: { key: "lazyColumnIdentifier", default: "hasChildren" }, ["treeProps.children"]: { key: "childrenColumnName", default: "children" }, ["treeProps.checkStrictly"]: { key: "checkStrictly", default: false } }; function fx(e2, t2) { if (!e2) { throw new Error("Table is required."); } const n2 = cx(); n2.toggleAllSelection = Ds(n2._toggleAllSelection, 10); Object.keys(dx).forEach((e3) => { vx(mx(t2, e3), e3, n2); }); px(n2, t2); return n2; } function px(e2, t2) { Object.keys(dx).forEach((n2) => { vue.watch(() => mx(t2, n2), (t3) => { vx(t3, n2, e2); }); }); } function vx(e2, t2, n2) { let o2 = e2; let a2 = dx[t2]; if (typeof dx[t2] === "object") { a2 = a2.key; o2 = o2 || dx[t2].default; } n2.states[a2].value = o2; } function mx(e2, t2) { if (t2.includes(".")) { const n2 = t2.split("."); let o2 = e2; n2.forEach((e3) => { o2 = o2[e3]; }); return o2; } else { return e2[t2]; } } class hx { constructor(e2) { this.observers = []; this.table = null; this.store = null; this.columns = []; this.fit = true; this.showHeader = true; this.height = vue.ref(null); this.scrollX = vue.ref(false); this.scrollY = vue.ref(false); this.bodyWidth = vue.ref(null); this.fixedWidth = vue.ref(null); this.rightFixedWidth = vue.ref(null); this.gutterWidth = 0; for (const t2 in e2) { if (wt(e2, t2)) { if (vue.isRef(this[t2])) { this[t2].value = e2[t2]; } else { this[t2] = e2[t2]; } } } if (!this.table) { throw new Error("Table is required for Table Layout"); } if (!this.store) { throw new Error("Store is required for Table Layout"); } } updateScrollY() { const e2 = this.height.value; if (e2 === null) return false; const t2 = this.table.refs.scrollBarRef; if (this.table.vnode.el && (t2 == null ? void 0 : t2.wrapRef)) { let e3 = true; const n2 = this.scrollY.value; e3 = t2.wrapRef.scrollHeight > t2.wrapRef.clientHeight; this.scrollY.value = e3; return n2 !== e3; } return false; } setHeight(e2, t2 = "height") { if (!Be) return; const n2 = this.table.vnode.el; e2 = Hw(e2); this.height.value = Number(e2); if (!n2 && (e2 || e2 === 0)) return vue.nextTick(() => this.setHeight(e2, t2)); if (typeof e2 === "number") { n2.style[t2] = `${e2}px`; this.updateElsHeight(); } else if (typeof e2 === "string") { n2.style[t2] = e2; this.updateElsHeight(); } } setMaxHeight(e2) { this.setHeight(e2, "max-height"); } getFlattenColumns() { const e2 = []; const t2 = this.table.store.states.columns.value; t2.forEach((t3) => { if (t3.isColumnGroup) { e2.push.apply(e2, t3.columns); } else { e2.push(t3); } }); return e2; } updateElsHeight() { this.updateScrollY(); this.notifyObservers("scrollable"); } headerDisplayNone(e2) { if (!e2) return true; let t2 = e2; while (t2.tagName !== "DIV") { if (getComputedStyle(t2).display === "none") { return true; } t2 = t2.parentElement; } return false; } updateColumnsWidth() { if (!Be) return; const e2 = this.fit; const t2 = this.table.vnode.el.clientWidth; let n2 = 0; const o2 = this.getFlattenColumns(); const a2 = o2.filter((e3) => typeof e3.width !== "number"); o2.forEach((e3) => { if (typeof e3.width === "number" && e3.realWidth) e3.realWidth = null; }); if (a2.length > 0 && e2) { o2.forEach((e3) => { n2 += Number(e3.width || e3.minWidth || 80); }); if (n2 <= t2) { this.scrollX.value = false; const e3 = t2 - n2; if (a2.length === 1) { a2[0].realWidth = Number(a2[0].minWidth || 80) + e3; } else { const t3 = a2.reduce((e4, t4) => e4 + Number(t4.minWidth || 80), 0); const n3 = e3 / t3; let o3 = 0; a2.forEach((e4, t4) => { if (t4 === 0) return; const a3 = Math.floor(Number(e4.minWidth || 80) * n3); o3 += a3; e4.realWidth = Number(e4.minWidth || 80) + a3; }); a2[0].realWidth = Number(a2[0].minWidth || 80) + e3 - o3; } } else { this.scrollX.value = true; a2.forEach((e3) => { e3.realWidth = Number(e3.minWidth); }); } this.bodyWidth.value = Math.max(n2, t2); this.table.state.resizeState.value.width = this.bodyWidth.value; } else { o2.forEach((e3) => { if (!e3.width && !e3.minWidth) { e3.realWidth = 80; } else { e3.realWidth = Number(e3.width || e3.minWidth); } n2 += e3.realWidth; }); this.scrollX.value = n2 > t2; this.bodyWidth.value = n2; } const r2 = this.store.states.fixedColumns.value; if (r2.length > 0) { let e3 = 0; r2.forEach((t3) => { e3 += Number(t3.realWidth || t3.width); }); this.fixedWidth.value = e3; } const l2 = this.store.states.rightFixedColumns.value; if (l2.length > 0) { let e3 = 0; l2.forEach((t3) => { e3 += Number(t3.realWidth || t3.width); }); this.rightFixedWidth.value = e3; } this.notifyObservers("columns"); } addObserver(e2) { this.observers.push(e2); } removeObserver(e2) { const t2 = this.observers.indexOf(e2); if (t2 !== -1) { this.observers.splice(t2, 1); } } notifyObservers(e2) { const t2 = this.observers; t2.forEach((t3) => { var n2, o2; switch (e2) { case "columns": (n2 = t3.state) == null ? void 0 : n2.onColumnsChange(this); break; case "scrollable": (o2 = t3.state) == null ? void 0 : o2.onScrollableChange(this); break; default: throw new Error(`Table Layout don't have event ${e2}.`); } }); } } const { CheckboxGroup: gx } = iy; const yx = vue.defineComponent({ name: "ElTableFilterPanel", components: { ElCheckbox: iy, ElCheckboxGroup: gx, ElScrollbar: zp, ElTooltip: Cm, ElIcon: sp, ArrowDown: bi, ArrowUp: Ei }, directives: { ClickOutside: Qh }, props: { placement: { type: String, default: "bottom-start" }, store: { type: Object }, column: { type: Object }, upDataColumn: { type: Function } }, setup(e2) { const t2 = vue.getCurrentInstance(); const { t: n2 } = Wu(); const o2 = Xu("table-filter"); const a2 = t2 == null ? void 0 : t2.parent; if (!a2.filterPanels.value[e2.column.id]) { a2.filterPanels.value[e2.column.id] = t2; } const r2 = vue.ref(false); const u2 = vue.ref(null); const c2 = vue.computed(() => e2.column && e2.column.filters); const d2 = vue.computed(() => { if (e2.column.filterClassName) { return `${o2.b()} ${e2.column.filterClassName}`; } return o2.b(); }); const f2 = vue.computed({ get: () => { var t3; return (((t3 = e2.column) == null ? void 0 : t3.filteredValue) || [])[0]; }, set: (e3) => { if (p2.value) { if (typeof e3 !== "undefined" && e3 !== null) { p2.value.splice(0, 1, e3); } else { p2.value.splice(0, 1); } } } }); const p2 = vue.computed({ get() { if (e2.column) { return e2.column.filteredValue || []; } return []; }, set(t3) { if (e2.column) { e2.upDataColumn("filteredValue", t3); } } }); const m2 = vue.computed(() => { if (e2.column) { return e2.column.filterMultiple; } return true; }); const h2 = (e3) => e3.value === f2.value; const g2 = () => { r2.value = false; }; const y2 = (e3) => { e3.stopPropagation(); r2.value = !r2.value; }; const b2 = () => { r2.value = false; }; const w2 = () => { C2(p2.value); g2(); }; const x2 = () => { p2.value = []; C2(p2.value); g2(); }; const k2 = (e3) => { f2.value = e3; if (typeof e3 !== "undefined" && e3 !== null) { C2(p2.value); } else { C2([]); } g2(); }; const C2 = (t3) => { e2.store.commit("filterChange", { column: e2.column, values: t3 }); e2.store.updateAllSelected(); }; vue.watch(r2, (t3) => { if (e2.column) { e2.upDataColumn("filterOpened", t3); } }, { immediate: true }); const S2 = vue.computed(() => { var e3, t3; return (t3 = (e3 = u2.value) == null ? void 0 : e3.popperRef) == null ? void 0 : t3.contentRef; }); return { tooltipVisible: r2, multiple: m2, filterClassName: d2, filteredValue: p2, filterValue: f2, filters: c2, handleConfirm: w2, handleReset: x2, handleSelect: k2, isActive: h2, t: n2, ns: o2, showFilterPanel: y2, hideFilterPanel: b2, popperPaneRef: S2, tooltip: u2 }; } }); function bx(e2, a2, r2, l2, s2, i2) { const u2 = vue.resolveComponent("el-checkbox"); const c2 = vue.resolveComponent("el-checkbox-group"); const d2 = vue.resolveComponent("el-scrollbar"); const f2 = vue.resolveComponent("arrow-up"); const p2 = vue.resolveComponent("arrow-down"); const v2 = vue.resolveComponent("el-icon"); const m2 = vue.resolveComponent("el-tooltip"); const h2 = vue.resolveDirective("click-outside"); return vue.openBlock(), vue.createBlock(m2, { ref: "tooltip", visible: e2.tooltipVisible, offset: 0, placement: e2.placement, "show-arrow": false, "stop-popper-mouse-event": false, teleported: "", effect: "light", pure: "", "popper-class": e2.filterClassName, persistent: "" }, { content: vue.withCtx(() => [e2.multiple ? (vue.openBlock(), vue.createElementBlock("div", { key: 0 }, [vue.createElementVNode("div", { class: vue.normalizeClass(e2.ns.e("content")) }, [vue.createVNode(d2, { "wrap-class": e2.ns.e("wrap") }, { default: vue.withCtx(() => [vue.createVNode(c2, { modelValue: e2.filteredValue, "onUpdate:modelValue": (t2) => e2.filteredValue = t2, class: vue.normalizeClass(e2.ns.e("checkbox-group")) }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e2.filters, (e3) => (vue.openBlock(), vue.createBlock(u2, { key: e3.value, value: e3.value }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(e3.text), 1)]), _: 2 }, 1032, ["value"]))), 128))]), _: 1 }, 8, ["modelValue", "onUpdate:modelValue", "class"])]), _: 1 }, 8, ["wrap-class"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass(e2.ns.e("bottom")) }, [vue.createElementVNode("button", { class: vue.normalizeClass({ [e2.ns.is("disabled")]: e2.filteredValue.length === 0 }), disabled: e2.filteredValue.length === 0, type: "button", onClick: e2.handleConfirm }, vue.toDisplayString(e2.t("el.table.confirmFilter")), 11, ["disabled", "onClick"]), vue.createElementVNode("button", { type: "button", onClick: e2.handleReset }, vue.toDisplayString(e2.t("el.table.resetFilter")), 9, ["onClick"])], 2)])) : (vue.openBlock(), vue.createElementBlock("ul", { key: 1, class: vue.normalizeClass(e2.ns.e("list")) }, [vue.createElementVNode("li", { class: vue.normalizeClass([e2.ns.e("list-item"), { [e2.ns.is("active")]: e2.filterValue === void 0 || e2.filterValue === null }]), onClick: (t2) => e2.handleSelect(null) }, vue.toDisplayString(e2.t("el.table.clearFilter")), 11, ["onClick"]), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e2.filters, (o2) => (vue.openBlock(), vue.createElementBlock("li", { key: o2.value, class: vue.normalizeClass([e2.ns.e("list-item"), e2.ns.is("active", e2.isActive(o2))]), label: o2.value, onClick: (t2) => e2.handleSelect(o2.value) }, vue.toDisplayString(o2.text), 11, ["label", "onClick"]))), 128))], 2))]), default: vue.withCtx(() => [vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass([`${e2.ns.namespace.value}-table__column-filter-trigger`, `${e2.ns.namespace.value}-none-outline`]), onClick: e2.showFilterPanel }, [vue.createVNode(v2, null, { default: vue.withCtx(() => [vue.renderSlot(e2.$slots, "filter-icon", {}, () => [e2.column.filterOpened ? (vue.openBlock(), vue.createBlock(f2, { key: 0 })) : (vue.openBlock(), vue.createBlock(p2, { key: 1 }))])]), _: 3 })], 10, ["onClick"])), [[h2, e2.hideFilterPanel, e2.popperPaneRef]])]), _: 3 }, 8, ["visible", "placement", "popper-class"]); } var wx = np(yx, [["render", bx], ["__file", "filter-panel.vue"]]); function xx(e2) { const t2 = vue.getCurrentInstance(); vue.onBeforeMount(() => { n2.value.addObserver(t2); }); vue.onMounted(() => { o2(n2.value); a2(n2.value); }); vue.onUpdated(() => { o2(n2.value); a2(n2.value); }); vue.onUnmounted(() => { n2.value.removeObserver(t2); }); const n2 = vue.computed(() => { const t3 = e2.layout; if (!t3) { throw new Error("Can not find table layout."); } return t3; }); const o2 = (t3) => { var n3; const o3 = ((n3 = e2.vnode.el) == null ? void 0 : n3.querySelectorAll("colgroup > col")) || []; if (!o3.length) return; const a3 = t3.getFlattenColumns(); const r2 = {}; a3.forEach((e3) => { r2[e3.id] = e3; }); for (let e3 = 0, t4 = o3.length; e3 < t4; e3++) { const t5 = o3[e3]; const n4 = t5.getAttribute("name"); const a4 = r2[n4]; if (a4) { t5.setAttribute("width", a4.realWidth || a4.width); } } }; const a2 = (t3) => { var n3, o3; const a3 = ((n3 = e2.vnode.el) == null ? void 0 : n3.querySelectorAll("colgroup > col[name=gutter]")) || []; for (let e3 = 0, n4 = a3.length; e3 < n4; e3++) { const n5 = a3[e3]; n5.setAttribute("width", t3.scrollY.value ? t3.gutterWidth : "0"); } const r2 = ((o3 = e2.vnode.el) == null ? void 0 : o3.querySelectorAll("th.gutter")) || []; for (let e3 = 0, n4 = r2.length; e3 < n4; e3++) { const n5 = r2[e3]; n5.style.width = t3.scrollY.value ? `${t3.gutterWidth}px` : "0"; n5.style.display = t3.scrollY.value ? "" : "none"; } }; return { tableLayout: n2.value, onColumnsChange: o2, onScrollableChange: a2 }; } const kx = Symbol("ElTable"); function Cx(e2, t2) { const n2 = vue.getCurrentInstance(); const o2 = vue.inject(kx); const a2 = (e3) => { e3.stopPropagation(); return; }; const r2 = (e3, t3) => { if (!t3.filters && t3.sortable) { g2(e3, t3, false); } else if (t3.filterable && !t3.sortable) { a2(e3); } o2 == null ? void 0 : o2.emit("header-click", t3, e3); }; const l2 = (e3, t3) => { o2 == null ? void 0 : o2.emit("header-contextmenu", t3, e3); }; const i2 = vue.ref(null); const u2 = vue.ref(false); const c2 = vue.ref({}); const d2 = (a3, r3) => { if (!Be) return; if (r3.children && r3.children.length > 0) return; if (i2.value && e2.border) { u2.value = true; const l3 = o2; t2("set-drag-visible", true); const s2 = l3 == null ? void 0 : l3.vnode.el; const d3 = s2.getBoundingClientRect().left; const f3 = n2.vnode.el.querySelector(`th.${r3.id}`); const p2 = f3.getBoundingClientRect(); const v2 = p2.left - d3 + 30; fi(f3, "noclick"); c2.value = { startMouseLeft: a3.clientX, startLeft: p2.right - d3, startColumnLeft: p2.left - d3, tableLeft: d3 }; const m3 = l3 == null ? void 0 : l3.refs.resizeProxy; m3.style.left = `${c2.value.startLeft}px`; document.onselectstart = function() { return false; }; document.ondragstart = function() { return false; }; const h3 = (e3) => { const t3 = e3.clientX - c2.value.startMouseLeft; const n3 = c2.value.startLeft + t3; m3.style.left = `${Math.max(v2, n3)}px`; }; const g3 = () => { if (u2.value) { const { startColumnLeft: n3, startLeft: o3 } = c2.value; const s3 = Number.parseInt(m3.style.left, 10); const d4 = s3 - n3; r3.width = r3.realWidth = d4; l3 == null ? void 0 : l3.emit("header-dragend", r3.width, o3 - n3, r3, a3); requestAnimationFrame(() => { e2.store.scheduleLayout(false, true); }); document.body.style.cursor = ""; u2.value = false; i2.value = null; c2.value = {}; t2("set-drag-visible", false); } document.removeEventListener("mousemove", h3); document.removeEventListener("mouseup", g3); document.onselectstart = null; document.ondragstart = null; setTimeout(() => { pi(f3, "noclick"); }, 0); }; document.addEventListener("mousemove", h3); document.addEventListener("mouseup", g3); } }; const f2 = (t3, n3) => { if (n3.children && n3.children.length > 0) return; const o3 = t3.target; if (!ei(o3)) { return; } const a3 = o3 == null ? void 0 : o3.closest("th"); if (!n3 || !n3.resizable) return; if (!u2.value && e2.border) { const e3 = a3.getBoundingClientRect(); const o4 = document.body.style; if (e3.width > 12 && e3.right - t3.pageX < 8) { o4.cursor = "col-resize"; if (di(a3, "is-sortable")) { a3.style.cursor = "col-resize"; } i2.value = n3; } else if (!u2.value) { o4.cursor = ""; if (di(a3, "is-sortable")) { a3.style.cursor = "pointer"; } i2.value = null; } } }; const m2 = () => { if (!Be) return; document.body.style.cursor = ""; }; const h2 = ({ order: e3, sortOrders: t3 }) => { if (e3 === "") return t3[0]; const n3 = t3.indexOf(e3 || null); return t3[n3 > t3.length - 2 ? 0 : n3 + 1]; }; const g2 = (t3, n3, a3) => { var r3; t3.stopPropagation(); const l3 = n3.order === a3 ? null : a3 || h2(n3); const s2 = (r3 = t3.target) == null ? void 0 : r3.closest("th"); if (s2) { if (di(s2, "noclick")) { pi(s2, "noclick"); return; } } if (!n3.sortable) return; const i3 = t3.currentTarget; if (["ascending", "descending"].some((e3) => di(i3, e3) && !n3.sortOrders.includes(e3))) { return; } const u3 = e2.store.states; let c3 = u3.sortProp.value; let d3; const f3 = u3.sortingColumn.value; if (f3 !== n3 || f3 === n3 && f3.order === null) { if (f3) { f3.order = null; } u3.sortingColumn.value = n3; c3 = n3.property; } if (!l3) { d3 = n3.order = null; } else { d3 = n3.order = l3; } u3.sortProp.value = c3; u3.sortOrder.value = d3; o2 == null ? void 0 : o2.store.commit("changeSortCondition"); }; return { handleHeaderClick: r2, handleHeaderContextMenu: l2, handleMouseDown: d2, handleMouseMove: f2, handleMouseOut: m2, handleSortClick: g2, handleFilterClick: a2 }; } function Sx(e2) { const t2 = vue.inject(kx); const n2 = Xu("table"); const o2 = (e3) => { const n3 = t2 == null ? void 0 : t2.props.headerRowStyle; if (typeof n3 === "function") { return n3.call(null, { rowIndex: e3 }); } return n3; }; const a2 = (e3) => { const n3 = []; const o3 = t2 == null ? void 0 : t2.props.headerRowClassName; if (typeof o3 === "string") { n3.push(o3); } else if (typeof o3 === "function") { n3.push(o3.call(null, { rowIndex: e3 })); } return n3.join(" "); }; const r2 = (n3, o3, a3, r3) => { var l3; let s2 = (l3 = t2 == null ? void 0 : t2.props.headerCellStyle) != null ? l3 : {}; if (typeof s2 === "function") { s2 = s2.call(null, { rowIndex: n3, columnIndex: o3, row: a3, column: r3 }); } const i2 = ex(o3, r3.fixed, e2.store, a3); tx(i2, "left"); tx(i2, "right"); return Object.assign({}, s2, i2); }; const l2 = (o3, a3, r3, l3) => { const s2 = Jw(n2.b(), a3, l3.fixed, e2.store, r3); const i2 = [l3.id, l3.order, l3.headerAlign, l3.className, l3.labelClassName, ...s2]; if (!l3.children) { i2.push("is-leaf"); } if (l3.sortable) { i2.push("is-sortable"); } const u2 = t2 == null ? void 0 : t2.props.headerCellClassName; if (typeof u2 === "string") { i2.push(u2); } else if (typeof u2 === "function") { i2.push(u2.call(null, { rowIndex: o3, columnIndex: a3, row: r3, column: l3 })); } i2.push(n2.e("cell")); return i2.filter((e3) => Boolean(e3)).join(" "); }; return { getHeaderRowStyle: o2, getHeaderRowClass: a2, getHeaderCellStyle: r2, getHeaderCellClass: l2 }; } const Ex = (e2) => { const t2 = []; e2.forEach((e3) => { if (e3.children) { t2.push(e3); t2.push.apply(t2, Ex(e3.children)); } else { t2.push(e3); } }); return t2; }; const _x = (e2) => { let t2 = 1; const n2 = (e3, o3) => { if (o3) { e3.level = o3.level + 1; if (t2 < e3.level) { t2 = e3.level; } } if (e3.children) { let t3 = 0; e3.children.forEach((o4) => { n2(o4, e3); t3 += o4.colSpan; }); e3.colSpan = t3; } else { e3.colSpan = 1; } }; e2.forEach((e3) => { e3.level = 1; n2(e3, void 0); }); const o2 = []; for (let e3 = 0; e3 < t2; e3++) { o2.push([]); } const a2 = Ex(e2); a2.forEach((e3) => { if (!e3.children) { e3.rowSpan = t2 - e3.level + 1; } else { e3.rowSpan = 1; e3.children.forEach((e4) => e4.isSubColumn = true); } o2[e3.level - 1].push(e3); }); return o2; }; function Ox(e2) { const t2 = vue.inject(kx); const n2 = vue.computed(() => _x(e2.store.states.originColumns.value)); const o2 = vue.computed(() => { const e3 = n2.value.length > 1; if (e3 && t2) { t2.state.isGroup.value = true; } return e3; }); const a2 = (e3) => { e3.stopPropagation(); t2 == null ? void 0 : t2.store.commit("toggleAllSelection"); }; return { isGroup: o2, toggleAllSelection: a2, columnRows: n2 }; } var Mx = vue.defineComponent({ name: "ElTableHeader", components: { ElCheckbox: iy }, props: { fixed: { type: String, default: "" }, store: { required: true, type: Object }, border: Boolean, defaultSort: { type: Object, default: () => ({ prop: "", order: "" }) } }, setup(e2, { emit: t2 }) { const n2 = vue.getCurrentInstance(); const o2 = vue.inject(kx); const a2 = Xu("table"); const r2 = vue.ref({}); const { onColumnsChange: l2, onScrollableChange: i2 } = xx(o2); vue.onMounted(async () => { await vue.nextTick(); await vue.nextTick(); const { prop: t3, order: n3 } = e2.defaultSort; o2 == null ? void 0 : o2.store.commit("sort", { prop: t3, order: n3, init: true }); }); const { handleHeaderClick: u2, handleHeaderContextMenu: d2, handleMouseDown: f2, handleMouseMove: m2, handleMouseOut: h2, handleSortClick: g2, handleFilterClick: y2 } = Cx(e2, t2); const { getHeaderRowStyle: b2, getHeaderRowClass: x2, getHeaderCellStyle: k2, getHeaderCellClass: C2 } = Sx(e2); const { isGroup: S2, toggleAllSelection: E2, columnRows: _2 } = Ox(e2); n2.state = { onColumnsChange: l2, onScrollableChange: i2 }; n2.filterPanels = r2; return { ns: a2, filterPanels: r2, onColumnsChange: l2, onScrollableChange: i2, columnRows: _2, getHeaderRowClass: x2, getHeaderRowStyle: b2, getHeaderCellClass: C2, getHeaderCellStyle: k2, handleHeaderClick: u2, handleHeaderContextMenu: d2, handleMouseDown: f2, handleMouseMove: m2, handleMouseOut: h2, handleSortClick: g2, handleFilterClick: y2, isGroup: S2, toggleAllSelection: E2 }; }, render() { const { ns: e2, isGroup: t2, columnRows: n2, getHeaderCellStyle: o2, getHeaderCellClass: a2, getHeaderRowClass: r2, getHeaderRowStyle: l2, handleHeaderClick: s2, handleHeaderContextMenu: i2, handleMouseDown: u2, handleMouseMove: c2, handleSortClick: d2, handleMouseOut: f2, store: p2, $parent: v2 } = this; let m2 = 1; return vue.h("thead", { class: { [e2.is("group")]: t2 } }, n2.map((e3, t3) => vue.h("tr", { class: r2(t3), key: t3, style: l2(t3) }, e3.map((n3, r3) => { if (n3.rowSpan > m2) { m2 = n3.rowSpan; } return vue.h("th", { class: a2(t3, r3, e3, n3), colspan: n3.colSpan, key: `${n3.id}-thead`, rowspan: n3.rowSpan, style: o2(t3, r3, e3, n3), onClick: (e4) => { if (e4.currentTarget.classList.contains("noclick")) { return; } s2(e4, n3); }, onContextmenu: (e4) => i2(e4, n3), onMousedown: (e4) => u2(e4, n3), onMousemove: (e4) => c2(e4, n3), onMouseout: f2 }, [vue.h("div", { class: ["cell", n3.filteredValue && n3.filteredValue.length > 0 ? "highlight" : ""] }, [n3.renderHeader ? n3.renderHeader({ column: n3, $index: r3, store: p2, _self: v2 }) : n3.label, n3.sortable && vue.h("span", { onClick: (e4) => d2(e4, n3), class: "caret-wrapper" }, [vue.h("i", { onClick: (e4) => d2(e4, n3, "ascending"), class: "sort-caret ascending" }), vue.h("i", { onClick: (e4) => d2(e4, n3, "descending"), class: "sort-caret descending" })]), n3.filterable && vue.h(wx, { store: p2, placement: n3.filterPlacement || "bottom-start", column: n3, upDataColumn: (e4, t4) => { n3[e4] = t4; } }, { "filter-icon": () => n3.renderFilterIcon ? n3.renderFilterIcon({ filterOpened: n3.filterOpened }) : null })])]); })))); } }); function Lx(e2, t2, n2 = 0.03) { return e2 - t2 > n2; } function Dx(e2) { const t2 = vue.inject(kx); const n2 = vue.ref(""); const o2 = vue.ref(vue.h("div")); const a2 = (n3, o3, a3) => { var r3; const l3 = t2; const s3 = $w(n3); let i3; const u3 = (r3 = l3 == null ? void 0 : l3.vnode.el) == null ? void 0 : r3.dataset.prefix; if (s3) { i3 = Iw({ columns: e2.store.states.columns.value }, s3, u3); if (i3) { l3 == null ? void 0 : l3.emit(`cell-${a3}`, o3, i3, s3, n3); } } l3 == null ? void 0 : l3.emit(`row-${a3}`, o3, i3, n3); }; const r2 = (e3, t3) => { a2(e3, t3, "dblclick"); }; const l2 = (t3, n3) => { e2.store.commit("setCurrentRow", n3); a2(t3, n3, "click"); }; const s2 = (e3, t3) => { a2(e3, t3, "contextmenu"); }; const i2 = Ds((t3) => { e2.store.commit("setHoverRow", t3); }, 30); const u2 = Ds(() => { e2.store.commit("setHoverRow", null); }, 30); const c2 = (e3) => { const t3 = window.getComputedStyle(e3, null); const n3 = Number.parseInt(t3.paddingLeft, 10) || 0; const o3 = Number.parseInt(t3.paddingRight, 10) || 0; const a3 = Number.parseInt(t3.paddingTop, 10) || 0; const r3 = Number.parseInt(t3.paddingBottom, 10) || 0; return { left: n3, right: o3, top: a3, bottom: r3 }; }; const d2 = (e3, t3, n3) => { let o3 = t3.target.parentNode; while (e3 > 1) { o3 = o3 == null ? void 0 : o3.nextSibling; if (!o3 || o3.nodeName !== "TR") break; n3(o3, "hover-row hover-fixed-row"); e3--; } }; const f2 = (n3, o3, a3) => { var r3; const l3 = t2; const s3 = $w(n3); const i3 = (r3 = l3 == null ? void 0 : l3.vnode.el) == null ? void 0 : r3.dataset.prefix; if (s3) { const t3 = Iw({ columns: e2.store.states.columns.value }, s3, i3); if (s3.rowSpan > 1) { d2(s3.rowSpan, n3, fi); } const a4 = l3.hoverState = { cell: s3, column: t3, row: o3 }; l3 == null ? void 0 : l3.emit("cell-mouse-enter", a4.row, a4.column, a4.cell, n3); } if (!a3) { return; } const u3 = n3.target.querySelector(".cell"); if (!(di(u3, `${i3}-tooltip`) && u3.childNodes.length)) { return; } const f3 = document.createRange(); f3.setStart(u3, 0); f3.setEnd(u3, u3.childNodes.length); const { width: p2, height: v2 } = f3.getBoundingClientRect(); const { width: m3, height: h2 } = u3.getBoundingClientRect(); const { top: g2, left: y2, right: b2, bottom: w2 } = c2(u3); const x2 = y2 + b2; const k2 = g2 + w2; if (Lx(p2 + x2, m3) || Lx(v2 + k2, h2) || Lx(u3.scrollWidth, m3)) { qw(a3, s3.innerText || s3.textContent, s3, l3); } }; const m2 = (e3) => { const n3 = $w(e3); if (!n3) return; if (n3.rowSpan > 1) { d2(n3.rowSpan, e3, pi); } const o3 = t2 == null ? void 0 : t2.hoverState; t2 == null ? void 0 : t2.emit("cell-mouse-leave", o3 == null ? void 0 : o3.row, o3 == null ? void 0 : o3.column, o3 == null ? void 0 : o3.cell, e3); }; return { handleDoubleClick: r2, handleClick: l2, handleContextMenu: s2, handleMouseEnter: i2, handleMouseLeave: u2, handleCellMouseEnter: f2, handleCellMouseLeave: m2, tooltipContent: n2, tooltipTrigger: o2 }; } function Ax(e2) { const t2 = vue.inject(kx); const n2 = Xu("table"); const o2 = (e3, n3) => { const o3 = t2 == null ? void 0 : t2.props.rowStyle; if (typeof o3 === "function") { return o3.call(null, { row: e3, rowIndex: n3 }); } return o3 || null; }; const a2 = (o3, a3) => { const r3 = [n2.e("row")]; if ((t2 == null ? void 0 : t2.props.highlightCurrentRow) && o3 === e2.store.states.currentRow.value) { r3.push("current-row"); } if (e2.stripe && a3 % 2 === 1) { r3.push(n2.em("row", "striped")); } const l3 = t2 == null ? void 0 : t2.props.rowClassName; if (typeof l3 === "string") { r3.push(l3); } else if (typeof l3 === "function") { r3.push(l3.call(null, { row: o3, rowIndex: a3 })); } return r3; }; const r2 = (n3, o3, a3, r3) => { const l3 = t2 == null ? void 0 : t2.props.cellStyle; let s3 = l3 != null ? l3 : {}; if (typeof l3 === "function") { s3 = l3.call(null, { rowIndex: n3, columnIndex: o3, row: a3, column: r3 }); } const i3 = ex(o3, e2 == null ? void 0 : e2.fixed, e2.store); tx(i3, "left"); tx(i3, "right"); return Object.assign({}, s3, i3); }; const l2 = (o3, a3, r3, l3, s3) => { const i3 = Jw(n2.b(), a3, e2 == null ? void 0 : e2.fixed, e2.store, void 0, s3); const u2 = [l3.id, l3.align, l3.className, ...i3]; const c2 = t2 == null ? void 0 : t2.props.cellClassName; if (typeof c2 === "string") { u2.push(c2); } else if (typeof c2 === "function") { u2.push(c2.call(null, { rowIndex: o3, columnIndex: a3, row: r3, column: l3 })); } u2.push(n2.e("cell")); return u2.filter((e3) => Boolean(e3)).join(" "); }; const s2 = (e3, n3, o3, a3) => { let r3 = 1; let l3 = 1; const s3 = t2 == null ? void 0 : t2.props.spanMethod; if (typeof s3 === "function") { const t3 = s3({ row: e3, column: n3, rowIndex: o3, columnIndex: a3 }); if (Array.isArray(t3)) { r3 = t3[0]; l3 = t3[1]; } else if (typeof t3 === "object") { r3 = t3.rowspan; l3 = t3.colspan; } } return { rowspan: r3, colspan: l3 }; }; const i2 = (e3, t3, n3) => { if (t3 < 1) { return e3[n3].realWidth; } const o3 = e3.map(({ realWidth: e4, width: t4 }) => e4 || t4).slice(n3, n3 + t3); return Number(o3.reduce((e4, t4) => Number(e4) + Number(t4), -1)); }; return { getRowStyle: o2, getRowClass: a2, getCellStyle: r2, getCellClass: l2, getSpan: s2, getColspanRealWidth: i2 }; } function Rx(e2) { const t2 = vue.inject(kx); const n2 = Xu("table"); const { handleDoubleClick: o2, handleClick: a2, handleContextMenu: r2, handleMouseEnter: s2, handleMouseLeave: i2, handleCellMouseEnter: u2, handleCellMouseLeave: c2, tooltipContent: d2, tooltipTrigger: f2 } = Dx(e2); const { getRowStyle: v2, getRowClass: m2, getCellStyle: h2, getCellClass: g2, getSpan: y2, getColspanRealWidth: b2 } = Ax(e2); const w2 = vue.computed(() => e2.store.states.columns.value.findIndex(({ type: e3 }) => e3 === "default")); const x2 = (e3, n3) => { const o3 = t2.props.rowKey; if (o3) { return Bw(e3, o3); } return n3; }; const k2 = (l2, d3, f3, p2 = false) => { const { tooltipEffect: k3, tooltipOptions: S3, store: E2 } = e2; const { indent: _2, columns: O2 } = E2.states; const M2 = m2(l2, d3); let L2 = true; if (f3) { M2.push(n2.em("row", `level-${f3.level}`)); L2 = f3.display; } const D2 = L2 ? null : { display: "none" }; return vue.h("tr", { style: [D2, v2(l2, d3)], class: M2, key: x2(l2, d3), onDblclick: (e3) => o2(e3, l2), onClick: (e3) => a2(e3, l2), onContextmenu: (e3) => r2(e3, l2), onMouseenter: () => s2(d3), onMouseleave: i2 }, O2.value.map((n3, o3) => { const { rowspan: a3, colspan: r3 } = y2(l2, n3, d3, o3); if (!a3 || !r3) { return null; } const s3 = Object.assign({}, n3); s3.realWidth = b2(O2.value, r3, o3); const i3 = { store: e2.store, _self: e2.context || t2, column: s3, row: l2, $index: d3, cellIndex: o3, expanded: p2 }; if (o3 === w2.value && f3) { i3.treeNode = { indent: f3.level * _2.value, level: f3.level }; if (typeof f3.expanded === "boolean") { i3.treeNode.expanded = f3.expanded; if ("loading" in f3) { i3.treeNode.loading = f3.loading; } if ("noLazyChildren" in f3) { i3.treeNode.noLazyChildren = f3.noLazyChildren; } } } const v3 = `${x2(l2, d3)},${o3}`; const m3 = s3.columnKey || s3.rawColumnKey || ""; const E3 = C2(o3, n3, i3); const M3 = n3.showOverflowTooltip && Ws({ effect: k3 }, S3, n3.showOverflowTooltip); return vue.h("td", { style: h2(d3, o3, l2, n3), class: g2(d3, o3, l2, n3, r3 - 1), key: `${m3}${v3}`, rowspan: a3, colspan: r3, onMouseenter: (e3) => u2(e3, l2, M3), onMouseleave: c2 }, [E3]); })); }; const C2 = (e3, t3, n3) => t3.renderCell(n3); const S2 = (o3, a3) => { const r3 = e2.store; const { isRowExpanded: l2, assertRowKey: s3 } = r3; const { treeData: i3, lazyTreeNodeMap: u3, childrenColumnName: c3, rowKey: d3 } = r3.states; const f3 = r3.states.columns.value; const p2 = f3.some(({ type: e3 }) => e3 === "expand"); if (p2) { const e3 = l2(o3); const s4 = k2(o3, a3, void 0, e3); const i4 = t2.renderExpanded; if (e3) { if (!i4) { console.error("[Element Error]renderExpanded is required."); return s4; } return [[s4, vue.h("tr", { key: `expanded-row__${s4.key}` }, [vue.h("td", { colspan: f3.length, class: `${n2.e("cell")} ${n2.e("expanded-cell")}` }, [i4({ row: o3, $index: a3, store: r3, expanded: e3 })])])]]; } else { return [[s4]]; } } else if (Object.keys(i3.value).length) { s3(); const e3 = Bw(o3, d3.value); let t3 = i3.value[e3]; let n3 = null; if (t3) { n3 = { expanded: t3.expanded, level: t3.level, display: true }; if (typeof t3.lazy === "boolean") { if (typeof t3.loaded === "boolean" && t3.loaded) { n3.noLazyChildren = !(t3.children && t3.children.length); } n3.loading = t3.loading; } } const r4 = [k2(o3, a3, n3)]; if (t3) { let n4 = 0; const l3 = (e4, o4) => { if (!(e4 && e4.length && o4)) return; e4.forEach((e5) => { const s5 = { display: o4.display && o4.expanded, level: o4.level + 1, expanded: false, noLazyChildren: false, loading: false }; const f4 = Bw(e5, d3.value); if (f4 === void 0 || f4 === null) { throw new Error("For nested data item, row-key is required."); } t3 = { ...i3.value[f4] }; if (t3) { s5.expanded = t3.expanded; t3.level = t3.level || s5.level; t3.display = !!(t3.expanded && s5.display); if (typeof t3.lazy === "boolean") { if (typeof t3.loaded === "boolean" && t3.loaded) { s5.noLazyChildren = !(t3.children && t3.children.length); } s5.loading = t3.loading; } } n4++; r4.push(k2(e5, a3 + n4, s5)); if (t3) { const n5 = u3.value[f4] || e5[c3.value]; l3(n5, t3); } }); }; t3.display = true; const s4 = u3.value[e3] || o3[c3.value]; l3(s4, t3); } return r4; } else { return k2(o3, a3, void 0); } }; return { wrappedRowRender: S2, tooltipContent: d2, tooltipTrigger: f2 }; } const $x = { store: { required: true, type: Object }, stripe: Boolean, tooltipEffect: String, tooltipOptions: { type: Object }, context: { default: () => ({}), type: Object }, rowClassName: [String, Function], rowStyle: [Object, Function], fixed: { type: String, default: "" }, highlight: Boolean }; var Tx = vue.defineComponent({ name: "ElTableBody", props: $x, setup(e2) { const t2 = vue.getCurrentInstance(); const n2 = vue.inject(kx); const o2 = Xu("table"); const { wrappedRowRender: a2, tooltipContent: r2, tooltipTrigger: l2 } = Rx(e2); const { onColumnsChange: u2, onScrollableChange: c2 } = xx(n2); const d2 = []; vue.watch(e2.store.states.hoverRow, (n3, a3) => { var r3; const l3 = t2 == null ? void 0 : t2.vnode.el; const s2 = Array.from((l3 == null ? void 0 : l3.children) || []).filter((e3) => e3 == null ? void 0 : e3.classList.contains(`${o2.e("row")}`)); let i2 = n3; const u3 = (r3 = s2[i2]) == null ? void 0 : r3.childNodes; if (u3 == null ? void 0 : u3.length) { let e3 = 0; const t3 = Array.from(u3).reduce((t4, n4, o3) => { var a4, r4; if (((a4 = u3[o3]) == null ? void 0 : a4.colSpan) > 1) { e3 = (r4 = u3[o3]) == null ? void 0 : r4.colSpan; } if (n4.nodeName !== "TD" && e3 === 0) { t4.push(o3); } e3 > 0 && e3--; return t4; }, []); t3.forEach((e4) => { var t4; i2 = n3; while (i2 > 0) { const n4 = (t4 = s2[i2 - 1]) == null ? void 0 : t4.childNodes; if (n4[e4] && n4[e4].nodeName === "TD" && n4[e4].rowSpan > 1) { fi(n4[e4], "hover-cell"); d2.push(n4[e4]); break; } i2--; } }); } else { d2.forEach((e3) => pi(e3, "hover-cell")); d2.length = 0; } if (!e2.store.states.isComplex.value || !Be) return; oi(() => { const e3 = s2[a3]; const t3 = s2[n3]; if (e3 && !e3.classList.contains("hover-fixed-row")) { pi(e3, "hover-row"); } if (t3) { fi(t3, "hover-row"); } }); }); vue.onUnmounted(() => { var e3; (e3 = Kw) == null ? void 0 : e3(); }); return { ns: o2, onColumnsChange: u2, onScrollableChange: c2, wrappedRowRender: a2, tooltipContent: r2, tooltipTrigger: l2 }; }, render() { const { wrappedRowRender: e2, store: t2 } = this; const n2 = t2.states.data.value || []; return vue.h("tbody", { tabIndex: -1 }, [n2.reduce((t3, n3) => t3.concat(e2(n3, t3.length)), [])]); } }); function Px() { const e2 = vue.inject(kx); const t2 = e2 == null ? void 0 : e2.store; const n2 = vue.computed(() => t2.states.fixedLeafColumnsLength.value); const o2 = vue.computed(() => t2.states.rightFixedColumns.value.length); const a2 = vue.computed(() => t2.states.columns.value.length); const r2 = vue.computed(() => t2.states.fixedColumns.value.length); const s2 = vue.computed(() => t2.states.rightFixedColumns.value.length); return { leftFixedLeafCount: n2, rightFixedLeafCount: o2, columnsCount: a2, leftFixedCount: r2, rightFixedCount: s2, columns: t2.states.columns }; } function Nx(e2) { const { columns: t2 } = Px(); const n2 = Xu("table"); const o2 = (t3, o3) => { const a3 = t3[o3]; const r2 = [n2.e("cell"), a3.id, a3.align, a3.labelClassName, ...Jw(n2.b(), o3, a3.fixed, e2.store)]; if (a3.className) { r2.push(a3.className); } if (!a3.children) { r2.push(n2.is("leaf")); } return r2; }; const a2 = (t3, n3) => { const o3 = ex(n3, t3.fixed, e2.store); tx(o3, "left"); tx(o3, "right"); return o3; }; return { getCellClasses: o2, getCellStyles: a2, columns: t2 }; } var Ix = vue.defineComponent({ name: "ElTableFooter", props: { fixed: { type: String, default: "" }, store: { required: true, type: Object }, summaryMethod: Function, sumText: String, border: Boolean, defaultSort: { type: Object, default: () => ({ prop: "", order: "" }) } }, setup(e2) { const { getCellClasses: t2, getCellStyles: n2, columns: o2 } = Nx(e2); const a2 = Xu("table"); return { ns: a2, getCellClasses: t2, getCellStyles: n2, columns: o2 }; }, render() { const { columns: e2, getCellStyles: t2, getCellClasses: n2, summaryMethod: o2, sumText: a2 } = this; const r2 = this.store.states.data.value; let l2 = []; if (o2) { l2 = o2({ columns: e2, data: r2 }); } else { e2.forEach((e3, t3) => { if (t3 === 0) { l2[t3] = a2; return; } const n3 = r2.map((t4) => Number(t4[e3.property])); const o3 = []; let s2 = true; n3.forEach((e4) => { if (!Number.isNaN(+e4)) { s2 = false; const t4 = `${e4}`.split(".")[1]; o3.push(t4 ? t4.length : 0); } }); const i2 = Math.max.apply(null, o3); if (!s2) { l2[t3] = n3.reduce((e4, t4) => { const n4 = Number(t4); if (!Number.isNaN(+n4)) { return Number.parseFloat((e4 + t4).toFixed(Math.min(i2, 20))); } else { return e4; } }, 0); } else { l2[t3] = ""; } }); } return vue.h(vue.h("tfoot", [vue.h("tr", {}, [...e2.map((o3, a3) => vue.h("td", { key: a3, colspan: o3.colSpan, rowspan: o3.rowSpan, class: n2(e2, a3), style: t2(o3, a3) }, [vue.h("div", { class: ["cell", o3.labelClassName] }, [l2[a3]])]))])])); } }); function Bx(e2) { const t2 = (t3) => { e2.commit("setCurrentRow", t3); }; const n2 = () => e2.getSelectionRows(); const o2 = (t3, n3) => { e2.toggleRowSelection(t3, n3, false); e2.updateAllSelected(); }; const a2 = () => { e2.clearSelection(); }; const r2 = (t3) => { e2.clearFilter(t3); }; const l2 = () => { e2.commit("toggleAllSelection"); }; const s2 = (t3, n3) => { e2.toggleRowExpansionAdapter(t3, n3); }; const i2 = () => { e2.clearSort(); }; const u2 = (t3, n3) => { e2.commit("sort", { prop: t3, order: n3 }); }; return { setCurrentRow: t2, getSelectionRows: n2, toggleRowSelection: o2, clearSelection: a2, clearFilter: r2, toggleAllSelection: l2, toggleRowExpansion: s2, clearSort: i2, sort: u2 }; } function Vx(e2, t2, n2, o2) { const a2 = vue.ref(false); const r2 = vue.ref(null); const s2 = vue.ref(false); const f2 = (e3) => { s2.value = e3; }; const p2 = vue.ref({ width: null, height: null, headerHeight: null }); const m2 = vue.ref(false); const h2 = { display: "inline-block", verticalAlign: "middle" }; const g2 = vue.ref(); const y2 = vue.ref(0); const b2 = vue.ref(0); const x2 = vue.ref(0); const k2 = vue.ref(0); const C2 = vue.ref(0); vue.watchEffect(() => { t2.setHeight(e2.height); }); vue.watchEffect(() => { t2.setMaxHeight(e2.maxHeight); }); vue.watch(() => [e2.currentRowKey, n2.states.rowKey], ([e3, t3]) => { if (!vue.unref(t3) || !vue.unref(e3)) return; n2.setCurrentRowKey(`${e3}`); }, { immediate: true }); vue.watch(() => e2.data, (e3) => { o2.store.commit("setData", e3); }, { immediate: true, deep: true }); vue.watchEffect(() => { if (e2.expandRowKeys) { n2.setExpandRowKeysAdapter(e2.expandRowKeys); } }); const S2 = () => { o2.store.commit("setHoverRow", null); if (o2.hoverState) o2.hoverState = null; }; const E2 = (e3, t3) => { const { pixelX: n3, pixelY: a3 } = t3; if (Math.abs(n3) >= Math.abs(a3)) { o2.refs.bodyWrapper.scrollLeft += t3.pixelX / 5; } }; const _2 = vue.computed(() => e2.height || e2.maxHeight || n2.states.fixedColumns.value.length > 0 || n2.states.rightFixedColumns.value.length > 0); const O2 = vue.computed(() => ({ width: t2.bodyWidth.value ? `${t2.bodyWidth.value}px` : "" })); const M2 = () => { if (_2.value) { t2.updateElsHeight(); } t2.updateColumnsWidth(); requestAnimationFrame(R2); }; vue.onMounted(async () => { await vue.nextTick(); n2.updateColumns(); $2(); requestAnimationFrame(M2); const t3 = o2.vnode.el; const a3 = o2.refs.headerWrapper; if (e2.flexible && t3 && t3.parentElement) { t3.parentElement.style.minWidth = "0"; } p2.value = { width: g2.value = t3.offsetWidth, height: t3.offsetHeight, headerHeight: e2.showHeader && a3 ? a3.offsetHeight : null }; n2.states.columns.value.forEach((e3) => { if (e3.filteredValue && e3.filteredValue.length) { o2.store.commit("filterChange", { column: e3, values: e3.filteredValue, silent: true }); } }); o2.$ready = true; }); const L2 = (e3, n3) => { if (!e3) return; const o3 = Array.from(e3.classList).filter((e4) => !e4.startsWith("is-scrolling-")); o3.push(t2.scrollX.value ? n3 : "is-scrolling-none"); e3.className = o3.join(" "); }; const D2 = (e3) => { const { tableWrapper: t3 } = o2.refs; L2(t3, e3); }; const A2 = (e3) => { const { tableWrapper: t3 } = o2.refs; return !!(t3 && t3.classList.contains(e3)); }; const R2 = function() { if (!o2.refs.scrollBarRef) return; if (!t2.scrollX.value) { const e4 = "is-scrolling-none"; if (!A2(e4)) { D2(e4); } return; } const e3 = o2.refs.scrollBarRef.wrapRef; if (!e3) return; const { scrollLeft: n3, offsetWidth: a3, scrollWidth: r3 } = e3; const { headerWrapper: l2, footerWrapper: s3 } = o2.refs; if (l2) l2.scrollLeft = n3; if (s3) s3.scrollLeft = n3; const i2 = r3 - a3 - 1; if (n3 >= i2) { D2("is-scrolling-right"); } else if (n3 === 0) { D2("is-scrolling-left"); } else { D2("is-scrolling-middle"); } }; const $2 = () => { if (!o2.refs.scrollBarRef) return; if (o2.refs.scrollBarRef.wrapRef) { Xe(o2.refs.scrollBarRef.wrapRef, "scroll", R2, { passive: true }); } if (e2.fit) { st(o2.vnode.el, T2); } else { Xe(window, "resize", T2); } st(o2.refs.bodyWrapper, () => { var e3, t3; T2(); (t3 = (e3 = o2.refs) == null ? void 0 : e3.scrollBarRef) == null ? void 0 : t3.update(); }); }; const T2 = () => { var t3, n3, a3, r3; const l2 = o2.vnode.el; if (!o2.$ready || !l2) return; let s3 = false; const { width: i2, height: u2, headerHeight: c2 } = p2.value; const d2 = g2.value = l2.offsetWidth; if (i2 !== d2) { s3 = true; } const f3 = l2.offsetHeight; if ((e2.height || _2.value) && u2 !== f3) { s3 = true; } const v2 = e2.tableLayout === "fixed" ? o2.refs.headerWrapper : (t3 = o2.refs.tableHeaderRef) == null ? void 0 : t3.$el; if (e2.showHeader && (v2 == null ? void 0 : v2.offsetHeight) !== c2) { s3 = true; } y2.value = ((n3 = o2.refs.tableWrapper) == null ? void 0 : n3.scrollHeight) || 0; x2.value = (v2 == null ? void 0 : v2.scrollHeight) || 0; k2.value = ((a3 = o2.refs.footerWrapper) == null ? void 0 : a3.offsetHeight) || 0; C2.value = ((r3 = o2.refs.appendWrapper) == null ? void 0 : r3.offsetHeight) || 0; b2.value = y2.value - x2.value - k2.value - C2.value; if (s3) { p2.value = { width: d2, height: f3, headerHeight: e2.showHeader && (v2 == null ? void 0 : v2.offsetHeight) || 0 }; M2(); } }; const P2 = cp(); const N2 = vue.computed(() => { const { bodyWidth: e3, scrollY: n3, gutterWidth: o3 } = t2; return e3.value ? `${e3.value - (n3.value ? o3 : 0)}px` : ""; }); const I2 = vue.computed(() => { if (e2.maxHeight) return "fixed"; return e2.tableLayout; }); const B2 = vue.computed(() => { if (e2.data && e2.data.length) return null; let t3 = "100%"; if (e2.height && b2.value) { t3 = `${b2.value}px`; } const n3 = g2.value; return { width: n3 ? `${n3}px` : "", height: t3 }; }); const V2 = vue.computed(() => { if (e2.height) { return { height: !Number.isNaN(Number(e2.height)) ? `${e2.height}px` : e2.height }; } if (e2.maxHeight) { return { maxHeight: !Number.isNaN(Number(e2.maxHeight)) ? `${e2.maxHeight}px` : e2.maxHeight }; } return {}; }); const F2 = vue.computed(() => { if (e2.height) { return { height: "100%" }; } if (e2.maxHeight) { if (!Number.isNaN(Number(e2.maxHeight))) { return { maxHeight: `${e2.maxHeight - x2.value - k2.value}px` }; } else { return { maxHeight: `calc(${e2.maxHeight} - ${x2.value + k2.value}px)` }; } } return {}; }); const j2 = (e3, t3) => { const n3 = o2.refs.bodyWrapper; if (Math.abs(t3.spinY) > 0) { const o3 = n3.scrollTop; if (t3.pixelY < 0 && o3 !== 0) { e3.preventDefault(); } if (t3.pixelY > 0 && n3.scrollHeight - n3.clientHeight > o3) { e3.preventDefault(); } n3.scrollTop += Math.ceil(t3.pixelY / 5); } else { n3.scrollLeft += Math.ceil(t3.pixelX / 5); } }; return { isHidden: a2, renderExpanded: r2, setDragVisible: f2, isGroup: m2, handleMouseLeave: S2, handleHeaderFooterMousewheel: E2, tableSize: P2, emptyBlockStyle: B2, handleFixedMousewheel: j2, resizeProxyVisible: s2, bodyWidth: N2, resizeState: p2, doLayout: M2, tableBodyStyles: O2, tableLayout: I2, scrollbarViewStyle: h2, tableInnerStyle: V2, scrollbarStyle: F2 }; } function Fx(e2) { const t2 = vue.ref(); const n2 = () => { const n3 = e2.vnode.el; const o2 = n3.querySelector(".hidden-columns"); const a2 = { childList: true, subtree: true }; const r2 = e2.store.states.updateOrderFns; t2.value = new MutationObserver(() => { r2.forEach((e3) => e3()); }); t2.value.observe(o2, a2); }; vue.onMounted(() => { n2(); }); vue.onUnmounted(() => { var e3; (e3 = t2.value) == null ? void 0 : e3.disconnect(); }); } var jx = { data: { type: Array, default: () => [] }, size: If, width: [String, Number], height: [String, Number], maxHeight: [String, Number], fit: { type: Boolean, default: true }, stripe: Boolean, border: Boolean, rowKey: [String, Function], showHeader: { type: Boolean, default: true }, showSummary: Boolean, sumText: String, summaryMethod: Function, rowClassName: [String, Function], rowStyle: [Object, Function], cellClassName: [String, Function], cellStyle: [Object, Function], headerRowClassName: [String, Function], headerRowStyle: [Object, Function], headerCellClassName: [String, Function], headerCellStyle: [Object, Function], highlightCurrentRow: Boolean, currentRowKey: [String, Number], emptyText: String, expandRowKeys: Array, defaultExpandAll: Boolean, defaultSort: Object, tooltipEffect: String, tooltipOptions: Object, spanMethod: Function, selectOnIndeterminate: { type: Boolean, default: true }, indent: { type: Number, default: 16 }, treeProps: { type: Object, default: () => ({ hasChildren: "hasChildren", children: "children", checkStrictly: false }) }, lazy: Boolean, load: Function, style: { type: Object, default: () => ({}) }, className: { type: String, default: "" }, tableLayout: { type: String, default: "fixed" }, scrollbarAlwaysOn: Boolean, flexible: Boolean, showOverflowTooltip: [Boolean, Object] }; function zx(e2) { const t2 = e2.tableLayout === "auto"; let n2 = e2.columns || []; if (t2) { if (n2.every((e3) => e3.width === void 0)) { n2 = []; } } const o2 = (n3) => { const o3 = { key: `${e2.tableLayout}_${n3.id}`, style: {}, name: void 0 }; if (t2) { o3.style = { width: `${n3.width}px` }; } else { o3.name = n3.id; } return o3; }; return vue.h("colgroup", {}, n2.map((e3) => vue.h("col", o2(e3)))); } zx.props = ["columns", "tableLayout"]; const Hx = () => { const e2 = vue.ref(); const t2 = (t3, n3) => { const o3 = e2.value; if (o3) { o3.scrollTo(t3, n3); } }; const n2 = (t3, n3) => { const o3 = e2.value; if (o3 && Js(n3) && ["Top", "Left"].includes(t3)) { o3[`setScroll${t3}`](n3); } }; const o2 = (e3) => n2("Top", e3); const a2 = (e3) => n2("Left", e3); return { scrollBarRef: e2, scrollTo: t2, setScrollTop: o2, setScrollLeft: a2 }; }; let Wx = 1; const Yx = vue.defineComponent({ name: "ElTable", directives: { Mousewheel: Tg }, components: { TableHeader: Mx, TableBody: Tx, TableFooter: Ix, ElScrollbar: zp, hColgroup: zx }, props: jx, emits: ["select", "select-all", "selection-change", "cell-mouse-enter", "cell-mouse-leave", "cell-contextmenu", "cell-click", "cell-dblclick", "row-click", "row-contextmenu", "row-dblclick", "header-click", "header-contextmenu", "sort-change", "filter-change", "current-change", "header-dragend", "expand-change"], setup(e2) { const { t: t2 } = Wu(); const n2 = Xu("table"); const o2 = vue.getCurrentInstance(); vue.provide(kx, o2); const a2 = fx(o2, e2); o2.store = a2; const r2 = new hx({ store: o2.store, table: o2, fit: e2.fit, showHeader: e2.showHeader }); o2.layout = r2; const i2 = vue.computed(() => (a2.states.data.value || []).length === 0); const { setCurrentRow: u2, getSelectionRows: c2, toggleRowSelection: d2, clearSelection: f2, clearFilter: p2, toggleAllSelection: v2, toggleRowExpansion: m2, clearSort: h2, sort: g2 } = Bx(a2); const { isHidden: y2, renderExpanded: w2, setDragVisible: x2, isGroup: k2, handleMouseLeave: C2, handleHeaderFooterMousewheel: S2, tableSize: E2, emptyBlockStyle: _2, handleFixedMousewheel: O2, resizeProxyVisible: M2, bodyWidth: L2, resizeState: D2, doLayout: A2, tableBodyStyles: R2, tableLayout: $2, scrollbarViewStyle: T2, tableInnerStyle: P2, scrollbarStyle: N2 } = Vx(e2, r2, a2, o2); const { scrollBarRef: I2, scrollTo: B2, setScrollLeft: V2, setScrollTop: F2 } = Hx(); const j2 = Ds(A2, 50); const z2 = `${n2.namespace.value}-table_${Wx++}`; o2.tableId = z2; o2.state = { isGroup: k2, resizeState: D2, doLayout: A2, debouncedUpdateLayout: j2 }; const H2 = vue.computed(() => e2.sumText || t2("el.table.sumText")); const W2 = vue.computed(() => e2.emptyText || t2("el.table.emptyText")); const Y2 = vue.computed(() => _x(a2.states.originColumns.value)[0]); Fx(o2); return { ns: n2, layout: r2, store: a2, columns: Y2, handleHeaderFooterMousewheel: S2, handleMouseLeave: C2, tableId: z2, tableSize: E2, isHidden: y2, isEmpty: i2, renderExpanded: w2, resizeProxyVisible: M2, resizeState: D2, isGroup: k2, bodyWidth: L2, tableBodyStyles: R2, emptyBlockStyle: _2, debouncedUpdateLayout: j2, handleFixedMousewheel: O2, setCurrentRow: u2, getSelectionRows: c2, toggleRowSelection: d2, clearSelection: f2, clearFilter: p2, toggleAllSelection: v2, toggleRowExpansion: m2, clearSort: h2, doLayout: A2, sort: g2, t: t2, setDragVisible: x2, context: o2, computedSumText: H2, computedEmptyText: W2, tableLayout: $2, scrollbarViewStyle: T2, tableInnerStyle: P2, scrollbarStyle: N2, scrollBarRef: I2, scrollTo: B2, setScrollLeft: V2, setScrollTop: F2 }; } }); function Ux(e2, a2, r2, l2, s2, i2) { const u2 = vue.resolveComponent("hColgroup"); const c2 = vue.resolveComponent("table-header"); const d2 = vue.resolveComponent("table-body"); const f2 = vue.resolveComponent("table-footer"); const p2 = vue.resolveComponent("el-scrollbar"); const v2 = vue.resolveDirective("mousewheel"); return vue.openBlock(), vue.createElementBlock("div", { ref: "tableWrapper", class: vue.normalizeClass([{ [e2.ns.m("fit")]: e2.fit, [e2.ns.m("striped")]: e2.stripe, [e2.ns.m("border")]: e2.border || e2.isGroup, [e2.ns.m("hidden")]: e2.isHidden, [e2.ns.m("group")]: e2.isGroup, [e2.ns.m("fluid-height")]: e2.maxHeight, [e2.ns.m("scrollable-x")]: e2.layout.scrollX.value, [e2.ns.m("scrollable-y")]: e2.layout.scrollY.value, [e2.ns.m("enable-row-hover")]: !e2.store.states.isComplex.value, [e2.ns.m("enable-row-transition")]: (e2.store.states.data.value || []).length !== 0 && (e2.store.states.data.value || []).length < 100, "has-footer": e2.showSummary }, e2.ns.m(e2.tableSize), e2.className, e2.ns.b(), e2.ns.m(`layout-${e2.tableLayout}`)]), style: vue.normalizeStyle(e2.style), "data-prefix": e2.ns.namespace.value, onMouseleave: e2.handleMouseLeave }, [vue.createElementVNode("div", { class: vue.normalizeClass(e2.ns.e("inner-wrapper")), style: vue.normalizeStyle(e2.tableInnerStyle) }, [vue.createElementVNode("div", { ref: "hiddenColumns", class: "hidden-columns" }, [vue.renderSlot(e2.$slots, "default")], 512), e2.showHeader && e2.tableLayout === "fixed" ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", { key: 0, ref: "headerWrapper", class: vue.normalizeClass(e2.ns.e("header-wrapper")) }, [vue.createElementVNode("table", { ref: "tableHeader", class: vue.normalizeClass(e2.ns.e("header")), style: vue.normalizeStyle(e2.tableBodyStyles), border: "0", cellpadding: "0", cellspacing: "0" }, [vue.createVNode(u2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), vue.createVNode(c2, { ref: "tableHeaderRef", border: e2.border, "default-sort": e2.defaultSort, store: e2.store, onSetDragVisible: e2.setDragVisible }, null, 8, ["border", "default-sort", "store", "onSetDragVisible"])], 6)], 2)), [[v2, e2.handleHeaderFooterMousewheel]]) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { ref: "bodyWrapper", class: vue.normalizeClass(e2.ns.e("body-wrapper")) }, [vue.createVNode(p2, { ref: "scrollBarRef", "view-style": e2.scrollbarViewStyle, "wrap-style": e2.scrollbarStyle, always: e2.scrollbarAlwaysOn }, { default: vue.withCtx(() => [vue.createElementVNode("table", { ref: "tableBody", class: vue.normalizeClass(e2.ns.e("body")), cellspacing: "0", cellpadding: "0", border: "0", style: vue.normalizeStyle({ width: e2.bodyWidth, tableLayout: e2.tableLayout }) }, [vue.createVNode(u2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), e2.showHeader && e2.tableLayout === "auto" ? (vue.openBlock(), vue.createBlock(c2, { key: 0, ref: "tableHeaderRef", class: vue.normalizeClass(e2.ns.e("body-header")), border: e2.border, "default-sort": e2.defaultSort, store: e2.store, onSetDragVisible: e2.setDragVisible }, null, 8, ["class", "border", "default-sort", "store", "onSetDragVisible"])) : vue.createCommentVNode("v-if", true), vue.createVNode(d2, { context: e2.context, highlight: e2.highlightCurrentRow, "row-class-name": e2.rowClassName, "tooltip-effect": e2.tooltipEffect, "tooltip-options": e2.tooltipOptions, "row-style": e2.rowStyle, store: e2.store, stripe: e2.stripe }, null, 8, ["context", "highlight", "row-class-name", "tooltip-effect", "tooltip-options", "row-style", "store", "stripe"]), e2.showSummary && e2.tableLayout === "auto" ? (vue.openBlock(), vue.createBlock(f2, { key: 1, class: vue.normalizeClass(e2.ns.e("body-footer")), border: e2.border, "default-sort": e2.defaultSort, store: e2.store, "sum-text": e2.computedSumText, "summary-method": e2.summaryMethod }, null, 8, ["class", "border", "default-sort", "store", "sum-text", "summary-method"])) : vue.createCommentVNode("v-if", true)], 6), e2.isEmpty ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, ref: "emptyBlock", style: vue.normalizeStyle(e2.emptyBlockStyle), class: vue.normalizeClass(e2.ns.e("empty-block")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(e2.ns.e("empty-text")) }, [vue.renderSlot(e2.$slots, "empty", {}, () => [vue.createTextVNode(vue.toDisplayString(e2.computedEmptyText), 1)])], 2)], 6)) : vue.createCommentVNode("v-if", true), e2.$slots.append ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, ref: "appendWrapper", class: vue.normalizeClass(e2.ns.e("append-wrapper")) }, [vue.renderSlot(e2.$slots, "append")], 2)) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["view-style", "wrap-style", "always"])], 2), e2.showSummary && e2.tableLayout === "fixed" ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", { key: 1, ref: "footerWrapper", class: vue.normalizeClass(e2.ns.e("footer-wrapper")) }, [vue.createElementVNode("table", { class: vue.normalizeClass(e2.ns.e("footer")), cellspacing: "0", cellpadding: "0", border: "0", style: vue.normalizeStyle(e2.tableBodyStyles) }, [vue.createVNode(u2, { columns: e2.store.states.columns.value, "table-layout": e2.tableLayout }, null, 8, ["columns", "table-layout"]), vue.createVNode(f2, { border: e2.border, "default-sort": e2.defaultSort, store: e2.store, "sum-text": e2.computedSumText, "summary-method": e2.summaryMethod }, null, 8, ["border", "default-sort", "store", "sum-text", "summary-method"])], 6)], 2)), [[vue.vShow, !e2.isEmpty], [v2, e2.handleHeaderFooterMousewheel]]) : vue.createCommentVNode("v-if", true), e2.border || e2.isGroup ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass(e2.ns.e("border-left-patch")) }, null, 2)) : vue.createCommentVNode("v-if", true)], 6), vue.withDirectives(vue.createElementVNode("div", { ref: "resizeProxy", class: vue.normalizeClass(e2.ns.e("column-resize-proxy")) }, null, 2), [[vue.vShow, e2.resizeProxyVisible]])], 46, ["data-prefix", "onMouseleave"]); } var Kx = np(Yx, [["render", Ux], ["__file", "table.vue"]]); const qx = { selection: "table-column--selection", expand: "table__expand-column" }; const Gx = { default: { order: "" }, selection: { width: 48, minWidth: 48, realWidth: 48, order: "" }, expand: { width: 48, minWidth: 48, realWidth: 48, order: "" }, index: { width: 48, minWidth: 48, realWidth: 48, order: "" } }; const Xx = (e2) => qx[e2] || ""; const Zx = { selection: { renderHeader({ store: e2, column: t2 }) { function n2() { return e2.states.data.value && e2.states.data.value.length === 0; } return vue.h(iy, { disabled: n2(), size: e2.states.tableSize.value, indeterminate: e2.states.selection.value.length > 0 && !e2.states.isAllSelected.value, "onUpdate:modelValue": e2.toggleAllSelection, modelValue: e2.states.isAllSelected.value, ariaLabel: t2.label }); }, renderCell({ row: e2, column: t2, store: n2, $index: o2 }) { return vue.h(iy, { disabled: t2.selectable ? !t2.selectable.call(null, e2, o2) : false, size: n2.states.tableSize.value, onChange: () => { n2.commit("rowSelectedChanged", e2); }, onClick: (e3) => e3.stopPropagation(), modelValue: n2.isSelected(e2), ariaLabel: t2.label }); }, sortable: false, resizable: false }, index: { renderHeader({ column: e2 }) { return e2.label || "#"; }, renderCell({ column: e2, $index: t2 }) { let n2 = t2 + 1; const o2 = e2.index; if (typeof o2 === "number") { n2 = t2 + o2; } else if (typeof o2 === "function") { n2 = o2(t2); } return vue.h("div", {}, [n2]); }, sortable: false }, expand: { renderHeader({ column: e2 }) { return e2.label || ""; }, renderCell({ row: e2, store: t2, expanded: n2 }) { const { ns: o2 } = t2; const a2 = [o2.e("expand-icon")]; if (n2) { a2.push(o2.em("expand-icon", "expanded")); } const r2 = function(n3) { n3.stopPropagation(); t2.toggleRowExpansion(e2); }; return vue.h("div", { class: a2, onClick: r2 }, { default: () => [vue.h(sp, null, { default: () => [vue.h(Ci)] })] }); }, sortable: false, resizable: false } }; function Jx({ row: e2, column: t2, $index: n2 }) { var o2; const a2 = t2.property; const r2 = a2 && li(e2, a2).value; if (t2 && t2.formatter) { return t2.formatter(e2, t2, r2, n2); } return ((o2 = r2 == null ? void 0 : r2.toString) == null ? void 0 : o2.call(r2)) || ""; } function Qx({ row: e2, treeNode: t2, store: n2 }, o2 = false) { const { ns: a2 } = n2; if (!t2) { if (o2) { return [vue.h("span", { class: a2.e("placeholder") })]; } return null; } const r2 = []; const l2 = function(o3) { o3.stopPropagation(); if (t2.loading) { return; } n2.loadOrToggle(e2); }; if (t2.indent) { r2.push(vue.h("span", { class: a2.e("indent"), style: { "padding-left": `${t2.indent}px` } })); } if (typeof t2.expanded === "boolean" && !t2.noLazyChildren) { const e3 = [a2.e("expand-icon"), t2.expanded ? a2.em("expand-icon", "expanded") : ""]; let n3 = Ci; if (t2.loading) { n3 = Ki; } r2.push(vue.h("div", { class: e3, onClick: l2 }, { default: () => [vue.h(sp, { class: { [a2.is("loading")]: t2.loading } }, { default: () => [vue.h(n3)] })] })); } else { r2.push(vue.h("span", { class: a2.e("placeholder") })); } return r2; } function ek(e2, t2) { return e2.reduce((e3, t3) => { e3[t3] = t3; return e3; }, t2); } function tk(e2, t2) { const n2 = vue.getCurrentInstance(); const o2 = () => { const o3 = ["fixed"]; const a3 = { realWidth: "width", realMinWidth: "minWidth" }; const r2 = ek(o3, a3); Object.keys(r2).forEach((o4) => { const r3 = a3[o4]; if (wt(t2, r3)) { vue.watch(() => t2[r3], (t3) => { let a4 = t3; if (r3 === "width" && o4 === "realWidth") { a4 = jw(t3); } if (r3 === "minWidth" && o4 === "realMinWidth") { a4 = zw(t3); } n2.columnConfig.value[r3] = a4; n2.columnConfig.value[o4] = a4; const l2 = r3 === "fixed"; e2.value.store.scheduleLayout(l2); }); } }); }; const a2 = () => { const e3 = ["label", "filters", "filterMultiple", "filteredValue", "sortable", "index", "formatter", "className", "labelClassName", "filterClassName", "showOverflowTooltip"]; const o3 = { property: "prop", align: "realAlign", headerAlign: "realHeaderAlign" }; const a3 = ek(e3, o3); Object.keys(a3).forEach((e4) => { const a4 = o3[e4]; if (wt(t2, a4)) { vue.watch(() => t2[a4], (t3) => { n2.columnConfig.value[e4] = t3; }); } }); }; return { registerComplexWatchers: o2, registerNormalWatchers: a2 }; } function nk(e2, t2, n2) { const o2 = vue.getCurrentInstance(); const a2 = vue.ref(""); const r2 = vue.ref(false); const i2 = vue.ref(); const c2 = vue.ref(); const f2 = Xu("table"); vue.watchEffect(() => { i2.value = e2.align ? `is-${e2.align}` : null; i2.value; }); vue.watchEffect(() => { c2.value = e2.headerAlign ? `is-${e2.headerAlign}` : i2.value; c2.value; }); const p2 = vue.computed(() => { let e3 = o2.vnode.vParent || o2.parent; while (e3 && !e3.tableId && !e3.columnId) { e3 = e3.vnode.vParent || e3.parent; } return e3; }); const m2 = vue.computed(() => { const { store: e3 } = o2.parent; if (!e3) return false; const { treeData: t3 } = e3.states; const n3 = t3.value; return n3 && Object.keys(n3).length > 0; }); const h2 = vue.ref(jw(e2.width)); const g2 = vue.ref(zw(e2.minWidth)); const y2 = (e3) => { if (h2.value) e3.width = h2.value; if (g2.value) { e3.minWidth = g2.value; } if (!h2.value && g2.value) { e3.width = void 0; } if (!e3.minWidth) { e3.minWidth = 80; } e3.realWidth = Number(e3.width === void 0 ? e3.minWidth : e3.width); return e3; }; const b2 = (e3) => { const t3 = e3.type; const n3 = Zx[t3] || {}; Object.keys(n3).forEach((t4) => { const o4 = n3[t4]; if (t4 !== "className" && o4 !== void 0) { e3[t4] = o4; } }); const o3 = Xx(t3); if (o3) { const t4 = `${vue.unref(f2.namespace)}-${o3}`; e3.className = e3.className ? `${e3.className} ${t4}` : t4; } return e3; }; const w2 = (e3) => { if (Array.isArray(e3)) { e3.forEach((e4) => t3(e4)); } else { t3(e3); } function t3(e4) { var t4; if (((t4 = e4 == null ? void 0 : e4.type) == null ? void 0 : t4.name) === "ElTableColumn") { e4.vParent = o2; } } }; const k2 = (a3) => { if (e2.renderHeader) ; else if (a3.type !== "selection") { a3.renderHeader = (e3) => { o2.columnConfig.value["label"]; return vue.renderSlot(t2, "header", e3, () => [a3.label]); }; } if (t2["filter-icon"]) { a3.renderFilterIcon = (e3) => vue.renderSlot(t2, "filter-icon", e3); } let r3 = a3.renderCell; if (a3.type === "expand") { a3.renderCell = (e3) => vue.h("div", { class: "cell" }, [r3(e3)]); n2.value.renderExpanded = (e3) => t2.default ? t2.default(e3) : t2.default; } else { r3 = r3 || Jx; a3.renderCell = (e3) => { let o3 = null; if (t2.default) { const n3 = t2.default(e3); o3 = n3.some((e4) => e4.type !== vue.Comment) ? n3 : r3(e3); } else { o3 = r3(e3); } const { columns: l2 } = n2.value.store.states; const s2 = l2.value.findIndex((e4) => e4.type === "default"); const i3 = m2.value && e3.cellIndex === s2; const c3 = Qx(e3, i3); const d2 = { class: "cell", style: {} }; if (a3.showOverflowTooltip) { d2.class = `${d2.class} ${vue.unref(f2.namespace)}-tooltip`; d2.style = { width: `${(e3.column.realWidth || Number(e3.column.width)) - 1}px` }; } w2(o3); return vue.h("div", d2, [c3, o3]); }; } return a3; }; const C2 = (...t3) => t3.reduce((t4, n3) => { if (Array.isArray(n3)) { n3.forEach((n4) => { t4[n4] = e2[n4]; }); } return t4; }, {}); const S2 = (e3, t3) => Array.prototype.indexOf.call(e3, t3); const E2 = () => { n2.value.store.commit("updateColumnOrder", o2.columnConfig.value); }; return { columnId: a2, realAlign: i2, isSubColumn: r2, realHeaderAlign: c2, columnOrTableParent: p2, setColumnWidth: y2, setColumnForcedProps: b2, setColumnRenders: k2, getPropsData: C2, getColumnElIndex: S2, updateColumnOrder: E2 }; } var ok = { type: { type: String, default: "default" }, label: String, className: String, labelClassName: String, property: String, prop: String, width: { type: [String, Number], default: "" }, minWidth: { type: [String, Number], default: "" }, renderHeader: Function, sortable: { type: [Boolean, String], default: false }, sortMethod: Function, sortBy: [String, Function, Array], resizable: { type: Boolean, default: true }, columnKey: String, align: String, headerAlign: String, showOverflowTooltip: { type: [Boolean, Object], default: void 0 }, fixed: [Boolean, String], formatter: Function, selectable: Function, reserveSelection: Boolean, filterMethod: Function, filteredValue: Array, filters: Array, filterPlacement: String, filterMultiple: { type: Boolean, default: true }, filterClassName: String, index: [Number, Function], sortOrders: { type: Array, default: () => ["ascending", "descending", null], validator: (e2) => e2.every((e3) => ["ascending", "descending", null].includes(e3)) } }; let ak = 1; var rk = vue.defineComponent({ name: "ElTableColumn", components: { ElCheckbox: iy }, props: ok, setup(e2, { slots: t2 }) { const n2 = vue.getCurrentInstance(); const o2 = vue.ref({}); const a2 = vue.computed(() => { let e3 = n2.parent; while (e3 && !e3.tableId) { e3 = e3.parent; } return e3; }); const { registerNormalWatchers: r2, registerComplexWatchers: i2 } = tk(a2, e2); const { columnId: u2, isSubColumn: d2, realHeaderAlign: p2, columnOrTableParent: m2, setColumnWidth: h2, setColumnForcedProps: g2, setColumnRenders: b2, getPropsData: w2, getColumnElIndex: x2, realAlign: k2, updateColumnOrder: C2 } = nk(e2, t2, a2); const S2 = m2.value; u2.value = `${S2.tableId || S2.columnId}_column_${ak++}`; vue.onBeforeMount(() => { d2.value = a2.value !== S2; const t3 = e2.type || "default"; const l2 = e2.sortable === "" ? true : e2.sortable; const s2 = Xs(e2.showOverflowTooltip) ? S2.props.showOverflowTooltip : e2.showOverflowTooltip; const c2 = { ...Gx[t3], id: u2.value, type: t3, property: e2.prop || e2.property, align: k2, headerAlign: p2, showOverflowTooltip: s2, filterable: e2.filters || e2.filterMethod, filteredValue: [], filterPlacement: "", filterClassName: "", isColumnGroup: false, isSubColumn: false, filterOpened: false, sortable: l2, index: e2.index, rawColumnKey: n2.vnode.key }; const f2 = ["columnKey", "label", "className", "labelClassName", "type", "renderHeader", "formatter", "fixed", "resizable"]; const v2 = ["sortMethod", "sortBy", "sortOrders"]; const m3 = ["selectable", "reserveSelection"]; const y2 = ["filterMethod", "filters", "filterMultiple", "filterOpened", "filteredValue", "filterPlacement", "filterClassName"]; let x3 = w2(f2, v2, m3, y2); x3 = Fw(c2, x3); const C3 = Ww(b2, h2, g2); x3 = C3(x3); o2.value = x3; r2(); i2(); }); vue.onMounted(() => { var e3; const t3 = m2.value; const r3 = d2.value ? t3.vnode.el.children : (e3 = t3.refs.hiddenColumns) == null ? void 0 : e3.children; const l2 = () => x2(r3 || [], n2.vnode.el); o2.value.getColumnIndex = l2; const s2 = l2(); s2 > -1 && a2.value.store.commit("insertColumn", o2.value, d2.value ? t3.columnConfig.value : null, C2); }); vue.onBeforeUnmount(() => { const e3 = o2.value.getColumnIndex(); e3 > -1 && a2.value.store.commit("removeColumn", o2.value, d2.value ? S2.columnConfig.value : null, C2); }); n2.columnId = u2.value; n2.columnConfig = o2; return; }, render() { var e2, t2, n2; try { const o2 = (t2 = (e2 = this.$slots).default) == null ? void 0 : t2.call(e2, { row: {}, column: {}, $index: -1 }); const a2 = []; if (Array.isArray(o2)) { for (const e3 of o2) { if (((n2 = e3.type) == null ? void 0 : n2.name) === "ElTableColumn" || e3.shapeFlag & 2) { a2.push(e3); } else if (e3.type === vue.Fragment && Array.isArray(e3.children)) { e3.children.forEach((e4) => { if ((e4 == null ? void 0 : e4.patchFlag) !== 1024 && !St(e4 == null ? void 0 : e4.children)) { a2.push(e4); } }); } } } const r2 = vue.h("div", a2); return r2; } catch (e3) { return vue.h("div", []); } } }); const lk = yu(Kx, { TableColumn: rk }); const sk = wu(rk); const ik = Symbol("tabsRootContextKey"); const uk = fu({ tabs: { type: uu(Array), default: () => $u([]) } }); const ck = "ElTabBar"; const dk = vue.defineComponent({ name: ck }); const fk = vue.defineComponent({ ...dk, props: uk, setup(e2, { expose: o2 }) { const a2 = e2; const r2 = vue.getCurrentInstance(); const l2 = vue.inject(ik); if (!l2) ii(ck, "<el-tabs><el-tab-bar /></el-tabs>"); const c2 = Xu("tabs"); const d2 = vue.ref(); const f2 = vue.ref(); const m2 = () => { let e3 = 0; let t2 = 0; const n2 = ["top", "bottom"].includes(l2.props.tabPosition) ? "width" : "height"; const o3 = n2 === "width" ? "x" : "y"; const s2 = o3 === "x" ? "left" : "top"; a2.tabs.every((o4) => { var a3, l3; const i2 = (l3 = (a3 = r2.parent) == null ? void 0 : a3.refs) == null ? void 0 : l3[`tab-${o4.uid}`]; if (!i2) return false; if (!o4.active) { return true; } e3 = i2[`offset${ai(s2)}`]; t2 = i2[`client${ai(n2)}`]; const u2 = window.getComputedStyle(i2); if (n2 === "width") { t2 -= Number.parseFloat(u2.paddingLeft) + Number.parseFloat(u2.paddingRight); e3 += Number.parseFloat(u2.paddingLeft); } return false; }); return { [n2]: `${t2}px`, transform: `translate${ai(o3)}(${e3}px)` }; }; const h2 = () => f2.value = m2(); vue.watch(() => a2.tabs, async () => { await vue.nextTick(); h2(); }, { immediate: true }); st(d2, () => h2()); o2({ ref: d2, update: h2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { ref_key: "barRef", ref: d2, class: vue.normalizeClass([vue.unref(c2).e("active-bar"), vue.unref(c2).is(vue.unref(l2).props.tabPosition)]), style: vue.normalizeStyle(f2.value) }, null, 6)); } }); var pk = np(fk, [["__file", "tab-bar.vue"]]); const vk = fu({ panes: { type: uu(Array), default: () => $u([]) }, currentName: { type: [String, Number], default: "" }, editable: Boolean, type: { type: String, values: ["card", "border-card", ""], default: "" }, stretch: Boolean }); const mk = { tabClick: (e2, t2, n2) => n2 instanceof Event, tabRemove: (e2, t2) => t2 instanceof Event }; const hk = "ElTabNav"; const gk = vue.defineComponent({ name: hk, props: vk, emits: mk, setup(e2, { expose: t2, emit: n2 }) { const o2 = vue.inject(ik); if (!o2) ii(hk, `<el-tabs><tab-nav /></el-tabs>`); const a2 = Xu("tabs"); const r2 = nt(); const s2 = ht(); const u2 = vue.ref(); const d2 = vue.ref(); const f2 = vue.ref(); const m2 = vue.ref(); const h2 = vue.ref(false); const g2 = vue.ref(0); const y2 = vue.ref(false); const b2 = vue.ref(true); const x2 = vue.computed(() => ["top", "bottom"].includes(o2.props.tabPosition) ? "width" : "height"); const k2 = vue.computed(() => { const e3 = x2.value === "width" ? "X" : "Y"; return { transform: `translate${e3}(-${g2.value}px)` }; }); const C2 = () => { if (!u2.value) return; const e3 = u2.value[`offset${ai(x2.value)}`]; const t3 = g2.value; if (!t3) return; const n3 = t3 > e3 ? t3 - e3 : 0; g2.value = n3; }; const S2 = () => { if (!u2.value || !d2.value) return; const e3 = d2.value[`offset${ai(x2.value)}`]; const t3 = u2.value[`offset${ai(x2.value)}`]; const n3 = g2.value; if (e3 - n3 <= t3) return; const o3 = e3 - n3 > t3 * 2 ? n3 + t3 : e3 - t3; g2.value = o3; }; const E2 = async () => { const e3 = d2.value; if (!h2.value || !f2.value || !u2.value || !e3) return; await vue.nextTick(); const t3 = f2.value.querySelector(".is-active"); if (!t3) return; const n3 = u2.value; const a3 = ["top", "bottom"].includes(o2.props.tabPosition); const r3 = t3.getBoundingClientRect(); const l2 = n3.getBoundingClientRect(); const s3 = a3 ? e3.offsetWidth - l2.width : e3.offsetHeight - l2.height; const i2 = g2.value; let c2 = i2; if (a3) { if (r3.left < l2.left) { c2 = i2 - (l2.left - r3.left); } if (r3.right > l2.right) { c2 = i2 + r3.right - l2.right; } } else { if (r3.top < l2.top) { c2 = i2 - (l2.top - r3.top); } if (r3.bottom > l2.bottom) { c2 = i2 + (r3.bottom - l2.bottom); } } c2 = Math.max(c2, 0); g2.value = Math.min(c2, s3); }; const _2 = () => { var t3; if (!d2.value || !u2.value) return; e2.stretch && ((t3 = m2.value) == null ? void 0 : t3.update()); const n3 = d2.value[`offset${ai(x2.value)}`]; const o3 = u2.value[`offset${ai(x2.value)}`]; const a3 = g2.value; if (o3 < n3) { h2.value = h2.value || {}; h2.value.prev = a3; h2.value.next = a3 + o3 < n3; if (n3 - a3 < o3) { g2.value = n3 - o3; } } else { h2.value = false; if (a3 > 0) { g2.value = 0; } } }; const O2 = (e3) => { const t3 = e3.code; const { up: n3, down: o3, left: a3, right: r3 } = ku; if (![n3, o3, a3, r3].includes(t3)) return; const l2 = Array.from(e3.currentTarget.querySelectorAll("[role=tab]:not(.is-disabled)")); const s3 = l2.indexOf(e3.target); let i2; if (t3 === a3 || t3 === n3) { if (s3 === 0) { i2 = l2.length - 1; } else { i2 = s3 - 1; } } else { if (s3 < l2.length - 1) { i2 = s3 + 1; } else { i2 = 0; } } l2[i2].focus({ preventScroll: true }); l2[i2].click(); M2(); }; const M2 = () => { if (b2.value) y2.value = true; }; const L2 = () => y2.value = false; vue.watch(r2, (e3) => { if (e3 === "hidden") { b2.value = false; } else if (e3 === "visible") { setTimeout(() => b2.value = true, 50); } }); vue.watch(s2, (e3) => { if (e3) { setTimeout(() => b2.value = true, 50); } else { b2.value = false; } }); st(f2, _2); vue.onMounted(() => setTimeout(() => E2(), 0)); vue.onUpdated(() => _2()); t2({ scrollToActiveTab: E2, removeFocus: L2 }); return () => { const t3 = h2.value ? [vue.createVNode("span", { class: [a2.e("nav-prev"), a2.is("disabled", !h2.value.prev)], onClick: C2 }, [vue.createVNode(sp, null, { default: () => [vue.createVNode(xi, null, null)] })]), vue.createVNode("span", { class: [a2.e("nav-next"), a2.is("disabled", !h2.value.next)], onClick: S2 }, [vue.createVNode(sp, null, { default: () => [vue.createVNode(Ci, null, null)] })])] : null; const r3 = e2.panes.map((t4, r4) => { var l2, s3, i2, u3; const c2 = t4.uid; const d3 = t4.props.disabled; const f3 = (s3 = (l2 = t4.props.name) != null ? l2 : t4.index) != null ? s3 : `${r4}`; const p2 = !d3 && (t4.isClosable || e2.editable); t4.index = `${r4}`; const v2 = p2 ? vue.createVNode(sp, { class: "is-icon-close", onClick: (e3) => n2("tabRemove", t4, e3) }, { default: () => [vue.createVNode(Ii, null, null)] }) : null; const m3 = ((u3 = (i2 = t4.slots).label) == null ? void 0 : u3.call(i2)) || t4.props.label; const h3 = !d3 && t4.active ? 0 : -1; return vue.createVNode("div", { ref: `tab-${c2}`, class: [a2.e("item"), a2.is(o2.props.tabPosition), a2.is("active", t4.active), a2.is("disabled", d3), a2.is("closable", p2), a2.is("focus", y2.value)], id: `tab-${f3}`, key: `tab-${c2}`, "aria-controls": `pane-${f3}`, role: "tab", "aria-selected": t4.active, tabindex: h3, onFocus: () => M2(), onBlur: () => L2(), onClick: (e3) => { L2(); n2("tabClick", t4, f3, e3); }, onKeydown: (e3) => { if (p2 && (e3.code === ku.delete || e3.code === ku.backspace)) { n2("tabRemove", t4, e3); } } }, [...[m3, v2]]); }); return vue.createVNode("div", { ref: f2, class: [a2.e("nav-wrap"), a2.is("scrollable", !!h2.value), a2.is(o2.props.tabPosition)] }, [t3, vue.createVNode("div", { class: a2.e("nav-scroll"), ref: u2 }, [vue.createVNode("div", { class: [a2.e("nav"), a2.is(o2.props.tabPosition), a2.is("stretch", e2.stretch && ["top", "bottom"].includes(o2.props.tabPosition))], ref: d2, style: k2.value, role: "tablist", onKeydown: O2 }, [...[!e2.type ? vue.createVNode(pk, { ref: m2, tabs: [...e2.panes] }, null) : null, r3]])])]); }; } }); const yk = fu({ type: { type: String, values: ["card", "border-card", ""], default: "" }, closable: Boolean, addable: Boolean, modelValue: { type: [String, Number] }, editable: Boolean, tabPosition: { type: String, values: ["top", "right", "bottom", "left"], default: "top" }, beforeLeave: { type: uu(Function), default: () => true }, stretch: Boolean }); const bk = (e2) => St(e2) || Js(e2); const wk = { [Su]: (e2) => bk(e2), tabClick: (e2, t2) => t2 instanceof Event, tabChange: (e2) => bk(e2), edit: (e2, t2) => ["remove", "add"].includes(t2), tabRemove: (e2) => bk(e2), tabAdd: () => true }; const xk = vue.defineComponent({ name: "ElTabs", props: yk, emits: wk, setup(e2, { emit: t2, slots: n2, expose: o2 }) { var a2; const r2 = Xu("tabs"); const u2 = vue.computed(() => ["left", "right"].includes(e2.tabPosition)); const { children: c2, addChild: d2, removeChild: f2 } = Nf(vue.getCurrentInstance(), "ElTabPane"); const p2 = vue.ref(); const m2 = vue.ref((a2 = e2.modelValue) != null ? a2 : "0"); const h2 = async (n3, o3 = false) => { var a3, r3, l2; if (m2.value === n3 || Xs(n3)) return; try { const s2 = await ((a3 = e2.beforeLeave) == null ? void 0 : a3.call(e2, n3, m2.value)); if (s2 !== false) { m2.value = n3; if (o3) { t2(Su, n3); t2("tabChange", n3); } (l2 = (r3 = p2.value) == null ? void 0 : r3.removeFocus) == null ? void 0 : l2.call(r3); } } catch (e3) { } }; const g2 = (e3, n3, o3) => { if (e3.props.disabled) return; h2(n3, true); t2("tabClick", e3, o3); }; const y2 = (e3, n3) => { if (e3.props.disabled || Xs(e3.props.name)) return; n3.stopPropagation(); t2("edit", e3.props.name, "remove"); t2("tabRemove", e3.props.name); }; const k2 = () => { t2("edit", void 0, "add"); t2("tabAdd"); }; vue.watch(() => e2.modelValue, (e3) => h2(e3)); vue.watch(m2, async () => { var e3; await vue.nextTick(); (e3 = p2.value) == null ? void 0 : e3.scrollToActiveTab(); }); vue.provide(ik, { props: e2, currentName: m2, registerPane: (e3) => { c2.value.push(e3); }, sortPane: d2, unregisterPane: f2 }); o2({ currentName: m2 }); const C2 = ({ render: e3 }) => e3(); return () => { const t3 = n2["add-icon"]; const o3 = e2.editable || e2.addable ? vue.createVNode("div", { class: [r2.e("new-tab"), u2.value && r2.e("new-tab-vertical")], tabindex: "0", onClick: k2, onKeydown: (e3) => { if (e3.code === ku.enter) k2(); } }, [t3 ? vue.renderSlot(n2, "add-icon") : vue.createVNode(sp, { class: r2.is("icon-plus") }, { default: () => [vue.createVNode(Zi, null, null)] })]) : null; const a3 = vue.createVNode("div", { class: [r2.e("header"), u2.value && r2.e("header-vertical"), r2.is(e2.tabPosition)] }, [vue.createVNode(C2, { render: () => { const t4 = c2.value.some((e3) => e3.slots.label); return vue.createVNode(gk, { ref: p2, currentName: m2.value, editable: e2.editable, type: e2.type, panes: c2.value, stretch: e2.stretch, onTabClick: g2, onTabRemove: y2 }, { $stable: !t4 }); } }, null), o3]); const l2 = vue.createVNode("div", { class: r2.e("content") }, [vue.renderSlot(n2, "default")]); return vue.createVNode("div", { class: [r2.b(), r2.m(e2.tabPosition), { [r2.m("card")]: e2.type === "card", [r2.m("border-card")]: e2.type === "border-card" }] }, [l2, a3]); }; } }); const kk = fu({ label: { type: String, default: "" }, name: { type: [String, Number] }, closable: Boolean, disabled: Boolean, lazy: Boolean }); const Ck = "ElTabPane"; const Sk = vue.defineComponent({ name: Ck }); const Ek = vue.defineComponent({ ...Sk, props: kk, setup(e2) { const o2 = e2; const a2 = vue.getCurrentInstance(); const r2 = vue.useSlots(); const d2 = vue.inject(ik); if (!d2) ii(Ck, "usage: <el-tabs><el-tab-pane /></el-tabs/>"); const f2 = Xu("tab-pane"); const m2 = vue.ref(); const h2 = vue.computed(() => o2.closable || d2.props.closable); const g2 = Ne(() => { var e3; return d2.currentName.value === ((e3 = o2.name) != null ? e3 : m2.value); }); const y2 = vue.ref(g2.value); const b2 = vue.computed(() => { var e3; return (e3 = o2.name) != null ? e3 : m2.value; }); const w2 = Ne(() => !o2.lazy || y2.value || g2.value); vue.watch(g2, (e3) => { if (e3) y2.value = true; }); const k2 = vue.reactive({ uid: a2.uid, slots: r2, props: o2, paneName: b2, active: g2, index: m2, isClosable: h2 }); d2.registerPane(k2); vue.onMounted(() => { d2.sortPane(k2); }); vue.onUnmounted(() => { d2.unregisterPane(k2.uid); }); return (e3, o3) => vue.unref(w2) ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", { key: 0, id: `pane-${vue.unref(b2)}`, class: vue.normalizeClass(vue.unref(f2).b()), role: "tabpanel", "aria-hidden": !vue.unref(g2), "aria-labelledby": `tab-${vue.unref(b2)}` }, [vue.renderSlot(e3.$slots, "default")], 10, ["id", "aria-hidden", "aria-labelledby"])), [[vue.vShow, vue.unref(g2)]]) : vue.createCommentVNode("v-if", true); } }); var _k = np(Ek, [["__file", "tab-pane.vue"]]); const Ok = yu(xk, { TabPane: _k }); const Mk = wu(_k); function Lk(t2) { let n2; const o2 = vue.ref(false); const a2 = vue.reactive({ ...t2, originalPosition: "", originalOverflow: "", visible: false }); function r2(e2) { a2.text = e2; } function l2() { const e2 = a2.parent; const t3 = f2.ns; if (!e2.vLoadingAddClassList) { let n3 = e2.getAttribute("loading-number"); n3 = Number.parseInt(n3) - 1; if (!n3) { pi(e2, t3.bm("parent", "relative")); e2.removeAttribute("loading-number"); } else { e2.setAttribute("loading-number", n3.toString()); } pi(e2, t3.bm("parent", "hidden")); } s2(); d2.unmount(); } function s2() { var e2, t3; (t3 = (e2 = f2.$el) == null ? void 0 : e2.parentNode) == null ? void 0 : t3.removeChild(f2.$el); } function i2() { var e2; if (t2.beforeClose && !t2.beforeClose()) return; o2.value = true; clearTimeout(n2); n2 = setTimeout(u2, 400); a2.visible = false; (e2 = t2.closed) == null ? void 0 : e2.call(t2); } function u2() { if (!o2.value) return; const e2 = a2.parent; o2.value = false; e2.vLoadingAddClassList = void 0; l2(); } const c2 = vue.defineComponent({ name: "ElLoading", setup(e2, { expose: t3 }) { const { ns: n3, zIndex: o3 } = Zf("loading"); t3({ ns: n3, zIndex: o3 }); return () => { const e3 = a2.spinner || a2.svg; const t4 = vue.h("svg", { class: "circular", viewBox: a2.svgViewBox ? a2.svgViewBox : "0 0 50 50", ...e3 ? { innerHTML: e3 } : {} }, [vue.h("circle", { class: "path", cx: "25", cy: "25", r: "20", fill: "none" })]); const o4 = a2.text ? vue.h("p", { class: n3.b("text") }, [a2.text]) : void 0; return vue.h(vue.Transition, { name: n3.b("fade"), onAfterLeave: u2 }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode("div", { style: { backgroundColor: a2.background || "" }, class: [n3.b("mask"), a2.customClass, a2.fullscreen ? "is-fullscreen" : ""] }, [vue.h("div", { class: n3.b("spinner") }, [t4, o4])]), [[vue.vShow, a2.visible]])]) }); }; } }); const d2 = vue.createApp(c2); const f2 = d2.mount(document.createElement("div")); return { ...vue.toRefs(a2), setText: r2, removeElLoadingChild: s2, close: i2, handleAfterLeave: u2, vm: f2, get $el() { return f2.$el; } }; } let Dk = void 0; const Ak = function(e2 = {}) { if (!Be) return void 0; const t2 = Rk(e2); if (t2.fullscreen && Dk) { return Dk; } const n2 = Lk({ ...t2, closed: () => { var e3; (e3 = t2.closed) == null ? void 0 : e3.call(t2); if (t2.fullscreen) Dk = void 0; } }); $k(t2, t2.parent, n2); Tk(t2, t2.parent, n2); t2.parent.vLoadingAddClassList = () => Tk(t2, t2.parent, n2); let o2 = t2.parent.getAttribute("loading-number"); if (!o2) { o2 = "1"; } else { o2 = `${Number.parseInt(o2) + 1}`; } t2.parent.setAttribute("loading-number", o2); t2.parent.appendChild(n2.$el); vue.nextTick(() => n2.visible.value = t2.visible); if (t2.fullscreen) { Dk = n2; } return n2; }; const Rk = (e2) => { var t2, n2, o2, a2; let r2; if (St(e2.target)) { r2 = (t2 = document.querySelector(e2.target)) != null ? t2 : document.body; } else { r2 = e2.target || document.body; } return { parent: r2 === document.body || e2.body ? document.body : r2, background: e2.background || "", svg: e2.svg || "", svgViewBox: e2.svgViewBox || "", spinner: e2.spinner || false, text: e2.text || "", fullscreen: r2 === document.body && ((n2 = e2.fullscreen) != null ? n2 : true), lock: (o2 = e2.lock) != null ? o2 : false, customClass: e2.customClass || "", visible: (a2 = e2.visible) != null ? a2 : true, beforeClose: e2.beforeClose, closed: e2.closed, target: r2 }; }; const $k = async (e2, t2, n2) => { const { nextZIndex: o2 } = n2.vm.zIndex || n2.vm._.exposed.zIndex; const a2 = {}; if (e2.fullscreen) { n2.originalPosition.value = vi(document.body, "position"); n2.originalOverflow.value = vi(document.body, "overflow"); a2.zIndex = o2(); } else if (e2.parent === document.body) { n2.originalPosition.value = vi(document.body, "position"); await vue.nextTick(); for (const t3 of ["top", "left"]) { const n3 = t3 === "top" ? "scrollTop" : "scrollLeft"; a2[t3] = `${e2.target.getBoundingClientRect()[t3] + document.body[n3] + document.documentElement[n3] - Number.parseInt(vi(document.body, `margin-${t3}`), 10)}px`; } for (const t3 of ["height", "width"]) { a2[t3] = `${e2.target.getBoundingClientRect()[t3]}px`; } } else { n2.originalPosition.value = vi(t2, "position"); } for (const [e3, t3] of Object.entries(a2)) { n2.$el.style[e3] = t3; } }; const Tk = (e2, t2, n2) => { const o2 = n2.vm.ns || n2.vm._.exposed.ns; if (!["absolute", "fixed", "sticky"].includes(n2.originalPosition.value)) { fi(t2, o2.bm("parent", "relative")); } else { pi(t2, o2.bm("parent", "relative")); } if (e2.fullscreen && e2.lock) { fi(t2, o2.bm("parent", "hidden")); } else { pi(t2, o2.bm("parent", "hidden")); } }; const Pk = Symbol("ElLoading"); const Nk = (e2, t2) => { var n2, o2, a2, r2; const l2 = t2.instance; const s2 = (e3) => Et(t2.value) ? t2.value[e3] : void 0; const i2 = (e3) => { const t3 = St(e3) && (l2 == null ? void 0 : l2[e3]) || e3; if (t3) return vue.ref(t3); else return t3; }; const u2 = (t3) => i2(s2(t3) || e2.getAttribute(`element-loading-${$t(t3)}`)); const c2 = (n2 = s2("fullscreen")) != null ? n2 : t2.modifiers.fullscreen; const d2 = { text: u2("text"), svg: u2("svg"), svgViewBox: u2("svgViewBox"), spinner: u2("spinner"), background: u2("background"), customClass: u2("customClass"), fullscreen: c2, target: (o2 = s2("target")) != null ? o2 : c2 ? void 0 : e2, body: (a2 = s2("body")) != null ? a2 : t2.modifiers.body, lock: (r2 = s2("lock")) != null ? r2 : t2.modifiers.lock }; e2[Pk] = { options: d2, instance: Ak(d2) }; }; const Ik = (e2, t2) => { for (const n2 of Object.keys(t2)) { if (vue.isRef(t2[n2])) t2[n2].value = e2[n2]; } }; const Bk = { mounted(e2, t2) { if (t2.value) { Nk(e2, t2); } }, updated(e2, t2) { const n2 = e2[Pk]; if (t2.oldValue !== t2.value) { if (t2.value && !t2.oldValue) { Nk(e2, t2); } else if (t2.value && t2.oldValue) { if (Et(t2.value)) Ik(t2.value, n2.options); } else { n2 == null ? void 0 : n2.instance.close(); } } }, unmounted(e2) { var t2; (t2 = e2[Pk]) == null ? void 0 : t2.instance.close(); e2[Pk] = null; } }; const Vk = ["success", "info", "warning", "error"]; const Fk = $u({ customClass: "", center: false, dangerouslyUseHTMLString: false, duration: 3e3, icon: void 0, id: "", message: "", onClose: void 0, showClose: false, type: "info", plain: false, offset: 16, zIndex: 0, grouping: false, repeatNum: 1, appendTo: Be ? document.body : void 0 }); const jk = fu({ customClass: { type: String, default: Fk.customClass }, center: { type: Boolean, default: Fk.center }, dangerouslyUseHTMLString: { type: Boolean, default: Fk.dangerouslyUseHTMLString }, duration: { type: Number, default: Fk.duration }, icon: { type: pu, default: Fk.icon }, id: { type: String, default: Fk.id }, message: { type: uu([String, Object, Function]), default: Fk.message }, onClose: { type: uu(Function), default: Fk.onClose }, showClose: { type: Boolean, default: Fk.showClose }, type: { type: String, values: Vk, default: Fk.type }, plain: { type: Boolean, default: Fk.plain }, offset: { type: Number, default: Fk.offset }, zIndex: { type: Number, default: Fk.zIndex }, grouping: { type: Boolean, default: Fk.grouping }, repeatNum: { type: Number, default: Fk.repeatNum } }); const zk = { destroy: () => true }; const Hk = vue.shallowReactive([]); const Wk = (e2) => { const t2 = Hk.findIndex((t3) => t3.id === e2); const n2 = Hk[t2]; let o2; if (t2 > 0) { o2 = Hk[t2 - 1]; } return { current: n2, prev: o2 }; }; const Yk = (e2) => { const { prev: t2 } = Wk(e2); if (!t2) return 0; return t2.vm.exposed.bottom.value; }; const Uk = (e2, t2) => { const n2 = Hk.findIndex((t3) => t3.id === e2); return n2 > 0 ? 16 : t2; }; const Kk = vue.defineComponent({ name: "ElMessage" }); const qk = vue.defineComponent({ ...Kk, props: jk, emits: zk, setup(e2, { expose: a2 }) { const r2 = e2; const { Close: s2 } = mu; const { ns: d2, zIndex: f2 } = Zf("message"); const { currentZIndex: p2, nextZIndex: m2 } = f2; const h2 = vue.ref(); const g2 = vue.ref(false); const y2 = vue.ref(0); let b2 = void 0; const w2 = vue.computed(() => r2.type ? r2.type === "error" ? "danger" : r2.type : "info"); const k2 = vue.computed(() => { const e3 = r2.type; return { [d2.bm("icon", e3)]: e3 && hu[e3] }; }); const C2 = vue.computed(() => r2.icon || hu[r2.type] || ""); const S2 = vue.computed(() => Yk(r2.id)); const E2 = vue.computed(() => Uk(r2.id, r2.offset) + S2.value); const _2 = vue.computed(() => y2.value + E2.value); const F2 = vue.computed(() => ({ top: `${E2.value}px`, zIndex: p2.value })); function j2() { if (r2.duration === 0) return; ({ stop: b2 } = Ue(() => { H2(); }, r2.duration)); } function z2() { b2 == null ? void 0 : b2(); } function H2() { g2.value = false; } function W2({ code: e3 }) { if (e3 === ku.esc) { H2(); } } vue.onMounted(() => { j2(); m2(); g2.value = true; }); vue.watch(() => r2.repeatNum, () => { z2(); j2(); }); Xe(document, "keydown", W2); st(h2, () => { y2.value = h2.value.getBoundingClientRect().height; }); a2({ visible: g2, bottom: _2, close: H2 }); return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(d2).b("fade"), onBeforeLeave: e3.onClose, onAfterLeave: (t2) => e3.$emit("destroy"), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createElementVNode("div", { id: e3.id, ref_key: "messageRef", ref: h2, class: vue.normalizeClass([vue.unref(d2).b(), { [vue.unref(d2).m(e3.type)]: e3.type }, vue.unref(d2).is("center", e3.center), vue.unref(d2).is("closable", e3.showClose), vue.unref(d2).is("plain", e3.plain), e3.customClass]), style: vue.normalizeStyle(vue.unref(F2)), role: "alert", onMouseenter: z2, onMouseleave: j2 }, [e3.repeatNum > 1 ? (vue.openBlock(), vue.createBlock(vue.unref(Mm), { key: 0, value: e3.repeatNum, type: vue.unref(w2), class: vue.normalizeClass(vue.unref(d2).e("badge")) }, null, 8, ["value", "type", "class"])) : vue.createCommentVNode("v-if", true), vue.unref(C2) ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 1, class: vue.normalizeClass([vue.unref(d2).e("icon"), vue.unref(k2)]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(C2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.renderSlot(e3.$slots, "default", {}, () => [!e3.dangerouslyUseHTMLString ? (vue.openBlock(), vue.createElementBlock("p", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("content")) }, vue.toDisplayString(e3.message), 3)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createCommentVNode(" Caution here, message could've been compromised, never use user's input as message "), vue.createElementVNode("p", { class: vue.normalizeClass(vue.unref(d2).e("content")), innerHTML: e3.message }, null, 10, ["innerHTML"])], 2112))]), e3.showClose ? (vue.openBlock(), vue.createBlock(vue.unref(sp), { key: 2, class: vue.normalizeClass(vue.unref(d2).e("closeBtn")), onClick: vue.withModifiers(H2, ["stop"]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(s2))]), _: 1 }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true)], 46, ["id"]), [[vue.vShow, g2.value]])]), _: 3 }, 8, ["name", "onBeforeLeave", "onAfterLeave"])); } }); var Gk = np(qk, [["__file", "message.vue"]]); let Xk = 1; const Zk = (e2) => { const t2 = !e2 || St(e2) || vue.isVNode(e2) || Ct(e2) ? { message: e2 } : e2; const n2 = { ...Fk, ...t2 }; if (!n2.appendTo) { n2.appendTo = document.body; } else if (St(n2.appendTo)) { let e3 = document.querySelector(n2.appendTo); if (!ei(e3)) { e3 = document.body; } n2.appendTo = e3; } return n2; }; const Jk = (e2) => { const t2 = Hk.indexOf(e2); if (t2 === -1) return; Hk.splice(t2, 1); const { handler: n2 } = e2; n2.close(); }; const Qk = ({ appendTo: e2, ...t2 }, n2) => { const o2 = `message_${Xk++}`; const a2 = t2.onClose; const l2 = document.createElement("div"); const s2 = { ...t2, id: o2, onClose: () => { a2 == null ? void 0 : a2(); Jk(d2); }, onDestroy: () => { vue.render(null, l2); } }; const i2 = vue.createVNode(Gk, s2, Ct(s2.message) || vue.isVNode(s2.message) ? { default: Ct(s2.message) ? s2.message : () => s2.message } : null); i2.appContext = n2 || eC._context; vue.render(i2, l2); e2.appendChild(l2.firstElementChild); const u2 = i2.component; const c2 = { close: () => { u2.exposed.visible.value = false; } }; const d2 = { id: o2, vnode: i2, vm: u2, handler: c2, props: i2.component.props }; return d2; }; const eC = (e2 = {}, t2) => { if (!Be) return { close: () => void 0 }; if (Js(tp.max) && Hk.length >= tp.max) { return { close: () => void 0 }; } const n2 = Zk(e2); if (n2.grouping && Hk.length) { const e3 = Hk.find(({ vnode: e4 }) => { var t3; return ((t3 = e4.props) == null ? void 0 : t3.message) === n2.message; }); if (e3) { e3.props.repeatNum += 1; e3.props.type = n2.type; return e3.handler; } } const o2 = Qk(n2, t2); Hk.push(o2); return o2.handler; }; Vk.forEach((e2) => { eC[e2] = (t2 = {}, n2) => { const o2 = Zk(t2); return eC({ ...o2, type: e2 }, n2); }; }); function tC(e2) { for (const t2 of Hk) { if (!e2 || e2 === t2.props.type) { t2.handler.close(); } } } eC.closeAll = tC; eC._context = null; const nC = bu(eC, "$message"); var oC = /* @__PURE__ */ (() => typeof GM_registerMenuCommand != "undefined" ? GM_registerMenuCommand : void 0)(); var aC = /* @__PURE__ */ (() => typeof GM_xmlhttpRequest != "undefined" ? GM_xmlhttpRequest : void 0)(); var rC = /* @__PURE__ */ (() => typeof unsafeWindow != "undefined" ? unsafeWindow : void 0)(); const lC = (e2) => { let { url: t2 } = e2; const { method: n2, params: o2, data: a2, responseType: r2, headers: l2 } = e2; if ((n2 === "get" || n2 === "GET") && o2) { t2 += `?${ce.stringify(o2)}`; } return new Promise((e3, o3) => { aC({ method: n2, url: t2, data: a2, responseType: r2 ? r2 : "json", headers: { "Content-Type": "application/x-www-form-urlencoded", ...l2 }, onload(t3) { e3(t3); }, onerror(e4) { o3(e4); } }); }); }; const sC = "https://www.doseeing.com/data"; const iC = (e2) => lC({ url: `${sC}/fan/${e2}`, method: "get", responseType: "text" }); const uC = (e2) => lC({ url: `${sC}/api/user_feed`, method: "get", params: e2 }); const cC = { class: "flex justify-between" }; const dC = { class: "flex-1" }; const fC = { class: "text-slate-400" }; const pC = ["innerHTML"]; const vC = ["src"]; const mC = vue.defineComponent({ __name: "DanmuRow", props: { data: {}, nickName: {} }, setup(e2) { const a2 = e2; const r2 = () => { window.open(`https://www.doseeing.com/data/room/${a2.data.rid}`); }; const l2 = (e3) => { navigator.clipboard.writeText(`@${a2.nickName}:${e3}`); nC.success("复制成功"); }; const s2 = (e3) => { navigator.clipboard.writeText(e3); nC.success("复制成功"); }; const i2 = (e3) => ue.unix(e3).format("YYYY-MM-DD HH:mm:ss"); return (e3, u2) => { const c2 = wh; return vue.openBlock(), vue.createElementBlock("div", cC, [vue.createElementVNode("div", dC, [vue.createElementVNode("div", fC, [vue.createElementVNode("span", null, vue.toDisplayString(i2(a2.data.ts)), 1), vue.createVNode(c2, { class: "ml-5", type: "primary", size: "small", plain: "", onClick: u2[0] || (u2[0] = () => s2(a2.data.txt)) }, { default: vue.withCtx(() => [vue.createTextVNode("复制")]), _: 1 }), vue.createVNode(c2, { class: "ml-12", type: "primary", size: "small", plain: "", onClick: u2[1] || (u2[1] = () => l2(a2.data.txt)) }, { default: vue.withCtx(() => [vue.createTextVNode("含名称复制")]), _: 1 })]), vue.createElementVNode("div", { class: "font-black text-3xl", innerHTML: a2.data.txt }, null, 8, pC)]), vue.createElementVNode("div", { class: "flex w-56 cursor-pointer items-center flex-none", onClick: r2 }, [vue.createElementVNode("img", { src: `https://apic.douyucdn.cn/upload/${a2.data["room.av"]}_middle.jpg`, class: "w-16 h-16 rounded-md" }, null, 8, vC), vue.createElementVNode("div", null, vue.toDisplayString(a2.data["room.nn"]), 1)])]); }; } }); const hC = { class: "flex justify-between mb-4" }; const gC = { class: "flex items-start" }; const yC = ["src"]; const bC = { class: "font-black text-xl ml-2" }; const wC = { class: "flex justify-between" }; const xC = { key: 1, class: "h-[58vh] text-center" }; const kC = 50; const CC = vue.defineComponent({ __name: "index", props: { rel: {}, nickName: {}, avatar: {} }, setup(e2) { const a2 = e2; const r2 = vue.ref(false); const l2 = vue.ref(""); const s2 = vue.ref(false); const u2 = vue.ref([]); const c2 = vue.ref("1"); const d2 = vue.ref(ue().format()); const f2 = vue.ref(0); const p2 = vue.ref(["chat"]); const m2 = vue.reactive({}); let h2 = true; const g2 = vue.ref(null); const y2 = [{ title: "弹幕", value: "chat" }, { title: "礼物", value: "gift" }]; vue.watch(p2, (e3) => { y2.forEach((t2) => m2[t2.value] = e3.includes(t2.value)); }, { immediate: true }); const b2 = () => { window.open(`https://www.doseeing.com/data/fan/${a2.rel}`); }; const w2 = async () => { f2.value = 0; await L2(); }; const x2 = () => { d2.value = ue(d2.value).add(1, "day").format(); w2(); }; const k2 = () => { d2.value = ue(d2.value).subtract(1, "day").format(); w2(); }; const C2 = ({ scrollTop: e3 }) => { if (g2.value.wrapRef.scrollHeight - e3 <= g2.value.wrapRef.clientHeight && h2) { f2.value += kC; L2(); } }; let S2; const E2 = async () => { S2 = document.createElement("style"); S2.textContent = "body{overflow:hidden;}"; document.head.appendChild(S2); r2.value = true; s2.value = true; f2.value = 0; try { const { finalUrl: e3, response: t2 } = await iC(a2.rel); if (e3.startsWith("https://www.doseeing.com/login")) { nC.error("未登录(不可用)doseeing,请先登录(不可用)"); return; } const n2 = R2(t2, 'data-id="', '"'); if (!n2) { nC.error("未获取到用户id"); return; } l2.value = n2; await L2(); } finally { s2.value = false; } }; E2(); const _2 = () => { S2.remove(); }; const L2 = async () => { try { s2.value = true; const { response: { result: e3 } } = await uC({ uid: l2.value, dt: ue(d2.value).format("YYYY-MM-DD"), offset: f2.value, order: c2.value }); if (f2.value === 0) { u2.value = e3; g2.value && g2.value.wrapRef && g2.value.setScrollTop(0); } else { u2.value = [...u2.value, ...e3]; } h2 = e3.length === kC; } finally { s2.value = false; } }; const R2 = (e3, t2, n2) => { const o2 = new RegExp(t2 + "(.*?)" + n2, "s"); const a3 = e3.match(o2); return a3 ? a3[1] : null; }; return (e3, l3) => { const i2 = wh; const f3 = Ly; const v2 = My; const h3 = iy; const S3 = uy; const E3 = Wb; const L3 = pw; const R3 = zp; const $2 = iw; const N2 = Bk; return vue.openBlock(), vue.createBlock($2, { modelValue: r2.value, "onUpdate:modelValue": l3[3] || (l3[3] = (e4) => r2.value = e4), title: "弹幕历史", width: "70%", top: "6vh", "destroy-on-close": "", "lock-scroll": "", onClosed: _2 }, { default: vue.withCtx(() => [vue.createElementVNode("div", hC, [vue.createElementVNode("div", gC, [vue.createElementVNode("img", { src: a2.avatar, class: "h-20 w-20 rounded-xl" }, null, 8, yC), vue.createElementVNode("span", bC, vue.toDisplayString(a2.nickName), 1)]), vue.createVNode(i2, { type: "primary", size: "small", onClick: b2 }, { default: vue.withCtx(() => [vue.createTextVNode("详情")]), _: 1 })]), vue.createElementVNode("div", wC, [vue.createElementVNode("div", null, [vue.createVNode(v2, { modelValue: c2.value, "onUpdate:modelValue": l3[0] || (l3[0] = (e4) => c2.value = e4), onChange: w2 }, { default: vue.withCtx(() => [vue.createVNode(f3, { label: "时间正序", value: "0" }), vue.createVNode(f3, { label: "时间倒序", value: "1" })]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(S3, { modelValue: p2.value, "onUpdate:modelValue": l3[1] || (l3[1] = (e4) => p2.value = e4) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(y2, (e4) => vue.createVNode(h3, { value: e4.value }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(e4.title), 1)]), _: 2 }, 1032, ["value"])), 64))]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(i2, { type: "primary", onClick: k2 }, { default: vue.withCtx(() => [vue.createTextVNode("前一天")]), _: 1 }), vue.createVNode(E3, { modelValue: d2.value, "onUpdate:modelValue": l3[2] || (l3[2] = (e4) => d2.value = e4), onChange: w2 }, null, 8, ["modelValue"]), vue.createVNode(i2, { type: "primary", onClick: x2 }, { default: vue.withCtx(() => [vue.createTextVNode("后一天")]), _: 1 })])]), vue.createVNode(L3), u2.value.length > 0 ? vue.withDirectives((vue.openBlock(), vue.createBlock(R3, { key: 0, class: "h-[58vh] w-full", height: "58vh", onScroll: C2, ref_key: "danmuContainer", ref: g2 }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(u2.value, (e4, o2) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: `${o2}${e4.ts}` }, [m2[e4.type] ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createVNode(mC, { data: e4, "nick-name": a2.nickName }, null, 8, ["data", "nick-name"]), vue.createVNode(L3)], 64)) : vue.createCommentVNode("", true)], 64))), 128))]), _: 1 })), [[N2, s2.value]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", xC, [vue.createTextVNode(" 翻来翻去还是没有记录 ")])), [[N2, s2.value]])]), _: 1 }, 8, ["modelValue"]); }; } }); const _SC = class _SC { constructor() { __publicField(this, "app", null); __publicField(this, "targetPosition", null); } init() { const e2 = "DOUYUCRX"; rC[e2].handleDanmuHistory = (e3) => { if (!this.targetPosition) { this.targetPosition = document.querySelector(".layout-Player"); const e4 = document.createElement("div"); e4.id = _SC.appId; this.targetPosition.appendChild(e4); } this.app && this.app.unmount(); this.app = vue.createApp(CC, { ...e3 }); this.app.mount(`#${_SC.appId}`); }; } }; __publicField(_SC, "appId", "danmu-history-btn"); let SC = _SC; const EC = pinia.defineStore("setting-btn", () => { const e2 = vue.ref({ show: true }); return { state: e2 }; }, { persist: true }); const _C = pinia.defineStore("setting-direction", () => { const e2 = vue.ref({ drawerDirection: "rtl", btnDirection: "2" }); return { state: e2 }; }, { persist: true }); const OC = vue.defineComponent({ __name: "SettingButton", setup(e2) { const { state: a2 } = _C(); const r2 = vue.ref(false); const { state: l2 } = EC(); const s2 = vue.ref({ display: "" }); oC("配置按钮[显示/隐藏]", () => { l2.show = !l2.show; }); const d2 = vue.ref(); let f2 = false; let p2 = 0; let m2 = 0; let h2 = 0; let g2 = 0; let y2 = 0; let b2 = 0; let w2 = 0; let k2 = 0; const C2 = () => { const e3 = a2.btnDirection; p2 = 0; m2 = 0; const t2 = e3 === "2" || e3 === "4" ? document.documentElement.clientWidth - w2 : 0; const n2 = e3 === "1" || e3 === "2" ? 0 : document.documentElement.clientHeight - k2; h2 = t2; g2 = n2; y2 = t2; b2 = n2; d2.value.style.transform = `translate(${y2}px, ${b2}px)`; }; vue.onMounted(() => { w2 = d2.value.offsetWidth; k2 = d2.value.offsetHeight; vue.watch(() => a2.btnDirection, () => { C2(); }, { immediate: true }); vue.watch(() => l2.show, () => { s2.value.display = l2.show ? "" : "none"; }, { immediate: true }); window.addEventListener("resize", C2); }); vue.onUnmounted(() => { window.removeEventListener("resize", C2); }); const E2 = (e3) => { f2 = true; p2 = e3.clientX; m2 = e3.clientY; document.addEventListener("mousemove", _2); document.addEventListener("mouseup", O2); }; const _2 = (e3) => { if (f2) { const t2 = e3.clientX - p2; const n2 = e3.clientY - m2; let o2 = h2 + t2; let a3 = g2 + n2; const r3 = window.innerWidth; const l3 = window.innerHeight; if (o2 < 0) o2 = 0; if (a3 < 0) a3 = 0; if (o2 + w2 > r3) o2 = r3 - w2; if (a3 + k2 > l3) a3 = l3 - k2; y2 = o2; b2 = a3; d2.value.style.transform = `translate(${y2}px, ${b2}px)`; } }; const O2 = () => { f2 = false; h2 = y2; g2 = b2; document.removeEventListener("mousemove", _2); document.removeEventListener("mouseup", O2); }; return (e3, l3) => { const i2 = sp; const c2 = bw; return vue.openBlock(), vue.createElementBlock("div", null, [vue.createElementVNode("div", { ref_key: "draggable", ref: d2, class: "setting-button fixed top-0 rounded-[6px] w-[30px] z-[10000]", style: vue.normalizeStyle(s2.value) }, [vue.createElementVNode("div", { class: "text-white flex items-center justify-center h-[30px] cursor-move", onMousedown: E2 }, [vue.createVNode(i2, { size: 18 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Qi))]), _: 1 })], 32), vue.createElementVNode("div", { class: "text-white flex items-center justify-center h-[30px] cursor-pointer", onClick: l3[0] || (l3[0] = (e4) => r2.value = true) }, [vue.createVNode(i2, { size: 18 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(tu))]), _: 1 })])], 4), vue.createVNode(c2, { modelValue: r2.value, "onUpdate:modelValue": l3[1] || (l3[1] = (e4) => r2.value = e4), size: "334px", "with-header": false, "z-index": 99999, "modal-class": "custom-modal", direction: vue.unref(a2).drawerDirection }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["modelValue", "direction"])]); }; } }); const MC = pinia.defineStore("light-stick", () => { const e2 = vue.ref({ enabled: false, configList: [], completeDay: "" }); return { state: e2 }; }, { persist: true }); const LC = "https://www.douyu.com"; const DC = async () => { const { response: e2 } = await lC({ url: `${LC}/member/cp/getFansBadgeList`, method: "get", responseType: "text" }); const t2 = /data-fans-room="(.+?)"[\s\S]+?data-anchor_name="(.+?)"/g; let n2; const o2 = []; while ((n2 = t2.exec(e2)) !== null) { o2.push({ rid: n2[1].trim(), name: n2[2] }); } return o2; }; const AC = (e2) => lC({ url: `${LC}/member/cp/getPropTransactionList`, method: "get", params: e2 }); const RC = (e2) => lC({ url: `${LC}/japi/prop/backpack/web/v2`, method: "get", params: e2, headers: { Referer: "https://www.douyu.com" } }); const $C = (e2) => { const t2 = new URLSearchParams(); for (const [n2, o2] of Object.entries(e2)) { t2.append(n2, o2); } t2.append("bizExt", '{"yzxq":{}}'); return lC({ url: `${LC}/japi/prop/donate/mainsite/v2`, method: "post", data: t2, headers: { Referer: "https://www.douyu.com" } }); }; const TC = { class: "dialog-footer" }; const PC = vue.defineComponent({ __name: "LightStickConfigDialog", props: { visible: { type: Boolean } }, emits: ["update:visible"], setup(e2, { emit: a2 }) { const r2 = e2; const l2 = vue.ref(true); const s2 = a2; const u2 = vue.ref(false); const c2 = ["周一", "周二", "周三", "周四", "周五", "周六", "周日"]; const d2 = vue.ref([]); const { state: f2 } = MC(); const p2 = ue().day(); const m2 = vue.ref(p2 === 0 ? 6 : p2 - 1); vue.watch(() => r2.visible, (e3) => { if (e3) { u2.value = true; h2(); } }); vue.watch(u2, (e3) => { if (!e3) { s2("update:visible", false); } }); const h2 = async () => { l2.value = true; try { d2.value = Array.from({ length: 7 }, () => []); const e3 = /* @__PURE__ */ new Map(); f2.configList.forEach((t3, n2) => { const o2 = /* @__PURE__ */ new Map(); e3.set(n2, o2); t3.forEach((e4) => { o2.set(e4.rid, { count: e4.count, remaining: e4.remaining }); }); }); const t2 = await DC(); if (t2.length === 0) { nC.warning("不存在粉丝牌,无法配置自动送荧光棒!"); u2.value = false; return; } t2.forEach(({ rid: t3, name: n2 }) => { d2.value.forEach((o2, a3) => { const r3 = e3.get(a3); const l3 = r3 == null ? void 0 : r3.get(t3); o2.push({ rid: t3, name: n2, count: l3 ? l3.count : 0, remaining: !!(l3 && l3.remaining) }); }); }); } finally { l2.value = false; } }; const g2 = (e3, t2) => { d2.value.forEach((n2, o2) => { if (t2 !== o2) { d2.value[o2] = JSON.parse(JSON.stringify(e3)); } }); nC.success("同步成功"); }; const y2 = () => { f2.configList = d2.value; f2.completeDay = ""; nC.success("保存成功"); u2.value = false; }; const b2 = (e3, t2) => { if (!e3[t2].remaining) { return; } e3.forEach((e4, n2) => { if (n2 !== t2) { e4.remaining = false; } }); }; return (e3, a3) => { const r3 = wh; const s3 = sk; const i2 = Ew; const f3 = Oy; const p3 = My; const v2 = lk; const h3 = Mk; const w2 = Ok; const x2 = iw; const k2 = Bk; return vue.openBlock(), vue.createBlock(x2, { modelValue: u2.value, "onUpdate:modelValue": a3[2] || (a3[2] = (e4) => u2.value = e4), title: "荧光棒配置", width: "50%", top: "6vh", "destroy-on-close": "", "lock-scroll": "" }, { footer: vue.withCtx(() => [vue.createElementVNode("div", TC, [vue.createVNode(r3, { onClick: a3[1] || (a3[1] = (e4) => u2.value = false), loading: l2.value }, { default: vue.withCtx(() => [vue.createTextVNode("取消")]), _: 1 }, 8, ["loading"]), vue.createVNode(r3, { type: "primary", onClick: y2, loading: l2.value }, { default: vue.withCtx(() => [vue.createTextVNode(" 保存 ")]), _: 1 }, 8, ["loading"])])]), default: vue.withCtx(() => [vue.withDirectives((vue.openBlock(), vue.createBlock(w2, { modelValue: m2.value, "onUpdate:modelValue": a3[0] || (a3[0] = (e4) => m2.value = e4), type: "border-card" }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(d2.value, (e4, n2) => (vue.openBlock(), vue.createBlock(h3, { label: c2[n2], key: n2, name: n2, class: "overflow-auto" }, { default: vue.withCtx(() => [vue.createVNode(r3, { type: "primary", onClick: (t2) => g2(e4, n2) }, { default: vue.withCtx(() => [vue.createTextVNode("同步至其他日")]), _: 2 }, 1032, ["onClick"]), vue.createVNode(v2, { data: e4, style: { width: "100%" }, height: "60vh" }, { default: vue.withCtx(() => [vue.createVNode(s3, { prop: "rid", label: "直播间号" }), vue.createVNode(s3, { prop: "name", label: "主播名称" }), vue.createVNode(s3, { prop: "count", label: "数量", width: "200" }, { default: vue.withCtx((t2) => [vue.createVNode(p3, { modelValue: t2.row.remaining, "onUpdate:modelValue": (e5) => t2.row.remaining = e5, onChange: (n3) => b2(e4, t2.$index) }, { default: vue.withCtx(() => [vue.createVNode(f3, { value: false, border: "" }, { default: vue.withCtx(() => [vue.createVNode(i2, { modelValue: t2.row.count, "onUpdate:modelValue": (e5) => t2.row.count = e5, size: "small", min: 0, disabled: t2.row.remaining }, null, 8, ["modelValue", "onUpdate:modelValue", "disabled"])]), _: 2 }, 1024), vue.createVNode(f3, { value: true, border: "" }, { default: vue.withCtx(() => [vue.createTextVNode("剩下全部")]), _: 1 })]), _: 2 }, 1032, ["modelValue", "onUpdate:modelValue", "onChange"])]), _: 2 }, 1024)]), _: 2 }, 1032, ["data"])]), _: 2 }, 1032, ["label", "name"]))), 128))]), _: 1 }, 8, ["modelValue"])), [[k2, l2.value]])]), _: 1 }, 8, ["modelValue"]); }; } }); const NC = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "荧光棒配置", -1); const IC = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const BC = vue.createElementVNode("span", null, "自动送荧光棒", -1); const VC = vue.defineComponent({ __name: "LightStickConf", setup(e2) { const a2 = vue.ref(false); const { state: r2 } = MC(); return (e3, l2) => { const s2 = Rw; const i2 = wh; const c2 = pw; return vue.openBlock(), vue.createElementBlock("div", null, [NC, vue.createElementVNode("div", IC, [BC, vue.createVNode(s2, { modelValue: vue.unref(r2).enabled, "onUpdate:modelValue": l2[0] || (l2[0] = (e4) => vue.unref(r2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(i2, { size: "small", type: "primary", onClick: l2[1] || (l2[1] = (e4) => a2.value = true) }, { default: vue.withCtx(() => [vue.createTextVNode("详细配置")]), _: 1 })]), vue.createVNode(PC, { visible: a2.value, "onUpdate:visible": l2[2] || (l2[2] = (e4) => a2.value = e4) }, null, 8, ["visible"]), vue.createVNode(c2)]); }; } }); const FC = pinia.defineStore("page-config", () => { const e2 = vue.ref({}); const t2 = vue.ref({}); const n2 = vue.ref(true); const o2 = (n3, o3) => { const { title: a2, hide: r2, have: l2 } = o3; const s2 = e2.value[n3]; e2.value[n3] = { hide: s2 ? s2.hide : r2 }; t2.value[n3] = { title: a2, have: l2 }; }; return { infoState: t2, hideState: e2, loading: n2, addPageConfig: o2 }; }, { persist: { paths: ["hideState"] } }); const jC = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "页面配置", -1); const zC = { key: 0, class: "h-[80px]" }; const HC = ["onMouseenter", "onMouseleave"]; const WC = { class: "cursor-default" }; const YC = vue.defineComponent({ __name: "ElementConf", setup(e2) { const a2 = FC(); const { infoState: r2, hideState: l2, loading: s2 } = pinia.storeToRefs(a2); const i2 = /* @__PURE__ */ new Map(); const c2 = (e3) => { const t2 = document.querySelector(e3); if (!t2) { return; } let n2 = i2.get(e3); if (!n2) { n2 = document.createElement("div"); n2.style.position = "absolute"; n2.style.background = "rgba(0, 0, 0, 0.5)"; n2.style.zIndex = "99998"; i2.set(e3, n2); } const o2 = t2.getBoundingClientRect(); n2.style.width = `${o2.width}px`; n2.style.height = `${o2.height}px`; n2.style.top = `${o2.top + window.scrollY}px`; n2.style.left = `${o2.left + window.scrollX}px`; document.body.appendChild(n2); }; const d2 = (e3) => { const t2 = i2.get(e3); if (t2) { t2.remove(); } }; return (e3, a3) => { const i3 = Rw; const f2 = pw; const p2 = Bk; return vue.openBlock(), vue.createElementBlock("div", null, [jC, vue.unref(s2) ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", zC, null, 512)), [[p2, true]]) : (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 1 }, vue.renderList(vue.unref(r2), (e4, a4) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [e4.have ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: "flex justify-between items-center pt-[5px] text-[14px]", onMouseenter: (e5) => c2(a4), onMouseleave: (e5) => d2(a4) }, [vue.createElementVNode("span", WC, vue.toDisplayString(e4.title), 1), vue.createVNode(i3, { modelValue: vue.unref(l2)[a4].hide, "onUpdate:modelValue": (e5) => vue.unref(l2)[a4].hide = e5 }, null, 8, ["modelValue", "onUpdate:modelValue"])], 40, HC)) : vue.createCommentVNode("", true)], 64))), 256)), vue.createVNode(f2)]); }; } }); const UC = "DOUYUCRX"; const KC = pinia.defineStore("red-packet", () => { const e2 = vue.ref({ enabled: false }); vue.watch(() => e2.value.enabled, (e3) => { rC[UC].redPacketEnabled = e3; }, { immediate: true }); return { state: e2 }; }, { persist: true }); const qC = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "抢宝箱配置", -1); const GC = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const XC = vue.createElementVNode("span", null, "自动抢宝箱", -1); const ZC = vue.defineComponent({ __name: "RedPacketConf", setup(e2) { const { state: a2 } = KC(); return (e3, r2) => { const l2 = Rw; const s2 = pw; return vue.openBlock(), vue.createElementBlock("div", null, [qC, vue.createElementVNode("div", GC, [XC, vue.createVNode(l2, { modelValue: vue.unref(a2).enabled, "onUpdate:modelValue": r2[0] || (r2[0] = (e4) => vue.unref(a2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createVNode(s2)]); }; } }); const JC = "DOUYUCRX"; const QC = pinia.defineStore("gift-treasure", () => { const e2 = vue.ref({ enabled: false, preBoxId: null }); rC[JC].joinGiftTreasure = (t2, n2) => { if (!e2.value.enabled) { return; } if (!n2 || !n2.giftR || !n2.giftR.boxId) { return; } const o2 = n2.giftR.boxId; if (o2 === e2.value.preBoxId) { return; } t2.reqJoin({ boxId: o2, checkBindPhone: 0 }); e2.value.preBoxId = o2; }; return { state: e2 }; }, { persist: true }); const eS = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "抢鱼翅红包配置", -1); const tS = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const nS = vue.createElementVNode("span", null, "自动抢鱼翅红包", -1); const oS = vue.defineComponent({ __name: "GiftTreasureConf", setup(e2) { const { state: a2 } = QC(); return (e3, r2) => { const l2 = Rw; const s2 = pw; return vue.openBlock(), vue.createElementBlock("div", null, [eS, vue.createElementVNode("div", tS, [nS, vue.createVNode(l2, { modelValue: vue.unref(a2).enabled, "onUpdate:modelValue": r2[0] || (r2[0] = (e4) => vue.unref(a2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createVNode(s2)]); }; } }); const aS = "DOUYUCRX"; const rS = pinia.defineStore("join-lottery", () => { const e2 = vue.ref({ enabled: false, resolveHide: false, rejectHide: false }); const t2 = vue.ref(); let n2 = void 0; rC[aS].uLotteryStartChange = (e3) => { t2.value = e3; }; rC[aS].lotteryContainerChange = (e3) => { n2 = e3; }; const o2 = async () => { try { await new Promise(async (e3, n3) => { const o3 = t2.value; const a2 = o3.props.lotteryInfo.join_condition.lottery_range; if (a2 >= 4) { o3.happyLotteryServices.getUserDiamondInfo().subscribe((t3) => { if (t3) { o3.joinLottery(); e3(); } else { n3(); } }); return; } if (a2 <= 1 || o3.props.isFans) { o3.joinLottery(); e3(); return; } n3(); }); if (e2.value.resolveHide) { setTimeout(() => { n2 && n2.closePanel(); }, 1e3); } } catch { if (e2.value.rejectHide) { setTimeout(() => { n2 && n2.closePanel(); }, 1e3); } } }; vue.watch(t2, (t3) => { if (!t3 || !e2.value.enabled) { return; } o2(); }); vue.watch(() => e2.value.enabled, (e3) => { if (!e3 || !t2.value) { return; } o2(); }); return { state: e2 }; }, { persist: { paths: ["state"] } }); const lS = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "抽奖配置", -1); const sS = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const iS = vue.createElementVNode("span", null, "自动参与抽奖", -1); const uS = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const cS = vue.createElementVNode("span", null, "参与后自动关闭抽奖", -1); const dS = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const fS = vue.createElementVNode("span", null, "无法自动满足条件,关闭抽奖", -1); const pS = vue.defineComponent({ __name: "JoinLotteryConf", setup(e2) { const { state: a2 } = rS(); return (e3, r2) => { const l2 = Rw; const s2 = pw; return vue.openBlock(), vue.createElementBlock("div", null, [lS, vue.createElementVNode("div", sS, [iS, vue.createVNode(l2, { modelValue: vue.unref(a2).enabled, "onUpdate:modelValue": r2[0] || (r2[0] = (e4) => vue.unref(a2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createElementVNode("div", uS, [cS, vue.createVNode(l2, { modelValue: vue.unref(a2).resolveHide, "onUpdate:modelValue": r2[1] || (r2[1] = (e4) => vue.unref(a2).resolveHide = e4) }, null, 8, ["modelValue"])]), vue.createElementVNode("div", dS, [fS, vue.createVNode(l2, { modelValue: vue.unref(a2).rejectHide, "onUpdate:modelValue": r2[2] || (r2[2] = (e4) => vue.unref(a2).rejectHide = e4) }, null, 8, ["modelValue"])]), vue.createVNode(s2)]); }; } }); const vS = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "配置位置", -1); const mS = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const hS = vue.createElementVNode("span", null, "弹框位置", -1); const gS = { class: "flex flex-wrap justify-between items-center pt-[5px] text-[14px]" }; const yS = vue.createElementVNode("span", { class: "" }, "配置按钮位置", -1); const bS = { class: "flex justify-end w-[254px]" }; const wS = vue.defineComponent({ __name: "SettingDirectionConf", setup(e2) { const { state: a2 } = _C(); return (e3, r2) => { const l2 = Ly; const s2 = My; return vue.openBlock(), vue.createElementBlock("div", null, [vS, vue.createElementVNode("div", mS, [hS, vue.createVNode(s2, { modelValue: vue.unref(a2).drawerDirection, "onUpdate:modelValue": r2[0] || (r2[0] = (e4) => vue.unref(a2).drawerDirection = e4), size: "small" }, { default: vue.withCtx(() => [vue.createVNode(l2, { value: "ltr" }, { default: vue.withCtx(() => [vue.createTextVNode("左")]), _: 1 }), vue.createVNode(l2, { value: "rtl" }, { default: vue.withCtx(() => [vue.createTextVNode("右")]), _: 1 }), vue.createVNode(l2, { value: "ttb" }, { default: vue.withCtx(() => [vue.createTextVNode("上")]), _: 1 }), vue.createVNode(l2, { value: "btt" }, { default: vue.withCtx(() => [vue.createTextVNode("下")]), _: 1 })]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", gS, [yS, vue.createElementVNode("div", bS, [vue.createVNode(s2, { modelValue: vue.unref(a2).btnDirection, "onUpdate:modelValue": r2[1] || (r2[1] = (e4) => vue.unref(a2).btnDirection = e4), size: "small" }, { default: vue.withCtx(() => [vue.createVNode(l2, { value: "1" }, { default: vue.withCtx(() => [vue.createTextVNode("左上角")]), _: 1 }), vue.createVNode(l2, { value: "2" }, { default: vue.withCtx(() => [vue.createTextVNode("右上角")]), _: 1 }), vue.createVNode(l2, { value: "3" }, { default: vue.withCtx(() => [vue.createTextVNode("左下角")]), _: 1 }), vue.createVNode(l2, { value: "4" }, { default: vue.withCtx(() => [vue.createTextVNode("右下角")]), _: 1 })]), _: 1 }, 8, ["modelValue"])])])]); }; } }); const xS = "DOUYUCRX"; const kS = pinia.defineStore("prevent-afk", () => { const e2 = vue.ref({ enabled: false }); vue.watch(() => e2.value.enabled, (e3) => { rC[xS].preventAfkEnabled = e3; }, { immediate: true }); return { state: e2 }; }, { persist: true }); const CS = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "挂机检测配置", -1); const SS = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const ES = vue.createElementVNode("span", null, "去除挂机检测", -1); const _S = vue.defineComponent({ __name: "PreventAfkConf", setup(e2) { const { state: a2 } = kS(); return (e3, r2) => { const l2 = Rw; const s2 = pw; return vue.openBlock(), vue.createElementBlock("div", null, [CS, vue.createElementVNode("div", SS, [ES, vue.createVNode(l2, { modelValue: vue.unref(a2).enabled, "onUpdate:modelValue": r2[0] || (r2[0] = (e4) => vue.unref(a2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createVNode(s2)]); }; } }); const OS = "DOUYUCRX"; const MS = pinia.defineStore("pageful", () => { const e2 = vue.ref({ enabled: false, hideDanmu: false }); const t2 = vue.ref(); let n2 = null; let o2 = null; rC[OS].videoLayoutChange = (a2) => { t2.value = a2; if (!e2.value.enabled) { return; } const r2 = t2.value; r2.clickPageful(); !n2 && (n2 = document.querySelector(".layout-Player-asidetoggleButton")); !o2 && (o2 = document.querySelector(".layout-Player-video")); if (e2.value.hideDanmu && n2 && o2 && o2.clientHeight !== document.documentElement.clientHeight && o2.clientWidth !== document.documentElement.clientWidth) { n2.click(); } }; return { state: e2 }; }, { persist: { paths: ["state"] } }); const LS = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "网页全屏", -1); const DS = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const AS = vue.createElementVNode("span", null, "自动网页全屏", -1); const RS = { class: "flex justify-between items-center pt-[5px] text-[14px]" }; const $S = vue.createElementVNode("span", null, "自动网页全屏后,隐藏右侧弹幕", -1); const TS = vue.defineComponent({ __name: "PagefulConf", setup(e2) { const { state: a2 } = MS(); return (e3, r2) => { const l2 = Rw; const s2 = pw; return vue.openBlock(), vue.createElementBlock("div", null, [LS, vue.createElementVNode("div", DS, [AS, vue.createVNode(l2, { modelValue: vue.unref(a2).enabled, "onUpdate:modelValue": r2[0] || (r2[0] = (e4) => vue.unref(a2).enabled = e4) }, null, 8, ["modelValue"])]), vue.createElementVNode("div", RS, [$S, vue.createVNode(l2, { modelValue: vue.unref(a2).hideDanmu, "onUpdate:modelValue": r2[1] || (r2[1] = (e4) => vue.unref(a2).hideDanmu = e4) }, null, 8, ["modelValue"])]), vue.createVNode(s2)]); }; } }); const PS = { class: "p-[20px]" }; const NS = vue.defineComponent({ __name: "SettingPage", setup(e2) { return (e3, o2) => { const a2 = pw; return vue.openBlock(), vue.createElementBlock("div", PS, [vue.createVNode(VC), vue.createVNode(oS), vue.createVNode(ZC), vue.createVNode(pS), vue.createVNode(TS), vue.createVNode(YC), vue.createVNode(_S), vue.createVNode(wS), vue.createVNode(a2)]); }; } }); const IS = vue.defineComponent({ __name: "index", setup(e2) { return (e3, n2) => (vue.openBlock(), vue.createBlock(OC, null, { default: vue.withCtx(() => [vue.createVNode(NS)]), _: 1 })); } }); function BS(e2) { return typeof e2 === "object" && e2 !== null; } function VS(e2, t2) { e2 = BS(e2) ? e2 : /* @__PURE__ */ Object.create(null); return new Proxy(e2, { get(e3, n2, o2) { if (n2 === "key") return Reflect.get(e3, n2, o2); return Reflect.get(e3, n2, o2) || Reflect.get(t2, n2, o2); } }); } function FS(e2, t2) { return t2.reduce((e3, t3) => e3 == null ? void 0 : e3[t3], e2); } function jS(e2, t2, n2) { return t2.slice(0, -1).reduce((e3, t3) => { if (/^(__proto__)$/.test(t3)) return {}; else return e3[t3] = e3[t3] || {}; }, e2)[t2[t2.length - 1]] = n2, e2; } function zS(e2, t2) { return t2.reduce((t3, n2) => { const o2 = n2.split("."); return jS(t3, o2, FS(e2, o2)); }, {}); } function HS(e2, t2) { return (n2) => { var o2; try { const { storage: a2 = localStorage, beforeRestore: r2 = void 0, afterRestore: l2 = void 0, serializer: s2 = { serialize: JSON.stringify, deserialize: JSON.parse }, key: i2 = t2.$id, paths: u2 = null, debug: c2 = false } = n2; return { storage: a2, beforeRestore: r2, afterRestore: l2, serializer: s2, key: ((o2 = e2.key) != null ? o2 : (e3) => e3)(typeof i2 == "string" ? i2 : i2(t2.$id)), paths: u2, debug: c2 }; } catch (e3) { if (n2.debug) console.error("[pinia-plugin-persistedstate]", e3); return null; } }; } function WS(e2, { storage: t2, serializer: n2, key: o2, debug: a2 }) { try { const a3 = t2 == null ? void 0 : t2.getItem(o2); if (a3) e2.$patch(n2 == null ? void 0 : n2.deserialize(a3)); } catch (e3) { if (a2) console.error("[pinia-plugin-persistedstate]", e3); } } function YS(e2, { storage: t2, serializer: n2, key: o2, paths: a2, debug: r2 }) { try { const r3 = Array.isArray(a2) ? zS(e2, a2) : e2; t2.setItem(o2, n2.serialize(r3)); } catch (e3) { if (r2) console.error("[pinia-plugin-persistedstate]", e3); } } function US(e2 = {}) { return (t2) => { const { auto: n2 = false } = e2; const { options: { persist: o2 = n2 }, store: a2, pinia: r2 } = t2; if (!o2) return; if (!(a2.$id in r2.state.value)) { const e3 = r2._s.get(a2.$id.replace("__hot:", "")); if (e3) Promise.resolve().then(() => e3.$persist()); return; } const l2 = (Array.isArray(o2) ? o2.map((t3) => VS(t3, e2)) : [VS(o2, e2)]).map(HS(e2, a2)).filter(Boolean); a2.$persist = () => { l2.forEach((e3) => { YS(a2.$state, e3); }); }; a2.$hydrate = ({ runHooks: e3 = true } = {}) => { l2.forEach((n3) => { const { beforeRestore: o3, afterRestore: r3 } = n3; if (e3) o3 == null ? void 0 : o3(t2); WS(a2, n3); if (e3) r3 == null ? void 0 : r3(t2); }); }; l2.forEach((e3) => { const { beforeRestore: n3, afterRestore: o3 } = e3; n3 == null ? void 0 : n3(t2); WS(a2, e3); o3 == null ? void 0 : o3(t2); a2.$subscribe((t3, n4) => { YS(n4, e3); }, { detached: true }); }); }; } const KS = pinia.createPinia(); KS.use(US({ key: (e2) => `douyu-crx-${e2}` })); const _qS = class _qS { constructor() { __publicField(this, "app", null); } init() { const e2 = document.querySelector("body"); const t2 = document.createElement("div"); t2.id = _qS.appId; e2.appendChild(t2); this.app = vue.createApp(IS); this.app.use(KS); this.app.mount(`#${_qS.appId}`); } }; __publicField(_qS, "appId", "setting-btn"); let qS = _qS; class GS { constructor(e2, t2, n2, o2) { __publicField(this, "styleElement"); __publicField(this, "stopWatcher"); __publicField(this, "pageConfigStore", FC()); this.selector = e2; this.title = t2; this.defaultHide = n2; this.defaultHave = o2; this.styleElement = document.createElement("style"); this.styleElement.type = "text/css"; } init() { const { hideState: e2, addPageConfig: t2 } = this.pageConfigStore; t2(this.selector, { hide: this.defaultHide, title: `隐藏${this.title}`, have: this.defaultHave }); const n2 = e2[this.selector]; this.stopWatcher = vue.watch(() => n2.hide, (e3) => { if (e3) { this.hide(); return; } this.show(); }, { immediate: true }); } hide() { this.styleElement.textContent = this.getTextContent(); document.head.appendChild(this.styleElement); } getTextContent() { return `${this.selector}{display:none !important;}`; } show() { this.styleElement.remove(); } markTarget() { const { infoState: e2 } = this.pageConfigStore; const t2 = e2[this.selector]; if (!t2.have) { const e3 = document.querySelector(this.selector); t2.have = !!e3; !t2.have && this.stopWatcher && this.stopWatcher(); } } } class XS { } class ZS extends XS { } const JS = []; function QS(e2) { JS.push(e2); } var eE = Object.defineProperty; var tE = Object.getOwnPropertyDescriptor; var nE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? tE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) eE(t2, n2, a2); return a2; }; let oE = class extends ZS { constructor() { super(...arguments); __publicField(this, "name", "背包-送礼时额外添加一项所有数量"); __publicField(this, "matchModuleList", ["GiftHallBanner"]); __publicField(this, "pattern", /BatchProp\.prototype\.componentWillReceiveProps/); } newModuleStr(e2) { const t2 = e2.match(/BatchProp\.prototype\.componentWillReceiveProps=function componentWillReceiveProps.+?{(.+?)},BatchProp\.prototype/); if (!t2) { throw new Error("未提取到componentWillReceiveProps方法"); } const n2 = t2[1]; return e2.replace(n2, `${n2};var propData=this.state.propData;!propData.batchInfo[""+propData.count]&&(propData.batchInfo[""+propData.count]={batchNum:propData.count,name:"暂不计算亲密度"})`); } }; oE = nE([QS], oE); var aE = Object.defineProperty; var rE = Object.getOwnPropertyDescriptor; var lE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? rE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) aE(t2, n2, a2); return a2; }; let sE = class extends ZS { constructor() { super(...arguments); __publicField(this, "name", "用户面板-弹幕历史按钮"); __publicField(this, "matchModuleList", ["ChatUserCard"]); __publicField(this, "pattern", /ChatUserCard\.prototype\.getControls/); } newModuleStr(e2) { const t2 = e2.match(/ChatUserCard\.prototype\.getControls=function getControls.+?{(.+?)},ChatUserCard\.prototype/); if (!t2) { throw new Error("未提取到getControls方法"); } const n2 = t2[1]; const o2 = "DOUYUCRX"; return e2.replace(n2, `var resultFn=function(){${n2}};var result=resultFn.call(this);var self=this;result.push({text:"弹幕历史",type:"button",onClick:function onClick(){window['${o2}'].handleDanmuHistory(self.props.chatUserCardData);}});return result;`); } }; sE = lE([QS], sE); var iE = Object.defineProperty; var uE = Object.getOwnPropertyDescriptor; var cE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? uE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) iE(t2, n2, a2); return a2; }; const dE = "DOUYUCRX"; let fE = class extends ZS { constructor() { super(...arguments); __publicField(this, "name", "自动参与抽奖"); __publicField(this, "matchModuleList", ["LotteryContainer"]); __publicField(this, "pattern", /ULotteryStart\.prototype\.render/); } newModuleStr(e2) { const t2 = e2.match(/ULotteryStart\.prototype\.componentDidMount=function componentDidMount.+?{(.+?)},ULotteryStart\.prototype/); if (!t2) { throw new Error("未提取到componentDidMount方法"); } const n2 = e2.match(/ULotteryStart\.prototype\.componentWillUnmount=function componentWillUnmount.+?{(.+?)},ULotteryStart\.prototype/); if (!n2) { throw new Error("未提取到componentWillUnmount方法"); } const o2 = t2[1]; const a2 = n2[1]; rS(); return e2.replace(o2, `${o2};window['${dE}'].uLotteryStartChange(this);`).replace(a2, `${a2};window['${dE}'].uLotteryStartChange(undefined);`); } }; fE = cE([QS], fE); var pE = Object.defineProperty; var vE = Object.getOwnPropertyDescriptor; var mE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? vE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) pE(t2, n2, a2); return a2; }; const hE = "DOUYUCRX"; let gE = class extends ZS { constructor() { super(...arguments); __publicField(this, "name", "抽取抽奖面板关闭方法"); __publicField(this, "matchModuleList", ["LotteryContainer"]); __publicField(this, "pattern", /LotteryContainer-close/); } newModuleStr(e2) { const t2 = e2.match(/LotteryContainer\.prototype\.componentDidMount=function componentDidMount.+?{(.+?)},LotteryContainer\.prototype/); if (!t2) { throw new Error("未提取到componentDidMount方法"); } const n2 = e2.match(/LotteryContainer\.prototype\.componentWillUnmount=function componentWillUnmount.+?{(.+?)},LotteryContainer\.prototype/); if (!n2) { throw new Error("未提取到componentWillUnmount方法"); } const o2 = t2[1]; const a2 = n2[1]; return e2.replace(o2, `${o2};window['${hE}'].lotteryContainerChange(this);`).replace(a2, `${a2};window['${hE}'].lotteryContainerChange(undefined);`); } }; gE = mE([QS], gE); class yE { constructor() { __publicField(this, "modifierList", []); __publicField(this, "isDefine", false); __publicField(this, "target"); } intercept() { this.initModifierList(); this.interceptDefine(); } interceptDefine() { const e2 = this; Object.defineProperty(rC, this.targetName, { get() { return e2.target; }, set(t2) { e2.interceptPush(t2); }, configurable: true }); } interceptPush(e2) { var _a2; this.target = e2; const t2 = this; if (((_a2 = this.target) == null ? void 0 : _a2.push) !== Array.prototype.push && !this.isDefine) { const e3 = this.target.push; this.target.push = function(...n2) { const { modifierList: o2 } = t2; if (o2.length > 0) { for (const e4 of n2) { if (o2.length === 0) { break; } t2.modifyModule(e4); } } return e3.apply(this, n2); }; this.isDefine = true; } } modifyModule(e2) { if (e2.length < 2) { return; } const [t2, n2] = e2; const { modifierList: o2 } = this; for (let t3 = o2.length - 1; t3 >= 0; t3--) { const a2 = o2[t3]; if (!this.isMatch(a2, e2)) { continue; } const r2 = Object.keys(n2); const { pattern: l2 } = a2; for (const e3 of r2) { const r3 = n2[e3].toString(); if (!l2.test(r3)) { continue; } try { n2[e3] = new Function("return " + a2.newModuleStr(r3))(); } catch (e4) { const t4 = e4; nC.error(`执行修改[${a2.name}]失败!(${t4.message})`); } o2.splice(t3, 1); break; } } } isMatch(e2, t2) { return true; } } class bE extends yE { constructor() { super(...arguments); __publicField(this, "targetName", "shark_room_jsonp"); } initModifierList() { JS.forEach((e2) => this.modifierList.push(new e2())); } isMatch(e2, t2) { const { matchModuleList: n2 } = e2; if (!n2 || n2.length === 0) { return true; } const [o2] = t2; const a2 = [...n2]; const r2 = [...o2]; for (let e3 = a2.length - 1; e3 >= 0; e3--) { let t3 = false; for (let n3 = r2.length - 1; n3 >= 0; n3--) { if (r2[n3].startsWith(a2[e3])) { r2.splice(n3, 1); a2.splice(e3, 1); t3 = true; break; } } if (!t3) { return false; } } return a2.length === 0; } } const wE = []; function xE(e2) { wE.push(e2); } var kE = Object.defineProperty; var CE = Object.getOwnPropertyDescriptor; var SE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? CE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) kE(t2, n2, a2); return a2; }; let EE = class extends XS { constructor() { super(...arguments); __publicField(this, "name", "自动抢宝箱"); __publicField(this, "pattern", /prototype\.countDownView/); } newModuleStr(e2) { const t2 = e2.match(/\.prototype\.countDownView=function.+?{(.+?)},[a-zA-Z]\.prototype/); if (!t2) { throw new Error("未提取到countDownView方法"); } const n2 = t2[1]; const o2 = n2.match(/var (.+?)=this,.+?({statusText:"领取",.+?}\),.+?)\)/); if (!o2) { throw new Error("未提取到countDownView方法的目标代码"); } const a2 = o2[1]; const r2 = o2[2]; const l2 = "DOUYUCRX"; KC(); return e2.replace(n2, n2.replace(r2, `${r2},window['${l2}'].redPacketEnabled&&${a2}.treasureService.drawTreasure(${a2}.props.treasureData.data[0],"init")`)); } }; EE = SE([xE], EE); var _E = Object.defineProperty; var OE = Object.getOwnPropertyDescriptor; var ME = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? OE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) _E(t2, n2, a2); return a2; }; const LE = "DOUYUCRX"; let DE = class extends XS { constructor() { super(...arguments); __publicField(this, "name", "自动抢鱼翅红包"); __publicField(this, "pattern", /prototype\.reqJoin/); } newModuleStr(e2) { const t2 = e2.match(/\.prototype\.updateBoxInfo=function\(([a-zA-Z])\){(.+?)},[a-zA-Z]\.prototype/); if (!t2) { throw new Error("未提取到updateBoxInfo方法"); } const n2 = t2[1]; const o2 = t2[2]; QC(); return e2.replace(o2, `${o2};window['${LE}'].joinGiftTreasure(this,${n2});`); } }; DE = ME([xE], DE); var AE = Object.defineProperty; var RE = Object.getOwnPropertyDescriptor; var $E = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? RE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) AE(t2, n2, a2); return a2; }; let TE = class extends XS { constructor() { super(...arguments); __publicField(this, "name", "关键词屏蔽解除20个限制"); __publicField(this, "pattern", /[a-zA-Z]\.addKeywords=function/); } newModuleStr(e2) { const t2 = e2.match(/([a-zA-Z])\.addKeywords=function.+?{(.+?)},\1\./); if (!t2) { throw new Error("未提取到addKeywords方法"); } const n2 = t2[2]; const o2 = n2.match(/\)(if\("room"==.+?20.+?20.+?else)\s/); if (!o2) { throw new Error("未提取到addKeywords方法的目标代码"); } const a2 = o2[1]; return e2.replace(n2, n2.replace(a2, "")); } }; TE = $E([xE], TE); class PE extends yE { constructor() { super(...arguments); __publicField(this, "targetName", "shark-microlive-player-aside-jsonp"); } initModifierList() { wE.forEach((e2) => this.modifierList.push(new e2())); } } const NE = []; function IE(e2) { NE.push(e2); } var BE = Object.defineProperty; var VE = Object.getOwnPropertyDescriptor; var FE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? VE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) BE(t2, n2, a2); return a2; }; let jE = class extends XS { constructor() { super(...arguments); __publicField(this, "name", "飘屏弹幕-加一和回复"); __publicField(this, "pattern", /prototype\.addDzJyButton=.+isOpenFireFBComment/); } newModuleStr(e2) { const t2 = e2.match(/([a-z])\.prototype\.addDzJyButton=.+?{(.+?)},\1\.prototype/); if (!t2) { throw new Error("未提取到addDzJyButton方法"); } const n2 = t2[2]; const o2 = n2.match(/if\(([a-zA-Z])&&\1\.isOpenFireFBComment\)/); if (!o2) { throw new Error("未检测到addDzJyButton方法的目标代码"); } const a2 = n2.match(/(if\([a-zA-Z]&&!this\.isFireOpenRank\([a-zA-Z]\)\))(if\(.*?\)){/); if (!a2) { throw new Error("未检测到addDzJyButton方法的目标代码"); } return e2.replace(n2, n2.replace(o2[0], "if(!0)").replace(a2[1], "if(!0)").replace(a2[2], "if(!0)")); } }; jE = FE([IE], jE); var zE = Object.defineProperty; var HE = Object.getOwnPropertyDescriptor; var WE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? HE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) zE(t2, n2, a2); return a2; }; let YE = class extends XS { constructor() { super(...arguments); __publicField(this, "name", "飘屏弹幕-弹幕历史按钮"); __publicField(this, "pattern", /复制.+举报.+屏蔽.+添加关键词屏蔽/); } newModuleStr(e2) { const t2 = e2.match(/([a-z])\.prototype\.clickDanmudiv=.+?{(.+?)},\1\.prototype/); if (!t2) { throw new Error("未提取到clickDanmudiv方法"); } const n2 = t2[2]; const o2 = n2.match(/[a-z]\.target==this\.CloseButton\?this\.CloseButtonHandle\(\):/); if (!o2) { throw new Error("未检测到clickDanmudiv方法的目标代码"); } const a2 = e2.match(/[a-z]\.prototype\.render=(.{20,50}showReport.+?复制.+?举报.+?屏蔽.+?添加关键词屏蔽.+?),(?=[a-z]\.prototype)/); if (!a2) { throw new Error("未提取到render方法"); } const r2 = a2[1]; const l2 = r2.match(/[a-zA-z]\.[a-zA-z]\.createElement\("div",{className:([a-zA-Z]\.[a-zA-Z]\.ReportButton).+?(ReportButtonHandle).+?(ReportButton).+?(举报).+?\)/); if (!l2) { throw new Error("未提取到render方法的目标代码"); } const s2 = l2[0].replace(l2[1], '"danmu-btn-modifier"').replace(l2[2], "HistoryButtonHandle").replace(l2[3], "HistoryButton").replace(l2[4], "弹幕历史"); const i2 = r2.match(/\?[a-zA-z]\.[a-zA-z]\.createElement\("div",(.+?)\):null/); if (!i2) { throw new Error("未提取到render方法的目标代码"); } const u2 = i2[1]; const c2 = "DOUYUCRX"; return e2.replace(`${r2}`, `${r2.replace(u2, `${u2},${s2}`)},e.prototype.HistoryButtonHandle=function(){var danmuObj=this.props.danmuobject.toJS();window['${c2}'].handleDanmuHistory({rel:parseInt(danmuObj.uid),nickName:danmuObj.author,avatar:''});}`).replace(n2, `${o2[0].replaceAll("Close", "History")}${n2}`); } }; YE = WE([IE], YE); var UE = Object.defineProperty; var KE = Object.getOwnPropertyDescriptor; var qE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? KE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) UE(t2, n2, a2); return a2; }; const GE = "DOUYUCRX"; let XE = class extends XS { constructor() { super(...arguments); __publicField(this, "name", "去除挂机检测"); __publicField(this, "pattern", /\.prototype\.syncTimeHandler/); } newModuleStr(e2) { const t2 = e2.match(/([a-z])\.prototype\.syncTimeHandler=.+?{(.+?userNoHandle.+?)},\1\.prototype/); if (!t2) { throw new Error("未提取到syncTimeHandler方法"); } const n2 = t2[2]; return e2.replace(n2, `if(window['${GE}'].preventAfkEnabled){return;}${n2}`); } }; XE = qE([IE], XE); var ZE = Object.defineProperty; var JE = Object.getOwnPropertyDescriptor; var QE = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? JE(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) ZE(t2, n2, a2); return a2; }; const e_ = "DOUYUCRX"; let t_ = class extends XS { constructor() { super(...arguments); __publicField(this, "name", "网页全屏方法抽取"); __publicField(this, "pattern", /\.prototype\.clickPageful=/); } newModuleStr(e2) { const t2 = e2.match(/([a-z])\.prototype\.componentDidMount=.+?{(.+?layout-Player-videoMain.+?)},\1\.prototype/); if (!t2) { throw new Error("未提取到componentDidMount方法"); } const n2 = t2[2]; MS(); return e2.replace(n2, `${n2};window['${e_}'].videoLayoutChange(this);`); } }; t_ = QE([IE], t_); class n_ extends yE { constructor() { super(...arguments); __publicField(this, "targetName", "sharkLivePlayerJsonp"); } initModifierList() { NE.forEach((e2) => this.modifierList.push(new e2())); } } const o_ = []; function a_(e2) { o_.push(e2); } var r_ = Object.defineProperty; var l_ = Object.getOwnPropertyDescriptor; var s_ = (e2, t2, n2, o2) => { var a2 = o2 > 1 ? void 0 : o2 ? l_(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) a2 = (o2 ? l2(t2, n2, a2) : l2(a2)) || a2; if (o2 && a2) r_(t2, n2, a2); return a2; }; let i_ = class extends XS { constructor() { super(...arguments); __publicField(this, "name", "飘屏弹幕-屏蔽TA-解除最多20个限制"); __publicField(this, "pattern", /PlayerServices\.prototype\.setFilterWords/); } newModuleStr(e2) { const t2 = e2.match(/PlayerServices\.prototype\.setFilterWords=function setFilterWords.+?{(.+?)},PlayerServices\.prototype/); if (!t2) { throw new Error("未提取到setFilterWords方法"); } const n2 = t2[1]; const o2 = n2.match(/if\([a-zA-Z]\.length>=20\)/); if (!o2) { throw new Error("未检测到目标代码"); } return e2.replace(n2, n2.replace(o2[0], "if(!1)")); } }; i_ = s_([a_], i_); class u_ { constructor() { __publicField(this, "modifierList", []); __publicField(this, "target", null); } intercept() { this.initModifierList(); this.interceptDefine(); } initModifierList() { o_.forEach((e2) => this.modifierList.push(new e2())); } interceptDefine() { const e2 = this; Object.defineProperty(rC, "_room_common_", { get() { return e2.target; }, set(t2) { e2.modifyProperty(t2); }, configurable: true }); } modifyProperty(e2) { this.target = new Proxy((...t2) => { const n2 = t2[0]; if (!e2.c[n2]) { e2.m[n2] = this.getNewModule(e2.m[n2]); } return e2(n2); }, { apply(e3, t2, n2) { return e3.apply(t2, n2); }, get(t2, n2, o2) { return Reflect.get(e2, n2, o2); } }); } getNewModule(e2) { const { modifierList: t2 } = this; if (t2.length === 0) { return e2; } const n2 = e2.toString(); for (let o2 = t2.length - 1; o2 >= 0; o2--) { const a2 = t2[o2]; if (!a2.pattern.test(n2)) { continue; } t2.splice(o2, 1); let r2 = null; try { r2 = new Function("return " + a2.newModuleStr(n2))(); } catch (e3) { const t3 = e3; nC.error(`执行修改[${a2.name}]失败!(${t3.message})`); } return r2 ? r2 : e2; } return e2; } } class c_ { constructor() { __publicField(this, "interceptors", [new u_(), new bE(), new n_(), new PE()]); } init() { this.interceptors.forEach((e2) => { new Promise(() => { e2.intercept(); }); }); } } const d_ = pinia.defineStore("room-info", () => { const e2 = document.documentElement.outerHTML.match(/\$ROOM\.room_id =(.+?);/); const t2 = vue.ref({ rid: e2 ? e2[1].trim() : "" }); return { state: t2 }; }); class f_ { constructor() { __publicField(this, "pageSize", 50); __publicField(this, "relId", 268); __publicField(this, "executing", false); __publicField(this, "today", ue().format("YYYY-MM-DD")); __publicField(this, "roomInfoStore", d_()); __publicField(this, "lightStickStore", MC()); } init() { const { state: e2 } = this.lightStickStore; const t2 = async () => { if (this.executing) { return; } this.executing = true; try { if (!e2.enabled || e2.configList.length < 7 || e2.completeDay === this.today) { return; } const t3 = ue(this.today).day(); const n2 = t3 === 0 ? 6 : t3 - 1; const o2 = e2.configList[n2]; if (!o2) { nC.warning("未读取到[自动送荧光棒]配置,请先配置[自动送荧光棒]"); return; } const a2 = await DC(); if (a2.length !== o2.length) { nC.warning("粉丝牌发生变化,[自动送荧光棒]需重新配置"); return; } const r2 = /* @__PURE__ */ new Set(); a2.forEach((e3) => r2.add(e3.rid)); for (const e3 of o2) { if (!r2.has(e3.rid)) { nC.warning("粉丝牌发生变化,[自动送荧光棒]需重新配置"); return; } r2.delete(e3.rid); } if (r2.size > 0) { nC.warning("粉丝牌发生变化,[自动送荧光棒]需重新配置"); return; } const l2 = ue(this.today).unix(); const s2 = ue(this.today).add(1, "day").unix() - 1; const i2 = /* @__PURE__ */ new Map(); let u2 = this.pageSize; let c2 = 1; while (u2 === this.pageSize) { const { response: { data: { total: e3, details: t4 } } } = await AC({ beginTime: l2, endTime: s2, pageSize: this.pageSize, pageNum: c2++ }); u2 = e3; t4.forEach((e4) => { const t5 = e4.roomId + ""; const n3 = i2.get(t5); if (e4.relId !== this.relId) { return; } if (!n3) { i2.set(t5, e4.number); return; } i2.set(t5, e4.number + n3); }); } let d2 = 0; const f2 = []; let p2 = null; for (const e3 of o2) { if (e3.remaining) { p2 = e3; continue; } if (e3.count <= 0) { continue; } const t4 = i2.get(e3.rid); if (!t4) { d2 += e3.count; f2.push({ rid: e3.rid, count: e3.count }); continue; } const n3 = e3.count - t4; if (n3 > 0) { d2 += n3; f2.push({ rid: e3.rid, count: n3 }); } } if (d2 === 0 && !p2) { nC.success("无需执行[自动送荧光棒],当日赠送的荧光棒已满足配置"); e2.completeDay = this.today; return; } const { response: { data: { list: v2 } } } = await RC({ rid: this.roomInfoStore.state.rid }); const m2 = v2.find((e3) => e3.id === this.relId); if (!m2) { if (i2.size === 0) { return; } if (d2 === 0) { nC.success("无需执行[自动送荧光棒],当日赠送的荧光棒已满足配置"); e2.completeDay = this.today; return; } nC.warning("荧光棒不足,视作当日[自动送荧光棒]已完成"); e2.completeDay = this.today; return; } if (d2 > m2.count) { nC.warning("荧光棒不足,视作当日[自动送荧光棒]已完成"); e2.completeDay = this.today; return; } for (const e3 of f2) { await $C({ propId: this.relId, roomId: e3.rid, propCount: e3.count }); } const h2 = m2.count - d2; if (p2 && h2 > 0) { await $C({ propId: this.relId, roomId: p2.rid, propCount: h2 }); } nC.success("[自动送荧光棒]已完成"); e2.completeDay = this.today; } finally { this.executing = false; } }; vue.watch(() => e2.enabled, t2, { immediate: true }); vue.watch(() => e2.configList, t2, { immediate: true }); t2(); } } class p_ extends GS { getTextContent() { return `${super.getTextContent()} #js-player-asideMain{top:0}`; } } class v_ { constructor() { __publicField(this, "hideCssInitializers", [new GS(".Title-header", "直播间标题", false, true), new GS(".Title-report", "举报按钮", false, true), new GS(".Title-category", "直播间分类", false, true), new GS(".Title-addFriend", "添加友邻按钮", false, false), new GS(".Title-followNum", "粉丝数", false, false), new GS(".Title-followBtn", "关注按钮", false, false), new GS(".Title-AnchorLevel", "主播等级", false, true), new GS(".Title-anchorName", "主播名称", false, true), new GS(".Title-anchorHot", "热度", false, true), new GS(".Title-txAuthentication", "腾讯认证", false, false), new GS(".Title-official-wrap", "官方认证", false, false), new GS(".Title-anchorFriendWrapper", "友邻", false, true), new GS(".SociatyLabel", "公会", false, false), new GS(".Title-anchorComment", "主播玩过", false, false), new GS(".Title-sharkWeight", "成就点", false, true), new GS(".Title-anchorLocation", "商品橱窗", false, false), new GS(".SuperFansV2-entrance", "超级粉丝团", false, true), new GS(".Title-GiftHallEntrance-icon", "礼物展馆", false, true), new GS(".RoomVipSysTitle", "V周榜", false, true), new GS(".LuckyStarTitle", "福星挑战", false, true), new GS(".WishGiftTitle", "心愿", false, true), new GS(".RankCoverage", "小时榜", false, false), new GS(".YJWJGameIcon", "游戏数据", false, false), new GS(".ComSuperscript", "巨星榜", false, false), new GS(".DiamondFansMatchEntrance", "钻粉联赛", false, true), new GS(".GiftNamingEntrance", "最强勇士团", false, true), new GS(".TitleShare", "分享按钮", false, true), new GS(".ClientJump", "客户端按钮", false, true), new GS(".ToolbarActivityArea-left", "直播画面底部元素1", false, true), new GS(".ToolbarActivityArea-right", "直播画面底部元素2", false, true), new GS(".ToolbarGiftArea", "直播画面底部元素3", false, true), new GS(".PlayerToolbar-couponInfo", "福利券", false, true), new GS(".PlayerToolbar-ywInfo", "鱼丸", false, true), new GS(".PlayerToolbar-ycInfo", "鱼翅", false, true), new GS(".PlayerToolbar-getYCArea", "充值按钮", false, true), new GS(".PlayerToolbar-backpackArea", "背包按钮", false, true), new GS(".layout-Player-announce", "主播投稿和直播回看", false, true), new GS(".layout-Player-rank", "排行榜", false, true), new GS("#js-barrage-extend-container", "入场提示", false, true), new GS(`[class*="watermark"]`, "左下角房间号水印", false, false), new GS(".PubgInfo-icon", "PUBG战绩统计", true, false), new GS("#webmActKefuWeidget > *", "活动客服", true, false), new GS(".AnchorPocketTips", "亲密度Buff提醒", false, false), new GS(".IconCardAdBoundsBox", "直播画面右下角广告", true, false), new GS("#js-room-activity > *", "右侧活动浮窗", true, false), new GS("#js-room-top-banner", "顶部大广告", true, false), new GS(".CloseVideoPlayerAd", "未开播时视频广告", true, true), new GS(".Title-ad", "分享按钮左侧广告", true, false), new p_("#js-player-asideTopSuspension > *", "排行榜顶部广告", true, false)]); __publicField(this, "pageConfigStore", pinia.storeToRefs(FC())); } init() { this.hideCssInitializers.forEach((e2) => { new Promise(() => { e2.init(); }); }); } markTarget() { this.hideCssInitializers.forEach((e3) => e3.markTarget()); const { loading: e2 } = this.pageConfigStore; e2.value = false; } } class m_ { constructor() { __publicField(this, "src", "https://hm.baidu.com/hm.js?5c04e81d1fc372b0efa06e8c1b711042"); } init() { const e2 = document.createElement("script"); e2.src = this.src; const t2 = document.getElementsByTagName("script")[0]; t2 && t2.parentNode && t2.parentNode.insertBefore(e2, t2); } } class h_ { constructor() { __publicField(this, "selector", ".ChatSend-txt"); __publicField(this, "maxLength", 70); } init() { const e2 = document.querySelector(this.selector); if (e2 && e2.maxLength < this.maxLength) { e2.maxLength = this.maxLength; } } } const g_ = "DOUYUCRX"; rC[g_] = {}; async function y_() { if (!document.querySelector(".layout-Main")) { return; } new qS().init(); const e2 = new v_(); [new c_(), new SC(), new m_(), new f_(), e2].forEach((e3) => { new Promise(() => { e3.init(); }); }); await new Ee().observe(); new h_().init(); e2.markTarget(); } y_(); } }); require_main_001(); })(Vue, dayjs, Qs, VueDemi, Pinia);
QingJ © 2025
镜像随时可能失效,请加Q群300939539或关注我们的公众号极客氢云获取最新地址