您需要先安装一个扩展,例如 篡改猴、Greasemonkey 或 暴力猴,之后才能安装此脚本。
您需要先安装一个扩展,例如 篡改猴 或 暴力猴,之后才能安装此脚本。
您需要先安装一个扩展,例如 篡改猴 或 暴力猴,之后才能安装此脚本。
您需要先安装一个扩展,例如 篡改猴 或 Userscripts ,之后才能安装此脚本。
您需要先安装一款用户脚本管理器扩展,例如 Tampermonkey,才能安装此脚本。
您需要先安装用户脚本管理器扩展后才能安装此脚本。
小说一键下载,点击一键下载后,会自动抓取小说章节目录,完成后会打包成zip,小说格式为txt
当前为
// ==UserScript== // @name 🔥🔥小说下载器,支持部分VIP网站🔥🔥 // @namespace https://www.softrr.cn/ // @version 1.0.8 // @author hackhase // @description 小说一键下载,点击一键下载后,会自动抓取小说章节目录,完成后会打包成zip,小说格式为txt // @license MIT // @icon https://p1-tt.byteimg.com/origin/novel-static/a3621391ca2e537045168afda6722ee9 // @match *://fanqienovel.com/page/* // @match *://*.dushuge.com/* // @match *://*.b5200.net/* // @match *://*.bxfanqizha.com/* // @match *://*.qimao.com/shuku/* // @match *://*.hujuge.com/* // @match *://*.anshuge.com/files/* // @match *://*.biquxs.com/book/* // @require https://cdnjs.cloudflare.com/ajax/libs/crypto-js/4.2.0/crypto-js.js // @require data:application/javascript,%3Bwindow.CryptoJS%3DCryptoJS%3B // @require https://cdn.jsdelivr.net/npm/[email protected]/dist/vue.global.prod.js // @require data:application/javascript,%3Bwindow.Vue%3DVue%3B // @require https://cdn.jsdelivr.net/npm/[email protected]/dist/index.full.min.js // @require https://cdn.jsdelivr.net/npm/[email protected]/index.min.js // @resource element-plus/dist/index.css https://cdn.jsdelivr.net/npm/[email protected]/dist/index.css // @connect www.softrr.cn // @connect fanqienovel.com // @connect www.dushuge.com // @connect www.b5200.net // @connect www.bxfanqizha.com // @connect www.qimao.com // @connect api-ks.wtzw.com // @connect www.hujuge.com // @connect www.anshuge.com // @connect www.biquxs.com // @grant GM_addStyle // @grant GM_getResourceText // @grant GM_xmlhttpRequest // @grant unsafeWindow // ==/UserScript== (e=>{if(typeof GM_addStyle=="function"){GM_addStyle(e);return}const r=document.createElement("style");r.textContent=e,document.head.append(r)})(` @charset "UTF-8";:root{font-family:Inter,Avenir,Helvetica,Arial,sans-serif;font-size:16px;line-height:24px;font-weight:400;color-scheme:light dark;color:#ffffffde;background-color:#242424;font-synthesis:none;text-rendering:optimizeLegibility;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;-webkit-text-size-adjust:100%}a{font-weight:500;color:#646cff;text-decoration:inherit}a:hover{color:#535bf2}body{margin:0;place-items:center;min-width:320px;min-height:100vh}h1{font-size:3.2em;line-height:1.1}button{border-radius:8px;border:1px solid transparent;padding:.6em 1.2em;font-size:1em;font-weight:500;font-family:inherit;background-color:#1a1a1a;cursor:pointer;transition:border-color .25s}button:hover{border-color:#646cff}button:focus,button:focus-visible{outline:4px auto -webkit-focus-ring-color}.card{padding:2em}#app{height:100px}@media (prefers-color-scheme: light){:root{color:#213547;background-color:#fff}a:hover{color:#747bff}button{background-color:#f9f9f9}}:root{--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary-rgb:64,158,255;--el-color-success-rgb:103,194,58;--el-color-warning-rgb:230,162,60;--el-color-danger-rgb:245,108,108;--el-color-error-rgb:245,108,108;--el-color-info-rgb:144,147,153;--el-font-size-extra-large:20px;--el-font-size-large:18px;--el-font-size-medium:16px;--el-font-size-base:14px;--el-font-size-small:13px;--el-font-size-extra-small:12px;--el-font-family:"Helvetica Neue",Helvetica,"PingFang SC","Hiragino Sans GB","Microsoft YaHei","\u5FAE\u8F6F\u96C5\u9ED1",Arial,sans-serif;--el-font-weight-primary:500;--el-font-line-height-primary:24px;--el-index-normal:1;--el-index-top:1000;--el-index-popper:2000;--el-border-radius-base:4px;--el-border-radius-small:2px;--el-border-radius-round:20px;--el-border-radius-circle:100%;--el-transition-duration:.3s;--el-transition-duration-fast:.2s;--el-transition-function-ease-in-out-bezier:cubic-bezier(.645,.045,.355,1);--el-transition-function-fast-bezier:cubic-bezier(.23,1,.32,1);--el-transition-all:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade:opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade:transform var(--el-transition-duration) var(--el-transition-function-fast-bezier),opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear:opacity var(--el-transition-duration-fast) linear;--el-transition-border:border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow:box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color:color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large:40px;--el-component-size:32px;--el-component-size-small:24px}:root{color-scheme:light;--el-color-primary:#409eff;--el-color-primary-light-3:#79bbff;--el-color-primary-light-5:#a0cfff;--el-color-primary-light-7:#c6e2ff;--el-color-primary-light-8:#d9ecff;--el-color-primary-light-9:#ecf5ff;--el-color-primary-dark-2:#337ecc;--el-color-success:#67c23a;--el-color-success-light-3:#95d475;--el-color-success-light-5:#b3e19d;--el-color-success-light-7:#d1edc4;--el-color-success-light-8:#e1f3d8;--el-color-success-light-9:#f0f9eb;--el-color-success-dark-2:#529b2e;--el-color-warning:#e6a23c;--el-color-warning-light-3:#eebe77;--el-color-warning-light-5:#f3d19e;--el-color-warning-light-7:#f8e3c5;--el-color-warning-light-8:#faecd8;--el-color-warning-light-9:#fdf6ec;--el-color-warning-dark-2:#b88230;--el-color-danger:#f56c6c;--el-color-danger-light-3:#f89898;--el-color-danger-light-5:#fab6b6;--el-color-danger-light-7:#fcd3d3;--el-color-danger-light-8:#fde2e2;--el-color-danger-light-9:#fef0f0;--el-color-danger-dark-2:#c45656;--el-color-error:#f56c6c;--el-color-error-light-3:#f89898;--el-color-error-light-5:#fab6b6;--el-color-error-light-7:#fcd3d3;--el-color-error-light-8:#fde2e2;--el-color-error-light-9:#fef0f0;--el-color-error-dark-2:#c45656;--el-color-info:#909399;--el-color-info-light-3:#b1b3b8;--el-color-info-light-5:#c8c9cc;--el-color-info-light-7:#dedfe0;--el-color-info-light-8:#e9e9eb;--el-color-info-light-9:#f4f4f5;--el-color-info-dark-2:#73767a;--el-bg-color:#ffffff;--el-bg-color-page:#f2f3f5;--el-bg-color-overlay:#ffffff;--el-text-color-primary:#303133;--el-text-color-regular:#606266;--el-text-color-secondary:#909399;--el-text-color-placeholder:#a8abb2;--el-text-color-disabled:#c0c4cc;--el-border-color:#dcdfe6;--el-border-color-light:#e4e7ed;--el-border-color-lighter:#ebeef5;--el-border-color-extra-light:#f2f6fc;--el-border-color-dark:#d4d7de;--el-border-color-darker:#cdd0d6;--el-fill-color:#f0f2f5;--el-fill-color-light:#f5f7fa;--el-fill-color-lighter:#fafafa;--el-fill-color-extra-light:#fafcff;--el-fill-color-dark:#ebedf0;--el-fill-color-darker:#e6e8eb;--el-fill-color-blank:#ffffff;--el-box-shadow:0px 12px 32px 4px rgba(0,0,0,.04),0px 8px 20px rgba(0,0,0,.08);--el-box-shadow-light:0px 0px 12px rgba(0,0,0,.12);--el-box-shadow-lighter:0px 0px 6px rgba(0,0,0,.12);--el-box-shadow-dark:0px 16px 48px 16px rgba(0,0,0,.08),0px 12px 32px rgba(0,0,0,.12),0px 8px 16px -8px rgba(0,0,0,.16);--el-disabled-bg-color:var(--el-fill-color-light);--el-disabled-text-color:var(--el-text-color-placeholder);--el-disabled-border-color:var(--el-border-color-light);--el-overlay-color:rgba(0,0,0,.8);--el-overlay-color-light:rgba(0,0,0,.7);--el-overlay-color-lighter:rgba(0,0,0,.5);--el-mask-color:rgba(255,255,255,.9);--el-mask-color-extra-light:rgba(255,255,255,.3);--el-border-width:1px;--el-border-style:solid;--el-border-color-hover:var(--el-text-color-disabled);--el-border:var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey:var(--el-border-color)}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transform-origin:center top;transition:var(--el-transition-md-fade)}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transform-origin:center bottom;transition:var(--el-transition-md-fade)}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transform-origin:top left;transition:var(--el-transition-md-fade)}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-icon-loading{-webkit-animation:rotating 2s linear infinite;animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@-webkit-keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(1turn)}}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(1turn)}}.el-icon{--color:inherit;align-items:center;display:inline-flex;height:1em;justify-content:center;line-height:1em;position:relative;width:1em;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{-webkit-animation:rotating 2s linear infinite;animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}.el-progress{align-items:center;display:flex;line-height:1;position:relative}.el-progress__text{color:var(--el-text-color-regular);font-size:14px;line-height:1;margin-left:5px;min-width:50px}.el-progress__text i{display:block;vertical-align:middle}.el-progress--circle,.el-progress--dashboard{display:inline-block}.el-progress--circle .el-progress__text,.el-progress--dashboard .el-progress__text{left:0;margin:0;position:absolute;text-align:center;top:50%;transform:translateY(-50%);width:100%}.el-progress--circle .el-progress__text i,.el-progress--dashboard .el-progress__text i{display:inline-block;vertical-align:middle}.el-progress--without-text .el-progress__text{display:none}.el-progress--without-text .el-progress-bar{display:block;margin-right:0;padding-right:0}.el-progress--text-inside .el-progress-bar{margin-right:0;padding-right:0}.el-progress.is-success .el-progress-bar__inner{background-color:var(--el-color-success)}.el-progress.is-success .el-progress__text{color:var(--el-color-success)}.el-progress.is-warning .el-progress-bar__inner{background-color:var(--el-color-warning)}.el-progress.is-warning .el-progress__text{color:var(--el-color-warning)}.el-progress.is-exception .el-progress-bar__inner{background-color:var(--el-color-danger)}.el-progress.is-exception .el-progress__text{color:var(--el-color-danger)}.el-progress-bar{box-sizing:border-box;flex-grow:1}.el-progress-bar__outer{background-color:var(--el-border-color-lighter);border-radius:100px;height:6px;overflow:hidden;position:relative;vertical-align:middle}.el-progress-bar__inner{background-color:var(--el-color-primary);border-radius:100px;height:100%;left:0;line-height:1;position:absolute;text-align:right;top:0;transition:width .6s ease;white-space:nowrap}.el-progress-bar__inner:after{content:"";display:inline-block;height:100%;vertical-align:middle}.el-progress-bar__inner--indeterminate{-webkit-animation:indeterminate 3s infinite;animation:indeterminate 3s infinite;transform:translateZ(0)}.el-progress-bar__inner--striped{background-image:linear-gradient(45deg,rgba(0,0,0,.1) 25%,transparent 0,transparent 50%,rgba(0,0,0,.1) 0,rgba(0,0,0,.1) 75%,transparent 0,transparent);background-size:1.25em 1.25em}.el-progress-bar__inner--striped.el-progress-bar__inner--striped-flow{-webkit-animation:striped-flow 3s linear infinite;animation:striped-flow 3s linear infinite}.el-progress-bar__innerText{color:#fff;display:inline-block;font-size:12px;margin:0 5px;vertical-align:middle}@-webkit-keyframes progress{0%{background-position:0 0}to{background-position:32px 0}}@keyframes progress{0%{background-position:0 0}to{background-position:32px 0}}@-webkit-keyframes indeterminate{0%{left:-100%}to{left:100%}}@keyframes indeterminate{0%{left:-100%}to{left:100%}}@-webkit-keyframes striped-flow{0%{background-position:-100%}to{background-position:100%}}@keyframes striped-flow{0%{background-position:-100%}to{background-position:100%}}.el-textarea{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;display:inline-block;font-size:var(--el-font-size-base);position:relative;vertical-align:bottom;width:100%}.el-textarea__inner{-webkit-appearance:none;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));display:block;font-family:inherit;font-size:inherit;line-height:1.5;padding:5px 11px;position:relative;resize:vertical;transition:var(--el-transition-box-shadow);width:100%}.el-textarea__inner::-moz-placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:-ms-input-placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-textarea__inner:focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset;outline:none}.el-textarea .el-input__count{background:var(--el-fill-color-blank);bottom:5px;color:var(--el-color-info);font-size:12px;line-height:14px;position:absolute;right:10px}.el-textarea.is-disabled .el-textarea__inner{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset;color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::-moz-placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-disabled .el-textarea__inner:-ms-input-placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;--el-input-height:var(--el-component-size);box-sizing:border-box;display:inline-flex;font-size:var(--el-font-size-base);line-height:var(--el-input-height);position:relative;vertical-align:middle;width:var(--el-input-width)}.el-input::-webkit-scrollbar{width:6px;z-index:11}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{background:var(--el-text-color-disabled);border-radius:5px;width:6px}.el-input::-webkit-scrollbar-corner,.el-input::-webkit-scrollbar-track{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track-piece{background:var(--el-fill-color-blank);width:6px}.el-input .el-input__clear,.el-input .el-input__password{color:var(--el-input-icon-color);cursor:pointer;font-size:14px}.el-input .el-input__clear:hover,.el-input .el-input__password:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{align-items:center;color:var(--el-color-info);display:inline-flex;font-size:12px;height:100%}.el-input .el-input__count .el-input__count-inner{background:var(--el-fill-color-blank);display:inline-block;line-height:normal;padding-left:8px}.el-input__wrapper{align-items:center;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;cursor:text;display:inline-flex;flex-grow:1;justify-content:center;padding:1px 11px;transform:translateZ(0);transition:var(--el-transition-box-shadow)}.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 32px) - 2px);-webkit-appearance:none;background:none;border:none;box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));flex-grow:1;font-size:inherit;height:var(--el-input-inner-height);line-height:var(--el-input-inner-height);outline:none;padding:0;width:100%}.el-input__inner:focus{outline:none}.el-input__inner::-moz-placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner:-ms-input-placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner[type=password]::-ms-reveal{display:none}.el-input__inner[type=number]{line-height:1}.el-input__prefix{color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:inline-flex;flex-shrink:0;flex-wrap:nowrap;height:100%;pointer-events:none;text-align:center;transition:all var(--el-transition-duration);white-space:nowrap}.el-input__prefix-inner{align-items:center;display:inline-flex;justify-content:center;pointer-events:all}.el-input__prefix-inner>:last-child{margin-right:8px}.el-input__prefix-inner>:first-child,.el-input__prefix-inner>:first-child.el-input__icon{margin-left:0}.el-input__suffix{color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:inline-flex;flex-shrink:0;flex-wrap:nowrap;height:100%;pointer-events:none;text-align:center;transition:all var(--el-transition-duration);white-space:nowrap}.el-input__suffix-inner{align-items:center;display:inline-flex;justify-content:center;pointer-events:all}.el-input__suffix-inner>:first-child{margin-left:8px}.el-input .el-input__icon{align-items:center;display:flex;height:inherit;justify-content:center;line-height:inherit;margin-left:8px;transition:all var(--el-transition-duration)}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-color, ) inset}.el-input.is-disabled{cursor:not-allowed}.el-input.is-disabled .el-input__wrapper{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset}.el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color);-webkit-text-fill-color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::-moz-placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__inner:-ms-input-placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--large{--el-input-height:var(--el-component-size-large);font-size:14px}.el-input--large .el-input__wrapper{padding:1px 15px}.el-input--large .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 40px) - 2px)}.el-input--small{--el-input-height:var(--el-component-size-small);font-size:12px}.el-input--small .el-input__wrapper{padding:1px 7px}.el-input--small .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 24px) - 2px)}.el-input-group{align-items:stretch;display:inline-flex;width:100%}.el-input-group__append,.el-input-group__prepend{align-items:center;background-color:var(--el-fill-color-light);border-radius:var(--el-input-border-radius);color:var(--el-color-info);display:inline-flex;justify-content:center;min-height:100%;padding:0 20px;position:relative;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:none}.el-input-group__append .el-button,.el-input-group__append .el-select,.el-input-group__prepend .el-button,.el-input-group__prepend .el-select{display:inline-block;margin:0 -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-select__wrapper,.el-input-group__append div.el-select:hover .el-select__wrapper,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-select__wrapper,.el-input-group__prepend div.el-select:hover .el-select__wrapper{background-color:transparent;border-color:transparent;color:inherit}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-bottom-right-radius:0;border-right:0;border-top-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group__append{border-bottom-left-radius:0;border-left:0;border-top-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--prepend>.el-input__wrapper{border-bottom-left-radius:0;border-top-left-radius:0}.el-input-group--prepend .el-input-group__prepend .el-select .el-select__wrapper{border-bottom-right-radius:0;border-top-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group--append>.el-input__wrapper{border-bottom-right-radius:0;border-top-right-radius:0}.el-input-group--append .el-input-group__append .el-select .el-select__wrapper{border-bottom-left-radius:0;border-top-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-hidden{display:none!important}.el-tag{--el-tag-font-size:12px;--el-tag-border-radius:4px;--el-tag-border-radius-rounded:9999px;--el-tag-bg-color:var(--el-color-primary-light-9);--el-tag-border-color:var(--el-color-primary-light-8);--el-tag-hover-color:var(--el-color-primary);align-items:center;background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);border-radius:var(--el-tag-border-radius);border-style:solid;border-width:1px;box-sizing:border-box;color:var(--el-tag-text-color);display:inline-flex;font-size:var(--el-tag-font-size);height:24px;justify-content:center;line-height:1;padding:0 9px;vertical-align:middle;white-space:nowrap;--el-icon-size:14px}.el-tag.el-tag--primary{--el-tag-bg-color:var(--el-color-primary-light-9);--el-tag-border-color:var(--el-color-primary-light-8);--el-tag-hover-color:var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-bg-color:var(--el-color-success-light-9);--el-tag-border-color:var(--el-color-success-light-8);--el-tag-hover-color:var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-bg-color:var(--el-color-warning-light-9);--el-tag-border-color:var(--el-color-warning-light-8);--el-tag-hover-color:var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-bg-color:var(--el-color-danger-light-9);--el-tag-border-color:var(--el-color-danger-light-8);--el-tag-hover-color:var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-bg-color:var(--el-color-error-light-9);--el-tag-border-color:var(--el-color-error-light-8);--el-tag-hover-color:var(--el-color-error)}.el-tag.el-tag--info{--el-tag-bg-color:var(--el-color-info-light-9);--el-tag-border-color:var(--el-color-info-light-8);--el-tag-hover-color:var(--el-color-info)}.el-tag.el-tag--primary{--el-tag-text-color:var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-text-color:var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-text-color:var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-text-color:var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-text-color:var(--el-color-error)}.el-tag.el-tag--info{--el-tag-text-color:var(--el-color-info)}.el-tag.is-hit{border-color:var(--el-color-primary)}.el-tag.is-round{border-radius:var(--el-tag-border-radius-rounded)}.el-tag .el-tag__close{color:var(--el-tag-text-color);flex-shrink:0}.el-tag .el-tag__close:hover{background-color:var(--el-tag-hover-color);color:var(--el-color-white)}.el-tag .el-icon{border-radius:50%;cursor:pointer;font-size:calc(var(--el-icon-size) - 2px);height:var(--el-icon-size);width:var(--el-icon-size)}.el-tag .el-tag__close{margin-left:6px}.el-tag--dark{--el-tag-bg-color:var(--el-color-primary);--el-tag-border-color:var(--el-color-primary);--el-tag-hover-color:var(--el-color-primary-light-3);--el-tag-text-color:var(--el-color-white)}.el-tag--dark.el-tag--primary{--el-tag-bg-color:var(--el-color-primary);--el-tag-border-color:var(--el-color-primary);--el-tag-hover-color:var(--el-color-primary-light-3)}.el-tag--dark.el-tag--success{--el-tag-bg-color:var(--el-color-success);--el-tag-border-color:var(--el-color-success);--el-tag-hover-color:var(--el-color-success-light-3)}.el-tag--dark.el-tag--warning{--el-tag-bg-color:var(--el-color-warning);--el-tag-border-color:var(--el-color-warning);--el-tag-hover-color:var(--el-color-warning-light-3)}.el-tag--dark.el-tag--danger{--el-tag-bg-color:var(--el-color-danger);--el-tag-border-color:var(--el-color-danger);--el-tag-hover-color:var(--el-color-danger-light-3)}.el-tag--dark.el-tag--error{--el-tag-bg-color:var(--el-color-error);--el-tag-border-color:var(--el-color-error);--el-tag-hover-color:var(--el-color-error-light-3)}.el-tag--dark.el-tag--info{--el-tag-bg-color:var(--el-color-info);--el-tag-border-color:var(--el-color-info);--el-tag-hover-color:var(--el-color-info-light-3)}.el-tag--dark.el-tag--danger,.el-tag--dark.el-tag--error,.el-tag--dark.el-tag--info,.el-tag--dark.el-tag--primary,.el-tag--dark.el-tag--success,.el-tag--dark.el-tag--warning{--el-tag-text-color:var(--el-color-white)}.el-tag--plain{--el-tag-border-color:var(--el-color-primary-light-5);--el-tag-hover-color:var(--el-color-primary);--el-tag-bg-color:var(--el-fill-color-blank)}.el-tag--plain.el-tag--primary{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-primary-light-5);--el-tag-hover-color:var(--el-color-primary)}.el-tag--plain.el-tag--success{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-success-light-5);--el-tag-hover-color:var(--el-color-success)}.el-tag--plain.el-tag--warning{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-warning-light-5);--el-tag-hover-color:var(--el-color-warning)}.el-tag--plain.el-tag--danger{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-danger-light-5);--el-tag-hover-color:var(--el-color-danger)}.el-tag--plain.el-tag--error{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-error-light-5);--el-tag-hover-color:var(--el-color-error)}.el-tag--plain.el-tag--info{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-info-light-5);--el-tag-hover-color:var(--el-color-info)}.el-tag.is-closable{padding-right:5px}.el-tag--large{height:32px;padding:0 11px;--el-icon-size:16px}.el-tag--large .el-tag__close{margin-left:8px}.el-tag--large.is-closable{padding-right:7px}.el-tag--small{height:20px;padding:0 7px;--el-icon-size:12px}.el-tag--small .el-tag__close{margin-left:4px}.el-tag--small.is-closable{padding-right:3px}.el-tag--small .el-icon-close{transform:scale(.8)}.el-tag.el-tag--primary.is-hit{border-color:var(--el-color-primary)}.el-tag.el-tag--success.is-hit{border-color:var(--el-color-success)}.el-tag.el-tag--warning.is-hit{border-color:var(--el-color-warning)}.el-tag.el-tag--danger.is-hit{border-color:var(--el-color-danger)}.el-tag.el-tag--error.is-hit{border-color:var(--el-color-error)}.el-tag.el-tag--info.is-hit{border-color:var(--el-color-info)}.el-select-dropdown.is-multiple .el-select-dropdown__item.is-selected:after{background-color:var(--el-color-primary);background-position:50%;background-repeat:no-repeat;border-right:none;border-top:none;content:"";height:12px;mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask-size:100% 100%;-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;-webkit-mask-size:100% 100%;position:absolute;right:20px;top:50%;transform:translateY(-50%);width:12px}.el-scrollbar{--el-scrollbar-opacity:.3;--el-scrollbar-bg-color:var(--el-text-color-secondary);--el-scrollbar-hover-opacity:.5;--el-scrollbar-hover-bg-color:var(--el-text-color-secondary);height:100%;overflow:hidden;position:relative}.el-scrollbar__wrap{height:100%;overflow:auto}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{background-color:var(--el-scrollbar-bg-color,var(--el-text-color-secondary));border-radius:inherit;cursor:pointer;display:block;height:0;opacity:var(--el-scrollbar-opacity,.3);position:relative;transition:var(--el-transition-duration) background-color;width:0}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color,var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity,.5)}.el-scrollbar__bar{border-radius:4px;bottom:2px;position:absolute;right:2px;z-index:1}.el-scrollbar__bar.is-vertical{top:2px;width:6px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity .34s ease-out}.el-scrollbar-fade-leave-active{transition:opacity .12s ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}.el-popper{--el-popper-border-radius:var(--el-popover-border-radius,4px);border-radius:var(--el-popper-border-radius);font-size:12px;line-height:20px;min-width:10px;overflow-wrap:break-word;padding:5px 11px;position:absolute;visibility:visible;z-index:2000}.el-popper.is-dark{background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary);color:var(--el-bg-color)}.el-popper.is-dark .el-popper__arrow:before{background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary);right:0}.el-popper.is-light{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow:before{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);right:0}.el-popper.is-pure{padding:0}.el-popper__arrow{height:10px;position:absolute;width:10px;z-index:-1}.el-popper__arrow:before{background:var(--el-text-color-primary);box-sizing:border-box;content:" ";height:10px;position:absolute;transform:rotate(45deg);width:10px;z-index:-1}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow:before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow:before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow:before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow:before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-left-color:transparent!important;border-top-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-bottom-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent!important;border-top-color:transparent!important}.el-select-dropdown{border-radius:var(--el-border-radius-base);box-sizing:border-box;z-index:calc(var(--el-index-top) + 1)}.el-select-dropdown .el-scrollbar.is-empty .el-select-dropdown__list{padding:0}.el-select-dropdown__empty,.el-select-dropdown__loading{color:var(--el-text-color-secondary);font-size:var(--el-select-font-size);margin:0;padding:10px 0;text-align:center}.el-select-dropdown__wrap{max-height:274px}.el-select-dropdown__list{box-sizing:border-box;list-style:none;margin:0;padding:6px 0}.el-select-dropdown__list.el-vl__window{margin:6px 0;padding:0}.el-select-dropdown__header{border-bottom:1px solid var(--el-border-color-light);padding:10px}.el-select-dropdown__footer{border-top:1px solid var(--el-border-color-light);padding:10px}.el-select-dropdown__item{box-sizing:border-box;color:var(--el-text-color-regular);cursor:pointer;font-size:var(--el-font-size-base);height:34px;line-height:34px;overflow:hidden;padding:0 32px 0 20px;position:relative;text-overflow:ellipsis;white-space:nowrap}.el-select-dropdown__item.is-hovering{background-color:var(--el-fill-color-light)}.el-select-dropdown__item.is-selected{color:var(--el-color-primary);font-weight:700}.el-select-dropdown__item.is-disabled{background-color:unset;color:var(--el-text-color-placeholder);cursor:not-allowed}.el-select-dropdown.is-multiple .el-select-dropdown__item.is-selected:after{background-color:var(--el-color-primary);background-position:50%;background-repeat:no-repeat;border-right:none;border-top:none;content:"";height:12px;mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask-size:100% 100%;-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;-webkit-mask-size:100% 100%;position:absolute;right:20px;top:50%;transform:translateY(-50%);width:12px}.el-select-dropdown.is-multiple .el-select-dropdown__item.is-disabled:after{background-color:var(--el-text-color-placeholder)}.el-select-group{margin:0;padding:0}.el-select-group__wrap{list-style:none;margin:0;padding:0;position:relative}.el-select-group__wrap:not(:last-of-type){padding-bottom:24px}.el-select-group__wrap:not(:last-of-type):after{background:var(--el-border-color-light);bottom:12px;content:"";display:block;height:1px;left:20px;position:absolute;right:20px}.el-select-group__split-dash{background:var(--el-border-color-light);height:1px;left:20px;position:absolute;right:20px}.el-select-group__title{color:var(--el-color-info);font-size:12px;line-height:30px;padding-left:20px}.el-select-group .el-select-dropdown__item{padding-left:20px}.el-select{--el-select-border-color-hover:var(--el-border-color-hover);--el-select-disabled-color:var(--el-disabled-text-color);--el-select-disabled-border:var(--el-disabled-border-color);--el-select-font-size:var(--el-font-size-base);--el-select-close-hover-color:var(--el-text-color-secondary);--el-select-input-color:var(--el-text-color-placeholder);--el-select-multiple-input-color:var(--el-text-color-regular);--el-select-input-focus-border-color:var(--el-color-primary);--el-select-input-font-size:14px;--el-select-width:100%;display:inline-block;position:relative;vertical-align:middle;width:var(--el-select-width)}.el-select__wrapper{align-items:center;background-color:var(--el-fill-color-blank);border-radius:var(--el-border-radius-base);box-shadow:0 0 0 1px var(--el-border-color) inset;box-sizing:border-box;cursor:pointer;display:flex;font-size:14px;gap:6px;line-height:24px;min-height:32px;padding:4px 12px;position:relative;text-align:left;transition:var(--el-transition-duration)}.el-select__wrapper:hover{box-shadow:0 0 0 1px var(--el-text-color) inset}.el-select__wrapper.is-filterable{cursor:text}.el-select__wrapper.is-focused{box-shadow:0 0 0 1px var(--el-color-primary) inset}.el-select__wrapper.is-hovering:not(.is-focused){box-shadow:0 0 0 1px var(--el-border-color-hover) inset}.el-select__wrapper.is-disabled{background-color:var(--el-fill-color-light);box-shadow:0 0 0 1px var(--el-select-disabled-border) inset;color:var(--el-text-color-placeholder);cursor:not-allowed}.el-select__wrapper.is-disabled:hover{box-shadow:0 0 0 1px var(--el-select-disabled-border) inset}.el-select__wrapper.is-disabled.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-select__wrapper.is-disabled .el-select__selected-item{color:var(--el-select-disabled-color)}.el-select__wrapper.is-disabled .el-select__caret,.el-select__wrapper.is-disabled .el-tag{cursor:not-allowed}.el-select__prefix,.el-select__suffix{align-items:center;color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:flex;flex-shrink:0;gap:6px}.el-select__caret{color:var(--el-select-input-color);cursor:pointer;font-size:var(--el-select-input-font-size);transform:rotate(0);transition:var(--el-transition-duration)}.el-select__caret.is-reverse{transform:rotate(180deg)}.el-select__selection{align-items:center;display:flex;flex:1;flex-wrap:wrap;gap:6px;min-width:0;position:relative}.el-select__selection.is-near{margin-left:-8px}.el-select__selection .el-tag{border-color:transparent;cursor:pointer}.el-select__selection .el-tag .el-tag__content{min-width:0}.el-select__selected-item{display:flex;flex-wrap:wrap;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.el-select__tags-text{line-height:normal}.el-select__placeholder,.el-select__tags-text{display:block;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.el-select__placeholder{color:var(--el-input-text-color,var(--el-text-color-regular));position:absolute;top:50%;transform:translateY(-50%);width:100%}.el-select__placeholder.is-transparent{color:var(--el-text-color-placeholder);-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.el-select__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);box-shadow:var(--el-box-shadow-light)}.el-select__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-border-color-light)}.el-select__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-left-color:transparent;border-top-color:transparent}.el-select__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-select__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-bottom-color:transparent;border-left-color:transparent}.el-select__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-select__input-wrapper{max-width:100%}.el-select__input-wrapper.is-hidden{opacity:0;position:absolute}.el-select__input{-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent;border:none;color:var(--el-select-multiple-input-color);font-family:inherit;font-size:inherit;height:24px;max-width:100%;outline:none;padding:0}.el-select__input.is-disabled{cursor:not-allowed}.el-select__input-calculator{left:0;max-width:100%;overflow:hidden;position:absolute;top:0;visibility:hidden;white-space:pre}.el-select--large .el-select__wrapper{font-size:14px;gap:6px;line-height:24px;min-height:40px;padding:8px 16px}.el-select--large .el-select__selection{gap:6px}.el-select--large .el-select__selection.is-near{margin-left:-8px}.el-select--large .el-select__prefix,.el-select--large .el-select__suffix{gap:6px}.el-select--large .el-select__input{height:24px}.el-select--small .el-select__wrapper{font-size:12px;gap:4px;line-height:20px;min-height:24px;padding:2px 8px}.el-select--small .el-select__selection{gap:4px}.el-select--small .el-select__selection.is-near{margin-left:-6px}.el-select--small .el-select__prefix,.el-select--small .el-select__suffix{gap:4px}.el-select--small .el-select__input{height:20px}.modal-wrapper[data-v-b425a440]{position:fixed;top:0;left:0;width:100%;height:100%;background-color:#00000080;display:flex;justify-content:center;align-items:center;z-index:9999}.modal_code[data-v-b425a440]{background-color:#fff;padding:20px;border-radius:5px}.header[data-v-b425a440]{display:flex;justify-content:space-between;align-items:center;margin-bottom:10px}.header h2[data-v-b425a440]{margin:0;font-size:20px;font-weight:700}.header button[data-v-b425a440]{border:none;background-color:transparent;font-size:20px;cursor:pointer}.content[data-v-b425a440]{max-height:400px;overflow:auto;font-size:16px;display:flex;justify-content:space-between}.content .produce p[data-v-b425a440]{margin-top:15px}.content .produce .ipt[data-v-b425a440]{margin-top:15px;height:30px;border-radius:5px;padding-left:10px}.content .img[data-v-b425a440]{display:flex;align-items:center;justify-content:center}.content .img img[data-v-b425a440]{width:180px}input[data-v-b425a440]::-webkit-input-placeholder{color:#aab2bd;font-size:14px;padding-left:5px}.downLoad_container[data-v-9a5f872a]{width:160px;position:fixed;right:10px;top:80px;color:#111;z-index:999;display:flex;flex-direction:column;justify-content:center;align-items:center}.downLoad_container .down[data-v-9a5f872a]{margin-top:10px;margin-bottom:10px;width:100px;height:30px;font-size:14px;background-color:red;color:#fff;border-radius:10%;z-index:999;display:flex;justify-content:center;align-content:center}.downLoad_container .down[data-v-9a5f872a]:hover{background-color:#87ceeb;color:#fff} `); (async function (vue, elementPlus, CryptoJS) { 'use strict'; const composeEventHandlers = (theirsHandler, oursHandler, { checkForDefaultPrevented = true } = {}) => { const handleEvent = (event) => { const shouldPrevent = theirsHandler == null ? void 0 : theirsHandler(event); if (checkForDefaultPrevented === false || !shouldPrevent) { return oursHandler == null ? void 0 : oursHandler(event); } }; return handleEvent; }; var _a; const isClient = typeof window !== "undefined"; const isString$1 = (val) => typeof val === "string"; const noop = () => { }; const isIOS = isClient && ((_a = window == null ? void 0 : window.navigator) == null ? void 0 : _a.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent); function resolveUnref(r) { return typeof r === "function" ? r() : vue.unref(r); } function identity$1(arg) { return arg; } function tryOnScopeDispose(fn2) { if (vue.getCurrentScope()) { vue.onScopeDispose(fn2); return true; } return false; } function tryOnMounted(fn2, sync = true) { if (vue.getCurrentInstance()) vue.onMounted(fn2); else if (sync) fn2(); else vue.nextTick(fn2); } function unrefElement(elRef) { var _a2; const plain = resolveUnref(elRef); return (_a2 = plain == null ? void 0 : plain.$el) != null ? _a2 : plain; } const defaultWindow = isClient ? window : void 0; function useEventListener(...args) { let target; let events; let listeners; let options; if (isString$1(args[0]) || Array.isArray(args[0])) { [events, listeners, options] = args; target = defaultWindow; } else { [target, events, listeners, options] = args; } if (!target) return noop; if (!Array.isArray(events)) events = [events]; if (!Array.isArray(listeners)) listeners = [listeners]; const cleanups = []; const cleanup = () => { cleanups.forEach((fn2) => fn2()); cleanups.length = 0; }; const register = (el, event, listener, options2) => { el.addEventListener(event, listener, options2); return () => el.removeEventListener(event, listener, options2); }; const stopWatch = vue.watch(() => [unrefElement(target), resolveUnref(options)], ([el, options2]) => { cleanup(); if (!el) return; cleanups.push(...events.flatMap((event) => { return listeners.map((listener) => register(el, event, listener, options2)); })); }, { immediate: true, flush: "post" }); const stop = () => { stopWatch(); cleanup(); }; tryOnScopeDispose(stop); return stop; } let _iOSWorkaround = false; function onClickOutside(target, handler, options = {}) { const { window: window2 = defaultWindow, ignore = [], capture = true, detectIframe = false } = options; if (!window2) return; if (isIOS && !_iOSWorkaround) { _iOSWorkaround = true; Array.from(window2.document.body.children).forEach((el) => el.addEventListener("click", noop)); } let shouldListen = true; const shouldIgnore = (event) => { return ignore.some((target2) => { if (typeof target2 === "string") { return Array.from(window2.document.querySelectorAll(target2)).some((el) => el === event.target || event.composedPath().includes(el)); } else { const el = unrefElement(target2); return el && (event.target === el || event.composedPath().includes(el)); } }); }; const listener = (event) => { const el = unrefElement(target); if (!el || el === event.target || event.composedPath().includes(el)) return; if (event.detail === 0) shouldListen = !shouldIgnore(event); if (!shouldListen) { shouldListen = true; return; } handler(event); }; const cleanup = [ useEventListener(window2, "click", listener, { passive: true, capture }), useEventListener(window2, "pointerdown", (e) => { const el = unrefElement(target); if (el) shouldListen = !e.composedPath().includes(el) && !shouldIgnore(e); }, { passive: true }), detectIframe && useEventListener(window2, "blur", (event) => { var _a2; const el = unrefElement(target); if (((_a2 = window2.document.activeElement) == null ? void 0 : _a2.tagName) === "IFRAME" && !(el == null ? void 0 : el.contains(window2.document.activeElement))) handler(event); }) ].filter(Boolean); const stop = () => cleanup.forEach((fn2) => fn2()); return stop; } function useSupported(callback, sync = false) { const isSupported = vue.ref(); const update = () => isSupported.value = Boolean(callback()); update(); tryOnMounted(update, sync); return isSupported; } const _global = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {}; const globalKey = "__vueuse_ssr_handlers__"; _global[globalKey] = _global[globalKey] || {}; var __getOwnPropSymbols$g = Object.getOwnPropertySymbols; var __hasOwnProp$g = Object.prototype.hasOwnProperty; var __propIsEnum$g = Object.prototype.propertyIsEnumerable; var __objRest$2 = (source, exclude) => { var target = {}; for (var prop in source) if (__hasOwnProp$g.call(source, prop) && exclude.indexOf(prop) < 0) target[prop] = source[prop]; if (source != null && __getOwnPropSymbols$g) for (var prop of __getOwnPropSymbols$g(source)) { if (exclude.indexOf(prop) < 0 && __propIsEnum$g.call(source, prop)) target[prop] = source[prop]; } return target; }; function useResizeObserver(target, callback, options = {}) { const _a2 = options, { window: window2 = defaultWindow } = _a2, observerOptions = __objRest$2(_a2, ["window"]); let observer; const isSupported = useSupported(() => window2 && "ResizeObserver" in window2); const cleanup = () => { if (observer) { observer.disconnect(); observer = void 0; } }; const stopWatch = vue.watch(() => unrefElement(target), (el) => { cleanup(); if (isSupported.value && window2 && el) { observer = new ResizeObserver(callback); observer.observe(el, observerOptions); } }, { immediate: true, flush: "post" }); const stop = () => { cleanup(); stopWatch(); }; tryOnScopeDispose(stop); return { isSupported, stop }; } var __getOwnPropSymbols$8 = Object.getOwnPropertySymbols; var __hasOwnProp$8 = Object.prototype.hasOwnProperty; var __propIsEnum$8 = Object.prototype.propertyIsEnumerable; var __objRest$1 = (source, exclude) => { var target = {}; for (var prop in source) if (__hasOwnProp$8.call(source, prop) && exclude.indexOf(prop) < 0) target[prop] = source[prop]; if (source != null && __getOwnPropSymbols$8) for (var prop of __getOwnPropSymbols$8(source)) { if (exclude.indexOf(prop) < 0 && __propIsEnum$8.call(source, prop)) target[prop] = source[prop]; } return target; }; function useMutationObserver(target, callback, options = {}) { const _a2 = options, { window: window2 = defaultWindow } = _a2, mutationOptions = __objRest$1(_a2, ["window"]); let observer; const isSupported = useSupported(() => window2 && "MutationObserver" in window2); const cleanup = () => { if (observer) { observer.disconnect(); observer = void 0; } }; const stopWatch = vue.watch(() => unrefElement(target), (el) => { cleanup(); if (isSupported.value && window2 && el) { observer = new MutationObserver(callback); observer.observe(el, mutationOptions); } }, { immediate: true }); const stop = () => { cleanup(); stopWatch(); }; tryOnScopeDispose(stop); return { isSupported, stop }; } var SwipeDirection; (function(SwipeDirection2) { SwipeDirection2["UP"] = "UP"; SwipeDirection2["RIGHT"] = "RIGHT"; SwipeDirection2["DOWN"] = "DOWN"; SwipeDirection2["LEFT"] = "LEFT"; SwipeDirection2["NONE"] = "NONE"; })(SwipeDirection || (SwipeDirection = {})); var __defProp = Object.defineProperty; var __getOwnPropSymbols = Object.getOwnPropertySymbols; var __hasOwnProp = Object.prototype.hasOwnProperty; var __propIsEnum = Object.prototype.propertyIsEnumerable; var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value; var __spreadValues = (a, b) => { for (var prop in b || (b = {})) if (__hasOwnProp.call(b, prop)) __defNormalProp(a, prop, b[prop]); if (__getOwnPropSymbols) for (var prop of __getOwnPropSymbols(b)) { if (__propIsEnum.call(b, prop)) __defNormalProp(a, prop, b[prop]); } return a; }; const _TransitionPresets = { easeInSine: [0.12, 0, 0.39, 0], easeOutSine: [0.61, 1, 0.88, 1], easeInOutSine: [0.37, 0, 0.63, 1], easeInQuad: [0.11, 0, 0.5, 0], easeOutQuad: [0.5, 1, 0.89, 1], easeInOutQuad: [0.45, 0, 0.55, 1], easeInCubic: [0.32, 0, 0.67, 0], easeOutCubic: [0.33, 1, 0.68, 1], easeInOutCubic: [0.65, 0, 0.35, 1], easeInQuart: [0.5, 0, 0.75, 0], easeOutQuart: [0.25, 1, 0.5, 1], easeInOutQuart: [0.76, 0, 0.24, 1], easeInQuint: [0.64, 0, 0.78, 0], easeOutQuint: [0.22, 1, 0.36, 1], easeInOutQuint: [0.83, 0, 0.17, 1], easeInExpo: [0.7, 0, 0.84, 0], easeOutExpo: [0.16, 1, 0.3, 1], easeInOutExpo: [0.87, 0, 0.13, 1], easeInCirc: [0.55, 0, 1, 0.45], easeOutCirc: [0, 0.55, 0.45, 1], easeInOutCirc: [0.85, 0, 0.15, 1], easeInBack: [0.36, 0, 0.66, -0.56], easeOutBack: [0.34, 1.56, 0.64, 1], easeInOutBack: [0.68, -0.6, 0.32, 1.6] }; __spreadValues({ linear: identity$1 }, _TransitionPresets); const isFirefox = () => isClient && /firefox/i.test(window.navigator.userAgent); const NOOP = () => { }; const hasOwnProperty$9 = Object.prototype.hasOwnProperty; const hasOwn = (val, key) => hasOwnProperty$9.call(val, key); const isArray$2 = Array.isArray; const isFunction$1 = (val) => typeof val === "function"; const isString = (val) => typeof val === "string"; const isObject$1 = (val) => val !== null && typeof val === "object"; const objectToString$1 = Object.prototype.toString; const toTypeString = (value) => objectToString$1.call(value); const toRawType = (value) => { return toTypeString(value).slice(8, -1); }; var freeGlobal = typeof global == "object" && global && global.Object === Object && global; const freeGlobal$1 = freeGlobal; var freeSelf = typeof self == "object" && self && self.Object === Object && self; var root = freeGlobal$1 || freeSelf || Function("return this")(); const root$1 = root; var Symbol$1 = root$1.Symbol; const Symbol$2 = Symbol$1; var objectProto$b = Object.prototype; var hasOwnProperty$8 = objectProto$b.hasOwnProperty; var nativeObjectToString$1 = objectProto$b.toString; var symToStringTag$1 = Symbol$2 ? Symbol$2.toStringTag : void 0; function getRawTag(value) { var isOwn = hasOwnProperty$8.call(value, symToStringTag$1), tag = value[symToStringTag$1]; try { value[symToStringTag$1] = void 0; var unmasked = true; } catch (e) { } var result = nativeObjectToString$1.call(value); if (unmasked) { if (isOwn) { value[symToStringTag$1] = tag; } else { delete value[symToStringTag$1]; } } return result; } var objectProto$a = Object.prototype; var nativeObjectToString = objectProto$a.toString; function objectToString(value) { return nativeObjectToString.call(value); } var nullTag = "[object Null]", undefinedTag = "[object Undefined]"; var symToStringTag = Symbol$2 ? Symbol$2.toStringTag : void 0; function baseGetTag(value) { if (value == null) { return value === void 0 ? undefinedTag : nullTag; } return symToStringTag && symToStringTag in Object(value) ? getRawTag(value) : objectToString(value); } function isObjectLike(value) { return value != null && typeof value == "object"; } var symbolTag$1 = "[object Symbol]"; function isSymbol(value) { return typeof value == "symbol" || isObjectLike(value) && baseGetTag(value) == symbolTag$1; } function arrayMap(array, iteratee) { var index = -1, length = array == null ? 0 : array.length, result = Array(length); while (++index < length) { result[index] = iteratee(array[index], index, array); } return result; } var isArray = Array.isArray; const isArray$1 = isArray; var INFINITY$2 = 1 / 0; var symbolProto$1 = Symbol$2 ? Symbol$2.prototype : void 0, symbolToString = symbolProto$1 ? symbolProto$1.toString : void 0; function baseToString(value) { if (typeof value == "string") { return value; } if (isArray$1(value)) { return arrayMap(value, baseToString) + ""; } if (isSymbol(value)) { return symbolToString ? symbolToString.call(value) : ""; } var result = value + ""; return result == "0" && 1 / value == -INFINITY$2 ? "-0" : result; } var reWhitespace = /\s/; function trimmedEndIndex(string) { var index = string.length; while (index-- && reWhitespace.test(string.charAt(index))) { } return index; } var reTrimStart = /^\s+/; function baseTrim(string) { return string ? string.slice(0, trimmedEndIndex(string) + 1).replace(reTrimStart, "") : string; } function isObject(value) { var type = typeof value; return value != null && (type == "object" || type == "function"); } var NAN = 0 / 0; var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; var reIsBinary = /^0b[01]+$/i; var reIsOctal = /^0o[0-7]+$/i; var freeParseInt = parseInt; function toNumber(value) { if (typeof value == "number") { return value; } if (isSymbol(value)) { return NAN; } if (isObject(value)) { var other = typeof value.valueOf == "function" ? value.valueOf() : value; value = isObject(other) ? other + "" : other; } if (typeof value != "string") { return value === 0 ? value : +value; } value = baseTrim(value); var isBinary = reIsBinary.test(value); return isBinary || reIsOctal.test(value) ? freeParseInt(value.slice(2), isBinary ? 2 : 8) : reIsBadHex.test(value) ? NAN : +value; } var INFINITY$1 = 1 / 0, MAX_INTEGER = 17976931348623157e292; function toFinite(value) { if (!value) { return value === 0 ? value : 0; } value = toNumber(value); if (value === INFINITY$1 || value === -INFINITY$1) { var sign = value < 0 ? -1 : 1; return sign * MAX_INTEGER; } return value === value ? value : 0; } function toInteger(value) { var result = toFinite(value), remainder = result % 1; return result === result ? remainder ? result - remainder : result : 0; } function identity(value) { return value; } var asyncTag = "[object AsyncFunction]", funcTag$1 = "[object Function]", genTag = "[object GeneratorFunction]", proxyTag = "[object Proxy]"; function isFunction(value) { if (!isObject(value)) { return false; } var tag = baseGetTag(value); return tag == funcTag$1 || tag == genTag || tag == asyncTag || tag == proxyTag; } var coreJsData = root$1["__core-js_shared__"]; const coreJsData$1 = coreJsData; var maskSrcKey = function() { var uid = /[^.]+$/.exec(coreJsData$1 && coreJsData$1.keys && coreJsData$1.keys.IE_PROTO || ""); return uid ? "Symbol(src)_1." + uid : ""; }(); function isMasked(func) { return !!maskSrcKey && maskSrcKey in func; } var funcProto$1 = Function.prototype; var funcToString$1 = funcProto$1.toString; function toSource(func) { if (func != null) { try { return funcToString$1.call(func); } catch (e) { } try { return func + ""; } catch (e) { } } return ""; } var reRegExpChar = /[\\^$.*+?()[\]{}|]/g; var reIsHostCtor = /^\[object .+?Constructor\]$/; var funcProto = Function.prototype, objectProto$9 = Object.prototype; var funcToString = funcProto.toString; var hasOwnProperty$7 = objectProto$9.hasOwnProperty; var reIsNative = RegExp( "^" + funcToString.call(hasOwnProperty$7).replace(reRegExpChar, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$" ); function baseIsNative(value) { if (!isObject(value) || isMasked(value)) { return false; } var pattern = isFunction(value) ? reIsNative : reIsHostCtor; return pattern.test(toSource(value)); } function getValue(object, key) { return object == null ? void 0 : object[key]; } function getNative(object, key) { var value = getValue(object, key); return baseIsNative(value) ? value : void 0; } var WeakMap = getNative(root$1, "WeakMap"); const WeakMap$1 = WeakMap; function baseFindIndex(array, predicate, fromIndex, fromRight) { var length = array.length, index = fromIndex + (fromRight ? 1 : -1); while (fromRight ? index-- : ++index < length) { if (predicate(array[index], index, array)) { return index; } } return -1; } var MAX_SAFE_INTEGER$1 = 9007199254740991; var reIsUint = /^(?:0|[1-9]\d*)$/; function isIndex(value, length) { var type = typeof value; length = length == null ? MAX_SAFE_INTEGER$1 : length; return !!length && (type == "number" || type != "symbol" && reIsUint.test(value)) && (value > -1 && value % 1 == 0 && value < length); } function eq(value, other) { return value === other || value !== value && other !== other; } var MAX_SAFE_INTEGER = 9007199254740991; function isLength(value) { return typeof value == "number" && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; } function isArrayLike(value) { return value != null && isLength(value.length) && !isFunction(value); } var objectProto$8 = Object.prototype; function isPrototype(value) { var Ctor = value && value.constructor, proto = typeof Ctor == "function" && Ctor.prototype || objectProto$8; return value === proto; } function baseTimes(n, iteratee) { var index = -1, result = Array(n); while (++index < n) { result[index] = iteratee(index); } return result; } var argsTag$2 = "[object Arguments]"; function baseIsArguments(value) { return isObjectLike(value) && baseGetTag(value) == argsTag$2; } var objectProto$7 = Object.prototype; var hasOwnProperty$6 = objectProto$7.hasOwnProperty; var propertyIsEnumerable$1 = objectProto$7.propertyIsEnumerable; var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { return isObjectLike(value) && hasOwnProperty$6.call(value, "callee") && !propertyIsEnumerable$1.call(value, "callee"); }; const isArguments$1 = isArguments; function stubFalse() { return false; } var freeExports$1 = typeof exports == "object" && exports && !exports.nodeType && exports; var freeModule$1 = freeExports$1 && typeof module == "object" && module && !module.nodeType && module; var moduleExports$1 = freeModule$1 && freeModule$1.exports === freeExports$1; var Buffer = moduleExports$1 ? root$1.Buffer : void 0; var nativeIsBuffer = Buffer ? Buffer.isBuffer : void 0; var isBuffer = nativeIsBuffer || stubFalse; const isBuffer$1 = isBuffer; var argsTag$1 = "[object Arguments]", arrayTag$1 = "[object Array]", boolTag$1 = "[object Boolean]", dateTag$1 = "[object Date]", errorTag$1 = "[object Error]", funcTag = "[object Function]", mapTag$2 = "[object Map]", numberTag$1 = "[object Number]", objectTag$2 = "[object Object]", regexpTag$1 = "[object RegExp]", setTag$2 = "[object Set]", stringTag$1 = "[object String]", weakMapTag$1 = "[object WeakMap]"; var arrayBufferTag$1 = "[object ArrayBuffer]", dataViewTag$2 = "[object DataView]", float32Tag = "[object Float32Array]", float64Tag = "[object Float64Array]", int8Tag = "[object Int8Array]", int16Tag = "[object Int16Array]", int32Tag = "[object Int32Array]", uint8Tag = "[object Uint8Array]", uint8ClampedTag = "[object Uint8ClampedArray]", uint16Tag = "[object Uint16Array]", uint32Tag = "[object Uint32Array]"; var typedArrayTags = {}; typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = typedArrayTags[uint32Tag] = true; typedArrayTags[argsTag$1] = typedArrayTags[arrayTag$1] = typedArrayTags[arrayBufferTag$1] = typedArrayTags[boolTag$1] = typedArrayTags[dataViewTag$2] = typedArrayTags[dateTag$1] = typedArrayTags[errorTag$1] = typedArrayTags[funcTag] = typedArrayTags[mapTag$2] = typedArrayTags[numberTag$1] = typedArrayTags[objectTag$2] = typedArrayTags[regexpTag$1] = typedArrayTags[setTag$2] = typedArrayTags[stringTag$1] = typedArrayTags[weakMapTag$1] = false; function baseIsTypedArray(value) { return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; } function baseUnary(func) { return function(value) { return func(value); }; } var freeExports = typeof exports == "object" && exports && !exports.nodeType && exports; var freeModule = freeExports && typeof module == "object" && module && !module.nodeType && module; var moduleExports = freeModule && freeModule.exports === freeExports; var freeProcess = moduleExports && freeGlobal$1.process; var nodeUtil = function() { try { var types = freeModule && freeModule.require && freeModule.require("util").types; if (types) { return types; } return freeProcess && freeProcess.binding && freeProcess.binding("util"); } catch (e) { } }(); const nodeUtil$1 = nodeUtil; var nodeIsTypedArray = nodeUtil$1 && nodeUtil$1.isTypedArray; var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; const isTypedArray$1 = isTypedArray; var objectProto$6 = Object.prototype; var hasOwnProperty$5 = objectProto$6.hasOwnProperty; function arrayLikeKeys(value, inherited) { var isArr = isArray$1(value), isArg = !isArr && isArguments$1(value), isBuff = !isArr && !isArg && isBuffer$1(value), isType = !isArr && !isArg && !isBuff && isTypedArray$1(value), skipIndexes = isArr || isArg || isBuff || isType, result = skipIndexes ? baseTimes(value.length, String) : [], length = result.length; for (var key in value) { if ((inherited || hasOwnProperty$5.call(value, key)) && !(skipIndexes && // Safari 9 has enumerable `arguments.length` in strict mode. (key == "length" || // Node.js 0.10 has enumerable non-index properties on buffers. isBuff && (key == "offset" || key == "parent") || // PhantomJS 2 has enumerable non-index properties on typed arrays. isType && (key == "buffer" || key == "byteLength" || key == "byteOffset") || // Skip index properties. isIndex(key, length)))) { result.push(key); } } return result; } function overArg(func, transform) { return function(arg) { return func(transform(arg)); }; } var nativeKeys = overArg(Object.keys, Object); const nativeKeys$1 = nativeKeys; var objectProto$5 = Object.prototype; var hasOwnProperty$4 = objectProto$5.hasOwnProperty; function baseKeys(object) { if (!isPrototype(object)) { return nativeKeys$1(object); } var result = []; for (var key in Object(object)) { if (hasOwnProperty$4.call(object, key) && key != "constructor") { result.push(key); } } return result; } function keys(object) { return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); } var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, reIsPlainProp = /^\w*$/; function isKey(value, object) { if (isArray$1(value)) { return false; } var type = typeof value; if (type == "number" || type == "symbol" || type == "boolean" || value == null || isSymbol(value)) { return true; } return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || object != null && value in Object(object); } var nativeCreate = getNative(Object, "create"); const nativeCreate$1 = nativeCreate; function hashClear() { this.__data__ = nativeCreate$1 ? nativeCreate$1(null) : {}; this.size = 0; } function hashDelete(key) { var result = this.has(key) && delete this.__data__[key]; this.size -= result ? 1 : 0; return result; } var HASH_UNDEFINED$2 = "__lodash_hash_undefined__"; var objectProto$4 = Object.prototype; var hasOwnProperty$3 = objectProto$4.hasOwnProperty; function hashGet(key) { var data = this.__data__; if (nativeCreate$1) { var result = data[key]; return result === HASH_UNDEFINED$2 ? void 0 : result; } return hasOwnProperty$3.call(data, key) ? data[key] : void 0; } var objectProto$3 = Object.prototype; var hasOwnProperty$2 = objectProto$3.hasOwnProperty; function hashHas(key) { var data = this.__data__; return nativeCreate$1 ? data[key] !== void 0 : hasOwnProperty$2.call(data, key); } var HASH_UNDEFINED$1 = "__lodash_hash_undefined__"; function hashSet(key, value) { var data = this.__data__; this.size += this.has(key) ? 0 : 1; data[key] = nativeCreate$1 && value === void 0 ? HASH_UNDEFINED$1 : value; return this; } function Hash(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } Hash.prototype.clear = hashClear; Hash.prototype["delete"] = hashDelete; Hash.prototype.get = hashGet; Hash.prototype.has = hashHas; Hash.prototype.set = hashSet; function listCacheClear() { this.__data__ = []; this.size = 0; } function assocIndexOf(array, key) { var length = array.length; while (length--) { if (eq(array[length][0], key)) { return length; } } return -1; } var arrayProto = Array.prototype; var splice = arrayProto.splice; function listCacheDelete(key) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { return false; } var lastIndex = data.length - 1; if (index == lastIndex) { data.pop(); } else { splice.call(data, index, 1); } --this.size; return true; } function listCacheGet(key) { var data = this.__data__, index = assocIndexOf(data, key); return index < 0 ? void 0 : data[index][1]; } function listCacheHas(key) { return assocIndexOf(this.__data__, key) > -1; } function listCacheSet(key, value) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { ++this.size; data.push([key, value]); } else { data[index][1] = value; } return this; } function ListCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } ListCache.prototype.clear = listCacheClear; ListCache.prototype["delete"] = listCacheDelete; ListCache.prototype.get = listCacheGet; ListCache.prototype.has = listCacheHas; ListCache.prototype.set = listCacheSet; var Map$1 = getNative(root$1, "Map"); const Map$2 = Map$1; function mapCacheClear() { this.size = 0; this.__data__ = { "hash": new Hash(), "map": new (Map$2 || ListCache)(), "string": new Hash() }; } function isKeyable(value) { var type = typeof value; return type == "string" || type == "number" || type == "symbol" || type == "boolean" ? value !== "__proto__" : value === null; } function getMapData(map, key) { var data = map.__data__; return isKeyable(key) ? data[typeof key == "string" ? "string" : "hash"] : data.map; } function mapCacheDelete(key) { var result = getMapData(this, key)["delete"](key); this.size -= result ? 1 : 0; return result; } function mapCacheGet(key) { return getMapData(this, key).get(key); } function mapCacheHas(key) { return getMapData(this, key).has(key); } function mapCacheSet(key, value) { var data = getMapData(this, key), size = data.size; data.set(key, value); this.size += data.size == size ? 0 : 1; return this; } function MapCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } MapCache.prototype.clear = mapCacheClear; MapCache.prototype["delete"] = mapCacheDelete; MapCache.prototype.get = mapCacheGet; MapCache.prototype.has = mapCacheHas; MapCache.prototype.set = mapCacheSet; var FUNC_ERROR_TEXT$1 = "Expected a function"; function memoize(func, resolver) { if (typeof func != "function" || resolver != null && typeof resolver != "function") { throw new TypeError(FUNC_ERROR_TEXT$1); } var memoized = function() { var args = arguments, key = resolver ? resolver.apply(this, args) : args[0], cache = memoized.cache; if (cache.has(key)) { return cache.get(key); } var result = func.apply(this, args); memoized.cache = cache.set(key, result) || cache; return result; }; memoized.cache = new (memoize.Cache || MapCache)(); return memoized; } memoize.Cache = MapCache; var MAX_MEMOIZE_SIZE = 500; function memoizeCapped(func) { var result = memoize(func, function(key) { if (cache.size === MAX_MEMOIZE_SIZE) { cache.clear(); } return key; }); var cache = result.cache; return result; } var rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; var reEscapeChar = /\\(\\)?/g; var stringToPath = memoizeCapped(function(string) { var result = []; if (string.charCodeAt(0) === 46) { result.push(""); } string.replace(rePropName, function(match, number, quote, subString) { result.push(quote ? subString.replace(reEscapeChar, "$1") : number || match); }); return result; }); const stringToPath$1 = stringToPath; function toString(value) { return value == null ? "" : baseToString(value); } function castPath(value, object) { if (isArray$1(value)) { return value; } return isKey(value, object) ? [value] : stringToPath$1(toString(value)); } var INFINITY = 1 / 0; function toKey(value) { if (typeof value == "string" || isSymbol(value)) { return value; } var result = value + ""; return result == "0" && 1 / value == -INFINITY ? "-0" : result; } function baseGet(object, path) { path = castPath(path, object); var index = 0, length = path.length; while (object != null && index < length) { object = object[toKey(path[index++])]; } return index && index == length ? object : void 0; } function get(object, path, defaultValue) { var result = object == null ? void 0 : baseGet(object, path); return result === void 0 ? defaultValue : result; } function arrayPush(array, values) { var index = -1, length = values.length, offset = array.length; while (++index < length) { array[offset + index] = values[index]; } return array; } function stackClear() { this.__data__ = new ListCache(); this.size = 0; } function stackDelete(key) { var data = this.__data__, result = data["delete"](key); this.size = data.size; return result; } function stackGet(key) { return this.__data__.get(key); } function stackHas(key) { return this.__data__.has(key); } var LARGE_ARRAY_SIZE = 200; function stackSet(key, value) { var data = this.__data__; if (data instanceof ListCache) { var pairs = data.__data__; if (!Map$2 || pairs.length < LARGE_ARRAY_SIZE - 1) { pairs.push([key, value]); this.size = ++data.size; return this; } data = this.__data__ = new MapCache(pairs); } data.set(key, value); this.size = data.size; return this; } function Stack(entries) { var data = this.__data__ = new ListCache(entries); this.size = data.size; } Stack.prototype.clear = stackClear; Stack.prototype["delete"] = stackDelete; Stack.prototype.get = stackGet; Stack.prototype.has = stackHas; Stack.prototype.set = stackSet; function arrayFilter(array, predicate) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result[resIndex++] = value; } } return result; } function stubArray() { return []; } var objectProto$2 = Object.prototype; var propertyIsEnumerable = objectProto$2.propertyIsEnumerable; var nativeGetSymbols = Object.getOwnPropertySymbols; var getSymbols = !nativeGetSymbols ? stubArray : function(object) { if (object == null) { return []; } object = Object(object); return arrayFilter(nativeGetSymbols(object), function(symbol) { return propertyIsEnumerable.call(object, symbol); }); }; const getSymbols$1 = getSymbols; function baseGetAllKeys(object, keysFunc, symbolsFunc) { var result = keysFunc(object); return isArray$1(object) ? result : arrayPush(result, symbolsFunc(object)); } function getAllKeys(object) { return baseGetAllKeys(object, keys, getSymbols$1); } var DataView = getNative(root$1, "DataView"); const DataView$1 = DataView; var Promise$1 = getNative(root$1, "Promise"); const Promise$2 = Promise$1; var Set$1 = getNative(root$1, "Set"); const Set$2 = Set$1; var mapTag$1 = "[object Map]", objectTag$1 = "[object Object]", promiseTag = "[object Promise]", setTag$1 = "[object Set]", weakMapTag = "[object WeakMap]"; var dataViewTag$1 = "[object DataView]"; var dataViewCtorString = toSource(DataView$1), mapCtorString = toSource(Map$2), promiseCtorString = toSource(Promise$2), setCtorString = toSource(Set$2), weakMapCtorString = toSource(WeakMap$1); var getTag = baseGetTag; if (DataView$1 && getTag(new DataView$1(new ArrayBuffer(1))) != dataViewTag$1 || Map$2 && getTag(new Map$2()) != mapTag$1 || Promise$2 && getTag(Promise$2.resolve()) != promiseTag || Set$2 && getTag(new Set$2()) != setTag$1 || WeakMap$1 && getTag(new WeakMap$1()) != weakMapTag) { getTag = function(value) { var result = baseGetTag(value), Ctor = result == objectTag$1 ? value.constructor : void 0, ctorString = Ctor ? toSource(Ctor) : ""; if (ctorString) { switch (ctorString) { case dataViewCtorString: return dataViewTag$1; case mapCtorString: return mapTag$1; case promiseCtorString: return promiseTag; case setCtorString: return setTag$1; case weakMapCtorString: return weakMapTag; } } return result; }; } const getTag$1 = getTag; var Uint8Array = root$1.Uint8Array; const Uint8Array$1 = Uint8Array; var HASH_UNDEFINED = "__lodash_hash_undefined__"; function setCacheAdd(value) { this.__data__.set(value, HASH_UNDEFINED); return this; } function setCacheHas(value) { return this.__data__.has(value); } function SetCache(values) { var index = -1, length = values == null ? 0 : values.length; this.__data__ = new MapCache(); while (++index < length) { this.add(values[index]); } } SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; SetCache.prototype.has = setCacheHas; function arraySome(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (predicate(array[index], index, array)) { return true; } } return false; } function cacheHas(cache, key) { return cache.has(key); } var COMPARE_PARTIAL_FLAG$5 = 1, COMPARE_UNORDERED_FLAG$3 = 2; function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG$5, arrLength = array.length, othLength = other.length; if (arrLength != othLength && !(isPartial && othLength > arrLength)) { return false; } var arrStacked = stack.get(array); var othStacked = stack.get(other); if (arrStacked && othStacked) { return arrStacked == other && othStacked == array; } var index = -1, result = true, seen = bitmask & COMPARE_UNORDERED_FLAG$3 ? new SetCache() : void 0; stack.set(array, other); stack.set(other, array); while (++index < arrLength) { var arrValue = array[index], othValue = other[index]; if (customizer) { var compared = isPartial ? customizer(othValue, arrValue, index, other, array, stack) : customizer(arrValue, othValue, index, array, other, stack); } if (compared !== void 0) { if (compared) { continue; } result = false; break; } if (seen) { if (!arraySome(other, function(othValue2, othIndex) { if (!cacheHas(seen, othIndex) && (arrValue === othValue2 || equalFunc(arrValue, othValue2, bitmask, customizer, stack))) { return seen.push(othIndex); } })) { result = false; break; } } else if (!(arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { result = false; break; } } stack["delete"](array); stack["delete"](other); return result; } function mapToArray(map) { var index = -1, result = Array(map.size); map.forEach(function(value, key) { result[++index] = [key, value]; }); return result; } function setToArray(set) { var index = -1, result = Array(set.size); set.forEach(function(value) { result[++index] = value; }); return result; } var COMPARE_PARTIAL_FLAG$4 = 1, COMPARE_UNORDERED_FLAG$2 = 2; var boolTag = "[object Boolean]", dateTag = "[object Date]", errorTag = "[object Error]", mapTag = "[object Map]", numberTag = "[object Number]", regexpTag = "[object RegExp]", setTag = "[object Set]", stringTag = "[object String]", symbolTag = "[object Symbol]"; var arrayBufferTag = "[object ArrayBuffer]", dataViewTag = "[object DataView]"; var symbolProto = Symbol$2 ? Symbol$2.prototype : void 0, symbolValueOf = symbolProto ? symbolProto.valueOf : void 0; function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { switch (tag) { case dataViewTag: if (object.byteLength != other.byteLength || object.byteOffset != other.byteOffset) { return false; } object = object.buffer; other = other.buffer; case arrayBufferTag: if (object.byteLength != other.byteLength || !equalFunc(new Uint8Array$1(object), new Uint8Array$1(other))) { return false; } return true; case boolTag: case dateTag: case numberTag: return eq(+object, +other); case errorTag: return object.name == other.name && object.message == other.message; case regexpTag: case stringTag: return object == other + ""; case mapTag: var convert = mapToArray; case setTag: var isPartial = bitmask & COMPARE_PARTIAL_FLAG$4; convert || (convert = setToArray); if (object.size != other.size && !isPartial) { return false; } var stacked = stack.get(object); if (stacked) { return stacked == other; } bitmask |= COMPARE_UNORDERED_FLAG$2; stack.set(object, other); var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); stack["delete"](object); return result; case symbolTag: if (symbolValueOf) { return symbolValueOf.call(object) == symbolValueOf.call(other); } } return false; } var COMPARE_PARTIAL_FLAG$3 = 1; var objectProto$1 = Object.prototype; var hasOwnProperty$1 = objectProto$1.hasOwnProperty; function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG$3, objProps = getAllKeys(object), objLength = objProps.length, othProps = getAllKeys(other), othLength = othProps.length; if (objLength != othLength && !isPartial) { return false; } var index = objLength; while (index--) { var key = objProps[index]; if (!(isPartial ? key in other : hasOwnProperty$1.call(other, key))) { return false; } } var objStacked = stack.get(object); var othStacked = stack.get(other); if (objStacked && othStacked) { return objStacked == other && othStacked == object; } var result = true; stack.set(object, other); stack.set(other, object); var skipCtor = isPartial; while (++index < objLength) { key = objProps[index]; var objValue = object[key], othValue = other[key]; if (customizer) { var compared = isPartial ? customizer(othValue, objValue, key, other, object, stack) : customizer(objValue, othValue, key, object, other, stack); } if (!(compared === void 0 ? objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack) : compared)) { result = false; break; } skipCtor || (skipCtor = key == "constructor"); } if (result && !skipCtor) { var objCtor = object.constructor, othCtor = other.constructor; if (objCtor != othCtor && ("constructor" in object && "constructor" in other) && !(typeof objCtor == "function" && objCtor instanceof objCtor && typeof othCtor == "function" && othCtor instanceof othCtor)) { result = false; } } stack["delete"](object); stack["delete"](other); return result; } var COMPARE_PARTIAL_FLAG$2 = 1; var argsTag = "[object Arguments]", arrayTag = "[object Array]", objectTag = "[object Object]"; var objectProto = Object.prototype; var hasOwnProperty = objectProto.hasOwnProperty; function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { var objIsArr = isArray$1(object), othIsArr = isArray$1(other), objTag = objIsArr ? arrayTag : getTag$1(object), othTag = othIsArr ? arrayTag : getTag$1(other); objTag = objTag == argsTag ? objectTag : objTag; othTag = othTag == argsTag ? objectTag : othTag; var objIsObj = objTag == objectTag, othIsObj = othTag == objectTag, isSameTag = objTag == othTag; if (isSameTag && isBuffer$1(object)) { if (!isBuffer$1(other)) { return false; } objIsArr = true; objIsObj = false; } if (isSameTag && !objIsObj) { stack || (stack = new Stack()); return objIsArr || isTypedArray$1(object) ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); } if (!(bitmask & COMPARE_PARTIAL_FLAG$2)) { var objIsWrapped = objIsObj && hasOwnProperty.call(object, "__wrapped__"), othIsWrapped = othIsObj && hasOwnProperty.call(other, "__wrapped__"); if (objIsWrapped || othIsWrapped) { var objUnwrapped = objIsWrapped ? object.value() : object, othUnwrapped = othIsWrapped ? other.value() : other; stack || (stack = new Stack()); return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); } } if (!isSameTag) { return false; } stack || (stack = new Stack()); return equalObjects(object, other, bitmask, customizer, equalFunc, stack); } function baseIsEqual(value, other, bitmask, customizer, stack) { if (value === other) { return true; } if (value == null || other == null || !isObjectLike(value) && !isObjectLike(other)) { return value !== value && other !== other; } return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); } var COMPARE_PARTIAL_FLAG$1 = 1, COMPARE_UNORDERED_FLAG$1 = 2; function baseIsMatch(object, source, matchData, customizer) { var index = matchData.length, length = index, noCustomizer = !customizer; if (object == null) { return !length; } object = Object(object); while (index--) { var data = matchData[index]; if (noCustomizer && data[2] ? data[1] !== object[data[0]] : !(data[0] in object)) { return false; } } while (++index < length) { data = matchData[index]; var key = data[0], objValue = object[key], srcValue = data[1]; if (noCustomizer && data[2]) { if (objValue === void 0 && !(key in object)) { return false; } } else { var stack = new Stack(); if (customizer) { var result = customizer(objValue, srcValue, key, object, source, stack); } if (!(result === void 0 ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG$1 | COMPARE_UNORDERED_FLAG$1, customizer, stack) : result)) { return false; } } } return true; } function isStrictComparable(value) { return value === value && !isObject(value); } function getMatchData(object) { var result = keys(object), length = result.length; while (length--) { var key = result[length], value = object[key]; result[length] = [key, value, isStrictComparable(value)]; } return result; } function matchesStrictComparable(key, srcValue) { return function(object) { if (object == null) { return false; } return object[key] === srcValue && (srcValue !== void 0 || key in Object(object)); }; } function baseMatches(source) { var matchData = getMatchData(source); if (matchData.length == 1 && matchData[0][2]) { return matchesStrictComparable(matchData[0][0], matchData[0][1]); } return function(object) { return object === source || baseIsMatch(object, source, matchData); }; } function baseHasIn(object, key) { return object != null && key in Object(object); } function hasPath(object, path, hasFunc) { path = castPath(path, object); var index = -1, length = path.length, result = false; while (++index < length) { var key = toKey(path[index]); if (!(result = object != null && hasFunc(object, key))) { break; } object = object[key]; } if (result || ++index != length) { return result; } length = object == null ? 0 : object.length; return !!length && isLength(length) && isIndex(key, length) && (isArray$1(object) || isArguments$1(object)); } function hasIn(object, path) { return object != null && hasPath(object, path, baseHasIn); } var COMPARE_PARTIAL_FLAG = 1, COMPARE_UNORDERED_FLAG = 2; function baseMatchesProperty(path, srcValue) { if (isKey(path) && isStrictComparable(srcValue)) { return matchesStrictComparable(toKey(path), srcValue); } return function(object) { var objValue = get(object, path); return objValue === void 0 && objValue === srcValue ? hasIn(object, path) : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); }; } function baseProperty(key) { return function(object) { return object == null ? void 0 : object[key]; }; } function basePropertyDeep(path) { return function(object) { return baseGet(object, path); }; } function property(path) { return isKey(path) ? baseProperty(toKey(path)) : basePropertyDeep(path); } function baseIteratee(value) { if (typeof value == "function") { return value; } if (value == null) { return identity; } if (typeof value == "object") { return isArray$1(value) ? baseMatchesProperty(value[0], value[1]) : baseMatches(value); } return property(value); } var now = function() { return root$1.Date.now(); }; const now$1 = now; var FUNC_ERROR_TEXT = "Expected a function"; var nativeMax$1 = Math.max, nativeMin$1 = Math.min; function debounce(func, wait, options) { var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true; if (typeof func != "function") { throw new TypeError(FUNC_ERROR_TEXT); } wait = toNumber(wait) || 0; if (isObject(options)) { leading = !!options.leading; maxing = "maxWait" in options; maxWait = maxing ? nativeMax$1(toNumber(options.maxWait) || 0, wait) : maxWait; trailing = "trailing" in options ? !!options.trailing : trailing; } function invokeFunc(time) { var args = lastArgs, thisArg = lastThis; lastArgs = lastThis = void 0; lastInvokeTime = time; result = func.apply(thisArg, args); return result; } function leadingEdge(time) { lastInvokeTime = time; timerId = setTimeout(timerExpired, wait); return leading ? invokeFunc(time) : result; } function remainingWait(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, timeWaiting = wait - timeSinceLastCall; return maxing ? nativeMin$1(timeWaiting, maxWait - timeSinceLastInvoke) : timeWaiting; } function shouldInvoke(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime; return lastCallTime === void 0 || timeSinceLastCall >= wait || timeSinceLastCall < 0 || maxing && timeSinceLastInvoke >= maxWait; } function timerExpired() { var time = now$1(); if (shouldInvoke(time)) { return trailingEdge(time); } timerId = setTimeout(timerExpired, remainingWait(time)); } function trailingEdge(time) { timerId = void 0; if (trailing && lastArgs) { return invokeFunc(time); } lastArgs = lastThis = void 0; return result; } function cancel() { if (timerId !== void 0) { clearTimeout(timerId); } lastInvokeTime = 0; lastArgs = lastCallTime = lastThis = timerId = void 0; } function flush() { return timerId === void 0 ? result : trailingEdge(now$1()); } function debounced() { var time = now$1(), isInvoking = shouldInvoke(time); lastArgs = arguments; lastThis = this; lastCallTime = time; if (isInvoking) { if (timerId === void 0) { return leadingEdge(lastCallTime); } if (maxing) { clearTimeout(timerId); timerId = setTimeout(timerExpired, wait); return invokeFunc(lastCallTime); } } if (timerId === void 0) { timerId = setTimeout(timerExpired, wait); } return result; } debounced.cancel = cancel; debounced.flush = flush; return debounced; } var nativeMax = Math.max, nativeMin = Math.min; function findLastIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length - 1; if (fromIndex !== void 0) { index = toInteger(fromIndex); index = fromIndex < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return baseFindIndex(array, baseIteratee(predicate), index, true); } function fromPairs(pairs) { var index = -1, length = pairs == null ? 0 : pairs.length, result = {}; while (++index < length) { var pair = pairs[index]; result[pair[0]] = pair[1]; } return result; } function isEqual(value, other) { return baseIsEqual(value, other); } function isNil(value) { return value == null; } function isUndefined$1(value) { return value === void 0; } const isUndefined = (val) => val === void 0; const isBoolean = (val) => typeof val === "boolean"; const isNumber = (val) => typeof val === "number"; const isElement = (e) => { if (typeof Element === "undefined") return false; return e instanceof Element; }; const isStringNumber = (val) => { if (!isString(val)) { return false; } return !Number.isNaN(Number(val)); }; const escapeStringRegexp = (string = "") => string.replace(/[|\\{}()[\]^$+*?.]/g, "\\$&").replace(/-/g, "\\x2d"); class ElementPlusError extends Error { constructor(m) { super(m); this.name = "ElementPlusError"; } } function throwError(scope, m) { throw new ElementPlusError(`[${scope}] ${m}`); } function debugWarn(scope, message) { } function addUnit(value, defaultUnit = "px") { if (!value) return ""; if (isNumber(value) || isStringNumber(value)) { return `${value}${defaultUnit}`; } else if (isString(value)) { return value; } } function scrollIntoView(container, selected) { if (!isClient) return; if (!selected) { container.scrollTop = 0; return; } const offsetParents = []; let pointer = selected.offsetParent; while (pointer !== null && container !== pointer && container.contains(pointer)) { offsetParents.push(pointer); pointer = pointer.offsetParent; } const top = selected.offsetTop + offsetParents.reduce((prev, curr) => prev + curr.offsetTop, 0); const bottom = top + selected.offsetHeight; const viewRectTop = container.scrollTop; const viewRectBottom = viewRectTop + container.clientHeight; if (top < viewRectTop) { container.scrollTop = top; } else if (bottom > viewRectBottom) { container.scrollTop = bottom - container.clientHeight; } } /*! Element Plus Icons Vue v2.3.1 */ var arrow_down_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "ArrowDown", __name: "arrow-down", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "M831.872 340.864 512 652.672 192.128 340.864a30.592 30.592 0 0 0-42.752 0 29.12 29.12 0 0 0 0 41.6L489.664 714.24a32 32 0 0 0 44.672 0l340.288-331.712a29.12 29.12 0 0 0 0-41.728 30.592 30.592 0 0 0-42.752 0z" }) ])); } }); var arrow_down_default = arrow_down_vue_vue_type_script_setup_true_lang_default; var check_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "Check", __name: "check", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "M406.656 706.944 195.84 496.256a32 32 0 1 0-45.248 45.248l256 256 512-512a32 32 0 0 0-45.248-45.248L406.592 706.944z" }) ])); } }); var check_default = check_vue_vue_type_script_setup_true_lang_default; var circle_check_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "CircleCheck", __name: "circle-check", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M745.344 361.344a32 32 0 0 1 45.312 45.312l-288 288a32 32 0 0 1-45.312 0l-160-160a32 32 0 1 1 45.312-45.312L480 626.752l265.344-265.408z" }) ])); } }); var circle_check_default = circle_check_vue_vue_type_script_setup_true_lang_default; var circle_close_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "CircleClose", __name: "circle-close", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "m466.752 512-90.496-90.496a32 32 0 0 1 45.248-45.248L512 466.752l90.496-90.496a32 32 0 1 1 45.248 45.248L557.248 512l90.496 90.496a32 32 0 1 1-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 0 1-45.248-45.248z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }) ])); } }); var circle_close_default = circle_close_vue_vue_type_script_setup_true_lang_default; var close_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "Close", __name: "close", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z" }) ])); } }); var close_default = close_vue_vue_type_script_setup_true_lang_default; var hide_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "Hide", __name: "hide", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "M876.8 156.8c0-9.6-3.2-16-9.6-22.4-6.4-6.4-12.8-9.6-22.4-9.6-9.6 0-16 3.2-22.4 9.6L736 220.8c-64-32-137.6-51.2-224-60.8-160 16-288 73.6-377.6 176C44.8 438.4 0 496 0 512s48 73.6 134.4 176c22.4 25.6 44.8 48 73.6 67.2l-86.4 89.6c-6.4 6.4-9.6 12.8-9.6 22.4 0 9.6 3.2 16 9.6 22.4 6.4 6.4 12.8 9.6 22.4 9.6 9.6 0 16-3.2 22.4-9.6l704-710.4c3.2-6.4 6.4-12.8 6.4-22.4Zm-646.4 528c-76.8-70.4-128-128-153.6-172.8 28.8-48 80-105.6 153.6-172.8C304 272 400 230.4 512 224c64 3.2 124.8 19.2 176 44.8l-54.4 54.4C598.4 300.8 560 288 512 288c-64 0-115.2 22.4-160 64s-64 96-64 160c0 48 12.8 89.6 35.2 124.8L256 707.2c-9.6-6.4-19.2-16-25.6-22.4Zm140.8-96c-12.8-22.4-19.2-48-19.2-76.8 0-44.8 16-83.2 48-112 32-28.8 67.2-48 112-48 28.8 0 54.4 6.4 73.6 19.2zM889.599 336c-12.8-16-28.8-28.8-41.6-41.6l-48 48c73.6 67.2 124.8 124.8 150.4 169.6-28.8 48-80 105.6-153.6 172.8-73.6 67.2-172.8 108.8-284.8 115.2-51.2-3.2-99.2-12.8-140.8-28.8l-48 48c57.6 22.4 118.4 38.4 188.8 44.8 160-16 288-73.6 377.6-176C979.199 585.6 1024 528 1024 512s-48.001-73.6-134.401-176Z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M511.998 672c-12.8 0-25.6-3.2-38.4-6.4l-51.2 51.2c28.8 12.8 57.6 19.2 89.6 19.2 64 0 115.2-22.4 160-64 41.6-41.6 64-96 64-160 0-32-6.4-64-19.2-89.6l-51.2 51.2c3.2 12.8 6.4 25.6 6.4 38.4 0 44.8-16 83.2-48 112-32 28.8-67.2 48-112 48Z" }) ])); } }); var hide_default = hide_vue_vue_type_script_setup_true_lang_default; var loading_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "Loading", __name: "loading", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32m0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32m448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32m-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32M195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0m-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z" }) ])); } }); var loading_default = loading_vue_vue_type_script_setup_true_lang_default; var view_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "View", __name: "view", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352m0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 1 1 0 448 224 224 0 0 1 0-448m0 64a160.192 160.192 0 0 0-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160" }) ])); } }); var view_default = view_vue_vue_type_script_setup_true_lang_default; var warning_filled_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({ name: "WarningFilled", __name: "warning-filled", setup(__props) { return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [ vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m0 192a58.432 58.432 0 0 0-58.24 63.744l23.36 256.384a35.072 35.072 0 0 0 69.76 0l23.296-256.384A58.432 58.432 0 0 0 512 256m0 512a51.2 51.2 0 1 0 0-102.4 51.2 51.2 0 0 0 0 102.4" }) ])); } }); var warning_filled_default = warning_filled_vue_vue_type_script_setup_true_lang_default; const epPropKey = "__epPropKey"; const definePropType = (val) => val; const isEpProp = (val) => isObject$1(val) && !!val[epPropKey]; const buildProp = (prop, key) => { if (!isObject$1(prop) || isEpProp(prop)) return prop; const { values, required, default: defaultValue, type, validator } = prop; const _validator = values || validator ? (val) => { let valid = false; let allowedValues = []; if (values) { allowedValues = Array.from(values); if (hasOwn(prop, "default")) { allowedValues.push(defaultValue); } valid || (valid = allowedValues.includes(val)); } if (validator) valid || (valid = validator(val)); if (!valid && allowedValues.length > 0) { const allowValuesText = [...new Set(allowedValues)].map((value) => JSON.stringify(value)).join(", "); vue.warn(`Invalid prop: validation failed${key ? ` for prop "${key}"` : ""}. Expected one of [${allowValuesText}], got value ${JSON.stringify(val)}.`); } return valid; } : void 0; const epProp = { type, required: !!required, validator: _validator, [epPropKey]: true }; if (hasOwn(prop, "default")) epProp.default = defaultValue; return epProp; }; const buildProps = (props) => fromPairs(Object.entries(props).map(([key, option]) => [ key, buildProp(option, key) ])); const iconPropType = definePropType([ String, Object, Function ]); const ValidateComponentsMap = { validating: loading_default, success: circle_check_default, error: circle_close_default }; const withInstall = (main, extra) => { main.install = (app2) => { for (const comp of [main, ...Object.values(extra != null ? extra : {})]) { app2.component(comp.name, comp); } }; if (extra) { for (const [key, comp] of Object.entries(extra)) { main[key] = comp; } } return main; }; const withNoopInstall = (component) => { component.install = NOOP; return component; }; const EVENT_CODE = { tab: "Tab", enter: "Enter", space: "Space", left: "ArrowLeft", up: "ArrowUp", right: "ArrowRight", down: "ArrowDown", esc: "Escape", delete: "Delete", backspace: "Backspace", numpadEnter: "NumpadEnter", pageUp: "PageUp", pageDown: "PageDown", home: "Home", end: "End" }; const UPDATE_MODEL_EVENT = "update:modelValue"; const CHANGE_EVENT = "change"; const componentSizes = ["", "default", "small", "large"]; const isKorean = (text) => /([\uAC00-\uD7AF\u3130-\u318F])+/gi.test(text); const mutable = (val) => val; const DEFAULT_EXCLUDE_KEYS = ["class", "style"]; const LISTENER_PREFIX = /^on[A-Z]/; const useAttrs = (params = {}) => { const { excludeListeners = false, excludeKeys } = params; const allExcludeKeys = vue.computed(() => { return ((excludeKeys == null ? void 0 : excludeKeys.value) || []).concat(DEFAULT_EXCLUDE_KEYS); }); const instance = vue.getCurrentInstance(); if (!instance) { return vue.computed(() => ({})); } return vue.computed(() => { var _a2; return fromPairs(Object.entries((_a2 = instance.proxy) == null ? void 0 : _a2.$attrs).filter(([key]) => !allExcludeKeys.value.includes(key) && !(excludeListeners && LISTENER_PREFIX.test(key)))); }); }; var English = { name: "en", el: { breadcrumb: { label: "Breadcrumb" }, colorpicker: { confirm: "OK", clear: "Clear", defaultLabel: "color picker", description: "current color is {color}. press enter to select a new color." }, datepicker: { now: "Now", today: "Today", cancel: "Cancel", clear: "Clear", confirm: "OK", dateTablePrompt: "Use the arrow keys and enter to select the day of the month", monthTablePrompt: "Use the arrow keys and enter to select the month", yearTablePrompt: "Use the arrow keys and enter to select the year", selectedDate: "Selected date", selectDate: "Select date", selectTime: "Select time", startDate: "Start Date", startTime: "Start Time", endDate: "End Date", endTime: "End Time", prevYear: "Previous Year", nextYear: "Next Year", prevMonth: "Previous Month", nextMonth: "Next Month", year: "", month1: "January", month2: "February", month3: "March", month4: "April", month5: "May", month6: "June", month7: "July", month8: "August", month9: "September", month10: "October", month11: "November", month12: "December", week: "week", weeks: { sun: "Sun", mon: "Mon", tue: "Tue", wed: "Wed", thu: "Thu", fri: "Fri", sat: "Sat" }, weeksFull: { sun: "Sunday", mon: "Monday", tue: "Tuesday", wed: "Wednesday", thu: "Thursday", fri: "Friday", sat: "Saturday" }, months: { jan: "Jan", feb: "Feb", mar: "Mar", apr: "Apr", may: "May", jun: "Jun", jul: "Jul", aug: "Aug", sep: "Sep", oct: "Oct", nov: "Nov", dec: "Dec" } }, inputNumber: { decrease: "decrease number", increase: "increase number" }, select: { loading: "Loading", noMatch: "No matching data", noData: "No data", placeholder: "Select" }, dropdown: { toggleDropdown: "Toggle Dropdown" }, cascader: { noMatch: "No matching data", loading: "Loading", placeholder: "Select", noData: "No data" }, pagination: { goto: "Go to", pagesize: "/page", total: "Total {total}", pageClassifier: "", page: "Page", prev: "Go to previous page", next: "Go to next page", currentPage: "page {pager}", prevPages: "Previous {pager} pages", nextPages: "Next {pager} pages", deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details" }, dialog: { close: "Close this dialog" }, drawer: { close: "Close this dialog" }, messagebox: { title: "Message", confirm: "OK", cancel: "Cancel", error: "Illegal input", close: "Close this dialog" }, upload: { deleteTip: "press delete to remove", delete: "Delete", preview: "Preview", continue: "Continue" }, slider: { defaultLabel: "slider between {min} and {max}", defaultRangeStartLabel: "pick start value", defaultRangeEndLabel: "pick end value" }, table: { emptyText: "No Data", confirmFilter: "Confirm", resetFilter: "Reset", clearFilter: "All", sumText: "Sum" }, tour: { next: "Next", previous: "Previous", finish: "Finish" }, tree: { emptyText: "No Data" }, transfer: { noMatch: "No matching data", noData: "No data", titles: ["List 1", "List 2"], filterPlaceholder: "Enter keyword", noCheckedFormat: "{total} items", hasCheckedFormat: "{checked}/{total} checked" }, image: { error: "FAILED" }, pageHeader: { title: "Back" }, popconfirm: { confirmButtonText: "Yes", cancelButtonText: "No" }, carousel: { leftArrow: "Carousel arrow left", rightArrow: "Carousel arrow right", indicator: "Carousel switch to index {index}" } } }; const buildTranslator = (locale) => (path, option) => translate(path, option, vue.unref(locale)); const translate = (path, option, locale) => get(locale, path, path).replace(/\{(\w+)\}/g, (_, key) => { var _a2; return `${(_a2 = option == null ? void 0 : option[key]) != null ? _a2 : `{${key}}`}`; }); const buildLocaleContext = (locale) => { const lang = vue.computed(() => vue.unref(locale).name); const localeRef = vue.isRef(locale) ? locale : vue.ref(locale); return { lang, locale: localeRef, t: buildTranslator(locale) }; }; const localeContextKey = Symbol("localeContextKey"); const useLocale = (localeOverrides) => { const locale = localeOverrides || vue.inject(localeContextKey, vue.ref()); return buildLocaleContext(vue.computed(() => locale.value || English)); }; const defaultNamespace = "el"; const statePrefix = "is-"; const _bem = (namespace, block, blockSuffix, element, modifier) => { let cls = `${namespace}-${block}`; if (blockSuffix) { cls += `-${blockSuffix}`; } if (element) { cls += `__${element}`; } if (modifier) { cls += `--${modifier}`; } return cls; }; const namespaceContextKey = Symbol("namespaceContextKey"); const useGetDerivedNamespace = (namespaceOverrides) => { const derivedNamespace = namespaceOverrides || (vue.getCurrentInstance() ? vue.inject(namespaceContextKey, vue.ref(defaultNamespace)) : vue.ref(defaultNamespace)); const namespace = vue.computed(() => { return vue.unref(derivedNamespace) || defaultNamespace; }); return namespace; }; const useNamespace = (block, namespaceOverrides) => { const namespace = useGetDerivedNamespace(namespaceOverrides); const b = (blockSuffix = "") => _bem(namespace.value, block, blockSuffix, "", ""); const e = (element) => element ? _bem(namespace.value, block, "", element, "") : ""; const m = (modifier) => modifier ? _bem(namespace.value, block, "", "", modifier) : ""; const be2 = (blockSuffix, element) => blockSuffix && element ? _bem(namespace.value, block, blockSuffix, element, "") : ""; const em = (element, modifier) => element && modifier ? _bem(namespace.value, block, "", element, modifier) : ""; const bm = (blockSuffix, modifier) => blockSuffix && modifier ? _bem(namespace.value, block, blockSuffix, "", modifier) : ""; const bem = (blockSuffix, element, modifier) => blockSuffix && element && modifier ? _bem(namespace.value, block, blockSuffix, element, modifier) : ""; const is = (name, ...args) => { const state = args.length >= 1 ? args[0] : true; return name && state ? `${statePrefix}${name}` : ""; }; const cssVar = (object) => { const styles = {}; for (const key in object) { if (object[key]) { styles[`--${namespace.value}-${key}`] = object[key]; } } return styles; }; const cssVarBlock = (object) => { const styles = {}; for (const key in object) { if (object[key]) { styles[`--${namespace.value}-${block}-${key}`] = object[key]; } } return styles; }; const cssVarName = (name) => `--${namespace.value}-${name}`; const cssVarBlockName = (name) => `--${namespace.value}-${block}-${name}`; return { namespace, b, e, m, be: be2, em, bm, bem, is, cssVar, cssVarName, cssVarBlock, cssVarBlockName }; }; const _prop = buildProp({ type: definePropType(Boolean), default: null }); const _event = buildProp({ type: definePropType(Function) }); const createModelToggleComposable = (name) => { const updateEventKey = `update:${name}`; const updateEventKeyRaw = `onUpdate:${name}`; const useModelToggleEmits2 = [updateEventKey]; const useModelToggleProps2 = { [name]: _prop, [updateEventKeyRaw]: _event }; const useModelToggle2 = ({ indicator, toggleReason, shouldHideWhenRouteChanges, shouldProceed, onShow, onHide }) => { const instance = vue.getCurrentInstance(); const { emit } = instance; const props = instance.props; const hasUpdateHandler = vue.computed(() => isFunction$1(props[updateEventKeyRaw])); const isModelBindingAbsent = vue.computed(() => props[name] === null); const doShow = (event) => { if (indicator.value === true) { return; } indicator.value = true; if (toggleReason) { toggleReason.value = event; } if (isFunction$1(onShow)) { onShow(event); } }; const doHide = (event) => { if (indicator.value === false) { return; } indicator.value = false; if (toggleReason) { toggleReason.value = event; } if (isFunction$1(onHide)) { onHide(event); } }; const show = (event) => { if (props.disabled === true || isFunction$1(shouldProceed) && !shouldProceed()) return; const shouldEmit = hasUpdateHandler.value && isClient; if (shouldEmit) { emit(updateEventKey, true); } if (isModelBindingAbsent.value || !shouldEmit) { doShow(event); } }; const hide = (event) => { if (props.disabled === true || !isClient) return; const shouldEmit = hasUpdateHandler.value && isClient; if (shouldEmit) { emit(updateEventKey, false); } if (isModelBindingAbsent.value || !shouldEmit) { doHide(event); } }; const onChange = (val) => { if (!isBoolean(val)) return; if (props.disabled && val) { if (hasUpdateHandler.value) { emit(updateEventKey, false); } } else if (indicator.value !== val) { if (val) { doShow(); } else { doHide(); } } }; const toggle = () => { if (indicator.value) { hide(); } else { show(); } }; vue.watch(() => props[name], onChange); if (shouldHideWhenRouteChanges && instance.appContext.config.globalProperties.$route !== void 0) { vue.watch(() => ({ ...instance.proxy.$route }), () => { if (shouldHideWhenRouteChanges.value && indicator.value) { hide(); } }); } vue.onMounted(() => { onChange(props[name]); }); return { hide, show, toggle, hasUpdateHandler }; }; return { useModelToggle: useModelToggle2, useModelToggleProps: useModelToggleProps2, useModelToggleEmits: useModelToggleEmits2 }; }; const useProp = (name) => { const vm = vue.getCurrentInstance(); return vue.computed(() => { var _a2, _b; return (_b = (_a2 = vm == null ? void 0 : vm.proxy) == null ? void 0 : _a2.$props) == null ? void 0 : _b[name]; }); }; var E = "top", R = "bottom", W = "right", P = "left", me = "auto", G = [E, R, W, P], U = "start", J = "end", Xe = "clippingParents", je = "viewport", K = "popper", Ye = "reference", De = G.reduce(function(t, e) { return t.concat([e + "-" + U, e + "-" + J]); }, []), Ee = [].concat(G, [me]).reduce(function(t, e) { return t.concat([e, e + "-" + U, e + "-" + J]); }, []), Ge = "beforeRead", Je = "read", Ke = "afterRead", Qe = "beforeMain", Ze = "main", et = "afterMain", tt = "beforeWrite", nt = "write", rt = "afterWrite", ot = [Ge, Je, Ke, Qe, Ze, et, tt, nt, rt]; function C(t) { return t ? (t.nodeName || "").toLowerCase() : null; } function H(t) { if (t == null) return window; if (t.toString() !== "[object Window]") { var e = t.ownerDocument; return e && e.defaultView || window; } return t; } function Q(t) { var e = H(t).Element; return t instanceof e || t instanceof Element; } function B(t) { var e = H(t).HTMLElement; return t instanceof e || t instanceof HTMLElement; } function Pe(t) { if (typeof ShadowRoot == "undefined") return false; var e = H(t).ShadowRoot; return t instanceof e || t instanceof ShadowRoot; } function Mt(t) { var e = t.state; Object.keys(e.elements).forEach(function(n) { var r = e.styles[n] || {}, o = e.attributes[n] || {}, i = e.elements[n]; !B(i) || !C(i) || (Object.assign(i.style, r), Object.keys(o).forEach(function(a) { var s = o[a]; s === false ? i.removeAttribute(a) : i.setAttribute(a, s === true ? "" : s); })); }); } function Rt(t) { var e = t.state, n = { popper: { position: e.options.strategy, left: "0", top: "0", margin: "0" }, arrow: { position: "absolute" }, reference: {} }; return Object.assign(e.elements.popper.style, n.popper), e.styles = n, e.elements.arrow && Object.assign(e.elements.arrow.style, n.arrow), function() { Object.keys(e.elements).forEach(function(r) { var o = e.elements[r], i = e.attributes[r] || {}, a = Object.keys(e.styles.hasOwnProperty(r) ? e.styles[r] : n[r]), s = a.reduce(function(f, c) { return f[c] = "", f; }, {}); !B(o) || !C(o) || (Object.assign(o.style, s), Object.keys(i).forEach(function(f) { o.removeAttribute(f); })); }); }; } var Ae = { name: "applyStyles", enabled: true, phase: "write", fn: Mt, effect: Rt, requires: ["computeStyles"] }; function q(t) { return t.split("-")[0]; } var X = Math.max, ve = Math.min, Z = Math.round; function ee(t, e) { e === void 0 && (e = false); var n = t.getBoundingClientRect(), r = 1, o = 1; if (B(t) && e) { var i = t.offsetHeight, a = t.offsetWidth; a > 0 && (r = Z(n.width) / a || 1), i > 0 && (o = Z(n.height) / i || 1); } return { width: n.width / r, height: n.height / o, top: n.top / o, right: n.right / r, bottom: n.bottom / o, left: n.left / r, x: n.left / r, y: n.top / o }; } function ke(t) { var e = ee(t), n = t.offsetWidth, r = t.offsetHeight; return Math.abs(e.width - n) <= 1 && (n = e.width), Math.abs(e.height - r) <= 1 && (r = e.height), { x: t.offsetLeft, y: t.offsetTop, width: n, height: r }; } function it(t, e) { var n = e.getRootNode && e.getRootNode(); if (t.contains(e)) return true; if (n && Pe(n)) { var r = e; do { if (r && t.isSameNode(r)) return true; r = r.parentNode || r.host; } while (r); } return false; } function N(t) { return H(t).getComputedStyle(t); } function Wt(t) { return ["table", "td", "th"].indexOf(C(t)) >= 0; } function I(t) { return ((Q(t) ? t.ownerDocument : t.document) || window.document).documentElement; } function ge(t) { return C(t) === "html" ? t : t.assignedSlot || t.parentNode || (Pe(t) ? t.host : null) || I(t); } function at(t) { return !B(t) || N(t).position === "fixed" ? null : t.offsetParent; } function Bt(t) { var e = navigator.userAgent.toLowerCase().indexOf("firefox") !== -1, n = navigator.userAgent.indexOf("Trident") !== -1; if (n && B(t)) { var r = N(t); if (r.position === "fixed") return null; } var o = ge(t); for (Pe(o) && (o = o.host); B(o) && ["html", "body"].indexOf(C(o)) < 0; ) { var i = N(o); if (i.transform !== "none" || i.perspective !== "none" || i.contain === "paint" || ["transform", "perspective"].indexOf(i.willChange) !== -1 || e && i.willChange === "filter" || e && i.filter && i.filter !== "none") return o; o = o.parentNode; } return null; } function se(t) { for (var e = H(t), n = at(t); n && Wt(n) && N(n).position === "static"; ) n = at(n); return n && (C(n) === "html" || C(n) === "body" && N(n).position === "static") ? e : n || Bt(t) || e; } function Le(t) { return ["top", "bottom"].indexOf(t) >= 0 ? "x" : "y"; } function fe(t, e, n) { return X(t, ve(e, n)); } function St(t, e, n) { var r = fe(t, e, n); return r > n ? n : r; } function st() { return { top: 0, right: 0, bottom: 0, left: 0 }; } function ft(t) { return Object.assign({}, st(), t); } function ct(t, e) { return e.reduce(function(n, r) { return n[r] = t, n; }, {}); } var Tt = function(t, e) { return t = typeof t == "function" ? t(Object.assign({}, e.rects, { placement: e.placement })) : t, ft(typeof t != "number" ? t : ct(t, G)); }; function Ht(t) { var e, n = t.state, r = t.name, o = t.options, i = n.elements.arrow, a = n.modifiersData.popperOffsets, s = q(n.placement), f = Le(s), c = [P, W].indexOf(s) >= 0, u = c ? "height" : "width"; if (!(!i || !a)) { var m = Tt(o.padding, n), v = ke(i), l = f === "y" ? E : P, h = f === "y" ? R : W, p = n.rects.reference[u] + n.rects.reference[f] - a[f] - n.rects.popper[u], g = a[f] - n.rects.reference[f], x = se(i), y = x ? f === "y" ? x.clientHeight || 0 : x.clientWidth || 0 : 0, $ = p / 2 - g / 2, d = m[l], b = y - v[u] - m[h], w = y / 2 - v[u] / 2 + $, O = fe(d, w, b), j = f; n.modifiersData[r] = (e = {}, e[j] = O, e.centerOffset = O - w, e); } } function Ct(t) { var e = t.state, n = t.options, r = n.element, o = r === void 0 ? "[data-popper-arrow]" : r; o != null && (typeof o == "string" && (o = e.elements.popper.querySelector(o), !o) || !it(e.elements.popper, o) || (e.elements.arrow = o)); } var pt = { name: "arrow", enabled: true, phase: "main", fn: Ht, effect: Ct, requires: ["popperOffsets"], requiresIfExists: ["preventOverflow"] }; function te(t) { return t.split("-")[1]; } var qt = { top: "auto", right: "auto", bottom: "auto", left: "auto" }; function Vt(t) { var e = t.x, n = t.y, r = window, o = r.devicePixelRatio || 1; return { x: Z(e * o) / o || 0, y: Z(n * o) / o || 0 }; } function ut(t) { var e, n = t.popper, r = t.popperRect, o = t.placement, i = t.variation, a = t.offsets, s = t.position, f = t.gpuAcceleration, c = t.adaptive, u = t.roundOffsets, m = t.isFixed, v = a.x, l = v === void 0 ? 0 : v, h = a.y, p = h === void 0 ? 0 : h, g = typeof u == "function" ? u({ x: l, y: p }) : { x: l, y: p }; l = g.x, p = g.y; var x = a.hasOwnProperty("x"), y = a.hasOwnProperty("y"), $ = P, d = E, b = window; if (c) { var w = se(n), O = "clientHeight", j = "clientWidth"; if (w === H(n) && (w = I(n), N(w).position !== "static" && s === "absolute" && (O = "scrollHeight", j = "scrollWidth")), w = w, o === E || (o === P || o === W) && i === J) { d = R; var A = m && w === b && b.visualViewport ? b.visualViewport.height : w[O]; p -= A - r.height, p *= f ? 1 : -1; } if (o === P || (o === E || o === R) && i === J) { $ = W; var k = m && w === b && b.visualViewport ? b.visualViewport.width : w[j]; l -= k - r.width, l *= f ? 1 : -1; } } var D = Object.assign({ position: s }, c && qt), S = u === true ? Vt({ x: l, y: p }) : { x: l, y: p }; if (l = S.x, p = S.y, f) { var L; return Object.assign({}, D, (L = {}, L[d] = y ? "0" : "", L[$] = x ? "0" : "", L.transform = (b.devicePixelRatio || 1) <= 1 ? "translate(" + l + "px, " + p + "px)" : "translate3d(" + l + "px, " + p + "px, 0)", L)); } return Object.assign({}, D, (e = {}, e[d] = y ? p + "px" : "", e[$] = x ? l + "px" : "", e.transform = "", e)); } function Nt(t) { var e = t.state, n = t.options, r = n.gpuAcceleration, o = r === void 0 ? true : r, i = n.adaptive, a = i === void 0 ? true : i, s = n.roundOffsets, f = s === void 0 ? true : s, c = { placement: q(e.placement), variation: te(e.placement), popper: e.elements.popper, popperRect: e.rects.popper, gpuAcceleration: o, isFixed: e.options.strategy === "fixed" }; e.modifiersData.popperOffsets != null && (e.styles.popper = Object.assign({}, e.styles.popper, ut(Object.assign({}, c, { offsets: e.modifiersData.popperOffsets, position: e.options.strategy, adaptive: a, roundOffsets: f })))), e.modifiersData.arrow != null && (e.styles.arrow = Object.assign({}, e.styles.arrow, ut(Object.assign({}, c, { offsets: e.modifiersData.arrow, position: "absolute", adaptive: false, roundOffsets: f })))), e.attributes.popper = Object.assign({}, e.attributes.popper, { "data-popper-placement": e.placement }); } var Me = { name: "computeStyles", enabled: true, phase: "beforeWrite", fn: Nt, data: {} }, ye = { passive: true }; function It(t) { var e = t.state, n = t.instance, r = t.options, o = r.scroll, i = o === void 0 ? true : o, a = r.resize, s = a === void 0 ? true : a, f = H(e.elements.popper), c = [].concat(e.scrollParents.reference, e.scrollParents.popper); return i && c.forEach(function(u) { u.addEventListener("scroll", n.update, ye); }), s && f.addEventListener("resize", n.update, ye), function() { i && c.forEach(function(u) { u.removeEventListener("scroll", n.update, ye); }), s && f.removeEventListener("resize", n.update, ye); }; } var Re = { name: "eventListeners", enabled: true, phase: "write", fn: function() { }, effect: It, data: {} }, _t = { left: "right", right: "left", bottom: "top", top: "bottom" }; function be(t) { return t.replace(/left|right|bottom|top/g, function(e) { return _t[e]; }); } var zt = { start: "end", end: "start" }; function lt(t) { return t.replace(/start|end/g, function(e) { return zt[e]; }); } function We(t) { var e = H(t), n = e.pageXOffset, r = e.pageYOffset; return { scrollLeft: n, scrollTop: r }; } function Be(t) { return ee(I(t)).left + We(t).scrollLeft; } function Ft(t) { var e = H(t), n = I(t), r = e.visualViewport, o = n.clientWidth, i = n.clientHeight, a = 0, s = 0; return r && (o = r.width, i = r.height, /^((?!chrome|android).)*safari/i.test(navigator.userAgent) || (a = r.offsetLeft, s = r.offsetTop)), { width: o, height: i, x: a + Be(t), y: s }; } function Ut(t) { var e, n = I(t), r = We(t), o = (e = t.ownerDocument) == null ? void 0 : e.body, i = X(n.scrollWidth, n.clientWidth, o ? o.scrollWidth : 0, o ? o.clientWidth : 0), a = X(n.scrollHeight, n.clientHeight, o ? o.scrollHeight : 0, o ? o.clientHeight : 0), s = -r.scrollLeft + Be(t), f = -r.scrollTop; return N(o || n).direction === "rtl" && (s += X(n.clientWidth, o ? o.clientWidth : 0) - i), { width: i, height: a, x: s, y: f }; } function Se(t) { var e = N(t), n = e.overflow, r = e.overflowX, o = e.overflowY; return /auto|scroll|overlay|hidden/.test(n + o + r); } function dt(t) { return ["html", "body", "#document"].indexOf(C(t)) >= 0 ? t.ownerDocument.body : B(t) && Se(t) ? t : dt(ge(t)); } function ce(t, e) { var n; e === void 0 && (e = []); var r = dt(t), o = r === ((n = t.ownerDocument) == null ? void 0 : n.body), i = H(r), a = o ? [i].concat(i.visualViewport || [], Se(r) ? r : []) : r, s = e.concat(a); return o ? s : s.concat(ce(ge(a))); } function Te(t) { return Object.assign({}, t, { left: t.x, top: t.y, right: t.x + t.width, bottom: t.y + t.height }); } function Xt(t) { var e = ee(t); return e.top = e.top + t.clientTop, e.left = e.left + t.clientLeft, e.bottom = e.top + t.clientHeight, e.right = e.left + t.clientWidth, e.width = t.clientWidth, e.height = t.clientHeight, e.x = e.left, e.y = e.top, e; } function ht(t, e) { return e === je ? Te(Ft(t)) : Q(e) ? Xt(e) : Te(Ut(I(t))); } function Yt(t) { var e = ce(ge(t)), n = ["absolute", "fixed"].indexOf(N(t).position) >= 0, r = n && B(t) ? se(t) : t; return Q(r) ? e.filter(function(o) { return Q(o) && it(o, r) && C(o) !== "body"; }) : []; } function Gt(t, e, n) { var r = e === "clippingParents" ? Yt(t) : [].concat(e), o = [].concat(r, [n]), i = o[0], a = o.reduce(function(s, f) { var c = ht(t, f); return s.top = X(c.top, s.top), s.right = ve(c.right, s.right), s.bottom = ve(c.bottom, s.bottom), s.left = X(c.left, s.left), s; }, ht(t, i)); return a.width = a.right - a.left, a.height = a.bottom - a.top, a.x = a.left, a.y = a.top, a; } function mt(t) { var e = t.reference, n = t.element, r = t.placement, o = r ? q(r) : null, i = r ? te(r) : null, a = e.x + e.width / 2 - n.width / 2, s = e.y + e.height / 2 - n.height / 2, f; switch (o) { case E: f = { x: a, y: e.y - n.height }; break; case R: f = { x: a, y: e.y + e.height }; break; case W: f = { x: e.x + e.width, y: s }; break; case P: f = { x: e.x - n.width, y: s }; break; default: f = { x: e.x, y: e.y }; } var c = o ? Le(o) : null; if (c != null) { var u = c === "y" ? "height" : "width"; switch (i) { case U: f[c] = f[c] - (e[u] / 2 - n[u] / 2); break; case J: f[c] = f[c] + (e[u] / 2 - n[u] / 2); break; } } return f; } function ne(t, e) { e === void 0 && (e = {}); var n = e, r = n.placement, o = r === void 0 ? t.placement : r, i = n.boundary, a = i === void 0 ? Xe : i, s = n.rootBoundary, f = s === void 0 ? je : s, c = n.elementContext, u = c === void 0 ? K : c, m = n.altBoundary, v = m === void 0 ? false : m, l = n.padding, h = l === void 0 ? 0 : l, p = ft(typeof h != "number" ? h : ct(h, G)), g = u === K ? Ye : K, x = t.rects.popper, y = t.elements[v ? g : u], $ = Gt(Q(y) ? y : y.contextElement || I(t.elements.popper), a, f), d = ee(t.elements.reference), b = mt({ reference: d, element: x, strategy: "absolute", placement: o }), w = Te(Object.assign({}, x, b)), O = u === K ? w : d, j = { top: $.top - O.top + p.top, bottom: O.bottom - $.bottom + p.bottom, left: $.left - O.left + p.left, right: O.right - $.right + p.right }, A = t.modifiersData.offset; if (u === K && A) { var k = A[o]; Object.keys(j).forEach(function(D) { var S = [W, R].indexOf(D) >= 0 ? 1 : -1, L = [E, R].indexOf(D) >= 0 ? "y" : "x"; j[D] += k[L] * S; }); } return j; } function Jt(t, e) { e === void 0 && (e = {}); var n = e, r = n.placement, o = n.boundary, i = n.rootBoundary, a = n.padding, s = n.flipVariations, f = n.allowedAutoPlacements, c = f === void 0 ? Ee : f, u = te(r), m = u ? s ? De : De.filter(function(h) { return te(h) === u; }) : G, v = m.filter(function(h) { return c.indexOf(h) >= 0; }); v.length === 0 && (v = m); var l = v.reduce(function(h, p) { return h[p] = ne(t, { placement: p, boundary: o, rootBoundary: i, padding: a })[q(p)], h; }, {}); return Object.keys(l).sort(function(h, p) { return l[h] - l[p]; }); } function Kt(t) { if (q(t) === me) return []; var e = be(t); return [lt(t), e, lt(e)]; } function Qt(t) { var e = t.state, n = t.options, r = t.name; if (!e.modifiersData[r]._skip) { for (var o = n.mainAxis, i = o === void 0 ? true : o, a = n.altAxis, s = a === void 0 ? true : a, f = n.fallbackPlacements, c = n.padding, u = n.boundary, m = n.rootBoundary, v = n.altBoundary, l = n.flipVariations, h = l === void 0 ? true : l, p = n.allowedAutoPlacements, g = e.options.placement, x = q(g), y = x === g, $ = f || (y || !h ? [be(g)] : Kt(g)), d = [g].concat($).reduce(function(z, V) { return z.concat(q(V) === me ? Jt(e, { placement: V, boundary: u, rootBoundary: m, padding: c, flipVariations: h, allowedAutoPlacements: p }) : V); }, []), b = e.rects.reference, w = e.rects.popper, O = /* @__PURE__ */ new Map(), j = true, A = d[0], k = 0; k < d.length; k++) { var D = d[k], S = q(D), L = te(D) === U, re = [E, R].indexOf(S) >= 0, oe = re ? "width" : "height", M = ne(e, { placement: D, boundary: u, rootBoundary: m, altBoundary: v, padding: c }), T = re ? L ? W : P : L ? R : E; b[oe] > w[oe] && (T = be(T)); var pe = be(T), _ = []; if (i && _.push(M[S] <= 0), s && _.push(M[T] <= 0, M[pe] <= 0), _.every(function(z) { return z; })) { A = D, j = false; break; } O.set(D, _); } if (j) for (var ue = h ? 3 : 1, xe = function(z) { var V = d.find(function(de) { var ae = O.get(de); if (ae) return ae.slice(0, z).every(function(Y) { return Y; }); }); if (V) return A = V, "break"; }, ie = ue; ie > 0; ie--) { var le = xe(ie); if (le === "break") break; } e.placement !== A && (e.modifiersData[r]._skip = true, e.placement = A, e.reset = true); } } var vt = { name: "flip", enabled: true, phase: "main", fn: Qt, requiresIfExists: ["offset"], data: { _skip: false } }; function gt(t, e, n) { return n === void 0 && (n = { x: 0, y: 0 }), { top: t.top - e.height - n.y, right: t.right - e.width + n.x, bottom: t.bottom - e.height + n.y, left: t.left - e.width - n.x }; } function yt(t) { return [E, W, R, P].some(function(e) { return t[e] >= 0; }); } function Zt(t) { var e = t.state, n = t.name, r = e.rects.reference, o = e.rects.popper, i = e.modifiersData.preventOverflow, a = ne(e, { elementContext: "reference" }), s = ne(e, { altBoundary: true }), f = gt(a, r), c = gt(s, o, i), u = yt(f), m = yt(c); e.modifiersData[n] = { referenceClippingOffsets: f, popperEscapeOffsets: c, isReferenceHidden: u, hasPopperEscaped: m }, e.attributes.popper = Object.assign({}, e.attributes.popper, { "data-popper-reference-hidden": u, "data-popper-escaped": m }); } var bt = { name: "hide", enabled: true, phase: "main", requiresIfExists: ["preventOverflow"], fn: Zt }; function en(t, e, n) { var r = q(t), o = [P, E].indexOf(r) >= 0 ? -1 : 1, i = typeof n == "function" ? n(Object.assign({}, e, { placement: t })) : n, a = i[0], s = i[1]; return a = a || 0, s = (s || 0) * o, [P, W].indexOf(r) >= 0 ? { x: s, y: a } : { x: a, y: s }; } function tn(t) { var e = t.state, n = t.options, r = t.name, o = n.offset, i = o === void 0 ? [0, 0] : o, a = Ee.reduce(function(u, m) { return u[m] = en(m, e.rects, i), u; }, {}), s = a[e.placement], f = s.x, c = s.y; e.modifiersData.popperOffsets != null && (e.modifiersData.popperOffsets.x += f, e.modifiersData.popperOffsets.y += c), e.modifiersData[r] = a; } var wt = { name: "offset", enabled: true, phase: "main", requires: ["popperOffsets"], fn: tn }; function nn(t) { var e = t.state, n = t.name; e.modifiersData[n] = mt({ reference: e.rects.reference, element: e.rects.popper, strategy: "absolute", placement: e.placement }); } var He = { name: "popperOffsets", enabled: true, phase: "read", fn: nn, data: {} }; function rn(t) { return t === "x" ? "y" : "x"; } function on(t) { var e = t.state, n = t.options, r = t.name, o = n.mainAxis, i = o === void 0 ? true : o, a = n.altAxis, s = a === void 0 ? false : a, f = n.boundary, c = n.rootBoundary, u = n.altBoundary, m = n.padding, v = n.tether, l = v === void 0 ? true : v, h = n.tetherOffset, p = h === void 0 ? 0 : h, g = ne(e, { boundary: f, rootBoundary: c, padding: m, altBoundary: u }), x = q(e.placement), y = te(e.placement), $ = !y, d = Le(x), b = rn(d), w = e.modifiersData.popperOffsets, O = e.rects.reference, j = e.rects.popper, A = typeof p == "function" ? p(Object.assign({}, e.rects, { placement: e.placement })) : p, k = typeof A == "number" ? { mainAxis: A, altAxis: A } : Object.assign({ mainAxis: 0, altAxis: 0 }, A), D = e.modifiersData.offset ? e.modifiersData.offset[e.placement] : null, S = { x: 0, y: 0 }; if (w) { if (i) { var L, re = d === "y" ? E : P, oe = d === "y" ? R : W, M = d === "y" ? "height" : "width", T = w[d], pe = T + g[re], _ = T - g[oe], ue = l ? -j[M] / 2 : 0, xe = y === U ? O[M] : j[M], ie = y === U ? -j[M] : -O[M], le = e.elements.arrow, z = l && le ? ke(le) : { width: 0, height: 0 }, V = e.modifiersData["arrow#persistent"] ? e.modifiersData["arrow#persistent"].padding : st(), de = V[re], ae = V[oe], Y = fe(0, O[M], z[M]), jt = $ ? O[M] / 2 - ue - Y - de - k.mainAxis : xe - Y - de - k.mainAxis, Dt = $ ? -O[M] / 2 + ue + Y + ae + k.mainAxis : ie + Y + ae + k.mainAxis, Oe = e.elements.arrow && se(e.elements.arrow), Et = Oe ? d === "y" ? Oe.clientTop || 0 : Oe.clientLeft || 0 : 0, Ce = (L = D == null ? void 0 : D[d]) != null ? L : 0, Pt = T + jt - Ce - Et, At = T + Dt - Ce, qe = fe(l ? ve(pe, Pt) : pe, T, l ? X(_, At) : _); w[d] = qe, S[d] = qe - T; } if (s) { var Ve, kt = d === "x" ? E : P, Lt = d === "x" ? R : W, F = w[b], he = b === "y" ? "height" : "width", Ne = F + g[kt], Ie = F - g[Lt], $e = [E, P].indexOf(x) !== -1, _e = (Ve = D == null ? void 0 : D[b]) != null ? Ve : 0, ze = $e ? Ne : F - O[he] - j[he] - _e + k.altAxis, Fe = $e ? F + O[he] + j[he] - _e - k.altAxis : Ie, Ue = l && $e ? St(ze, F, Fe) : fe(l ? ze : Ne, F, l ? Fe : Ie); w[b] = Ue, S[b] = Ue - F; } e.modifiersData[r] = S; } } var xt = { name: "preventOverflow", enabled: true, phase: "main", fn: on, requiresIfExists: ["offset"] }; function an(t) { return { scrollLeft: t.scrollLeft, scrollTop: t.scrollTop }; } function sn(t) { return t === H(t) || !B(t) ? We(t) : an(t); } function fn(t) { var e = t.getBoundingClientRect(), n = Z(e.width) / t.offsetWidth || 1, r = Z(e.height) / t.offsetHeight || 1; return n !== 1 || r !== 1; } function cn(t, e, n) { n === void 0 && (n = false); var r = B(e), o = B(e) && fn(e), i = I(e), a = ee(t, o), s = { scrollLeft: 0, scrollTop: 0 }, f = { x: 0, y: 0 }; return (r || !r && !n) && ((C(e) !== "body" || Se(i)) && (s = sn(e)), B(e) ? (f = ee(e, true), f.x += e.clientLeft, f.y += e.clientTop) : i && (f.x = Be(i))), { x: a.left + s.scrollLeft - f.x, y: a.top + s.scrollTop - f.y, width: a.width, height: a.height }; } function pn(t) { var e = /* @__PURE__ */ new Map(), n = /* @__PURE__ */ new Set(), r = []; t.forEach(function(i) { e.set(i.name, i); }); function o(i) { n.add(i.name); var a = [].concat(i.requires || [], i.requiresIfExists || []); a.forEach(function(s) { if (!n.has(s)) { var f = e.get(s); f && o(f); } }), r.push(i); } return t.forEach(function(i) { n.has(i.name) || o(i); }), r; } function un(t) { var e = pn(t); return ot.reduce(function(n, r) { return n.concat(e.filter(function(o) { return o.phase === r; })); }, []); } function ln(t) { var e; return function() { return e || (e = new Promise(function(n) { Promise.resolve().then(function() { e = void 0, n(t()); }); })), e; }; } function dn(t) { var e = t.reduce(function(n, r) { var o = n[r.name]; return n[r.name] = o ? Object.assign({}, o, r, { options: Object.assign({}, o.options, r.options), data: Object.assign({}, o.data, r.data) }) : r, n; }, {}); return Object.keys(e).map(function(n) { return e[n]; }); } var Ot = { placement: "bottom", modifiers: [], strategy: "absolute" }; function $t() { for (var t = arguments.length, e = new Array(t), n = 0; n < t; n++) e[n] = arguments[n]; return !e.some(function(r) { return !(r && typeof r.getBoundingClientRect == "function"); }); } function we(t) { t === void 0 && (t = {}); var e = t, n = e.defaultModifiers, r = n === void 0 ? [] : n, o = e.defaultOptions, i = o === void 0 ? Ot : o; return function(a, s, f) { f === void 0 && (f = i); var c = { placement: "bottom", orderedModifiers: [], options: Object.assign({}, Ot, i), modifiersData: {}, elements: { reference: a, popper: s }, attributes: {}, styles: {} }, u = [], m = false, v = { state: c, setOptions: function(p) { var g = typeof p == "function" ? p(c.options) : p; h(), c.options = Object.assign({}, i, c.options, g), c.scrollParents = { reference: Q(a) ? ce(a) : a.contextElement ? ce(a.contextElement) : [], popper: ce(s) }; var x = un(dn([].concat(r, c.options.modifiers))); return c.orderedModifiers = x.filter(function(y) { return y.enabled; }), l(), v.update(); }, forceUpdate: function() { if (!m) { var p = c.elements, g = p.reference, x = p.popper; if ($t(g, x)) { c.rects = { reference: cn(g, se(x), c.options.strategy === "fixed"), popper: ke(x) }, c.reset = false, c.placement = c.options.placement, c.orderedModifiers.forEach(function(j) { return c.modifiersData[j.name] = Object.assign({}, j.data); }); for (var y = 0; y < c.orderedModifiers.length; y++) { if (c.reset === true) { c.reset = false, y = -1; continue; } var $ = c.orderedModifiers[y], d = $.fn, b = $.options, w = b === void 0 ? {} : b, O = $.name; typeof d == "function" && (c = d({ state: c, options: w, name: O, instance: v }) || c); } } } }, update: ln(function() { return new Promise(function(p) { v.forceUpdate(), p(c); }); }), destroy: function() { h(), m = true; } }; if (!$t(a, s)) return v; v.setOptions(f).then(function(p) { !m && f.onFirstUpdate && f.onFirstUpdate(p); }); function l() { c.orderedModifiers.forEach(function(p) { var g = p.name, x = p.options, y = x === void 0 ? {} : x, $ = p.effect; if (typeof $ == "function") { var d = $({ state: c, name: g, instance: v, options: y }), b = function() { }; u.push(d || b); } }); } function h() { u.forEach(function(p) { return p(); }), u = []; } return v; }; } we(); var mn = [Re, He, Me, Ae]; we({ defaultModifiers: mn }); var gn = [Re, He, Me, Ae, wt, vt, xt, pt, bt], yn = we({ defaultModifiers: gn }); const usePopper = (referenceElementRef, popperElementRef, opts = {}) => { const stateUpdater = { name: "updateState", enabled: true, phase: "write", fn: ({ state }) => { const derivedState = deriveState(state); Object.assign(states.value, derivedState); }, requires: ["computeStyles"] }; const options = vue.computed(() => { const { onFirstUpdate, placement, strategy, modifiers } = vue.unref(opts); return { onFirstUpdate, placement: placement || "bottom", strategy: strategy || "absolute", modifiers: [ ...modifiers || [], stateUpdater, { name: "applyStyles", enabled: false } ] }; }); const instanceRef = vue.shallowRef(); const states = vue.ref({ styles: { popper: { position: vue.unref(options).strategy, left: "0", top: "0" }, arrow: { position: "absolute" } }, attributes: {} }); const destroy = () => { if (!instanceRef.value) return; instanceRef.value.destroy(); instanceRef.value = void 0; }; vue.watch(options, (newOptions) => { const instance = vue.unref(instanceRef); if (instance) { instance.setOptions(newOptions); } }, { deep: true }); vue.watch([referenceElementRef, popperElementRef], ([referenceElement, popperElement]) => { destroy(); if (!referenceElement || !popperElement) return; instanceRef.value = yn(referenceElement, popperElement, vue.unref(options)); }); vue.onBeforeUnmount(() => { destroy(); }); return { state: vue.computed(() => { var _a2; return { ...((_a2 = vue.unref(instanceRef)) == null ? void 0 : _a2.state) || {} }; }), styles: vue.computed(() => vue.unref(states).styles), attributes: vue.computed(() => vue.unref(states).attributes), update: () => { var _a2; return (_a2 = vue.unref(instanceRef)) == null ? void 0 : _a2.update(); }, forceUpdate: () => { var _a2; return (_a2 = vue.unref(instanceRef)) == null ? void 0 : _a2.forceUpdate(); }, instanceRef: vue.computed(() => vue.unref(instanceRef)) }; }; function deriveState(state) { const elements = Object.keys(state.elements); const styles = fromPairs(elements.map((element) => [element, state.styles[element] || {}])); const attributes = fromPairs(elements.map((element) => [element, state.attributes[element]])); return { styles, attributes }; } function useTimeout() { let timeoutHandle; const registerTimeout = (fn2, delay) => { cancelTimeout(); timeoutHandle = window.setTimeout(fn2, delay); }; const cancelTimeout = () => window.clearTimeout(timeoutHandle); tryOnScopeDispose(() => cancelTimeout()); return { registerTimeout, cancelTimeout }; } const defaultIdInjection = { prefix: Math.floor(Math.random() * 1e4), current: 0 }; const ID_INJECTION_KEY = Symbol("elIdInjection"); const useIdInjection = () => { return vue.getCurrentInstance() ? vue.inject(ID_INJECTION_KEY, defaultIdInjection) : defaultIdInjection; }; const useId = (deterministicId) => { const idInjection = useIdInjection(); const namespace = useGetDerivedNamespace(); const idRef = vue.computed(() => vue.unref(deterministicId) || `${namespace.value}-id-${idInjection.prefix}-${idInjection.current++}`); return idRef; }; let registeredEscapeHandlers = []; const cachedHandler = (e) => { const event = e; if (event.key === EVENT_CODE.esc) { registeredEscapeHandlers.forEach((registeredHandler) => registeredHandler(event)); } }; const useEscapeKeydown = (handler) => { vue.onMounted(() => { if (registeredEscapeHandlers.length === 0) { document.addEventListener("keydown", cachedHandler); } if (isClient) registeredEscapeHandlers.push(handler); }); vue.onBeforeUnmount(() => { registeredEscapeHandlers = registeredEscapeHandlers.filter((registeredHandler) => registeredHandler !== handler); if (registeredEscapeHandlers.length === 0) { if (isClient) document.removeEventListener("keydown", cachedHandler); } }); }; let cachedContainer; const usePopperContainerId = () => { const namespace = useGetDerivedNamespace(); const idInjection = useIdInjection(); const id = vue.computed(() => { return `${namespace.value}-popper-container-${idInjection.prefix}`; }); const selector = vue.computed(() => `#${id.value}`); return { id, selector }; }; const createContainer = (id) => { const container = document.createElement("div"); container.id = id; document.body.appendChild(container); return container; }; const usePopperContainer = () => { const { id, selector } = usePopperContainerId(); vue.onBeforeMount(() => { if (!isClient) return; if (!cachedContainer && !document.body.querySelector(selector.value)) { cachedContainer = createContainer(id.value); } }); return { id, selector }; }; const useDelayedToggleProps = buildProps({ showAfter: { type: Number, default: 0 }, hideAfter: { type: Number, default: 200 }, autoClose: { type: Number, default: 0 } }); const useDelayedToggle = ({ showAfter, hideAfter, autoClose, open, close }) => { const { registerTimeout } = useTimeout(); const { registerTimeout: registerTimeoutForAutoClose, cancelTimeout: cancelTimeoutForAutoClose } = useTimeout(); const onOpen = (event) => { registerTimeout(() => { open(event); const _autoClose = vue.unref(autoClose); if (isNumber(_autoClose) && _autoClose > 0) { registerTimeoutForAutoClose(() => { close(event); }, _autoClose); } }, vue.unref(showAfter)); }; const onClose = (event) => { cancelTimeoutForAutoClose(); registerTimeout(() => { close(event); }, vue.unref(hideAfter)); }; return { onOpen, onClose }; }; const FORWARD_REF_INJECTION_KEY = Symbol("elForwardRef"); const useForwardRef = (forwardRef) => { const setForwardRef = (el) => { forwardRef.value = el; }; vue.provide(FORWARD_REF_INJECTION_KEY, { setForwardRef }); }; const useForwardRefDirective = (setForwardRef) => { return { mounted(el) { setForwardRef(el); }, updated(el) { setForwardRef(el); }, unmounted() { setForwardRef(null); } }; }; const initial = { current: 0 }; const zIndex = vue.ref(0); const defaultInitialZIndex = 2e3; const ZINDEX_INJECTION_KEY = Symbol("elZIndexContextKey"); const zIndexContextKey = Symbol("zIndexContextKey"); const useZIndex = (zIndexOverrides) => { const increasingInjection = vue.getCurrentInstance() ? vue.inject(ZINDEX_INJECTION_KEY, initial) : initial; const zIndexInjection = zIndexOverrides || (vue.getCurrentInstance() ? vue.inject(zIndexContextKey, void 0) : void 0); const initialZIndex = vue.computed(() => { const zIndexFromInjection = vue.unref(zIndexInjection); return isNumber(zIndexFromInjection) ? zIndexFromInjection : defaultInitialZIndex; }); const currentZIndex = vue.computed(() => initialZIndex.value + zIndex.value); const nextZIndex = () => { increasingInjection.current++; zIndex.value = increasingInjection.current; return currentZIndex.value; }; if (!isClient && !vue.inject(ZINDEX_INJECTION_KEY)) ; return { initialZIndex, currentZIndex, nextZIndex }; }; function useCursor(input) { const selectionRef = vue.ref(); function recordCursor() { if (input.value == void 0) return; const { selectionStart, selectionEnd, value } = input.value; if (selectionStart == null || selectionEnd == null) return; const beforeTxt = value.slice(0, Math.max(0, selectionStart)); const afterTxt = value.slice(Math.max(0, selectionEnd)); selectionRef.value = { selectionStart, selectionEnd, value, beforeTxt, afterTxt }; } function setCursor() { if (input.value == void 0 || selectionRef.value == void 0) return; const { value } = input.value; const { beforeTxt, afterTxt, selectionStart } = selectionRef.value; if (beforeTxt == void 0 || afterTxt == void 0 || selectionStart == void 0) return; let startPos = value.length; if (value.endsWith(afterTxt)) { startPos = value.length - afterTxt.length; } else if (value.startsWith(beforeTxt)) { startPos = beforeTxt.length; } else { const beforeLastChar = beforeTxt[selectionStart - 1]; const newIndex = value.indexOf(beforeLastChar, selectionStart - 1); if (newIndex !== -1) { startPos = newIndex + 1; } } input.value.setSelectionRange(startPos, startPos); } return [recordCursor, setCursor]; } const useSizeProp = buildProp({ type: String, values: componentSizes, required: false }); const SIZE_INJECTION_KEY = Symbol("size"); const useGlobalSize = () => { const injectedSize = vue.inject(SIZE_INJECTION_KEY, {}); return vue.computed(() => { return vue.unref(injectedSize.size) || ""; }); }; function useFocusController(target, { afterFocus, beforeBlur, afterBlur } = {}) { const instance = vue.getCurrentInstance(); const { emit } = instance; const wrapperRef = vue.shallowRef(); const isFocused = vue.ref(false); const handleFocus = (event) => { if (isFocused.value) return; isFocused.value = true; emit("focus", event); afterFocus == null ? void 0 : afterFocus(); }; const handleBlur = (event) => { var _a2; const cancelBlur = isFunction$1(beforeBlur) ? beforeBlur(event) : false; if (cancelBlur || event.relatedTarget && ((_a2 = wrapperRef.value) == null ? void 0 : _a2.contains(event.relatedTarget))) return; isFocused.value = false; emit("blur", event); afterBlur == null ? void 0 : afterBlur(); }; const handleClick = () => { var _a2; (_a2 = target.value) == null ? void 0 : _a2.focus(); }; vue.watch(wrapperRef, (el) => { if (el) { el.setAttribute("tabindex", "-1"); } }); useEventListener(wrapperRef, "click", handleClick); return { wrapperRef, isFocused, handleFocus, handleBlur }; } const DEFAULT_EMPTY_VALUES = ["", void 0, null]; const DEFAULT_VALUE_ON_CLEAR = void 0; const useEmptyValuesProps = buildProps({ emptyValues: Array, valueOnClear: { type: [String, Number, Boolean, Function], default: void 0, validator: (val) => isFunction$1(val) ? !val() : !val } }); const useEmptyValues = (props, defaultValue) => { let config = useGlobalConfig(); if (!config.value) { config = vue.ref({}); } const emptyValues = vue.computed(() => props.emptyValues || config.value.emptyValues || DEFAULT_EMPTY_VALUES); const valueOnClear = vue.computed(() => { if (isFunction$1(props.valueOnClear)) { return props.valueOnClear(); } else if (props.valueOnClear !== void 0) { return props.valueOnClear; } else if (isFunction$1(config.value.valueOnClear)) { return config.value.valueOnClear(); } else if (config.value.valueOnClear !== void 0) { return config.value.valueOnClear; } return defaultValue !== void 0 ? defaultValue : DEFAULT_VALUE_ON_CLEAR; }); const isEmptyValue = (value) => { return emptyValues.value.includes(value); }; if (!emptyValues.value.includes(valueOnClear.value)) ; return { emptyValues, valueOnClear, isEmptyValue }; }; const configProviderContextKey = Symbol(); const globalConfig = vue.ref(); function useGlobalConfig(key, defaultValue = void 0) { const config = vue.getCurrentInstance() ? vue.inject(configProviderContextKey, globalConfig) : globalConfig; if (key) { return vue.computed(() => { var _a2, _b; return (_b = (_a2 = config.value) == null ? void 0 : _a2[key]) != null ? _b : defaultValue; }); } else { return config; } } var _export_sfc$1 = (sfc, props) => { const target = sfc.__vccOpts || sfc; for (const [key, val] of props) { target[key] = val; } return target; }; const iconProps = buildProps({ size: { type: definePropType([Number, String]) }, color: { type: String } }); const __default__$b = vue.defineComponent({ name: "ElIcon", inheritAttrs: false }); const _sfc_main$k = /* @__PURE__ */ vue.defineComponent({ ...__default__$b, props: iconProps, setup(__props) { const props = __props; const ns = useNamespace("icon"); const style2 = vue.computed(() => { const { size, color } = props; if (!size && !color) return {}; return { fontSize: isUndefined(size) ? void 0 : addUnit(size), "--color": color }; }); return (_ctx, _cache) => { return vue.openBlock(), vue.createElementBlock("i", vue.mergeProps({ class: vue.unref(ns).b(), style: vue.unref(style2) }, _ctx.$attrs), [ vue.renderSlot(_ctx.$slots, "default") ], 16); }; } }); var Icon = /* @__PURE__ */ _export_sfc$1(_sfc_main$k, [["__file", "icon.vue"]]); const ElIcon = withInstall(Icon); const formContextKey = Symbol("formContextKey"); const formItemContextKey = Symbol("formItemContextKey"); const useFormSize = (fallback, ignore = {}) => { const emptyRef = vue.ref(void 0); const size = ignore.prop ? emptyRef : useProp("size"); const globalConfig2 = ignore.global ? emptyRef : useGlobalSize(); const form = ignore.form ? { size: void 0 } : vue.inject(formContextKey, void 0); const formItem = ignore.formItem ? { size: void 0 } : vue.inject(formItemContextKey, void 0); return vue.computed(() => size.value || vue.unref(fallback) || (formItem == null ? void 0 : formItem.size) || (form == null ? void 0 : form.size) || globalConfig2.value || ""); }; const useFormDisabled = (fallback) => { const disabled = useProp("disabled"); const form = vue.inject(formContextKey, void 0); return vue.computed(() => disabled.value || vue.unref(fallback) || (form == null ? void 0 : form.disabled) || false); }; const useFormItem = () => { const form = vue.inject(formContextKey, void 0); const formItem = vue.inject(formItemContextKey, void 0); return { form, formItem }; }; const useFormItemInputId = (props, { formItemContext, disableIdGeneration, disableIdManagement }) => { if (!disableIdGeneration) { disableIdGeneration = vue.ref(false); } if (!disableIdManagement) { disableIdManagement = vue.ref(false); } const inputId = vue.ref(); let idUnwatch = void 0; const isLabeledByFormItem = vue.computed(() => { var _a2; return !!(!props.label && formItemContext && formItemContext.inputIds && ((_a2 = formItemContext.inputIds) == null ? void 0 : _a2.length) <= 1); }); vue.onMounted(() => { idUnwatch = vue.watch([vue.toRef(props, "id"), disableIdGeneration], ([id, disableIdGeneration2]) => { const newId = id != null ? id : !disableIdGeneration2 ? useId().value : void 0; if (newId !== inputId.value) { if (formItemContext == null ? void 0 : formItemContext.removeInputId) { inputId.value && formItemContext.removeInputId(inputId.value); if (!(disableIdManagement == null ? void 0 : disableIdManagement.value) && !disableIdGeneration2 && newId) { formItemContext.addInputId(newId); } } inputId.value = newId; } }, { immediate: true }); }); vue.onUnmounted(() => { idUnwatch && idUnwatch(); if (formItemContext == null ? void 0 : formItemContext.removeInputId) { inputId.value && formItemContext.removeInputId(inputId.value); } }); return { isLabeledByFormItem, inputId }; }; let hiddenTextarea = void 0; const HIDDEN_STYLE = ` height:0 !important; visibility:hidden !important; ${isFirefox() ? "" : "overflow:hidden !important;"} position:absolute !important; z-index:-1000 !important; top:0 !important; right:0 !important; `; const CONTEXT_STYLE = [ "letter-spacing", "line-height", "padding-top", "padding-bottom", "font-family", "font-weight", "font-size", "text-rendering", "text-transform", "width", "text-indent", "padding-left", "padding-right", "border-width", "box-sizing" ]; function calculateNodeStyling(targetElement) { const style2 = window.getComputedStyle(targetElement); const boxSizing = style2.getPropertyValue("box-sizing"); const paddingSize = Number.parseFloat(style2.getPropertyValue("padding-bottom")) + Number.parseFloat(style2.getPropertyValue("padding-top")); const borderSize = Number.parseFloat(style2.getPropertyValue("border-bottom-width")) + Number.parseFloat(style2.getPropertyValue("border-top-width")); const contextStyle = CONTEXT_STYLE.map((name) => `${name}:${style2.getPropertyValue(name)}`).join(";"); return { contextStyle, paddingSize, borderSize, boxSizing }; } function calcTextareaHeight(targetElement, minRows = 1, maxRows) { var _a2; if (!hiddenTextarea) { hiddenTextarea = document.createElement("textarea"); document.body.appendChild(hiddenTextarea); } const { paddingSize, borderSize, boxSizing, contextStyle } = calculateNodeStyling(targetElement); hiddenTextarea.setAttribute("style", `${contextStyle};${HIDDEN_STYLE}`); hiddenTextarea.value = targetElement.value || targetElement.placeholder || ""; let height = hiddenTextarea.scrollHeight; const result = {}; if (boxSizing === "border-box") { height = height + borderSize; } else if (boxSizing === "content-box") { height = height - paddingSize; } hiddenTextarea.value = ""; const singleRowHeight = hiddenTextarea.scrollHeight - paddingSize; if (isNumber(minRows)) { let minHeight = singleRowHeight * minRows; if (boxSizing === "border-box") { minHeight = minHeight + paddingSize + borderSize; } height = Math.max(minHeight, height); result.minHeight = `${minHeight}px`; } if (isNumber(maxRows)) { let maxHeight = singleRowHeight * maxRows; if (boxSizing === "border-box") { maxHeight = maxHeight + paddingSize + borderSize; } height = Math.min(maxHeight, height); } result.height = `${height}px`; (_a2 = hiddenTextarea.parentNode) == null ? void 0 : _a2.removeChild(hiddenTextarea); hiddenTextarea = void 0; return result; } const inputProps = buildProps({ id: { type: String, default: void 0 }, size: useSizeProp, disabled: Boolean, modelValue: { type: definePropType([ String, Number, Object ]), default: "" }, maxlength: { type: [String, Number] }, minlength: { type: [String, Number] }, type: { type: String, default: "text" }, resize: { type: String, values: ["none", "both", "horizontal", "vertical"] }, autosize: { type: definePropType([Boolean, Object]), default: false }, autocomplete: { type: String, default: "off" }, formatter: { type: Function }, parser: { type: Function }, placeholder: { type: String }, form: { type: String }, readonly: { type: Boolean, default: false }, clearable: { type: Boolean, default: false }, showPassword: { type: Boolean, default: false }, showWordLimit: { type: Boolean, default: false }, suffixIcon: { type: iconPropType }, prefixIcon: { type: iconPropType }, containerRole: { type: String, default: void 0 }, label: { type: String, default: void 0 }, tabindex: { type: [String, Number], default: 0 }, validateEvent: { type: Boolean, default: true }, inputStyle: { type: definePropType([Object, Array, String]), default: () => mutable({}) }, autofocus: { type: Boolean, default: false } }); const inputEmits = { [UPDATE_MODEL_EVENT]: (value) => isString(value), input: (value) => isString(value), change: (value) => isString(value), focus: (evt) => evt instanceof FocusEvent, blur: (evt) => evt instanceof FocusEvent, clear: () => true, mouseleave: (evt) => evt instanceof MouseEvent, mouseenter: (evt) => evt instanceof MouseEvent, keydown: (evt) => evt instanceof Event, compositionstart: (evt) => evt instanceof CompositionEvent, compositionupdate: (evt) => evt instanceof CompositionEvent, compositionend: (evt) => evt instanceof CompositionEvent }; const _hoisted_1$6 = ["role"]; const _hoisted_2$4 = ["id", "minlength", "maxlength", "type", "disabled", "readonly", "autocomplete", "tabindex", "aria-label", "placeholder", "form", "autofocus"]; const _hoisted_3$2 = ["id", "minlength", "maxlength", "tabindex", "disabled", "readonly", "autocomplete", "aria-label", "placeholder", "form", "autofocus"]; const __default__$a = vue.defineComponent({ name: "ElInput", inheritAttrs: false }); const _sfc_main$j = /* @__PURE__ */ vue.defineComponent({ ...__default__$a, props: inputProps, emits: inputEmits, setup(__props, { expose, emit }) { const props = __props; const rawAttrs = vue.useAttrs(); const slots = vue.useSlots(); const containerAttrs = vue.computed(() => { const comboBoxAttrs = {}; if (props.containerRole === "combobox") { comboBoxAttrs["aria-haspopup"] = rawAttrs["aria-haspopup"]; comboBoxAttrs["aria-owns"] = rawAttrs["aria-owns"]; comboBoxAttrs["aria-expanded"] = rawAttrs["aria-expanded"]; } return comboBoxAttrs; }); const containerKls = vue.computed(() => [ props.type === "textarea" ? nsTextarea.b() : nsInput.b(), nsInput.m(inputSize.value), nsInput.is("disabled", inputDisabled.value), nsInput.is("exceed", inputExceed.value), { [nsInput.b("group")]: slots.prepend || slots.append, [nsInput.bm("group", "append")]: slots.append, [nsInput.bm("group", "prepend")]: slots.prepend, [nsInput.m("prefix")]: slots.prefix || props.prefixIcon, [nsInput.m("suffix")]: slots.suffix || props.suffixIcon || props.clearable || props.showPassword, [nsInput.bm("suffix", "password-clear")]: showClear.value && showPwdVisible.value, [nsInput.b("hidden")]: props.type === "hidden" }, rawAttrs.class ]); const wrapperKls = vue.computed(() => [ nsInput.e("wrapper"), nsInput.is("focus", isFocused.value) ]); const attrs = useAttrs({ excludeKeys: vue.computed(() => { return Object.keys(containerAttrs.value); }) }); const { form: elForm, formItem: elFormItem } = useFormItem(); const { inputId } = useFormItemInputId(props, { formItemContext: elFormItem }); const inputSize = useFormSize(); const inputDisabled = useFormDisabled(); const nsInput = useNamespace("input"); const nsTextarea = useNamespace("textarea"); const input = vue.shallowRef(); const textarea = vue.shallowRef(); const hovering = vue.ref(false); const isComposing = vue.ref(false); const passwordVisible = vue.ref(false); const countStyle = vue.ref(); const textareaCalcStyle = vue.shallowRef(props.inputStyle); const _ref = vue.computed(() => input.value || textarea.value); const { wrapperRef, isFocused, handleFocus, handleBlur } = useFocusController(_ref, { afterBlur() { var _a2; if (props.validateEvent) { (_a2 = elFormItem == null ? void 0 : elFormItem.validate) == null ? void 0 : _a2.call(elFormItem, "blur").catch((err) => debugWarn()); } } }); const needStatusIcon = vue.computed(() => { var _a2; return (_a2 = elForm == null ? void 0 : elForm.statusIcon) != null ? _a2 : false; }); const validateState = vue.computed(() => (elFormItem == null ? void 0 : elFormItem.validateState) || ""); const validateIcon = vue.computed(() => validateState.value && ValidateComponentsMap[validateState.value]); const passwordIcon = vue.computed(() => passwordVisible.value ? view_default : hide_default); const containerStyle = vue.computed(() => [ rawAttrs.style ]); const textareaStyle = vue.computed(() => [ props.inputStyle, textareaCalcStyle.value, { resize: props.resize } ]); const nativeInputValue = vue.computed(() => isNil(props.modelValue) ? "" : String(props.modelValue)); const showClear = vue.computed(() => props.clearable && !inputDisabled.value && !props.readonly && !!nativeInputValue.value && (isFocused.value || hovering.value)); const showPwdVisible = vue.computed(() => props.showPassword && !inputDisabled.value && !props.readonly && !!nativeInputValue.value && (!!nativeInputValue.value || isFocused.value)); const isWordLimitVisible = vue.computed(() => props.showWordLimit && !!props.maxlength && (props.type === "text" || props.type === "textarea") && !inputDisabled.value && !props.readonly && !props.showPassword); const textLength = vue.computed(() => nativeInputValue.value.length); const inputExceed = vue.computed(() => !!isWordLimitVisible.value && textLength.value > Number(props.maxlength)); const suffixVisible = vue.computed(() => !!slots.suffix || !!props.suffixIcon || showClear.value || props.showPassword || isWordLimitVisible.value || !!validateState.value && needStatusIcon.value); const [recordCursor, setCursor] = useCursor(input); useResizeObserver(textarea, (entries) => { onceInitSizeTextarea(); if (!isWordLimitVisible.value || props.resize !== "both") return; const entry = entries[0]; const { width } = entry.contentRect; countStyle.value = { right: `calc(100% - ${width + 15 + 6}px)` }; }); const resizeTextarea = () => { const { type, autosize } = props; if (!isClient || type !== "textarea" || !textarea.value) return; if (autosize) { const minRows = isObject$1(autosize) ? autosize.minRows : void 0; const maxRows = isObject$1(autosize) ? autosize.maxRows : void 0; const textareaStyle2 = calcTextareaHeight(textarea.value, minRows, maxRows); textareaCalcStyle.value = { overflowY: "hidden", ...textareaStyle2 }; vue.nextTick(() => { textarea.value.offsetHeight; textareaCalcStyle.value = textareaStyle2; }); } else { textareaCalcStyle.value = { minHeight: calcTextareaHeight(textarea.value).minHeight }; } }; const createOnceInitResize = (resizeTextarea2) => { let isInit = false; return () => { var _a2; if (isInit || !props.autosize) return; const isElHidden = ((_a2 = textarea.value) == null ? void 0 : _a2.offsetParent) === null; if (!isElHidden) { resizeTextarea2(); isInit = true; } }; }; const onceInitSizeTextarea = createOnceInitResize(resizeTextarea); const setNativeInputValue = () => { const input2 = _ref.value; const formatterValue = props.formatter ? props.formatter(nativeInputValue.value) : nativeInputValue.value; if (!input2 || input2.value === formatterValue) return; input2.value = formatterValue; }; const handleInput = async (event) => { recordCursor(); let { value } = event.target; if (props.formatter) { value = props.parser ? props.parser(value) : value; } if (isComposing.value) return; if (value === nativeInputValue.value) { setNativeInputValue(); return; } emit(UPDATE_MODEL_EVENT, value); emit("input", value); await vue.nextTick(); setNativeInputValue(); setCursor(); }; const handleChange = (event) => { emit("change", event.target.value); }; const handleCompositionStart = (event) => { emit("compositionstart", event); isComposing.value = true; }; const handleCompositionUpdate = (event) => { var _a2; emit("compositionupdate", event); const text = (_a2 = event.target) == null ? void 0 : _a2.value; const lastCharacter = text[text.length - 1] || ""; isComposing.value = !isKorean(lastCharacter); }; const handleCompositionEnd = (event) => { emit("compositionend", event); if (isComposing.value) { isComposing.value = false; handleInput(event); } }; const handlePasswordVisible = () => { passwordVisible.value = !passwordVisible.value; focus(); }; const focus = async () => { var _a2; await vue.nextTick(); (_a2 = _ref.value) == null ? void 0 : _a2.focus(); }; const blur = () => { var _a2; return (_a2 = _ref.value) == null ? void 0 : _a2.blur(); }; const handleMouseLeave = (evt) => { hovering.value = false; emit("mouseleave", evt); }; const handleMouseEnter = (evt) => { hovering.value = true; emit("mouseenter", evt); }; const handleKeydown = (evt) => { emit("keydown", evt); }; const select = () => { var _a2; (_a2 = _ref.value) == null ? void 0 : _a2.select(); }; const clear = () => { emit(UPDATE_MODEL_EVENT, ""); emit("change", ""); emit("clear"); emit("input", ""); }; vue.watch(() => props.modelValue, () => { var _a2; vue.nextTick(() => resizeTextarea()); if (props.validateEvent) { (_a2 = elFormItem == null ? void 0 : elFormItem.validate) == null ? void 0 : _a2.call(elFormItem, "change").catch((err) => debugWarn()); } }); vue.watch(nativeInputValue, () => setNativeInputValue()); vue.watch(() => props.type, async () => { await vue.nextTick(); setNativeInputValue(); resizeTextarea(); }); vue.onMounted(() => { if (!props.formatter && props.parser) ; setNativeInputValue(); vue.nextTick(resizeTextarea); }); expose({ input, textarea, ref: _ref, textareaStyle, autosize: vue.toRef(props, "autosize"), focus, blur, select, clear, resizeTextarea }); return (_ctx, _cache) => { return vue.openBlock(), vue.createElementBlock("div", vue.mergeProps(vue.unref(containerAttrs), { class: vue.unref(containerKls), style: vue.unref(containerStyle), role: _ctx.containerRole, onMouseenter: handleMouseEnter, onMouseleave: handleMouseLeave }), [ vue.createCommentVNode(" input "), _ctx.type !== "textarea" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [ vue.createCommentVNode(" prepend slot "), _ctx.$slots.prepend ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(nsInput).be("group", "prepend")) }, [ vue.renderSlot(_ctx.$slots, "prepend") ], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { ref_key: "wrapperRef", ref: wrapperRef, class: vue.normalizeClass(vue.unref(wrapperKls)) }, [ vue.createCommentVNode(" prefix slot "), _ctx.$slots.prefix || _ctx.prefixIcon ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(nsInput).e("prefix")) }, [ vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(nsInput).e("prefix-inner")) }, [ vue.renderSlot(_ctx.$slots, "prefix"), _ctx.prefixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 0, class: vue.normalizeClass(vue.unref(nsInput).e("icon")) }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.prefixIcon))) ]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true) ], 2) ], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", vue.mergeProps({ id: vue.unref(inputId), ref_key: "input", ref: input, class: vue.unref(nsInput).e("inner") }, vue.unref(attrs), { minlength: _ctx.minlength, maxlength: _ctx.maxlength, type: _ctx.showPassword ? passwordVisible.value ? "text" : "password" : _ctx.type, disabled: vue.unref(inputDisabled), readonly: _ctx.readonly, autocomplete: _ctx.autocomplete, tabindex: _ctx.tabindex, "aria-label": _ctx.label, placeholder: _ctx.placeholder, style: _ctx.inputStyle, form: _ctx.form, autofocus: _ctx.autofocus, onCompositionstart: handleCompositionStart, onCompositionupdate: handleCompositionUpdate, onCompositionend: handleCompositionEnd, onInput: handleInput, onFocus: _cache[0] || (_cache[0] = (...args) => vue.unref(handleFocus) && vue.unref(handleFocus)(...args)), onBlur: _cache[1] || (_cache[1] = (...args) => vue.unref(handleBlur) && vue.unref(handleBlur)(...args)), onChange: handleChange, onKeydown: handleKeydown }), null, 16, _hoisted_2$4), vue.createCommentVNode(" suffix slot "), vue.unref(suffixVisible) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(nsInput).e("suffix")) }, [ vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(nsInput).e("suffix-inner")) }, [ !vue.unref(showClear) || !vue.unref(showPwdVisible) || !vue.unref(isWordLimitVisible) ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [ vue.renderSlot(_ctx.$slots, "suffix"), _ctx.suffixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 0, class: vue.normalizeClass(vue.unref(nsInput).e("icon")) }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.suffixIcon))) ]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true) ], 64)) : vue.createCommentVNode("v-if", true), vue.unref(showClear) ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 1, class: vue.normalizeClass([vue.unref(nsInput).e("icon"), vue.unref(nsInput).e("clear")]), onMousedown: vue.withModifiers(vue.unref(NOOP), ["prevent"]), onClick: clear }, { default: vue.withCtx(() => [ vue.createVNode(vue.unref(circle_close_default)) ]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.unref(showPwdVisible) ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 2, class: vue.normalizeClass([vue.unref(nsInput).e("icon"), vue.unref(nsInput).e("password")]), onClick: handlePasswordVisible }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(passwordIcon)))) ]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.unref(isWordLimitVisible) ? (vue.openBlock(), vue.createElementBlock("span", { key: 3, class: vue.normalizeClass(vue.unref(nsInput).e("count")) }, [ vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(nsInput).e("count-inner")) }, vue.toDisplayString(vue.unref(textLength)) + " / " + vue.toDisplayString(_ctx.maxlength), 3) ], 2)) : vue.createCommentVNode("v-if", true), vue.unref(validateState) && vue.unref(validateIcon) && vue.unref(needStatusIcon) ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 4, class: vue.normalizeClass([ vue.unref(nsInput).e("icon"), vue.unref(nsInput).e("validateIcon"), vue.unref(nsInput).is("loading", vue.unref(validateState) === "validating") ]) }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(validateIcon)))) ]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true) ], 2) ], 2)) : vue.createCommentVNode("v-if", true) ], 2), vue.createCommentVNode(" append slot "), _ctx.$slots.append ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass(vue.unref(nsInput).be("group", "append")) }, [ vue.renderSlot(_ctx.$slots, "append") ], 2)) : vue.createCommentVNode("v-if", true) ], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [ vue.createCommentVNode(" textarea "), vue.createElementVNode("textarea", vue.mergeProps({ id: vue.unref(inputId), ref_key: "textarea", ref: textarea, class: vue.unref(nsTextarea).e("inner") }, vue.unref(attrs), { minlength: _ctx.minlength, maxlength: _ctx.maxlength, tabindex: _ctx.tabindex, disabled: vue.unref(inputDisabled), readonly: _ctx.readonly, autocomplete: _ctx.autocomplete, style: vue.unref(textareaStyle), "aria-label": _ctx.label, placeholder: _ctx.placeholder, form: _ctx.form, autofocus: _ctx.autofocus, onCompositionstart: handleCompositionStart, onCompositionupdate: handleCompositionUpdate, onCompositionend: handleCompositionEnd, onInput: handleInput, onFocus: _cache[2] || (_cache[2] = (...args) => vue.unref(handleFocus) && vue.unref(handleFocus)(...args)), onBlur: _cache[3] || (_cache[3] = (...args) => vue.unref(handleBlur) && vue.unref(handleBlur)(...args)), onChange: handleChange, onKeydown: handleKeydown }), null, 16, _hoisted_3$2), vue.unref(isWordLimitVisible) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, style: vue.normalizeStyle(countStyle.value), class: vue.normalizeClass(vue.unref(nsInput).e("count")) }, vue.toDisplayString(vue.unref(textLength)) + " / " + vue.toDisplayString(_ctx.maxlength), 7)) : vue.createCommentVNode("v-if", true) ], 64)) ], 16, _hoisted_1$6); }; } }); var Input = /* @__PURE__ */ _export_sfc$1(_sfc_main$j, [["__file", "input.vue"]]); const ElInput = withInstall(Input); const GAP = 4; const BAR_MAP = { vertical: { offset: "offsetHeight", scroll: "scrollTop", scrollSize: "scrollHeight", size: "height", key: "vertical", axis: "Y", client: "clientY", direction: "top" }, horizontal: { offset: "offsetWidth", scroll: "scrollLeft", scrollSize: "scrollWidth", size: "width", key: "horizontal", axis: "X", client: "clientX", direction: "left" } }; const renderThumbStyle = ({ move, size, bar }) => ({ [bar.size]: size, transform: `translate${bar.axis}(${move}%)` }); const scrollbarContextKey = Symbol("scrollbarContextKey"); const thumbProps = buildProps({ vertical: Boolean, size: String, move: Number, ratio: { type: Number, required: true }, always: Boolean }); const COMPONENT_NAME$2 = "Thumb"; const _sfc_main$i = /* @__PURE__ */ vue.defineComponent({ __name: "thumb", props: thumbProps, setup(__props) { const props = __props; const scrollbar = vue.inject(scrollbarContextKey); const ns = useNamespace("scrollbar"); if (!scrollbar) throwError(COMPONENT_NAME$2, "can not inject scrollbar context"); const instance = vue.ref(); const thumb = vue.ref(); const thumbState = vue.ref({}); const visible = vue.ref(false); let cursorDown = false; let cursorLeave = false; let originalOnSelectStart = isClient ? document.onselectstart : null; const bar = vue.computed(() => BAR_MAP[props.vertical ? "vertical" : "horizontal"]); const thumbStyle = vue.computed(() => renderThumbStyle({ size: props.size, move: props.move, bar: bar.value })); const offsetRatio = vue.computed(() => instance.value[bar.value.offset] ** 2 / scrollbar.wrapElement[bar.value.scrollSize] / props.ratio / thumb.value[bar.value.offset]); const clickThumbHandler = (e) => { var _a2; e.stopPropagation(); if (e.ctrlKey || [1, 2].includes(e.button)) return; (_a2 = window.getSelection()) == null ? void 0 : _a2.removeAllRanges(); startDrag(e); const el = e.currentTarget; if (!el) return; thumbState.value[bar.value.axis] = el[bar.value.offset] - (e[bar.value.client] - el.getBoundingClientRect()[bar.value.direction]); }; const clickTrackHandler = (e) => { if (!thumb.value || !instance.value || !scrollbar.wrapElement) return; const offset = Math.abs(e.target.getBoundingClientRect()[bar.value.direction] - e[bar.value.client]); const thumbHalf = thumb.value[bar.value.offset] / 2; const thumbPositionPercentage = (offset - thumbHalf) * 100 * offsetRatio.value / instance.value[bar.value.offset]; scrollbar.wrapElement[bar.value.scroll] = thumbPositionPercentage * scrollbar.wrapElement[bar.value.scrollSize] / 100; }; const startDrag = (e) => { e.stopImmediatePropagation(); cursorDown = true; document.addEventListener("mousemove", mouseMoveDocumentHandler); document.addEventListener("mouseup", mouseUpDocumentHandler); originalOnSelectStart = document.onselectstart; document.onselectstart = () => false; }; const mouseMoveDocumentHandler = (e) => { if (!instance.value || !thumb.value) return; if (cursorDown === false) return; const prevPage = thumbState.value[bar.value.axis]; if (!prevPage) return; const offset = (instance.value.getBoundingClientRect()[bar.value.direction] - e[bar.value.client]) * -1; const thumbClickPosition = thumb.value[bar.value.offset] - prevPage; const thumbPositionPercentage = (offset - thumbClickPosition) * 100 * offsetRatio.value / instance.value[bar.value.offset]; scrollbar.wrapElement[bar.value.scroll] = thumbPositionPercentage * scrollbar.wrapElement[bar.value.scrollSize] / 100; }; const mouseUpDocumentHandler = () => { cursorDown = false; thumbState.value[bar.value.axis] = 0; document.removeEventListener("mousemove", mouseMoveDocumentHandler); document.removeEventListener("mouseup", mouseUpDocumentHandler); restoreOnselectstart(); if (cursorLeave) visible.value = false; }; const mouseMoveScrollbarHandler = () => { cursorLeave = false; visible.value = !!props.size; }; const mouseLeaveScrollbarHandler = () => { cursorLeave = true; visible.value = cursorDown; }; vue.onBeforeUnmount(() => { restoreOnselectstart(); document.removeEventListener("mouseup", mouseUpDocumentHandler); }); const restoreOnselectstart = () => { if (document.onselectstart !== originalOnSelectStart) document.onselectstart = originalOnSelectStart; }; useEventListener(vue.toRef(scrollbar, "scrollbarElement"), "mousemove", mouseMoveScrollbarHandler); useEventListener(vue.toRef(scrollbar, "scrollbarElement"), "mouseleave", mouseLeaveScrollbarHandler); return (_ctx, _cache) => { return vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(ns).b("fade"), persisted: "" }, { default: vue.withCtx(() => [ vue.withDirectives(vue.createElementVNode("div", { ref_key: "instance", ref: instance, class: vue.normalizeClass([vue.unref(ns).e("bar"), vue.unref(ns).is(vue.unref(bar).key)]), onMousedown: clickTrackHandler }, [ vue.createElementVNode("div", { ref_key: "thumb", ref: thumb, class: vue.normalizeClass(vue.unref(ns).e("thumb")), style: vue.normalizeStyle(vue.unref(thumbStyle)), onMousedown: clickThumbHandler }, null, 38) ], 34), [ [vue.vShow, _ctx.always || visible.value] ]) ]), _: 1 }, 8, ["name"]); }; } }); var Thumb = /* @__PURE__ */ _export_sfc$1(_sfc_main$i, [["__file", "thumb.vue"]]); const barProps = buildProps({ always: { type: Boolean, default: true }, minSize: { type: Number, required: true } }); const _sfc_main$h = /* @__PURE__ */ vue.defineComponent({ __name: "bar", props: barProps, setup(__props, { expose }) { const props = __props; const scrollbar = vue.inject(scrollbarContextKey); const moveX = vue.ref(0); const moveY = vue.ref(0); const sizeWidth = vue.ref(""); const sizeHeight = vue.ref(""); const ratioY = vue.ref(1); const ratioX = vue.ref(1); const handleScroll = (wrap) => { if (wrap) { const offsetHeight = wrap.offsetHeight - GAP; const offsetWidth = wrap.offsetWidth - GAP; moveY.value = wrap.scrollTop * 100 / offsetHeight * ratioY.value; moveX.value = wrap.scrollLeft * 100 / offsetWidth * ratioX.value; } }; const update = () => { const wrap = scrollbar == null ? void 0 : scrollbar.wrapElement; if (!wrap) return; const offsetHeight = wrap.offsetHeight - GAP; const offsetWidth = wrap.offsetWidth - GAP; const originalHeight = offsetHeight ** 2 / wrap.scrollHeight; const originalWidth = offsetWidth ** 2 / wrap.scrollWidth; const height = Math.max(originalHeight, props.minSize); const width = Math.max(originalWidth, props.minSize); ratioY.value = originalHeight / (offsetHeight - originalHeight) / (height / (offsetHeight - height)); ratioX.value = originalWidth / (offsetWidth - originalWidth) / (width / (offsetWidth - width)); sizeHeight.value = height + GAP < offsetHeight ? `${height}px` : ""; sizeWidth.value = width + GAP < offsetWidth ? `${width}px` : ""; }; expose({ handleScroll, update }); return (_ctx, _cache) => { return vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [ vue.createVNode(Thumb, { move: moveX.value, ratio: ratioX.value, size: sizeWidth.value, always: _ctx.always }, null, 8, ["move", "ratio", "size", "always"]), vue.createVNode(Thumb, { move: moveY.value, ratio: ratioY.value, size: sizeHeight.value, vertical: "", always: _ctx.always }, null, 8, ["move", "ratio", "size", "always"]) ], 64); }; } }); var Bar = /* @__PURE__ */ _export_sfc$1(_sfc_main$h, [["__file", "bar.vue"]]); const scrollbarProps = buildProps({ height: { type: [String, Number], default: "" }, maxHeight: { type: [String, Number], default: "" }, native: { type: Boolean, default: false }, wrapStyle: { type: definePropType([String, Object, Array]), default: "" }, wrapClass: { type: [String, Array], default: "" }, viewClass: { type: [String, Array], default: "" }, viewStyle: { type: [String, Array, Object], default: "" }, noresize: Boolean, tag: { type: String, default: "div" }, always: Boolean, minSize: { type: Number, default: 20 }, id: String, role: String, ariaLabel: String, ariaOrientation: { type: String, values: ["horizontal", "vertical"] } }); const scrollbarEmits = { scroll: ({ scrollTop, scrollLeft }) => [scrollTop, scrollLeft].every(isNumber) }; const COMPONENT_NAME$1 = "ElScrollbar"; const __default__$9 = vue.defineComponent({ name: COMPONENT_NAME$1 }); const _sfc_main$g = /* @__PURE__ */ vue.defineComponent({ ...__default__$9, props: scrollbarProps, emits: scrollbarEmits, setup(__props, { expose, emit }) { const props = __props; const ns = useNamespace("scrollbar"); let stopResizeObserver = void 0; let stopResizeListener = void 0; const scrollbarRef = vue.ref(); const wrapRef = vue.ref(); const resizeRef = vue.ref(); const barRef = vue.ref(); const wrapStyle = vue.computed(() => { const style2 = {}; if (props.height) style2.height = addUnit(props.height); if (props.maxHeight) style2.maxHeight = addUnit(props.maxHeight); return [props.wrapStyle, style2]; }); const wrapKls = vue.computed(() => { return [ props.wrapClass, ns.e("wrap"), { [ns.em("wrap", "hidden-default")]: !props.native } ]; }); const resizeKls = vue.computed(() => { return [ns.e("view"), props.viewClass]; }); const handleScroll = () => { var _a2; if (wrapRef.value) { (_a2 = barRef.value) == null ? void 0 : _a2.handleScroll(wrapRef.value); emit("scroll", { scrollTop: wrapRef.value.scrollTop, scrollLeft: wrapRef.value.scrollLeft }); } }; function scrollTo(arg1, arg2) { if (isObject$1(arg1)) { wrapRef.value.scrollTo(arg1); } else if (isNumber(arg1) && isNumber(arg2)) { wrapRef.value.scrollTo(arg1, arg2); } } const setScrollTop = (value) => { if (!isNumber(value)) { return; } wrapRef.value.scrollTop = value; }; const setScrollLeft = (value) => { if (!isNumber(value)) { return; } wrapRef.value.scrollLeft = value; }; const update = () => { var _a2; (_a2 = barRef.value) == null ? void 0 : _a2.update(); }; vue.watch(() => props.noresize, (noresize) => { if (noresize) { stopResizeObserver == null ? void 0 : stopResizeObserver(); stopResizeListener == null ? void 0 : stopResizeListener(); } else { ({ stop: stopResizeObserver } = useResizeObserver(resizeRef, update)); stopResizeListener = useEventListener("resize", update); } }, { immediate: true }); vue.watch(() => [props.maxHeight, props.height], () => { if (!props.native) vue.nextTick(() => { var _a2; update(); if (wrapRef.value) { (_a2 = barRef.value) == null ? void 0 : _a2.handleScroll(wrapRef.value); } }); }); vue.provide(scrollbarContextKey, vue.reactive({ scrollbarElement: scrollbarRef, wrapElement: wrapRef })); vue.onMounted(() => { if (!props.native) vue.nextTick(() => { update(); }); }); vue.onUpdated(() => update()); expose({ wrapRef, update, scrollTo, setScrollTop, setScrollLeft, handleScroll }); return (_ctx, _cache) => { return vue.openBlock(), vue.createElementBlock("div", { ref_key: "scrollbarRef", ref: scrollbarRef, class: vue.normalizeClass(vue.unref(ns).b()) }, [ vue.createElementVNode("div", { ref_key: "wrapRef", ref: wrapRef, class: vue.normalizeClass(vue.unref(wrapKls)), style: vue.normalizeStyle(vue.unref(wrapStyle)), onScroll: handleScroll }, [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.tag), { id: _ctx.id, ref_key: "resizeRef", ref: resizeRef, class: vue.normalizeClass(vue.unref(resizeKls)), style: vue.normalizeStyle(_ctx.viewStyle), role: _ctx.role, "aria-label": _ctx.ariaLabel, "aria-orientation": _ctx.ariaOrientation }, { default: vue.withCtx(() => [ vue.renderSlot(_ctx.$slots, "default") ]), _: 3 }, 8, ["id", "class", "style", "role", "aria-label", "aria-orientation"])) ], 38), !_ctx.native ? (vue.openBlock(), vue.createBlock(Bar, { key: 0, ref_key: "barRef", ref: barRef, always: _ctx.always, "min-size": _ctx.minSize }, null, 8, ["always", "min-size"])) : vue.createCommentVNode("v-if", true) ], 2); }; } }); var Scrollbar = /* @__PURE__ */ _export_sfc$1(_sfc_main$g, [["__file", "scrollbar.vue"]]); const ElScrollbar = withInstall(Scrollbar); const POPPER_INJECTION_KEY = Symbol("popper"); const POPPER_CONTENT_INJECTION_KEY = Symbol("popperContent"); const roleTypes = [ "dialog", "grid", "group", "listbox", "menu", "navigation", "tooltip", "tree" ]; const popperProps = buildProps({ role: { type: String, values: roleTypes, default: "tooltip" } }); const __default__$8 = vue.defineComponent({ name: "ElPopper", inheritAttrs: false }); const _sfc_main$f = /* @__PURE__ */ vue.defineComponent({ ...__default__$8, props: popperProps, setup(__props, { expose }) { const props = __props; const triggerRef = vue.ref(); const popperInstanceRef = vue.ref(); const contentRef = vue.ref(); const referenceRef = vue.ref(); const role = vue.computed(() => props.role); const popperProvides = { triggerRef, popperInstanceRef, contentRef, referenceRef, role }; expose(popperProvides); vue.provide(POPPER_INJECTION_KEY, popperProvides); return (_ctx, _cache) => { return vue.renderSlot(_ctx.$slots, "default"); }; } }); var Popper = /* @__PURE__ */ _export_sfc$1(_sfc_main$f, [["__file", "popper.vue"]]); const popperArrowProps = buildProps({ arrowOffset: { type: Number, default: 5 } }); const __default__$7 = vue.defineComponent({ name: "ElPopperArrow", inheritAttrs: false }); const _sfc_main$e = /* @__PURE__ */ vue.defineComponent({ ...__default__$7, props: popperArrowProps, setup(__props, { expose }) { const props = __props; const ns = useNamespace("popper"); const { arrowOffset, arrowRef, arrowStyle } = vue.inject(POPPER_CONTENT_INJECTION_KEY, void 0); vue.watch(() => props.arrowOffset, (val) => { arrowOffset.value = val; }); vue.onBeforeUnmount(() => { arrowRef.value = void 0; }); expose({ arrowRef }); return (_ctx, _cache) => { return vue.openBlock(), vue.createElementBlock("span", { ref_key: "arrowRef", ref: arrowRef, class: vue.normalizeClass(vue.unref(ns).e("arrow")), style: vue.normalizeStyle(vue.unref(arrowStyle)), "data-popper-arrow": "" }, null, 6); }; } }); var ElPopperArrow = /* @__PURE__ */ _export_sfc$1(_sfc_main$e, [["__file", "arrow.vue"]]); const NAME = "ElOnlyChild"; const OnlyChild = vue.defineComponent({ name: NAME, setup(_, { slots, attrs }) { var _a2; const forwardRefInjection = vue.inject(FORWARD_REF_INJECTION_KEY); const forwardRefDirective = useForwardRefDirective((_a2 = forwardRefInjection == null ? void 0 : forwardRefInjection.setForwardRef) != null ? _a2 : NOOP); return () => { var _a22; const defaultSlot = (_a22 = slots.default) == null ? void 0 : _a22.call(slots, attrs); if (!defaultSlot) return null; if (defaultSlot.length > 1) { return null; } const firstLegitNode = findFirstLegitChild(defaultSlot); if (!firstLegitNode) { return null; } return vue.withDirectives(vue.cloneVNode(firstLegitNode, attrs), [[forwardRefDirective]]); }; } }); function findFirstLegitChild(node) { if (!node) return null; const children = node; for (const child of children) { if (isObject$1(child)) { switch (child.type) { case vue.Comment: continue; case vue.Text: case "svg": return wrapTextContent(child); case vue.Fragment: return findFirstLegitChild(child.children); default: return child; } } return wrapTextContent(child); } return null; } function wrapTextContent(s) { const ns = useNamespace("only-child"); return vue.createVNode("span", { "class": ns.e("content") }, [s]); } const popperTriggerProps = buildProps({ virtualRef: { type: definePropType(Object) }, virtualTriggering: Boolean, onMouseenter: { type: definePropType(Function) }, onMouseleave: { type: definePropType(Function) }, onClick: { type: definePropType(Function) }, onKeydown: { type: definePropType(Function) }, onFocus: { type: definePropType(Function) }, onBlur: { type: definePropType(Function) }, onContextmenu: { type: definePropType(Function) }, id: String, open: Boolean }); const __default__$6 = vue.defineComponent({ name: "ElPopperTrigger", inheritAttrs: false }); const _sfc_main$d = /* @__PURE__ */ vue.defineComponent({ ...__default__$6, props: popperTriggerProps, setup(__props, { expose }) { const props = __props; const { role, triggerRef } = vue.inject(POPPER_INJECTION_KEY, void 0); useForwardRef(triggerRef); const ariaControls = vue.computed(() => { return ariaHaspopup.value ? props.id : void 0; }); const ariaDescribedby = vue.computed(() => { if (role && role.value === "tooltip") { return props.open && props.id ? props.id : void 0; } return void 0; }); const ariaHaspopup = vue.computed(() => { if (role && role.value !== "tooltip") { return role.value; } return void 0; }); const ariaExpanded = vue.computed(() => { return ariaHaspopup.value ? `${props.open}` : void 0; }); let virtualTriggerAriaStopWatch = void 0; vue.onMounted(() => { vue.watch(() => props.virtualRef, (virtualEl) => { if (virtualEl) { triggerRef.value = unrefElement(virtualEl); } }, { immediate: true }); vue.watch(triggerRef, (el, prevEl) => { virtualTriggerAriaStopWatch == null ? void 0 : virtualTriggerAriaStopWatch(); virtualTriggerAriaStopWatch = void 0; if (isElement(el)) { [ "onMouseenter", "onMouseleave", "onClick", "onKeydown", "onFocus", "onBlur", "onContextmenu" ].forEach((eventName) => { var _a2; const handler = props[eventName]; if (handler) { el.addEventListener(eventName.slice(2).toLowerCase(), handler); (_a2 = prevEl == null ? void 0 : prevEl.removeEventListener) == null ? void 0 : _a2.call(prevEl, eventName.slice(2).toLowerCase(), handler); } }); virtualTriggerAriaStopWatch = vue.watch([ariaControls, ariaDescribedby, ariaHaspopup, ariaExpanded], (watches) => { [ "aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded" ].forEach((key, idx) => { isNil(watches[idx]) ? el.removeAttribute(key) : el.setAttribute(key, watches[idx]); }); }, { immediate: true }); } if (isElement(prevEl)) { [ "aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded" ].forEach((key) => prevEl.removeAttribute(key)); } }, { immediate: true }); }); vue.onBeforeUnmount(() => { virtualTriggerAriaStopWatch == null ? void 0 : virtualTriggerAriaStopWatch(); virtualTriggerAriaStopWatch = void 0; }); expose({ triggerRef }); return (_ctx, _cache) => { return !_ctx.virtualTriggering ? (vue.openBlock(), vue.createBlock(vue.unref(OnlyChild), vue.mergeProps({ key: 0 }, _ctx.$attrs, { "aria-controls": vue.unref(ariaControls), "aria-describedby": vue.unref(ariaDescribedby), "aria-expanded": vue.unref(ariaExpanded), "aria-haspopup": vue.unref(ariaHaspopup) }), { default: vue.withCtx(() => [ vue.renderSlot(_ctx.$slots, "default") ]), _: 3 }, 16, ["aria-controls", "aria-describedby", "aria-expanded", "aria-haspopup"])) : vue.createCommentVNode("v-if", true); }; } }); var ElPopperTrigger = /* @__PURE__ */ _export_sfc$1(_sfc_main$d, [["__file", "trigger.vue"]]); const FOCUS_AFTER_TRAPPED = "focus-trap.focus-after-trapped"; const FOCUS_AFTER_RELEASED = "focus-trap.focus-after-released"; const FOCUSOUT_PREVENTED = "focus-trap.focusout-prevented"; const FOCUS_AFTER_TRAPPED_OPTS = { cancelable: true, bubbles: false }; const FOCUSOUT_PREVENTED_OPTS = { cancelable: true, bubbles: false }; const ON_TRAP_FOCUS_EVT = "focusAfterTrapped"; const ON_RELEASE_FOCUS_EVT = "focusAfterReleased"; const FOCUS_TRAP_INJECTION_KEY = Symbol("elFocusTrap"); const focusReason = vue.ref(); const lastUserFocusTimestamp = vue.ref(0); const lastAutomatedFocusTimestamp = vue.ref(0); let focusReasonUserCount = 0; const obtainAllFocusableElements = (element) => { const nodes = []; const walker = document.createTreeWalker(element, NodeFilter.SHOW_ELEMENT, { acceptNode: (node) => { const isHiddenInput = node.tagName === "INPUT" && node.type === "hidden"; if (node.disabled || node.hidden || isHiddenInput) return NodeFilter.FILTER_SKIP; return node.tabIndex >= 0 || node === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP; } }); while (walker.nextNode()) nodes.push(walker.currentNode); return nodes; }; const getVisibleElement = (elements, container) => { for (const element of elements) { if (!isHidden(element, container)) return element; } }; const isHidden = (element, container) => { if (getComputedStyle(element).visibility === "hidden") return true; while (element) { if (container && element === container) return false; if (getComputedStyle(element).display === "none") return true; element = element.parentElement; } return false; }; const getEdges = (container) => { const focusable = obtainAllFocusableElements(container); const first = getVisibleElement(focusable, container); const last = getVisibleElement(focusable.reverse(), container); return [first, last]; }; const isSelectable = (element) => { return element instanceof HTMLInputElement && "select" in element; }; const tryFocus = (element, shouldSelect) => { if (element && element.focus) { const prevFocusedElement = document.activeElement; element.focus({ preventScroll: true }); lastAutomatedFocusTimestamp.value = window.performance.now(); if (element !== prevFocusedElement && isSelectable(element) && shouldSelect) { element.select(); } } }; function removeFromStack(list, item) { const copy = [...list]; const idx = list.indexOf(item); if (idx !== -1) { copy.splice(idx, 1); } return copy; } const createFocusableStack = () => { let stack = []; const push = (layer) => { const currentLayer = stack[0]; if (currentLayer && layer !== currentLayer) { currentLayer.pause(); } stack = removeFromStack(stack, layer); stack.unshift(layer); }; const remove = (layer) => { var _a2, _b; stack = removeFromStack(stack, layer); (_b = (_a2 = stack[0]) == null ? void 0 : _a2.resume) == null ? void 0 : _b.call(_a2); }; return { push, remove }; }; const focusFirstDescendant = (elements, shouldSelect = false) => { const prevFocusedElement = document.activeElement; for (const element of elements) { tryFocus(element, shouldSelect); if (document.activeElement !== prevFocusedElement) return; } }; const focusableStack = createFocusableStack(); const isFocusCausedByUserEvent = () => { return lastUserFocusTimestamp.value > lastAutomatedFocusTimestamp.value; }; const notifyFocusReasonPointer = () => { focusReason.value = "pointer"; lastUserFocusTimestamp.value = window.performance.now(); }; const notifyFocusReasonKeydown = () => { focusReason.value = "keyboard"; lastUserFocusTimestamp.value = window.performance.now(); }; const useFocusReason = () => { vue.onMounted(() => { if (focusReasonUserCount === 0) { document.addEventListener("mousedown", notifyFocusReasonPointer); document.addEventListener("touchstart", notifyFocusReasonPointer); document.addEventListener("keydown", notifyFocusReasonKeydown); } focusReasonUserCount++; }); vue.onBeforeUnmount(() => { focusReasonUserCount--; if (focusReasonUserCount <= 0) { document.removeEventListener("mousedown", notifyFocusReasonPointer); document.removeEventListener("touchstart", notifyFocusReasonPointer); document.removeEventListener("keydown", notifyFocusReasonKeydown); } }); return { focusReason, lastUserFocusTimestamp, lastAutomatedFocusTimestamp }; }; const createFocusOutPreventedEvent = (detail) => { return new CustomEvent(FOCUSOUT_PREVENTED, { ...FOCUSOUT_PREVENTED_OPTS, detail }); }; const _sfc_main$c = vue.defineComponent({ name: "ElFocusTrap", inheritAttrs: false, props: { loop: Boolean, trapped: Boolean, focusTrapEl: Object, focusStartEl: { type: [Object, String], default: "first" } }, emits: [ ON_TRAP_FOCUS_EVT, ON_RELEASE_FOCUS_EVT, "focusin", "focusout", "focusout-prevented", "release-requested" ], setup(props, { emit }) { const forwardRef = vue.ref(); let lastFocusBeforeTrapped; let lastFocusAfterTrapped; const { focusReason: focusReason2 } = useFocusReason(); useEscapeKeydown((event) => { if (props.trapped && !focusLayer.paused) { emit("release-requested", event); } }); const focusLayer = { paused: false, pause() { this.paused = true; }, resume() { this.paused = false; } }; const onKeydown = (e) => { if (!props.loop && !props.trapped) return; if (focusLayer.paused) return; const { key, altKey, ctrlKey, metaKey, currentTarget, shiftKey } = e; const { loop } = props; const isTabbing = key === EVENT_CODE.tab && !altKey && !ctrlKey && !metaKey; const currentFocusingEl = document.activeElement; if (isTabbing && currentFocusingEl) { const container = currentTarget; const [first, last] = getEdges(container); const isTabbable = first && last; if (!isTabbable) { if (currentFocusingEl === container) { const focusoutPreventedEvent = createFocusOutPreventedEvent({ focusReason: focusReason2.value }); emit("focusout-prevented", focusoutPreventedEvent); if (!focusoutPreventedEvent.defaultPrevented) { e.preventDefault(); } } } else { if (!shiftKey && currentFocusingEl === last) { const focusoutPreventedEvent = createFocusOutPreventedEvent({ focusReason: focusReason2.value }); emit("focusout-prevented", focusoutPreventedEvent); if (!focusoutPreventedEvent.defaultPrevented) { e.preventDefault(); if (loop) tryFocus(first, true); } } else if (shiftKey && [first, container].includes(currentFocusingEl)) { const focusoutPreventedEvent = createFocusOutPreventedEvent({ focusReason: focusReason2.value }); emit("focusout-prevented", focusoutPreventedEvent); if (!focusoutPreventedEvent.defaultPrevented) { e.preventDefault(); if (loop) tryFocus(last, true); } } } } }; vue.provide(FOCUS_TRAP_INJECTION_KEY, { focusTrapRef: forwardRef, onKeydown }); vue.watch(() => props.focusTrapEl, (focusTrapEl) => { if (focusTrapEl) { forwardRef.value = focusTrapEl; } }, { immediate: true }); vue.watch([forwardRef], ([forwardRef2], [oldForwardRef]) => { if (forwardRef2) { forwardRef2.addEventListener("keydown", onKeydown); forwardRef2.addEventListener("focusin", onFocusIn); forwardRef2.addEventListener("focusout", onFocusOut); } if (oldForwardRef) { oldForwardRef.removeEventListener("keydown", onKeydown); oldForwardRef.removeEventListener("focusin", onFocusIn); oldForwardRef.removeEventListener("focusout", onFocusOut); } }); const trapOnFocus = (e) => { emit(ON_TRAP_FOCUS_EVT, e); }; const releaseOnFocus = (e) => emit(ON_RELEASE_FOCUS_EVT, e); const onFocusIn = (e) => { const trapContainer = vue.unref(forwardRef); if (!trapContainer) return; const target = e.target; const relatedTarget = e.relatedTarget; const isFocusedInTrap = target && trapContainer.contains(target); if (!props.trapped) { const isPrevFocusedInTrap = relatedTarget && trapContainer.contains(relatedTarget); if (!isPrevFocusedInTrap) { lastFocusBeforeTrapped = relatedTarget; } } if (isFocusedInTrap) emit("focusin", e); if (focusLayer.paused) return; if (props.trapped) { if (isFocusedInTrap) { lastFocusAfterTrapped = target; } else { tryFocus(lastFocusAfterTrapped, true); } } }; const onFocusOut = (e) => { const trapContainer = vue.unref(forwardRef); if (focusLayer.paused || !trapContainer) return; if (props.trapped) { const relatedTarget = e.relatedTarget; if (!isNil(relatedTarget) && !trapContainer.contains(relatedTarget)) { setTimeout(() => { if (!focusLayer.paused && props.trapped) { const focusoutPreventedEvent = createFocusOutPreventedEvent({ focusReason: focusReason2.value }); emit("focusout-prevented", focusoutPreventedEvent); if (!focusoutPreventedEvent.defaultPrevented) { tryFocus(lastFocusAfterTrapped, true); } } }, 0); } } else { const target = e.target; const isFocusedInTrap = target && trapContainer.contains(target); if (!isFocusedInTrap) emit("focusout", e); } }; async function startTrap() { await vue.nextTick(); const trapContainer = vue.unref(forwardRef); if (trapContainer) { focusableStack.push(focusLayer); const prevFocusedElement = trapContainer.contains(document.activeElement) ? lastFocusBeforeTrapped : document.activeElement; lastFocusBeforeTrapped = prevFocusedElement; const isPrevFocusContained = trapContainer.contains(prevFocusedElement); if (!isPrevFocusContained) { const focusEvent = new Event(FOCUS_AFTER_TRAPPED, FOCUS_AFTER_TRAPPED_OPTS); trapContainer.addEventListener(FOCUS_AFTER_TRAPPED, trapOnFocus); trapContainer.dispatchEvent(focusEvent); if (!focusEvent.defaultPrevented) { vue.nextTick(() => { let focusStartEl = props.focusStartEl; if (!isString(focusStartEl)) { tryFocus(focusStartEl); if (document.activeElement !== focusStartEl) { focusStartEl = "first"; } } if (focusStartEl === "first") { focusFirstDescendant(obtainAllFocusableElements(trapContainer), true); } if (document.activeElement === prevFocusedElement || focusStartEl === "container") { tryFocus(trapContainer); } }); } } } } function stopTrap() { const trapContainer = vue.unref(forwardRef); if (trapContainer) { trapContainer.removeEventListener(FOCUS_AFTER_TRAPPED, trapOnFocus); const releasedEvent = new CustomEvent(FOCUS_AFTER_RELEASED, { ...FOCUS_AFTER_TRAPPED_OPTS, detail: { focusReason: focusReason2.value } }); trapContainer.addEventListener(FOCUS_AFTER_RELEASED, releaseOnFocus); trapContainer.dispatchEvent(releasedEvent); if (!releasedEvent.defaultPrevented && (focusReason2.value == "keyboard" || !isFocusCausedByUserEvent() || trapContainer.contains(document.activeElement))) { tryFocus(lastFocusBeforeTrapped != null ? lastFocusBeforeTrapped : document.body); } trapContainer.removeEventListener(FOCUS_AFTER_RELEASED, releaseOnFocus); focusableStack.remove(focusLayer); } } vue.onMounted(() => { if (props.trapped) { startTrap(); } vue.watch(() => props.trapped, (trapped) => { if (trapped) { startTrap(); } else { stopTrap(); } }); }); vue.onBeforeUnmount(() => { if (props.trapped) { stopTrap(); } }); return { onKeydown }; } }); function _sfc_render$4(_ctx, _cache, $props, $setup, $data, $options) { return vue.renderSlot(_ctx.$slots, "default", { handleKeydown: _ctx.onKeydown }); } var ElFocusTrap = /* @__PURE__ */ _export_sfc$1(_sfc_main$c, [["render", _sfc_render$4], ["__file", "focus-trap.vue"]]); const POSITIONING_STRATEGIES = ["fixed", "absolute"]; const popperCoreConfigProps = buildProps({ boundariesPadding: { type: Number, default: 0 }, fallbackPlacements: { type: definePropType(Array), default: void 0 }, gpuAcceleration: { type: Boolean, default: true }, offset: { type: Number, default: 12 }, placement: { type: String, values: Ee, default: "bottom" }, popperOptions: { type: definePropType(Object), default: () => ({}) }, strategy: { type: String, values: POSITIONING_STRATEGIES, default: "absolute" } }); const popperContentProps = buildProps({ ...popperCoreConfigProps, id: String, style: { type: definePropType([String, Array, Object]) }, className: { type: definePropType([String, Array, Object]) }, effect: { type: String, default: "dark" }, visible: Boolean, enterable: { type: Boolean, default: true }, pure: Boolean, focusOnShow: { type: Boolean, default: false }, trapping: { type: Boolean, default: false }, popperClass: { type: definePropType([String, Array, Object]) }, popperStyle: { type: definePropType([String, Array, Object]) }, referenceEl: { type: definePropType(Object) }, triggerTargetEl: { type: definePropType(Object) }, stopPopperMouseEvent: { type: Boolean, default: true }, ariaLabel: { type: String, default: void 0 }, virtualTriggering: Boolean, zIndex: Number }); const popperContentEmits = { mouseenter: (evt) => evt instanceof MouseEvent, mouseleave: (evt) => evt instanceof MouseEvent, focus: () => true, blur: () => true, close: () => true }; const buildPopperOptions = (props, modifiers = []) => { const { placement, strategy, popperOptions } = props; const options = { placement, strategy, ...popperOptions, modifiers: [...genModifiers(props), ...modifiers] }; deriveExtraModifiers(options, popperOptions == null ? void 0 : popperOptions.modifiers); return options; }; const unwrapMeasurableEl = ($el) => { if (!isClient) return; return unrefElement($el); }; function genModifiers(options) { const { offset, gpuAcceleration, fallbackPlacements } = options; return [ { name: "offset", options: { offset: [0, offset != null ? offset : 12] } }, { name: "preventOverflow", options: { padding: { top: 2, bottom: 2, left: 5, right: 5 } } }, { name: "flip", options: { padding: 5, fallbackPlacements } }, { name: "computeStyles", options: { gpuAcceleration } } ]; } function deriveExtraModifiers(options, modifiers) { if (modifiers) { options.modifiers = [...options.modifiers, ...modifiers != null ? modifiers : []]; } } const DEFAULT_ARROW_OFFSET = 0; const usePopperContent = (props) => { const { popperInstanceRef, contentRef, triggerRef, role } = vue.inject(POPPER_INJECTION_KEY, void 0); const arrowRef = vue.ref(); const arrowOffset = vue.ref(); const eventListenerModifier = vue.computed(() => { return { name: "eventListeners", enabled: !!props.visible }; }); const arrowModifier = vue.computed(() => { var _a2; const arrowEl = vue.unref(arrowRef); const offset = (_a2 = vue.unref(arrowOffset)) != null ? _a2 : DEFAULT_ARROW_OFFSET; return { name: "arrow", enabled: !isUndefined$1(arrowEl), options: { element: arrowEl, padding: offset } }; }); const options = vue.computed(() => { return { onFirstUpdate: () => { update(); }, ...buildPopperOptions(props, [ vue.unref(arrowModifier), vue.unref(eventListenerModifier) ]) }; }); const computedReference = vue.computed(() => unwrapMeasurableEl(props.referenceEl) || vue.unref(triggerRef)); const { attributes, state, styles, update, forceUpdate, instanceRef } = usePopper(computedReference, contentRef, options); vue.watch(instanceRef, (instance) => popperInstanceRef.value = instance); vue.onMounted(() => { vue.watch(() => { var _a2; return (_a2 = vue.unref(computedReference)) == null ? void 0 : _a2.getBoundingClientRect(); }, () => { update(); }); }); return { attributes, arrowRef, contentRef, instanceRef, state, styles, role, forceUpdate, update }; }; const usePopperContentDOM = (props, { attributes, styles, role }) => { const { nextZIndex } = useZIndex(); const ns = useNamespace("popper"); const contentAttrs = vue.computed(() => vue.unref(attributes).popper); const contentZIndex = vue.ref(isNumber(props.zIndex) ? props.zIndex : nextZIndex()); const contentClass = vue.computed(() => [ ns.b(), ns.is("pure", props.pure), ns.is(props.effect), props.popperClass ]); const contentStyle = vue.computed(() => { return [ { zIndex: vue.unref(contentZIndex) }, vue.unref(styles).popper, props.popperStyle || {} ]; }); const ariaModal = vue.computed(() => role.value === "dialog" ? "false" : void 0); const arrowStyle = vue.computed(() => vue.unref(styles).arrow || {}); const updateZIndex = () => { contentZIndex.value = isNumber(props.zIndex) ? props.zIndex : nextZIndex(); }; return { ariaModal, arrowStyle, contentAttrs, contentClass, contentStyle, contentZIndex, updateZIndex }; }; const usePopperContentFocusTrap = (props, emit) => { const trapped = vue.ref(false); const focusStartRef = vue.ref(); const onFocusAfterTrapped = () => { emit("focus"); }; const onFocusAfterReleased = (event) => { var _a2; if (((_a2 = event.detail) == null ? void 0 : _a2.focusReason) !== "pointer") { focusStartRef.value = "first"; emit("blur"); } }; const onFocusInTrap = (event) => { if (props.visible && !trapped.value) { if (event.target) { focusStartRef.value = event.target; } trapped.value = true; } }; const onFocusoutPrevented = (event) => { if (!props.trapping) { if (event.detail.focusReason === "pointer") { event.preventDefault(); } trapped.value = false; } }; const onReleaseRequested = () => { trapped.value = false; emit("close"); }; return { focusStartRef, trapped, onFocusAfterReleased, onFocusAfterTrapped, onFocusInTrap, onFocusoutPrevented, onReleaseRequested }; }; const __default__$5 = vue.defineComponent({ name: "ElPopperContent" }); const _sfc_main$b = /* @__PURE__ */ vue.defineComponent({ ...__default__$5, props: popperContentProps, emits: popperContentEmits, setup(__props, { expose, emit }) { const props = __props; const { focusStartRef, trapped, onFocusAfterReleased, onFocusAfterTrapped, onFocusInTrap, onFocusoutPrevented, onReleaseRequested } = usePopperContentFocusTrap(props, emit); const { attributes, arrowRef, contentRef, styles, instanceRef, role, update } = usePopperContent(props); const { ariaModal, arrowStyle, contentAttrs, contentClass, contentStyle, updateZIndex } = usePopperContentDOM(props, { styles, attributes, role }); const formItemContext = vue.inject(formItemContextKey, void 0); const arrowOffset = vue.ref(); vue.provide(POPPER_CONTENT_INJECTION_KEY, { arrowStyle, arrowRef, arrowOffset }); if (formItemContext && (formItemContext.addInputId || formItemContext.removeInputId)) { vue.provide(formItemContextKey, { ...formItemContext, addInputId: NOOP, removeInputId: NOOP }); } let triggerTargetAriaStopWatch = void 0; const updatePopper = (shouldUpdateZIndex = true) => { update(); shouldUpdateZIndex && updateZIndex(); }; const togglePopperAlive = () => { updatePopper(false); if (props.visible && props.focusOnShow) { trapped.value = true; } else if (props.visible === false) { trapped.value = false; } }; vue.onMounted(() => { vue.watch(() => props.triggerTargetEl, (triggerTargetEl, prevTriggerTargetEl) => { triggerTargetAriaStopWatch == null ? void 0 : triggerTargetAriaStopWatch(); triggerTargetAriaStopWatch = void 0; const el = vue.unref(triggerTargetEl || contentRef.value); const prevEl = vue.unref(prevTriggerTargetEl || contentRef.value); if (isElement(el)) { triggerTargetAriaStopWatch = vue.watch([role, () => props.ariaLabel, ariaModal, () => props.id], (watches) => { ["role", "aria-label", "aria-modal", "id"].forEach((key, idx) => { isNil(watches[idx]) ? el.removeAttribute(key) : el.setAttribute(key, watches[idx]); }); }, { immediate: true }); } if (prevEl !== el && isElement(prevEl)) { ["role", "aria-label", "aria-modal", "id"].forEach((key) => { prevEl.removeAttribute(key); }); } }, { immediate: true }); vue.watch(() => props.visible, togglePopperAlive, { immediate: true }); }); vue.onBeforeUnmount(() => { triggerTargetAriaStopWatch == null ? void 0 : triggerTargetAriaStopWatch(); triggerTargetAriaStopWatch = void 0; }); expose({ popperContentRef: contentRef, popperInstanceRef: instanceRef, updatePopper, contentStyle }); return (_ctx, _cache) => { return vue.openBlock(), vue.createElementBlock("div", vue.mergeProps({ ref_key: "contentRef", ref: contentRef }, vue.unref(contentAttrs), { style: vue.unref(contentStyle), class: vue.unref(contentClass), tabindex: "-1", onMouseenter: _cache[0] || (_cache[0] = (e) => _ctx.$emit("mouseenter", e)), onMouseleave: _cache[1] || (_cache[1] = (e) => _ctx.$emit("mouseleave", e)) }), [ vue.createVNode(vue.unref(ElFocusTrap), { trapped: vue.unref(trapped), "trap-on-focus-in": true, "focus-trap-el": vue.unref(contentRef), "focus-start-el": vue.unref(focusStartRef), onFocusAfterTrapped: vue.unref(onFocusAfterTrapped), onFocusAfterReleased: vue.unref(onFocusAfterReleased), onFocusin: vue.unref(onFocusInTrap), onFocusoutPrevented: vue.unref(onFocusoutPrevented), onReleaseRequested: vue.unref(onReleaseRequested) }, { default: vue.withCtx(() => [ vue.renderSlot(_ctx.$slots, "default") ]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusin", "onFocusoutPrevented", "onReleaseRequested"]) ], 16); }; } }); var ElPopperContent = /* @__PURE__ */ _export_sfc$1(_sfc_main$b, [["__file", "content.vue"]]); const ElPopper = withInstall(Popper); const TOOLTIP_INJECTION_KEY = Symbol("elTooltip"); const useTooltipContentProps = buildProps({ ...useDelayedToggleProps, ...popperContentProps, appendTo: { type: definePropType([String, Object]) }, content: { type: String, default: "" }, rawContent: { type: Boolean, default: false }, persistent: Boolean, ariaLabel: String, visible: { type: definePropType(Boolean), default: null }, transition: String, teleported: { type: Boolean, default: true }, disabled: Boolean }); const useTooltipTriggerProps = buildProps({ ...popperTriggerProps, disabled: Boolean, trigger: { type: definePropType([String, Array]), default: "hover" }, triggerKeys: { type: definePropType(Array), default: () => [EVENT_CODE.enter, EVENT_CODE.space] } }); const { useModelToggleProps: useTooltipModelToggleProps, useModelToggleEmits: useTooltipModelToggleEmits, useModelToggle: useTooltipModelToggle } = createModelToggleComposable("visible"); const useTooltipProps = buildProps({ ...popperProps, ...useTooltipModelToggleProps, ...useTooltipContentProps, ...useTooltipTriggerProps, ...popperArrowProps, showArrow: { type: Boolean, default: true } }); const tooltipEmits = [ ...useTooltipModelToggleEmits, "before-show", "before-hide", "show", "hide", "open", "close" ]; const isTriggerType = (trigger, type) => { if (isArray$2(trigger)) { return trigger.includes(type); } return trigger === type; }; const whenTrigger = (trigger, type, handler) => { return (e) => { isTriggerType(vue.unref(trigger), type) && handler(e); }; }; const __default__$4 = vue.defineComponent({ name: "ElTooltipTrigger" }); const _sfc_main$a = /* @__PURE__ */ vue.defineComponent({ ...__default__$4, props: useTooltipTriggerProps, setup(__props, { expose }) { const props = __props; const ns = useNamespace("tooltip"); const { controlled, id, open, onOpen, onClose, onToggle } = vue.inject(TOOLTIP_INJECTION_KEY, void 0); const triggerRef = vue.ref(null); const stopWhenControlledOrDisabled = () => { if (vue.unref(controlled) || props.disabled) { return true; } }; const trigger = vue.toRef(props, "trigger"); const onMouseenter = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "hover", onOpen)); const onMouseleave = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "hover", onClose)); const onClick = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "click", (e) => { if (e.button === 0) { onToggle(e); } })); const onFocus = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "focus", onOpen)); const onBlur = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "focus", onClose)); const onContextMenu = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "contextmenu", (e) => { e.preventDefault(); onToggle(e); })); const onKeydown = composeEventHandlers(stopWhenControlledOrDisabled, (e) => { const { code } = e; if (props.triggerKeys.includes(code)) { e.preventDefault(); onToggle(e); } }); expose({ triggerRef }); return (_ctx, _cache) => { return vue.openBlock(), vue.createBlock(vue.unref(ElPopperTrigger), { id: vue.unref(id), "virtual-ref": _ctx.virtualRef, open: vue.unref(open), "virtual-triggering": _ctx.virtualTriggering, class: vue.normalizeClass(vue.unref(ns).e("trigger")), onBlur: vue.unref(onBlur), onClick: vue.unref(onClick), onContextmenu: vue.unref(onContextMenu), onFocus: vue.unref(onFocus), onMouseenter: vue.unref(onMouseenter), onMouseleave: vue.unref(onMouseleave), onKeydown: vue.unref(onKeydown) }, { default: vue.withCtx(() => [ vue.renderSlot(_ctx.$slots, "default") ]), _: 3 }, 8, ["id", "virtual-ref", "open", "virtual-triggering", "class", "onBlur", "onClick", "onContextmenu", "onFocus", "onMouseenter", "onMouseleave", "onKeydown"]); }; } }); var ElTooltipTrigger = /* @__PURE__ */ _export_sfc$1(_sfc_main$a, [["__file", "trigger.vue"]]); const __default__$3 = vue.defineComponent({ name: "ElTooltipContent", inheritAttrs: false }); const _sfc_main$9 = /* @__PURE__ */ vue.defineComponent({ ...__default__$3, props: useTooltipContentProps, setup(__props, { expose }) { const props = __props; const { selector } = usePopperContainerId(); const ns = useNamespace("tooltip"); const contentRef = vue.ref(null); const destroyed = vue.ref(false); const { controlled, id, open, trigger, onClose, onOpen, onShow, onHide, onBeforeShow, onBeforeHide } = vue.inject(TOOLTIP_INJECTION_KEY, void 0); const transitionClass = vue.computed(() => { return props.transition || `${ns.namespace.value}-fade-in-linear`; }); const persistentRef = vue.computed(() => { return props.persistent; }); vue.onBeforeUnmount(() => { destroyed.value = true; }); const shouldRender = vue.computed(() => { return vue.unref(persistentRef) ? true : vue.unref(open); }); const shouldShow = vue.computed(() => { return props.disabled ? false : vue.unref(open); }); const appendTo = vue.computed(() => { return props.appendTo || selector.value; }); const contentStyle = vue.computed(() => { var _a2; return (_a2 = props.style) != null ? _a2 : {}; }); const ariaHidden = vue.computed(() => !vue.unref(open)); const onTransitionLeave = () => { onHide(); }; const stopWhenControlled = () => { if (vue.unref(controlled)) return true; }; const onContentEnter = composeEventHandlers(stopWhenControlled, () => { if (props.enterable && vue.unref(trigger) === "hover") { onOpen(); } }); const onContentLeave = composeEventHandlers(stopWhenControlled, () => { if (vue.unref(trigger) === "hover") { onClose(); } }); const onBeforeEnter = () => { var _a2, _b; (_b = (_a2 = contentRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2); onBeforeShow == null ? void 0 : onBeforeShow(); }; const onBeforeLeave = () => { onBeforeHide == null ? void 0 : onBeforeHide(); }; const onAfterShow = () => { onShow(); stopHandle = onClickOutside(vue.computed(() => { var _a2; return (_a2 = contentRef.value) == null ? void 0 : _a2.popperContentRef; }), () => { if (vue.unref(controlled)) return; const $trigger = vue.unref(trigger); if ($trigger !== "hover") { onClose(); } }); }; const onBlur = () => { if (!props.virtualTriggering) { onClose(); } }; let stopHandle; vue.watch(() => vue.unref(open), (val) => { if (!val) { stopHandle == null ? void 0 : stopHandle(); } }, { flush: "post" }); vue.watch(() => props.content, () => { var _a2, _b; (_b = (_a2 = contentRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2); }); expose({ contentRef }); return (_ctx, _cache) => { return vue.openBlock(), vue.createBlock(vue.Teleport, { disabled: !_ctx.teleported, to: vue.unref(appendTo) }, [ vue.createVNode(vue.Transition, { name: vue.unref(transitionClass), onAfterLeave: onTransitionLeave, onBeforeEnter, onAfterEnter: onAfterShow, onBeforeLeave }, { default: vue.withCtx(() => [ vue.unref(shouldRender) ? vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(ElPopperContent), vue.mergeProps({ key: 0, id: vue.unref(id), ref_key: "contentRef", ref: contentRef }, _ctx.$attrs, { "aria-label": _ctx.ariaLabel, "aria-hidden": vue.unref(ariaHidden), "boundaries-padding": _ctx.boundariesPadding, "fallback-placements": _ctx.fallbackPlacements, "gpu-acceleration": _ctx.gpuAcceleration, offset: _ctx.offset, placement: _ctx.placement, "popper-options": _ctx.popperOptions, strategy: _ctx.strategy, effect: _ctx.effect, enterable: _ctx.enterable, pure: _ctx.pure, "popper-class": _ctx.popperClass, "popper-style": [_ctx.popperStyle, vue.unref(contentStyle)], "reference-el": _ctx.referenceEl, "trigger-target-el": _ctx.triggerTargetEl, visible: vue.unref(shouldShow), "z-index": _ctx.zIndex, onMouseenter: vue.unref(onContentEnter), onMouseleave: vue.unref(onContentLeave), onBlur, onClose: vue.unref(onClose) }), { default: vue.withCtx(() => [ !destroyed.value ? vue.renderSlot(_ctx.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true) ]), _: 3 }, 16, ["id", "aria-label", "aria-hidden", "boundaries-padding", "fallback-placements", "gpu-acceleration", "offset", "placement", "popper-options", "strategy", "effect", "enterable", "pure", "popper-class", "popper-style", "reference-el", "trigger-target-el", "visible", "z-index", "onMouseenter", "onMouseleave", "onClose"])), [ [vue.vShow, vue.unref(shouldShow)] ]) : vue.createCommentVNode("v-if", true) ]), _: 3 }, 8, ["name"]) ], 8, ["disabled", "to"]); }; } }); var ElTooltipContent = /* @__PURE__ */ _export_sfc$1(_sfc_main$9, [["__file", "content.vue"]]); const _hoisted_1$5 = ["innerHTML"]; const _hoisted_2$3 = { key: 1 }; const __default__$2 = vue.defineComponent({ name: "ElTooltip" }); const _sfc_main$8 = /* @__PURE__ */ vue.defineComponent({ ...__default__$2, props: useTooltipProps, emits: tooltipEmits, setup(__props, { expose, emit }) { const props = __props; usePopperContainer(); const id = useId(); const popperRef = vue.ref(); const contentRef = vue.ref(); const updatePopper = () => { var _a2; const popperComponent = vue.unref(popperRef); if (popperComponent) { (_a2 = popperComponent.popperInstanceRef) == null ? void 0 : _a2.update(); } }; const open = vue.ref(false); const toggleReason = vue.ref(); const { show, hide, hasUpdateHandler } = useTooltipModelToggle({ indicator: open, toggleReason }); const { onOpen, onClose } = useDelayedToggle({ showAfter: vue.toRef(props, "showAfter"), hideAfter: vue.toRef(props, "hideAfter"), autoClose: vue.toRef(props, "autoClose"), open: show, close: hide }); const controlled = vue.computed(() => isBoolean(props.visible) && !hasUpdateHandler.value); vue.provide(TOOLTIP_INJECTION_KEY, { controlled, id, open: vue.readonly(open), trigger: vue.toRef(props, "trigger"), onOpen: (event) => { onOpen(event); }, onClose: (event) => { onClose(event); }, onToggle: (event) => { if (vue.unref(open)) { onClose(event); } else { onOpen(event); } }, onShow: () => { emit("show", toggleReason.value); }, onHide: () => { emit("hide", toggleReason.value); }, onBeforeShow: () => { emit("before-show", toggleReason.value); }, onBeforeHide: () => { emit("before-hide", toggleReason.value); }, updatePopper }); vue.watch(() => props.disabled, (disabled) => { if (disabled && open.value) { open.value = false; } }); const isFocusInsideContent = (event) => { var _a2, _b; const popperContent = (_b = (_a2 = contentRef.value) == null ? void 0 : _a2.contentRef) == null ? void 0 : _b.popperContentRef; const activeElement = (event == null ? void 0 : event.relatedTarget) || document.activeElement; return popperContent && popperContent.contains(activeElement); }; vue.onDeactivated(() => open.value && hide()); expose({ popperRef, contentRef, isFocusInsideContent, updatePopper, onOpen, onClose, hide }); return (_ctx, _cache) => { return vue.openBlock(), vue.createBlock(vue.unref(ElPopper), { ref_key: "popperRef", ref: popperRef, role: _ctx.role }, { default: vue.withCtx(() => [ vue.createVNode(ElTooltipTrigger, { disabled: _ctx.disabled, trigger: _ctx.trigger, "trigger-keys": _ctx.triggerKeys, "virtual-ref": _ctx.virtualRef, "virtual-triggering": _ctx.virtualTriggering }, { default: vue.withCtx(() => [ _ctx.$slots.default ? vue.renderSlot(_ctx.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true) ]), _: 3 }, 8, ["disabled", "trigger", "trigger-keys", "virtual-ref", "virtual-triggering"]), vue.createVNode(ElTooltipContent, { ref_key: "contentRef", ref: contentRef, "aria-label": _ctx.ariaLabel, "boundaries-padding": _ctx.boundariesPadding, content: _ctx.content, disabled: _ctx.disabled, effect: _ctx.effect, enterable: _ctx.enterable, "fallback-placements": _ctx.fallbackPlacements, "hide-after": _ctx.hideAfter, "gpu-acceleration": _ctx.gpuAcceleration, offset: _ctx.offset, persistent: _ctx.persistent, "popper-class": _ctx.popperClass, "popper-style": _ctx.popperStyle, placement: _ctx.placement, "popper-options": _ctx.popperOptions, pure: _ctx.pure, "raw-content": _ctx.rawContent, "reference-el": _ctx.referenceEl, "trigger-target-el": _ctx.triggerTargetEl, "show-after": _ctx.showAfter, strategy: _ctx.strategy, teleported: _ctx.teleported, transition: _ctx.transition, "virtual-triggering": _ctx.virtualTriggering, "z-index": _ctx.zIndex, "append-to": _ctx.appendTo }, { default: vue.withCtx(() => [ vue.renderSlot(_ctx.$slots, "content", {}, () => [ _ctx.rawContent ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, innerHTML: _ctx.content }, null, 8, _hoisted_1$5)) : (vue.openBlock(), vue.createElementBlock("span", _hoisted_2$3, vue.toDisplayString(_ctx.content), 1)) ]), _ctx.showArrow ? (vue.openBlock(), vue.createBlock(vue.unref(ElPopperArrow), { key: 0, "arrow-offset": _ctx.arrowOffset }, null, 8, ["arrow-offset"])) : vue.createCommentVNode("v-if", true) ]), _: 3 }, 8, ["aria-label", "boundaries-padding", "content", "disabled", "effect", "enterable", "fallback-placements", "hide-after", "gpu-acceleration", "offset", "persistent", "popper-class", "popper-style", "placement", "popper-options", "pure", "raw-content", "reference-el", "trigger-target-el", "show-after", "strategy", "teleported", "transition", "virtual-triggering", "z-index", "append-to"]) ]), _: 3 }, 8, ["role"]); }; } }); var Tooltip = /* @__PURE__ */ _export_sfc$1(_sfc_main$8, [["__file", "tooltip.vue"]]); const ElTooltip = withInstall(Tooltip); const nodeList = /* @__PURE__ */ new Map(); let startClick; if (isClient) { document.addEventListener("mousedown", (e) => startClick = e); document.addEventListener("mouseup", (e) => { for (const handlers of nodeList.values()) { for (const { documentHandler } of handlers) { documentHandler(e, startClick); } } }); } function createDocumentHandler(el, binding) { let excludes = []; if (Array.isArray(binding.arg)) { excludes = binding.arg; } else if (isElement(binding.arg)) { excludes.push(binding.arg); } return function(mouseup, mousedown) { const popperRef = binding.instance.popperRef; const mouseUpTarget = mouseup.target; const mouseDownTarget = mousedown == null ? void 0 : mousedown.target; const isBound = !binding || !binding.instance; const isTargetExists = !mouseUpTarget || !mouseDownTarget; const isContainedByEl = el.contains(mouseUpTarget) || el.contains(mouseDownTarget); const isSelf = el === mouseUpTarget; const isTargetExcluded = excludes.length && excludes.some((item) => item == null ? void 0 : item.contains(mouseUpTarget)) || excludes.length && excludes.includes(mouseDownTarget); const isContainedByPopper = popperRef && (popperRef.contains(mouseUpTarget) || popperRef.contains(mouseDownTarget)); if (isBound || isTargetExists || isContainedByEl || isSelf || isTargetExcluded || isContainedByPopper) { return; } binding.value(mouseup, mousedown); }; } const ClickOutside = { beforeMount(el, binding) { if (!nodeList.has(el)) { nodeList.set(el, []); } nodeList.get(el).push({ documentHandler: createDocumentHandler(el, binding), bindingFn: binding.value }); }, updated(el, binding) { if (!nodeList.has(el)) { nodeList.set(el, []); } const handlers = nodeList.get(el); const oldHandlerIndex = handlers.findIndex((item) => item.bindingFn === binding.oldValue); const newHandler = { documentHandler: createDocumentHandler(el, binding), bindingFn: binding.value }; if (oldHandlerIndex >= 0) { handlers.splice(oldHandlerIndex, 1, newHandler); } else { handlers.push(newHandler); } }, unmounted(el) { nodeList.delete(el); } }; const tagProps = buildProps({ type: { type: String, values: ["primary", "success", "info", "warning", "danger"], default: "primary" }, closable: Boolean, disableTransitions: Boolean, hit: Boolean, color: String, size: { type: String, values: componentSizes }, effect: { type: String, values: ["dark", "light", "plain"], default: "light" }, round: Boolean }); const tagEmits = { close: (evt) => evt instanceof MouseEvent, click: (evt) => evt instanceof MouseEvent }; const __default__$1 = vue.defineComponent({ name: "ElTag" }); const _sfc_main$7 = /* @__PURE__ */ vue.defineComponent({ ...__default__$1, props: tagProps, emits: tagEmits, setup(__props, { emit }) { const props = __props; const tagSize = useFormSize(); const ns = useNamespace("tag"); const containerKls = vue.computed(() => { const { type, hit, effect, closable, round } = props; return [ ns.b(), ns.is("closable", closable), ns.m(type || "primary"), ns.m(tagSize.value), ns.m(effect), ns.is("hit", hit), ns.is("round", round) ]; }); const handleClose = (event) => { emit("close", event); }; const handleClick = (event) => { emit("click", event); }; return (_ctx, _cache) => { return _ctx.disableTransitions ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(containerKls)), style: vue.normalizeStyle({ backgroundColor: _ctx.color }), onClick: handleClick }, [ vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(ns).e("content")) }, [ vue.renderSlot(_ctx.$slots, "default") ], 2), _ctx.closable ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 0, class: vue.normalizeClass(vue.unref(ns).e("close")), onClick: vue.withModifiers(handleClose, ["stop"]) }, { default: vue.withCtx(() => [ vue.createVNode(vue.unref(close_default)) ]), _: 1 }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true) ], 6)) : (vue.openBlock(), vue.createBlock(vue.Transition, { key: 1, name: `${vue.unref(ns).namespace.value}-zoom-in-center`, appear: "" }, { default: vue.withCtx(() => [ vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(containerKls)), style: vue.normalizeStyle({ backgroundColor: _ctx.color }), onClick: handleClick }, [ vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(ns).e("content")) }, [ vue.renderSlot(_ctx.$slots, "default") ], 2), _ctx.closable ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 0, class: vue.normalizeClass(vue.unref(ns).e("close")), onClick: vue.withModifiers(handleClose, ["stop"]) }, { default: vue.withCtx(() => [ vue.createVNode(vue.unref(close_default)) ]), _: 1 }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true) ], 6) ]), _: 3 }, 8, ["name"])); }; } }); var Tag = /* @__PURE__ */ _export_sfc$1(_sfc_main$7, [["__file", "tag.vue"]]); const ElTag = withInstall(Tag); const selectGroupKey = Symbol("ElSelectGroup"); const selectKey = Symbol("ElSelect"); function useOption(props, states) { const select = vue.inject(selectKey); const selectGroup = vue.inject(selectGroupKey, { disabled: false }); const itemSelected = vue.computed(() => { if (select.props.multiple) { return contains(select.props.modelValue, props.value); } else { return contains([select.props.modelValue], props.value); } }); const limitReached = vue.computed(() => { if (select.props.multiple) { const modelValue = select.props.modelValue || []; return !itemSelected.value && modelValue.length >= select.props.multipleLimit && select.props.multipleLimit > 0; } else { return false; } }); const currentLabel = vue.computed(() => { return props.label || (isObject$1(props.value) ? "" : props.value); }); const currentValue = vue.computed(() => { return props.value || props.label || ""; }); const isDisabled = vue.computed(() => { return props.disabled || states.groupDisabled || limitReached.value; }); const instance = vue.getCurrentInstance(); const contains = (arr = [], target) => { if (!isObject$1(props.value)) { return arr && arr.includes(target); } else { const valueKey = select.props.valueKey; return arr && arr.some((item) => { return vue.toRaw(get(item, valueKey)) === get(target, valueKey); }); } }; const hoverItem = () => { if (!props.disabled && !selectGroup.disabled) { select.states.hoveringIndex = select.optionsArray.indexOf(instance.proxy); } }; const updateOption = (query) => { const regexp = new RegExp(escapeStringRegexp(query), "i"); states.visible = regexp.test(currentLabel.value) || props.created; }; vue.watch(() => currentLabel.value, () => { if (!props.created && !select.props.remote) select.setSelected(); }); vue.watch(() => props.value, (val, oldVal) => { const { remote, valueKey } = select.props; if (!isEqual(val, oldVal)) { select.onOptionDestroy(oldVal, instance.proxy); select.onOptionCreate(instance.proxy); } if (!props.created && !remote) { if (valueKey && isObject$1(val) && isObject$1(oldVal) && val[valueKey] === oldVal[valueKey]) { return; } select.setSelected(); } }); vue.watch(() => selectGroup.disabled, () => { states.groupDisabled = selectGroup.disabled; }, { immediate: true }); return { select, currentLabel, currentValue, itemSelected, isDisabled, hoverItem, updateOption }; } const _sfc_main$6 = vue.defineComponent({ name: "ElOption", componentName: "ElOption", props: { value: { required: true, type: [String, Number, Boolean, Object] }, label: [String, Number], created: Boolean, disabled: Boolean }, setup(props) { const ns = useNamespace("select"); const id = useId(); const containerKls = vue.computed(() => [ ns.be("dropdown", "item"), ns.is("disabled", vue.unref(isDisabled)), ns.is("selected", vue.unref(itemSelected)), ns.is("hovering", vue.unref(hover)) ]); const states = vue.reactive({ index: -1, groupDisabled: false, visible: true, hover: false }); const { currentLabel, itemSelected, isDisabled, select, hoverItem, updateOption } = useOption(props, states); const { visible, hover } = vue.toRefs(states); const vm = vue.getCurrentInstance().proxy; select.onOptionCreate(vm); vue.onBeforeUnmount(() => { const key = vm.value; const { selected } = select.states; const selectedOptions = select.props.multiple ? selected : [selected]; const doesSelected = selectedOptions.some((item) => { return item.value === vm.value; }); vue.nextTick(() => { if (select.states.cachedOptions.get(key) === vm && !doesSelected) { select.states.cachedOptions.delete(key); } }); select.onOptionDestroy(key, vm); }); function selectOptionClick() { if (props.disabled !== true && states.groupDisabled !== true) { select.handleOptionSelect(vm); } } return { ns, id, containerKls, currentLabel, itemSelected, isDisabled, select, hoverItem, updateOption, visible, hover, selectOptionClick, states }; } }); const _hoisted_1$4 = ["id", "aria-disabled", "aria-selected"]; function _sfc_render$3(_ctx, _cache, $props, $setup, $data, $options) { return vue.withDirectives((vue.openBlock(), vue.createElementBlock("li", { id: _ctx.id, class: vue.normalizeClass(_ctx.containerKls), role: "option", "aria-disabled": _ctx.isDisabled || void 0, "aria-selected": _ctx.itemSelected, onMouseenter: _cache[0] || (_cache[0] = (...args) => _ctx.hoverItem && _ctx.hoverItem(...args)), onClick: _cache[1] || (_cache[1] = vue.withModifiers((...args) => _ctx.selectOptionClick && _ctx.selectOptionClick(...args), ["stop"])) }, [ vue.renderSlot(_ctx.$slots, "default", {}, () => [ vue.createElementVNode("span", null, vue.toDisplayString(_ctx.currentLabel), 1) ]) ], 42, _hoisted_1$4)), [ [vue.vShow, _ctx.visible] ]); } var Option = /* @__PURE__ */ _export_sfc$1(_sfc_main$6, [["render", _sfc_render$3], ["__file", "option.vue"]]); const _sfc_main$5 = vue.defineComponent({ name: "ElSelectDropdown", componentName: "ElSelectDropdown", setup() { const select = vue.inject(selectKey); const ns = useNamespace("select"); const popperClass = vue.computed(() => select.props.popperClass); const isMultiple = vue.computed(() => select.props.multiple); const isFitInputWidth = vue.computed(() => select.props.fitInputWidth); const minWidth = vue.ref(""); function updateMinWidth() { var _a2; minWidth.value = `${(_a2 = select.selectRef) == null ? void 0 : _a2.offsetWidth}px`; } vue.onMounted(() => { updateMinWidth(); useResizeObserver(select.selectRef, updateMinWidth); }); return { ns, minWidth, popperClass, isMultiple, isFitInputWidth }; } }); function _sfc_render$2(_ctx, _cache, $props, $setup, $data, $options) { return vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([_ctx.ns.b("dropdown"), _ctx.ns.is("multiple", _ctx.isMultiple), _ctx.popperClass]), style: vue.normalizeStyle({ [_ctx.isFitInputWidth ? "width" : "minWidth"]: _ctx.minWidth }) }, [ _ctx.$slots.header ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(_ctx.ns.be("dropdown", "header")) }, [ vue.renderSlot(_ctx.$slots, "header") ], 2)) : vue.createCommentVNode("v-if", true), vue.renderSlot(_ctx.$slots, "default"), _ctx.$slots.footer ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass(_ctx.ns.be("dropdown", "footer")) }, [ vue.renderSlot(_ctx.$slots, "footer") ], 2)) : vue.createCommentVNode("v-if", true) ], 6); } var ElSelectMenu = /* @__PURE__ */ _export_sfc$1(_sfc_main$5, [["render", _sfc_render$2], ["__file", "select-dropdown.vue"]]); function useInput(handleInput) { const isComposing = vue.ref(false); const handleCompositionStart = () => { isComposing.value = true; }; const handleCompositionUpdate = (event) => { const text = event.target.value; const lastCharacter = text[text.length - 1] || ""; isComposing.value = !isKorean(lastCharacter); }; const handleCompositionEnd = (event) => { if (isComposing.value) { isComposing.value = false; if (isFunction$1(handleInput)) { handleInput(event); } } }; return { handleCompositionStart, handleCompositionUpdate, handleCompositionEnd }; } const MINIMUM_INPUT_WIDTH = 11; const useSelect = (props, emit) => { const { t } = useLocale(); const contentId = useId(); const nsSelect = useNamespace("select"); const nsInput = useNamespace("input"); const states = vue.reactive({ inputValue: "", options: /* @__PURE__ */ new Map(), cachedOptions: /* @__PURE__ */ new Map(), disabledOptions: /* @__PURE__ */ new Map(), optionValues: [], selected: props.multiple ? [] : {}, selectionWidth: 0, calculatorWidth: 0, collapseItemWidth: 0, selectedLabel: "", hoveringIndex: -1, previousQuery: null, inputHovering: false, menuVisibleOnFocus: false, isBeforeHide: false }); const selectRef = vue.ref(null); const selectionRef = vue.ref(null); const tooltipRef = vue.ref(null); const tagTooltipRef = vue.ref(null); const inputRef = vue.ref(null); const calculatorRef = vue.ref(null); const prefixRef = vue.ref(null); const suffixRef = vue.ref(null); const menuRef = vue.ref(null); const tagMenuRef = vue.ref(null); const collapseItemRef = vue.ref(null); const scrollbarRef = vue.ref(null); const { wrapperRef, isFocused, handleFocus, handleBlur } = useFocusController(inputRef, { afterFocus() { if (props.automaticDropdown && !expanded.value) { expanded.value = true; states.menuVisibleOnFocus = true; } }, beforeBlur(event) { var _a2, _b; return ((_a2 = tooltipRef.value) == null ? void 0 : _a2.isFocusInsideContent(event)) || ((_b = tagTooltipRef.value) == null ? void 0 : _b.isFocusInsideContent(event)); }, afterBlur() { expanded.value = false; states.menuVisibleOnFocus = false; } }); const expanded = vue.ref(false); const hoverOption = vue.ref(); const { form, formItem } = useFormItem(); const { inputId } = useFormItemInputId(props, { formItemContext: formItem }); const { valueOnClear, isEmptyValue } = useEmptyValues(props); const selectDisabled = vue.computed(() => props.disabled || (form == null ? void 0 : form.disabled)); const hasModelValue = vue.computed(() => { return props.multiple ? isArray$2(props.modelValue) && props.modelValue.length > 0 : !isEmptyValue(props.modelValue); }); const showClose = vue.computed(() => { return props.clearable && !selectDisabled.value && states.inputHovering && hasModelValue.value; }); const iconComponent = vue.computed(() => props.remote && props.filterable && !props.remoteShowSuffix ? "" : props.suffixIcon); const iconReverse = vue.computed(() => nsSelect.is("reverse", iconComponent.value && expanded.value)); const validateState = vue.computed(() => (formItem == null ? void 0 : formItem.validateState) || ""); const validateIcon = vue.computed(() => ValidateComponentsMap[validateState.value]); const debounce$1 = vue.computed(() => props.remote ? 300 : 0); const emptyText = vue.computed(() => { if (props.loading) { return props.loadingText || t("el.select.loading"); } else { if (props.remote && !states.inputValue && states.options.size === 0) return false; if (props.filterable && states.inputValue && states.options.size > 0 && filteredOptionsCount.value === 0) { return props.noMatchText || t("el.select.noMatch"); } if (states.options.size === 0) { return props.noDataText || t("el.select.noData"); } } return null; }); const filteredOptionsCount = vue.computed(() => optionsArray.value.filter((option) => option.visible).length); const optionsArray = vue.computed(() => { const list = Array.from(states.options.values()); const newList = []; states.optionValues.forEach((item) => { const index = list.findIndex((i) => i.value === item); if (index > -1) { newList.push(list[index]); } }); return newList.length >= list.length ? newList : list; }); const cachedOptionsArray = vue.computed(() => Array.from(states.cachedOptions.values())); const showNewOption = vue.computed(() => { const hasExistingOption = optionsArray.value.filter((option) => { return !option.created; }).some((option) => { return option.currentLabel === states.inputValue; }); return props.filterable && props.allowCreate && states.inputValue !== "" && !hasExistingOption; }); const updateOptions = () => { if (props.filterable && isFunction$1(props.filterMethod)) return; if (props.filterable && props.remote && isFunction$1(props.remoteMethod)) return; optionsArray.value.forEach((option) => { var _a2; (_a2 = option.updateOption) == null ? void 0 : _a2.call(option, states.inputValue); }); }; const selectSize = useFormSize(); const collapseTagSize = vue.computed(() => ["small"].includes(selectSize.value) ? "small" : "default"); const dropdownMenuVisible = vue.computed({ get() { return expanded.value && emptyText.value !== false; }, set(val) { expanded.value = val; } }); const shouldShowPlaceholder = vue.computed(() => { if (isArray$2(props.modelValue)) { return props.modelValue.length === 0 && !states.inputValue; } return props.filterable ? !states.inputValue : true; }); const currentPlaceholder = vue.computed(() => { var _a2; const _placeholder = (_a2 = props.placeholder) != null ? _a2 : t("el.select.placeholder"); return props.multiple || !hasModelValue.value ? _placeholder : states.selectedLabel; }); vue.watch(() => props.modelValue, (val, oldVal) => { if (props.multiple) { if (props.filterable && !props.reserveKeyword) { states.inputValue = ""; handleQueryChange(""); } } setSelected(); if (!isEqual(val, oldVal) && props.validateEvent) { formItem == null ? void 0 : formItem.validate("change").catch((err) => debugWarn()); } }, { flush: "post", deep: true }); vue.watch(() => expanded.value, (val) => { if (val) { handleQueryChange(states.inputValue); } else { states.inputValue = ""; states.previousQuery = null; states.isBeforeHide = true; } emit("visible-change", val); }); vue.watch(() => states.options.entries(), () => { var _a2; if (!isClient) return; const inputs = ((_a2 = selectRef.value) == null ? void 0 : _a2.querySelectorAll("input")) || []; if (!props.filterable && !props.defaultFirstOption && !isUndefined(props.modelValue) || !Array.from(inputs).includes(document.activeElement)) { setSelected(); } if (props.defaultFirstOption && (props.filterable || props.remote) && filteredOptionsCount.value) { checkDefaultFirstOption(); } }, { flush: "post" }); vue.watch(() => states.hoveringIndex, (val) => { if (isNumber(val) && val > -1) { hoverOption.value = optionsArray.value[val] || {}; } else { hoverOption.value = {}; } optionsArray.value.forEach((option) => { option.hover = hoverOption.value === option; }); }); vue.watchEffect(() => { if (states.isBeforeHide) return; updateOptions(); }); const handleQueryChange = (val) => { if (states.previousQuery === val) { return; } states.previousQuery = val; if (props.filterable && isFunction$1(props.filterMethod)) { props.filterMethod(val); } else if (props.filterable && props.remote && isFunction$1(props.remoteMethod)) { props.remoteMethod(val); } if (props.defaultFirstOption && (props.filterable || props.remote) && filteredOptionsCount.value) { vue.nextTick(checkDefaultFirstOption); } else { vue.nextTick(updateHoveringIndex); } }; const checkDefaultFirstOption = () => { const optionsInDropdown = optionsArray.value.filter((n) => n.visible && !n.disabled && !n.states.groupDisabled); const userCreatedOption = optionsInDropdown.find((n) => n.created); const firstOriginOption = optionsInDropdown[0]; states.hoveringIndex = getValueIndex(optionsArray.value, userCreatedOption || firstOriginOption); }; const setSelected = () => { if (!props.multiple) { const option = getOption(props.modelValue); states.selectedLabel = option.currentLabel; states.selected = option; return; } else { states.selectedLabel = ""; } const result = []; if (isArray$2(props.modelValue)) { props.modelValue.forEach((value) => { result.push(getOption(value)); }); } states.selected = result; }; const getOption = (value) => { let option; const isObjectValue = toRawType(value).toLowerCase() === "object"; const isNull = toRawType(value).toLowerCase() === "null"; const isUndefined2 = toRawType(value).toLowerCase() === "undefined"; for (let i = states.cachedOptions.size - 1; i >= 0; i--) { const cachedOption = cachedOptionsArray.value[i]; const isEqualValue = isObjectValue ? get(cachedOption.value, props.valueKey) === get(value, props.valueKey) : cachedOption.value === value; if (isEqualValue) { option = { value, currentLabel: cachedOption.currentLabel, isDisabled: cachedOption.isDisabled }; break; } } if (option) return option; const label = isObjectValue ? value.label : !isNull && !isUndefined2 ? value : ""; const newOption = { value, currentLabel: label }; return newOption; }; const updateHoveringIndex = () => { if (!props.multiple) { states.hoveringIndex = optionsArray.value.findIndex((item) => { return getValueKey(item) === getValueKey(states.selected); }); } else { states.hoveringIndex = optionsArray.value.findIndex((item) => states.selected.some((selected) => getValueKey(selected) === getValueKey(item))); } }; const resetSelectionWidth = () => { states.selectionWidth = selectionRef.value.getBoundingClientRect().width; }; const resetCalculatorWidth = () => { states.calculatorWidth = calculatorRef.value.getBoundingClientRect().width; }; const resetCollapseItemWidth = () => { states.collapseItemWidth = collapseItemRef.value.getBoundingClientRect().width; }; const updateTooltip = () => { var _a2, _b; (_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2); }; const updateTagTooltip = () => { var _a2, _b; (_b = (_a2 = tagTooltipRef.value) == null ? void 0 : _a2.updatePopper) == null ? void 0 : _b.call(_a2); }; const onInputChange = () => { if (states.inputValue.length > 0 && !expanded.value) { expanded.value = true; } handleQueryChange(states.inputValue); }; const onInput = (event) => { states.inputValue = event.target.value; if (props.remote) { debouncedOnInputChange(); } else { return onInputChange(); } }; const debouncedOnInputChange = debounce(() => { onInputChange(); }, debounce$1.value); const emitChange = (val) => { if (!isEqual(props.modelValue, val)) { emit(CHANGE_EVENT, val); } }; const getLastNotDisabledIndex = (value) => findLastIndex(value, (it2) => !states.disabledOptions.has(it2)); const deletePrevTag = (e) => { if (!props.multiple) return; if (e.code === EVENT_CODE.delete) return; if (e.target.value.length <= 0) { const value = props.modelValue.slice(); const lastNotDisabledIndex = getLastNotDisabledIndex(value); if (lastNotDisabledIndex < 0) return; value.splice(lastNotDisabledIndex, 1); emit(UPDATE_MODEL_EVENT, value); emitChange(value); } }; const deleteTag = (event, tag) => { const index = states.selected.indexOf(tag); if (index > -1 && !selectDisabled.value) { const value = props.modelValue.slice(); value.splice(index, 1); emit(UPDATE_MODEL_EVENT, value); emitChange(value); emit("remove-tag", tag.value); } event.stopPropagation(); focus(); }; const deleteSelected = (event) => { event.stopPropagation(); const value = props.multiple ? [] : valueOnClear.value; if (props.multiple) { for (const item of states.selected) { if (item.isDisabled) value.push(item.value); } } emit(UPDATE_MODEL_EVENT, value); emitChange(value); states.hoveringIndex = -1; expanded.value = false; emit("clear"); focus(); }; const handleOptionSelect = (option) => { if (props.multiple) { const value = (props.modelValue || []).slice(); const optionIndex = getValueIndex(value, option.value); if (optionIndex > -1) { value.splice(optionIndex, 1); } else if (props.multipleLimit <= 0 || value.length < props.multipleLimit) { value.push(option.value); } emit(UPDATE_MODEL_EVENT, value); emitChange(value); if (option.created) { handleQueryChange(""); } if (props.filterable && !props.reserveKeyword) { states.inputValue = ""; } } else { emit(UPDATE_MODEL_EVENT, option.value); emitChange(option.value); expanded.value = false; } focus(); if (expanded.value) return; vue.nextTick(() => { scrollToOption(option); }); }; const getValueIndex = (arr = [], value) => { if (!isObject$1(value)) return arr.indexOf(value); const valueKey = props.valueKey; let index = -1; arr.some((item, i) => { if (vue.toRaw(get(item, valueKey)) === get(value, valueKey)) { index = i; return true; } return false; }); return index; }; const scrollToOption = (option) => { var _a2, _b, _c, _d, _e; const targetOption = isArray$2(option) ? option[0] : option; let target = null; if (targetOption == null ? void 0 : targetOption.value) { const options = optionsArray.value.filter((item) => item.value === targetOption.value); if (options.length > 0) { target = options[0].$el; } } if (tooltipRef.value && target) { const menu = (_d = (_c = (_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.popperRef) == null ? void 0 : _b.contentRef) == null ? void 0 : _c.querySelector) == null ? void 0 : _d.call(_c, `.${nsSelect.be("dropdown", "wrap")}`); if (menu) { scrollIntoView(menu, target); } } (_e = scrollbarRef.value) == null ? void 0 : _e.handleScroll(); }; const onOptionCreate = (vm) => { states.options.set(vm.value, vm); states.cachedOptions.set(vm.value, vm); vm.disabled && states.disabledOptions.set(vm.value, vm); }; const onOptionDestroy = (key, vm) => { if (states.options.get(key) === vm) { states.options.delete(key); } }; const { handleCompositionStart, handleCompositionUpdate, handleCompositionEnd } = useInput((e) => onInput(e)); const popperRef = vue.computed(() => { var _a2, _b; return (_b = (_a2 = tooltipRef.value) == null ? void 0 : _a2.popperRef) == null ? void 0 : _b.contentRef; }); const handleMenuEnter = () => { states.isBeforeHide = false; vue.nextTick(() => scrollToOption(states.selected)); }; const focus = () => { var _a2; (_a2 = inputRef.value) == null ? void 0 : _a2.focus(); }; const blur = () => { handleClickOutside(); }; const handleClearClick = (event) => { deleteSelected(event); }; const handleClickOutside = (event) => { expanded.value = false; if (isFocused.value) { const _event2 = new FocusEvent("focus", event); vue.nextTick(() => handleBlur(_event2)); } }; const handleEsc = () => { if (states.inputValue.length > 0) { states.inputValue = ""; } else { expanded.value = false; } }; const toggleMenu = () => { if (selectDisabled.value) return; if (states.menuVisibleOnFocus) { states.menuVisibleOnFocus = false; } else { expanded.value = !expanded.value; } }; const selectOption = () => { if (!expanded.value) { toggleMenu(); } else { if (optionsArray.value[states.hoveringIndex]) { handleOptionSelect(optionsArray.value[states.hoveringIndex]); } } }; const getValueKey = (item) => { return isObject$1(item.value) ? get(item.value, props.valueKey) : item.value; }; const optionsAllDisabled = vue.computed(() => optionsArray.value.filter((option) => option.visible).every((option) => option.disabled)); const showTagList = vue.computed(() => { if (!props.multiple) { return []; } return props.collapseTags ? states.selected.slice(0, props.maxCollapseTags) : states.selected; }); const collapseTagList = vue.computed(() => { if (!props.multiple) { return []; } return props.collapseTags ? states.selected.slice(props.maxCollapseTags) : []; }); const navigateOptions = (direction) => { if (!expanded.value) { expanded.value = true; return; } if (states.options.size === 0 || filteredOptionsCount.value === 0) return; if (!optionsAllDisabled.value) { if (direction === "next") { states.hoveringIndex++; if (states.hoveringIndex === states.options.size) { states.hoveringIndex = 0; } } else if (direction === "prev") { states.hoveringIndex--; if (states.hoveringIndex < 0) { states.hoveringIndex = states.options.size - 1; } } const option = optionsArray.value[states.hoveringIndex]; if (option.disabled === true || option.states.groupDisabled === true || !option.visible) { navigateOptions(direction); } vue.nextTick(() => scrollToOption(hoverOption.value)); } }; const getGapWidth = () => { if (!selectionRef.value) return 0; const style2 = window.getComputedStyle(selectionRef.value); return Number.parseFloat(style2.gap || "6px"); }; const tagStyle = vue.computed(() => { const gapWidth = getGapWidth(); const maxWidth = collapseItemRef.value && props.maxCollapseTags === 1 ? states.selectionWidth - states.collapseItemWidth - gapWidth : states.selectionWidth; return { maxWidth: `${maxWidth}px` }; }); const collapseTagStyle = vue.computed(() => { return { maxWidth: `${states.selectionWidth}px` }; }); const inputStyle = vue.computed(() => ({ width: `${Math.max(states.calculatorWidth, MINIMUM_INPUT_WIDTH)}px` })); if (props.multiple && !isArray$2(props.modelValue)) { emit(UPDATE_MODEL_EVENT, []); } if (!props.multiple && isArray$2(props.modelValue)) { emit(UPDATE_MODEL_EVENT, ""); } useResizeObserver(selectionRef, resetSelectionWidth); useResizeObserver(calculatorRef, resetCalculatorWidth); useResizeObserver(menuRef, updateTooltip); useResizeObserver(wrapperRef, updateTooltip); useResizeObserver(tagMenuRef, updateTagTooltip); useResizeObserver(collapseItemRef, resetCollapseItemWidth); vue.onMounted(() => { setSelected(); }); return { inputId, contentId, nsSelect, nsInput, states, isFocused, expanded, optionsArray, hoverOption, selectSize, filteredOptionsCount, resetCalculatorWidth, updateTooltip, updateTagTooltip, debouncedOnInputChange, onInput, deletePrevTag, deleteTag, deleteSelected, handleOptionSelect, scrollToOption, hasModelValue, shouldShowPlaceholder, currentPlaceholder, showClose, iconComponent, iconReverse, validateState, validateIcon, showNewOption, updateOptions, collapseTagSize, setSelected, selectDisabled, emptyText, handleCompositionStart, handleCompositionUpdate, handleCompositionEnd, onOptionCreate, onOptionDestroy, handleMenuEnter, handleFocus, focus, blur, handleBlur, handleClearClick, handleClickOutside, handleEsc, toggleMenu, selectOption, getValueKey, navigateOptions, dropdownMenuVisible, showTagList, collapseTagList, tagStyle, collapseTagStyle, inputStyle, popperRef, inputRef, tooltipRef, tagTooltipRef, calculatorRef, prefixRef, suffixRef, selectRef, wrapperRef, selectionRef, scrollbarRef, menuRef, tagMenuRef, collapseItemRef }; }; var ElOptions = vue.defineComponent({ name: "ElOptions", setup(_, { slots }) { const select = vue.inject(selectKey); let cachedValueList = []; return () => { var _a2, _b; const children = (_a2 = slots.default) == null ? void 0 : _a2.call(slots); const valueList = []; function filterOptions(children2) { if (!isArray$2(children2)) return; children2.forEach((item) => { var _a22, _b2, _c, _d; const name = (_a22 = (item == null ? void 0 : item.type) || {}) == null ? void 0 : _a22.name; if (name === "ElOptionGroup") { filterOptions(!isString(item.children) && !isArray$2(item.children) && isFunction$1((_b2 = item.children) == null ? void 0 : _b2.default) ? (_c = item.children) == null ? void 0 : _c.default() : item.children); } else if (name === "ElOption") { valueList.push((_d = item.props) == null ? void 0 : _d.value); } else if (isArray$2(item.children)) { filterOptions(item.children); } }); } if (children.length) { filterOptions((_b = children[0]) == null ? void 0 : _b.children); } if (!isEqual(valueList, cachedValueList)) { cachedValueList = valueList; if (select) { select.states.optionValues = valueList; } } return children; }; } }); const SelectProps = buildProps({ name: String, id: String, modelValue: { type: [Array, String, Number, Boolean, Object], default: void 0 }, autocomplete: { type: String, default: "off" }, automaticDropdown: Boolean, size: useSizeProp, effect: { type: definePropType(String), default: "light" }, disabled: Boolean, clearable: Boolean, filterable: Boolean, allowCreate: Boolean, loading: Boolean, popperClass: { type: String, default: "" }, popperOptions: { type: definePropType(Object), default: () => ({}) }, remote: Boolean, loadingText: String, noMatchText: String, noDataText: String, remoteMethod: Function, filterMethod: Function, multiple: Boolean, multipleLimit: { type: Number, default: 0 }, placeholder: { type: String }, defaultFirstOption: Boolean, reserveKeyword: { type: Boolean, default: true }, valueKey: { type: String, default: "value" }, collapseTags: Boolean, collapseTagsTooltip: Boolean, maxCollapseTags: { type: Number, default: 1 }, teleported: useTooltipContentProps.teleported, persistent: { type: Boolean, default: true }, clearIcon: { type: iconPropType, default: circle_close_default }, fitInputWidth: Boolean, suffixIcon: { type: iconPropType, default: arrow_down_default }, tagType: { ...tagProps.type, default: "info" }, validateEvent: { type: Boolean, default: true }, remoteShowSuffix: Boolean, placement: { type: definePropType(String), values: Ee, default: "bottom-start" }, fallbackPlacements: { type: definePropType(Array), default: ["bottom-start", "top-start", "right", "left"] }, ariaLabel: { type: String, default: void 0 }, ...useEmptyValuesProps }); const COMPONENT_NAME = "ElSelect"; const _sfc_main$4 = vue.defineComponent({ name: COMPONENT_NAME, componentName: COMPONENT_NAME, components: { ElInput, ElSelectMenu, ElOption: Option, ElOptions, ElTag, ElScrollbar, ElTooltip, ElIcon }, directives: { ClickOutside }, props: SelectProps, emits: [ UPDATE_MODEL_EVENT, CHANGE_EVENT, "remove-tag", "clear", "visible-change", "focus", "blur" ], setup(props, { emit }) { const API = useSelect(props, emit); vue.provide(selectKey, vue.reactive({ props, states: API.states, optionsArray: API.optionsArray, handleOptionSelect: API.handleOptionSelect, onOptionCreate: API.onOptionCreate, onOptionDestroy: API.onOptionDestroy, selectRef: API.selectRef, setSelected: API.setSelected })); return { ...API }; } }); const _hoisted_1$3 = ["id", "disabled", "autocomplete", "readonly", "aria-activedescendant", "aria-controls", "aria-expanded", "aria-label"]; const _hoisted_2$2 = ["textContent"]; function _sfc_render$1(_ctx, _cache, $props, $setup, $data, $options) { const _component_el_tag = vue.resolveComponent("el-tag"); const _component_el_tooltip = vue.resolveComponent("el-tooltip"); const _component_el_icon = vue.resolveComponent("el-icon"); const _component_el_option = vue.resolveComponent("el-option"); const _component_el_options = vue.resolveComponent("el-options"); const _component_el_scrollbar = vue.resolveComponent("el-scrollbar"); const _component_el_select_menu = vue.resolveComponent("el-select-menu"); const _directive_click_outside = vue.resolveDirective("click-outside"); return vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", { ref: "selectRef", class: vue.normalizeClass([_ctx.nsSelect.b(), _ctx.nsSelect.m(_ctx.selectSize)]), onMouseenter: _cache[16] || (_cache[16] = ($event) => _ctx.states.inputHovering = true), onMouseleave: _cache[17] || (_cache[17] = ($event) => _ctx.states.inputHovering = false), onClick: _cache[18] || (_cache[18] = vue.withModifiers((...args) => _ctx.toggleMenu && _ctx.toggleMenu(...args), ["prevent", "stop"])) }, [ vue.createVNode(_component_el_tooltip, { ref: "tooltipRef", visible: _ctx.dropdownMenuVisible, placement: _ctx.placement, teleported: _ctx.teleported, "popper-class": [_ctx.nsSelect.e("popper"), _ctx.popperClass], "popper-options": _ctx.popperOptions, "fallback-placements": _ctx.fallbackPlacements, effect: _ctx.effect, pure: "", trigger: "click", transition: `${_ctx.nsSelect.namespace.value}-zoom-in-top`, "stop-popper-mouse-event": false, "gpu-acceleration": false, persistent: _ctx.persistent, onBeforeShow: _ctx.handleMenuEnter, onHide: _cache[15] || (_cache[15] = ($event) => _ctx.states.isBeforeHide = false) }, { default: vue.withCtx(() => { var _a2; return [ vue.createElementVNode("div", { ref: "wrapperRef", class: vue.normalizeClass([ _ctx.nsSelect.e("wrapper"), _ctx.nsSelect.is("focused", _ctx.isFocused), _ctx.nsSelect.is("hovering", _ctx.states.inputHovering), _ctx.nsSelect.is("filterable", _ctx.filterable), _ctx.nsSelect.is("disabled", _ctx.selectDisabled) ]) }, [ _ctx.$slots.prefix ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, ref: "prefixRef", class: vue.normalizeClass(_ctx.nsSelect.e("prefix")) }, [ vue.renderSlot(_ctx.$slots, "prefix") ], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { ref: "selectionRef", class: vue.normalizeClass([ _ctx.nsSelect.e("selection"), _ctx.nsSelect.is("near", _ctx.multiple && !_ctx.$slots.prefix && !!_ctx.states.selected.length) ]) }, [ _ctx.multiple ? vue.renderSlot(_ctx.$slots, "tag", { key: 0 }, () => [ (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(_ctx.showTagList, (item) => { return vue.openBlock(), vue.createElementBlock("div", { key: _ctx.getValueKey(item), class: vue.normalizeClass(_ctx.nsSelect.e("selected-item")) }, [ vue.createVNode(_component_el_tag, { closable: !_ctx.selectDisabled && !item.isDisabled, size: _ctx.collapseTagSize, type: _ctx.tagType, "disable-transitions": "", style: vue.normalizeStyle(_ctx.tagStyle), onClose: ($event) => _ctx.deleteTag($event, item) }, { default: vue.withCtx(() => [ vue.createElementVNode("span", { class: vue.normalizeClass(_ctx.nsSelect.e("tags-text")) }, vue.toDisplayString(item.currentLabel), 3) ]), _: 2 }, 1032, ["closable", "size", "type", "style", "onClose"]) ], 2); }), 128)), _ctx.collapseTags && _ctx.states.selected.length > _ctx.maxCollapseTags ? (vue.openBlock(), vue.createBlock(_component_el_tooltip, { key: 0, ref: "tagTooltipRef", disabled: _ctx.dropdownMenuVisible || !_ctx.collapseTagsTooltip, "fallback-placements": ["bottom", "top", "right", "left"], effect: _ctx.effect, placement: "bottom", teleported: _ctx.teleported }, { default: vue.withCtx(() => [ vue.createElementVNode("div", { ref: "collapseItemRef", class: vue.normalizeClass(_ctx.nsSelect.e("selected-item")) }, [ vue.createVNode(_component_el_tag, { closable: false, size: _ctx.collapseTagSize, type: _ctx.tagType, "disable-transitions": "", style: vue.normalizeStyle(_ctx.collapseTagStyle) }, { default: vue.withCtx(() => [ vue.createElementVNode("span", { class: vue.normalizeClass(_ctx.nsSelect.e("tags-text")) }, " + " + vue.toDisplayString(_ctx.states.selected.length - _ctx.maxCollapseTags), 3) ]), _: 1 }, 8, ["size", "type", "style"]) ], 2) ]), content: vue.withCtx(() => [ vue.createElementVNode("div", { ref: "tagMenuRef", class: vue.normalizeClass(_ctx.nsSelect.e("selection")) }, [ (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(_ctx.collapseTagList, (item) => { return vue.openBlock(), vue.createElementBlock("div", { key: _ctx.getValueKey(item), class: vue.normalizeClass(_ctx.nsSelect.e("selected-item")) }, [ vue.createVNode(_component_el_tag, { class: "in-tooltip", closable: !_ctx.selectDisabled && !item.isDisabled, size: _ctx.collapseTagSize, type: _ctx.tagType, "disable-transitions": "", onClose: ($event) => _ctx.deleteTag($event, item) }, { default: vue.withCtx(() => [ vue.createElementVNode("span", { class: vue.normalizeClass(_ctx.nsSelect.e("tags-text")) }, vue.toDisplayString(item.currentLabel), 3) ]), _: 2 }, 1032, ["closable", "size", "type", "onClose"]) ], 2); }), 128)) ], 2) ]), _: 1 }, 8, ["disabled", "effect", "teleported"])) : vue.createCommentVNode("v-if", true) ]) : vue.createCommentVNode("v-if", true), !_ctx.selectDisabled ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass([ _ctx.nsSelect.e("selected-item"), _ctx.nsSelect.e("input-wrapper"), _ctx.nsSelect.is("hidden", !_ctx.filterable) ]) }, [ vue.withDirectives(vue.createElementVNode("input", { id: _ctx.inputId, ref: "inputRef", "onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => _ctx.states.inputValue = $event), type: "text", class: vue.normalizeClass([_ctx.nsSelect.e("input"), _ctx.nsSelect.is(_ctx.selectSize)]), disabled: _ctx.selectDisabled, autocomplete: _ctx.autocomplete, style: vue.normalizeStyle(_ctx.inputStyle), role: "combobox", readonly: !_ctx.filterable, spellcheck: "false", "aria-activedescendant": ((_a2 = _ctx.hoverOption) == null ? void 0 : _a2.id) || "", "aria-controls": _ctx.contentId, "aria-expanded": _ctx.dropdownMenuVisible, "aria-label": _ctx.ariaLabel, "aria-autocomplete": "none", "aria-haspopup": "listbox", onFocus: _cache[1] || (_cache[1] = (...args) => _ctx.handleFocus && _ctx.handleFocus(...args)), onBlur: _cache[2] || (_cache[2] = (...args) => _ctx.handleBlur && _ctx.handleBlur(...args)), onKeydown: [ _cache[3] || (_cache[3] = vue.withKeys(vue.withModifiers(($event) => _ctx.navigateOptions("next"), ["stop", "prevent"]), ["down"])), _cache[4] || (_cache[4] = vue.withKeys(vue.withModifiers(($event) => _ctx.navigateOptions("prev"), ["stop", "prevent"]), ["up"])), _cache[5] || (_cache[5] = vue.withKeys(vue.withModifiers((...args) => _ctx.handleEsc && _ctx.handleEsc(...args), ["stop", "prevent"]), ["esc"])), _cache[6] || (_cache[6] = vue.withKeys(vue.withModifiers((...args) => _ctx.selectOption && _ctx.selectOption(...args), ["stop", "prevent"]), ["enter"])), _cache[7] || (_cache[7] = vue.withKeys(vue.withModifiers((...args) => _ctx.deletePrevTag && _ctx.deletePrevTag(...args), ["stop"]), ["delete"])) ], onCompositionstart: _cache[8] || (_cache[8] = (...args) => _ctx.handleCompositionStart && _ctx.handleCompositionStart(...args)), onCompositionupdate: _cache[9] || (_cache[9] = (...args) => _ctx.handleCompositionUpdate && _ctx.handleCompositionUpdate(...args)), onCompositionend: _cache[10] || (_cache[10] = (...args) => _ctx.handleCompositionEnd && _ctx.handleCompositionEnd(...args)), onInput: _cache[11] || (_cache[11] = (...args) => _ctx.onInput && _ctx.onInput(...args)), onClick: _cache[12] || (_cache[12] = vue.withModifiers((...args) => _ctx.toggleMenu && _ctx.toggleMenu(...args), ["stop"])) }, null, 46, _hoisted_1$3), [ [vue.vModelText, _ctx.states.inputValue] ]), _ctx.filterable ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, ref: "calculatorRef", "aria-hidden": "true", class: vue.normalizeClass(_ctx.nsSelect.e("input-calculator")), textContent: vue.toDisplayString(_ctx.states.inputValue) }, null, 10, _hoisted_2$2)) : vue.createCommentVNode("v-if", true) ], 2)) : vue.createCommentVNode("v-if", true), _ctx.shouldShowPlaceholder ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass([ _ctx.nsSelect.e("selected-item"), _ctx.nsSelect.e("placeholder"), _ctx.nsSelect.is("transparent", !_ctx.hasModelValue || _ctx.expanded && !_ctx.states.inputValue) ]) }, [ vue.createElementVNode("span", null, vue.toDisplayString(_ctx.currentPlaceholder), 1) ], 2)) : vue.createCommentVNode("v-if", true) ], 2), vue.createElementVNode("div", { ref: "suffixRef", class: vue.normalizeClass(_ctx.nsSelect.e("suffix")) }, [ _ctx.iconComponent && !_ctx.showClose ? (vue.openBlock(), vue.createBlock(_component_el_icon, { key: 0, class: vue.normalizeClass([_ctx.nsSelect.e("caret"), _ctx.nsSelect.e("icon"), _ctx.iconReverse]) }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.iconComponent))) ]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), _ctx.showClose && _ctx.clearIcon ? (vue.openBlock(), vue.createBlock(_component_el_icon, { key: 1, class: vue.normalizeClass([_ctx.nsSelect.e("caret"), _ctx.nsSelect.e("icon")]), onClick: _ctx.handleClearClick }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.clearIcon))) ]), _: 1 }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true), _ctx.validateState && _ctx.validateIcon ? (vue.openBlock(), vue.createBlock(_component_el_icon, { key: 2, class: vue.normalizeClass([_ctx.nsInput.e("icon"), _ctx.nsInput.e("validateIcon")]) }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.validateIcon))) ]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true) ], 2) ], 2) ]; }), content: vue.withCtx(() => [ vue.createVNode(_component_el_select_menu, { ref: "menuRef" }, { default: vue.withCtx(() => [ _ctx.$slots.header ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(_ctx.nsSelect.be("dropdown", "header")), onClick: _cache[13] || (_cache[13] = vue.withModifiers(() => { }, ["stop"])) }, [ vue.renderSlot(_ctx.$slots, "header") ], 2)) : vue.createCommentVNode("v-if", true), vue.withDirectives(vue.createVNode(_component_el_scrollbar, { id: _ctx.contentId, ref: "scrollbarRef", tag: "ul", "wrap-class": _ctx.nsSelect.be("dropdown", "wrap"), "view-class": _ctx.nsSelect.be("dropdown", "list"), class: vue.normalizeClass([_ctx.nsSelect.is("empty", _ctx.filteredOptionsCount === 0)]), role: "listbox", "aria-label": _ctx.ariaLabel, "aria-orientation": "vertical" }, { default: vue.withCtx(() => [ _ctx.showNewOption ? (vue.openBlock(), vue.createBlock(_component_el_option, { key: 0, value: _ctx.states.inputValue, created: true }, null, 8, ["value"])) : vue.createCommentVNode("v-if", true), vue.createVNode(_component_el_options, null, { default: vue.withCtx(() => [ vue.renderSlot(_ctx.$slots, "default") ]), _: 3 }) ]), _: 3 }, 8, ["id", "wrap-class", "view-class", "class", "aria-label"]), [ [vue.vShow, _ctx.states.options.size > 0 && !_ctx.loading] ]), _ctx.$slots.loading && _ctx.loading ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass(_ctx.nsSelect.be("dropdown", "loading")) }, [ vue.renderSlot(_ctx.$slots, "loading") ], 2)) : _ctx.loading || _ctx.filteredOptionsCount === 0 ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass(_ctx.nsSelect.be("dropdown", "empty")) }, [ vue.renderSlot(_ctx.$slots, "empty", {}, () => [ vue.createElementVNode("span", null, vue.toDisplayString(_ctx.emptyText), 1) ]) ], 2)) : vue.createCommentVNode("v-if", true), _ctx.$slots.footer ? (vue.openBlock(), vue.createElementBlock("div", { key: 3, class: vue.normalizeClass(_ctx.nsSelect.be("dropdown", "footer")), onClick: _cache[14] || (_cache[14] = vue.withModifiers(() => { }, ["stop"])) }, [ vue.renderSlot(_ctx.$slots, "footer") ], 2)) : vue.createCommentVNode("v-if", true) ]), _: 3 }, 512) ]), _: 3 }, 8, ["visible", "placement", "teleported", "popper-class", "popper-options", "fallback-placements", "effect", "transition", "persistent", "onBeforeShow"]) ], 34)), [ [_directive_click_outside, _ctx.handleClickOutside, _ctx.popperRef] ]); } var Select = /* @__PURE__ */ _export_sfc$1(_sfc_main$4, [["render", _sfc_render$1], ["__file", "select.vue"]]); const _sfc_main$3 = vue.defineComponent({ name: "ElOptionGroup", componentName: "ElOptionGroup", props: { label: String, disabled: Boolean }, setup(props) { const ns = useNamespace("select"); const groupRef = vue.ref(null); const instance = vue.getCurrentInstance(); const children = vue.ref([]); vue.provide(selectGroupKey, vue.reactive({ ...vue.toRefs(props) })); const visible = vue.computed(() => children.value.some((option) => option.visible === true)); const flattedChildren = (node) => { const children2 = []; if (isArray$2(node.children)) { node.children.forEach((child) => { var _a2, _b; if (child.type && child.type.name === "ElOption" && child.component && child.component.proxy) { children2.push(child.component.proxy); } else if ((_a2 = child.children) == null ? void 0 : _a2.length) { children2.push(...flattedChildren(child)); } else if ((_b = child.component) == null ? void 0 : _b.subTree) { children2.push(...flattedChildren(child.component.subTree)); } }); } return children2; }; const updateChildren = () => { children.value = flattedChildren(instance.subTree); }; vue.onMounted(() => { updateChildren(); }); useMutationObserver(groupRef, updateChildren, { attributes: true, subtree: true, childList: true }); return { groupRef, visible, ns }; } }); function _sfc_render(_ctx, _cache, $props, $setup, $data, $options) { return vue.withDirectives((vue.openBlock(), vue.createElementBlock("ul", { ref: "groupRef", class: vue.normalizeClass(_ctx.ns.be("group", "wrap")) }, [ vue.createElementVNode("li", { class: vue.normalizeClass(_ctx.ns.be("group", "title")) }, vue.toDisplayString(_ctx.label), 3), vue.createElementVNode("li", null, [ vue.createElementVNode("ul", { class: vue.normalizeClass(_ctx.ns.b("group")) }, [ vue.renderSlot(_ctx.$slots, "default") ], 2) ]) ], 2)), [ [vue.vShow, _ctx.visible] ]); } var OptionGroup = /* @__PURE__ */ _export_sfc$1(_sfc_main$3, [["render", _sfc_render], ["__file", "option-group.vue"]]); const ElSelect = withInstall(Select, { Option, OptionGroup }); const ElOption = withNoopInstall(Option); withNoopInstall(OptionGroup); const progressProps = buildProps({ type: { type: String, default: "line", values: ["line", "circle", "dashboard"] }, percentage: { type: Number, default: 0, validator: (val) => val >= 0 && val <= 100 }, status: { type: String, default: "", values: ["", "success", "exception", "warning"] }, indeterminate: { type: Boolean, default: false }, duration: { type: Number, default: 3 }, strokeWidth: { type: Number, default: 6 }, strokeLinecap: { type: definePropType(String), default: "round" }, textInside: { type: Boolean, default: false }, width: { type: Number, default: 126 }, showText: { type: Boolean, default: true }, color: { type: definePropType([ String, Array, Function ]), default: "" }, striped: Boolean, stripedFlow: Boolean, format: { type: definePropType(Function), default: (percentage) => `${percentage}%` } }); const _hoisted_1$2 = ["aria-valuenow"]; const _hoisted_2$1 = { viewBox: "0 0 100 100" }; const _hoisted_3$1 = ["d", "stroke", "stroke-linecap", "stroke-width"]; const _hoisted_4$1 = ["d", "stroke", "opacity", "stroke-linecap", "stroke-width"]; const _hoisted_5$1 = { key: 0 }; const __default__ = vue.defineComponent({ name: "ElProgress" }); const _sfc_main$2 = /* @__PURE__ */ vue.defineComponent({ ...__default__, props: progressProps, setup(__props) { const props = __props; const STATUS_COLOR_MAP = { success: "#13ce66", exception: "#ff4949", warning: "#e6a23c", default: "#20a0ff" }; const ns = useNamespace("progress"); const barStyle = vue.computed(() => ({ width: `${props.percentage}%`, animationDuration: `${props.duration}s`, backgroundColor: getCurrentColor(props.percentage) })); const relativeStrokeWidth = vue.computed(() => (props.strokeWidth / props.width * 100).toFixed(1)); const radius = vue.computed(() => { if (["circle", "dashboard"].includes(props.type)) { return Number.parseInt(`${50 - Number.parseFloat(relativeStrokeWidth.value) / 2}`, 10); } return 0; }); const trackPath = vue.computed(() => { const r = radius.value; const isDashboard = props.type === "dashboard"; return ` M 50 50 m 0 ${isDashboard ? "" : "-"}${r} a ${r} ${r} 0 1 1 0 ${isDashboard ? "-" : ""}${r * 2} a ${r} ${r} 0 1 1 0 ${isDashboard ? "" : "-"}${r * 2} `; }); const perimeter = vue.computed(() => 2 * Math.PI * radius.value); const rate = vue.computed(() => props.type === "dashboard" ? 0.75 : 1); const strokeDashoffset = vue.computed(() => { const offset = -1 * perimeter.value * (1 - rate.value) / 2; return `${offset}px`; }); const trailPathStyle = vue.computed(() => ({ strokeDasharray: `${perimeter.value * rate.value}px, ${perimeter.value}px`, strokeDashoffset: strokeDashoffset.value })); const circlePathStyle = vue.computed(() => ({ strokeDasharray: `${perimeter.value * rate.value * (props.percentage / 100)}px, ${perimeter.value}px`, strokeDashoffset: strokeDashoffset.value, transition: "stroke-dasharray 0.6s ease 0s, stroke 0.6s ease, opacity ease 0.6s" })); const stroke = vue.computed(() => { let ret; if (props.color) { ret = getCurrentColor(props.percentage); } else { ret = STATUS_COLOR_MAP[props.status] || STATUS_COLOR_MAP.default; } return ret; }); const statusIcon = vue.computed(() => { if (props.status === "warning") { return warning_filled_default; } if (props.type === "line") { return props.status === "success" ? circle_check_default : circle_close_default; } else { return props.status === "success" ? check_default : close_default; } }); const progressTextSize = vue.computed(() => { return props.type === "line" ? 12 + props.strokeWidth * 0.4 : props.width * 0.111111 + 2; }); const content = vue.computed(() => props.format(props.percentage)); function getColors(color) { const span = 100 / color.length; const seriesColors = color.map((seriesColor, index) => { if (isString(seriesColor)) { return { color: seriesColor, percentage: (index + 1) * span }; } return seriesColor; }); return seriesColors.sort((a, b) => a.percentage - b.percentage); } const getCurrentColor = (percentage) => { var _a2; const { color } = props; if (isFunction$1(color)) { return color(percentage); } else if (isString(color)) { return color; } else { const colors = getColors(color); for (const color2 of colors) { if (color2.percentage > percentage) return color2.color; } return (_a2 = colors[colors.length - 1]) == null ? void 0 : _a2.color; } }; return (_ctx, _cache) => { return vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([ vue.unref(ns).b(), vue.unref(ns).m(_ctx.type), vue.unref(ns).is(_ctx.status), { [vue.unref(ns).m("without-text")]: !_ctx.showText, [vue.unref(ns).m("text-inside")]: _ctx.textInside } ]), role: "progressbar", "aria-valuenow": _ctx.percentage, "aria-valuemin": "0", "aria-valuemax": "100" }, [ _ctx.type === "line" ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(ns).b("bar")) }, [ vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(ns).be("bar", "outer")), style: vue.normalizeStyle({ height: `${_ctx.strokeWidth}px` }) }, [ vue.createElementVNode("div", { class: vue.normalizeClass([ vue.unref(ns).be("bar", "inner"), { [vue.unref(ns).bem("bar", "inner", "indeterminate")]: _ctx.indeterminate }, { [vue.unref(ns).bem("bar", "inner", "striped")]: _ctx.striped }, { [vue.unref(ns).bem("bar", "inner", "striped-flow")]: _ctx.stripedFlow } ]), style: vue.normalizeStyle(vue.unref(barStyle)) }, [ (_ctx.showText || _ctx.$slots.default) && _ctx.textInside ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(ns).be("bar", "innerText")) }, [ vue.renderSlot(_ctx.$slots, "default", { percentage: _ctx.percentage }, () => [ vue.createElementVNode("span", null, vue.toDisplayString(vue.unref(content)), 1) ]) ], 2)) : vue.createCommentVNode("v-if", true) ], 6) ], 6) ], 2)) : (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass(vue.unref(ns).b("circle")), style: vue.normalizeStyle({ height: `${_ctx.width}px`, width: `${_ctx.width}px` }) }, [ (vue.openBlock(), vue.createElementBlock("svg", _hoisted_2$1, [ vue.createElementVNode("path", { class: vue.normalizeClass(vue.unref(ns).be("circle", "track")), d: vue.unref(trackPath), stroke: `var(${vue.unref(ns).cssVarName("fill-color-light")}, #e5e9f2)`, "stroke-linecap": _ctx.strokeLinecap, "stroke-width": vue.unref(relativeStrokeWidth), fill: "none", style: vue.normalizeStyle(vue.unref(trailPathStyle)) }, null, 14, _hoisted_3$1), vue.createElementVNode("path", { class: vue.normalizeClass(vue.unref(ns).be("circle", "path")), d: vue.unref(trackPath), stroke: vue.unref(stroke), fill: "none", opacity: _ctx.percentage ? 1 : 0, "stroke-linecap": _ctx.strokeLinecap, "stroke-width": vue.unref(relativeStrokeWidth), style: vue.normalizeStyle(vue.unref(circlePathStyle)) }, null, 14, _hoisted_4$1) ])) ], 6)), (_ctx.showText || _ctx.$slots.default) && !_ctx.textInside ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass(vue.unref(ns).e("text")), style: vue.normalizeStyle({ fontSize: `${vue.unref(progressTextSize)}px` }) }, [ vue.renderSlot(_ctx.$slots, "default", { percentage: _ctx.percentage }, () => [ !_ctx.status ? (vue.openBlock(), vue.createElementBlock("span", _hoisted_5$1, vue.toDisplayString(vue.unref(content)), 1)) : (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 1 }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(statusIcon)))) ]), _: 1 })) ]) ], 6)) : vue.createCommentVNode("v-if", true) ], 10, _hoisted_1$2); }; } }); var Progress = /* @__PURE__ */ _export_sfc$1(_sfc_main$2, [["__file", "progress.vue"]]); const ElProgress = withInstall(Progress); const _export_sfc = (sfc, props) => { const target = sfc.__vccOpts || sfc; for (const [key, val] of props) { target[key] = val; } return target; }; const _withScopeId = (n) => (vue.pushScopeId("data-v-b425a440"), n = n(), vue.popScopeId(), n); const _hoisted_1$1 = { class: "modal_code" }; const _hoisted_2 = { class: "header" }; const _hoisted_3 = { class: "content" }; const _hoisted_4 = { class: "produce" }; const _hoisted_5 = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ vue.createElementVNode("p", null, "1、扫描右侧公众号,点击关注!", -1)); const _hoisted_6 = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ vue.createElementVNode("p", null, "2、在情感棱镜后台回复:验证码", -1)); const _hoisted_7 = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ vue.createElementVNode("p", null, "3、在下方输入框输入获取的验证码后回车", -1)); const _hoisted_8 = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ vue.createElementVNode("div", { class: "img" }, [ /* @__PURE__ */ vue.createElementVNode("img", { src: "data:image/jpeg;base64,/9j/4AAQSkZJRgABAQAAAQABAAD/2wBDAAMCAgMCAgMDAwMEAwMEBQgFBQQEBQoHBwYIDAoMDAsKCwsNDhIQDQ4RDgsLEBYQERMUFRUVDA8XGBYUGBIUFRT/2wBDAQMEBAUEBQkFBQkUDQsNFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBQUFBT/wAARCAGuAa4DASIAAhEBAxEB/8QAHwAAAQUBAQEBAQEAAAAAAAAAAAECAwQFBgcICQoL/8QAtRAAAgEDAwIEAwUFBAQAAAF9AQIDAAQRBRIhMUEGE1FhByJxFDKBkaEII0KxwRVS0fAkM2JyggkKFhcYGRolJicoKSo0NTY3ODk6Q0RFRkdISUpTVFVWV1hZWmNkZWZnaGlqc3R1dnd4eXqDhIWGh4iJipKTlJWWl5iZmqKjpKWmp6ipqrKztLW2t7i5usLDxMXGx8jJytLT1NXW19jZ2uHi4+Tl5ufo6erx8vP09fb3+Pn6/8QAHwEAAwEBAQEBAQEBAQAAAAAAAAECAwQFBgcICQoL/8QAtREAAgECBAQDBAcFBAQAAQJ3AAECAxEEBSExBhJBUQdhcRMiMoEIFEKRobHBCSMzUvAVYnLRChYkNOEl8RcYGRomJygpKjU2Nzg5OkNERUZHSElKU1RVVldYWVpjZGVmZ2hpanN0dXZ3eHl6goOEhYaHiImKkpOUlZaXmJmaoqOkpaanqKmqsrO0tba3uLm6wsPExcbHyMnK0tPU1dbX2Nna4uPk5ebn6Onq8vP09fb3+Pn6/9oADAMBAAIRAxEAPwD9U6KKKACiiigAooooAKKKKACiiigAooooAKKKKACiiigAooooAKKKKACiiigAooooAKKKKACiiigAooooAKKKKACiiigAooooAKKKKACiiigAooooAKKKKACiiigAooooAKKKKACiiigAooooAKKKKACiiuR+KPxR8M/BjwJqfjHxlqY0bw5ppi+1Xv2eWfy/MlSJPkiVnOXkQcKcZyeATQB11FfKn/D0b9mL/opv/lA1T/5Go/4ejfsxf9FN/wDKBqn/AMjUAfVdFfKn/D0b9mL/AKKb/wCUDVP/AJGo/wCHo37MX/RTf/KBqn/yNQB9V0V8qf8AD0b9mL/opv8A5QNU/wDkaj/h6N+zF/0U3/ygap/8jUAfVdFfKn/D0b9mL/opv/lA1T/5Go/4ejfsxf8ARTf/ACgap/8AI1AH1XRXlHwM/ai+GP7Sf9t/8K48Tf8ACR/2L5H2/wD0C6tfJ87zPK/18Sbs+VJ93ONvOMjPU/FH4o+Gfgx4E1Pxj4y1MaN4c00xfar37PLP5fmSpEnyRKznLyIOFOM5PAJoA66ivlT/AIejfsxf9FN/8oGqf/I1H/D0b9mL/opv/lA1T/5GoA+q6K+VP+Ho37MX/RTf/KBqn/yNXqnwM/ai+GP7Sf8Abf8AwrjxN/wkf9i+R9v/ANAurXyfO8zyv9fEm7PlSfdzjbzjIyAer0UUUAFFfKn/AA9G/Zi/6Kb/AOUDVP8A5Gr334XfFHwz8Z/AmmeMfBupjWfDmpGX7Le/Z5YPM8uV4n+SVVcYeNxyozjI4INAHXUUVyPxR+KPhn4MeBNT8Y+MtTGjeHNNMX2q9+zyz+X5kqRJ8kSs5y8iDhTjOTwCaAOuor5U/wCHo37MX/RTf/KBqn/yNX1XQAUV8+/FH9vP4F/Bfxzqfg3xl45/sfxJpvlfa7L+yL+fy/MjSVPnigZDlJEPDHGcHkEVy3/D0b9mL/opv/lA1T/5GoA+q6K+ffhd+3n8C/jR450zwb4N8c/2x4k1Lzfsll/ZF/B5nlxvK/zywKgwkbnlhnGByQK+gqACiiigAooooAKKKKACivn34o/t5/Av4L+OdT8G+MvHP9j+JNN8r7XZf2Rfz+X5kaSp88UDIcpIh4Y4zg8giuW/4ejfsxf9FN/8oGqf/I1AH1XRXz78Lv28/gX8aPHOmeDfBvjn+2PEmpeb9ksv7Iv4PM8uN5X+eWBUGEjc8sM4wOSBX0FQAUUV8+/FH9vP4F/Bfxzqfg3xl45/sfxJpvlfa7L+yL+fy/MjSVPnigZDlJEPDHGcHkEUAfQVFfKn/D0b9mL/AKKb/wCUDVP/AJGo/wCHo37MX/RTf/KBqn/yNQB9V0V8qf8AD0b9mL/opv8A5QNU/wDkaj/h6N+zF/0U3/ygap/8jUAfVdFfKn/D0b9mL/opv/lA1T/5Go/4ejfsxf8ARTf/ACgap/8AI1AH1XRXyp/w9G/Zi/6Kb/5QNU/+RqP+Ho37MX/RTf8Aygap/wDI1AH1XRRRQAUUUUAFFFFABXyp/wAFRv8AkxP4m/8AcM/9OlpX1XXyp/wVG/5MT+Jv/cM/9OlpQB+AVFFf1UUAfyr0V/VRRQB/KvRX9VFFAH8q9Ff1UV+AP/BUb/k+v4mf9wz/ANNdpQB9Vf8ABDH/AJrZ/wBwT/2/r6p/4Kjf8mJ/E3/uGf8Ap0tK+Vv+CGP/ADWz/uCf+39fVP8AwVG/5MT+Jv8A3DP/AE6WlAH4BUUUUAFfqp/wQx/5rZ/3BP8A2/r6p/4Jc/8AJifwy/7if/p0u6+Vv+C53/NE/wDuN/8AthQB+qlFfgD/AMEuf+T6/hn/ANxP/wBNd3X7/UAfyr1+/v8AwS5/5MT+GX/cT/8ATpd1+AVfv7/wS5/5MT+GX/cT/wDTpd0AfVdfKn/BUb/kxP4m/wDcM/8ATpaV9V0UAfyr1/VRRX8q9AH1V/wVG/5Pr+Jn/cM/9NdpXyrX7+/8Euf+TE/hl/3E/wD06XdfK3/Bc7/mif8A3G//AGwoA+Vf+CXP/J9fwz/7if8A6a7uv3+r+VeigD+qiiv5V6/f3/glz/yYn8Mv+4n/AOnS7oA+q6K/Kv8A4Lnf80T/AO43/wC2FflXQB/VRRX8q9FAH1V/wVG/5Pr+Jn/cM/8ATXaV8q0UUAfVX/BLn/k+v4Z/9xP/ANNd3X7/AFfgD/wS5/5Pr+Gf/cT/APTXd1+/1ABX4A/8FRv+T6/iZ/3DP/TXaV+/1fgD/wAFRv8Ak+v4mf8AcM/9NdpQB8q0V+qn/BDH/mtn/cE/9v6/VSgD+Veiv6qKKAP5V6K/qoooA/lXor9/f+Co3/JifxN/7hn/AKdLSvwCoA/qoooooAKKKKACiiigAr5U/wCCo3/JifxN/wC4Z/6dLSvquvlT/gqN/wAmJ/E3/uGf+nS0oA/AKv6qK/lXr+qigD8gP28f28vjr8Fv2r/HPg3wd44/sXw3pv2H7JZf2RYT+X5lhbyv88sDOcvI55Y4zgcACvAf+Ho37Tn/AEU3/wAoGl//ACNSf8FRv+T6/iZ/3DP/AE12lfKtAH1X/wAPRv2nP+im/wDlA0v/AORqP+Ho37Tn/RTf/KBpf/yNXypRQB/VRX4A/wDBUb/k+v4mf9wz/wBNdpX7/V+AP/BUb/k+v4mf9wz/ANNdpQB9Vf8ABDH/AJrZ/wBwT/2/r9Jvij8LvDPxn8Can4O8ZaYNZ8OakYvtVl9olg8zy5UlT54mVxh40PDDOMHgkV+bP/BDH/mtn/cE/wDb+vv39qP45/8ADNnwK8TfEb+xf+Ei/sX7L/xLPtf2XzvOuooP9bsfbjzd33TnbjjOQAeV/wDDrn9mL/omX/lf1T/5Jo/4dc/sxf8ARMv/ACv6p/8AJNfK3/D87/qif/l1/wD3FX6qUAcj8Lvhd4Z+DHgTTPB3g3TBo3hzTTL9lsvtEs/l+ZK8r/PKzOcvI55Y4zgcACuW+Of7Lvwx/aT/ALE/4WP4Z/4SP+xfP+wf6fdWvk+d5fm/6iVN2fKj+9nG3jGTn1eigD59+F37BnwL+C/jnTPGXg3wN/Y/iTTfN+yXv9r38/l+ZG8T/JLOyHKSOOVOM5HIBr6CoooA/lXr9/f+CXP/ACYn8Mv+4n/6dLuvlb/hxj/1Wz/y1P8A7to/4bl/4dtf8Y4/8IV/wsT/AIQv/mZf7W/sv7Z9s/07/j28ify9n2vy/wDWNu2buN20AH6qV8+/t5/FDxP8GP2T/HPjLwfqf9jeI9NNj9kvfs8U/l+Zf28T/JKrIcpI45U4zkcgGuW/YZ/bm/4bP/4TYf8ACFf8If8A8I19h/5i3277T9o+0f8ATCLZt+z++d3bHPqn7UfwM/4aT+BXib4c/wBtf8I7/bX2X/iZ/ZPtXk+TdRT/AOq3puz5W37wxuzzjBAPxZ/4ejftOf8ARTf/ACgaX/8AI1fql/w65/Zi/wCiZf8Alf1T/wCSa+Vv+HGP/VbP/LU/+7a/VSgD8V/2of2ovid+xh8dPE3wb+Dfib/hDvhv4bFt/ZWi/YLW++zfaLWK6m/fXUUsz7priV/nc43YGFAA9U/Ya/42Tf8ACa/8NG/8XF/4Qz7D/YX/ADC/sf2z7R9p/wCPHyPM3/ZIP9Zu27PlxubPqn7UX/BKY/tJ/HXxN8Rv+Fo/8I5/bX2X/iWf8I/9q8nybWKD/W/ak3Z8rd90Y3Y5xk+V/wDKF7/qsP8Awsn/ALgf9nf2f/4E+b5n2/8A2NvlfxbvlAOq/bx/YN+BXwW/ZQ8c+MvB3gf+xfEmm/YRaXv9rX8/l+Zf28T/ACSzshykjjlTjORyAa/IGv1U/wCG5f8Ah5L/AMY4/wDCFf8ACu/+E0/5mX+1v7U+x/Y/9O/49vIg8zf9k8v/AFi7d+7nbtJ/w4x/6rZ/5an/AN20AfVP/Drn9mL/AKJl/wCV/VP/AJJr4C/ah/ai+J37GHx08TfBv4N+Jv8AhDvhv4bFt/ZWi/YLW++zfaLWK6m/fXUUsz7priV/nc43YGFAA9U/4fnf9UT/APLr/wDuKvgL9qP45/8ADSfx18TfEb+xf+Ed/tr7L/xLPtf2ryfJtYoP9bsTdnyt33RjdjnGSAffv7DX/Gyb/hNf+Gjf+Li/8IZ9h/sL/mF/Y/tn2j7T/wAePkeZv+yQf6zdt2fLjc2fqn/h1z+zF/0TL/yv6p/8k18rf8EMf+a2f9wT/wBv6/VSgD5U/wCHXP7MX/RMv/K/qn/yTR/w65/Zi/6Jl/5X9U/+Sa+q6KAPlT/h1z+zF/0TL/yv6p/8k18A/wDBVj9l34Yfs2f8Kv8A+FceGf8AhHBrX9qfb/8AT7q687yfsnlf6+V9uPNk+7jO7nOBj9qa/Kv/AILnf80T/wC43/7YUAfmx8Lvij4l+DHjrTPGPg3VP7G8R6aJfst79nin8vzInif5JVZDlJHHKnGcjkA179/w9G/ac/6Kb/5QNL/+Rq+VKKAP6qK/AH/gqN/yfX8TP+4Z/wCmu0r9/q/AH/gqN/yfX8TP+4Z/6a7SgD6q/wCCGP8AzWz/ALgn/t/X2l+3n8UPE/wY/ZP8c+MvB+p/2N4j002P2S9+zxT+X5l/bxP8kqshykjjlTjORyAa+Lf+CGP/ADWz/uCf+39fVP8AwVG/5MT+Jv8A3DP/AE6WlAH5W/8AD0b9pz/opv8A5QNL/wDkaj/h6N+05/0U3/ygaX/8jV8qUUAfVf8Aw9G/ac/6Kb/5QNL/APkavv3/AIJT/tRfE/8AaT/4Wh/wsbxN/wAJH/Yv9l/YP9AtbXyfO+1+b/qIk3Z8qP72cbeMZOfxXr9VP+CGP/NbP+4J/wC39AH1T/wVG/5MT+Jv/cM/9OlpX4BV+/v/AAVG/wCTE/ib/wBwz/06WlfgFQB/VRRRRQAUUUUAFFFFABXyp/wVG/5MT+Jv/cM/9OlpX1XXyp/wVG/5MT+Jv/cM/wDTpaUAfgFX9VFfyr1/VRQB+AP/AAVG/wCT6/iZ/wBwz/012lfKtfVX/BUb/k+v4mf9wz/012lfKtABRRRQB/VRX4A/8FRv+T6/iZ/3DP8A012lfv8AV+AP/BUb/k+v4mf9wz/012lAH1V/wQx/5rZ/3BP/AG/r6p/4Kjf8mJ/E3/uGf+nS0r5W/wCCGP8AzWz/ALgn/t/X1T/wVG/5MT+Jv/cM/wDTpaUAfgFX7+/8PRv2Yv8Aopv/AJQNU/8AkavwCooA/f3/AIejfsxf9FN/8oGqf/I1H/D0b9mL/opv/lA1T/5Gr8AqKAP39/4ejfsxf9FN/wDKBqn/AMjUf8PRv2Yv+im/+UDVP/kavwCooA/qor8Af+Co3/J9fxM/7hn/AKa7Sv3+r8Af+Co3/J9fxM/7hn/prtKAPqr/AIIY/wDNbP8AuCf+39fpN8Ufij4Z+DHgTU/GPjLUxo3hzTTF9qvfs8s/l+ZKkSfJErOcvIg4U4zk8AmvzZ/4IY/81s/7gn/t/X1T/wAFRv8AkxP4m/8AcM/9OlpQAf8AD0b9mL/opv8A5QNU/wDkaj/h6N+zF/0U3/ygap/8jV+AVFAH9PXwu+KPhn4z+BNM8Y+DdTGs+HNSMv2W9+zyweZ5crxP8kqq4w8bjlRnGRwQa+Lf+CrH7LvxP/aT/wCFX/8ACufDP/CR/wBi/wBqfb/9PtbXyfO+yeV/r5U3Z8qT7ucbecZGfVf+CXP/ACYn8Mv+4n/6dLuvqugD8gP2Dv2Dfjr8Fv2r/A3jLxj4H/sXw3pv277Xe/2vYT+X5lhcRJ8kU7OcvIg4U4zk8Amv1/oooA/AL/h1z+05/wBEy/8AK/pf/wAk0f8ADrn9pz/omX/lf0v/AOSa/f2igD8q/wBhr/jWz/wmv/DRv/Fuv+Ez+w/2F/zFPtn2P7R9p/48fP8AL2fa4P8AWbd2/wCXO1sfVP8Aw9G/Zi/6Kb/5QNU/+Rq+Vv8Agud/zRP/ALjf/thX5V0Afv7/AMPRv2Yv+im/+UDVP/kaj/h6N+zF/wBFN/8AKBqn/wAjV+AVFAH9PXwu+KPhn4z+BNM8Y+DdTGs+HNSMv2W9+zyweZ5crxP8kqq4w8bjlRnGRwQa/Nn/AILnf80T/wC43/7YV9U/8Euf+TE/hl/3E/8A06XdfK3/AAXO/wCaJ/8Acb/9sKAPyrooooA/qor8Af8AgqN/yfX8TP8AuGf+mu0r9/q/AH/gqN/yfX8TP+4Z/wCmu0oA+qv+CGP/ADWz/uCf+39fVP8AwVG/5MT+Jv8A3DP/AE6WlfK3/BDH/mtn/cE/9v6+qf8AgqN/yYn8Tf8AuGf+nS0oA/AKiiigAr9VP+CGP/NbP+4J/wC39flXX6qf8EMf+a2f9wT/ANv6APqn/gqN/wAmJ/E3/uGf+nS0r8Aq/f3/AIKjf8mJ/E3/ALhn/p0tK/AKgD+qiiiigAooooAKKKKACvlT/gqN/wAmJ/E3/uGf+nS0r6rr5U/4Kjf8mJ/E3/uGf+nS0oA/AKv6qK/lXr6r/wCHo37Tn/RTf/KBpf8A8jUAfv7RX4Bf8PRv2nP+im/+UDS//kaj/h6N+05/0U3/AMoGl/8AyNQB+/tFfgF/w9G/ac/6Kb/5QNL/APkaj/h6N+05/wBFN/8AKBpf/wAjUAfv7X4A/wDBUb/k+v4mf9wz/wBNdpS/8PRv2nP+im/+UDS//kavAfij8UfEvxn8dan4x8Zap/bPiPUhF9qvfs8UHmeXEkSfJEqoMJGg4UZxk8kmgD9J/wDghj/zWz/uCf8At/X1T/wVG/5MT+Jv/cM/9OlpXyt/wQx/5rZ/3BP/AG/r6p/4Kjf8mJ/E3/uGf+nS0oA/AKiiv39/4dc/sxf9Ey/8r+qf/JNAB/wS5/5MT+GX/cT/APTpd19V1+K/7UP7UXxO/Yw+Onib4N/BvxN/wh3w38Ni2/srRfsFrffZvtFrFdTfvrqKWZ901xK/zucbsDCgAfVH/BKf9qL4n/tJ/wDC0P8AhY3ib/hI/wCxf7L+wf6Ba2vk+d9r83/URJuz5Uf3s428YycgHqv/AAVG/wCTE/ib/wBwz/06WlfgFX7+/wDBUb/kxP4m/wDcM/8ATpaV+AVABRX7+/8ADrn9mL/omX/lf1T/AOSa/IT9vP4X+GPgx+1h458G+D9M/sbw5posfsll9oln8vzLC3lf55WZzl5HPLHGcDgAUAfPtfVX/BLn/k+v4Z/9xP8A9Nd3Xqv/AASn/Zd+GH7Sf/C0P+Fj+Gf+EjGi/wBl/YP9PurXyfO+1+b/AKiVN2fKj+9nG3jGTn6o/ah/Zd+GP7GHwK8TfGT4N+Gf+EP+JHhs239la19vur77N9ouorWb9zdSywvuhuJU+dDjdkYYAgA/QGv5V6+q/wDh6N+05/0U3/ygaX/8jV+qX/Drn9mL/omX/lf1T/5JoA/AKv1U/wCCGP8AzWz/ALgn/t/Xxb+3n8L/AAx8GP2sPHPg3wfpn9jeHNNFj9ksvtEs/l+ZYW8r/PKzOcvI55Y4zgcACvtL/ghj/wA1s/7gn/t/QB9U/wDBUb/kxP4m/wDcM/8ATpaV+AVfv7/wVG/5MT+Jv/cM/wDTpaV+AVABX7+/8Euf+TE/hl/3E/8A06XdH/Drn9mL/omX/lf1T/5Jr4C/ah/ai+J37GHx08TfBv4N+Jv+EO+G/hsW39laL9gtb77N9otYrqb99dRSzPumuJX+dzjdgYUAAA/aiivz/wD+CU/7UXxP/aT/AOFof8LG8Tf8JH/Yv9l/YP8AQLW18nzvtfm/6iJN2fKj+9nG3jGTn379vP4oeJ/gx+yf458ZeD9T/sbxHppsfsl79nin8vzL+3if5JVZDlJHHKnGcjkA0AfQVfyr19V/8PRv2nP+im/+UDS//kav1S/4dc/sxf8ARMv/ACv6p/8AJNAH4BUV9Bft5/C/wx8GP2sPHPg3wfpn9jeHNNFj9ksvtEs/l+ZYW8r/ADysznLyOeWOM4HAAr33/glP+y78MP2k/wDhaH/Cx/DP/CRjRf7L+wf6fdWvk+d9r83/AFEqbs+VH97ONvGMnIB8AUV+v37eP7BvwK+C37KHjnxl4O8D/wBi+JNN+wi0vf7Wv5/L8y/t4n+SWdkOUkccqcZyOQDX5A0Af1UV+AP/AAVG/wCT6/iZ/wBwz/012lfv9X4A/wDBUb/k+v4mf9wz/wBNdpQB9Vf8EMf+a2f9wT/2/r9VK/mu+Bn7UXxO/Zs/tv8A4Vx4m/4Rz+2vI+3/AOgWt153k+Z5X+vifbjzZPu4zu5zgY9U/wCHo37Tn/RTf/KBpf8A8jUAfv7RX4Bf8PRv2nP+im/+UDS//kaj/h6N+05/0U3/AMoGl/8AyNQB+/tFfgF/w9G/ac/6Kb/5QNL/APkaj/h6N+05/wBFN/8AKBpf/wAjUAfql/wVG/5MT+Jv/cM/9OlpX4BV9A/FH9vP46fGjwNqfg3xj45/tjw3qXlfa7L+yLCDzPLkSVPnigVxh40PDDOMHgkV8/UAf1UUUUUAFFFFABRRRQAV5R+1H8DP+Gk/gV4m+HP9tf8ACO/219l/4mf2T7V5Pk3UU/8Aqt6bs+Vt+8Mbs84wfV6KAPyr/wCHGP8A1Wz/AMtT/wC7aP8Ahxj/ANVs/wDLU/8Au2v1UooA/Kv/AIcY/wDVbP8Ay1P/ALto/wCHGP8A1Wz/AMtT/wC7a/VSvKPjn+1F8Mf2bP7E/wCFj+Jv+Ec/trz/ALB/oF1ded5Pl+b/AKiJ9uPNj+9jO7jODgA+Av8Ahxj/ANVs/wDLU/8Au2j/AIcY/wDVbP8Ay1P/ALtr7S+F37efwL+NHjnTPBvg3xz/AGx4k1Lzfsll/ZF/B5nlxvK/zywKgwkbnlhnGByQK+gqAPyr/wCHGP8A1Wz/AMtT/wC7aP8Ahxj/ANVs/wDLU/8Au2v1Ur59+KP7efwL+C/jnU/BvjLxz/Y/iTTfK+12X9kX8/l+ZGkqfPFAyHKSIeGOM4PIIoA5b9hn9hn/AIYw/wCE2P8Awmv/AAmH/CS/Yf8AmE/Yfs32f7R/03l37vtHtjb3zx6p+1H8DP8AhpP4FeJvhz/bX/CO/wBtfZf+Jn9k+1eT5N1FP/qt6bs+Vt+8Mbs84wT4GftRfDH9pP8Atv8A4Vx4m/4SP+xfI+3/AOgXVr5PneZ5X+viTdnypPu5xt5xkZ9XoA/Kv/hxj/1Wz/y1P/u2v1UoooA/AH/gqN/yfX8TP+4Z/wCmu0pf2Gv25f8AhjD/AITb/iiv+Ew/4SX7D/zFvsP2b7P9o/6YS7932j2xt7549+/bx/YN+Ovxp/av8c+MvB3gf+2vDepfYfsl7/a9hB5nl2FvE/ySzq4w8bjlRnGRwQa+Lfjn+y78Tv2bP7E/4WP4Z/4Rz+2vP+wf6fa3XneT5fm/6iV9uPNj+9jO7jODgA+qf2ov+CrI/aT+BXib4c/8Kv8A+Ec/tr7L/wATP/hIPtXk+TdRT/6r7Km7PlbfvDG7POMH8/6KKAP1U/4fnf8AVE//AC6//uKvgL9qP45/8NJ/HXxN8Rv7F/4R3+2vsv8AxLPtf2ryfJtYoP8AW7E3Z8rd90Y3Y5xk+UV9A/C79gz46fGjwNpnjLwd4G/tjw3qXm/ZL3+17CDzPLkeJ/klnVxh43HKjOMjgg0AdV+w1+3L/wAMYf8ACbf8UV/wmH/CS/Yf+Yt9h+zfZ/tH/TCXfu+0e2NvfPHqv7UX/BVkftJ/ArxN8Of+FX/8I5/bX2X/AImf/CQfavJ8m6in/wBV9lTdnytv3hjdnnGD5V/w65/ac/6Jl/5X9L/+Sa5X4o/sGfHT4L+BtT8ZeMfA39j+G9N8r7Xe/wBr2E/l+ZIkSfJFOznLyIOFOM5PAJoA+fq/VT/h+d/1RP8A8uv/AO4q/KuigD1f9qP45/8ADSfx18TfEb+xf+Ed/tr7L/xLPtf2ryfJtYoP9bsTdnyt33RjdjnGT6p+w1+3L/wxh/wm3/FFf8Jh/wAJL9h/5i32H7N9n+0f9MJd+77R7Y2988fKler/AAM/Zd+J37Sf9t/8K48M/wDCR/2L5H2//T7W18nzvM8r/Xypuz5Un3c4284yMgH37/w3L/w8l/4xx/4Qr/hXf/Caf8zL/a39qfY/sf8Ap3/Ht5EHmb/snl/6xdu/dzt2k/4cY/8AVbP/AC1P/u2uU/YO/YN+OvwW/av8DeMvGPgf+xfDem/bvtd7/a9hP5fmWFxEnyRTs5y8iDhTjOTwCa/X+gAr8Af+Co3/ACfX8TP+4Z/6a7Sv3+r8gP28f2Dfjr8af2r/ABz4y8HeB/7a8N6l9h+yXv8Aa9hB5nl2FvE/ySzq4w8bjlRnGRwQaAPAf2Gv25f+GMP+E2/4or/hMP8AhJfsP/MW+w/Zvs/2j/phLv3faPbG3vnj1X9qL/gqyP2k/gV4m+HP/Cr/APhHP7a+y/8AEz/4SD7V5Pk3UU/+q+ypuz5W37wxuzzjB8q/4dc/tOf9Ey/8r+l//JNcr8Uf2DPjp8F/A2p+MvGPgb+x/Dem+V9rvf7XsJ/L8yRIk+SKdnOXkQcKcZyeATQB8/V/VRX8q9fv7/w9G/Zi/wCim/8AlA1T/wCRqAPKv2ov+CUx/aT+Ovib4jf8LR/4Rz+2vsv/ABLP+Ef+1eT5NrFB/rftSbs+Vu+6Mbsc4yfVf2Gf2Gf+GMP+E2P/AAmv/CYf8JL9h/5hP2H7N9n+0f8ATeXfu+0e2NvfPB/w9G/Zi/6Kb/5QNU/+RqP+Ho37MX/RTf8Aygap/wDI1AHqn7UfwM/4aT+BXib4c/21/wAI7/bX2X/iZ/ZPtXk+TdRT/wCq3puz5W37wxuzzjB+Av8Ahxj/ANVs/wDLU/8Au2vtL4Xft5/Av40eOdM8G+DfHP8AbHiTUvN+yWX9kX8HmeXG8r/PLAqDCRueWGcYHJAr6CoAK/P/APai/wCCUx/aT+Ovib4jf8LR/wCEc/tr7L/xLP8AhH/tXk+TaxQf637Um7PlbvujG7HOMn9AKKAPyr/4cY/9Vs/8tT/7to/4cY/9Vs/8tT/7tr79+Of7UXwx/Zs/sT/hY/ib/hHP7a8/7B/oF1ded5Pl+b/qIn2482P72M7uM4OPK/8Ah6N+zF/0U3/ygap/8jUAfK3/AA4x/wCq2f8Alqf/AHbR/wAOMf8Aqtn/AJan/wB219U/8PRv2Yv+im/+UDVP/kaj/h6N+zF/0U3/AMoGqf8AyNQB8rf8OMf+q2f+Wp/920f8OMf+q2f+Wp/921+k3wu+KPhn4z+BNM8Y+DdTGs+HNSMv2W9+zyweZ5crxP8AJKquMPG45UZxkcEGuW+Of7UXwx/Zs/sT/hY/ib/hHP7a8/7B/oF1ded5Pl+b/qIn2482P72M7uM4OAD4C/4cY/8AVbP/AC1P/u2j/hxj/wBVs/8ALU/+7a+qf+Ho37MX/RTf/KBqn/yNR/w9G/Zi/wCim/8AlA1T/wCRqAPquiiigAooooAKKKKACiiigAoor+VegD+qivyr/wCC53/NE/8AuN/+2FfVP/BLn/kxP4Zf9xP/ANOl3X1XQB+AP/BLn/k+v4Z/9xP/ANNd3X7/AFfKn/BUb/kxP4m/9wz/ANOlpX4BUAf1UV+AP/BUb/k+v4mf9wz/ANNdpX7/AFFAH5V/8EMf+a2f9wT/ANv6/VSiigAooooAK/Kv/gud/wA0T/7jf/thXyr/AMFRv+T6/iZ/3DP/AE12lfVX/BDH/mtn/cE/9v6APyror+qiigD+Vev39/4Jc/8AJifwy/7if/p0u6+q6/AH/gqN/wAn1/Ez/uGf+mu0oA/f6vlT/gqN/wAmJ/E3/uGf+nS0r8Aq+qv+CXP/ACfX8M/+4n/6a7ugD5Vor+qiv5V6ACv1U/4IY/8ANbP+4J/7f19U/wDBLn/kxP4Zf9xP/wBOl3Xyt/wXO/5on/3G/wD2woA/VSiv5V6KAP6qKK/lXooA/qor5U/4Kjf8mJ/E3/uGf+nS0r8Aq+qv+CXP/J9fwz/7if8A6a7ugD5Vor+qiv5V6ACiv39/4Jc/8mJ/DL/uJ/8Ap0u6+q6APwB/4Jc/8n1/DP8A7if/AKa7uv3+oooAKK/lXooA/VT/AILnf80T/wC43/7YV+Vdfqp/wQx/5rZ/3BP/AG/r9VKAP5V6K/qor+VegD9/f+CXP/Jifwy/7if/AKdLuvlb/gud/wA0T/7jf/thX1T/AMEuf+TE/hl/3E//AE6XdfK3/Bc7/mif/cb/APbCgD8q6KKKAP6qKKKKACiiigAooooAK+ff28/ih4n+DH7J/jnxl4P1P+xvEemmx+yXv2eKfy/Mv7eJ/klVkOUkccqcZyOQDX0FXyp/wVG/5MT+Jv8A3DP/AE6WlAH5W/8AD0b9pz/opv8A5QNL/wDkavlSiigD6B+F37efx0+C/gbTPBvg7xz/AGP4b03zfsll/ZFhP5fmSPK/zywM5y8jnljjOBwAK/Sf/glP+1F8T/2k/wDhaH/CxvE3/CR/2L/Zf2D/AEC1tfJ877X5v+oiTdnyo/vZxt4xk5+V/wBl3/glMP2k/gV4Z+I3/C0P+Ec/tr7V/wASz/hH/tXk+TdSwf637Um7PlbvujG7HOMn79/YZ/YZ/wCGMP8AhNj/AMJr/wAJh/wkv2H/AJhP2H7N9n+0f9N5d+77R7Y2988AHvvxR+F3hn4z+BNT8HeMtMGs+HNSMX2qy+0SweZ5cqSp88TK4w8aHhhnGDwSK8C/4dc/sxf9Ey/8r+qf/JNeqftR/HP/AIZs+BXib4jf2L/wkX9i/Zf+JZ9r+y+d511FB/rdj7cebu+6c7ccZyPgL/h+d/1RP/y6/wD7ioA/VSvyA/bx/by+OvwW/av8c+DfB3jj+xfDem/Yfsll/ZFhP5fmWFvK/wA8sDOcvI55Y4zgcACur/4fnf8AVE//AC6//uKj/hhr/h5L/wAZHf8ACa/8K7/4TT/mWv7J/tT7H9j/ANB/4+fPg8zf9k8z/Vrt37edu4gHqn/BKf8Aai+J/wC0n/wtD/hY3ib/AISP+xf7L+wf6Ba2vk+d9r83/URJuz5Uf3s428Yyc+/ft5/FDxP8GP2T/HPjLwfqf9jeI9NNj9kvfs8U/l+Zf28T/JKrIcpI45U4zkcgGvi3/lC9/wBVh/4WT/3A/wCzv7P/APAnzfM+3/7G3yv4t3y+V/tRf8FWR+0n8CvE3w5/4Vf/AMI5/bX2X/iZ/wDCQfavJ8m6in/1X2VN2fK2/eGN2ecYIB5V/wAPRv2nP+im/wDlA0v/AORq/f2v5V6/VT/h+d/1RP8A8uv/AO4qAPlX/gqN/wAn1/Ez/uGf+mu0r6q/4IY/81s/7gn/ALf18BftR/HP/hpP46+JviN/Yv8Awjv9tfZf+JZ9r+1eT5NrFB/rdibs+Vu+6Mbsc4yfv3/ghj/zWz/uCf8At/QB9pft5/FDxP8ABj9k/wAc+MvB+p/2N4j002P2S9+zxT+X5l/bxP8AJKrIcpI45U4zkcgGvyE/4ejftOf9FN/8oGl//I1ftN+1H8DP+Gk/gV4m+HP9tf8ACO/219l/4mf2T7V5Pk3UU/8Aqt6bs+Vt+8Mbs84wfgL/AIcY/wDVbP8Ay1P/ALtoA/VSvn34o/sGfAv40eOdT8ZeMvA39seJNS8r7Xe/2vfweZ5caRJ8kU6oMJGg4UZxk8kmvoKvz/8A2ov+CrJ/Zs+Ovib4c/8ACrv+Ej/sX7L/AMTP/hIPsvnedaxT/wCq+yvtx5u37xztzxnAAPVf+HXP7MX/AETL/wAr+qf/ACTXU/C79gz4F/BfxzpnjLwb4G/sfxJpvm/ZL3+17+fy/MjeJ/klnZDlJHHKnGcjkA18W/8AD87/AKon/wCXX/8AcVeqfsu/8FWT+0n8dfDPw5/4Vd/wjn9tfav+Jn/wkH2ryfJtZZ/9V9lTdnytv3hjdnnGCAfoBX8q9f1UV/KvQB9A/C79vP46fBfwNpng3wd45/sfw3pvm/ZLL+yLCfy/MkeV/nlgZzl5HPLHGcDgAV9p/sNf8bJv+E1/4aN/4uL/AMIZ9h/sL/mF/Y/tn2j7T/x4+R5m/wCyQf6zdt2fLjc2fK/2Xf8AglMP2k/gV4Z+I3/C0P8AhHP7a+1f8Sz/AIR/7V5Pk3UsH+t+1Juz5W77oxuxzjJ+/f2Gf2Gf+GMP+E2P/Ca/8Jh/wkv2H/mE/Yfs32f7R/03l37vtHtjb3zwAeAft4/sG/Ar4LfsoeOfGXg7wP8A2L4k037CLS9/ta/n8vzL+3if5JZ2Q5SRxypxnI5ANfkDX9KP7UfwM/4aT+BXib4c/wBtf8I7/bX2X/iZ/ZPtXk+TdRT/AOq3puz5W37wxuzzjB+Av+HGP/VbP/LU/wDu2gD6p/4dc/sxf9Ey/wDK/qn/AMk0f8Ouf2Yv+iZf+V/VP/kmvquvz/8A2ov+CrJ/Zs+Ovib4c/8ACrv+Ej/sX7L/AMTP/hIPsvnedaxT/wCq+yvtx5u37xztzxnAAPVf+HXP7MX/AETL/wAr+qf/ACTXU/C79gz4F/BfxzpnjLwb4G/sfxJpvm/ZL3+17+fy/MjeJ/klnZDlJHHKnGcjkA18W/8AD87/AKon/wCXX/8AcVeqfsu/8FWT+0n8dfDPw5/4Vd/wjn9tfav+Jn/wkH2ryfJtZZ/9V9lTdnytv3hjdnnGCAfoBXyp/wAOuf2Yv+iZf+V/VP8A5Jr6rr8q/wDh+d/1RP8A8uv/AO4qAP0m+F3wu8M/BjwJpng7wbpg0bw5ppl+y2X2iWfy/MleV/nlZnOXkc8scZwOABXXV5R+y58c/wDhpP4FeGfiN/Yv/CO/219q/wCJZ9r+1eT5N1LB/rdibs+Vu+6Mbsc4yfK/25v25v8AhjD/AIQkf8IV/wAJh/wkv27/AJi32H7N9n+z/wDTCXfu+0e2NvfPAB1P7efxQ8T/AAY/ZP8AHPjLwfqf9jeI9NNj9kvfs8U/l+Zf28T/ACSqyHKSOOVOM5HIBr8hP+Ho37Tn/RTf/KBpf/yNX1T/AMNy/wDDyX/jHH/hCv8AhXf/AAmn/My/2t/an2P7H/p3/Ht5EHmb/snl/wCsXbv3c7dpP+HGP/VbP/LU/wDu2gD6p/4dc/sxf9Ey/wDK/qn/AMk1+Qn7efwv8MfBj9rDxz4N8H6Z/Y3hzTRY/ZLL7RLP5fmWFvK/zysznLyOeWOM4HAAr+iavz//AGov+CUx/aT+Ovib4jf8LR/4Rz+2vsv/ABLP+Ef+1eT5NrFB/rftSbs+Vu+6Mbsc4yQD8rvgZ+1F8Tv2bP7b/wCFceJv+Ec/tryPt/8AoFrded5PmeV/r4n2482T7uM7uc4GPtL9g79vL46/Gn9q/wADeDfGPjj+2vDepfbvtdl/ZFhB5nl2FxKnzxQK4w8aHhhnGDwSK8B/bl/Ya/4Yw/4Qn/itf+Ew/wCEl+3f8wn7D9m+z/Z/+m8u/d9o9sbe+ePK/wBlz45/8M2fHXwz8Rv7F/4SL+xftX/Es+1/ZfO861lg/wBbsfbjzd33TnbjjOQAf0o1/KvX6qf8Pzv+qJ/+XX/9xUf8OMf+q2f+Wp/920AfVP8AwS5/5MT+GX/cT/8ATpd16p8c/wBl34Y/tJ/2J/wsfwz/AMJH/Yvn/YP9PurXyfO8vzf9RKm7PlR/ezjbxjJyfsufAz/hmz4FeGfhz/bX/CRf2L9q/wCJn9k+y+d511LP/qt77cebt+8c7c8ZwPV6APzV/bx/YN+BXwW/ZQ8c+MvB3gf+xfEmm/YRaXv9rX8/l+Zf28T/ACSzshykjjlTjORyAa/IGv39/wCCo3/JifxN/wC4Z/6dLSvwCoA/qoooooAKKKKACiiigAr5U/4Kjf8AJifxN/7hn/p0tK+q6+VP+Co3/JifxN/7hn/p0tKAPwCooooA/f3/AIJc/wDJifwy/wC4n/6dLuvVPjn+1F8Mf2bP7E/4WP4m/wCEc/trz/sH+gXV153k+X5v+oifbjzY/vYzu4zg48r/AOCXP/Jifwy/7if/AKdLuvlb/gud/wA0T/7jf/thQB6n+1D+1F8Mf2z/AIFeJvg38G/E3/CYfEjxIbb+ytF+wXVj9p+z3UV1N++uoooU2w28r/O4ztwMsQD8B/8ADrn9pz/omX/lf0v/AOSaT/glz/yfX8M/+4n/AOmu7r9/qAP5V6/X79g79vL4FfBb9lDwN4N8Y+OP7F8Sab9uN3Zf2Tfz+X5l/cSp88UDIcpIh4Y4zg8givyBooA+/wD/AIKsftRfDD9pP/hV/wDwrjxN/wAJGNF/tT7f/oF1a+T532Tyv9fEm7PlSfdzjbzjIz8AUUUAFfVf/Drn9pz/AKJl/wCV/S//AJJr5Ur+qigD8Av+HXP7Tn/RMv8Ayv6X/wDJNffv/BKf9l34n/s2f8LQ/wCFjeGf+Ec/tr+y/sH+n2t153k/a/N/1Er7cebH97Gd3GcHH6AUUAcj8Ufij4Z+DHgTU/GPjLUxo3hzTTF9qvfs8s/l+ZKkSfJErOcvIg4U4zk8AmvAv+Ho37MX/RTf/KBqn/yNR/wVG/5MT+Jv/cM/9OlpX4BUAfv7/wAPRv2Yv+im/wDlA1T/AORq+Av2of2Xfid+2f8AHTxN8ZPg34Z/4TH4b+JBbf2VrX2+1sftP2e1itZv3N1LFMm2a3lT50GduRlSCfz/AK/f3/glz/yYn8Mv+4n/AOnS7oA/K3/h1z+05/0TL/yv6X/8k179+wd+wb8dfgt+1f4G8ZeMfA/9i+G9N+3fa73+17Cfy/MsLiJPkinZzl5EHCnGcngE1+v9FABX4Bf8Ouf2nP8AomX/AJX9L/8Akmv39ooA+ff2DPhf4n+DH7J/gbwb4w0z+xvEemm++12X2iKfy/Mv7iVPniZkOUkQ8McZweQRX0FRRQByPxR+KPhn4MeBNT8Y+MtTGjeHNNMX2q9+zyz+X5kqRJ8kSs5y8iDhTjOTwCa8C/4ejfsxf9FN/wDKBqn/AMjUf8FRv+TE/ib/ANwz/wBOlpX4BUAf1UV+AP8AwVG/5Pr+Jn/cM/8ATXaV+/1fgD/wVG/5Pr+Jn/cM/wDTXaUAfKtfVX/BLn/k+v4Z/wDcT/8ATXd18q19Vf8ABLn/AJPr+Gf/AHE//TXd0Afv9X8q9f1UV/KvQB+/v/BLn/kxP4Zf9xP/ANOl3Xyt/wAFzv8Amif/AHG//bCvqn/glz/yYn8Mv+4n/wCnS7r5W/4Lnf8ANE/+43/7YUAfFv7BnxQ8MfBj9rDwN4y8Yan/AGN4c00X32u9+zyz+X5lhcRJ8kSs5y8iDhTjOTwCa/Xv/h6N+zF/0U3/AMoGqf8AyNX4BUUAf1UV8+/FH9vP4F/Bfxzqfg3xl45/sfxJpvlfa7L+yL+fy/MjSVPnigZDlJEPDHGcHkEV9BV+AP8AwVG/5Pr+Jn/cM/8ATXaUAfVX7cv/ABsm/wCEK/4Zy/4uL/whn27+3f8AmF/Y/tn2f7N/x/eR5m/7JP8A6vdt2fNjcufiz4o/sGfHT4L+BtT8ZeMfA39j+G9N8r7Xe/2vYT+X5kiRJ8kU7OcvIg4U4zk8AmvtP/ghj/zWz/uCf+39fVP/AAVG/wCTE/ib/wBwz/06WlAH4BV/VRX8q9f1UUAfPvxR/bz+BfwX8c6n4N8ZeOf7H8Sab5X2uy/si/n8vzI0lT54oGQ5SRDwxxnB5BFdX8DP2ovhj+0n/bf/AArjxN/wkf8AYvkfb/8AQLq18nzvM8r/AF8Sbs+VJ93ONvOMjP4sf8FRv+T6/iZ/3DP/AE12lfVX/BDH/mtn/cE/9v6APqn/AIKjf8mJ/E3/ALhn/p0tK/AKv39/4Kjf8mJ/E3/uGf8Ap0tK/AKgD+qiiiigAooooAKKKKACvlT/AIKjf8mJ/E3/ALhn/p0tK+q6+VP+Co3/ACYn8Tf+4Z/6dLSgD8Aq/qor+Vev6qKACiiigD5U/wCCo3/JifxN/wC4Z/6dLSvwCr9/f+Co3/JifxN/7hn/AKdLSvwCoA/qoor8Av8Ah6N+05/0U3/ygaX/API1H/D0b9pz/opv/lA0v/5GoA/f2ivwC/4ejftOf9FN/wDKBpf/AMjUf8PRv2nP+im/+UDS/wD5GoA/f2ivwC/4ejftOf8ARTf/ACgaX/8AI1H/AA9G/ac/6Kb/AOUDS/8A5GoA/f2vyr/4Lnf80T/7jf8A7YV9pfsGfFDxP8Z/2T/A3jLxhqf9s+I9SN99rvfs8UHmeXf3ESfJEqoMJGg4UZxk8kmur+Of7Lvwx/aT/sT/AIWP4Z/4SP8AsXz/ALB/p91a+T53l+b/AKiVN2fKj+9nG3jGTkA/Fj/glz/yfX8M/wDuJ/8Apru6/f6vz+/ah/Zd+GP7GHwK8TfGT4N+Gf8AhD/iR4bNt/ZWtfb7q++zfaLqK1m/c3UssL7obiVPnQ43ZGGAI+A/+Ho37Tn/AEU3/wAoGl//ACNQB8qda2fC/hPW/HGu22ieG9H1DX9aug32fTtKtXubiXapdtkaAs2FVmOBwFJ6Cv3kH/BLr9mP/omX/lf1T/5Jro9O8A/BL9g3wLqus+HPC9t4civZtpFu8l1f38pUbYElndpCvybgm8IvzNgEsSDSbdkfkTpX/BMD9pTVbOK5X4dfZY5UV0W71ixikwRnlDPuUjuGAI9Ku/8ADqz9pb/oRLX/AMHth/8AHq+6td/4KJ+Or2+d9F8NeHtLsv4YdRE93L+LJJEPw21Rj/4KAfFqUbl0fwjtAySdOus/+lVZupFaXOlYaq1dI+I/+HVf7S3/AEIlr/4PbD/49X741+edh+338Uby4jibT/CEQJwznTrravv/AMfVXF/bs+KJuEiNh4QUO20ObG52/X/j6pe1h3D6tV7HhP7dv7AXxv8AjX+1X438aeEPCcGqeHdT+xfZbp9VtIS/l2MET/JJKrDDxuORzjPQ14H/AMOq/wBpX/oRLX/we2H/AMer9DJf2yfijBDJO0Hg2WCMAs8NncPj8ruq1v8At8+K2jUTafofmD75Symwfcf6RUOvBK6d/QpYWq3ax88/sJfsBfHD4KftV+CPGni/wnBpnh3TPtv2q6TVbSYp5ljPEnyRysxy8iDgcZz0FfrrXwdc/t7eMBg29noGO/mafcE/pc1kXH/BQH4jLnyNO8LsB3fTrn/5KpqtBieEqrofoRRXwBY/t7/EW4jfzNO8MLIB8oGn3OP/AEprc8If8FBdZtNZii8YeHrG509yBJPoiyRywj+8I3dw/wBNyn+VV7WHcl4equh9x0VlaBrth4n0Sy1fS7uO+068iWeG4iPyuhGQfb6HkdDXiX7eXxQ8T/Bj9k/xz4y8Han/AGN4j002P2S9+zxT+X5l/bxP8kqshykjjlTjORyAa1OY+gq/lXr6r/4ejftOf9FN/wDKBpf/AMjV8qUAfv7/AMEuf+TE/hl/3E//AE6XdfVdfzsfC79vP46fBfwNpng3wd45/sfw3pvm/ZLL+yLCfy/MkeV/nlgZzl5HPLHGcDgAV+k//BKf9qL4n/tJ/wDC0P8AhY3ib/hI/wCxf7L+wf6Ba2vk+d9r83/URJuz5Uf3s428YycgH6AUV8+/t5/FDxP8GP2T/HPjLwfqf9jeI9NNj9kvfs8U/l+Zf28T/JKrIcpI45U4zkcgGvyE/wCHo37Tn/RTf/KBpf8A8jUAfv7X4A/8FRv+T6/iZ/3DP/TXaUv/AA9G/ac/6Kb/AOUDS/8A5GrwH4o/FHxL8Z/HWp+MfGWqf2z4j1IRfar37PFB5nlxJEnyRKqDCRoOFGcZPJJoA5Kvqr/glz/yfX8M/wDuJ/8Apru69V/4JT/su/DD9pP/AIWh/wALH8M/8JGNF/sv7B/p91a+T532vzf9RKm7PlR/ezjbxjJz9UftQ/su/DH9jD4FeJvjJ8G/DP8Awh/xI8Nm2/srWvt91ffZvtF1FazfubqWWF90NxKnzocbsjDAEAH6A1/KvX1X/wAPRv2nP+im/wDlA0v/AORq/VL/AIdc/sxf9Ey/8r+qf/JNAB/wS5/5MT+GX/cT/wDTpd18rf8ABc7/AJon/wBxv/2wryv9qH9qL4nfsYfHTxN8G/g34m/4Q74b+Gxbf2Vov2C1vvs32i1iupv311FLM+6a4lf53ON2BhQAPVP2Gv8AjZN/wmv/AA0b/wAXF/4Qz7D/AGF/zC/sf2z7R9p/48fI8zf9kg/1m7bs+XG5sgH5V0V+v37eP7BvwK+C37KHjnxl4O8D/wBi+JNN+wi0vf7Wv5/L8y/t4n+SWdkOUkccqcZyOQDX5A0Af1UUUUUAFFFFABRRRQAV8qf8FRv+TE/ib/3DP/TpaV9V18+/t5/C/wAT/Gf9k/xz4N8H6Z/bPiPUjY/ZLL7RFB5nl39vK/zysqDCRueWGcYHJAoA/nZr+qivwC/4dc/tOf8ARMv/ACv6X/8AJNfql/w9G/Zi/wCim/8AlA1T/wCRqAPquiuR+F3xR8M/GfwJpnjHwbqY1nw5qRl+y3v2eWDzPLleJ/klVXGHjccqM4yOCDXLfHP9qL4Y/s2f2J/wsfxN/wAI5/bXn/YP9AurrzvJ8vzf9RE+3Hmx/exndxnBwAeV/wDBUb/kxP4m/wDcM/8ATpaV+AVftP8AtQ/tRfDH9s/4FeJvg38G/E3/AAmHxI8SG2/srRfsF1Y/afs91FdTfvrqKKFNsNvK/wA7jO3AyxAPwH/w65/ac/6Jl/5X9L/+SaAPlSv0A/Zd/wCCUw/aT+BXhn4jf8LQ/wCEc/tr7V/xLP8AhH/tXk+TdSwf637Um7PlbvujG7HOMnyr/h1z+05/0TL/AMr+l/8AyTX35+y9+1F8Mf2MPgV4Z+Dfxk8Tf8If8SPDZuf7V0X7BdX32b7RdS3UP761ilhfdDcRP8jnG7BwwIAB5Z/w4x/6rZ/5an/3bR/w4x/6rZ/5an/3bX378DP2ovhj+0n/AG3/AMK48Tf8JH/Yvkfb/wDQLq18nzvM8r/XxJuz5Un3c4284yM9T8Ufij4Z+DHgTU/GPjLUxo3hzTTF9qvfs8s/l+ZKkSfJErOcvIg4U4zk8AmgD82f+HGP/VbP/LU/+7aP+HGP/VbP/LU/+7a+qf8Ah6N+zF/0U3/ygap/8jUf8PRv2Yv+im/+UDVP/kagD5W/4bl/4dtf8Y4/8IV/wsT/AIQv/mZf7W/sv7Z9s/07/j28ify9n2vy/wDWNu2buN20fVP7DP7c3/DZ/wDwmw/4Qr/hD/8AhGvsP/MW+3faftH2j/phFs2/Z/fO7tjn8hP28/ih4Y+M/wC1h458ZeD9T/tnw5qQsfsl79nlg8zy7C3if5JVVxh43HKjOMjgg19pf8EMf+a2f9wT/wBv6APqn/gqN/yYn8Tf+4Z/6dLSvwCr9/f+Co3/ACYn8Tf+4Z/6dLSvwCoA/qlPBxXwF/wUK8QSz/Fnw5o0uGtbHRRexKeR5k08qOcfS3Svvtj+9j/H+VfAH7eOmS3vx30+SOBptvh20X5QT1urzArlxE/Z03Jndgoc9ZI+XZb1xdRzJBGhiIZflGDjpn1q5q13qOo3j3FyjJLIozsTYCMcYA4rq4fhrrMeGfRLpk6n90T/ADq9HoUMV1aJd21wkIINxAsYRgATwp+g6183LFU5TvF3a7PU+uVFqNmebrZSxtnJXPU1s2VjLMB8jf7wzzXp1zrHw/8ABdlc3WuafJYaTGDIL27nQSDAyQAcBj2Cjk8V8sz/ALcGnaTq1xHpfgtb3TPNISXULv8AfbORkBV2qSOccgfrRSrYnENqnTdl1ZnUeGw6TnPU9lk0uZIiiI/zc4PNQxaEbS2ku7ySOytY+ZJriQIi/Uk4FdH4M8Yf8Lf+E+reKvh7pb6rrFiv/IFuvkbzeCU3A4b5ckYIJ4HGa+Lv2hfGfxH1x9Nt/G3h+fwrbqHa1sPsslvHKQcM5EhJYjgZzx+PPVQoVakrTdvzOOvi6dOPNBXPsLQ9O0zWVb7DqNlqMZGDJaTrKB6fdJreg8DoAUiUSkjJLDpX57fALxLq/hr4ueF7jSS8kz38MUluBlZo3cK6MPQqT9Ovav1jvfFGhRRAw2kk5XpuYL/Kli3TwbSnLcWGq1MWm4x2PPIfhhDLFFP9ojhfHKHgirKfDC2t1WZnZ3Ax8qZq3rPjCa5lItkW0jzwAMn865rU9c1CXO27k2d+cCuaOPpdLs6Hg6snvY+1P2NWuIfhhqunzM/kWGtTQ26OfuRtDDKQPQb5XP4mvzZ/as/4Knf8NDfBXxZ8MW+GP9gDVZLeP+1f7f8AtPleRdxT58r7Kmd3k7fvDG7POMH9EP2FJ3uPhp4leRy7f8JDIMn/AK9LWv599Z/5DF9/13k/9CNfT0J+0pxmuqPk68HCrKD6MpUUV9V/8Ouf2nP+iZf+V/S//kmtzA+VK+q/2Gv25f8AhjD/AITb/iiv+Ew/4SX7D/zFvsP2b7P9o/6YS7932j2xt754P+HXP7Tn/RMv/K/pf/yTR/w65/ac/wCiZf8Alf0v/wCSaAPVf2ov+CrI/aT+BXib4c/8Kv8A+Ec/tr7L/wATP/hIPtXk+TdRT/6r7Km7PlbfvDG7POMH8/6+q/8Ah1z+05/0TL/yv6X/APJNH/Drn9pz/omX/lf0v/5JoA+qf+HGP/VbP/LU/wDu2j/hxj/1Wz/y1P8A7tr6p/4ejfsxf9FN/wDKBqn/AMjUf8PRv2Yv+im/+UDVP/kagD5W/wCUL3/VYf8AhZP/AHA/7O/s/wD8CfN8z7f/ALG3yv4t3yn/AA3L/wAPJf8AjHH/AIQr/hXf/Caf8zL/AGt/an2P7H/p3/Ht5EHmb/snl/6xdu/dzt2k/bl/42Tf8IV/wzl/xcX/AIQz7d/bv/ML+x/bPs/2b/j+8jzN/wBkn/1e7bs+bG5c8p+wd+wb8dfgt+1f4G8ZeMfA/wDYvhvTft32u9/tewn8vzLC4iT5Ip2c5eRBwpxnJ4BNAHV/8OMf+q2f+Wp/921+qlFfKn/D0b9mL/opv/lA1T/5GoA8q/ai/wCCUx/aT+Ovib4jf8LR/wCEc/tr7L/xLP8AhH/tXk+TaxQf637Um7PlbvujG7HOMnyv/lC9/wBVh/4WT/3A/wCzv7P/APAnzfM+3/7G3yv4t3y/VP8Aw9G/Zi/6Kb/5QNU/+Rq+Vv25f+Nk3/CFf8M5f8XF/wCEM+3f27/zC/sf2z7P9m/4/vI8zf8AZJ/9Xu27PmxuXIAf8Ny/8PJf+Mcf+EK/4V3/AMJp/wAzL/a39qfY/sf+nf8AHt5EHmb/ALJ5f+sXbv3c7dpP+HGP/VbP/LU/+7a5T9g79g346/Bb9q/wN4y8Y+B/7F8N6b9u+13v9r2E/l+ZYXESfJFOznLyIOFOM5PAJr9f6ACiiigAooooAKKKKACiivlT/gqN/wAmJ/E3/uGf+nS0oA+q6/lXoooA/f3/AIJc/wDJifwy/wC4n/6dLuvlb/gud/zRP/uN/wDthX1T/wAEuf8AkxP4Zf8AcT/9Ol3X1XQB+AP/AAS5/wCT6/hn/wBxP/013dfv9Xyp/wAFRv8AkxP4m/8AcM/9OlpX4BUAf1UV+AP/AAVG/wCT6/iZ/wBwz/012lfv9RQB+Vf/AAQx/wCa2f8AcE/9v6+qf+Co3/JifxN/7hn/AKdLSvlb/gud/wA0T/7jf/thX5V0AFFFf1UUAfyr1+qn/BDH/mtn/cE/9v6+Vf8AgqN/yfX8TP8AuGf+mu0r5VoA/f3/AIKjf8mJ/E3/ALhn/p0tK/AKvqr/AIJc/wDJ9fwz/wC4n/6a7uv3+oAgk/10f4/yNfGv7Yd6w+K8VkiwRiTRbORpX++cXF3hR7Z5+tfZcn+uj/H+Rr4k/bF8RNovxytU+zR3CP4etWIcc5+0XfevLzHl9g3Pa6PVy2LliUob2Z5ppOr62gjSG+uBFEdyoGLDPqAeK6g3k+pKJ72WKSRF2hpdqn6cfj1rzVvF1xdyjfmKEH7ikgfpVkajp8gLTxSykn7qy7V/xr5Bzo3vGOvc+2+rVn8Wx83fHXWJfiR+0ung671K3gtW0ifT7IyrmGG4lhdlOMcFm2LuHPTHQV8jeJPDl94W1270rUIvJvLZzHIgYNgj3HavavHniewj/apu9bdQun6bdCYqCWGIIs4z3yU/WvMbz4hXeofEoeL722t764+3LefZJ0zAQrArHt/uAALj0Ffa4ZSjCKW1l958TiuSUnffmt8j7Z/4J3aNJB8N9fvr10t7KfUSsPlMyyyMsab93baMjHfO7Par37dXw10LxJ4Ag19dUtNN1LSnZoftlxtF0hXLQqO8hIBA74PTrXcfC3xbL4s8DaTqvh+yt9O0+9i80W9nBHEqPnDjCgDIYEZ74zXxd+2X42vdf+LEukTySeVo0K2+wvkeY3zs2PX5lH/Aa+bw0q2KzGUl7qX/AA1j6LFUqWGy9JvmbtY2f2F7nwyvxOurbWYx/bE9sRpk8n3FIyZF9mK9D6Bh35+6pNS8OXXiBtLjv7X7ckRka1WUF1XgZKjkckdfWvyw+EE08PxH0OW3lEJjnLvIc8RhSZOnP3N3A9a9yWO9+K8EPiDRNY0fwpfC6EV5E121sJvL+WPq2NgQDC4z949MZ7MywPt6nPzW0OLLMUqVLltd328j7Hv1tQzqCpVfukdDXP3X2aZyhuEVevBq4ul2zafA736TSlQX+zuGTdgZAP1rIvrKJSSrjvxg8V8rSkovle59a6aeqPtL9hVYk+GniQQyeYn/AAkEnzD1+yWtfz7az/yGb7/rvJ/6Ea/oB/YITy/hh4mH/Uwyf+kdpXP/APBS/wD5MM+Jf/cM/wDTpaV+i4T+BD0PzXGq2ImvM/BCv6qK/lXorrOI/qoor+Vev1U/4IY/81s/7gn/ALf0AfqpRXyp/wAFRv8AkxP4m/8AcM/9OlpX4BUAFFFFAH6qf8EMf+a2f9wT/wBv6/VSvyr/AOCGP/NbP+4J/wC39fVP/BUb/kxP4m/9wz/06WlAH1XX8q9FFABX6qf8EMf+a2f9wT/2/r8q6/VT/ghj/wA1s/7gn/t/QB+qlFfKn/BUb/kxP4m/9wz/ANOlpX4BUAf1UUUUUAFFFFABRRRQAVyPxR+F3hn4z+BNT8HeMtMGs+HNSMX2qy+0SweZ5cqSp88TK4w8aHhhnGDwSK66igD5U/4dc/sxf9Ey/wDK/qn/AMk0f8Ouf2Yv+iZf+V/VP/kmvquvyr/4fnf9UT/8uv8A+4qAPK/2of2ovid+xh8dPE3wb+Dfib/hDvhv4bFt/ZWi/YLW++zfaLWK6m/fXUUsz7priV/nc43YGFAA+qP+CU/7UXxP/aT/AOFof8LG8Tf8JH/Yv9l/YP8AQLW18nzvtfm/6iJN2fKj+9nG3jGTn8rv2o/jn/w0n8dfE3xG/sX/AIR3+2vsv/Es+1/avJ8m1ig/1uxN2fK3fdGN2OcZPqn7DX7cv/DGH/Cbf8UV/wAJh/wkv2H/AJi32H7N9n+0f9MJd+77R7Y2988AH6pf8FRv+TE/ib/3DP8A06WlfgFX6qf8Ny/8PJf+Mcf+EK/4V3/wmn/My/2t/an2P7H/AKd/x7eRB5m/7J5f+sXbv3c7dpP+HGP/AFWz/wAtT/7toA/VSvyA/bx/by+OvwW/av8AHPg3wd44/sXw3pv2H7JZf2RYT+X5lhbyv88sDOcvI55Y4zgcACv1/r8//wBqL/glMf2k/jr4m+I3/C0f+Ec/tr7L/wASz/hH/tXk+TaxQf637Um7PlbvujG7HOMkA8r/AGGv+Nk3/Ca/8NG/8XF/4Qz7D/YX/ML+x/bPtH2n/jx8jzN/2SD/AFm7bs+XG5s/VP8Aw65/Zi/6Jl/5X9U/+SaP2Gf2Gf8AhjD/AITY/wDCa/8ACYf8JL9h/wCYT9h+zfZ/tH/TeXfu+0e2NvfPH1XQB8qf8Ouf2Yv+iZf+V/VP/kmvyt/4ejftOf8ARTf/ACgaX/8AI1fv7X8q9AHW/FH4o+JfjP461Pxj4y1T+2fEepCL7Ve/Z4oPM8uJIk+SJVQYSNBwozjJ5JNclX6Afsu/8Eph+0n8CvDPxG/4Wh/wjn9tfav+JZ/wj/2ryfJupYP9b9qTdnyt33RjdjnGT6p/w4x/6rZ/5an/AN20Afmx8Lvij4l+DHjrTPGPg3VP7G8R6aJfst79nin8vzInif5JVZDlJHHKnGcjkA179/w9G/ac/wCim/8AlA0v/wCRq9V/ai/4JTD9mz4FeJviN/wtD/hI/wCxfsv/ABLP+Ef+y+d511FB/rftT7cebu+6c7ccZyPz/oA/TH9gX9uz44/Gz9qnwj4R8aeN/wC2vDt9HevcWf8AZNjBvMdpNInzxQK4wyqeCOnPFfRn7asqx/HKyJiVz/wj9ryf+vm7r8+f+CVf/J8PgP8A64al/wCkE9foZ+2Xamf43WzemgWo6f8ATxdV89ntX2OClPzX5n0nD1NVcwhB9n+R4jFeq+8Gyhw3fHIqby1aI5hBABPvVq0048ccVrQaYTjivyKpmbTu2fs0Muilsfmf8WLGTQ/iJrUsxCtcCRwBjGXGGXHYAlh/wGvOX+/X09+3T4b07QPFuhy2xC3V5bSSTRgdF3/KfxJf8q+X881+25ZXWJwlOrbdI/Dc1o/VsZUpdmfoT+xrfy3nwQtI4ZGH2a9ngYZ77g/HthxXxZ8bNSk1f4s+LLuUsWbU7hRu64Vyo/QCvt39hW0Wb4Hs6jn+1rjd7nZF/TFfDPxZsrjT/iX4ot7pGS4j1O5Dq3XPmNXzmUVVPNcXC/wtH0OcQ5crwsu6MrwvqDaVrENwljDqMm140t50LqzMpUHA6kE5HuBX238Nv2ctB0/wPpg17RUk1eRUuLlGZxsfbjb14ODhgOCfTAx8cfC3wzc+MfHuiaPa3P2Oa6uVVJym7yyOd2O+MV+l3g2DXofClhF4keCXWkQpcS2/3JCGIV/YlcE+5PSlxLjpYSEI05Wb37+XyL4ZwUcTKU6kbpbdvP5lOC0j0+1jt4IEigjwFjUYAA6DFSeJden1y6NxNb28Em1Vxbx7BhRgfp61dukYA8VjXSH0/OvgKeIVSXNLc/QJ4VLZH2N+wU5f4Y+JiRj/AIqGT/0ktK9f8e/C/wAM/Gf4eaj4O8Y6Z/bPhzUvK+12X2iWDzPLlSVPniZXGHjQ8MM4weCRXkP7Bwx8NPEv/Ywyf+klrXyE3/Bbn+yp57X/AIUx5vlSNHv/AOEqxnBxnH2Kv2PL3fCU35I/FcyVsZVXmz6q/wCHXP7MX/RMv/K/qn/yTX4BV+qn/D87/qif/l1//cVH/DjH/qtn/lqf/dteieaflXX6qf8ABDH/AJrZ/wBwT/2/r4C/aj+Bn/DNnx18TfDn+2v+Ei/sX7L/AMTP7J9l87zrWKf/AFW99uPN2/eOdueM4H37/wAEMf8Amtn/AHBP/b+gD6p/4Kjf8mJ/E3/uGf8Ap0tK/AKv6Uf2o/gZ/wANJ/ArxN8Of7a/4R3+2vsv/Ez+yfavJ8m6in/1W9N2fK2/eGN2ecYPwF/w4x/6rZ/5an/3bQB9U/8ADrn9mL/omX/lf1T/AOSaP+HXP7MX/RMv/K/qn/yTX1XX5/8A7UX/AAVZP7Nnx18TfDn/AIVd/wAJH/Yv2X/iZ/8ACQfZfO861in/ANV9lfbjzdv3jnbnjOAAfVPwM/Zd+GP7Nn9t/wDCuPDP/COf215H2/8A0+6uvO8nzPK/18r7cebJ93Gd3OcDHU/FH4XeGfjP4E1Pwd4y0waz4c1IxfarL7RLB5nlypKnzxMrjDxoeGGcYPBIr82f+H53/VE//Lr/APuKj/h+d/1RP/y6/wD7ioA+qf8Ah1z+zF/0TL/yv6p/8k1+AVfqp/w/O/6on/5df/3FR/w4x/6rZ/5an/3bQB+Vder/AAM/ai+J37Nn9t/8K48Tf8I5/bXkfb/9AtbrzvJ8zyv9fE+3HmyfdxndznAwftR/Az/hmz46+Jvhz/bX/CRf2L9l/wCJn9k+y+d51rFP/qt77cebt+8c7c8ZwPVP2Gv2Gv8Ahs//AITb/itf+EP/AOEa+w/8wn7d9p+0faP+m8Wzb9n987u2OQDlfij+3n8dPjR4G1Pwb4x8c/2x4b1Lyvtdl/ZFhB5nlyJKnzxQK4w8aHhhnGDwSK+fq/QD9qL/AIJTD9mz4FeJviN/wtD/AISP+xfsv/Es/wCEf+y+d511FB/rftT7cebu+6c7ccZyPz/oA/qoooooAKKKKACiiigAooooAK/lXr+qiv5V6APoH4XfsGfHT40eBtM8ZeDvA39seG9S837Je/2vYQeZ5cjxP8ks6uMPG45UZxkcEGuV+Of7LvxO/Zs/sT/hY/hn/hHP7a8/7B/p9rded5Pl+b/qJX2482P72M7uM4OP2m/4Jc/8mJ/DL/uJ/wDp0u6+Vv8Agud/zRP/ALjf/thQB8W/sGfFDwx8GP2sPA3jLxhqf9jeHNNF99rvfs8s/l+ZYXESfJErOcvIg4U4zk8Amv17/wCHo37MX/RTf/KBqn/yNX4BUUAf1UV8+/FH9vP4F/Bfxzqfg3xl45/sfxJpvlfa7L+yL+fy/MjSVPnigZDlJEPDHGcHkEV9BV+AP/BUb/k+v4mf9wz/ANNdpQB+0/wM/ai+GP7Sf9t/8K48Tf8ACR/2L5H2/wD0C6tfJ87zPK/18Sbs+VJ93ONvOMjPq9flX/wQx/5rZ/3BP/b+v1UoAK/AL/h1z+05/wBEy/8AK/pf/wAk1+/tFAHz7+wZ8L/E/wAGP2T/AAN4N8YaZ/Y3iPTTffa7L7RFP5fmX9xKnzxMyHKSIeGOM4PIIrq/jn+1F8Mf2bP7E/4WP4m/4Rz+2vP+wf6BdXXneT5fm/6iJ9uPNj+9jO7jODj1evyr/wCC53/NE/8AuN/+2FAHqf7UP7UXwx/bP+BXib4N/BvxN/wmHxI8SG2/srRfsF1Y/afs91FdTfvrqKKFNsNvK/zuM7cDLEA/Af8Aw65/ac/6Jl/5X9L/APkmk/4Jc/8AJ9fwz/7if/pru6/f6gD8iP2Bf2FPjj8Ev2qPCPi7xp4I/sXw7Yx3q3F5/a1jPsMlpNGnyRTs5yzKOAevPFfVP7WVobn41QEDONCtR/5Huq+x5eZY/qf5GvlH9paBZfjChbH/ACBbUdf+m9zXxXGFX2OUzn5r8z7DhNJ5rTT7P8jx+x0o8cVsxaWxQgfKSODitKwtIzgcAmuisdNSQDA/Sv5ir5lyu9z9xr4iNNNH5M/ta/D/AMVeEPiXe3viS7m1SG9k/wBE1CZFiE6hVJCICcKm4LnGMivCc/MK/Y34z/sY+Ffj7rNvq2t6nrNreW9uLaJLKaMRIoJbOxo25yTnkZ49K/LH46fCy6+C3xS17wfczG5OnTbYrgps86JgGjfGTjKsDjPBzX9LcKcSYLOcPGhSl+8hFcytby0P5+zjCzo4iVT7Mnp3PpT9gD4wWtjdXXw91LbGb2Z7zTpjxul2DfGfqqgj/dPrXGft/wDgv/hHPjLb6nHFth1jT47gt2MiEo36KhP1rb/4Ju6b4Z1v4xX9jrmmW97qa2Ju9KuJ03GGaJ1LbQeN21ic9Rt4r2L/AIKe+CVbwN4V8RRrh7K/eyfj+GWMsPwzF+teNUxdHA8XQoQTTqx17N7pr7vvPVVSeJyVwm78j08kfP37BPhO11/4q399cxrI+l6c80AP8MjOqZ/BWf8AOvvK904gH/CvjT/gm/5bePvFYLAv/ZSkJjkjzlyenYkD8a+7rwRjI2V8pxpjJQzd029FFWPvOEYx/s9WWrbPP7yxbJHJFYV5YEE8Ma9BvBEc/uv1rBu2hQnMGfxr56hjWz62rQdj6b/YXi8n4b+Jlxj/AIqCQ/8Akpa1+TV9/wAEx/2ltQ1G6ng+G3mRSSu6t/bumDILEjrc1+uP7Fjq/gLxKUTyx/br8f8AbrbV7vpH/HsK/orKJc+ApS7xR/O+brlx9Zf3mfgj/wAOuf2nP+iZf+V/S/8A5Jr9/aKK9c8k/AH/AIKjf8n1/Ez/ALhn/prtK9V/4JT/ALUXww/Zs/4Wh/wsfxN/wjg1r+y/sH+gXV153k/a/N/1ET7cebH97Gd3GcHHlX/BUb/k+v4mf9wz/wBNdpXyrQB+/v8Aw9G/Zi/6Kb/5QNU/+RqP+Ho37MX/AEU3/wAoGqf/ACNX4BUUAf1UV+AP/BUb/k+v4mf9wz/012lfv9X4A/8ABUb/AJPr+Jn/AHDP/TXaUAfKtFFFABX9VFfyr1/VRQB+QH7eP7Bvx1+NP7V/jnxl4O8D/wBteG9S+w/ZL3+17CDzPLsLeJ/klnVxh43HKjOMjgg11f7DX/Gtn/hNf+Gjf+Ldf8Jn9h/sL/mKfbPsf2j7T/x4+f5ez7XB/rNu7f8ALna2P1Ur8q/+C53/ADRP/uN/+2FAHqf7UP7UXwx/bP8AgV4m+Dfwb8Tf8Jh8SPEhtv7K0X7BdWP2n7PdRXU3766iihTbDbyv87jO3AyxAPwH/wAOuf2nP+iZf+V/S/8A5JpP+CXP/J9fwz/7if8A6a7uv3+oAKKKKACiiigAooooAK+VP+Co3/JifxN/7hn/AKdLSvquvlT/AIKjf8mJ/E3/ALhn/p0tKAPwCooooA/f3/glz/yYn8Mv+4n/AOnS7r6rr5U/4Jc/8mJ/DL/uJ/8Ap0u68q/4KsftRfE/9mz/AIVf/wAK58Tf8I5/bX9qfb/9AtbrzvJ+yeV/r4n2482T7uM7uc4GAD9AKK/ID9g79vL46/Gn9q/wN4N8Y+OP7a8N6l9u+12X9kWEHmeXYXEqfPFArjDxoeGGcYPBIr9f6AP5V6/f3/glz/yYn8Mv+4n/AOnS7r8Aq+gfhd+3n8dPgv4G0zwb4O8c/wBj+G9N837JZf2RYT+X5kjyv88sDOcvI55Y4zgcACgD+ievlT/gqN/yYn8Tf+4Z/wCnS0ryr/glP+1F8T/2k/8AhaH/AAsbxN/wkf8AYv8AZf2D/QLW18nzvtfm/wCoiTdnyo/vZxt4xk5+0vij8LvDPxn8Can4O8ZaYNZ8OakYvtVl9olg8zy5UlT54mVxh40PDDOMHgkUAfzC0V+/v/Drn9mL/omX/lf1T/5Jo/4dc/sxf9Ey/wDK/qn/AMk0AH/BLn/kxP4Zf9xP/wBOl3X1XXI/C74XeGfgx4E0zwd4N0waN4c00y/ZbL7RLP5fmSvK/wA8rM5y8jnljjOBwAK+Lf8Agqx+1F8T/wBmz/hV/wDwrnxN/wAI5/bX9qfb/wDQLW687yfsnlf6+J9uPNk+7jO7nOBgA9V/4Kjf8mJ/E3/uGf8Ap0tK/AKvoH4o/t5/HT40eBtT8G+MfHP9seG9S8r7XZf2RYQeZ5ciSp88UCuMPGh4YZxg8Eivn6gD63/4JWH/AIzf8Cf9cNS/9IJ6/UL9o2FJvjEgaRFb+xbXhmAP+vua/Jj/AIJ0eM7HwL+2l8L7/UZJUtbm/l0seSm4mW7t5baEEenmzR5PYZPavrz/AILNfC/X7XxR4L+J1hHO+i/2f/YN7NBnFtKksk0JfHQP50gB9Ux3GfAzzKf7bwcsHz8t2ne19nc9jKsweWYpYlR5rJq3qfRej6P5jooeMsegDDNd7onh1VUGV0QepbAr8ELTxhq1tKskWp3cci9HSdgR9DmtO4+I3iG9j2XOuajOg52y3UjD9TX49iPCerVemL09P+CfT4jil4lW5bH9BVlp1moAEscnH8LA1+NP/BS/VLTU/wBq/wAQRWiKv2K0tLWUqc7pBEGJ/AOB+FeFW3j/AFjT/nh1W8hIGMpOy/yNc3dapPq+rG7vJXnmkfLPIxYn6k19NwlwC+F8bPFyr894uKVrbtPu+x8xjMasTFK5+l3/AATM/ZKbSrOH4seI2khu7mJ4tHsfu4iYYad/94ZCj057ivbP+CgnhDTNQ/Zh8YvcXcVo9msN1E8ibv3iyrtQY5BbO0H/AGueK/KLwr8Y/F3gi6FzoHiTVNImGBusrt4sgdAQDyPY10fxE/av+JfxD8F3fhvxD4mm1XSrtk82OeKPc21gw+cKG6qO9Z5hwbmuM4hpZxLEJwg0+W1mkney3v1NaWKp06EqSe6Nb9hPxhF4W/aK0K3upPLstYWXTZucZLrmMfjIqfnX6pXdjpYz1Puz/wD1q/Drwvr9z4V8Q6brNmQt3YXMd1Cx7OjBl/UV9SQ/t8eNpLuOW407R2tv44o45ELfRi5x+Rq+MeE8VnmJp4nB2uo2d3bbY9/h/NqGChKniJuKvpb8T9C7ix0w/wAI/wC+qoy2ekLy0cePevi61/bxsrj/AI/dCvLfjrbzLJz+O2szW/23UkUf2Zp0in+Jrxv0AU/1r8+pcE5wpqMoNfNH6N/buVxp8/1i/wB5+sn7Kq2q+E/EgtVVY/7ZPC9M/ZbavNf+Cl//ACYb8S/+4Z/6dLSur/Yc0vxFp3wEtNd8WWZ03UvEFxLrAsipV4IGSNIgwJyCyRq+O28A4ORXK/8ABS/5f2DPiVn00z/052lf0NlOGqYPA0sPU+KKSZ+H5lWhiMZVq03eMm2j8D6KK/f3/h1z+zF/0TL/AMr+qf8AyTXrHmh/wS5/5MT+GX/cT/8ATpd19V1yPwu+F3hn4MeBNM8HeDdMGjeHNNMv2Wy+0Sz+X5kryv8APKzOcvI55Y4zgcACuuoAKK+ff28/ih4n+DH7J/jnxl4P1P8AsbxHppsfsl79nin8vzL+3if5JVZDlJHHKnGcjkA1+Qn/AA9G/ac/6Kb/AOUDS/8A5GoA/f2vwB/4Kjf8n1/Ez/uGf+mu0pf+Ho37Tn/RTf8AygaX/wDI1ffn7L37Lvwx/bP+BXhn4yfGTwz/AMJh8SPEhuf7V1r7fdWP2n7PdS2sP7m1lihTbDbxJ8iDO3JyxJIB5Z/wQx/5rZ/3BP8A2/r9VK/Kv9uX/jWz/wAIV/wzl/xbr/hM/t39u/8AMU+2fY/s/wBm/wCP7z/L2fa5/wDV7d2/5s7Vx8rf8PRv2nP+im/+UDS//kagD9/aK/AL/h6N+05/0U3/AMoGl/8AyNR/w9G/ac/6Kb/5QNL/APkagBP+Co3/ACfX8TP+4Z/6a7SvlWut+KPxR8S/Gfx1qfjHxlqn9s+I9SEX2q9+zxQeZ5cSRJ8kSqgwkaDhRnGTySa5KgD6q/4Jc/8AJ9fwz/7if/pru6/f6v5hPhd8UfEvwY8daZ4x8G6p/Y3iPTRL9lvfs8U/l+ZE8T/JKrIcpI45U4zkcgGvfv8Ah6N+05/0U3/ygaX/API1AH7+0UUUAFFFFABRRRQAV5R+1H8DP+Gk/gV4m+HP9tf8I7/bX2X/AImf2T7V5Pk3UU/+q3puz5W37wxuzzjB9Xrkfij8UfDPwY8Can4x8ZamNG8OaaYvtV79nln8vzJUiT5IlZzl5EHCnGcngE0Afmz/AMOMf+q2f+Wp/wDdtflXX7+/8PRv2Yv+im/+UDVP/kavwCoA/f3/AIJc/wDJifwy/wC4n/6dLuvlb/gud/zRP/uN/wDthX1T/wAEuf8AkxP4Zf8AcT/9Ol3Xyt/wXO/5on/3G/8A2woA+Av2XPjn/wAM2fHXwz8Rv7F/4SL+xftX/Es+1/ZfO861lg/1ux9uPN3fdOduOM5H37/w/O/6on/5df8A9xV+bHwu+F3iX4z+OtM8HeDdL/tnxHqQl+y2X2iKDzPLieV/nlZUGEjc8sM4wOSBXv3/AA65/ac/6Jl/5X9L/wDkmgD5Ur9AP2Xf+CUw/aT+BXhn4jf8LQ/4Rz+2vtX/ABLP+Ef+1eT5N1LB/rftSbs+Vu+6Mbsc4yfKv+HXP7Tn/RMv/K/pf/yTX35+y9+1F8Mf2MPgV4Z+Dfxk8Tf8If8AEjw2bn+1dF+wXV99m+0XUt1D++tYpYX3Q3ET/I5xuwcMCAAeWf8AKF7/AKrD/wALJ/7gf9nf2f8A+BPm+Z9v/wBjb5X8W75fVP2Xf+CrJ/aT+Ovhn4c/8Ku/4Rz+2vtX/Ez/AOEg+1eT5NrLP/qvsqbs+Vt+8Mbs84wflb/gqx+1F8MP2k/+FX/8K48Tf8JGNF/tT7f/AKBdWvk+d9k8r/XxJuz5Un3c4284yM+BfsGfFDwx8GP2sPA3jLxhqf8AY3hzTRffa737PLP5fmWFxEnyRKznLyIOFOM5PAJoA/omor5U/wCHo37MX/RTf/KBqn/yNX1XQAV8qftzfsM/8Nn/APCEn/hNf+EP/wCEa+3f8wn7d9p+0fZ/+m8Wzb9n987u2OfquvKPjn+1F8Mf2bP7E/4WP4m/4Rz+2vP+wf6BdXXneT5fm/6iJ9uPNj+9jO7jODgA/K79qL/glMP2bPgV4m+I3/C0P+Ej/sX7L/xLP+Ef+y+d511FB/rftT7cebu+6c7ccZyPz/r9p/2of2ovhj+2f8CvE3wb+Dfib/hMPiR4kNt/ZWi/YLqx+0/Z7qK6m/fXUUUKbYbeV/ncZ24GWIB+A/8Ah1z+05/0TL/yv6X/APJNAHyqGKkEHBHQiv2J/ZL/AOCjfw5+PHw1g+Gnx5m0zTNee1NjcX+vbRpOtQomRJLJIdsMxCncHIVnAMbAuI0/HWvoH4X/ALBnxz+M/gXTPGXg7wKdY8N6kJfsl7/a1jB5nlyPE/ySzq4w8bjlRnGRwQaAP061z/gkJ8APGN7/AGvpGoeKtE0+7Anht9F1WCS12MMqY2mhlYqQQQd54qiP+CLnwTH/ADNXj/8A8GFj/wDIdfld8af2bPir+zENH/4T/QZfCv8AbfnfYtmo28/n+Ts8z/USvjb5yfexndxnBxzvww8F+N/jN450zwd4OhudY8R6l5v2WyF4sPmeXE8r/PI6oMJG55I6YHOBV80l1FZH64t/wRa+CbjB8VeP8f8AYQsf/kOkX/giv8EVYEeKviBkf9RGx/8AkOvgj/h23+1X/wBCBe/+FDp//wAk199f8N3/ALMv/RSf/KHqf/yNUtt6jHj/AIIw/BQY/wCKq8f/APgwsf8A5Dpkn/BF34JygA+KfH+B6ahY/wDyHXyH8d/2YPiz+1V8V9c+KXwX0O68WfDXXvI/snWI9SgsVuPIgjt58Q3MscqbZ4Zl+ZBnbkZBBP0j/wAE5v2Rvir8H/8AhYX/AAs3w7caL/aP9nf2f5moQXfm+X9p83Hkyvtxvj+9jOeM4OG23pcVjp/+HKvwR/6Gr4gf+DCx/wDkOph/wRh+CoUD/hKvH+P+whY//IdfUX/Crv8Apk/5Gj/hV3/TJ/yNTdrYZ8vf8OYvgrz/AMVX4/8A/BhY/wDyHXR+D/8Agnr+zZ+zFcReMvE98byG0mTyNQ8fatbpZwTE/J8uyKJmyOA4bnoMiuYH7d/7MgP/ACUn/wAomp//ACNX5hftn+PfDHxM/aW8YeJfB+pf2x4bvvsf2W9EEsPmbLKCN/klVXGHRxyBnGRwQarmfcVkftL8Dv2xPCX7VfjHxjo/gGG7ufD/AIZWxMmtXUbQi/knNxxHCwDrGogU7nwzFiNihAX7b9pj4Ef8NH/AXxJ8OP7a/wCEd/toWv8AxM/sn2ryfJuop/8AVb03Z8rb94Y3Z5xg/lh/wSr/AGm/hh+zg/xNb4j+Jv8AhHf7Y/sv7B/oF1ded5X2vzf9RE+3Hmx/exndxnBx+gQ/4Ki/sxKMf8LN/wDKBqn/AMjVIz5W/wCHGP8A1Wz/AMtT/wC7aP8Ah+d/1RP/AMuv/wC4q+qf+Ho37MX/AEU3/wAoGqf/ACNX5W/8Ouf2nP8AomX/AJX9L/8AkmgD6p/4fnf9UT/8uv8A+4q+qf2Gf25v+Gz/APhNh/whX/CH/wDCNfYf+Yt9u+0/aPtH/TCLZt+z++d3bHP5W/8ADrn9pz/omX/lf0v/AOSa+qf2Gv8AjWz/AMJr/wANG/8AFuv+Ez+w/wBhf8xT7Z9j+0faf+PHz/L2fa4P9Zt3b/lztbAB9U/8FRv+TE/ib/3DP/TpaV+AVftP+1D+1F8Mf2z/AIFeJvg38G/E3/CYfEjxIbb+ytF+wXVj9p+z3UV1N++uoooU2w28r/O4ztwMsQD8B/8ADrn9pz/omX/lf0v/AOSaAPqn/hxj/wBVs/8ALU/+7aP+G5f+HbX/ABjj/wAIV/wsT/hC/wDmZf7W/sv7Z9s/07/j28ify9n2vy/9Y27Zu43bR9U/8PRv2Yv+im/+UDVP/kavyE/bz+KHhj4z/tYeOfGXg/U/7Z8OakLH7Je/Z5YPM8uwt4n+SVVcYeNxyozjI4INAH2l/wApof8Aqj3/AArb/uOf2j/aH/gN5Xl/YP8Ab3eb/Dt+byv9qL/glMP2bPgV4m+I3/C0P+Ej/sX7L/xLP+Ef+y+d511FB/rftT7cebu+6c7ccZyPVP8Aghj/AM1s/wC4J/7f19pft5/C/wAT/Gf9k/xz4N8H6Z/bPiPUjY/ZLL7RFB5nl39vK/zysqDCRueWGcYHJAoA/nZor6r/AOHXP7Tn/RMv/K/pf/yTXypQB+gH7Lv/AASmH7SfwK8M/Eb/AIWh/wAI5/bX2r/iWf8ACP8A2ryfJupYP9b9qTdnyt33RjdjnGT5V+3L+w1/wxh/whP/ABWv/CYf8JL9u/5hP2H7N9n+z/8ATeXfu+0e2NvfPH6pf8Euf+TE/hl/3E//AE6XdeVf8FWP2Xfif+0n/wAKv/4Vz4Z/4SP+xf7U+3/6fa2vk+d9k8r/AF8qbs+VJ93ONvOMjIB+V37LnwM/4aT+Ovhn4c/21/wjv9tfav8AiZ/ZPtXk+Tayz/6rem7PlbfvDG7POMH79/4cY/8AVbP/AC1P/u2vK/2Xv2Xfid+xh8dPDPxk+Mnhn/hDvhv4bFz/AGrrX2+1vvs32i1ltYf3NrLLM+6a4iT5EON2ThQSPv3/AIejfsxf9FN/8oGqf/I1AH1XRRRQAUUUUAFFFFABXyp/wVG/5MT+Jv8A3DP/AE6WlfVdFAH8q9Ff1UV/KvQB+/v/AAS5/wCTE/hl/wBxP/06XdfK3/Bc7/mif/cb/wDbCvyrooA+qv8Aglz/AMn1/DP/ALif/pru6/f6vwB/4Jc/8n1/DP8A7if/AKa7uv3+oAK/AH/gqN/yfX8TP+4Z/wCmu0r9/qKAP5V6K/VT/gud/wA0T/7jf/thXyr/AMEuf+T6/hn/ANxP/wBNd3QB8q1/VRRX8q9AH9VFflX/AMFzv+aJ/wDcb/8AbCvqn/glz/yYn8Mv+4n/AOnS7r5W/wCC53/NE/8AuN/+2FAHyr/wS5/5Pr+Gf/cT/wDTXd1+/wBX8q9FABX7+/8ABLn/AJMT+GX/AHE//Tpd1+AVFAH6qf8ABc7/AJon/wBxv/2wr5V/4Jc/8n1/DP8A7if/AKa7uvqr/ghj/wA1s/7gn/t/X1T/AMFRv+TE/ib/ANwz/wBOlpQB9V1/KvRRQB+/v/BLn/kxP4Zf9xP/ANOl3X1XX8q9fqp/wQx/5rZ/3BP/AG/oA/VSiiigD+VeiiigAooooAK/qor+Vev6qKACvyr/AOC53/NE/wDuN/8AthX6qUUAfgD/AMEuf+T6/hn/ANxP/wBNd3X7/V8qf8FRv+TE/ib/ANwz/wBOlpX4BUAFFf1UUUAflX/wQx/5rZ/3BP8A2/r9VK/Kv/gud/zRP/uN/wDthXyr/wAEuf8Ak+v4Z/8AcT/9Nd3QB+/1fyr1/VRRQB8qf8Euf+TE/hl/3E//AE6XdfVdfgD/AMFRv+T6/iZ/3DP/AE12lfVX/BDH/mtn/cE/9v6APqn/AIKjf8mJ/E3/ALhn/p0tK/AKv39/4Kjf8mJ/E3/uGf8Ap0tK/AKgD+qiiiigAooooAKKKKACvn39vP4oeJ/gx+yf458ZeD9T/sbxHppsfsl79nin8vzL+3if5JVZDlJHHKnGcjkA19BV5R+1H8DP+Gk/gV4m+HP9tf8ACO/219l/4mf2T7V5Pk3UU/8Aqt6bs+Vt+8Mbs84wQD8Wf+Ho37Tn/RTf/KBpf/yNX6pf8Ouf2Yv+iZf+V/VP/kmvlb/hxj/1Wz/y1P8A7to/4fnf9UT/APLr/wDuKgD4t/bz+F/hj4MftYeOfBvg/TP7G8OaaLH7JZfaJZ/L8ywt5X+eVmc5eRzyxxnA4AFfPter/tR/HP8A4aT+Ovib4jf2L/wjv9tfZf8AiWfa/tXk+TaxQf63Ym7PlbvujG7HOMnyigDrfhd8UfEvwY8daZ4x8G6p/Y3iPTRL9lvfs8U/l+ZE8T/JKrIcpI45U4zkcgGvfv8Ah6N+05/0U3/ygaX/API1eV/sufAz/hpP46+Gfhz/AG1/wjv9tfav+Jn9k+1eT5NrLP8A6rem7PlbfvDG7POMH79/4cY/9Vs/8tT/AO7aAPlb/h6N+05/0U3/AMoGl/8AyNR/w9G/ac/6Kb/5QNL/APkavqn/AIcY/wDVbP8Ay1P/ALto/wCHGP8A1Wz/AMtT/wC7aAD9hr/jZN/wmv8Aw0b/AMXF/wCEM+w/2F/zC/sf2z7R9p/48fI8zf8AZIP9Zu27PlxubPqf7UP7Lvwx/Yw+BXib4yfBvwz/AMIf8SPDZtv7K1r7fdX32b7RdRWs37m6llhfdDcSp86HG7IwwBHln/KF7/qsP/Cyf+4H/Z39n/8AgT5vmfb/APY2+V/Fu+Xyv9qL/gqyP2k/gV4m+HP/AAq//hHP7a+y/wDEz/4SD7V5Pk3UU/8Aqvsqbs+Vt+8Mbs84wQDyr/h6N+05/wBFN/8AKBpf/wAjV8qUUUAfv7/wS5/5MT+GX/cT/wDTpd16p8c/2Xfhj+0n/Yn/AAsfwz/wkf8AYvn/AGD/AE+6tfJ87y/N/wBRKm7PlR/ezjbxjJz+V37Lv/BVkfs2fArwz8Of+FX/APCR/wBi/av+Jn/wkH2XzvOupZ/9V9lfbjzdv3jnbnjOB9+/sM/tzf8ADZ//AAmw/wCEK/4Q/wD4Rr7D/wAxb7d9p+0faP8AphFs2/Z/fO7tjkA8A/bx/YN+BXwW/ZQ8c+MvB3gf+xfEmm/YRaXv9rX8/l+Zf28T/JLOyHKSOOVOM5HIBr8ga/f3/gqN/wAmJ/E3/uGf+nS0r8AqACiv1U/4cY/9Vs/8tT/7tr4C/aj+Bn/DNnx18TfDn+2v+Ei/sX7L/wATP7J9l87zrWKf/Vb32483b945254zgAB8DP2ovid+zZ/bf/CuPE3/AAjn9teR9v8A9AtbrzvJ8zyv9fE+3HmyfdxndznAx1XxR/bz+Onxo8Dan4N8Y+Of7Y8N6l5X2uy/siwg8zy5ElT54oFcYeNDwwzjB4JFdV+w1+w1/wANn/8ACbf8Vr/wh/8AwjX2H/mE/bvtP2j7R/03i2bfs/vnd2xz9U/8OMf+q2f+Wp/920AflXRX6qf8OMf+q2f+Wp/921+VdABXq/wM/ai+J37Nn9t/8K48Tf8ACOf215H2/wD0C1uvO8nzPK/18T7cebJ93Gd3OcDH1T+y7/wSmH7SfwK8M/Eb/haH/COf219q/wCJZ/wj/wBq8nybqWD/AFv2pN2fK3fdGN2OcZPlX7cv7DX/AAxh/wAIT/xWv/CYf8JL9u/5hP2H7N9n+z/9N5d+77R7Y2988AB/w9G/ac/6Kb/5QNL/APkaj/h6N+05/wBFN/8AKBpf/wAjV5X+y58DP+Gk/jr4Z+HP9tf8I7/bX2r/AImf2T7V5Pk2ss/+q3puz5W37wxuzzjB+/f+HGP/AFWz/wAtT/7toA+qf+HXP7MX/RMv/K/qn/yTX5Cft5/C/wAMfBj9rDxz4N8H6Z/Y3hzTRY/ZLL7RLP5fmWFvK/zysznLyOeWOM4HAAr+iavz/wD2ov8AglMf2k/jr4m+I3/C0f8AhHP7a+y/8Sz/AIR/7V5Pk2sUH+t+1Juz5W77oxuxzjJAPlb/AIJT/su/DD9pP/haH/Cx/DP/AAkY0X+y/sH+n3Vr5Pnfa/N/1Eqbs+VH97ONvGMnPv8A+3j+wb8Cvgt+yh458ZeDvA/9i+JNN+wi0vf7Wv5/L8y/t4n+SWdkOUkccqcZyOQDXv8A+wz+wz/wxh/wmx/4TX/hMP8AhJfsP/MJ+w/Zvs/2j/pvLv3faPbG3vng/wCCo3/JifxN/wC4Z/6dLSgD8Aq/qor+Vev1U/4fnf8AVE//AC6//uKgDlP28f28vjr8Fv2r/HPg3wd44/sXw3pv2H7JZf2RYT+X5lhbyv8APLAznLyOeWOM4HAAr3//AIJT/tRfE/8AaT/4Wh/wsbxN/wAJH/Yv9l/YP9AtbXyfO+1+b/qIk3Z8qP72cbeMZOfyu/aj+Of/AA0n8dfE3xG/sX/hHf7a+y/8Sz7X9q8nybWKD/W7E3Z8rd90Y3Y5xk/fv/BDH/mtn/cE/wDb+gD9Jvij8LvDPxn8Can4O8ZaYNZ8OakYvtVl9olg8zy5UlT54mVxh40PDDOMHgkV4F/w65/Zi/6Jl/5X9U/+Sa9U/aj+Of8AwzZ8CvE3xG/sX/hIv7F+y/8AEs+1/ZfO866ig/1ux9uPN3fdOduOM5HwF/w/O/6on/5df/3FQB8rf8PRv2nP+im/+UDS/wD5Gr9e/wBgz4oeJ/jP+yf4G8ZeMNT/ALZ8R6kb77Xe/Z4oPM8u/uIk+SJVQYSNBwozjJ5JNfzs1+gH7Lv/AAVZH7NnwK8M/Dn/AIVf/wAJH/Yv2r/iZ/8ACQfZfO866ln/ANV9lfbjzdv3jnbnjOAAfqj8c/2Xfhj+0n/Yn/Cx/DP/AAkf9i+f9g/0+6tfJ87y/N/1Eqbs+VH97ONvGMnPyr+1D+y78Mf2MPgV4m+Mnwb8M/8ACH/Ejw2bb+yta+33V99m+0XUVrN+5upZYX3Q3EqfOhxuyMMAR5Z/w/O/6on/AOXX/wDcVH/Dcv8Aw8l/4xx/4Qr/AIV3/wAJp/zMv9rf2p9j+x/6d/x7eRB5m/7J5f8ArF2793O3aQD5W/4ejftOf9FN/wDKBpf/AMjV+/tflX/w4x/6rZ/5an/3bX6qUAfPvxR/YM+Bfxo8c6n4y8ZeBv7Y8Sal5X2u9/te/g8zy40iT5Ip1QYSNBwozjJ5JNdX8DP2Xfhj+zZ/bf8Awrjwz/wjn9teR9v/ANPurrzvJ8zyv9fK+3HmyfdxndznAx6vRQB8qf8ABUb/AJMT+Jv/AHDP/TpaV+AVfv7/AMFRv+TE/ib/ANwz/wBOlpX4BUAf1UUUUUAFFFFABRRRQAVyPxR+KPhn4MeBNT8Y+MtTGjeHNNMX2q9+zyz+X5kqRJ8kSs5y8iDhTjOTwCa66vlT/gqN/wAmJ/E3/uGf+nS0oAP+Ho37MX/RTf8Aygap/wDI1fgFRRQAUUUUAfQX7BnxQ8MfBj9rDwN4y8Yan/Y3hzTRffa737PLP5fmWFxEnyRKznLyIOFOM5PAJr9e/wDh6N+zF/0U3/ygap/8jV+AVFAH9VFfPvxR/bz+BfwX8c6n4N8ZeOf7H8Sab5X2uy/si/n8vzI0lT54oGQ5SRDwxxnB5BFfQVfgD/wVG/5Pr+Jn/cM/9NdpQB9Vfty/8bJv+EK/4Zy/4uL/AMIZ9u/t3/mF/Y/tn2f7N/x/eR5m/wCyT/6vdt2fNjcuflb/AIdc/tOf9Ey/8r+l/wDyTX1T/wAEMf8Amtn/AHBP/b+v1UoA/AL/AIdc/tOf9Ey/8r+l/wDyTR/w65/ac/6Jl/5X9L/+Sa/f2igD+YT4o/C7xL8GPHWp+DvGWl/2N4j00RfarL7RFP5fmRJKnzxMyHKSIeGOM4PIIr7S/wCCU/7UXww/Zs/4Wh/wsfxN/wAI4Na/sv7B/oF1ded5P2vzf9RE+3Hmx/exndxnBx5V/wAFRv8Ak+v4mf8AcM/9NdpXyrQB+v37eP7eXwK+NP7KHjnwb4O8cf214k1L7CbSy/sm/g8zy7+3lf55YFQYSNzywzjA5IFfkDRRQB/VRX5Aft4/sG/HX40/tX+OfGXg7wP/AG14b1L7D9kvf7XsIPM8uwt4n+SWdXGHjccqM4yOCDX6/wBFAH5V/sNf8a2f+E1/4aN/4t1/wmf2H+wv+Yp9s+x/aPtP/Hj5/l7PtcH+s27t/wAudrY+qf8Ah6N+zF/0U3/ygap/8jV8rf8ABc7/AJon/wBxv/2wr8q6AP39/wCHo37MX/RTf/KBqn/yNX4BUUUAfr9+wd+3l8Cvgt+yh4G8G+MfHH9i+JNN+3G7sv7Jv5/L8y/uJU+eKBkOUkQ8McZweQRXK/ty/wDGyb/hCv8AhnL/AIuL/wAIZ9u/t3/mF/Y/tn2f7N/x/eR5m/7JP/q923Z82Ny5/Kuv1U/4IY/81s/7gn/t/QB5X+y9+y78Tv2MPjp4Z+Mnxk8M/wDCHfDfw2Ln+1da+32t99m+0WstrD+5tZZZn3TXESfIhxuycKCR9+/8PRv2Yv8Aopv/AJQNU/8Akaj/AIKjf8mJ/E3/ALhn/p0tK/AKgD+qivn34o/t5/Av4L+OdT8G+MvHP9j+JNN8r7XZf2Rfz+X5kaSp88UDIcpIh4Y4zg8givoKvwB/4Kjf8n1/Ez/uGf8AprtKAP1T/wCHo37MX/RTf/KBqn/yNXlP7UP7UXwx/bP+BXib4N/BvxN/wmHxI8SG2/srRfsF1Y/afs91FdTfvrqKKFNsNvK/zuM7cDLEA/ixX1V/wS5/5Pr+Gf8A3E//AE13dAC/8Ouf2nP+iZf+V/S//kmj/h1z+05/0TL/AMr+l/8AyTX7+0UAfgF/w65/ac/6Jl/5X9L/APkmvv3/AIJT/su/E/8AZs/4Wh/wsbwz/wAI5/bX9l/YP9PtbrzvJ+1+b/qJX2482P72M7uM4OP0AooA+VP+Co3/ACYn8Tf+4Z/6dLSvwCr9/f8AgqN/yYn8Tf8AuGf+nS0r8AqACiiigAr6C/YM+KHhj4MftYeBvGXjDU/7G8OaaL77Xe/Z5Z/L8ywuIk+SJWc5eRBwpxnJ4BNfPtFAH7+/8PRv2Yv+im/+UDVP/kaj/h6N+zF/0U3/AMoGqf8AyNX4BUUAfv7/AMPRv2Yv+im/+UDVP/kaj/h6N+zF/wBFN/8AKBqn/wAjV+AVFAH7T/tQ/tRfDH9s/wCBXib4N/BvxN/wmHxI8SG2/srRfsF1Y/afs91FdTfvrqKKFNsNvK/zuM7cDLEA/Af/AA65/ac/6Jl/5X9L/wDkmk/4Jc/8n1/DP/uJ/wDpru6/f6gAooooAKKKKACiiigAoor59/bz+KHif4Mfsn+OfGXg/U/7G8R6abH7Je/Z4p/L8y/t4n+SVWQ5SRxypxnI5ANAH0FRX4Bf8PRv2nP+im/+UDS//kaj/h6N+05/0U3/AMoGl/8AyNQB+/tFfgF/w9G/ac/6Kb/5QNL/APkaj/h6N+05/wBFN/8AKBpf/wAjUAfv7RX4Bf8AD0b9pz/opv8A5QNL/wDkaj/h6N+05/0U3/ygaX/8jUAfv7RX4Bf8PRv2nP8Aopv/AJQNL/8Akaj/AIejftOf9FN/8oGl/wDyNQB+/tfKn/BUb/kxP4m/9wz/ANOlpXlX/BKf9qL4n/tJ/wDC0P8AhY3ib/hI/wCxf7L+wf6Ba2vk+d9r83/URJuz5Uf3s428Yyc/aXxR+F3hn4z+BNT8HeMtMGs+HNSMX2qy+0SweZ5cqSp88TK4w8aHhhnGDwSKAP5ha/qor5U/4dc/sxf9Ey/8r+qf/JNflb/w9G/ac/6Kb/5QNL/+RqAP39or59/YM+KHif4z/sn+BvGXjDU/7Z8R6kb77Xe/Z4oPM8u/uIk+SJVQYSNBwozjJ5JNfQVAHyp/wVG/5MT+Jv8A3DP/AE6WlfgFX9PXxR+F3hn4z+BNT8HeMtMGs+HNSMX2qy+0SweZ5cqSp88TK4w8aHhhnGDwSK8C/wCHXP7MX/RMv/K/qn/yTQB+AVfv7/wS5/5MT+GX/cT/APTpd1+AVfv7/wAEuf8AkxP4Zf8AcT/9Ol3QB9V18qf8FRv+TE/ib/3DP/TpaV5V/wAFWP2ovif+zZ/wq/8A4Vz4m/4Rz+2v7U+3/wCgWt153k/ZPK/18T7cebJ93Gd3OcDH5sfFH9vP46fGjwNqfg3xj45/tjw3qXlfa7L+yLCDzPLkSVPnigVxh40PDDOMHgkUAfP1FFfv7/w65/Zi/wCiZf8Alf1T/wCSaAD/AIJc/wDJifwy/wC4n/6dLuvquvxX/ah/ai+J37GHx08TfBv4N+Jv+EO+G/hsW39laL9gtb77N9otYrqb99dRSzPumuJX+dzjdgYUADyr/h6N+05/0U3/AMoGl/8AyNQB+/tFfkB+wd+3l8dfjT+1f4G8G+MfHH9teG9S+3fa7L+yLCDzPLsLiVPnigVxh40PDDOMHgkV+v8AQB/KvRX7+/8ADrn9mL/omX/lf1T/AOSaP+HXP7MX/RMv/K/qn/yTQB+AVFfv7/w65/Zi/wCiZf8Alf1T/wCSaP8Ah1z+zF/0TL/yv6p/8k0AfgFX9VFfKn/Drn9mL/omX/lf1T/5Jr6roA/AH/gqN/yfX8TP+4Z/6a7Svqr/AIIY/wDNbP8AuCf+39faXxR/YM+Bfxo8c6n4y8ZeBv7Y8Sal5X2u9/te/g8zy40iT5Ip1QYSNBwozjJ5JNfFv7cv/Gtn/hCv+Gcv+Ldf8Jn9u/t3/mKfbPsf2f7N/wAf3n+Xs+1z/wCr27t/zZ2rgA+qf+Co3/JifxN/7hn/AKdLSvwCr6B+KP7efx0+NHgbU/BvjHxz/bHhvUvK+12X9kWEHmeXIkqfPFArjDxoeGGcYPBIr5+oA/qooor8gP28f28vjr8Fv2r/ABz4N8HeOP7F8N6b9h+yWX9kWE/l+ZYW8r/PLAznLyOeWOM4HAAoA/X+vlT/AIKjf8mJ/E3/ALhn/p0tK8q/4JT/ALUXxP8A2k/+Fof8LG8Tf8JH/Yv9l/YP9AtbXyfO+1+b/qIk3Z8qP72cbeMZOfVf+Co3/JifxN/7hn/p0tKAPwCr+qiv5V6/qooAK/Kv/gud/wA0T/7jf/thXKft4/t5fHX4LftX+OfBvg7xx/YvhvTfsP2Sy/siwn8vzLC3lf55YGc5eRzyxxnA4AFfFvxz/ai+J37Sf9if8LH8Tf8ACR/2L5/2D/QLW18nzvL83/URJuz5Uf3s428YycgHlFFFFAH9VFFFFABRRRQAUUUUAFfKn/BUb/kxP4m/9wz/ANOlpX1XXyp/wVG/5MT+Jv8A3DP/AE6WlAH4BV+qn/DjH/qtn/lqf/dtflXX9VFAH5V/8OMf+q2f+Wp/920f8OMf+q2f+Wp/9219pfFH9vP4F/Bfxzqfg3xl45/sfxJpvlfa7L+yL+fy/MjSVPnigZDlJEPDHGcHkEVy3/D0b9mL/opv/lA1T/5GoA+Vv+HGP/VbP/LU/wDu2j/hxj/1Wz/y1P8A7tr6p/4ejfsxf9FN/wDKBqn/AMjUf8PRv2Yv+im/+UDVP/kagD5W/wCHGP8A1Wz/AMtT/wC7a+Av2o/gZ/wzZ8dfE3w5/tr/AISL+xfsv/Ez+yfZfO861in/ANVvfbjzdv3jnbnjOB/SjX4A/wDBUb/k+v4mf9wz/wBNdpQB9Vf8EMf+a2f9wT/2/r9VK/Kv/ghj/wA1s/7gn/t/X6qUAFflX/w4x/6rZ/5an/3bX6qV8qf8PRv2Yv8Aopv/AJQNU/8AkagD1T9lz4Gf8M2fArwz8Of7a/4SL+xftX/Ez+yfZfO866ln/wBVvfbjzdv3jnbnjOB5X+3N+3N/wxh/whI/4Qr/AITD/hJft3/MW+w/Zvs/2f8A6YS7932j2xt75499+F3xR8M/GfwJpnjHwbqY1nw5qRl+y3v2eWDzPLleJ/klVXGHjccqM4yOCDX5s/8ABc7/AJon/wBxv/2woAP+H53/AFRP/wAuv/7io/4fnf8AVE//AC6//uKvyrooA/VT/hxj/wBVs/8ALU/+7a+/f2XPgZ/wzZ8CvDPw5/tr/hIv7F+1f8TP7J9l87zrqWf/AFW99uPN2/eOdueM4Hlf/D0b9mL/AKKb/wCUDVP/AJGr334XfFHwz8Z/AmmeMfBupjWfDmpGX7Le/Z5YPM8uV4n+SVVcYeNxyozjI4INAH5s/wDBc7/mif8A3G//AGwr4C/Zc+Bn/DSfx18M/Dn+2v8AhHf7a+1f8TP7J9q8nybWWf8A1W9N2fK2/eGN2ecYP37/AMFzv+aJ/wDcb/8AbCvi39gz4oeGPgx+1h4G8ZeMNT/sbw5povvtd79nln8vzLC4iT5IlZzl5EHCnGcngE0AfaX/AA4x/wCq2f8Alqf/AHbX6qV8qf8AD0b9mL/opv8A5QNU/wDkaj/h6N+zF/0U3/ygap/8jUAflZ/wVG/5Pr+Jn/cM/wDTXaUv7DX7DX/DZ/8Awm3/ABWv/CH/APCNfYf+YT9u+0/aPtH/AE3i2bfs/vnd2xzy37efxQ8MfGf9rDxz4y8H6n/bPhzUhY/ZL37PLB5nl2FvE/ySqrjDxuOVGcZHBBr33/glP+1F8MP2bP8AhaH/AAsfxN/wjg1r+y/sH+gXV153k/a/N/1ET7cebH97Gd3GcHAB9U/su/8ABKY/s2fHXwz8Rv8AhaP/AAkf9i/av+JZ/wAI/wDZfO861lg/1v2p9uPN3fdOduOM5H6AV8+/C79vP4F/Gjxzpng3wb45/tjxJqXm/ZLL+yL+DzPLjeV/nlgVBhI3PLDOMDkgV9BUAflX/wAPzv8Aqif/AJdf/wBxUf8AD87/AKon/wCXX/8AcVfK3/Drn9pz/omX/lf0v/5Jo/4dc/tOf9Ey/wDK/pf/AMk0AfVP/D87/qif/l1//cVH/D87/qif/l1//cVfAXxz/Zd+J37Nn9if8LH8M/8ACOf215/2D/T7W687yfL83/USvtx5sf3sZ3cZwceUUAfqp/w/O/6on/5df/3FX6qV/KvX7+/8PRv2Yv8Aopv/AJQNU/8AkagDyr9qL/gqyf2bPjr4m+HP/Crv+Ej/ALF+y/8AEz/4SD7L53nWsU/+q+yvtx5u37xztzxnA8r/AOU0P/VHv+Fbf9xz+0f7Q/8AAbyvL+wf7e7zf4dvzeV/tQ/su/E79s/46eJvjJ8G/DP/AAmPw38SC2/srWvt9rY/afs9rFazfubqWKZNs1vKnzoM7cjKkE/VH/BKf9l34n/s2f8AC0P+FjeGf+Ec/tr+y/sH+n2t153k/a/N/wBRK+3Hmx/exndxnBwAfK/7UX/BKYfs2fArxN8Rv+Fof8JH/Yv2X/iWf8I/9l87zrqKD/W/an2483d905244zkfn/X7+/8ABUb/AJMT+Jv/AHDP/TpaV+AVAH9VFfn/APtRf8Epj+0n8dfE3xG/4Wj/AMI5/bX2X/iWf8I/9q8nybWKD/W/ak3Z8rd90Y3Y5xk+q/8AD0b9mL/opv8A5QNU/wDkaj/h6N+zF/0U3/ygap/8jUAH7DP7DP8Awxh/wmx/4TX/AITD/hJfsP8AzCfsP2b7P9o/6by7932j2xt754P+Co3/ACYn8Tf+4Z/6dLSj/h6N+zF/0U3/AMoGqf8AyNXgH7eP7eXwK+NP7KHjnwb4O8cf214k1L7CbSy/sm/g8zy7+3lf55YFQYSNzywzjA5IFAH5A1/VRX8q9fv7/wAPRv2Yv+im/wDlA1T/AORqAPys/wCCo3/J9fxM/wC4Z/6a7Sl/Ya/Ya/4bP/4Tb/itf+EP/wCEa+w/8wn7d9p+0faP+m8Wzb9n987u2OfVf2of2Xfid+2f8dPE3xk+Dfhn/hMfhv4kFt/ZWtfb7Wx+0/Z7WK1m/c3UsUybZreVPnQZ25GVIJ9U/Ya/41s/8Jr/AMNG/wDFuv8AhM/sP9hf8xT7Z9j+0faf+PHz/L2fa4P9Zt3b/lztbAAf8OMf+q2f+Wp/920f8OMf+q2f+Wp/9219pfC79vP4F/Gjxzpng3wb45/tjxJqXm/ZLL+yL+DzPLjeV/nlgVBhI3PLDOMDkgV9BUAFFFFABRRRQAUUUUAFfKn/AAVG/wCTE/ib/wBwz/06WlfVdfKn/BUb/kxP4m/9wz/06WlAH4BV/VRX8q9f1UUAfgD/AMFRv+T6/iZ/3DP/AE12lfKtfVX/AAVG/wCT6/iZ/wBwz/012lfKtABRRRQB/VRX4A/8FRv+T6/iZ/3DP/TXaV+/1fgD/wAFRv8Ak+v4mf8AcM/9NdpQB9Vf8EMf+a2f9wT/ANv6/VSvyr/4IY/81s/7gn/t/X1T/wAFRv8AkxP4m/8AcM/9OlpQB9V1/KvRX9VFAHyp/wAEuf8AkxP4Zf8AcT/9Ol3Xyt/wXO/5on/3G/8A2wr5V/4Kjf8AJ9fxM/7hn/prtK+qv+CGP/NbP+4J/wC39AH5V0V/VRRQB/KvX7+/8Euf+TE/hl/3E/8A06XdfgFX7+/8Euf+TE/hl/3E/wD06XdAHyt/wXO/5on/ANxv/wBsK/Kuv6qKKAP5V6K/qor+VegAoor9VP8Aghj/AM1s/wC4J/7f0AfKv/BLn/k+v4Z/9xP/ANNd3X7/AFFFABRRRQB+Vf8AwXO/5on/ANxv/wBsK/Kuv1U/4Lnf80T/AO43/wC2FfKv/BLn/k+v4Z/9xP8A9Nd3QB8q0V/VRX8q9AH7+/8ABLn/AJMT+GX/AHE//Tpd19V18qf8Euf+TE/hl/3E/wD06XdfK3/Bc7/mif8A3G//AGwoA+qf+Co3/JifxN/7hn/p0tK/AKvqr/glz/yfX8M/+4n/AOmu7r9/qAP5V6KK/f3/AIJc/wDJifwy/wC4n/6dLugD8AqK/qoooA/lXor+qiigD5U/4Jc/8mJ/DL/uJ/8Ap0u6+Vv+C53/ADRP/uN/+2FfKv8AwVG/5Pr+Jn/cM/8ATXaV8q0AfVX/AAS5/wCT6/hn/wBxP/013dfv9X8q9FAH9VFFFFABRRRQAUUUUAFfKn/BUb/kxP4m/wDcM/8ATpaV9V18qf8ABUb/AJMT+Jv/AHDP/TpaUAfgFX9VFfyr1/VRQB+AP/BUb/k+v4mf9wz/ANNdpXyrX7UftRf8Epj+0n8dfE3xG/4Wj/wjn9tfZf8AiWf8I/8AavJ8m1ig/wBb9qTdnyt33RjdjnGT5X/w4x/6rZ/5an/3bQB+VdFfqp/w4x/6rZ/5an/3bR/w4x/6rZ/5an/3bQB+qlfgD/wVG/5Pr+Jn/cM/9NdpX7/V+AP/AAVG/wCT6/iZ/wBwz/012lAH1V/wQx/5rZ/3BP8A2/r9Jvij8LvDPxn8Can4O8ZaYNZ8OakYvtVl9olg8zy5UlT54mVxh40PDDOMHgkV+bP/AAQx/wCa2f8AcE/9v6/VSgD5U/4dc/sxf9Ey/wDK/qn/AMk19V0V+Vf/AA/O/wCqJ/8Al1//AHFQB8q/8FRv+T6/iZ/3DP8A012lfVX/AAQx/wCa2f8AcE/9v6+Av2o/jn/w0n8dfE3xG/sX/hHf7a+y/wDEs+1/avJ8m1ig/wBbsTdnyt33RjdjnGT9+/8ABDH/AJrZ/wBwT/2/oA+0v28/ih4n+DH7J/jnxl4P1P8AsbxHppsfsl79nin8vzL+3if5JVZDlJHHKnGcjkA1+Qn/AA9G/ac/6Kb/AOUDS/8A5Gr9Uv8AgqN/yYn8Tf8AuGf+nS0r8AqAP39/4dc/sxf9Ey/8r+qf/JNfAX7UP7UXxO/Yw+Onib4N/BvxN/wh3w38Ni2/srRfsFrffZvtFrFdTfvrqKWZ901xK/zucbsDCgAeqf8AD87/AKon/wCXX/8AcVH/AAw1/wAPJf8AjI7/AITX/hXf/Caf8y1/ZP8Aan2P7H/oP/Hz58Hmb/snmf6tdu/bzt3EA9U/4JT/ALUXxP8A2k/+Fof8LG8Tf8JH/Yv9l/YP9AtbXyfO+1+b/qIk3Z8qP72cbeMZOffv28/ih4n+DH7J/jnxl4P1P+xvEemmx+yXv2eKfy/Mv7eJ/klVkOUkccqcZyOQDXLfsM/sM/8ADGH/AAmx/wCE1/4TD/hJfsP/ADCfsP2b7P8AaP8ApvLv3faPbG3vng/4Kjf8mJ/E3/uGf+nS0oA/K3/h6N+05/0U3/ygaX/8jV+qX/Drn9mL/omX/lf1T/5Jr8Aq/VT/AIfnf9UT/wDLr/8AuKgD6p/4dc/sxf8ARMv/ACv6p/8AJNeqfAz9l34Y/s2f23/wrjwz/wAI5/bXkfb/APT7q687yfM8r/Xyvtx5sn3cZ3c5wMfAX/D87/qif/l1/wD3FX1T+wz+3N/w2f8A8JsP+EK/4Q//AIRr7D/zFvt32n7R9o/6YRbNv2f3zu7Y5AOp/bz+KHif4Mfsn+OfGXg/U/7G8R6abH7Je/Z4p/L8y/t4n+SVWQ5SRxypxnI5ANfkJ/w9G/ac/wCim/8AlA0v/wCRq/VL/gqN/wAmJ/E3/uGf+nS0r8AqAPqv/h6N+05/0U3/AMoGl/8AyNR/w9G/ac/6Kb/5QNL/APkavlSv0A/Zd/4JTD9pP4FeGfiN/wALQ/4Rz+2vtX/Es/4R/wC1eT5N1LB/rftSbs+Vu+6Mbsc4yQD1T9hr/jZN/wAJr/w0b/xcX/hDPsP9hf8AML+x/bPtH2n/AI8fI8zf9kg/1m7bs+XG5s+p/tQ/su/DH9jD4FeJvjJ8G/DP/CH/ABI8Nm2/srWvt91ffZvtF1FazfubqWWF90NxKnzocbsjDAEerfsM/sM/8MYf8Jsf+E1/4TD/AISX7D/zCfsP2b7P9o/6by7932j2xt754P8AgqN/yYn8Tf8AuGf+nS0oA/K3/h6N+05/0U3/AMoGl/8AyNXypRRQB+/v/BLn/kxP4Zf9xP8A9Ol3Xyt/wXO/5on/ANxv/wBsK+qf+CXP/Jifwy/7if8A6dLuvlb/AILnf80T/wC43/7YUAfKv/BLn/k+v4Z/9xP/ANNd3X7/AFfzXfsufHP/AIZs+Ovhn4jf2L/wkX9i/av+JZ9r+y+d51rLB/rdj7cebu+6c7ccZyPv3/h+d/1RP/y6/wD7ioA+qf8Ah1z+zF/0TL/yv6p/8k1778Lvhd4Z+DHgTTPB3g3TBo3hzTTL9lsvtEs/l+ZK8r/PKzOcvI55Y4zgcACuuooAK+ff28/ih4n+DH7J/jnxl4P1P+xvEemmx+yXv2eKfy/Mv7eJ/klVkOUkccqcZyOQDXLftzftzf8ADGH/AAhI/wCEK/4TD/hJft3/ADFvsP2b7P8AZ/8AphLv3faPbG3vnj4C/ai/4Ksj9pP4FeJvhz/wq/8A4Rz+2vsv/Ez/AOEg+1eT5N1FP/qvsqbs+Vt+8Mbs84wQDyr/AIejftOf9FN/8oGl/wDyNX7+1/KvX6qf8Pzv+qJ/+XX/APcVAHyr/wAFRv8Ak+v4mf8AcM/9NdpXqv8AwSn/AGXfhh+0n/wtD/hY/hn/AISMaL/Zf2D/AE+6tfJ877X5v+olTdnyo/vZxt4xk59V/wCGGv8Ah5L/AMZHf8Jr/wAK7/4TT/mWv7J/tT7H9j/0H/j58+DzN/2TzP8AVrt37edu4/VP7DP7DP8Awxh/wmx/4TX/AITD/hJfsP8AzCfsP2b7P9o/6by7932j2xt754APAP28f2DfgV8Fv2UPHPjLwd4H/sXxJpv2EWl7/a1/P5fmX9vE/wAks7IcpI45U4zkcgGvyBr+lH9qP4Gf8NJ/ArxN8Of7a/4R3+2vsv8AxM/sn2ryfJuop/8AVb03Z8rb94Y3Z5xg/AX/AA4x/wCq2f8Alqf/AHbQB+qlFFFABRRRQAUUUUAFfKn/AAVG/wCTE/ib/wBwz/06WlfVdfKn/BUb/kxP4m/9wz/06WlAH4BV+/v/AA9G/Zi/6Kb/AOUDVP8A5Gr8AqKAP39/4ejfsxf9FN/8oGqf/I1H/D0b9mL/AKKb/wCUDVP/AJGr8AqKAP39/wCHo37MX/RTf/KBqn/yNR/w9G/Zi/6Kb/5QNU/+Rq/AKigD9/f+Ho37MX/RTf8Aygap/wDI1fkJ+3n8UPDHxn/aw8c+MvB+p/2z4c1IWP2S9+zyweZ5dhbxP8kqq4w8bjlRnGRwQa+faKAP1U/4IY/81s/7gn/t/X6qV+Vf/BDH/mtn/cE/9v6/VSgAr+Vev6qK/lXoAK/VT/ghj/zWz/uCf+39flXX6qf8EMf+a2f9wT/2/oA+0v28/hf4n+M/7J/jnwb4P0z+2fEepGx+yWX2iKDzPLv7eV/nlZUGEjc8sM4wOSBX5Cf8Ouf2nP8AomX/AJX9L/8Akmv39ooA/lXr9/f+CXP/ACYn8Mv+4n/6dLuvwCr9/f8Aglz/AMmJ/DL/ALif/p0u6APVPjn+1F8Mf2bP7E/4WP4m/wCEc/trz/sH+gXV153k+X5v+oifbjzY/vYzu4zg4+Vf2of2ovhj+2f8CvE3wb+Dfib/AITD4keJDbf2Vov2C6sftP2e6iupv311FFCm2G3lf53GduBliAfLP+C53/NE/wDuN/8AthXyr/wS5/5Pr+Gf/cT/APTXd0AL/wAOuf2nP+iZf+V/S/8A5Jr5Ur+qiv5V6APoH4XfsGfHT40eBtM8ZeDvA39seG9S837Je/2vYQeZ5cjxP8ks6uMPG45UZxkcEGv0n/4JT/su/E/9mz/haH/CxvDP/COf21/Zf2D/AE+1uvO8n7X5v+olfbjzY/vYzu4zg49V/wCCXP8AyYn8Mv8AuJ/+nS7r6roA+VP+Co3/ACYn8Tf+4Z/6dLSvwCr9/f8AgqN/yYn8Tf8AuGf+nS0r8AqAPqv/AIdc/tOf9Ey/8r+l/wDyTX35+y9+1F8Mf2MPgV4Z+Dfxk8Tf8If8SPDZuf7V0X7BdX32b7RdS3UP761ilhfdDcRP8jnG7BwwIH6A1+AP/BUb/k+v4mf9wz/012lAH7T/AAM/ai+GP7Sf9t/8K48Tf8JH/Yvkfb/9AurXyfO8zyv9fEm7PlSfdzjbzjIz5X/wVG/5MT+Jv/cM/wDTpaV8rf8ABDH/AJrZ/wBwT/2/r6p/4Kjf8mJ/E3/uGf8Ap0tKAPwCooooA/f3/glz/wAmJ/DL/uJ/+nS7ryr/AIKsfsu/E/8AaT/4Vf8A8K58M/8ACR/2L/an2/8A0+1tfJ877J5X+vlTdnypPu5xt5xkZ9V/4Jc/8mJ/DL/uJ/8Ap0u6+q6AP52Pij+wZ8dPgv4G1Pxl4x8Df2P4b03yvtd7/a9hP5fmSJEnyRTs5y8iDhTjOTwCa+fq/f3/AIKjf8mJ/E3/ALhn/p0tK/AKgD9/f+Ho37MX/RTf/KBqn/yNR/w9G/Zi/wCim/8AlA1T/wCRq/AKigD9VP25f+Nk3/CFf8M5f8XF/wCEM+3f27/zC/sf2z7P9m/4/vI8zf8AZJ/9Xu27PmxuXPxZ8Uf2DPjp8F/A2p+MvGPgb+x/Dem+V9rvf7XsJ/L8yRIk+SKdnOXkQcKcZyeATX2n/wAEMf8Amtn/AHBP/b+vqn/gqN/yYn8Tf+4Z/wCnS0oA/AKvqv8A4dc/tOf9Ey/8r+l//JNfKlf1UUAfPv7Bnwv8T/Bj9k/wN4N8YaZ/Y3iPTTffa7L7RFP5fmX9xKnzxMyHKSIeGOM4PIIrq/jn+1F8Mf2bP7E/4WP4m/4Rz+2vP+wf6BdXXneT5fm/6iJ9uPNj+9jO7jODj1evyr/4Lnf80T/7jf8A7YUAfVP/AA9G/Zi/6Kb/AOUDVP8A5Go/4ejfsxf9FN/8oGqf/I1fgFRQB/VRRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAFFFFABRRRQAUUUUAf/2Q==", alt: "" }) ], -1)); const _sfc_main$1 = { __name: "Model", props: { title: { type: String, required: true }, code: { type: Number || String } }, setup(__props, { expose: __expose }) { const props = __props; const visible = vue.ref(false); const openModal = () => { visible.value = true; }; const closeModal = () => { visible.value = false; }; __expose({ visible, openModal, closeModal }); const codeValue = vue.ref(); const enterCode = () => { if (codeValue.value == props.code) { localStorage.setItem("fcode", codeValue.value); visible.value = false; alert("验证成功,请再次点击解析!"); codeValue.value = ""; } else { alert("验证码错误,请重新输入!"); codeValue.value = ""; } }; return (_ctx, _cache) => { return vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", { class: "modal-wrapper", onClick: vue.withModifiers(closeModal, ["self"]) }, [ vue.createElementVNode("div", _hoisted_1$1, [ vue.createElementVNode("div", _hoisted_2, [ vue.createElementVNode("h2", null, vue.toDisplayString(__props.title), 1), vue.createElementVNode("button", { onClick: closeModal }, "X") ]), vue.createElementVNode("div", _hoisted_3, [ vue.createElementVNode("div", _hoisted_4, [ _hoisted_5, _hoisted_6, _hoisted_7, vue.withDirectives(vue.createElementVNode("input", { class: "ipt", type: "text", "onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => codeValue.value = $event), onKeydown: vue.withKeys(enterCode, ["enter"]), placeholder: "请输入验证码后按回车" }, null, 544), [ [vue.vModelText, codeValue.value] ]) ]), _hoisted_8 ]) ]) ], 512)), [ [vue.vShow, visible.value] ]); }; } }; const Model = /* @__PURE__ */ _export_sfc(_sfc_main$1, [["__scopeId", "data-v-b425a440"]]); var _GM_xmlhttpRequest = /* @__PURE__ */ (() => typeof GM_xmlhttpRequest != "undefined" ? GM_xmlhttpRequest : void 0)(); var _unsafeWindow = /* @__PURE__ */ (() => typeof unsafeWindow != "undefined" ? unsafeWindow : void 0)(); const importScript = (src) => { return new Promise((resolve, reject) => { const script = document.createElement("script"); script.src = src; script.addEventListener("load", () => { var _a2; resolve(); (_a2 = script.parentElement) == null ? void 0 : _a2.removeChild(script); }); script.addEventListener("error", (e) => { var _a2; reject(e); (_a2 = script.parentElement) == null ? void 0 : _a2.removeChild(script); }); document.body.appendChild(script); }); }; await( importScript( "https://cdn.jsdelivr.net/npm/[email protected]/dist/jszip.min.js" )); const JSZip = _unsafeWindow == null ? void 0 : _unsafeWindow.JSZip; const headers$1 = { // Referer: 'http://www.b5200.net/', "User-Agent": "Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/114.0.5735.289 Safari/537.36", "Accept-Language": "zh-CN,zh;q=0.9", "Accept-Encoding": "gzip, deflate", // 指定服务器返回的编码格式 "Accept-Charset": "GBK,utf-8;q=0.7,*;q=0.3" }; const getDuShuGe = (url) => { return new Promise((resolve, reject) => { _GM_xmlhttpRequest({ method: "GET", url, headers: headers$1, encoding: "gb2312", onload: function(res) { if (res.status == 200) { if (res.response !== void 0) { resolve(res.response); } else { resolve("无法解析"); } } else { resolve("无法解析"); } }, onerror: function(error) { reject("解析失败", error); } }); }); }; const getDuShuGeList = async () => { let chapterList = document.querySelectorAll(".listmain > dl>dd"); let Idlist = []; const regId = /href="([^"]*)"/; const regContent = /<a.*?>(.*?)<\/a>/; for (var i = 0; i < chapterList.length; i++) { let aTag = chapterList[i].innerHTML; let url = "http://www.dushuge.com/" + aTag.match(regId)[1]; let chapter = aTag.match(regContent)[1]; Idlist.push({ url, chapter }); } return Idlist; }; const getDuShuGeContent = async (url) => { let contentdata = await getDuShuGe(url); contentdata = contentdata.split('<div id="content" class="showtxt">')[1].split("<br /><br /></div>")[0]; contentdata = contentdata.replace(/ /gi, ""); contentdata = contentdata.replace(/<br \/>/g, "\n"); return contentdata; }; const getBiQuGeList = async () => { let chapterList = document.querySelectorAll("#list > dl> dd"); let Idlist = []; const regId = /href="([^"]*)"/; const regContent = /<a.*?>(.*?)<\/a>/; for (var i = 0; i < chapterList.length; i++) { let aTag = chapterList[i].innerHTML; let url = "http://www.b5200.net/" + aTag.match(regId)[1]; let chapter = aTag.match(regContent)[1]; Idlist.push({ url, chapter }); } return Idlist; }; const getBiQuGeContent = async (url) => { let contentdata = await getDuShuGe(url); contentdata = contentdata.replace(/<div id='gc1' class='gcontent1'>(.*?)<\/div>/, ""); var regexCon = /<div id="content" class="(.*?)">(.*?)<\/div>/; let contentList = contentdata.match(regexCon)[0]; contentList = contentList.replace(/<div id="content" class="(.*?)">/, ""); contentList = contentList.replace(/<div(.*?)><\/div>/, ""); contentList = contentList.replace(/<\/p><p>/g, "\n"); contentList = contentList.replace("<p>", ""); contentList = contentList.replace("</p></div>", ""); return contentdata; }; const getBxfanqizhaList = async () => { let chapterList = document.querySelectorAll("#newlist > dd"); let Idlist = []; const regId = /href="([^"]*)"/; const regContent = /<a.*?>(.*?)<\/a>/; for (var i = 0; i < chapterList.length; i++) { let aTag = chapterList[i].innerHTML; let url = "https://www.bxfanqizha.com" + aTag.match(regId)[1]; let chapter = aTag.match(regContent)[1]; Idlist.push({ url, chapter }); } return Idlist; }; const getBxfanqizhaContent = async (url) => { let contentdata = await getDuShuGe(url); contentdata = contentdata.trim(); const regex = /<div class="panel-body" id="rtext">([\s\S]*)<\/div>/; contentdata = contentdata.match(regex)[1]; contentdata = contentdata.split("</div>")[0].replace('<div id="booktxt">', "").replace("<b></b>", "").replace(/<\/p><p>/g, "\n").replace(/<\/p>/g, "\n").split("<p>")[3]; return contentdata; }; const getQiMaoIdList = () => { let chapterList = document.querySelectorAll(".qm-book-catalog-list-content>li"); let Idlist = []; for (var i = 0; i < chapterList.length; i++) { let iDList = chapterList[i].children[0].href.split("/")[4]; let id = iDList.split("-")[0]; let chapterId = iDList.split("-")[1]; let chapter = chapterList[i].innerText; Idlist.push({ id, chapterId, chapter }); } return Idlist; }; const headers = { "app-version": "51110", platform: "android", reg: "0", AUTHORIZATION: "", "application-id": "com.****.reader", "net-env": "1", channel: "unknown", "qm-params": "", sign: "fc697243ab534ebaf51d2fa80f251cb4" }; const sign_key = "d3dGiJc651gSQ8w1"; function decode(response) { let txt = CryptoJS.enc.Base64.parse(response).toString(); let iv = txt.slice(0, 32); let _content = decrypt(txt.slice(32), iv).trim(); return _content; } const decrypt = function(data, iv) { let key = CryptoJS.enc.Hex.parse("32343263636238323330643730396531"); iv = CryptoJS.enc.Hex.parse(iv); let HexStr = CryptoJS.enc.Hex.parse(data); let Base64Str = CryptoJS.enc.Base64.stringify(HexStr); let decrypted = CryptoJS.AES.decrypt(Base64Str, key, { iv, mode: CryptoJS.mode.CBC, padding: CryptoJS.pad.Pkcs7 }); return decrypted.toString(CryptoJS.enc.Utf8); }; const getQiMaoContent = (id, chapterId) => { return new Promise(function(resolve, reject) { const params = { id, chapterId }; const sign = CryptoJS.MD5( Object.keys(params).sort().reduce((pre, n) => pre + n + "=" + params[n], "") + sign_key ).toString(); let url = `https://api-ks.wtzw.com/api/v1/chapter/content?id=${id}&chapterId=${chapterId}&sign=${sign}`; _GM_xmlhttpRequest({ method: "GET", // url: `https://novel.snssdk.com/api/novel/book/reader/full/v1/?device_platform=android&parent_enterfrom=novel_channel_search.tab.&aid=2329&platform_id=1&group_id=0&item_id=${ID}`, url, headers, onload: function(res) { if (res.response !== void 0) { let result = JSON.parse(res.response).data.content; let content = decode(result); resolve(content); } else { resolve("无法解析"); } }, onerror: function(error) { reject(error); } }); }); }; const getHujugeIdList = () => { let chapterList = document.querySelectorAll(".section-list")[1].querySelectorAll("li"); let Idlist = []; const regId = /href="([^"]*)"/; for (var i = 0; i < chapterList.length; i++) { let aTag = chapterList[i].innerHTML; let url = "https://www.hujuge.com" + aTag.match(regId)[1]; let chapter = chapterList[i].innerText; Idlist.push({ url, chapter }); } return Idlist; }; const getHujugeContent = async (url) => { let contentdata = await getDuShuGe(url); contentdata = contentdata.split("并刷新页面。</div>")[1].split("</div>")[0].trim(); contentdata = contentdata.replace(/<\/p><p>/gi, "\n"); contentdata = contentdata.replace(/<p>/g, ""); contentdata = contentdata.replace(/<\/p>/g, ""); return contentdata; }; const getAnshugeIdList = () => { let chapterList = document.querySelectorAll(".L"); let Idlist = []; const regId = /href="([^"]*)"/; for (var i = 0; i < chapterList.length; i++) { let aTag = chapterList[i].innerHTML; let url = aTag.match(regId)[1]; let chapter = chapterList[i].innerText; Idlist.push({ url, chapter }); } return Idlist; }; const getAnshugeContent = async (url) => { let contentdata = await getDuShuGe(url); const regex = /<div id="center_tip">([\s\S]*)<\/div>/; contentdata = contentdata.match(regex)[1]; contentdata = contentdata.split('id="contents">')[1].split("</dd>")[0].trim(); contentdata = contentdata.replace(/ /gi, ""); contentdata = contentdata.replace(/<br \/>/g, ""); return contentdata; }; const getBiquxsIdList = () => { let chapterList = document.querySelectorAll(".listmain>dl>dd"); let Idlist = []; const regId = /href="([^"]*)"/; for (var i = 5; i < chapterList.length; i++) { let aTag = chapterList[i].innerHTML; let url = "http://www.biquxs.com" + aTag.match(regId)[1]; let chapter = chapterList[i].innerText; Idlist.push({ url, chapter }); } return Idlist; }; const getBiquxsContent = async (url) => { let contentdata = await getDuShuGe(url); const regex = /<div id="content".*?class="showtxt">([\s\S]*)<\/div>/; contentdata = contentdata.match(regex)[1].trim(); contentdata = contentdata.replace( / <p class="content_detail">/gi, "" ); contentdata = contentdata.split("</div>")[0]; contentdata = contentdata.replace(/\n/g, ""); contentdata = contentdata.replace(/<br\/>/g, ""); contentdata = contentdata.replace(/\s+/g, ""); contentdata = contentdata.replace(/<\/p>/g, "\n"); return contentdata; }; const getCode = () => { return new Promise(function(resolve, reject) { _GM_xmlhttpRequest({ method: "GET", url: `https://www.softrr.cn/crawler/getCode?id=2`, headers: { Referer: "https://www.softrr.cn/", "User-Agent": "Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/114.0.5735.289 Safari/537.36" }, onload: function(res) { resolve(JSON.parse(res.response).data[0].code); }, onerror: function(error) { console.log(error); } }); }); }; const downComFileTxt = (IDList, chapterTitle, ms) => { const zip = new JSZip(); const cache = {}; const promises = []; let i = 0; let n = IDList.length; let timer; let href = window.location.href; async function tick() { (function(i2) { if (href.includes("dushuge")) { if (i2 < n) { let promise = getDuShuGeContent(IDList[i2].url).then((data) => { let blob = new Blob([data], { type: "text/plain" }); zip.file(IDList[i2].chapter + ".txt", blob, { binary: true }); cache[IDList[i2].chapter] = data; }); promises.push(promise); } } if (href.includes("b5200")) { if (i2 < n) { let promise = getBiQuGeContent(IDList[i2].url).then((data) => { let blob = new Blob([data], { type: "text/plain" }); zip.file(IDList[i2].chapter + ".txt", blob, { binary: true }); cache[IDList[i2].chapter] = data; }); promises.push(promise); } } if (href.includes("bxfanqizha")) { if (i2 < n) { let promise = getBxfanqizhaContent(IDList[i2].url).then((data) => { let blob = new Blob([data], { type: "text/plain" }); zip.file(IDList[i2].chapter + ".txt", blob, { binary: true }); cache[IDList[i2].chapter] = data; }); promises.push(promise); } } if (href.includes("qimao")) { if (i2 < n) { let promise = getQiMaoContent(IDList[i2].id, IDList[i2].chapterId).then((data) => { let blob = new Blob([data], { type: "text/plain" }); zip.file(IDList[i2].chapter + ".txt", blob, { binary: true }); cache[IDList[i2].chapter] = data; }); promises.push(promise); } } if (href.includes("hujuge")) { if (i2 < n) { let promise = getHujugeContent(IDList[i2].url).then((data) => { let blob = new Blob([data], { type: "text/plain" }); zip.file(IDList[i2].chapter + ".txt", blob, { binary: true }); cache[IDList[i2].chapter] = data; }); promises.push(promise); } } if (href.includes("anshuge")) { if (i2 < n) { let promise = getAnshugeContent(IDList[i2].url).then((data) => { let blob = new Blob([data], { type: "text/plain" }); zip.file(IDList[i2].chapter + ".txt", blob, { binary: true }); cache[IDList[i2].chapter] = data; }); promises.push(promise); } } if (href.includes("biquxs")) { if (i2 < n) { let promise = getBiquxsContent(IDList[i2].url).then((data) => { let blob = new Blob([data], { type: "text/plain" }); zip.file(IDList[i2].chapter + ".txt", blob, { binary: true }); cache[IDList[i2].chapter] = data; }); promises.push(promise); } } })(i); i++; if (i == n) { Promise.all(promises).then(() => { zip.generateAsync({ type: "blob" }).then((content) => { downLoad(content, chapterTitle, "zip"); }); }).catch((err) => { elementPlus.ElMessage.error("网站存在网络问题,请稍后重试!"); }); clearTimeout(timer); } timer = setTimeout(tick, ms); } tick(); }; const downLoad = (blob, name, type) => { if (!blob || !type) return; const url = window.URL || window.webkitURL || window.moxURL; const downloadHref = url.createObjectURL(blob); const link = document.createElement("a"); link.href = downloadHref; link.download = `${name || "导出文件"}.${type}`; document.body.appendChild(link); link.click(); document.body.removeChild(link); url.revokeObjectURL(downloadHref); }; const getIdList = () => { let chapterList = document.querySelectorAll(".chapter-item"); let Idlist = []; const regId = /\/reader\/(\d+)/; const regContent = /<a.*?>(.*?)<\/a>/; for (var i = 0; i < chapterList.length; i++) { let aTag = chapterList[i].innerHTML; let ID = aTag.match(regId)[1]; let chapter = aTag.match(regContent)[1]; Idlist.push({ ID, chapter }); } return Idlist; }; const cookie = "novel_web_id=7357767624615331362;"; const getContent = (ID) => { return new Promise(function(resolve, reject) { _GM_xmlhttpRequest({ method: "GET", // url: `https://novel.snssdk.com/api/novel/book/reader/full/v1/?device_platform=android&parent_enterfrom=novel_channel_search.tab.&aid=2329&platform_id=1&group_id=0&item_id=${ID}`, // url: `http://fq.travacocro.com/content?item_id=${ID}`, url: `https://fanqienovel.com/api/reader/full?itemId=${ID}`, headers: { "Content-Type": "application/json", Accept: "application/json, text/plain, */*" }, cookie, anonymous: true, onload: function(res) { if (res.response !== void 0) { resolve(JSON.parse(res.responseText).data.chapterData.content); } else { resolve("无法解析"); } }, onerror: function(error) { reject(error); } }); }); }; const CODE_ST = 58344; const CODE_ED = 58715; const charset = [ "D", "在", "主", "特", "家", "军", "然", "表", "场", "4", "要", "只", "v", "和", "?", "6", "别", "还", "g", "现", "儿", "岁", "?", "?", "此", "象", "月", "3", "出", "战", "工", "相", "o", "男", "直", "失", "世", "F", "都", "平", "文", "什", "V", "O", "将", "真", "T", "那", "当", "?", "会", "立", "些", "u", "是", "十", "张", "学", "气", "大", "爱", "两", "命", "全", "后", "东", "性", "通", "被", "1", "它", "乐", "接", "而", "感", "车", "山", "公", "了", "常", "以", "何", "可", "话", "先", "p", "i", "叫", "轻", "M", "士", "w", "着", "变", "尔", "快", "l", "个", "说", "少", "色", "里", "安", "花", "远", "7", "难", "师", "放", "t", "报", "认", "面", "道", "S", "?", "克", "地", "度", "I", "好", "机", "U", "民", "写", "把", "万", "同", "水", "新", "没", "书", "电", "吃", "像", "斯", "5", "为", "y", "白", "几", "日", "教", "看", "但", "第", "加", "候", "作", "上", "拉", "住", "有", "法", "r", "事", "应", "位", "利", "你", "声", "身", "国", "问", "马", "女", "他", "Y", "比", "父", "x", "A", "H", "N", "s", "X", "边", "美", "对", "所", "金", "活", "回", "意", "到", "z", "从", "j", "知", "又", "内", "因", "点", "Q", "三", "定", "8", "R", "b", "正", "或", "夫", "向", "德", "听", "更", "?", "得", "告", "并", "本", "q", "过", "记", "L", "让", "打", "f", "人", "就", "者", "去", "原", "满", "体", "做", "经", "K", "走", "如", "孩", "c", "G", "给", "使", "物", "?", "最", "笑", "部", "?", "员", "等", "受", "k", "行", "一", "条", "果", "动", "光", "门", "头", "见", "往", "自", "解", "成", "处", "天", "能", "于", "名", "其", "发", "总", "母", "的", "死", "手", "入", "路", "进", "心", "来", "h", "时", "力", "多", "开", "已", "许", "d", "至", "由", "很", "界", "n", "小", "与", "Z", "想", "代", "么", "分", "生", "口", "再", "妈", "望", "次", "西", "风", "种", "带", "J", "?", "实", "情", "才", "这", "?", "E", "我", "神", "格", "长", "觉", "间", "年", "眼", "无", "不", "亲", "关", "结", "0", "友", "信", "下", "却", "重", "己", "老", "2", "音", "字", "m", "呢", "明", "之", "前", "高", "P", "B", "目", "太", "e", "9", "起", "稜", "她", "也", "W", "用", "方", "子", "英", "每", "理", "便", "四", "数", "期", "中", "C", "外", "样", "a", "海", "们", "任" ]; function interpreter(cc) { let bias = cc - CODE_ST; if (bias < 0 || bias >= charset.length || charset[bias] === "?") { return String.fromCharCode(cc); } return charset[bias]; } function r_content(content) { let newText = ""; try { for (var text of content) { let len = text.length; for (var ind = 0; ind < len; ind++) { let cc = text.charCodeAt(ind); var ch = text.charAt(ind); if (cc >= CODE_ST && cc <= CODE_ED) { ch = interpreter(cc); } newText += ch; } } } catch (err) { console.log(err); } return newText; } const downFanQieFileTxt = (IDList, chapterTitle, ms) => { const zip = new JSZip(); const promises = []; let i = 0; async function tick() { let promise = getContent(IDList[i].ID).then((data) => { data = r_content(data); data = data.replace(/<\/p><p>/g, "\n").replace("<p>", "").replace("</p>", ""); let blob = new Blob([data], { type: "text/plain" }); zip.file(`第${i + 1}章.txt`, blob, { binary: true }); }); promises.push(promise); i++; if (i == IDList.length) { Promise.all(promises).then(() => { zip.generateAsync({ type: "blob" }).then((content) => { downLoad(content, chapterTitle, "zip"); }); }).catch((err) => { console.log(err); }); clearTimeout(timer); } const timer = setTimeout(tick, ms); } tick(); }; const _hoisted_1 = { class: "downLoad_container" }; const _sfc_main = { __name: "App", setup(__props) { const flag = vue.ref(false); const percentage2 = vue.ref(); const ms = vue.ref(); const code = vue.ref(); const model = vue.ref(""); const titleList = vue.ref([]); const chapterTitle = vue.ref(""); const containShow = vue.ref(true); const colors = [ { color: "#f56c6c", percentage: 20 }, { color: "#e6a23c", percentage: 40 }, { color: "#5cb87a", percentage: 60 }, { color: "#1989fa", percentage: 80 }, { color: "#6f7ad3", percentage: 100 } ]; let url = window.location.href; if (url.includes("html")) { containShow.value = false; } if (url.includes("hujuge")) { containShow.value = true; } if (url.includes("anshuge.com/files/article")) { containShow.value = true; document.querySelector("#apprecom2").style.display = "none"; } if (url.includes("qimao") && url.includes("-")) { containShow.value = false; } if (url.includes("anshuge") && !url.includes("index")) { containShow.value = false; } const onDown = async () => { if (!ms.value) return elementPlus.ElMessage.error("请选择请求间隔时间!"); code.value = await getCode(); let locaCode = localStorage.getItem("fcode") || ""; if (locaCode == code.value) { flag.value = true; if (url.includes("fanqienovel")) { titleList.value = getIdList(); let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / titleList.value.length); if (i == titleList.value.length) { flag.value = false; clearInterval(timer2); } }, ms.value); chapterTitle.value = document.querySelector(".info-name").innerText; downFanQieFileTxt(titleList.value, chapterTitle.value, ms.value); } if (url.includes("dushuge")) { titleList.value = await getDuShuGeList(); let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / titleList.value.length); if (i == titleList.value.length) { flag.value = false; clearInterval(timer2); } }, ms.value); chapterTitle.value = document.querySelector("#info > h1").innerText; dowloadFile(titleList.value, chapterTitle.value); } if (url.includes("b5200")) { titleList.value = await getBiQuGeList(); let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / titleList.value.length); if (i == titleList.value.length) { flag.value = false; clearInterval(timer2); } }, ms.value); chapterTitle.value = document.querySelector("#info > h1").innerText; dowloadFile(titleList.value, chapterTitle.value); } if (url.includes("bxfanqizha")) { titleList.value = await getBxfanqizhaList(); let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / titleList.value.length); if (i == titleList.value.length) { flag.value = false; clearInterval(timer2); } }, ms.value); chapterTitle.value = document.querySelector(".pl0 > h1").innerText; dowloadFile(titleList.value, chapterTitle.value); } if (url.includes("qimao")) { titleList.value = getQiMaoIdList(); let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / titleList.value.length); if (i == titleList.value.length) { flag.value = false; clearInterval(timer2); } }, ms.value); chapterTitle.value = document.querySelector(".title > .txt").innerText; dowloadFile(titleList.value, chapterTitle.value); } if (url.includes("hujuge")) { titleList.value = getHujugeIdList(); let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / titleList.value.length); if (i == titleList.value.length) { flag.value = false; clearInterval(timer2); } }, ms.value); chapterTitle.value = document.querySelector(".top > h1").innerText; dowloadFile(titleList.value, chapterTitle.value); } if (url.includes("anshuge")) { titleList.value = getAnshugeIdList(); let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / titleList.value.length); if (i == titleList.value.length) { flag.value = false; clearInterval(timer2); } }, ms.value); chapterTitle.value = document.querySelectorAll(".bdsub > dl > dt > a")[2].innerText; dowloadFile(titleList.value, chapterTitle.value); } if (url.includes("biquxs")) { titleList.value = getBiquxsIdList(); let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / titleList.value.length); if (i == titleList.value.length) { flag.value = false; clearInterval(timer2); } }, ms.value); chapterTitle.value = document.querySelector("#info>h1").innerText; dowloadFile(titleList.value, chapterTitle.value); } } else { model.value.openModal(); } }; const dowloadFile = (list, title2) => { let i = 0; const timer2 = setInterval(() => { i++; percentage2.value = Math.round(i * 100 / list.length); if (i == list.length) { flag.value = false; clearInterval(timer2); } }, ms.value); downComFileTxt(list, title2, ms.value); }; const options = [100, 200, 300, 400, 500, 600, 700, 800, 900, 1e3, 1200, 1400, 1600, 1800, 2e3]; const title = vue.ref("为了减少端口压力,防止滥用,采取必要的验证手段。"); return (_ctx, _cache) => { const _component_el_option = ElOption; const _component_el_select = ElSelect; const _component_el_progress = ElProgress; return vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", _hoisted_1, [ vue.createVNode(_component_el_select, { modelValue: ms.value, "onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => ms.value = $event), placeholder: "请求间隔", style: { "width": "120px" } }, { default: vue.withCtx(() => [ (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(options, (item) => { return vue.createVNode(_component_el_option, { key: item, label: item, value: item }, null, 8, ["label", "value"]); }), 64)) ]), _: 1 }, 8, ["modelValue"]), vue.createElementVNode("button", { onClick: onDown, class: "down" }, "一键下载"), vue.withDirectives(vue.createVNode(_component_el_progress, { type: "dashboard", percentage: percentage2.value, color: colors }, null, 8, ["percentage"]), [ [vue.vShow, flag.value] ]), vue.createVNode(Model, { title: title.value, code: code.value, ref_key: "model", ref: model }, null, 8, ["title", "code"]) ], 512)), [ [vue.vShow, containShow.value] ]); }; } }; const App = /* @__PURE__ */ _export_sfc(_sfc_main, [["__scopeId", "data-v-9a5f872a"]]); const cssLoader = (e) => { const t = GM_getResourceText(e); return GM_addStyle(t), t; }; cssLoader("element-plus/dist/index.css"); const app = vue.createApp(App); app.mount( (() => { const app2 = document.createElement("div"); document.body.append(app2); return app2; })() ); })(Vue, ElementPlus, CryptoJS);
QingJ © 2025
镜像随时可能失效,请加Q群300939539或关注我们的公众号极客氢云获取最新地址