斗鱼插件
От
// ==UserScript== // @name douyu-crx // @namespace npm/douyu-crx // @version 1.2 // @author monkey // @description 斗鱼插件 // @icon https://vitejs.dev/logo.svg // @match *://*.douyu.com/0* // @match *://*.douyu.com/1* // @match *://*.douyu.com/2* // @match *://*.douyu.com/3* // @match *://*.douyu.com/4* // @match *://*.douyu.com/5* // @match *://*.douyu.com/6* // @match *://*.douyu.com/7* // @match *://*.douyu.com/8* // @match *://*.douyu.com/9* // @match *://*.douyu.com/topic/* // @require https://cdn.jsdelivr.net/npm/[email protected]/dist/vue.global.prod.js // @require data:application/javascript,%3Bwindow.Vue%3DVue%3B // @require https://cdn.jsdelivr.net/npm/[email protected]/dist/index.full.min.js // @require https://cdn.jsdelivr.net/npm/[email protected]/dist/qs.min.js // @require https://cdn.jsdelivr.net/npm/[email protected]/lib/index.iife.min.js // @require https://cdn.jsdelivr.net/npm/[email protected]/dist/pinia.iife.min.js // @resource element-plus/dist/index.css https://cdn.jsdelivr.net/npm/[email protected]/dist/index.css // @connect doseeing.com // @connect douyu.com // @grant GM_addStyle // @grant GM_getResourceText // @grant GM_xmlhttpRequest // @grant unsafeWindow // ==/UserScript== (e=>{if(typeof GM_addStyle=="function"){GM_addStyle(e);return}const r=document.createElement("style");r.textContent=e,document.head.append(r)})(' @charset "UTF-8";*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }.static{position:static}.fixed{position:fixed}.mb-4{margin-bottom:1rem}.ml-12{margin-left:3rem}.ml-2{margin-left:.5rem}.ml-5{margin-left:1.25rem}.flex{display:flex}.h-16{height:4rem}.h-20{height:5rem}.h-\\[58vh\\]{height:58vh}.w-16{width:4rem}.w-20{width:5rem}.w-56{width:14rem}.w-full{width:100%}.flex-1{flex:1 1 0%}.flex-none{flex:none}.cursor-pointer{cursor:pointer}.items-start{align-items:flex-start}.items-center{align-items:center}.justify-between{justify-content:space-between}.rounded-md{border-radius:.375rem}.rounded-xl{border-radius:.75rem}.p-\\[20px\\]{padding:20px}.pt-\\[5px\\]{padding-top:5px}.text-center{text-align:center}.text-3xl{font-size:1.875rem;line-height:2.25rem}.text-\\[14px\\]{font-size:14px}.text-xl{font-size:1.25rem;line-height:1.75rem}.font-black{font-weight:900}.font-bold{font-weight:700}.text-slate-400{--tw-text-opacity: 1;color:rgb(148 163 184 / var(--tw-text-opacity))}:root{--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary-rgb:64,158,255;--el-color-success-rgb:103,194,58;--el-color-warning-rgb:230,162,60;--el-color-danger-rgb:245,108,108;--el-color-error-rgb:245,108,108;--el-color-info-rgb:144,147,153;--el-font-size-extra-large:20px;--el-font-size-large:18px;--el-font-size-medium:16px;--el-font-size-base:14px;--el-font-size-small:13px;--el-font-size-extra-small:12px;--el-font-family:"Helvetica Neue",Helvetica,"PingFang SC","Hiragino Sans GB","Microsoft YaHei","\u5FAE\u8F6F\u96C5\u9ED1",Arial,sans-serif;--el-font-weight-primary:500;--el-font-line-height-primary:24px;--el-index-normal:1;--el-index-top:1000;--el-index-popper:2000;--el-border-radius-base:4px;--el-border-radius-small:2px;--el-border-radius-round:20px;--el-border-radius-circle:100%;--el-transition-duration:.3s;--el-transition-duration-fast:.2s;--el-transition-function-ease-in-out-bezier:cubic-bezier(.645,.045,.355,1);--el-transition-function-fast-bezier:cubic-bezier(.23,1,.32,1);--el-transition-all:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade:opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade:transform var(--el-transition-duration) var(--el-transition-function-fast-bezier),opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear:opacity var(--el-transition-duration-fast) linear;--el-transition-border:border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow:box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color:color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large:40px;--el-component-size:32px;--el-component-size-small:24px;color-scheme:light;--el-color-primary:#409eff;--el-color-primary-light-3:#79bbff;--el-color-primary-light-5:#a0cfff;--el-color-primary-light-7:#c6e2ff;--el-color-primary-light-8:#d9ecff;--el-color-primary-light-9:#ecf5ff;--el-color-primary-dark-2:#337ecc;--el-color-success:#67c23a;--el-color-success-light-3:#95d475;--el-color-success-light-5:#b3e19d;--el-color-success-light-7:#d1edc4;--el-color-success-light-8:#e1f3d8;--el-color-success-light-9:#f0f9eb;--el-color-success-dark-2:#529b2e;--el-color-warning:#e6a23c;--el-color-warning-light-3:#eebe77;--el-color-warning-light-5:#f3d19e;--el-color-warning-light-7:#f8e3c5;--el-color-warning-light-8:#faecd8;--el-color-warning-light-9:#fdf6ec;--el-color-warning-dark-2:#b88230;--el-color-danger:#f56c6c;--el-color-danger-light-3:#f89898;--el-color-danger-light-5:#fab6b6;--el-color-danger-light-7:#fcd3d3;--el-color-danger-light-8:#fde2e2;--el-color-danger-light-9:#fef0f0;--el-color-danger-dark-2:#c45656;--el-color-error:#f56c6c;--el-color-error-light-3:#f89898;--el-color-error-light-5:#fab6b6;--el-color-error-light-7:#fcd3d3;--el-color-error-light-8:#fde2e2;--el-color-error-light-9:#fef0f0;--el-color-error-dark-2:#c45656;--el-color-info:#909399;--el-color-info-light-3:#b1b3b8;--el-color-info-light-5:#c8c9cc;--el-color-info-light-7:#dedfe0;--el-color-info-light-8:#e9e9eb;--el-color-info-light-9:#f4f4f5;--el-color-info-dark-2:#73767a;--el-bg-color:#ffffff;--el-bg-color-page:#f2f3f5;--el-bg-color-overlay:#ffffff;--el-text-color-primary:#303133;--el-text-color-regular:#606266;--el-text-color-secondary:#909399;--el-text-color-placeholder:#a8abb2;--el-text-color-disabled:#c0c4cc;--el-border-color:#dcdfe6;--el-border-color-light:#e4e7ed;--el-border-color-lighter:#ebeef5;--el-border-color-extra-light:#f2f6fc;--el-border-color-dark:#d4d7de;--el-border-color-darker:#cdd0d6;--el-fill-color:#f0f2f5;--el-fill-color-light:#f5f7fa;--el-fill-color-lighter:#fafafa;--el-fill-color-extra-light:#fafcff;--el-fill-color-dark:#ebedf0;--el-fill-color-darker:#e6e8eb;--el-fill-color-blank:#ffffff;--el-box-shadow:0px 12px 32px 4px rgba(0,0,0,.04),0px 8px 20px rgba(0,0,0,.08);--el-box-shadow-light:0px 0px 12px rgba(0,0,0,.12);--el-box-shadow-lighter:0px 0px 6px rgba(0,0,0,.12);--el-box-shadow-dark:0px 16px 48px 16px rgba(0,0,0,.08),0px 12px 32px rgba(0,0,0,.12),0px 8px 16px -8px rgba(0,0,0,.16);--el-disabled-bg-color:var(--el-fill-color-light);--el-disabled-text-color:var(--el-text-color-placeholder);--el-disabled-border-color:var(--el-border-color-light);--el-overlay-color:rgba(0,0,0,.8);--el-overlay-color-light:rgba(0,0,0,.7);--el-overlay-color-lighter:rgba(0,0,0,.5);--el-mask-color:rgba(255,255,255,.9);--el-mask-color-extra-light:rgba(255,255,255,.3);--el-border-width:1px;--el-border-style:solid;--el-border-color-hover:var(--el-text-color-disabled);--el-border:var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey:var(--el-border-color)}.el-icon-loading{animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(1turn)}}.el-icon{--color:inherit;align-items:center;display:inline-flex;height:1em;justify-content:center;line-height:1em;position:relative;width:1em;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}:root{--el-loading-spinner-size:42px;--el-loading-fullscreen-spinner-size:50px}.el-loading-parent--relative{position:relative!important}.el-loading-parent--hidden{overflow:hidden!important}.el-loading-mask{background-color:var(--el-mask-color);bottom:0;left:0;margin:0;position:absolute;right:0;top:0;transition:opacity var(--el-transition-duration);z-index:2000}.el-loading-mask.is-fullscreen{position:fixed}.el-loading-mask.is-fullscreen .el-loading-spinner{margin-top:calc((0px - var(--el-loading-fullscreen-spinner-size))/2)}.el-loading-mask.is-fullscreen .el-loading-spinner .circular{height:var(--el-loading-fullscreen-spinner-size);width:var(--el-loading-fullscreen-spinner-size)}.el-loading-spinner{margin-top:calc((0px - var(--el-loading-spinner-size))/2);position:absolute;text-align:center;top:50%;width:100%}.el-loading-spinner .el-loading-text{color:var(--el-color-primary);font-size:14px;margin:3px 0}.el-loading-spinner .circular{animation:loading-rotate 2s linear infinite;display:inline;height:var(--el-loading-spinner-size);width:var(--el-loading-spinner-size)}.el-loading-spinner .path{animation:loading-dash 1.5s ease-in-out infinite;stroke-dasharray:90,150;stroke-dashoffset:0;stroke-width:2;stroke:var(--el-color-primary);stroke-linecap:round}.el-loading-spinner i{color:var(--el-color-primary)}.el-loading-fade-enter-from,.el-loading-fade-leave-to{opacity:0}@keyframes loading-rotate{to{transform:rotate(1turn)}}@keyframes loading-dash{0%{stroke-dasharray:1,200;stroke-dashoffset:0}50%{stroke-dasharray:90,150;stroke-dashoffset:-40px}to{stroke-dasharray:90,150;stroke-dashoffset:-120px}}:root{--el-popup-modal-bg-color:var(--el-color-black);--el-popup-modal-opacity:.5}.v-modal-enter{animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-out{to{opacity:0}}.v-modal{background:var(--el-popup-modal-bg-color);height:100%;left:0;opacity:var(--el-popup-modal-opacity);position:fixed;top:0;width:100%}.el-popup-parent--hidden{overflow:hidden}.el-dialog{--el-dialog-width:50%;--el-dialog-margin-top:15vh;--el-dialog-bg-color:var(--el-bg-color);--el-dialog-box-shadow:var(--el-box-shadow);--el-dialog-title-font-size:var(--el-font-size-large);--el-dialog-content-font-size:14px;--el-dialog-font-line-height:var(--el-font-line-height-primary);--el-dialog-padding-primary:16px;--el-dialog-border-radius:var(--el-border-radius-small);background:var(--el-dialog-bg-color);border-radius:var(--el-dialog-border-radius);box-shadow:var(--el-dialog-box-shadow);box-sizing:border-box;margin:var(--el-dialog-margin-top,15vh) auto 50px;overflow-wrap:break-word;padding:var(--el-dialog-padding-primary);position:relative;width:var(--el-dialog-width,50%)}.el-dialog:focus{outline:none!important}.el-dialog.is-align-center{margin:auto}.el-dialog.is-fullscreen{--el-dialog-width:100%;--el-dialog-margin-top:0;height:100%;margin-bottom:0;overflow:auto}.el-dialog__wrapper{bottom:0;left:0;margin:0;overflow:auto;position:fixed;right:0;top:0}.el-dialog.is-draggable .el-dialog__header{cursor:move;-webkit-user-select:none;user-select:none}.el-dialog__header{padding-bottom:var(--el-dialog-padding-primary)}.el-dialog__header.show-close{padding-right:calc(var(--el-dialog-padding-primary) + var(--el-message-close-size, 16px))}.el-dialog__headerbtn{background:transparent;border:none;cursor:pointer;font-size:var(--el-message-close-size,16px);height:48px;outline:none;padding:0;position:absolute;right:0;top:0;width:48px}.el-dialog__headerbtn .el-dialog__close{color:var(--el-color-info);font-size:inherit}.el-dialog__headerbtn:focus .el-dialog__close,.el-dialog__headerbtn:hover .el-dialog__close{color:var(--el-color-primary)}.el-dialog__title{color:var(--el-text-color-primary);font-size:var(--el-dialog-title-font-size);line-height:var(--el-dialog-font-line-height)}.el-dialog__body{color:var(--el-text-color-regular);font-size:var(--el-dialog-content-font-size)}.el-dialog__footer{box-sizing:border-box;padding-top:var(--el-dialog-padding-primary);text-align:right}.el-dialog--center{text-align:center}.el-dialog--center .el-dialog__body{text-align:initial}.el-dialog--center .el-dialog__footer{text-align:inherit}.el-overlay-dialog{bottom:0;left:0;overflow:auto;position:fixed;right:0;top:0}.dialog-fade-enter-active{animation:modal-fade-in var(--el-transition-duration)}.dialog-fade-enter-active .el-overlay-dialog{animation:dialog-fade-in var(--el-transition-duration)}.dialog-fade-leave-active{animation:modal-fade-out var(--el-transition-duration)}.dialog-fade-leave-active .el-overlay-dialog{animation:dialog-fade-out var(--el-transition-duration)}@keyframes dialog-fade-in{0%{opacity:0;transform:translate3d(0,-20px,0)}to{opacity:1;transform:translateZ(0)}}@keyframes dialog-fade-out{0%{opacity:1;transform:translateZ(0)}to{opacity:0;transform:translate3d(0,-20px,0)}}@keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}.el-overlay{background-color:var(--el-overlay-color-lighter);bottom:0;height:100%;left:0;overflow:auto;position:fixed;right:0;top:0;z-index:2000}.el-overlay .el-overlay-root{height:0}.el-scrollbar{--el-scrollbar-opacity:.3;--el-scrollbar-bg-color:var(--el-text-color-secondary);--el-scrollbar-hover-opacity:.5;--el-scrollbar-hover-bg-color:var(--el-text-color-secondary);height:100%;overflow:hidden;position:relative}.el-scrollbar__wrap{height:100%;overflow:auto}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{background-color:var(--el-scrollbar-bg-color,var(--el-text-color-secondary));border-radius:inherit;cursor:pointer;display:block;height:0;opacity:var(--el-scrollbar-opacity,.3);position:relative;transition:var(--el-transition-duration) background-color;width:0}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color,var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity,.5)}.el-scrollbar__bar{border-radius:4px;bottom:2px;position:absolute;right:2px;z-index:1}.el-scrollbar__bar.is-vertical{top:2px;width:6px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity .34s ease-out}.el-scrollbar-fade-leave-active{transition:opacity .12s ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}.el-divider{position:relative}.el-divider--horizontal{border-top:1px var(--el-border-color) var(--el-border-style);display:block;height:1px;margin:24px 0;width:100%}.el-divider--vertical{border-left:1px var(--el-border-color) var(--el-border-style);display:inline-block;height:1em;margin:0 8px;position:relative;vertical-align:middle;width:1px}.el-divider__text{background-color:var(--el-bg-color);color:var(--el-text-color-primary);font-size:14px;font-weight:500;padding:0 20px;position:absolute}.el-divider__text.is-left{left:20px;transform:translateY(-50%)}.el-divider__text.is-center{left:50%;transform:translate(-50%) translateY(-50%)}.el-divider__text.is-right{right:20px;transform:translateY(-50%)}.el-date-table{font-size:12px;-webkit-user-select:none;user-select:none}.el-date-table.is-week-mode .el-date-table__row:hover .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table.is-week-mode .el-date-table__row:hover td.available:hover{color:var(--el-datepicker-text-color)}.el-date-table.is-week-mode .el-date-table__row:hover td:first-child .el-date-table-cell{border-bottom-left-radius:15px;border-top-left-radius:15px;margin-left:5px}.el-date-table.is-week-mode .el-date-table__row:hover td:last-child .el-date-table-cell{border-bottom-right-radius:15px;border-top-right-radius:15px;margin-right:5px}.el-date-table.is-week-mode .el-date-table__row.current .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td{box-sizing:border-box;cursor:pointer;height:30px;padding:4px 0;position:relative;text-align:center;width:32px}.el-date-table td .el-date-table-cell{box-sizing:border-box;height:30px;padding:3px 0}.el-date-table td .el-date-table-cell .el-date-table-cell__text{border-radius:50%;display:block;height:24px;left:50%;line-height:24px;margin:0 auto;position:absolute;transform:translate(-50%);width:24px}.el-date-table td.next-month,.el-date-table td.prev-month{color:var(--el-datepicker-off-text-color)}.el-date-table td.today{position:relative}.el-date-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-date-table td.today.end-date .el-date-table-cell__text,.el-date-table td.today.start-date .el-date-table-cell__text{color:#fff}.el-date-table td.available:hover{color:var(--el-datepicker-hover-text-color)}.el-date-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-date-table td.current:not(.disabled) .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);color:#fff}.el-date-table td.current:not(.disabled):focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-date-table td.end-date .el-date-table-cell,.el-date-table td.start-date .el-date-table-cell{color:#fff}.el-date-table td.end-date .el-date-table-cell__text,.el-date-table td.start-date .el-date-table-cell__text{background-color:var(--el-datepicker-active-color)}.el-date-table td.start-date .el-date-table-cell{border-bottom-left-radius:15px;border-top-left-radius:15px;margin-left:5px}.el-date-table td.end-date .el-date-table-cell{border-bottom-right-radius:15px;border-top-right-radius:15px;margin-right:5px}.el-date-table td.disabled .el-date-table-cell{background-color:var(--el-fill-color-light);color:var(--el-text-color-placeholder);cursor:not-allowed;opacity:1}.el-date-table td.selected .el-date-table-cell{border-radius:15px;margin-left:5px;margin-right:5px}.el-date-table td.selected .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);border-radius:15px;color:#fff}.el-date-table td.week{color:var(--el-datepicker-header-text-color);font-size:80%}.el-date-table td:focus{outline:none}.el-date-table th{border-bottom:1px solid var(--el-border-color-lighter);color:var(--el-datepicker-header-text-color);font-weight:400;padding:5px}.el-month-table{border-collapse:collapse;font-size:12px;margin:-1px}.el-month-table td{cursor:pointer;padding:8px 0;position:relative;text-align:center;width:68px}.el-month-table td div{box-sizing:border-box;height:48px;padding:6px 0}.el-month-table td.today .cell{color:var(--el-color-primary);font-weight:700}.el-month-table td.today.end-date .cell,.el-month-table td.today.start-date .cell{color:#fff}.el-month-table td.disabled .cell{background-color:var(--el-fill-color-light);color:var(--el-text-color-placeholder);cursor:not-allowed}.el-month-table td.disabled .cell:hover{color:var(--el-text-color-placeholder)}.el-month-table td .cell{border-radius:18px;color:var(--el-datepicker-text-color);display:block;height:36px;left:50%;line-height:36px;margin:0 auto;position:absolute;transform:translate(-50%);width:54px}.el-month-table td .cell:hover{color:var(--el-datepicker-hover-text-color)}.el-month-table td.in-range div{background-color:var(--el-datepicker-inrange-bg-color)}.el-month-table td.in-range div:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-month-table td.end-date div,.el-month-table td.start-date div{color:#fff}.el-month-table td.end-date .cell,.el-month-table td.start-date .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-month-table td.start-date div{border-bottom-left-radius:24px;border-top-left-radius:24px;margin-left:3px}.el-month-table td.end-date div{border-bottom-right-radius:24px;border-top-right-radius:24px;margin-right:3px}.el-month-table td.current:not(.disabled) div{border-radius:24px;margin-left:3px;margin-right:3px}.el-month-table td.current:not(.disabled) .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-month-table td:focus-visible{outline:none}.el-month-table td:focus-visible .cell{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-year-table{border-collapse:collapse;font-size:12px;margin:-1px}.el-year-table .el-icon{color:var(--el-datepicker-icon-color)}.el-year-table td{cursor:pointer;padding:8px 0;position:relative;text-align:center;width:68px}.el-year-table td div{box-sizing:border-box;height:48px;padding:6px 0}.el-year-table td.today .cell{color:var(--el-color-primary);font-weight:700}.el-year-table td.disabled .cell{background-color:var(--el-fill-color-light);color:var(--el-text-color-placeholder);cursor:not-allowed}.el-year-table td.disabled .cell:hover{color:var(--el-text-color-placeholder)}.el-year-table td .cell{border-radius:18px;color:var(--el-datepicker-text-color);display:block;height:36px;left:50%;line-height:36px;margin:0 auto;position:absolute;transform:translate(-50%);width:54px}.el-year-table td .cell:hover{color:var(--el-datepicker-hover-text-color)}.el-year-table td.current:not(.disabled) div{border-radius:24px;margin-left:3px;margin-right:3px}.el-year-table td.current:not(.disabled) .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-year-table td:focus-visible{outline:none}.el-year-table td:focus-visible .cell{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-time-spinner.has-seconds .el-time-spinner__wrapper{width:33.3%}.el-time-spinner__wrapper{display:inline-block;max-height:192px;overflow:auto;position:relative;vertical-align:top;width:50%}.el-time-spinner__wrapper.el-scrollbar__wrap:not(.el-scrollbar__wrap--hidden-default){padding-bottom:15px}.el-time-spinner__wrapper.is-arrow{box-sizing:border-box;overflow:hidden;text-align:center}.el-time-spinner__wrapper.is-arrow .el-time-spinner__list{transform:translateY(-32px)}.el-time-spinner__wrapper.is-arrow .el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:default}.el-time-spinner__arrow{color:var(--el-text-color-secondary);cursor:pointer;font-size:12px;height:30px;left:0;line-height:30px;position:absolute;text-align:center;width:100%;z-index:var(--el-index-normal)}.el-time-spinner__arrow:hover{color:var(--el-color-primary)}.el-time-spinner__arrow.arrow-up{top:10px}.el-time-spinner__arrow.arrow-down{bottom:10px}.el-time-spinner__input.el-input{width:70%}.el-time-spinner__input.el-input .el-input__inner,.el-time-spinner__list{padding:0;text-align:center}.el-time-spinner__list{list-style:none;margin:0}.el-time-spinner__list:after,.el-time-spinner__list:before{content:"";display:block;height:80px;width:100%}.el-time-spinner__item{color:var(--el-text-color-regular);font-size:12px;height:32px;line-height:32px}.el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:pointer}.el-time-spinner__item.is-active:not(.is-disabled){color:var(--el-text-color-primary);font-weight:700}.el-time-spinner__item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transform-origin:center top;transition:var(--el-transition-md-fade)}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transform-origin:center bottom;transition:var(--el-transition-md-fade)}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transform-origin:top left;transition:var(--el-transition-md-fade)}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-picker__popper{--el-datepicker-border-color:var(--el-disabled-border-color)}.el-picker__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-datepicker-border-color);box-shadow:var(--el-box-shadow-light)}.el-picker__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-datepicker-border-color)}.el-picker__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-left-color:transparent;border-top-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-bottom-color:transparent;border-left-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-date-editor{--el-date-editor-width:220px;--el-date-editor-monthrange-width:300px;--el-date-editor-daterange-width:350px;--el-date-editor-datetimerange-width:400px;--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;position:relative;text-align:left;vertical-align:middle}.el-date-editor.el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset}.el-date-editor.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-date-editor.el-input,.el-date-editor.el-input__wrapper{height:var(--el-input-height,var(--el-component-size));width:var(--el-date-editor-width)}.el-date-editor--monthrange{--el-date-editor-width:var(--el-date-editor-monthrange-width)}.el-date-editor--daterange,.el-date-editor--timerange{--el-date-editor-width:var(--el-date-editor-daterange-width)}.el-date-editor--datetimerange{--el-date-editor-width:var(--el-date-editor-datetimerange-width)}.el-date-editor--dates .el-input__wrapper{text-overflow:ellipsis;white-space:nowrap}.el-date-editor .clear-icon,.el-date-editor .close-icon{cursor:pointer}.el-date-editor .clear-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__icon{color:var(--el-text-color-placeholder);float:left;font-size:14px;height:inherit}.el-date-editor .el-range__icon svg{vertical-align:middle}.el-date-editor .el-range-input{-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent;border:none;color:var(--el-text-color-regular);display:inline-block;font-size:var(--el-font-size-base);height:30px;line-height:30px;margin:0;outline:none;padding:0;text-align:center;width:39%}.el-date-editor .el-range-input::placeholder{color:var(--el-text-color-placeholder)}.el-date-editor .el-range-separator{align-items:center;color:var(--el-text-color-primary);display:inline-flex;flex:1;font-size:14px;height:100%;justify-content:center;margin:0;overflow-wrap:break-word;padding:0 5px}.el-date-editor .el-range__close-icon{color:var(--el-text-color-placeholder);cursor:pointer;font-size:14px;height:inherit;width:unset}.el-date-editor .el-range__close-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__close-icon svg{vertical-align:middle}.el-date-editor .el-range__close-icon--hidden{opacity:0;visibility:hidden}.el-range-editor.el-input__wrapper{align-items:center;display:inline-flex;padding:0 10px}.el-range-editor.is-active,.el-range-editor.is-active:hover{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-range-editor--large{line-height:var(--el-component-size-large)}.el-range-editor--large.el-input__wrapper{height:var(--el-component-size-large)}.el-range-editor--large .el-range-separator{font-size:14px;line-height:40px}.el-range-editor--large .el-range-input{font-size:14px;height:38px;line-height:38px}.el-range-editor--small{line-height:var(--el-component-size-small)}.el-range-editor--small.el-input__wrapper{height:var(--el-component-size-small)}.el-range-editor--small .el-range-separator{font-size:12px;line-height:24px}.el-range-editor--small .el-range-input{font-size:12px;height:22px;line-height:22px}.el-range-editor.is-disabled{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled:focus,.el-range-editor.is-disabled:hover{border-color:var(--el-disabled-border-color)}.el-range-editor.is-disabled input{background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled input::placeholder{color:var(--el-text-color-placeholder)}.el-range-editor.is-disabled .el-range-separator{color:var(--el-disabled-text-color)}.el-picker-panel{background:var(--el-bg-color-overlay);border-radius:var(--el-border-radius-base);color:var(--el-text-color-regular);line-height:30px}.el-picker-panel .el-time-panel{background-color:var(--el-bg-color-overlay);border:1px solid var(--el-datepicker-border-color);box-shadow:var(--el-box-shadow-light);margin:5px 0}.el-picker-panel__body-wrapper:after,.el-picker-panel__body:after{clear:both;content:"";display:table}.el-picker-panel__content{margin:15px;position:relative}.el-picker-panel__footer{background-color:var(--el-bg-color-overlay);border-top:1px solid var(--el-datepicker-inner-border-color);font-size:0;padding:4px 12px;position:relative;text-align:right}.el-picker-panel__shortcut{background-color:transparent;border:0;color:var(--el-datepicker-text-color);cursor:pointer;display:block;font-size:14px;line-height:28px;outline:none;padding-left:12px;text-align:left;width:100%}.el-picker-panel__shortcut:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__shortcut.active{background-color:#e6f1fe;color:var(--el-datepicker-active-color)}.el-picker-panel__btn{background-color:transparent;border:1px solid var(--el-fill-color-darker);border-radius:2px;color:var(--el-text-color-primary);cursor:pointer;font-size:12px;line-height:24px;outline:none;padding:0 20px}.el-picker-panel__btn[disabled]{color:var(--el-text-color-disabled);cursor:not-allowed}.el-picker-panel__icon-btn{background:transparent;border:0;color:var(--el-datepicker-icon-color);cursor:pointer;font-size:12px;margin-top:8px;outline:none}.el-picker-panel__icon-btn:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn:focus-visible{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn.is-disabled{color:var(--el-text-color-disabled)}.el-picker-panel__icon-btn.is-disabled:hover{cursor:not-allowed}.el-picker-panel__icon-btn .el-icon{cursor:pointer;font-size:inherit}.el-picker-panel__link-btn{vertical-align:middle}.el-picker-panel [slot=sidebar],.el-picker-panel__sidebar{background-color:var(--el-bg-color-overlay);border-right:1px solid var(--el-datepicker-inner-border-color);bottom:0;box-sizing:border-box;overflow:auto;padding-top:6px;position:absolute;top:0;width:110px}.el-picker-panel [slot=sidebar]+.el-picker-panel__body,.el-picker-panel__sidebar+.el-picker-panel__body{margin-left:110px}.el-date-picker{--el-datepicker-text-color:var(--el-text-color-regular);--el-datepicker-off-text-color:var(--el-text-color-placeholder);--el-datepicker-header-text-color:var(--el-text-color-regular);--el-datepicker-icon-color:var(--el-text-color-primary);--el-datepicker-border-color:var(--el-disabled-border-color);--el-datepicker-inner-border-color:var(--el-border-color-light);--el-datepicker-inrange-bg-color:var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color:var(--el-border-color-extra-light);--el-datepicker-active-color:var(--el-color-primary);--el-datepicker-hover-text-color:var(--el-color-primary);width:322px}.el-date-picker.has-sidebar.has-time{width:434px}.el-date-picker.has-sidebar{width:438px}.el-date-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-picker .el-picker-panel__content{width:292px}.el-date-picker table{table-layout:fixed;width:100%}.el-date-picker__editor-wrap{display:table-cell;padding:0 5px;position:relative}.el-date-picker__time-header{border-bottom:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;display:table;font-size:12px;padding:8px 5px 5px;position:relative;width:100%}.el-date-picker__header{margin:12px;text-align:center}.el-date-picker__header--bordered{border-bottom:1px solid var(--el-border-color-lighter);margin-bottom:0;padding-bottom:12px}.el-date-picker__header--bordered+.el-picker-panel__content{margin-top:0}.el-date-picker__header-label{color:var(--el-text-color-regular);cursor:pointer;font-size:16px;font-weight:500;line-height:22px;padding:0 5px;text-align:center}.el-date-picker__header-label:hover{color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label:focus-visible{color:var(--el-datepicker-hover-text-color);outline:none}.el-date-picker__header-label.active{color:var(--el-datepicker-active-color)}.el-date-picker__prev-btn{float:left}.el-date-picker__next-btn{float:right}.el-date-picker__time-wrap{padding:10px;text-align:center}.el-date-picker__time-label{cursor:pointer;float:left;line-height:30px;margin-left:10px}.el-date-picker .el-time-panel{position:absolute}.el-date-range-picker{--el-datepicker-text-color:var(--el-text-color-regular);--el-datepicker-off-text-color:var(--el-text-color-placeholder);--el-datepicker-header-text-color:var(--el-text-color-regular);--el-datepicker-icon-color:var(--el-text-color-primary);--el-datepicker-border-color:var(--el-disabled-border-color);--el-datepicker-inner-border-color:var(--el-border-color-light);--el-datepicker-inrange-bg-color:var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color:var(--el-border-color-extra-light);--el-datepicker-active-color:var(--el-color-primary);--el-datepicker-hover-text-color:var(--el-color-primary);width:646px}.el-date-range-picker.has-sidebar{width:756px}.el-date-range-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-range-picker table{table-layout:fixed;width:100%}.el-date-range-picker .el-picker-panel__body{min-width:513px}.el-date-range-picker .el-picker-panel__content{margin:0}.el-date-range-picker__header{height:28px;position:relative;text-align:center}.el-date-range-picker__header [class*=arrow-left]{float:left}.el-date-range-picker__header [class*=arrow-right]{float:right}.el-date-range-picker__header div{font-size:16px;font-weight:500;margin-right:50px}.el-date-range-picker__content{box-sizing:border-box;float:left;margin:0;padding:16px;width:50%}.el-date-range-picker__content.is-left{border-right:1px solid var(--el-datepicker-inner-border-color)}.el-date-range-picker__content .el-date-range-picker__header div{margin-left:50px;margin-right:50px}.el-date-range-picker__editors-wrap{box-sizing:border-box;display:table-cell}.el-date-range-picker__editors-wrap.is-right{text-align:right}.el-date-range-picker__time-header{border-bottom:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;display:table;font-size:12px;padding:8px 5px 5px;position:relative;width:100%}.el-date-range-picker__time-header>.el-icon-arrow-right{color:var(--el-datepicker-icon-color);display:table-cell;font-size:20px;vertical-align:middle}.el-date-range-picker__time-picker-wrap{display:table-cell;padding:0 5px;position:relative}.el-date-range-picker__time-picker-wrap .el-picker-panel{background:#fff;position:absolute;right:0;top:13px;z-index:1}.el-date-range-picker__time-picker-wrap .el-time-panel{position:absolute}.el-time-range-picker{overflow:visible;width:354px}.el-time-range-picker__content{padding:10px;position:relative;text-align:center;z-index:1}.el-time-range-picker__cell{box-sizing:border-box;display:inline-block;margin:0;padding:4px 7px 7px;width:50%}.el-time-range-picker__header{font-size:14px;margin-bottom:5px;text-align:center}.el-time-range-picker__body{border:1px solid var(--el-datepicker-border-color);border-radius:2px}.el-time-panel{border-radius:2px;box-sizing:content-box;left:0;position:relative;-webkit-user-select:none;user-select:none;width:180px;z-index:var(--el-index-top)}.el-time-panel__content{font-size:0;overflow:hidden;position:relative}.el-time-panel__content:after,.el-time-panel__content:before{box-sizing:border-box;content:"";height:32px;left:0;margin-top:-16px;padding-top:6px;position:absolute;right:0;text-align:left;top:50%;z-index:-1}.el-time-panel__content:after{left:50%;margin-left:12%;margin-right:12%}.el-time-panel__content:before{border-bottom:1px solid var(--el-border-color-light);border-top:1px solid var(--el-border-color-light);margin-left:12%;margin-right:12%;padding-left:50%}.el-time-panel__content.has-seconds:after{left:66.6666666667%}.el-time-panel__content.has-seconds:before{padding-left:33.3333333333%}.el-time-panel__footer{border-top:1px solid var(--el-timepicker-inner-border-color,var(--el-border-color-light));box-sizing:border-box;height:36px;line-height:25px;padding:4px;text-align:right}.el-time-panel__btn{background-color:transparent;border:none;color:var(--el-text-color-primary);cursor:pointer;font-size:12px;line-height:28px;margin:0 5px;outline:none;padding:0 5px}.el-time-panel__btn.confirm{color:var(--el-timepicker-active-color,var(--el-color-primary));font-weight:800}.el-textarea{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;display:inline-block;font-size:var(--el-font-size-base);position:relative;vertical-align:bottom;width:100%}.el-textarea__inner{-webkit-appearance:none;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));display:block;font-family:inherit;font-size:inherit;line-height:1.5;padding:5px 11px;position:relative;resize:vertical;transition:var(--el-transition-box-shadow);width:100%}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-textarea__inner:focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset;outline:none}.el-textarea .el-input__count{background:var(--el-fill-color-blank);bottom:5px;color:var(--el-color-info);font-size:12px;line-height:14px;position:absolute;right:10px}.el-textarea.is-disabled .el-textarea__inner{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset;color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;--el-input-height:var(--el-component-size);box-sizing:border-box;display:inline-flex;font-size:var(--el-font-size-base);line-height:var(--el-input-height);position:relative;vertical-align:middle;width:var(--el-input-width)}.el-input::-webkit-scrollbar{width:6px;z-index:11}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{background:var(--el-text-color-disabled);border-radius:5px;width:6px}.el-input::-webkit-scrollbar-corner,.el-input::-webkit-scrollbar-track{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track-piece{background:var(--el-fill-color-blank);width:6px}.el-input .el-input__clear,.el-input .el-input__password{color:var(--el-input-icon-color);cursor:pointer;font-size:14px}.el-input .el-input__clear:hover,.el-input .el-input__password:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{align-items:center;color:var(--el-color-info);display:inline-flex;font-size:12px;height:100%}.el-input .el-input__count .el-input__count-inner{background:var(--el-fill-color-blank);display:inline-block;line-height:normal;padding-left:8px}.el-input__wrapper{align-items:center;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;cursor:text;display:inline-flex;flex-grow:1;justify-content:center;padding:1px 11px;transform:translateZ(0);transition:var(--el-transition-box-shadow)}.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 32px) - 2px);-webkit-appearance:none;background:none;border:none;box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));flex-grow:1;font-size:inherit;height:var(--el-input-inner-height);line-height:var(--el-input-inner-height);outline:none;padding:0;width:100%}.el-input__inner:focus{outline:none}.el-input__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner[type=password]::-ms-reveal{display:none}.el-input__inner[type=number]{line-height:1}.el-input__prefix{color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:inline-flex;flex-shrink:0;flex-wrap:nowrap;height:100%;pointer-events:none;text-align:center;transition:all var(--el-transition-duration);white-space:nowrap}.el-input__prefix-inner{align-items:center;display:inline-flex;justify-content:center;pointer-events:all}.el-input__prefix-inner>:last-child{margin-right:8px}.el-input__prefix-inner>:first-child,.el-input__prefix-inner>:first-child.el-input__icon{margin-left:0}.el-input__suffix{color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:inline-flex;flex-shrink:0;flex-wrap:nowrap;height:100%;pointer-events:none;text-align:center;transition:all var(--el-transition-duration);white-space:nowrap}.el-input__suffix-inner{align-items:center;display:inline-flex;justify-content:center;pointer-events:all}.el-input__suffix-inner>:first-child{margin-left:8px}.el-input .el-input__icon{align-items:center;display:flex;height:inherit;justify-content:center;line-height:inherit;margin-left:8px;transition:all var(--el-transition-duration)}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-color, ) inset}.el-input.is-disabled{cursor:not-allowed}.el-input.is-disabled .el-input__wrapper{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset}.el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color);-webkit-text-fill-color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--large{--el-input-height:var(--el-component-size-large);font-size:14px}.el-input--large .el-input__wrapper{padding:1px 15px}.el-input--large .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 40px) - 2px)}.el-input--small{--el-input-height:var(--el-component-size-small);font-size:12px}.el-input--small .el-input__wrapper{padding:1px 7px}.el-input--small .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 24px) - 2px)}.el-input-group{align-items:stretch;display:inline-flex;width:100%}.el-input-group__append,.el-input-group__prepend{align-items:center;background-color:var(--el-fill-color-light);border-radius:var(--el-input-border-radius);color:var(--el-color-info);display:inline-flex;justify-content:center;min-height:100%;padding:0 20px;position:relative;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:none}.el-input-group__append .el-button,.el-input-group__append .el-select,.el-input-group__prepend .el-button,.el-input-group__prepend .el-select{display:inline-block;margin:0 -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-select__wrapper,.el-input-group__append div.el-select:hover .el-select__wrapper,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-select__wrapper,.el-input-group__prepend div.el-select:hover .el-select__wrapper{background-color:transparent;border-color:transparent;color:inherit}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-bottom-right-radius:0;border-right:0;border-top-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group__append{border-bottom-left-radius:0;border-left:0;border-top-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--prepend>.el-input__wrapper{border-bottom-left-radius:0;border-top-left-radius:0}.el-input-group--prepend .el-input-group__prepend .el-select .el-select__wrapper{border-bottom-right-radius:0;border-top-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group--append>.el-input__wrapper{border-bottom-right-radius:0;border-top-right-radius:0}.el-input-group--append .el-input-group__append .el-select .el-select__wrapper{border-bottom-left-radius:0;border-top-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-hidden{display:none!important}.el-popper{--el-popper-border-radius:var(--el-popover-border-radius,4px);border-radius:var(--el-popper-border-radius);font-size:12px;line-height:20px;min-width:10px;overflow-wrap:break-word;padding:5px 11px;position:absolute;visibility:visible;z-index:2000}.el-popper.is-dark{background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary);color:var(--el-bg-color)}.el-popper.is-dark .el-popper__arrow:before{background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary);right:0}.el-popper.is-light{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow:before{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);right:0}.el-popper.is-pure{padding:0}.el-popper__arrow{height:10px;position:absolute;width:10px;z-index:-1}.el-popper__arrow:before{background:var(--el-text-color-primary);box-sizing:border-box;content:" ";height:10px;position:absolute;transform:rotate(45deg);width:10px;z-index:-1}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow:before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow:before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow:before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow:before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-left-color:transparent!important;border-top-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-bottom-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent!important;border-top-color:transparent!important}.el-button{--el-button-font-weight:var(--el-font-weight-primary);--el-button-border-color:var(--el-border-color);--el-button-bg-color:var(--el-fill-color-blank);--el-button-text-color:var(--el-text-color-regular);--el-button-disabled-text-color:var(--el-disabled-text-color);--el-button-disabled-bg-color:var(--el-fill-color-blank);--el-button-disabled-border-color:var(--el-border-color-light);--el-button-divide-border-color:rgba(255,255,255,.5);--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-9);--el-button-hover-border-color:var(--el-color-primary-light-7);--el-button-active-text-color:var(--el-button-hover-text-color);--el-button-active-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-button-hover-bg-color);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-hover-link-text-color:var(--el-color-info);--el-button-active-color:var(--el-text-color-primary);align-items:center;-webkit-appearance:none;background-color:var(--el-button-bg-color);border:var(--el-border);border-color:var(--el-button-border-color);border-radius:var(--el-border-radius-base);box-sizing:border-box;color:var(--el-button-text-color);cursor:pointer;display:inline-flex;font-size:var(--el-font-size-base);font-weight:var(--el-button-font-weight);height:32px;justify-content:center;line-height:1;outline:none;padding:8px 15px;text-align:center;transition:.1s;-webkit-user-select:none;user-select:none;vertical-align:middle;white-space:nowrap}.el-button:hover{background-color:var(--el-button-hover-bg-color);border-color:var(--el-button-hover-border-color);color:var(--el-button-hover-text-color);outline:none}.el-button:active{background-color:var(--el-button-active-bg-color);border-color:var(--el-button-active-border-color);color:var(--el-button-active-text-color);outline:none}.el-button:focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button>span{align-items:center;display:inline-flex}.el-button+.el-button{margin-left:12px}.el-button.is-round{padding:8px 15px}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-fill-color-blank);--el-button-hover-border-color:var(--el-color-primary)}.el-button.is-active{background-color:var(--el-button-active-bg-color);border-color:var(--el-button-active-border-color);color:var(--el-button-active-text-color);outline:none}.el-button.is-disabled,.el-button.is-disabled:hover{background-color:var(--el-button-disabled-bg-color);background-image:none;border-color:var(--el-button-disabled-border-color);color:var(--el-button-disabled-text-color);cursor:not-allowed}.el-button.is-loading{pointer-events:none;position:relative}.el-button.is-loading:before{background-color:var(--el-mask-color-extra-light);border-radius:inherit;bottom:-1px;content:"";left:-1px;pointer-events:none;position:absolute;right:-1px;top:-1px;z-index:1}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{border-radius:50%;padding:8px;width:32px}.el-button.is-text{background-color:transparent;border:0 solid transparent;color:var(--el-button-text-color)}.el-button.is-text.is-disabled{background-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button.is-text:not(.is-disabled):hover{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled):focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button.is-text:not(.is-disabled):active{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled).is-has-bg:hover{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg:active{background-color:var(--el-fill-color-dark)}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button.is-link{background:transparent;border-color:transparent;color:var(--el-button-text-color);height:auto;padding:2px}.el-button.is-link:hover{color:var(--el-button-hover-link-text-color)}.el-button.is-link.is-disabled{background-color:transparent!important;border-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button.is-link:not(.is-disabled):hover{background-color:transparent;border-color:transparent}.el-button.is-link:not(.is-disabled):active{background-color:transparent;border-color:transparent;color:var(--el-button-active-color)}.el-button--text{background:transparent;border-color:transparent;color:var(--el-color-primary);padding-left:0;padding-right:0}.el-button--text.is-disabled{background-color:transparent!important;border-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button--text:not(.is-disabled):hover{background-color:transparent;border-color:transparent;color:var(--el-color-primary-light-3)}.el-button--text:not(.is-disabled):active{background-color:transparent;border-color:transparent;color:var(--el-color-primary-dark-2)}.el-button__link--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--primary{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-active-color:var(--el-color-primary-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-primary-light-5);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-primary-light-5);--el-button-disabled-border-color:var(--el-color-primary-light-5)}.el-button--primary.is-link,.el-button--primary.is-plain,.el-button--primary.is-text{--el-button-text-color:var(--el-color-primary);--el-button-bg-color:var(--el-color-primary-light-9);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-text-color:var(--el-color-white)}.el-button--primary.is-link.is-disabled,.el-button--primary.is-link.is-disabled:active,.el-button--primary.is-link.is-disabled:focus,.el-button--primary.is-link.is-disabled:hover,.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:hover,.el-button--primary.is-text.is-disabled,.el-button--primary.is-text.is-disabled:active,.el-button--primary.is-text.is-disabled:focus,.el-button--primary.is-text.is-disabled:hover{background-color:var(--el-color-primary-light-9);border-color:var(--el-color-primary-light-8);color:var(--el-color-primary-light-5)}.el-button--success{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-success);--el-button-border-color:var(--el-color-success);--el-button-outline-color:var(--el-color-success-light-5);--el-button-active-color:var(--el-color-success-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-success-light-5);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-success-light-5);--el-button-disabled-border-color:var(--el-color-success-light-5)}.el-button--success.is-link,.el-button--success.is-plain,.el-button--success.is-text{--el-button-text-color:var(--el-color-success);--el-button-bg-color:var(--el-color-success-light-9);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-text-color:var(--el-color-white)}.el-button--success.is-link.is-disabled,.el-button--success.is-link.is-disabled:active,.el-button--success.is-link.is-disabled:focus,.el-button--success.is-link.is-disabled:hover,.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:hover,.el-button--success.is-text.is-disabled,.el-button--success.is-text.is-disabled:active,.el-button--success.is-text.is-disabled:focus,.el-button--success.is-text.is-disabled:hover{background-color:var(--el-color-success-light-9);border-color:var(--el-color-success-light-8);color:var(--el-color-success-light-5)}.el-button--warning{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-warning);--el-button-border-color:var(--el-color-warning);--el-button-outline-color:var(--el-color-warning-light-5);--el-button-active-color:var(--el-color-warning-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-warning-light-5);--el-button-hover-bg-color:var(--el-color-warning-light-3);--el-button-hover-border-color:var(--el-color-warning-light-3);--el-button-active-bg-color:var(--el-color-warning-dark-2);--el-button-active-border-color:var(--el-color-warning-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-warning-light-5);--el-button-disabled-border-color:var(--el-color-warning-light-5)}.el-button--warning.is-link,.el-button--warning.is-plain,.el-button--warning.is-text{--el-button-text-color:var(--el-color-warning);--el-button-bg-color:var(--el-color-warning-light-9);--el-button-border-color:var(--el-color-warning-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-warning);--el-button-hover-border-color:var(--el-color-warning);--el-button-active-text-color:var(--el-color-white)}.el-button--warning.is-link.is-disabled,.el-button--warning.is-link.is-disabled:active,.el-button--warning.is-link.is-disabled:focus,.el-button--warning.is-link.is-disabled:hover,.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:hover,.el-button--warning.is-text.is-disabled,.el-button--warning.is-text.is-disabled:active,.el-button--warning.is-text.is-disabled:focus,.el-button--warning.is-text.is-disabled:hover{background-color:var(--el-color-warning-light-9);border-color:var(--el-color-warning-light-8);color:var(--el-color-warning-light-5)}.el-button--danger{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger);--el-button-outline-color:var(--el-color-danger-light-5);--el-button-active-color:var(--el-color-danger-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-danger-light-5);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-danger-light-5);--el-button-disabled-border-color:var(--el-color-danger-light-5)}.el-button--danger.is-link,.el-button--danger.is-plain,.el-button--danger.is-text{--el-button-text-color:var(--el-color-danger);--el-button-bg-color:var(--el-color-danger-light-9);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-text-color:var(--el-color-white)}.el-button--danger.is-link.is-disabled,.el-button--danger.is-link.is-disabled:active,.el-button--danger.is-link.is-disabled:focus,.el-button--danger.is-link.is-disabled:hover,.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:hover,.el-button--danger.is-text.is-disabled,.el-button--danger.is-text.is-disabled:active,.el-button--danger.is-text.is-disabled:focus,.el-button--danger.is-text.is-disabled:hover{background-color:var(--el-color-danger-light-9);border-color:var(--el-color-danger-light-8);color:var(--el-color-danger-light-5)}.el-button--info{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-info);--el-button-border-color:var(--el-color-info);--el-button-outline-color:var(--el-color-info-light-5);--el-button-active-color:var(--el-color-info-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-info-light-5);--el-button-hover-bg-color:var(--el-color-info-light-3);--el-button-hover-border-color:var(--el-color-info-light-3);--el-button-active-bg-color:var(--el-color-info-dark-2);--el-button-active-border-color:var(--el-color-info-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-info-light-5);--el-button-disabled-border-color:var(--el-color-info-light-5)}.el-button--info.is-link,.el-button--info.is-plain,.el-button--info.is-text{--el-button-text-color:var(--el-color-info);--el-button-bg-color:var(--el-color-info-light-9);--el-button-border-color:var(--el-color-info-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-info);--el-button-hover-border-color:var(--el-color-info);--el-button-active-text-color:var(--el-color-white)}.el-button--info.is-link.is-disabled,.el-button--info.is-link.is-disabled:active,.el-button--info.is-link.is-disabled:focus,.el-button--info.is-link.is-disabled:hover,.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:hover,.el-button--info.is-text.is-disabled,.el-button--info.is-text.is-disabled:active,.el-button--info.is-text.is-disabled:focus,.el-button--info.is-text.is-disabled:hover{background-color:var(--el-color-info-light-9);border-color:var(--el-color-info-light-8);color:var(--el-color-info-light-5)}.el-button--large{--el-button-size:40px;border-radius:var(--el-border-radius-base);font-size:var(--el-font-size-base);height:var(--el-button-size);padding:12px 19px}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{padding:12px;width:var(--el-button-size)}.el-button--small{--el-button-size:24px;border-radius:calc(var(--el-border-radius-base) - 1px);font-size:12px;height:var(--el-button-size);padding:5px 11px}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{padding:5px;width:var(--el-button-size)}.el-checkbox-group{font-size:0;line-height:0}.el-checkbox{--el-checkbox-font-size:14px;--el-checkbox-font-weight:var(--el-font-weight-primary);--el-checkbox-text-color:var(--el-text-color-regular);--el-checkbox-input-height:14px;--el-checkbox-input-width:14px;--el-checkbox-border-radius:var(--el-border-radius-small);--el-checkbox-bg-color:var(--el-fill-color-blank);--el-checkbox-input-border:var(--el-border);--el-checkbox-disabled-border-color:var(--el-border-color);--el-checkbox-disabled-input-fill:var(--el-fill-color-light);--el-checkbox-disabled-icon-color:var(--el-text-color-placeholder);--el-checkbox-disabled-checked-input-fill:var(--el-border-color-extra-light);--el-checkbox-disabled-checked-input-border-color:var(--el-border-color);--el-checkbox-disabled-checked-icon-color:var(--el-text-color-placeholder);--el-checkbox-checked-text-color:var(--el-color-primary);--el-checkbox-checked-input-border-color:var(--el-color-primary);--el-checkbox-checked-bg-color:var(--el-color-primary);--el-checkbox-checked-icon-color:var(--el-color-white);--el-checkbox-input-border-color-hover:var(--el-color-primary);align-items:center;color:var(--el-checkbox-text-color);cursor:pointer;display:inline-flex;font-size:var(--el-font-size-base);font-weight:var(--el-checkbox-font-weight);height:var(--el-checkbox-height,32px);margin-right:30px;position:relative;-webkit-user-select:none;user-select:none;white-space:nowrap}.el-checkbox.is-disabled{cursor:not-allowed}.el-checkbox.is-bordered{border:var(--el-border);border-radius:var(--el-border-radius-base);box-sizing:border-box;padding:0 15px 0 9px}.el-checkbox.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-checkbox.is-bordered.is-disabled{border-color:var(--el-border-color-lighter)}.el-checkbox.is-bordered.el-checkbox--large{border-radius:var(--el-border-radius-base);padding:0 19px 0 11px}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__label{font-size:var(--el-font-size-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.is-bordered.el-checkbox--small{border-radius:calc(var(--el-border-radius-base) - 1px);padding:0 11px 0 7px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox input:focus-visible+.el-checkbox__inner{border-radius:var(--el-checkbox-border-radius);outline:2px solid var(--el-checkbox-input-border-color-hover);outline-offset:1px}.el-checkbox__input{cursor:pointer;display:inline-flex;outline:none;position:relative;white-space:nowrap}.el-checkbox__input.is-disabled .el-checkbox__inner{background-color:var(--el-checkbox-disabled-input-fill);border-color:var(--el-checkbox-disabled-border-color);cursor:not-allowed}.el-checkbox__input.is-disabled .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-icon-color);cursor:not-allowed}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-disabled-checked-icon-color);border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled+span.el-checkbox__label{color:var(--el-disabled-text-color);cursor:not-allowed}.el-checkbox__input.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-checked-icon-color);transform:rotate(45deg) scaleY(1)}.el-checkbox__input.is-checked+.el-checkbox__label{color:var(--el-checkbox-checked-text-color)}.el-checkbox__input.is-focus:not(.is-checked) .el-checkbox__original:not(:focus-visible){border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__input.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-checked-icon-color);content:"";display:block;height:2px;left:0;position:absolute;right:0;top:5px;transform:scale(.5)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:after{display:none}.el-checkbox__inner{background-color:var(--el-checkbox-bg-color);border:var(--el-checkbox-input-border);border-radius:var(--el-checkbox-border-radius);box-sizing:border-box;display:inline-block;height:var(--el-checkbox-input-height);position:relative;transition:border-color .25s cubic-bezier(.71,-.46,.29,1.46),background-color .25s cubic-bezier(.71,-.46,.29,1.46),outline .25s cubic-bezier(.71,-.46,.29,1.46);width:var(--el-checkbox-input-width);z-index:var(--el-index-normal)}.el-checkbox__inner:hover{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__inner:after{border:1px solid transparent;border-left:0;border-top:0;box-sizing:content-box;content:"";height:7px;left:4px;position:absolute;top:1px;transform:rotate(45deg) scaleY(0);transform-origin:center;transition:transform .15s ease-in .05s;width:3px}.el-checkbox__original{height:0;margin:0;opacity:0;outline:none;position:absolute;width:0;z-index:-1}.el-checkbox__label{display:inline-block;font-size:var(--el-checkbox-font-size);line-height:1;padding-left:8px}.el-checkbox.el-checkbox--large{height:40px}.el-checkbox.el-checkbox--large .el-checkbox__label{font-size:14px}.el-checkbox.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.el-checkbox--small{height:24px}.el-checkbox.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.el-checkbox--small .el-checkbox__input.is-indeterminate .el-checkbox__inner:before{top:4px}.el-checkbox.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox:last-of-type{margin-right:0}.el-radio-group{align-items:center;display:inline-flex;flex-wrap:wrap;font-size:0}.el-radio-button{--el-radio-button-checked-bg-color:var(--el-color-primary);--el-radio-button-checked-text-color:var(--el-color-white);--el-radio-button-checked-border-color:var(--el-color-primary);--el-radio-button-disabled-checked-fill:var(--el-border-color-extra-light)}.el-radio-button,.el-radio-button__inner{display:inline-block;outline:none;position:relative}.el-radio-button__inner{-webkit-appearance:none;background:var(--el-button-bg-color,var(--el-fill-color-blank));border:var(--el-border);border-left:0;border-radius:0;box-sizing:border-box;color:var(--el-button-text-color,var(--el-text-color-regular));cursor:pointer;font-size:var(--el-font-size-base);font-weight:var(--el-button-font-weight,var(--el-font-weight-primary));line-height:1;margin:0;padding:8px 15px;text-align:center;transition:var(--el-transition-all);-webkit-user-select:none;user-select:none;vertical-align:middle;white-space:nowrap}.el-radio-button__inner.is-round{padding:8px 15px}.el-radio-button__inner:hover{color:var(--el-color-primary)}.el-radio-button__inner [class*=el-icon-]{line-height:.9}.el-radio-button__inner [class*=el-icon-]+span{margin-left:5px}.el-radio-button:first-child .el-radio-button__inner{border-left:var(--el-border);border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);box-shadow:none!important}.el-radio-button__original-radio{opacity:0;outline:none;position:absolute;z-index:-1}.el-radio-button__original-radio:checked+.el-radio-button__inner{background-color:var(--el-radio-button-checked-bg-color,var(--el-color-primary));border-color:var(--el-radio-button-checked-border-color,var(--el-color-primary));box-shadow:-1px 0 0 0 var(--el-radio-button-checked-border-color,var(--el-color-primary));color:var(--el-radio-button-checked-text-color,var(--el-color-white))}.el-radio-button__original-radio:focus-visible+.el-radio-button__inner{border-left:var(--el-border);border-left-color:var(--el-radio-button-checked-border-color,var(--el-color-primary));border-radius:var(--el-border-radius-base);box-shadow:none;outline:2px solid var(--el-radio-button-checked-border-color);outline-offset:1px;z-index:2}.el-radio-button__original-radio:disabled+.el-radio-button__inner{background-color:var(--el-button-disabled-bg-color,var(--el-fill-color-blank));background-image:none;border-color:var(--el-button-disabled-border-color,var(--el-border-color-light));box-shadow:none;color:var(--el-disabled-text-color);cursor:not-allowed}.el-radio-button__original-radio:disabled:checked+.el-radio-button__inner{background-color:var(--el-radio-button-disabled-checked-fill)}.el-radio-button:last-child .el-radio-button__inner{border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0}.el-radio-button:first-child:last-child .el-radio-button__inner{border-radius:var(--el-border-radius-base)}.el-radio-button--large .el-radio-button__inner{border-radius:0;font-size:var(--el-font-size-base);padding:12px 19px}.el-radio-button--large .el-radio-button__inner.is-round{padding:12px 19px}.el-radio-button--small .el-radio-button__inner{border-radius:0;font-size:12px;padding:5px 11px}.el-radio-button--small .el-radio-button__inner.is-round{padding:5px 11px}.el-drawer{--el-drawer-bg-color:var(--el-dialog-bg-color,var(--el-bg-color));--el-drawer-padding-primary:var(--el-dialog-padding-primary,20px);background-color:var(--el-drawer-bg-color);box-shadow:var(--el-box-shadow-dark);box-sizing:border-box;display:flex;flex-direction:column;overflow:hidden;position:absolute;transition:all var(--el-transition-duration)}.el-drawer .btt,.el-drawer .ltr,.el-drawer .rtl,.el-drawer .ttb{transform:translate(0)}.el-drawer__sr-focus:focus{outline:none!important}.el-drawer__header{align-items:center;color:#72767b;display:flex;margin-bottom:32px;padding:var(--el-drawer-padding-primary);padding-bottom:0}.el-drawer__header>:first-child{flex:1}.el-drawer__title{flex:1;font-size:1rem;line-height:inherit;margin:0}.el-drawer__footer{padding:var(--el-drawer-padding-primary);padding-top:10px;text-align:right}.el-drawer__close-btn{background-color:transparent;border:none;color:inherit;cursor:pointer;display:inline-flex;font-size:var(--el-font-size-extra-large);outline:none}.el-drawer__close-btn:focus i,.el-drawer__close-btn:hover i{color:var(--el-color-primary)}.el-drawer__body{flex:1;overflow:auto;padding:var(--el-drawer-padding-primary)}.el-drawer__body>*{box-sizing:border-box}.el-drawer.ltr,.el-drawer.rtl{bottom:0;height:100%;top:0}.el-drawer.btt,.el-drawer.ttb{left:0;right:0;width:100%}.el-drawer.ltr{left:0}.el-drawer.rtl{right:0}.el-drawer.ttb{top:0}.el-drawer.btt{bottom:0}.el-drawer-fade-enter-active,.el-drawer-fade-leave-active{transition:all var(--el-transition-duration)}.el-drawer-fade-enter-active,.el-drawer-fade-enter-from,.el-drawer-fade-enter-to,.el-drawer-fade-leave-active,.el-drawer-fade-leave-from,.el-drawer-fade-leave-to{overflow:hidden!important}.el-drawer-fade-enter-from,.el-drawer-fade-leave-to{opacity:0}.el-drawer-fade-enter-to,.el-drawer-fade-leave-from{opacity:1}.el-drawer-fade-enter-from .rtl,.el-drawer-fade-leave-to .rtl{transform:translate(100%)}.el-drawer-fade-enter-from .ltr,.el-drawer-fade-leave-to .ltr{transform:translate(-100%)}.el-drawer-fade-enter-from .ttb,.el-drawer-fade-leave-to .ttb{transform:translateY(-100%)}.el-drawer-fade-enter-from .btt,.el-drawer-fade-leave-to .btt{transform:translateY(100%)}.handle-button[data-v-dacedd06]{width:48px;height:48px;background-color:var(--el-color-primary);position:fixed;top:60px;right:0;border-radius:6px 0 0 6px;z-index:1000;cursor:pointer;pointer-events:auto;color:#fff;display:flex;align-items:center;justify-content:center}.el-switch{--el-switch-on-color:var(--el-color-primary);--el-switch-off-color:var(--el-border-color);align-items:center;display:inline-flex;font-size:14px;height:32px;line-height:20px;position:relative;vertical-align:middle}.el-switch.is-disabled .el-switch__core,.el-switch.is-disabled .el-switch__label{cursor:not-allowed}.el-switch__label{color:var(--el-text-color-primary);cursor:pointer;display:inline-block;font-size:14px;font-weight:500;height:20px;transition:var(--el-transition-duration-fast);vertical-align:middle}.el-switch__label.is-active{color:var(--el-color-primary)}.el-switch__label--left{margin-right:10px}.el-switch__label--right{margin-left:10px}.el-switch__label *{display:inline-block;font-size:14px;line-height:1}.el-switch__label .el-icon{height:inherit}.el-switch__label .el-icon svg{vertical-align:middle}.el-switch__input{height:0;margin:0;opacity:0;position:absolute;width:0}.el-switch__input:focus-visible~.el-switch__core{outline:2px solid var(--el-switch-on-color);outline-offset:1px}.el-switch__core{align-items:center;background:var(--el-switch-off-color);border:1px solid var(--el-switch-border-color,var(--el-switch-off-color));border-radius:10px;box-sizing:border-box;cursor:pointer;display:inline-flex;height:20px;min-width:40px;outline:none;position:relative;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration)}.el-switch__core .el-switch__inner{align-items:center;display:flex;height:16px;justify-content:center;overflow:hidden;padding:0 4px 0 18px;transition:all var(--el-transition-duration);width:100%}.el-switch__core .el-switch__inner .is-icon,.el-switch__core .el-switch__inner .is-text{color:var(--el-color-white);font-size:12px;overflow:hidden;text-overflow:ellipsis;-webkit-user-select:none;user-select:none;white-space:nowrap}.el-switch__core .el-switch__action{align-items:center;background-color:var(--el-color-white);border-radius:var(--el-border-radius-circle);color:var(--el-switch-off-color);display:flex;height:16px;justify-content:center;left:1px;position:absolute;transition:all var(--el-transition-duration);width:16px}.el-switch.is-checked .el-switch__core{background-color:var(--el-switch-on-color);border-color:var(--el-switch-border-color,var(--el-switch-on-color))}.el-switch.is-checked .el-switch__core .el-switch__action{color:var(--el-switch-on-color);left:calc(100% - 17px)}.el-switch.is-checked .el-switch__core .el-switch__inner{padding:0 18px 0 4px}.el-switch.is-disabled{opacity:.6}.el-switch--wide .el-switch__label.el-switch__label--left span{left:10px}.el-switch--wide .el-switch__label.el-switch__label--right span{right:10px}.el-switch .label-fade-enter-from,.el-switch .label-fade-leave-active{opacity:0}.el-switch--large{font-size:14px;height:40px;line-height:24px}.el-switch--large .el-switch__label{font-size:14px;height:24px}.el-switch--large .el-switch__label *{font-size:14px}.el-switch--large .el-switch__core{border-radius:12px;height:24px;min-width:50px}.el-switch--large .el-switch__core .el-switch__inner{height:20px;padding:0 6px 0 22px}.el-switch--large .el-switch__core .el-switch__action{height:20px;width:20px}.el-switch--large.is-checked .el-switch__core .el-switch__action{left:calc(100% - 21px)}.el-switch--large.is-checked .el-switch__core .el-switch__inner{padding:0 22px 0 6px}.el-switch--small{font-size:12px;height:24px;line-height:16px}.el-switch--small .el-switch__label{font-size:12px;height:16px}.el-switch--small .el-switch__label *{font-size:12px}.el-switch--small .el-switch__core{border-radius:8px;height:16px;min-width:30px}.el-switch--small .el-switch__core .el-switch__inner{height:12px;padding:0 2px 0 14px}.el-switch--small .el-switch__core .el-switch__action{height:12px;width:12px}.el-switch--small.is-checked .el-switch__core .el-switch__action{left:calc(100% - 13px)}.el-switch--small.is-checked .el-switch__core .el-switch__inner{padding:0 14px 0 2px} '); (function (vue, elementPlus, oe, vueDemi, pinia) { 'use strict'; var __defProp = Object.defineProperty; var __getOwnPropNames = Object.getOwnPropertyNames; var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value; var __commonJS = (cb, mod) => function __require() { return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports; }; var __publicField = (obj, key, value) => __defNormalProp(obj, typeof key !== "symbol" ? key + "" : key, value); var require_main_001 = __commonJS({ "main-D2SMd04l.js"(exports, module) { const be = (e2) => { const t2 = GM_getResourceText(e2); return GM_addStyle(t2), t2; }; be("element-plus/dist/index.css"); const _ge = class _ge { observe() { return new Promise((e2) => { new MutationObserver((t2, n2) => { const a2 = document.querySelector(_ge.pageEndSelector); if (a2) { n2.disconnect(); e2(); } }).observe(document, { childList: true, subtree: true }); }); } }; __publicField(_ge, "pageEndSelector", ".layout-Player-userCard > div > div"); let ge = _ge; const ye = (e2, t2, { checkForDefaultPrevented: n2 = true } = {}) => { const a2 = (a3) => { const o2 = e2 == null ? void 0 : e2(a3); if (n2 === false || !o2) { return t2 == null ? void 0 : t2(a3); } }; return a2; }; var we; const ke = typeof window !== "undefined"; const xe = (e2) => typeof e2 === "string"; const Se = () => { }; const Ce = ke && ((we = window == null ? void 0 : window.navigator) == null ? void 0 : we.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent); function _e(e2) { return typeof e2 === "function" ? e2() : vueDemi.unref(e2); } function Me(e2) { return e2; } function Oe(e2) { if (vueDemi.getCurrentScope()) { vueDemi.onScopeDispose(e2); return true; } return false; } function De(e2, t2 = true) { if (vueDemi.getCurrentInstance()) vueDemi.onMounted(e2); else if (t2) e2(); else vueDemi.nextTick(e2); } function Ae(e2, t2, n2 = {}) { const { immediate: a2 = true } = n2; const o2 = vueDemi.ref(false); let r2 = null; function l2() { if (r2) { clearTimeout(r2); r2 = null; } } function s2() { o2.value = false; l2(); } function i2(...n3) { l2(); o2.value = true; r2 = setTimeout(() => { o2.value = false; r2 = null; e2(...n3); }, _e(t2)); } if (a2) { o2.value = true; if (ke) i2(); } Oe(s2); return { isPending: vueDemi.readonly(o2), start: i2, stop: s2 }; } function Ee(e2) { var t2; const n2 = _e(e2); return (t2 = n2 == null ? void 0 : n2.$el) != null ? t2 : n2; } const $e = ke ? window : void 0; function Le(...e2) { let t2; let n2; let a2; let o2; if (xe(e2[0]) || Array.isArray(e2[0])) { [n2, a2, o2] = e2; t2 = $e; } else { [t2, n2, a2, o2] = e2; } if (!t2) return Se; if (!Array.isArray(n2)) n2 = [n2]; if (!Array.isArray(a2)) a2 = [a2]; const r2 = []; const l2 = () => { r2.forEach((e3) => e3()); r2.length = 0; }; const s2 = (e3, t3, n3, a3) => { e3.addEventListener(t3, n3, a3); return () => e3.removeEventListener(t3, n3, a3); }; const i2 = vueDemi.watch(() => [Ee(t2), _e(o2)], ([e3, t3]) => { l2(); if (!e3) return; r2.push(...n2.flatMap((n3) => a2.map((a3) => s2(e3, n3, a3, t3)))); }, { immediate: true, flush: "post" }); const u2 = () => { i2(); l2(); }; Oe(u2); return u2; } let Ie = false; function Te(e2, t2, n2 = {}) { const { window: a2 = $e, ignore: o2 = [], capture: r2 = true, detectIframe: l2 = false } = n2; if (!a2) return; if (Ce && !Ie) { Ie = true; Array.from(a2.document.body.children).forEach((e3) => e3.addEventListener("click", Se)); } let s2 = true; const i2 = (e3) => o2.some((t3) => { if (typeof t3 === "string") { return Array.from(a2.document.querySelectorAll(t3)).some((t4) => t4 === e3.target || e3.composedPath().includes(t4)); } else { const n3 = Ee(t3); return n3 && (e3.target === n3 || e3.composedPath().includes(n3)); } }); const u2 = (n3) => { const a3 = Ee(e2); if (!a3 || a3 === n3.target || n3.composedPath().includes(a3)) return; if (n3.detail === 0) s2 = !i2(n3); if (!s2) { s2 = true; return; } t2(n3); }; const c2 = [Le(a2, "click", u2, { passive: true, capture: r2 }), Le(a2, "pointerdown", (t3) => { const n3 = Ee(e2); if (n3) s2 = !t3.composedPath().includes(n3) && !i2(t3); }, { passive: true }), l2 && Le(a2, "blur", (n3) => { var o3; const r3 = Ee(e2); if (((o3 = a2.document.activeElement) == null ? void 0 : o3.tagName) === "IFRAME" && !(r3 == null ? void 0 : r3.contains(a2.document.activeElement))) t2(n3); })].filter(Boolean); const d2 = () => c2.forEach((e3) => e3()); return d2; } function Pe(e2, t2 = false) { const n2 = vueDemi.ref(); const a2 = () => n2.value = Boolean(e2()); a2(); De(a2, t2); return n2; } const Be = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {}; const Re = "__vueuse_ssr_handlers__"; Be[Re] = Be[Re] || {}; var Ve = Object.getOwnPropertySymbols; var Fe = Object.prototype.hasOwnProperty; var je = Object.prototype.propertyIsEnumerable; var ze = (e2, t2) => { var n2 = {}; for (var a2 in e2) if (Fe.call(e2, a2) && t2.indexOf(a2) < 0) n2[a2] = e2[a2]; if (e2 != null && Ve) for (var a2 of Ve(e2)) { if (t2.indexOf(a2) < 0 && je.call(e2, a2)) n2[a2] = e2[a2]; } return n2; }; function Ne(e2, t2, n2 = {}) { const a2 = n2, { window: o2 = $e } = a2, r2 = ze(a2, ["window"]); let l2; const s2 = Pe(() => o2 && "ResizeObserver" in o2); const i2 = () => { if (l2) { l2.disconnect(); l2 = void 0; } }; const u2 = vueDemi.watch(() => Ee(e2), (e3) => { i2(); if (s2.value && o2 && e3) { l2 = new ResizeObserver(t2); l2.observe(e3, r2); } }, { immediate: true, flush: "post" }); const c2 = () => { i2(); u2(); }; Oe(c2); return { isSupported: s2, stop: c2 }; } var He; (function(e2) { e2["UP"] = "UP"; e2["RIGHT"] = "RIGHT"; e2["DOWN"] = "DOWN"; e2["LEFT"] = "LEFT"; e2["NONE"] = "NONE"; })(He || (He = {})); var Ye = Object.defineProperty; var We = Object.getOwnPropertySymbols; var Ue = Object.prototype.hasOwnProperty; var Ke = Object.prototype.propertyIsEnumerable; var qe = (e2, t2, n2) => t2 in e2 ? Ye(e2, t2, { enumerable: true, configurable: true, writable: true, value: n2 }) : e2[t2] = n2; var Ge = (e2, t2) => { for (var n2 in t2 || (t2 = {})) if (Ue.call(t2, n2)) qe(e2, n2, t2[n2]); if (We) for (var n2 of We(t2)) { if (Ke.call(t2, n2)) qe(e2, n2, t2[n2]); } return e2; }; const Ze = { easeInSine: [0.12, 0, 0.39, 0], easeOutSine: [0.61, 1, 0.88, 1], easeInOutSine: [0.37, 0, 0.63, 1], easeInQuad: [0.11, 0, 0.5, 0], easeOutQuad: [0.5, 1, 0.89, 1], easeInOutQuad: [0.45, 0, 0.55, 1], easeInCubic: [0.32, 0, 0.67, 0], easeOutCubic: [0.33, 1, 0.68, 1], easeInOutCubic: [0.65, 0, 0.35, 1], easeInQuart: [0.5, 0, 0.75, 0], easeOutQuart: [0.25, 1, 0.5, 1], easeInOutQuart: [0.76, 0, 0.24, 1], easeInQuint: [0.64, 0, 0.78, 0], easeOutQuint: [0.22, 1, 0.36, 1], easeInOutQuint: [0.83, 0, 0.17, 1], easeInExpo: [0.7, 0, 0.84, 0], easeOutExpo: [0.16, 1, 0.3, 1], easeInOutExpo: [0.87, 0, 0.13, 1], easeInCirc: [0.55, 0, 1, 0.45], easeOutCirc: [0, 0.55, 0.45, 1], easeInOutCirc: [0.85, 0, 0.15, 1], easeInBack: [0.36, 0, 0.66, -0.56], easeOutBack: [0.34, 1.56, 0.64, 1], easeInOutBack: [0.68, -0.6, 0.32, 1.6] }; Ge({ linear: Me }, Ze); const Je = () => ke && /firefox/i.test(window.navigator.userAgent); const Xe = () => { }; const Qe = Object.prototype.hasOwnProperty; const et = (e2, t2) => Qe.call(e2, t2); const tt = Array.isArray; const nt = (e2) => it(e2) === "[object Date]"; const at = (e2) => typeof e2 === "function"; const ot = (e2) => typeof e2 === "string"; const rt = (e2) => e2 !== null && typeof e2 === "object"; const lt = (e2) => (rt(e2) || at(e2)) && at(e2.then) && at(e2.catch); const st = Object.prototype.toString; const it = (e2) => st.call(e2); const ut = (e2) => { const t2 = /* @__PURE__ */ Object.create(null); return (n2) => { const a2 = t2[n2]; return a2 || (t2[n2] = e2(n2)); }; }; const ct = /-(\w)/g; const dt = ut((e2) => e2.replace(ct, (e3, t2) => t2 ? t2.toUpperCase() : "")); const ft = /\B([A-Z])/g; const vt = ut((e2) => e2.replace(ft, "-$1").toLowerCase()); var pt = typeof global == "object" && global && global.Object === Object && global; var mt = typeof self == "object" && self && self.Object === Object && self; var ht = pt || mt || Function("return this")(); var bt = ht.Symbol; var gt = Object.prototype; var yt = gt.hasOwnProperty; var wt = gt.toString; var kt = bt ? bt.toStringTag : void 0; function xt(e2) { var t2 = yt.call(e2, kt), n2 = e2[kt]; try { e2[kt] = void 0; var a2 = true; } catch (e3) { } var o2 = wt.call(e2); if (a2) { if (t2) { e2[kt] = n2; } else { delete e2[kt]; } } return o2; } var St = Object.prototype; var Ct = St.toString; function _t(e2) { return Ct.call(e2); } var Mt = "[object Null]", Ot = "[object Undefined]"; var Dt = bt ? bt.toStringTag : void 0; function At(e2) { if (e2 == null) { return e2 === void 0 ? Ot : Mt; } return Dt && Dt in Object(e2) ? xt(e2) : _t(e2); } function Et(e2) { return e2 != null && typeof e2 == "object"; } var $t = "[object Symbol]"; function Lt(e2) { return typeof e2 == "symbol" || Et(e2) && At(e2) == $t; } function It(e2, t2) { var n2 = -1, a2 = e2 == null ? 0 : e2.length, o2 = Array(a2); while (++n2 < a2) { o2[n2] = t2(e2[n2], n2, e2); } return o2; } var Tt = Array.isArray; var Pt = 1 / 0; var Bt = bt ? bt.prototype : void 0, Rt = Bt ? Bt.toString : void 0; function Vt(e2) { if (typeof e2 == "string") { return e2; } if (Tt(e2)) { return It(e2, Vt) + ""; } if (Lt(e2)) { return Rt ? Rt.call(e2) : ""; } var t2 = e2 + ""; return t2 == "0" && 1 / e2 == -Pt ? "-0" : t2; } var Ft = /\s/; function jt(e2) { var t2 = e2.length; while (t2-- && Ft.test(e2.charAt(t2))) { } return t2; } var zt = /^\s+/; function Nt(e2) { return e2 ? e2.slice(0, jt(e2) + 1).replace(zt, "") : e2; } function Ht(e2) { var t2 = typeof e2; return e2 != null && (t2 == "object" || t2 == "function"); } var Yt = 0 / 0; var Wt = /^[-+]0x[0-9a-f]+$/i; var Ut = /^0b[01]+$/i; var Kt = /^0o[0-7]+$/i; var qt = parseInt; function Gt(e2) { if (typeof e2 == "number") { return e2; } if (Lt(e2)) { return Yt; } if (Ht(e2)) { var t2 = typeof e2.valueOf == "function" ? e2.valueOf() : e2; e2 = Ht(t2) ? t2 + "" : t2; } if (typeof e2 != "string") { return e2 === 0 ? e2 : +e2; } e2 = Nt(e2); var n2 = Ut.test(e2); return n2 || Kt.test(e2) ? qt(e2.slice(2), n2 ? 2 : 8) : Wt.test(e2) ? Yt : +e2; } function Zt(e2) { return e2; } var Jt = "[object AsyncFunction]", Xt = "[object Function]", Qt = "[object GeneratorFunction]", en = "[object Proxy]"; function tn(e2) { if (!Ht(e2)) { return false; } var t2 = At(e2); return t2 == Xt || t2 == Qt || t2 == Jt || t2 == en; } var nn = ht["__core-js_shared__"]; var an = function() { var e2 = /[^.]+$/.exec(nn && nn.keys && nn.keys.IE_PROTO || ""); return e2 ? "Symbol(src)_1." + e2 : ""; }(); function on(e2) { return !!an && an in e2; } var rn = Function.prototype; var ln = rn.toString; function sn(e2) { if (e2 != null) { try { return ln.call(e2); } catch (e3) { } try { return e2 + ""; } catch (e3) { } } return ""; } var un = /[\\^$.*+?()[\]{}|]/g; var cn = /^\[object .+?Constructor\]$/; var dn = Function.prototype, fn = Object.prototype; var vn = dn.toString; var pn = fn.hasOwnProperty; var mn = RegExp("^" + vn.call(pn).replace(un, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$"); function hn(e2) { if (!Ht(e2) || on(e2)) { return false; } var t2 = tn(e2) ? mn : cn; return t2.test(sn(e2)); } function bn(e2, t2) { return e2 == null ? void 0 : e2[t2]; } function gn(e2, t2) { var n2 = bn(e2, t2); return hn(n2) ? n2 : void 0; } var yn = gn(ht, "WeakMap"); function wn(e2, t2, n2) { switch (n2.length) { case 0: return e2.call(t2); case 1: return e2.call(t2, n2[0]); case 2: return e2.call(t2, n2[0], n2[1]); case 3: return e2.call(t2, n2[0], n2[1], n2[2]); } return e2.apply(t2, n2); } var kn = 800, xn = 16; var Sn = Date.now; function Cn(e2) { var t2 = 0, n2 = 0; return function() { var a2 = Sn(), o2 = xn - (a2 - n2); n2 = a2; if (o2 > 0) { if (++t2 >= kn) { return arguments[0]; } } else { t2 = 0; } return e2.apply(void 0, arguments); }; } function _n(e2) { return function() { return e2; }; } var Mn = function() { try { var e2 = gn(Object, "defineProperty"); e2({}, "", {}); return e2; } catch (e3) { } }(); var On = !Mn ? Zt : function(e2, t2) { return Mn(e2, "toString", { configurable: true, enumerable: false, value: _n(t2), writable: true }); }; var Dn = Cn(On); var An = 9007199254740991; var En = /^(?:0|[1-9]\d*)$/; function $n(e2, t2) { var n2 = typeof e2; t2 = t2 == null ? An : t2; return !!t2 && (n2 == "number" || n2 != "symbol" && En.test(e2)) && (e2 > -1 && e2 % 1 == 0 && e2 < t2); } function Ln(e2, t2, n2) { if (t2 == "__proto__" && Mn) { Mn(e2, t2, { configurable: true, enumerable: true, value: n2, writable: true }); } else { e2[t2] = n2; } } function In(e2, t2) { return e2 === t2 || e2 !== e2 && t2 !== t2; } var Tn = Object.prototype; var Pn = Tn.hasOwnProperty; function Bn(e2, t2, n2) { var a2 = e2[t2]; if (!(Pn.call(e2, t2) && In(a2, n2)) || n2 === void 0 && !(t2 in e2)) { Ln(e2, t2, n2); } } var Rn = Math.max; function Vn(e2, t2, n2) { t2 = Rn(t2 === void 0 ? e2.length - 1 : t2, 0); return function() { var a2 = arguments, o2 = -1, r2 = Rn(a2.length - t2, 0), l2 = Array(r2); while (++o2 < r2) { l2[o2] = a2[t2 + o2]; } o2 = -1; var s2 = Array(t2 + 1); while (++o2 < t2) { s2[o2] = a2[o2]; } s2[t2] = n2(l2); return wn(e2, this, s2); }; } var Fn = 9007199254740991; function jn(e2) { return typeof e2 == "number" && e2 > -1 && e2 % 1 == 0 && e2 <= Fn; } function zn(e2) { return e2 != null && jn(e2.length) && !tn(e2); } var Nn = Object.prototype; function Hn(e2) { var t2 = e2 && e2.constructor, n2 = typeof t2 == "function" && t2.prototype || Nn; return e2 === n2; } function Yn(e2, t2) { var n2 = -1, a2 = Array(e2); while (++n2 < e2) { a2[n2] = t2(n2); } return a2; } var Wn = "[object Arguments]"; function Un(e2) { return Et(e2) && At(e2) == Wn; } var Kn = Object.prototype; var qn = Kn.hasOwnProperty; var Gn = Kn.propertyIsEnumerable; var Zn = Un(/* @__PURE__ */ function() { return arguments; }()) ? Un : function(e2) { return Et(e2) && qn.call(e2, "callee") && !Gn.call(e2, "callee"); }; function Jn() { return false; } var Xn = typeof exports == "object" && exports && !exports.nodeType && exports; var Qn = Xn && typeof module == "object" && module && !module.nodeType && module; var ea = Qn && Qn.exports === Xn; var ta = ea ? ht.Buffer : void 0; var na = ta ? ta.isBuffer : void 0; var aa = na || Jn; var oa = "[object Arguments]", ra = "[object Array]", la = "[object Boolean]", sa = "[object Date]", ia = "[object Error]", ua = "[object Function]", ca = "[object Map]", da = "[object Number]", fa = "[object Object]", va = "[object RegExp]", pa = "[object Set]", ma = "[object String]", ha = "[object WeakMap]"; var ba = "[object ArrayBuffer]", ga = "[object DataView]", ya = "[object Float32Array]", wa = "[object Float64Array]", ka = "[object Int8Array]", xa = "[object Int16Array]", Sa = "[object Int32Array]", Ca = "[object Uint8Array]", _a = "[object Uint8ClampedArray]", Ma = "[object Uint16Array]", Oa = "[object Uint32Array]"; var Da = {}; Da[ya] = Da[wa] = Da[ka] = Da[xa] = Da[Sa] = Da[Ca] = Da[_a] = Da[Ma] = Da[Oa] = true; Da[oa] = Da[ra] = Da[ba] = Da[la] = Da[ga] = Da[sa] = Da[ia] = Da[ua] = Da[ca] = Da[da] = Da[fa] = Da[va] = Da[pa] = Da[ma] = Da[ha] = false; function Aa(e2) { return Et(e2) && jn(e2.length) && !!Da[At(e2)]; } function Ea(e2) { return function(t2) { return e2(t2); }; } var $a = typeof exports == "object" && exports && !exports.nodeType && exports; var La = $a && typeof module == "object" && module && !module.nodeType && module; var Ia = La && La.exports === $a; var Ta = Ia && pt.process; var Pa = function() { try { var e2 = La && La.require && La.require("util").types; if (e2) { return e2; } return Ta && Ta.binding && Ta.binding("util"); } catch (e3) { } }(); var Ba = Pa && Pa.isTypedArray; var Ra = Ba ? Ea(Ba) : Aa; var Va = Object.prototype; var Fa = Va.hasOwnProperty; function ja(e2, t2) { var n2 = Tt(e2), a2 = !n2 && Zn(e2), o2 = !n2 && !a2 && aa(e2), r2 = !n2 && !a2 && !o2 && Ra(e2), l2 = n2 || a2 || o2 || r2, s2 = l2 ? Yn(e2.length, String) : [], i2 = s2.length; for (var u2 in e2) { if (Fa.call(e2, u2) && !(l2 && (u2 == "length" || o2 && (u2 == "offset" || u2 == "parent") || r2 && (u2 == "buffer" || u2 == "byteLength" || u2 == "byteOffset") || $n(u2, i2)))) { s2.push(u2); } } return s2; } function za(e2, t2) { return function(n2) { return e2(t2(n2)); }; } var Na = za(Object.keys, Object); var Ha = Object.prototype; var Ya = Ha.hasOwnProperty; function Wa(e2) { if (!Hn(e2)) { return Na(e2); } var t2 = []; for (var n2 in Object(e2)) { if (Ya.call(e2, n2) && n2 != "constructor") { t2.push(n2); } } return t2; } function Ua(e2) { return zn(e2) ? ja(e2) : Wa(e2); } var Ka = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, qa = /^\w*$/; function Ga(e2, t2) { if (Tt(e2)) { return false; } var n2 = typeof e2; if (n2 == "number" || n2 == "symbol" || n2 == "boolean" || e2 == null || Lt(e2)) { return true; } return qa.test(e2) || !Ka.test(e2) || t2 != null && e2 in Object(t2); } var Za = gn(Object, "create"); function Ja() { this.__data__ = Za ? Za(null) : {}; this.size = 0; } function Xa(e2) { var t2 = this.has(e2) && delete this.__data__[e2]; this.size -= t2 ? 1 : 0; return t2; } var Qa = "__lodash_hash_undefined__"; var eo = Object.prototype; var to = eo.hasOwnProperty; function no(e2) { var t2 = this.__data__; if (Za) { var n2 = t2[e2]; return n2 === Qa ? void 0 : n2; } return to.call(t2, e2) ? t2[e2] : void 0; } var ao = Object.prototype; var oo = ao.hasOwnProperty; function ro(e2) { var t2 = this.__data__; return Za ? t2[e2] !== void 0 : oo.call(t2, e2); } var lo = "__lodash_hash_undefined__"; function so(e2, t2) { var n2 = this.__data__; this.size += this.has(e2) ? 0 : 1; n2[e2] = Za && t2 === void 0 ? lo : t2; return this; } function io(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length; this.clear(); while (++t2 < n2) { var a2 = e2[t2]; this.set(a2[0], a2[1]); } } io.prototype.clear = Ja; io.prototype["delete"] = Xa; io.prototype.get = no; io.prototype.has = ro; io.prototype.set = so; function uo() { this.__data__ = []; this.size = 0; } function co(e2, t2) { var n2 = e2.length; while (n2--) { if (In(e2[n2][0], t2)) { return n2; } } return -1; } var fo = Array.prototype; var vo = fo.splice; function po(e2) { var t2 = this.__data__, n2 = co(t2, e2); if (n2 < 0) { return false; } var a2 = t2.length - 1; if (n2 == a2) { t2.pop(); } else { vo.call(t2, n2, 1); } --this.size; return true; } function mo(e2) { var t2 = this.__data__, n2 = co(t2, e2); return n2 < 0 ? void 0 : t2[n2][1]; } function ho(e2) { return co(this.__data__, e2) > -1; } function bo(e2, t2) { var n2 = this.__data__, a2 = co(n2, e2); if (a2 < 0) { ++this.size; n2.push([e2, t2]); } else { n2[a2][1] = t2; } return this; } function go(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length; this.clear(); while (++t2 < n2) { var a2 = e2[t2]; this.set(a2[0], a2[1]); } } go.prototype.clear = uo; go.prototype["delete"] = po; go.prototype.get = mo; go.prototype.has = ho; go.prototype.set = bo; var yo = gn(ht, "Map"); function wo() { this.size = 0; this.__data__ = { hash: new io(), map: new (yo || go)(), string: new io() }; } function ko(e2) { var t2 = typeof e2; return t2 == "string" || t2 == "number" || t2 == "symbol" || t2 == "boolean" ? e2 !== "__proto__" : e2 === null; } function xo(e2, t2) { var n2 = e2.__data__; return ko(t2) ? n2[typeof t2 == "string" ? "string" : "hash"] : n2.map; } function So(e2) { var t2 = xo(this, e2)["delete"](e2); this.size -= t2 ? 1 : 0; return t2; } function Co(e2) { return xo(this, e2).get(e2); } function _o(e2) { return xo(this, e2).has(e2); } function Mo(e2, t2) { var n2 = xo(this, e2), a2 = n2.size; n2.set(e2, t2); this.size += n2.size == a2 ? 0 : 1; return this; } function Oo(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length; this.clear(); while (++t2 < n2) { var a2 = e2[t2]; this.set(a2[0], a2[1]); } } Oo.prototype.clear = wo; Oo.prototype["delete"] = So; Oo.prototype.get = Co; Oo.prototype.has = _o; Oo.prototype.set = Mo; var Do = "Expected a function"; function Ao(e2, t2) { if (typeof e2 != "function" || t2 != null && typeof t2 != "function") { throw new TypeError(Do); } var n2 = function() { var a2 = arguments, o2 = t2 ? t2.apply(this, a2) : a2[0], r2 = n2.cache; if (r2.has(o2)) { return r2.get(o2); } var l2 = e2.apply(this, a2); n2.cache = r2.set(o2, l2) || r2; return l2; }; n2.cache = new (Ao.Cache || Oo)(); return n2; } Ao.Cache = Oo; var Eo = 500; function $o(e2) { var t2 = Ao(e2, function(e3) { if (n2.size === Eo) { n2.clear(); } return e3; }); var n2 = t2.cache; return t2; } var Lo = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; var Io = /\\(\\)?/g; var To = $o(function(e2) { var t2 = []; if (e2.charCodeAt(0) === 46) { t2.push(""); } e2.replace(Lo, function(e3, n2, a2, o2) { t2.push(a2 ? o2.replace(Io, "$1") : n2 || e3); }); return t2; }); function Po(e2) { return e2 == null ? "" : Vt(e2); } function Bo(e2, t2) { if (Tt(e2)) { return e2; } return Ga(e2, t2) ? [e2] : To(Po(e2)); } var Ro = 1 / 0; function Vo(e2) { if (typeof e2 == "string" || Lt(e2)) { return e2; } var t2 = e2 + ""; return t2 == "0" && 1 / e2 == -Ro ? "-0" : t2; } function Fo(e2, t2) { t2 = Bo(t2, e2); var n2 = 0, a2 = t2.length; while (e2 != null && n2 < a2) { e2 = e2[Vo(t2[n2++])]; } return n2 && n2 == a2 ? e2 : void 0; } function jo(e2, t2, n2) { var a2 = e2 == null ? void 0 : Fo(e2, t2); return a2 === void 0 ? n2 : a2; } function zo(e2, t2) { var n2 = -1, a2 = t2.length, o2 = e2.length; while (++n2 < a2) { e2[o2 + n2] = t2[n2]; } return e2; } var No = bt ? bt.isConcatSpreadable : void 0; function Ho(e2) { return Tt(e2) || Zn(e2) || !!(No && e2 && e2[No]); } function Yo(e2, t2, n2, a2, o2) { var r2 = -1, l2 = e2.length; n2 || (n2 = Ho); o2 || (o2 = []); while (++r2 < l2) { var s2 = e2[r2]; if (n2(s2)) { { zo(o2, s2); } } else { o2[o2.length] = s2; } } return o2; } function Wo(e2) { var t2 = e2 == null ? 0 : e2.length; return t2 ? Yo(e2) : []; } function Uo(e2) { return Dn(Vn(e2, void 0, Wo), e2 + ""); } function Ko() { this.__data__ = new go(); this.size = 0; } function qo(e2) { var t2 = this.__data__, n2 = t2["delete"](e2); this.size = t2.size; return n2; } function Go(e2) { return this.__data__.get(e2); } function Zo(e2) { return this.__data__.has(e2); } var Jo = 200; function Xo(e2, t2) { var n2 = this.__data__; if (n2 instanceof go) { var a2 = n2.__data__; if (!yo || a2.length < Jo - 1) { a2.push([e2, t2]); this.size = ++n2.size; return this; } n2 = this.__data__ = new Oo(a2); } n2.set(e2, t2); this.size = n2.size; return this; } function Qo(e2) { var t2 = this.__data__ = new go(e2); this.size = t2.size; } Qo.prototype.clear = Ko; Qo.prototype["delete"] = qo; Qo.prototype.get = Go; Qo.prototype.has = Zo; Qo.prototype.set = Xo; function er(e2, t2) { var n2 = -1, a2 = e2 == null ? 0 : e2.length, o2 = 0, r2 = []; while (++n2 < a2) { var l2 = e2[n2]; if (t2(l2, n2, e2)) { r2[o2++] = l2; } } return r2; } function tr() { return []; } var nr = Object.prototype; var ar = nr.propertyIsEnumerable; var or = Object.getOwnPropertySymbols; var rr = !or ? tr : function(e2) { if (e2 == null) { return []; } e2 = Object(e2); return er(or(e2), function(t2) { return ar.call(e2, t2); }); }; function lr(e2, t2, n2) { var a2 = t2(e2); return Tt(e2) ? a2 : zo(a2, n2(e2)); } function sr(e2) { return lr(e2, Ua, rr); } var ir = gn(ht, "DataView"); var ur = gn(ht, "Promise"); var cr = gn(ht, "Set"); var dr = "[object Map]", fr = "[object Object]", vr = "[object Promise]", pr = "[object Set]", mr = "[object WeakMap]"; var hr = "[object DataView]"; var br = sn(ir), gr = sn(yo), yr = sn(ur), wr = sn(cr), kr = sn(yn); var xr = At; if (ir && xr(new ir(new ArrayBuffer(1))) != hr || yo && xr(new yo()) != dr || ur && xr(ur.resolve()) != vr || cr && xr(new cr()) != pr || yn && xr(new yn()) != mr) { xr = function(e2) { var t2 = At(e2), n2 = t2 == fr ? e2.constructor : void 0, a2 = n2 ? sn(n2) : ""; if (a2) { switch (a2) { case br: return hr; case gr: return dr; case yr: return vr; case wr: return pr; case kr: return mr; } } return t2; }; } var Sr = ht.Uint8Array; var Cr = "__lodash_hash_undefined__"; function _r(e2) { this.__data__.set(e2, Cr); return this; } function Mr(e2) { return this.__data__.has(e2); } function Or(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length; this.__data__ = new Oo(); while (++t2 < n2) { this.add(e2[t2]); } } Or.prototype.add = Or.prototype.push = _r; Or.prototype.has = Mr; function Dr(e2, t2) { var n2 = -1, a2 = e2 == null ? 0 : e2.length; while (++n2 < a2) { if (t2(e2[n2], n2, e2)) { return true; } } return false; } function Ar(e2, t2) { return e2.has(t2); } var Er = 1, $r = 2; function Lr(e2, t2, n2, a2, o2, r2) { var l2 = n2 & Er, s2 = e2.length, i2 = t2.length; if (s2 != i2 && !(l2 && i2 > s2)) { return false; } var u2 = r2.get(e2); var c2 = r2.get(t2); if (u2 && c2) { return u2 == t2 && c2 == e2; } var d2 = -1, f2 = true, v2 = n2 & $r ? new Or() : void 0; r2.set(e2, t2); r2.set(t2, e2); while (++d2 < s2) { var p2 = e2[d2], m2 = t2[d2]; if (a2) { var h2 = l2 ? a2(m2, p2, d2, t2, e2, r2) : a2(p2, m2, d2, e2, t2, r2); } if (h2 !== void 0) { if (h2) { continue; } f2 = false; break; } if (v2) { if (!Dr(t2, function(e3, t3) { if (!Ar(v2, t3) && (p2 === e3 || o2(p2, e3, n2, a2, r2))) { return v2.push(t3); } })) { f2 = false; break; } } else if (!(p2 === m2 || o2(p2, m2, n2, a2, r2))) { f2 = false; break; } } r2["delete"](e2); r2["delete"](t2); return f2; } function Ir(e2) { var t2 = -1, n2 = Array(e2.size); e2.forEach(function(e3, a2) { n2[++t2] = [a2, e3]; }); return n2; } function Tr(e2) { var t2 = -1, n2 = Array(e2.size); e2.forEach(function(e3) { n2[++t2] = e3; }); return n2; } var Pr = 1, Br = 2; var Rr = "[object Boolean]", Vr = "[object Date]", Fr = "[object Error]", jr = "[object Map]", zr = "[object Number]", Nr = "[object RegExp]", Hr = "[object Set]", Yr = "[object String]", Wr = "[object Symbol]"; var Ur = "[object ArrayBuffer]", Kr = "[object DataView]"; var qr = bt ? bt.prototype : void 0, Gr = qr ? qr.valueOf : void 0; function Zr(e2, t2, n2, a2, o2, r2, l2) { switch (n2) { case Kr: if (e2.byteLength != t2.byteLength || e2.byteOffset != t2.byteOffset) { return false; } e2 = e2.buffer; t2 = t2.buffer; case Ur: if (e2.byteLength != t2.byteLength || !r2(new Sr(e2), new Sr(t2))) { return false; } return true; case Rr: case Vr: case zr: return In(+e2, +t2); case Fr: return e2.name == t2.name && e2.message == t2.message; case Nr: case Yr: return e2 == t2 + ""; case jr: var s2 = Ir; case Hr: var i2 = a2 & Pr; s2 || (s2 = Tr); if (e2.size != t2.size && !i2) { return false; } var u2 = l2.get(e2); if (u2) { return u2 == t2; } a2 |= Br; l2.set(e2, t2); var c2 = Lr(s2(e2), s2(t2), a2, o2, r2, l2); l2["delete"](e2); return c2; case Wr: if (Gr) { return Gr.call(e2) == Gr.call(t2); } } return false; } var Jr = 1; var Xr = Object.prototype; var Qr = Xr.hasOwnProperty; function el(e2, t2, n2, a2, o2, r2) { var l2 = n2 & Jr, s2 = sr(e2), i2 = s2.length, u2 = sr(t2), c2 = u2.length; if (i2 != c2 && !l2) { return false; } var d2 = i2; while (d2--) { var f2 = s2[d2]; if (!(l2 ? f2 in t2 : Qr.call(t2, f2))) { return false; } } var v2 = r2.get(e2); var p2 = r2.get(t2); if (v2 && p2) { return v2 == t2 && p2 == e2; } var m2 = true; r2.set(e2, t2); r2.set(t2, e2); var h2 = l2; while (++d2 < i2) { f2 = s2[d2]; var b2 = e2[f2], g2 = t2[f2]; if (a2) { var y2 = l2 ? a2(g2, b2, f2, t2, e2, r2) : a2(b2, g2, f2, e2, t2, r2); } if (!(y2 === void 0 ? b2 === g2 || o2(b2, g2, n2, a2, r2) : y2)) { m2 = false; break; } h2 || (h2 = f2 == "constructor"); } if (m2 && !h2) { var w2 = e2.constructor, k2 = t2.constructor; if (w2 != k2 && ("constructor" in e2 && "constructor" in t2) && !(typeof w2 == "function" && w2 instanceof w2 && typeof k2 == "function" && k2 instanceof k2)) { m2 = false; } } r2["delete"](e2); r2["delete"](t2); return m2; } var tl = 1; var nl = "[object Arguments]", al = "[object Array]", ol = "[object Object]"; var rl = Object.prototype; var ll = rl.hasOwnProperty; function sl(e2, t2, n2, a2, o2, r2) { var l2 = Tt(e2), s2 = Tt(t2), i2 = l2 ? al : xr(e2), u2 = s2 ? al : xr(t2); i2 = i2 == nl ? ol : i2; u2 = u2 == nl ? ol : u2; var c2 = i2 == ol, d2 = u2 == ol, f2 = i2 == u2; if (f2 && aa(e2)) { if (!aa(t2)) { return false; } l2 = true; c2 = false; } if (f2 && !c2) { r2 || (r2 = new Qo()); return l2 || Ra(e2) ? Lr(e2, t2, n2, a2, o2, r2) : Zr(e2, t2, i2, n2, a2, o2, r2); } if (!(n2 & tl)) { var v2 = c2 && ll.call(e2, "__wrapped__"), p2 = d2 && ll.call(t2, "__wrapped__"); if (v2 || p2) { var m2 = v2 ? e2.value() : e2, h2 = p2 ? t2.value() : t2; r2 || (r2 = new Qo()); return o2(m2, h2, n2, a2, r2); } } if (!f2) { return false; } r2 || (r2 = new Qo()); return el(e2, t2, n2, a2, o2, r2); } function il(e2, t2, n2, a2, o2) { if (e2 === t2) { return true; } if (e2 == null || t2 == null || !Et(e2) && !Et(t2)) { return e2 !== e2 && t2 !== t2; } return sl(e2, t2, n2, a2, il, o2); } function ul(e2, t2) { return e2 != null && t2 in Object(e2); } function cl(e2, t2, n2) { t2 = Bo(t2, e2); var a2 = -1, o2 = t2.length, r2 = false; while (++a2 < o2) { var l2 = Vo(t2[a2]); if (!(r2 = e2 != null && n2(e2, l2))) { break; } e2 = e2[l2]; } if (r2 || ++a2 != o2) { return r2; } o2 = e2 == null ? 0 : e2.length; return !!o2 && jn(o2) && $n(l2, o2) && (Tt(e2) || Zn(e2)); } function dl(e2, t2) { return e2 != null && cl(e2, t2, ul); } var fl = function() { return ht.Date.now(); }; var vl = "Expected a function"; var pl = Math.max, ml = Math.min; function hl(e2, t2, n2) { var a2, o2, r2, l2, s2, i2, u2 = 0, c2 = false, d2 = false, f2 = true; if (typeof e2 != "function") { throw new TypeError(vl); } t2 = Gt(t2) || 0; if (Ht(n2)) { c2 = !!n2.leading; d2 = "maxWait" in n2; r2 = d2 ? pl(Gt(n2.maxWait) || 0, t2) : r2; f2 = "trailing" in n2 ? !!n2.trailing : f2; } function v2(t3) { var n3 = a2, r3 = o2; a2 = o2 = void 0; u2 = t3; l2 = e2.apply(r3, n3); return l2; } function p2(e3) { u2 = e3; s2 = setTimeout(b2, t2); return c2 ? v2(e3) : l2; } function m2(e3) { var n3 = e3 - i2, a3 = e3 - u2, o3 = t2 - n3; return d2 ? ml(o3, r2 - a3) : o3; } function h2(e3) { var n3 = e3 - i2, a3 = e3 - u2; return i2 === void 0 || n3 >= t2 || n3 < 0 || d2 && a3 >= r2; } function b2() { var e3 = fl(); if (h2(e3)) { return g2(e3); } s2 = setTimeout(b2, m2(e3)); } function g2(e3) { s2 = void 0; if (f2 && a2) { return v2(e3); } a2 = o2 = void 0; return l2; } function y2() { if (s2 !== void 0) { clearTimeout(s2); } u2 = 0; a2 = i2 = o2 = s2 = void 0; } function w2() { return s2 === void 0 ? l2 : g2(fl()); } function k2() { var e3 = fl(), n3 = h2(e3); a2 = arguments; o2 = this; i2 = e3; if (n3) { if (s2 === void 0) { return p2(i2); } if (d2) { clearTimeout(s2); s2 = setTimeout(b2, t2); return v2(i2); } } if (s2 === void 0) { s2 = setTimeout(b2, t2); } return l2; } k2.cancel = y2; k2.flush = w2; return k2; } function bl(e2) { var t2 = -1, n2 = e2 == null ? 0 : e2.length, a2 = {}; while (++t2 < n2) { var o2 = e2[t2]; a2[o2[0]] = o2[1]; } return a2; } function gl(e2, t2) { return il(e2, t2); } function yl(e2) { return e2 == null; } function wl(e2) { return e2 === void 0; } function kl(e2, t2, n2, a2) { if (!Ht(e2)) { return e2; } t2 = Bo(t2, e2); var o2 = -1, r2 = t2.length, l2 = r2 - 1, s2 = e2; while (s2 != null && ++o2 < r2) { var i2 = Vo(t2[o2]), u2 = n2; if (i2 === "__proto__" || i2 === "constructor" || i2 === "prototype") { return e2; } if (o2 != l2) { var c2 = s2[i2]; u2 = void 0; if (u2 === void 0) { u2 = Ht(c2) ? c2 : $n(t2[o2 + 1]) ? [] : {}; } } Bn(s2, i2, u2); s2 = s2[i2]; } return e2; } function xl(e2, t2, n2) { var a2 = -1, o2 = t2.length, r2 = {}; while (++a2 < o2) { var l2 = t2[a2], s2 = Fo(e2, l2); if (n2(s2, l2)) { kl(r2, Bo(l2, e2), s2); } } return r2; } function Sl(e2, t2) { return xl(e2, t2, function(t3, n2) { return dl(e2, n2); }); } var Cl = Uo(function(e2, t2) { return e2 == null ? {} : Sl(e2, t2); }); const _l = (e2) => e2 === void 0; const Ml = (e2) => typeof e2 === "boolean"; const Ol = (e2) => typeof e2 === "number"; const Dl = (e2) => !e2 && e2 !== 0 || tt(e2) && e2.length === 0 || rt(e2) && !Object.keys(e2).length; const Al = (e2) => { if (typeof Element === "undefined") return false; return e2 instanceof Element; }; const El = (e2) => yl(e2); const $l = (e2) => { if (!ot(e2)) { return false; } return !Number.isNaN(Number(e2)); }; const Ll = (e2) => Object.keys(e2); class Il extends Error { constructor(e2) { super(e2); this.name = "ElementPlusError"; } } function Tl(e2, t2) { throw new Il(`[${e2}] ${t2}`); } function Pl(e2, t2) { } const Bl = (e2 = "") => e2.split(" ").filter((e3) => !!e3.trim()); const Rl = (e2, t2) => { if (!e2 || !t2) return false; if (t2.includes(" ")) throw new Error("className should not contain space."); return e2.classList.contains(t2); }; const Vl = (e2, t2) => { if (!e2 || !t2.trim()) return; e2.classList.add(...Bl(t2)); }; const Fl = (e2, t2) => { if (!e2 || !t2.trim()) return; e2.classList.remove(...Bl(t2)); }; const jl = (e2, t2) => { var n2; if (!ke || !e2 || !t2) return ""; let a2 = dt(t2); if (a2 === "float") a2 = "cssFloat"; try { const t3 = e2.style[a2]; if (t3) return t3; const o2 = (n2 = document.defaultView) == null ? void 0 : n2.getComputedStyle(e2, ""); return o2 ? o2[a2] : ""; } catch (t3) { return e2.style[a2]; } }; function zl(e2, t2 = "px") { if (!e2) return ""; if (Ol(e2) || $l(e2)) { return `${e2}${t2}`; } else if (ot(e2)) { return e2; } } let Nl; const Hl = (e2) => { var t2; if (!ke) return 0; if (Nl !== void 0) return Nl; const n2 = document.createElement("div"); n2.className = `${e2}-scrollbar__wrap`; n2.style.visibility = "hidden"; n2.style.width = "100px"; n2.style.position = "absolute"; n2.style.top = "-9999px"; document.body.appendChild(n2); const a2 = n2.offsetWidth; n2.style.overflow = "scroll"; const o2 = document.createElement("div"); o2.style.width = "100%"; n2.appendChild(o2); const r2 = o2.offsetWidth; (t2 = n2.parentNode) == null ? void 0 : t2.removeChild(n2); Nl = a2 - r2; return Nl; }; /*! Element Plus Icons Vue v2.3.1 */ var Yl = vue.defineComponent({ name: "ArrowDown", __name: "arrow-down", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M831.872 340.864 512 652.672 192.128 340.864a30.592 30.592 0 0 0-42.752 0 29.12 29.12 0 0 0 0 41.6L489.664 714.24a32 32 0 0 0 44.672 0l340.288-331.712a29.12 29.12 0 0 0 0-41.728 30.592 30.592 0 0 0-42.752 0z" })])); } }); var Wl = Yl; var Ul = vue.defineComponent({ name: "ArrowLeft", __name: "arrow-left", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M609.408 149.376 277.76 489.6a32 32 0 0 0 0 44.672l331.648 340.352a29.12 29.12 0 0 0 41.728 0 30.592 30.592 0 0 0 0-42.752L339.264 511.936l311.872-319.872a30.592 30.592 0 0 0 0-42.688 29.12 29.12 0 0 0-41.728 0z" })])); } }); var Kl = Ul; var ql = vue.defineComponent({ name: "ArrowRight", __name: "arrow-right", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M340.864 149.312a30.592 30.592 0 0 0 0 42.752L652.736 512 340.864 831.872a30.592 30.592 0 0 0 0 42.752 29.12 29.12 0 0 0 41.728 0L714.24 534.336a32 32 0 0 0 0-44.672L382.592 149.376a29.12 29.12 0 0 0-41.728 0z" })])); } }); var Gl = ql; var Zl = vue.defineComponent({ name: "ArrowUp", __name: "arrow-up", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m488.832 344.32-339.84 356.672a32 32 0 0 0 0 44.16l.384.384a29.44 29.44 0 0 0 42.688 0l320-335.872 319.872 335.872a29.44 29.44 0 0 0 42.688 0l.384-.384a32 32 0 0 0 0-44.16L535.168 344.32a32 32 0 0 0-46.336 0" })])); } }); var Jl = Zl; var Xl = vue.defineComponent({ name: "Calendar", __name: "calendar", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M128 384v512h768V192H768v32a32 32 0 1 1-64 0v-32H320v32a32 32 0 0 1-64 0v-32H128v128h768v64zm192-256h384V96a32 32 0 1 1 64 0v32h160a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h160V96a32 32 0 0 1 64 0zm-32 384h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64" })])); } }); var Ql = Xl; var es = vue.defineComponent({ name: "CircleCheck", __name: "circle-check", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M745.344 361.344a32 32 0 0 1 45.312 45.312l-288 288a32 32 0 0 1-45.312 0l-160-160a32 32 0 1 1 45.312-45.312L480 626.752l265.344-265.408z" })])); } }); var ts = es; var ns = vue.defineComponent({ name: "CircleClose", __name: "circle-close", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m466.752 512-90.496-90.496a32 32 0 0 1 45.248-45.248L512 466.752l90.496-90.496a32 32 0 1 1 45.248 45.248L557.248 512l90.496 90.496a32 32 0 1 1-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 0 1-45.248-45.248z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" })])); } }); var as = ns; var os = vue.defineComponent({ name: "Clock", __name: "clock", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M480 256a32 32 0 0 1 32 32v256a32 32 0 0 1-64 0V288a32 32 0 0 1 32-32" }), vue.createElementVNode("path", { fill: "currentColor", d: "M480 512h256q32 0 32 32t-32 32H480q-32 0-32-32t32-32" })])); } }); var rs = os; var ls = vue.defineComponent({ name: "Close", __name: "close", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z" })])); } }); var ss = ls; var is = vue.defineComponent({ name: "DArrowLeft", __name: "d-arrow-left", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M529.408 149.376a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L259.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L197.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224zm256 0a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L515.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L453.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224z" })])); } }); var us = is; var cs = vue.defineComponent({ name: "DArrowRight", __name: "d-arrow-right", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M452.864 149.312a29.12 29.12 0 0 1 41.728.064L826.24 489.664a32 32 0 0 1 0 44.672L494.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L764.736 512 452.864 192a30.592 30.592 0 0 1 0-42.688m-256 0a29.12 29.12 0 0 1 41.728.064L570.24 489.664a32 32 0 0 1 0 44.672L238.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L508.736 512 196.864 192a30.592 30.592 0 0 1 0-42.688z" })])); } }); var ds = cs; var fs = vue.defineComponent({ name: "Hide", __name: "hide", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M876.8 156.8c0-9.6-3.2-16-9.6-22.4-6.4-6.4-12.8-9.6-22.4-9.6-9.6 0-16 3.2-22.4 9.6L736 220.8c-64-32-137.6-51.2-224-60.8-160 16-288 73.6-377.6 176C44.8 438.4 0 496 0 512s48 73.6 134.4 176c22.4 25.6 44.8 48 73.6 67.2l-86.4 89.6c-6.4 6.4-9.6 12.8-9.6 22.4 0 9.6 3.2 16 9.6 22.4 6.4 6.4 12.8 9.6 22.4 9.6 9.6 0 16-3.2 22.4-9.6l704-710.4c3.2-6.4 6.4-12.8 6.4-22.4Zm-646.4 528c-76.8-70.4-128-128-153.6-172.8 28.8-48 80-105.6 153.6-172.8C304 272 400 230.4 512 224c64 3.2 124.8 19.2 176 44.8l-54.4 54.4C598.4 300.8 560 288 512 288c-64 0-115.2 22.4-160 64s-64 96-64 160c0 48 12.8 89.6 35.2 124.8L256 707.2c-9.6-6.4-19.2-16-25.6-22.4Zm140.8-96c-12.8-22.4-19.2-48-19.2-76.8 0-44.8 16-83.2 48-112 32-28.8 67.2-48 112-48 28.8 0 54.4 6.4 73.6 19.2zM889.599 336c-12.8-16-28.8-28.8-41.6-41.6l-48 48c73.6 67.2 124.8 124.8 150.4 169.6-28.8 48-80 105.6-153.6 172.8-73.6 67.2-172.8 108.8-284.8 115.2-51.2-3.2-99.2-12.8-140.8-28.8l-48 48c57.6 22.4 118.4 38.4 188.8 44.8 160-16 288-73.6 377.6-176C979.199 585.6 1024 528 1024 512s-48.001-73.6-134.401-176Z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M511.998 672c-12.8 0-25.6-3.2-38.4-6.4l-51.2 51.2c28.8 12.8 57.6 19.2 89.6 19.2 64 0 115.2-22.4 160-64 41.6-41.6 64-96 64-160 0-32-6.4-64-19.2-89.6l-51.2 51.2c3.2 12.8 6.4 25.6 6.4 38.4 0 44.8-16 83.2-48 112-32 28.8-67.2 48-112 48Z" })])); } }); var vs = fs; var ps = vue.defineComponent({ name: "Loading", __name: "loading", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32m0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32m448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32m-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32M195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0m-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z" })])); } }); var ms = ps; var hs = vue.defineComponent({ name: "Setting", __name: "setting", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M600.704 64a32 32 0 0 1 30.464 22.208l35.2 109.376c14.784 7.232 28.928 15.36 42.432 24.512l112.384-24.192a32 32 0 0 1 34.432 15.36L944.32 364.8a32 32 0 0 1-4.032 37.504l-77.12 85.12a357.12 357.12 0 0 1 0 49.024l77.12 85.248a32 32 0 0 1 4.032 37.504l-88.704 153.6a32 32 0 0 1-34.432 15.296L708.8 803.904c-13.44 9.088-27.648 17.28-42.368 24.512l-35.264 109.376A32 32 0 0 1 600.704 960H423.296a32 32 0 0 1-30.464-22.208L357.696 828.48a351.616 351.616 0 0 1-42.56-24.64l-112.32 24.256a32 32 0 0 1-34.432-15.36L79.68 659.2a32 32 0 0 1 4.032-37.504l77.12-85.248a357.12 357.12 0 0 1 0-48.896l-77.12-85.248A32 32 0 0 1 79.68 364.8l88.704-153.6a32 32 0 0 1 34.432-15.296l112.32 24.256c13.568-9.152 27.776-17.408 42.56-24.64l35.2-109.312A32 32 0 0 1 423.232 64H600.64zm-23.424 64H446.72l-36.352 113.088-24.512 11.968a294.113 294.113 0 0 0-34.816 20.096l-22.656 15.36-116.224-25.088-65.28 113.152 79.68 88.192-1.92 27.136a293.12 293.12 0 0 0 0 40.192l1.92 27.136-79.808 88.192 65.344 113.152 116.224-25.024 22.656 15.296a294.113 294.113 0 0 0 34.816 20.096l24.512 11.968L446.72 896h130.688l36.48-113.152 24.448-11.904a288.282 288.282 0 0 0 34.752-20.096l22.592-15.296 116.288 25.024 65.28-113.152-79.744-88.192 1.92-27.136a293.12 293.12 0 0 0 0-40.256l-1.92-27.136 79.808-88.128-65.344-113.152-116.288 24.96-22.592-15.232a287.616 287.616 0 0 0-34.752-20.096l-24.448-11.904L577.344 128zM512 320a192 192 0 1 1 0 384 192 192 0 0 1 0-384m0 64a128 128 0 1 0 0 256 128 128 0 0 0 0-256" })])); } }); var bs = hs; var gs = vue.defineComponent({ name: "View", __name: "view", setup(e2) { return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352m0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 1 1 0 448 224 224 0 0 1 0-448m0 64a160.192 160.192 0 0 0-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160" })])); } }); var ys = gs; const ws = "__epPropKey"; const ks = (e2) => e2; const xs = (e2) => rt(e2) && !!e2[ws]; const Ss = (e2, t2) => { if (!rt(e2) || xs(e2)) return e2; const { values: n2, required: a2, default: r2, type: l2, validator: s2 } = e2; const i2 = n2 || s2 ? (a3) => { let l3 = false; let i3 = []; if (n2) { i3 = Array.from(n2); if (et(e2, "default")) { i3.push(r2); } l3 || (l3 = i3.includes(a3)); } if (s2) l3 || (l3 = s2(a3)); if (!l3 && i3.length > 0) { const e3 = [...new Set(i3)].map((e4) => JSON.stringify(e4)).join(", "); vue.warn(`Invalid prop: validation failed${t2 ? ` for prop "${t2}"` : ""}. Expected one of [${e3}], got value ${JSON.stringify(a3)}.`); } return l3; } : void 0; const u2 = { type: l2, required: !!a2, validator: i2, [ws]: true }; if (et(e2, "default")) u2.default = r2; return u2; }; const Cs = (e2) => bl(Object.entries(e2).map(([e3, t2]) => [e3, Ss(t2, e3)])); const _s = ks([String, Object, Function]); const Ms = { Close: ss }; const Os = { validating: ms, success: ts, error: as }; const Ds = (e2, t2) => { e2.install = (n2) => { for (const a2 of [e2, ...Object.values(t2 != null ? t2 : {})]) { n2.component(a2.name, a2); } }; if (t2) { for (const [n2, a2] of Object.entries(t2)) { e2[n2] = a2; } } return e2; }; const As = (e2) => { e2.install = Xe; return e2; }; const Es = (...e2) => (t2) => { e2.forEach((e3) => { if (at(e3)) { e3(t2); } else { e3.value = t2; } }); }; const $s = { tab: "Tab", enter: "Enter", space: "Space", left: "ArrowLeft", up: "ArrowUp", right: "ArrowRight", down: "ArrowDown", esc: "Escape", delete: "Delete", backspace: "Backspace", numpadEnter: "NumpadEnter", pageUp: "PageUp", pageDown: "PageDown", home: "Home", end: "End" }; const Ls = ["year", "years", "month", "date", "dates", "week", "datetime", "datetimerange", "daterange", "monthrange"]; const Is = "update:modelValue"; const Ts = "change"; const Ps = "input"; const Bs = ["", "default", "small", "large"]; const Rs = (e2) => ["", ...Bs].includes(e2); var Vs = ((e2) => { e2[e2["TEXT"] = 1] = "TEXT"; e2[e2["CLASS"] = 2] = "CLASS"; e2[e2["STYLE"] = 4] = "STYLE"; e2[e2["PROPS"] = 8] = "PROPS"; e2[e2["FULL_PROPS"] = 16] = "FULL_PROPS"; e2[e2["HYDRATE_EVENTS"] = 32] = "HYDRATE_EVENTS"; e2[e2["STABLE_FRAGMENT"] = 64] = "STABLE_FRAGMENT"; e2[e2["KEYED_FRAGMENT"] = 128] = "KEYED_FRAGMENT"; e2[e2["UNKEYED_FRAGMENT"] = 256] = "UNKEYED_FRAGMENT"; e2[e2["NEED_PATCH"] = 512] = "NEED_PATCH"; e2[e2["DYNAMIC_SLOTS"] = 1024] = "DYNAMIC_SLOTS"; e2[e2["HOISTED"] = -1] = "HOISTED"; e2[e2["BAIL"] = -2] = "BAIL"; return e2; })(Vs || {}); const Fs = (e2) => { if (!e2 && e2 !== 0) return []; return Array.isArray(e2) ? e2 : [e2]; }; const js = (e2) => /([\uAC00-\uD7AF\u3130-\u318F])+/gi.test(e2); const zs = (e2) => e2; const Ns = ["class", "style"]; const Hs = /^on[A-Z]/; const Ys = (e2 = {}) => { const { excludeListeners: t2 = false, excludeKeys: n2 } = e2; const a2 = vue.computed(() => ((n2 == null ? void 0 : n2.value) || []).concat(Ns)); const o2 = vue.getCurrentInstance(); if (!o2) { return vue.computed(() => ({})); } return vue.computed(() => { var e3; return bl(Object.entries((e3 = o2.proxy) == null ? void 0 : e3.$attrs).filter(([e4]) => !a2.value.includes(e4) && !(t2 && Hs.test(e4)))); }); }; const Ws = ({ from: e2, replacement: t2, scope: n2, version: a2, ref: o2, type: r2 = "API" }, l2) => { vue.watch(() => vue.unref(l2), (e3) => { }, { immediate: true }); }; const Us = (e2, t2, n2, a2) => { let o2 = { offsetX: 0, offsetY: 0 }; const r2 = (t3) => { const n3 = t3.clientX; const r3 = t3.clientY; const { offsetX: l3, offsetY: s3 } = o2; const i2 = e2.value.getBoundingClientRect(); const u2 = i2.left; const c2 = i2.top; const d2 = i2.width; const f2 = i2.height; const v2 = document.documentElement.clientWidth; const p2 = document.documentElement.clientHeight; const m2 = -u2 + l3; const h2 = -c2 + s3; const b2 = v2 - u2 - d2 + l3; const g2 = p2 - c2 - f2 + s3; const y2 = (t4) => { let i3 = l3 + t4.clientX - n3; let u3 = s3 + t4.clientY - r3; if (!(a2 == null ? void 0 : a2.value)) { i3 = Math.min(Math.max(i3, m2), b2); u3 = Math.min(Math.max(u3, h2), g2); } o2 = { offsetX: i3, offsetY: u3 }; if (e2.value) { e2.value.style.transform = `translate(${zl(i3)}, ${zl(u3)})`; } }; const w2 = () => { document.removeEventListener("mousemove", y2); document.removeEventListener("mouseup", w2); }; document.addEventListener("mousemove", y2); document.addEventListener("mouseup", w2); }; const l2 = () => { if (t2.value && e2.value) { t2.value.addEventListener("mousedown", r2); } }; const s2 = () => { if (t2.value && e2.value) { t2.value.removeEventListener("mousedown", r2); } }; vue.onMounted(() => { vue.watchEffect(() => { if (n2.value) { l2(); } else { s2(); } }); }); vue.onBeforeUnmount(() => { s2(); }); }; var Ks = { name: "en", el: { breadcrumb: { label: "Breadcrumb" }, colorpicker: { confirm: "OK", clear: "Clear", defaultLabel: "color picker", description: "current color is {color}. press enter to select a new color." }, datepicker: { now: "Now", today: "Today", cancel: "Cancel", clear: "Clear", confirm: "OK", dateTablePrompt: "Use the arrow keys and enter to select the day of the month", monthTablePrompt: "Use the arrow keys and enter to select the month", yearTablePrompt: "Use the arrow keys and enter to select the year", selectedDate: "Selected date", selectDate: "Select date", selectTime: "Select time", startDate: "Start Date", startTime: "Start Time", endDate: "End Date", endTime: "End Time", prevYear: "Previous Year", nextYear: "Next Year", prevMonth: "Previous Month", nextMonth: "Next Month", year: "", month1: "January", month2: "February", month3: "March", month4: "April", month5: "May", month6: "June", month7: "July", month8: "August", month9: "September", month10: "October", month11: "November", month12: "December", week: "week", weeks: { sun: "Sun", mon: "Mon", tue: "Tue", wed: "Wed", thu: "Thu", fri: "Fri", sat: "Sat" }, weeksFull: { sun: "Sunday", mon: "Monday", tue: "Tuesday", wed: "Wednesday", thu: "Thursday", fri: "Friday", sat: "Saturday" }, months: { jan: "Jan", feb: "Feb", mar: "Mar", apr: "Apr", may: "May", jun: "Jun", jul: "Jul", aug: "Aug", sep: "Sep", oct: "Oct", nov: "Nov", dec: "Dec" } }, inputNumber: { decrease: "decrease number", increase: "increase number" }, select: { loading: "Loading", noMatch: "No matching data", noData: "No data", placeholder: "Select" }, dropdown: { toggleDropdown: "Toggle Dropdown" }, cascader: { noMatch: "No matching data", loading: "Loading", placeholder: "Select", noData: "No data" }, pagination: { goto: "Go to", pagesize: "/page", total: "Total {total}", pageClassifier: "", page: "Page", prev: "Go to previous page", next: "Go to next page", currentPage: "page {pager}", prevPages: "Previous {pager} pages", nextPages: "Next {pager} pages", deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details" }, dialog: { close: "Close this dialog" }, drawer: { close: "Close this dialog" }, messagebox: { title: "Message", confirm: "OK", cancel: "Cancel", error: "Illegal input", close: "Close this dialog" }, upload: { deleteTip: "press delete to remove", delete: "Delete", preview: "Preview", continue: "Continue" }, slider: { defaultLabel: "slider between {min} and {max}", defaultRangeStartLabel: "pick start value", defaultRangeEndLabel: "pick end value" }, table: { emptyText: "No Data", confirmFilter: "Confirm", resetFilter: "Reset", clearFilter: "All", sumText: "Sum" }, tour: { next: "Next", previous: "Previous", finish: "Finish" }, tree: { emptyText: "No Data" }, transfer: { noMatch: "No matching data", noData: "No data", titles: ["List 1", "List 2"], filterPlaceholder: "Enter keyword", noCheckedFormat: "{total} items", hasCheckedFormat: "{checked}/{total} checked" }, image: { error: "FAILED" }, pageHeader: { title: "Back" }, popconfirm: { confirmButtonText: "Yes", cancelButtonText: "No" }, carousel: { leftArrow: "Carousel arrow left", rightArrow: "Carousel arrow right", indicator: "Carousel switch to index {index}" } } }; const qs = (e2) => (t2, n2) => Gs(t2, n2, vue.unref(e2)); const Gs = (e2, t2, n2) => jo(n2, e2, e2).replace(/\{(\w+)\}/g, (e3, n3) => { var a2; return `${(a2 = t2 == null ? void 0 : t2[n3]) != null ? a2 : `{${n3}}`}`; }); const Zs = (e2) => { const t2 = vue.computed(() => vue.unref(e2).name); const n2 = vue.isRef(e2) ? e2 : vue.ref(e2); return { lang: t2, locale: n2, t: qs(e2) }; }; const Js = Symbol("localeContextKey"); const Xs = (e2) => { const t2 = e2 || vue.inject(Js, vue.ref()); return Zs(vue.computed(() => t2.value || Ks)); }; const Qs = "el"; const ei = "is-"; const ti = (e2, t2, n2, a2, o2) => { let r2 = `${e2}-${t2}`; if (n2) { r2 += `-${n2}`; } if (a2) { r2 += `__${a2}`; } if (o2) { r2 += `--${o2}`; } return r2; }; const ni = Symbol("namespaceContextKey"); const ai = (e2) => { const t2 = e2 || (vue.getCurrentInstance() ? vue.inject(ni, vue.ref(Qs)) : vue.ref(Qs)); const n2 = vue.computed(() => vue.unref(t2) || Qs); return n2; }; const oi = (e2, t2) => { const n2 = ai(t2); const a2 = (t3 = "") => ti(n2.value, e2, t3, "", ""); const o2 = (t3) => t3 ? ti(n2.value, e2, "", t3, "") : ""; const r2 = (t3) => t3 ? ti(n2.value, e2, "", "", t3) : ""; const l2 = (t3, a3) => t3 && a3 ? ti(n2.value, e2, t3, a3, "") : ""; const s2 = (t3, a3) => t3 && a3 ? ti(n2.value, e2, "", t3, a3) : ""; const i2 = (t3, a3) => t3 && a3 ? ti(n2.value, e2, t3, "", a3) : ""; const u2 = (t3, a3, o3) => t3 && a3 && o3 ? ti(n2.value, e2, t3, a3, o3) : ""; const c2 = (e3, ...t3) => { const n3 = t3.length >= 1 ? t3[0] : true; return e3 && n3 ? `${ei}${e3}` : ""; }; const d2 = (e3) => { const t3 = {}; for (const a3 in e3) { if (e3[a3]) { t3[`--${n2.value}-${a3}`] = e3[a3]; } } return t3; }; const f2 = (t3) => { const a3 = {}; for (const o3 in t3) { if (t3[o3]) { a3[`--${n2.value}-${e2}-${o3}`] = t3[o3]; } } return a3; }; const v2 = (e3) => `--${n2.value}-${e3}`; const p2 = (t3) => `--${n2.value}-${e2}-${t3}`; return { namespace: n2, b: a2, e: o2, m: r2, be: l2, em: s2, bm: i2, bem: u2, is: c2, cssVar: d2, cssVarName: v2, cssVarBlock: f2, cssVarBlockName: p2 }; }; const ri = (e2, t2 = {}) => { if (!vue.isRef(e2)) { Tl("[useLockscreen]", "You need to pass a ref param to this function"); } const n2 = t2.ns || oi("popup"); const a2 = vue.computed(() => n2.bm("parent", "hidden")); if (!ke || Rl(document.body, a2.value)) { return; } let o2 = 0; let l2 = false; let i2 = "0"; const u2 = () => { setTimeout(() => { Fl(document == null ? void 0 : document.body, a2.value); if (l2 && document) { document.body.style.width = i2; } }, 200); }; vue.watch(e2, (e3) => { if (!e3) { u2(); return; } l2 = !Rl(document.body, a2.value); if (l2) { i2 = document.body.style.width; } o2 = Hl(n2.namespace.value); const t3 = document.documentElement.clientHeight < document.body.scrollHeight; const r2 = jl(document.body, "overflowY"); if (o2 > 0 && (t3 || r2 === "scroll") && l2) { document.body.style.width = `calc(100% - ${o2}px)`; } Vl(document.body, a2.value); }); vue.onScopeDispose(() => u2()); }; const li = Ss({ type: ks(Boolean), default: null }); const si = Ss({ type: ks(Function) }); const ii = (e2) => { const t2 = `update:${e2}`; const n2 = `onUpdate:${e2}`; const a2 = [t2]; const o2 = { [e2]: li, [n2]: si }; const i2 = ({ indicator: a3, toggleReason: o3, shouldHideWhenRouteChanges: i3, shouldProceed: c2, onShow: d2, onHide: f2 }) => { const v2 = vue.getCurrentInstance(); const { emit: p2 } = v2; const m2 = v2.props; const h2 = vue.computed(() => at(m2[n2])); const b2 = vue.computed(() => m2[e2] === null); const g2 = (e3) => { if (a3.value === true) { return; } a3.value = true; if (o3) { o3.value = e3; } if (at(d2)) { d2(e3); } }; const y2 = (e3) => { if (a3.value === false) { return; } a3.value = false; if (o3) { o3.value = e3; } if (at(f2)) { f2(e3); } }; const w2 = (e3) => { if (m2.disabled === true || at(c2) && !c2()) return; const n3 = h2.value && ke; if (n3) { p2(t2, true); } if (b2.value || !n3) { g2(e3); } }; const k2 = (e3) => { if (m2.disabled === true || !ke) return; const n3 = h2.value && ke; if (n3) { p2(t2, false); } if (b2.value || !n3) { y2(e3); } }; const x2 = (e3) => { if (!Ml(e3)) return; if (m2.disabled && e3) { if (h2.value) { p2(t2, false); } } else if (a3.value !== e3) { if (e3) { g2(); } else { y2(); } } }; const S2 = () => { if (a3.value) { k2(); } else { w2(); } }; vue.watch(() => m2[e2], x2); if (i3 && v2.appContext.config.globalProperties.$route !== void 0) { vue.watch(() => ({ ...v2.proxy.$route }), () => { if (i3.value && a3.value) { k2(); } }); } vue.onMounted(() => { x2(m2[e2]); }); return { hide: k2, show: w2, toggle: S2, hasUpdateHandler: h2 }; }; return { useModelToggle: i2, useModelToggleProps: o2, useModelToggleEmits: a2 }; }; const ui = (e2) => { const t2 = vue.getCurrentInstance(); return vue.computed(() => { var n2, a2; return (a2 = (n2 = t2 == null ? void 0 : t2.proxy) == null ? void 0 : n2.$props) == null ? void 0 : a2[e2]; }); }; var ci = "top", di = "bottom", fi = "right", vi = "left", pi = "auto", mi = [ci, di, fi, vi], hi = "start", bi = "end", gi = "clippingParents", yi = "viewport", wi = "popper", ki = "reference", xi = mi.reduce(function(e2, t2) { return e2.concat([t2 + "-" + hi, t2 + "-" + bi]); }, []), Si = [].concat(mi, [pi]).reduce(function(e2, t2) { return e2.concat([t2, t2 + "-" + hi, t2 + "-" + bi]); }, []), Ci = "beforeRead", _i = "read", Mi = "afterRead", Oi = "beforeMain", Di = "main", Ai = "afterMain", Ei = "beforeWrite", $i = "write", Li = "afterWrite", Ii = [Ci, _i, Mi, Oi, Di, Ai, Ei, $i, Li]; function Ti(e2) { return e2 ? (e2.nodeName || "").toLowerCase() : null; } function Pi(e2) { if (e2 == null) return window; if (e2.toString() !== "[object Window]") { var t2 = e2.ownerDocument; return t2 && t2.defaultView || window; } return e2; } function Bi(e2) { var t2 = Pi(e2).Element; return e2 instanceof t2 || e2 instanceof Element; } function Ri(e2) { var t2 = Pi(e2).HTMLElement; return e2 instanceof t2 || e2 instanceof HTMLElement; } function Vi(e2) { if (typeof ShadowRoot == "undefined") return false; var t2 = Pi(e2).ShadowRoot; return e2 instanceof t2 || e2 instanceof ShadowRoot; } function Fi(e2) { var t2 = e2.state; Object.keys(t2.elements).forEach(function(e3) { var n2 = t2.styles[e3] || {}, a2 = t2.attributes[e3] || {}, o2 = t2.elements[e3]; !Ri(o2) || !Ti(o2) || (Object.assign(o2.style, n2), Object.keys(a2).forEach(function(e4) { var t3 = a2[e4]; t3 === false ? o2.removeAttribute(e4) : o2.setAttribute(e4, t3 === true ? "" : t3); })); }); } function ji(e2) { var t2 = e2.state, n2 = { popper: { position: t2.options.strategy, left: "0", top: "0", margin: "0" }, arrow: { position: "absolute" }, reference: {} }; return Object.assign(t2.elements.popper.style, n2.popper), t2.styles = n2, t2.elements.arrow && Object.assign(t2.elements.arrow.style, n2.arrow), function() { Object.keys(t2.elements).forEach(function(e3) { var a2 = t2.elements[e3], o2 = t2.attributes[e3] || {}, r2 = Object.keys(t2.styles.hasOwnProperty(e3) ? t2.styles[e3] : n2[e3]), l2 = r2.reduce(function(e4, t3) { return e4[t3] = "", e4; }, {}); !Ri(a2) || !Ti(a2) || (Object.assign(a2.style, l2), Object.keys(o2).forEach(function(e4) { a2.removeAttribute(e4); })); }); }; } var zi = { name: "applyStyles", enabled: true, phase: "write", fn: Fi, effect: ji, requires: ["computeStyles"] }; function Ni(e2) { return e2.split("-")[0]; } var Hi = Math.max, Yi = Math.min, Wi = Math.round; function Ui(e2, t2) { t2 === void 0 && (t2 = false); var n2 = e2.getBoundingClientRect(), a2 = 1, o2 = 1; if (Ri(e2) && t2) { var r2 = e2.offsetHeight, l2 = e2.offsetWidth; l2 > 0 && (a2 = Wi(n2.width) / l2 || 1), r2 > 0 && (o2 = Wi(n2.height) / r2 || 1); } return { width: n2.width / a2, height: n2.height / o2, top: n2.top / o2, right: n2.right / a2, bottom: n2.bottom / o2, left: n2.left / a2, x: n2.left / a2, y: n2.top / o2 }; } function Ki(e2) { var t2 = Ui(e2), n2 = e2.offsetWidth, a2 = e2.offsetHeight; return Math.abs(t2.width - n2) <= 1 && (n2 = t2.width), Math.abs(t2.height - a2) <= 1 && (a2 = t2.height), { x: e2.offsetLeft, y: e2.offsetTop, width: n2, height: a2 }; } function qi(e2, t2) { var n2 = t2.getRootNode && t2.getRootNode(); if (e2.contains(t2)) return true; if (n2 && Vi(n2)) { var a2 = t2; do { if (a2 && e2.isSameNode(a2)) return true; a2 = a2.parentNode || a2.host; } while (a2); } return false; } function Gi(e2) { return Pi(e2).getComputedStyle(e2); } function Zi(e2) { return ["table", "td", "th"].indexOf(Ti(e2)) >= 0; } function Ji(e2) { return ((Bi(e2) ? e2.ownerDocument : e2.document) || window.document).documentElement; } function Xi(e2) { return Ti(e2) === "html" ? e2 : e2.assignedSlot || e2.parentNode || (Vi(e2) ? e2.host : null) || Ji(e2); } function Qi(e2) { return !Ri(e2) || Gi(e2).position === "fixed" ? null : e2.offsetParent; } function eu(e2) { var t2 = navigator.userAgent.toLowerCase().indexOf("firefox") !== -1, n2 = navigator.userAgent.indexOf("Trident") !== -1; if (n2 && Ri(e2)) { var a2 = Gi(e2); if (a2.position === "fixed") return null; } var o2 = Xi(e2); for (Vi(o2) && (o2 = o2.host); Ri(o2) && ["html", "body"].indexOf(Ti(o2)) < 0; ) { var r2 = Gi(o2); if (r2.transform !== "none" || r2.perspective !== "none" || r2.contain === "paint" || ["transform", "perspective"].indexOf(r2.willChange) !== -1 || t2 && r2.willChange === "filter" || t2 && r2.filter && r2.filter !== "none") return o2; o2 = o2.parentNode; } return null; } function tu(e2) { for (var t2 = Pi(e2), n2 = Qi(e2); n2 && Zi(n2) && Gi(n2).position === "static"; ) n2 = Qi(n2); return n2 && (Ti(n2) === "html" || Ti(n2) === "body" && Gi(n2).position === "static") ? t2 : n2 || eu(e2) || t2; } function nu(e2) { return ["top", "bottom"].indexOf(e2) >= 0 ? "x" : "y"; } function au(e2, t2, n2) { return Hi(e2, Yi(t2, n2)); } function ou(e2, t2, n2) { var a2 = au(e2, t2, n2); return a2 > n2 ? n2 : a2; } function ru() { return { top: 0, right: 0, bottom: 0, left: 0 }; } function lu(e2) { return Object.assign({}, ru(), e2); } function su(e2, t2) { return t2.reduce(function(t3, n2) { return t3[n2] = e2, t3; }, {}); } var iu = function(e2, t2) { return e2 = typeof e2 == "function" ? e2(Object.assign({}, t2.rects, { placement: t2.placement })) : e2, lu(typeof e2 != "number" ? e2 : su(e2, mi)); }; function uu(e2) { var t2, n2 = e2.state, a2 = e2.name, o2 = e2.options, r2 = n2.elements.arrow, l2 = n2.modifiersData.popperOffsets, s2 = Ni(n2.placement), i2 = nu(s2), u2 = [vi, fi].indexOf(s2) >= 0, c2 = u2 ? "height" : "width"; if (!(!r2 || !l2)) { var d2 = iu(o2.padding, n2), f2 = Ki(r2), v2 = i2 === "y" ? ci : vi, p2 = i2 === "y" ? di : fi, m2 = n2.rects.reference[c2] + n2.rects.reference[i2] - l2[i2] - n2.rects.popper[c2], h2 = l2[i2] - n2.rects.reference[i2], b2 = tu(r2), g2 = b2 ? i2 === "y" ? b2.clientHeight || 0 : b2.clientWidth || 0 : 0, y2 = m2 / 2 - h2 / 2, w2 = d2[v2], k2 = g2 - f2[c2] - d2[p2], x2 = g2 / 2 - f2[c2] / 2 + y2, S2 = au(w2, x2, k2), C2 = i2; n2.modifiersData[a2] = (t2 = {}, t2[C2] = S2, t2.centerOffset = S2 - x2, t2); } } function cu(e2) { var t2 = e2.state, n2 = e2.options, a2 = n2.element, o2 = a2 === void 0 ? "[data-popper-arrow]" : a2; o2 != null && (typeof o2 == "string" && (o2 = t2.elements.popper.querySelector(o2), !o2) || !qi(t2.elements.popper, o2) || (t2.elements.arrow = o2)); } var du = { name: "arrow", enabled: true, phase: "main", fn: uu, effect: cu, requires: ["popperOffsets"], requiresIfExists: ["preventOverflow"] }; function fu(e2) { return e2.split("-")[1]; } var vu = { top: "auto", right: "auto", bottom: "auto", left: "auto" }; function pu(e2) { var t2 = e2.x, n2 = e2.y, a2 = window, o2 = a2.devicePixelRatio || 1; return { x: Wi(t2 * o2) / o2 || 0, y: Wi(n2 * o2) / o2 || 0 }; } function mu(e2) { var t2, n2 = e2.popper, a2 = e2.popperRect, o2 = e2.placement, r2 = e2.variation, l2 = e2.offsets, s2 = e2.position, i2 = e2.gpuAcceleration, u2 = e2.adaptive, c2 = e2.roundOffsets, d2 = e2.isFixed, f2 = l2.x, v2 = f2 === void 0 ? 0 : f2, p2 = l2.y, m2 = p2 === void 0 ? 0 : p2, h2 = typeof c2 == "function" ? c2({ x: v2, y: m2 }) : { x: v2, y: m2 }; v2 = h2.x, m2 = h2.y; var b2 = l2.hasOwnProperty("x"), g2 = l2.hasOwnProperty("y"), y2 = vi, w2 = ci, k2 = window; if (u2) { var x2 = tu(n2), S2 = "clientHeight", C2 = "clientWidth"; if (x2 === Pi(n2) && (x2 = Ji(n2), Gi(x2).position !== "static" && s2 === "absolute" && (S2 = "scrollHeight", C2 = "scrollWidth")), x2 = x2, o2 === ci || (o2 === vi || o2 === fi) && r2 === bi) { w2 = di; var _2 = d2 && x2 === k2 && k2.visualViewport ? k2.visualViewport.height : x2[S2]; m2 -= _2 - a2.height, m2 *= i2 ? 1 : -1; } if (o2 === vi || (o2 === ci || o2 === di) && r2 === bi) { y2 = fi; var M2 = d2 && x2 === k2 && k2.visualViewport ? k2.visualViewport.width : x2[C2]; v2 -= M2 - a2.width, v2 *= i2 ? 1 : -1; } } var O2 = Object.assign({ position: s2 }, u2 && vu), D2 = c2 === true ? pu({ x: v2, y: m2 }) : { x: v2, y: m2 }; if (v2 = D2.x, m2 = D2.y, i2) { var A2; return Object.assign({}, O2, (A2 = {}, A2[w2] = g2 ? "0" : "", A2[y2] = b2 ? "0" : "", A2.transform = (k2.devicePixelRatio || 1) <= 1 ? "translate(" + v2 + "px, " + m2 + "px)" : "translate3d(" + v2 + "px, " + m2 + "px, 0)", A2)); } return Object.assign({}, O2, (t2 = {}, t2[w2] = g2 ? m2 + "px" : "", t2[y2] = b2 ? v2 + "px" : "", t2.transform = "", t2)); } function hu(e2) { var t2 = e2.state, n2 = e2.options, a2 = n2.gpuAcceleration, o2 = a2 === void 0 ? true : a2, r2 = n2.adaptive, l2 = r2 === void 0 ? true : r2, s2 = n2.roundOffsets, i2 = s2 === void 0 ? true : s2, u2 = { placement: Ni(t2.placement), variation: fu(t2.placement), popper: t2.elements.popper, popperRect: t2.rects.popper, gpuAcceleration: o2, isFixed: t2.options.strategy === "fixed" }; t2.modifiersData.popperOffsets != null && (t2.styles.popper = Object.assign({}, t2.styles.popper, mu(Object.assign({}, u2, { offsets: t2.modifiersData.popperOffsets, position: t2.options.strategy, adaptive: l2, roundOffsets: i2 })))), t2.modifiersData.arrow != null && (t2.styles.arrow = Object.assign({}, t2.styles.arrow, mu(Object.assign({}, u2, { offsets: t2.modifiersData.arrow, position: "absolute", adaptive: false, roundOffsets: i2 })))), t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-placement": t2.placement }); } var bu = { name: "computeStyles", enabled: true, phase: "beforeWrite", fn: hu, data: {} }, gu = { passive: true }; function yu(e2) { var t2 = e2.state, n2 = e2.instance, a2 = e2.options, o2 = a2.scroll, r2 = o2 === void 0 ? true : o2, l2 = a2.resize, s2 = l2 === void 0 ? true : l2, i2 = Pi(t2.elements.popper), u2 = [].concat(t2.scrollParents.reference, t2.scrollParents.popper); return r2 && u2.forEach(function(e3) { e3.addEventListener("scroll", n2.update, gu); }), s2 && i2.addEventListener("resize", n2.update, gu), function() { r2 && u2.forEach(function(e3) { e3.removeEventListener("scroll", n2.update, gu); }), s2 && i2.removeEventListener("resize", n2.update, gu); }; } var wu = { name: "eventListeners", enabled: true, phase: "write", fn: function() { }, effect: yu, data: {} }, ku = { left: "right", right: "left", bottom: "top", top: "bottom" }; function xu(e2) { return e2.replace(/left|right|bottom|top/g, function(e3) { return ku[e3]; }); } var Su = { start: "end", end: "start" }; function Cu(e2) { return e2.replace(/start|end/g, function(e3) { return Su[e3]; }); } function _u(e2) { var t2 = Pi(e2), n2 = t2.pageXOffset, a2 = t2.pageYOffset; return { scrollLeft: n2, scrollTop: a2 }; } function Mu(e2) { return Ui(Ji(e2)).left + _u(e2).scrollLeft; } function Ou(e2) { var t2 = Pi(e2), n2 = Ji(e2), a2 = t2.visualViewport, o2 = n2.clientWidth, r2 = n2.clientHeight, l2 = 0, s2 = 0; return a2 && (o2 = a2.width, r2 = a2.height, /^((?!chrome|android).)*safari/i.test(navigator.userAgent) || (l2 = a2.offsetLeft, s2 = a2.offsetTop)), { width: o2, height: r2, x: l2 + Mu(e2), y: s2 }; } function Du(e2) { var t2, n2 = Ji(e2), a2 = _u(e2), o2 = (t2 = e2.ownerDocument) == null ? void 0 : t2.body, r2 = Hi(n2.scrollWidth, n2.clientWidth, o2 ? o2.scrollWidth : 0, o2 ? o2.clientWidth : 0), l2 = Hi(n2.scrollHeight, n2.clientHeight, o2 ? o2.scrollHeight : 0, o2 ? o2.clientHeight : 0), s2 = -a2.scrollLeft + Mu(e2), i2 = -a2.scrollTop; return Gi(o2 || n2).direction === "rtl" && (s2 += Hi(n2.clientWidth, o2 ? o2.clientWidth : 0) - r2), { width: r2, height: l2, x: s2, y: i2 }; } function Au(e2) { var t2 = Gi(e2), n2 = t2.overflow, a2 = t2.overflowX, o2 = t2.overflowY; return /auto|scroll|overlay|hidden/.test(n2 + o2 + a2); } function Eu(e2) { return ["html", "body", "#document"].indexOf(Ti(e2)) >= 0 ? e2.ownerDocument.body : Ri(e2) && Au(e2) ? e2 : Eu(Xi(e2)); } function $u(e2, t2) { var n2; t2 === void 0 && (t2 = []); var a2 = Eu(e2), o2 = a2 === ((n2 = e2.ownerDocument) == null ? void 0 : n2.body), r2 = Pi(a2), l2 = o2 ? [r2].concat(r2.visualViewport || [], Au(a2) ? a2 : []) : a2, s2 = t2.concat(l2); return o2 ? s2 : s2.concat($u(Xi(l2))); } function Lu(e2) { return Object.assign({}, e2, { left: e2.x, top: e2.y, right: e2.x + e2.width, bottom: e2.y + e2.height }); } function Iu(e2) { var t2 = Ui(e2); return t2.top = t2.top + e2.clientTop, t2.left = t2.left + e2.clientLeft, t2.bottom = t2.top + e2.clientHeight, t2.right = t2.left + e2.clientWidth, t2.width = e2.clientWidth, t2.height = e2.clientHeight, t2.x = t2.left, t2.y = t2.top, t2; } function Tu(e2, t2) { return t2 === yi ? Lu(Ou(e2)) : Bi(t2) ? Iu(t2) : Lu(Du(Ji(e2))); } function Pu(e2) { var t2 = $u(Xi(e2)), n2 = ["absolute", "fixed"].indexOf(Gi(e2).position) >= 0, a2 = n2 && Ri(e2) ? tu(e2) : e2; return Bi(a2) ? t2.filter(function(e3) { return Bi(e3) && qi(e3, a2) && Ti(e3) !== "body"; }) : []; } function Bu(e2, t2, n2) { var a2 = t2 === "clippingParents" ? Pu(e2) : [].concat(t2), o2 = [].concat(a2, [n2]), r2 = o2[0], l2 = o2.reduce(function(t3, n3) { var a3 = Tu(e2, n3); return t3.top = Hi(a3.top, t3.top), t3.right = Yi(a3.right, t3.right), t3.bottom = Yi(a3.bottom, t3.bottom), t3.left = Hi(a3.left, t3.left), t3; }, Tu(e2, r2)); return l2.width = l2.right - l2.left, l2.height = l2.bottom - l2.top, l2.x = l2.left, l2.y = l2.top, l2; } function Ru(e2) { var t2 = e2.reference, n2 = e2.element, a2 = e2.placement, o2 = a2 ? Ni(a2) : null, r2 = a2 ? fu(a2) : null, l2 = t2.x + t2.width / 2 - n2.width / 2, s2 = t2.y + t2.height / 2 - n2.height / 2, i2; switch (o2) { case ci: i2 = { x: l2, y: t2.y - n2.height }; break; case di: i2 = { x: l2, y: t2.y + t2.height }; break; case fi: i2 = { x: t2.x + t2.width, y: s2 }; break; case vi: i2 = { x: t2.x - n2.width, y: s2 }; break; default: i2 = { x: t2.x, y: t2.y }; } var u2 = o2 ? nu(o2) : null; if (u2 != null) { var c2 = u2 === "y" ? "height" : "width"; switch (r2) { case hi: i2[u2] = i2[u2] - (t2[c2] / 2 - n2[c2] / 2); break; case bi: i2[u2] = i2[u2] + (t2[c2] / 2 - n2[c2] / 2); break; } } return i2; } function Vu(e2, t2) { t2 === void 0 && (t2 = {}); var n2 = t2, a2 = n2.placement, o2 = a2 === void 0 ? e2.placement : a2, r2 = n2.boundary, l2 = r2 === void 0 ? gi : r2, s2 = n2.rootBoundary, i2 = s2 === void 0 ? yi : s2, u2 = n2.elementContext, c2 = u2 === void 0 ? wi : u2, d2 = n2.altBoundary, f2 = d2 === void 0 ? false : d2, v2 = n2.padding, p2 = v2 === void 0 ? 0 : v2, m2 = lu(typeof p2 != "number" ? p2 : su(p2, mi)), h2 = c2 === wi ? ki : wi, b2 = e2.rects.popper, g2 = e2.elements[f2 ? h2 : c2], y2 = Bu(Bi(g2) ? g2 : g2.contextElement || Ji(e2.elements.popper), l2, i2), w2 = Ui(e2.elements.reference), k2 = Ru({ reference: w2, element: b2, strategy: "absolute", placement: o2 }), x2 = Lu(Object.assign({}, b2, k2)), S2 = c2 === wi ? x2 : w2, C2 = { top: y2.top - S2.top + m2.top, bottom: S2.bottom - y2.bottom + m2.bottom, left: y2.left - S2.left + m2.left, right: S2.right - y2.right + m2.right }, _2 = e2.modifiersData.offset; if (c2 === wi && _2) { var M2 = _2[o2]; Object.keys(C2).forEach(function(e3) { var t3 = [fi, di].indexOf(e3) >= 0 ? 1 : -1, n3 = [ci, di].indexOf(e3) >= 0 ? "y" : "x"; C2[e3] += M2[n3] * t3; }); } return C2; } function Fu(e2, t2) { t2 === void 0 && (t2 = {}); var n2 = t2, a2 = n2.placement, o2 = n2.boundary, r2 = n2.rootBoundary, l2 = n2.padding, s2 = n2.flipVariations, i2 = n2.allowedAutoPlacements, u2 = i2 === void 0 ? Si : i2, c2 = fu(a2), d2 = c2 ? s2 ? xi : xi.filter(function(e3) { return fu(e3) === c2; }) : mi, f2 = d2.filter(function(e3) { return u2.indexOf(e3) >= 0; }); f2.length === 0 && (f2 = d2); var v2 = f2.reduce(function(t3, n3) { return t3[n3] = Vu(e2, { placement: n3, boundary: o2, rootBoundary: r2, padding: l2 })[Ni(n3)], t3; }, {}); return Object.keys(v2).sort(function(e3, t3) { return v2[e3] - v2[t3]; }); } function ju(e2) { if (Ni(e2) === pi) return []; var t2 = xu(e2); return [Cu(e2), t2, Cu(t2)]; } function zu(e2) { var t2 = e2.state, n2 = e2.options, a2 = e2.name; if (!t2.modifiersData[a2]._skip) { for (var o2 = n2.mainAxis, r2 = o2 === void 0 ? true : o2, l2 = n2.altAxis, s2 = l2 === void 0 ? true : l2, i2 = n2.fallbackPlacements, u2 = n2.padding, c2 = n2.boundary, d2 = n2.rootBoundary, f2 = n2.altBoundary, v2 = n2.flipVariations, p2 = v2 === void 0 ? true : v2, m2 = n2.allowedAutoPlacements, h2 = t2.options.placement, b2 = Ni(h2), g2 = b2 === h2, y2 = i2 || (g2 || !p2 ? [xu(h2)] : ju(h2)), w2 = [h2].concat(y2).reduce(function(e3, n3) { return e3.concat(Ni(n3) === pi ? Fu(t2, { placement: n3, boundary: c2, rootBoundary: d2, padding: u2, flipVariations: p2, allowedAutoPlacements: m2 }) : n3); }, []), k2 = t2.rects.reference, x2 = t2.rects.popper, S2 = /* @__PURE__ */ new Map(), C2 = true, _2 = w2[0], M2 = 0; M2 < w2.length; M2++) { var O2 = w2[M2], D2 = Ni(O2), A2 = fu(O2) === hi, E2 = [ci, di].indexOf(D2) >= 0, $2 = E2 ? "width" : "height", L2 = Vu(t2, { placement: O2, boundary: c2, rootBoundary: d2, altBoundary: f2, padding: u2 }), I2 = E2 ? A2 ? fi : vi : A2 ? di : ci; k2[$2] > x2[$2] && (I2 = xu(I2)); var T2 = xu(I2), P2 = []; if (r2 && P2.push(L2[D2] <= 0), s2 && P2.push(L2[I2] <= 0, L2[T2] <= 0), P2.every(function(e3) { return e3; })) { _2 = O2, C2 = false; break; } S2.set(O2, P2); } if (C2) for (var B2 = p2 ? 3 : 1, R2 = function(e3) { var t3 = w2.find(function(t4) { var n3 = S2.get(t4); if (n3) return n3.slice(0, e3).every(function(e4) { return e4; }); }); if (t3) return _2 = t3, "break"; }, V2 = B2; V2 > 0; V2--) { var F2 = R2(V2); if (F2 === "break") break; } t2.placement !== _2 && (t2.modifiersData[a2]._skip = true, t2.placement = _2, t2.reset = true); } } var Nu = { name: "flip", enabled: true, phase: "main", fn: zu, requiresIfExists: ["offset"], data: { _skip: false } }; function Hu(e2, t2, n2) { return n2 === void 0 && (n2 = { x: 0, y: 0 }), { top: e2.top - t2.height - n2.y, right: e2.right - t2.width + n2.x, bottom: e2.bottom - t2.height + n2.y, left: e2.left - t2.width - n2.x }; } function Yu(e2) { return [ci, fi, di, vi].some(function(t2) { return e2[t2] >= 0; }); } function Wu(e2) { var t2 = e2.state, n2 = e2.name, a2 = t2.rects.reference, o2 = t2.rects.popper, r2 = t2.modifiersData.preventOverflow, l2 = Vu(t2, { elementContext: "reference" }), s2 = Vu(t2, { altBoundary: true }), i2 = Hu(l2, a2), u2 = Hu(s2, o2, r2), c2 = Yu(i2), d2 = Yu(u2); t2.modifiersData[n2] = { referenceClippingOffsets: i2, popperEscapeOffsets: u2, isReferenceHidden: c2, hasPopperEscaped: d2 }, t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-reference-hidden": c2, "data-popper-escaped": d2 }); } var Uu = { name: "hide", enabled: true, phase: "main", requiresIfExists: ["preventOverflow"], fn: Wu }; function Ku(e2, t2, n2) { var a2 = Ni(e2), o2 = [vi, ci].indexOf(a2) >= 0 ? -1 : 1, r2 = typeof n2 == "function" ? n2(Object.assign({}, t2, { placement: e2 })) : n2, l2 = r2[0], s2 = r2[1]; return l2 = l2 || 0, s2 = (s2 || 0) * o2, [vi, fi].indexOf(a2) >= 0 ? { x: s2, y: l2 } : { x: l2, y: s2 }; } function qu(e2) { var t2 = e2.state, n2 = e2.options, a2 = e2.name, o2 = n2.offset, r2 = o2 === void 0 ? [0, 0] : o2, l2 = Si.reduce(function(e3, n3) { return e3[n3] = Ku(n3, t2.rects, r2), e3; }, {}), s2 = l2[t2.placement], i2 = s2.x, u2 = s2.y; t2.modifiersData.popperOffsets != null && (t2.modifiersData.popperOffsets.x += i2, t2.modifiersData.popperOffsets.y += u2), t2.modifiersData[a2] = l2; } var Gu = { name: "offset", enabled: true, phase: "main", requires: ["popperOffsets"], fn: qu }; function Zu(e2) { var t2 = e2.state, n2 = e2.name; t2.modifiersData[n2] = Ru({ reference: t2.rects.reference, element: t2.rects.popper, strategy: "absolute", placement: t2.placement }); } var Ju = { name: "popperOffsets", enabled: true, phase: "read", fn: Zu, data: {} }; function Xu(e2) { return e2 === "x" ? "y" : "x"; } function Qu(e2) { var t2 = e2.state, n2 = e2.options, a2 = e2.name, o2 = n2.mainAxis, r2 = o2 === void 0 ? true : o2, l2 = n2.altAxis, s2 = l2 === void 0 ? false : l2, i2 = n2.boundary, u2 = n2.rootBoundary, c2 = n2.altBoundary, d2 = n2.padding, f2 = n2.tether, v2 = f2 === void 0 ? true : f2, p2 = n2.tetherOffset, m2 = p2 === void 0 ? 0 : p2, h2 = Vu(t2, { boundary: i2, rootBoundary: u2, padding: d2, altBoundary: c2 }), b2 = Ni(t2.placement), g2 = fu(t2.placement), y2 = !g2, w2 = nu(b2), k2 = Xu(w2), x2 = t2.modifiersData.popperOffsets, S2 = t2.rects.reference, C2 = t2.rects.popper, _2 = typeof m2 == "function" ? m2(Object.assign({}, t2.rects, { placement: t2.placement })) : m2, M2 = typeof _2 == "number" ? { mainAxis: _2, altAxis: _2 } : Object.assign({ mainAxis: 0, altAxis: 0 }, _2), O2 = t2.modifiersData.offset ? t2.modifiersData.offset[t2.placement] : null, D2 = { x: 0, y: 0 }; if (x2) { if (r2) { var A2, E2 = w2 === "y" ? ci : vi, $2 = w2 === "y" ? di : fi, L2 = w2 === "y" ? "height" : "width", I2 = x2[w2], T2 = I2 + h2[E2], P2 = I2 - h2[$2], B2 = v2 ? -C2[L2] / 2 : 0, R2 = g2 === hi ? S2[L2] : C2[L2], V2 = g2 === hi ? -C2[L2] : -S2[L2], F2 = t2.elements.arrow, j2 = v2 && F2 ? Ki(F2) : { width: 0, height: 0 }, z2 = t2.modifiersData["arrow#persistent"] ? t2.modifiersData["arrow#persistent"].padding : ru(), N2 = z2[E2], H2 = z2[$2], Y2 = au(0, S2[L2], j2[L2]), W2 = y2 ? S2[L2] / 2 - B2 - Y2 - N2 - M2.mainAxis : R2 - Y2 - N2 - M2.mainAxis, U2 = y2 ? -S2[L2] / 2 + B2 + Y2 + H2 + M2.mainAxis : V2 + Y2 + H2 + M2.mainAxis, K2 = t2.elements.arrow && tu(t2.elements.arrow), q2 = K2 ? w2 === "y" ? K2.clientTop || 0 : K2.clientLeft || 0 : 0, G2 = (A2 = O2 == null ? void 0 : O2[w2]) != null ? A2 : 0, Z2 = I2 + W2 - G2 - q2, J2 = I2 + U2 - G2, X2 = au(v2 ? Yi(T2, Z2) : T2, I2, v2 ? Hi(P2, J2) : P2); x2[w2] = X2, D2[w2] = X2 - I2; } if (s2) { var Q2, ee2 = w2 === "x" ? ci : vi, te2 = w2 === "x" ? di : fi, ne2 = x2[k2], ae2 = k2 === "y" ? "height" : "width", oe2 = ne2 + h2[ee2], re2 = ne2 - h2[te2], le2 = [ci, vi].indexOf(b2) !== -1, se2 = (Q2 = O2 == null ? void 0 : O2[k2]) != null ? Q2 : 0, ie2 = le2 ? oe2 : ne2 - S2[ae2] - C2[ae2] - se2 + M2.altAxis, ue2 = le2 ? ne2 + S2[ae2] + C2[ae2] - se2 - M2.altAxis : re2, ce2 = v2 && le2 ? ou(ie2, ne2, ue2) : au(v2 ? ie2 : oe2, ne2, v2 ? ue2 : re2); x2[k2] = ce2, D2[k2] = ce2 - ne2; } t2.modifiersData[a2] = D2; } } var ec = { name: "preventOverflow", enabled: true, phase: "main", fn: Qu, requiresIfExists: ["offset"] }; function tc(e2) { return { scrollLeft: e2.scrollLeft, scrollTop: e2.scrollTop }; } function nc(e2) { return e2 === Pi(e2) || !Ri(e2) ? _u(e2) : tc(e2); } function ac(e2) { var t2 = e2.getBoundingClientRect(), n2 = Wi(t2.width) / e2.offsetWidth || 1, a2 = Wi(t2.height) / e2.offsetHeight || 1; return n2 !== 1 || a2 !== 1; } function oc(e2, t2, n2) { n2 === void 0 && (n2 = false); var a2 = Ri(t2), o2 = Ri(t2) && ac(t2), r2 = Ji(t2), l2 = Ui(e2, o2), s2 = { scrollLeft: 0, scrollTop: 0 }, i2 = { x: 0, y: 0 }; return (a2 || !a2 && !n2) && ((Ti(t2) !== "body" || Au(r2)) && (s2 = nc(t2)), Ri(t2) ? (i2 = Ui(t2, true), i2.x += t2.clientLeft, i2.y += t2.clientTop) : r2 && (i2.x = Mu(r2))), { x: l2.left + s2.scrollLeft - i2.x, y: l2.top + s2.scrollTop - i2.y, width: l2.width, height: l2.height }; } function rc(e2) { var t2 = /* @__PURE__ */ new Map(), n2 = /* @__PURE__ */ new Set(), a2 = []; e2.forEach(function(e3) { t2.set(e3.name, e3); }); function o2(e3) { n2.add(e3.name); var r2 = [].concat(e3.requires || [], e3.requiresIfExists || []); r2.forEach(function(e4) { if (!n2.has(e4)) { var a3 = t2.get(e4); a3 && o2(a3); } }), a2.push(e3); } return e2.forEach(function(e3) { n2.has(e3.name) || o2(e3); }), a2; } function lc(e2) { var t2 = rc(e2); return Ii.reduce(function(e3, n2) { return e3.concat(t2.filter(function(e4) { return e4.phase === n2; })); }, []); } function sc(e2) { var t2; return function() { return t2 || (t2 = new Promise(function(n2) { Promise.resolve().then(function() { t2 = void 0, n2(e2()); }); })), t2; }; } function ic(e2) { var t2 = e2.reduce(function(e3, t3) { var n2 = e3[t3.name]; return e3[t3.name] = n2 ? Object.assign({}, n2, t3, { options: Object.assign({}, n2.options, t3.options), data: Object.assign({}, n2.data, t3.data) }) : t3, e3; }, {}); return Object.keys(t2).map(function(e3) { return t2[e3]; }); } var uc = { placement: "bottom", modifiers: [], strategy: "absolute" }; function cc() { for (var e2 = arguments.length, t2 = new Array(e2), n2 = 0; n2 < e2; n2++) t2[n2] = arguments[n2]; return !t2.some(function(e3) { return !(e3 && typeof e3.getBoundingClientRect == "function"); }); } function dc(e2) { e2 === void 0 && (e2 = {}); var t2 = e2, n2 = t2.defaultModifiers, a2 = n2 === void 0 ? [] : n2, o2 = t2.defaultOptions, r2 = o2 === void 0 ? uc : o2; return function(e3, t3, n3) { n3 === void 0 && (n3 = r2); var o3 = { placement: "bottom", orderedModifiers: [], options: Object.assign({}, uc, r2), modifiersData: {}, elements: { reference: e3, popper: t3 }, attributes: {}, styles: {} }, l2 = [], s2 = false, i2 = { state: o3, setOptions: function(n4) { var l3 = typeof n4 == "function" ? n4(o3.options) : n4; c2(), o3.options = Object.assign({}, r2, o3.options, l3), o3.scrollParents = { reference: Bi(e3) ? $u(e3) : e3.contextElement ? $u(e3.contextElement) : [], popper: $u(t3) }; var s3 = lc(ic([].concat(a2, o3.options.modifiers))); return o3.orderedModifiers = s3.filter(function(e4) { return e4.enabled; }), u2(), i2.update(); }, forceUpdate: function() { if (!s2) { var e4 = o3.elements, t4 = e4.reference, n4 = e4.popper; if (cc(t4, n4)) { o3.rects = { reference: oc(t4, tu(n4), o3.options.strategy === "fixed"), popper: Ki(n4) }, o3.reset = false, o3.placement = o3.options.placement, o3.orderedModifiers.forEach(function(e5) { return o3.modifiersData[e5.name] = Object.assign({}, e5.data); }); for (var a3 = 0; a3 < o3.orderedModifiers.length; a3++) { if (o3.reset === true) { o3.reset = false, a3 = -1; continue; } var r3 = o3.orderedModifiers[a3], l3 = r3.fn, u3 = r3.options, c3 = u3 === void 0 ? {} : u3, d2 = r3.name; typeof l3 == "function" && (o3 = l3({ state: o3, options: c3, name: d2, instance: i2 }) || o3); } } } }, update: sc(function() { return new Promise(function(e4) { i2.forceUpdate(), e4(o3); }); }), destroy: function() { c2(), s2 = true; } }; if (!cc(e3, t3)) return i2; i2.setOptions(n3).then(function(e4) { !s2 && n3.onFirstUpdate && n3.onFirstUpdate(e4); }); function u2() { o3.orderedModifiers.forEach(function(e4) { var t4 = e4.name, n4 = e4.options, a3 = n4 === void 0 ? {} : n4, r3 = e4.effect; if (typeof r3 == "function") { var s3 = r3({ state: o3, name: t4, instance: i2, options: a3 }), u3 = function() { }; l2.push(s3 || u3); } }); } function c2() { l2.forEach(function(e4) { return e4(); }), l2 = []; } return i2; }; } dc(); var fc = [wu, Ju, bu, zi]; dc({ defaultModifiers: fc }); var vc = [wu, Ju, bu, zi, Gu, Nu, ec, du, Uu], pc = dc({ defaultModifiers: vc }); const mc = (e2, t2, n2 = {}) => { const a2 = { name: "updateState", enabled: true, phase: "write", fn: ({ state: e3 }) => { const t3 = hc(e3); Object.assign(u2.value, t3); }, requires: ["computeStyles"] }; const o2 = vue.computed(() => { const { onFirstUpdate: e3, placement: t3, strategy: o3, modifiers: r2 } = vue.unref(n2); return { onFirstUpdate: e3, placement: t3 || "bottom", strategy: o3 || "absolute", modifiers: [...r2 || [], a2, { name: "applyStyles", enabled: false }] }; }); const l2 = vue.shallowRef(); const u2 = vue.ref({ styles: { popper: { position: vue.unref(o2).strategy, left: "0", top: "0" }, arrow: { position: "absolute" } }, attributes: {} }); const c2 = () => { if (!l2.value) return; l2.value.destroy(); l2.value = void 0; }; vue.watch(o2, (e3) => { const t3 = vue.unref(l2); if (t3) { t3.setOptions(e3); } }, { deep: true }); vue.watch([e2, t2], ([e3, t3]) => { c2(); if (!e3 || !t3) return; l2.value = pc(e3, t3, vue.unref(o2)); }); vue.onBeforeUnmount(() => { c2(); }); return { state: vue.computed(() => { var e3; return { ...((e3 = vue.unref(l2)) == null ? void 0 : e3.state) || {} }; }), styles: vue.computed(() => vue.unref(u2).styles), attributes: vue.computed(() => vue.unref(u2).attributes), update: () => { var e3; return (e3 = vue.unref(l2)) == null ? void 0 : e3.update(); }, forceUpdate: () => { var e3; return (e3 = vue.unref(l2)) == null ? void 0 : e3.forceUpdate(); }, instanceRef: vue.computed(() => vue.unref(l2)) }; }; function hc(e2) { const t2 = Object.keys(e2.elements); const n2 = bl(t2.map((t3) => [t3, e2.styles[t3] || {}])); const a2 = bl(t2.map((t3) => [t3, e2.attributes[t3]])); return { styles: n2, attributes: a2 }; } const bc = (e2) => { if (!e2) { return { onClick: Xe, onMousedown: Xe, onMouseup: Xe }; } let t2 = false; let n2 = false; const a2 = (a3) => { if (t2 && n2) { e2(a3); } t2 = n2 = false; }; const o2 = (e3) => { t2 = e3.target === e3.currentTarget; }; const r2 = (e3) => { n2 = e3.target === e3.currentTarget; }; return { onClick: a2, onMousedown: o2, onMouseup: r2 }; }; function gc() { let e2; const t2 = (t3, a2) => { n2(); e2 = window.setTimeout(t3, a2); }; const n2 = () => window.clearTimeout(e2); Oe(() => n2()); return { registerTimeout: t2, cancelTimeout: n2 }; } const yc = { prefix: Math.floor(Math.random() * 1e4), current: 0 }; const wc = Symbol("elIdInjection"); const kc = () => vue.getCurrentInstance() ? vue.inject(wc, yc) : yc; const xc = (e2) => { const t2 = kc(); const n2 = ai(); const a2 = vue.computed(() => vue.unref(e2) || `${n2.value}-id-${t2.prefix}-${t2.current++}`); return a2; }; let Sc = []; const Cc = (e2) => { const t2 = e2; if (t2.key === $s.esc) { Sc.forEach((e3) => e3(t2)); } }; const _c = (e2) => { vue.onMounted(() => { if (Sc.length === 0) { document.addEventListener("keydown", Cc); } if (ke) Sc.push(e2); }); vue.onBeforeUnmount(() => { Sc = Sc.filter((t2) => t2 !== e2); if (Sc.length === 0) { if (ke) document.removeEventListener("keydown", Cc); } }); }; let Mc; const Oc = () => { const e2 = ai(); const t2 = kc(); const n2 = vue.computed(() => `${e2.value}-popper-container-${t2.prefix}`); const a2 = vue.computed(() => `#${n2.value}`); return { id: n2, selector: a2 }; }; const Dc = (e2) => { const t2 = document.createElement("div"); t2.id = e2; document.body.appendChild(t2); return t2; }; const Ac = () => { const { id: e2, selector: t2 } = Oc(); vue.onBeforeMount(() => { if (!ke) return; if (!Mc && !document.body.querySelector(t2.value)) { Mc = Dc(e2.value); } }); return { id: e2, selector: t2 }; }; const Ec = Cs({ showAfter: { type: Number, default: 0 }, hideAfter: { type: Number, default: 200 }, autoClose: { type: Number, default: 0 } }); const $c = ({ showAfter: e2, hideAfter: t2, autoClose: n2, open: a2, close: o2 }) => { const { registerTimeout: r2 } = gc(); const { registerTimeout: l2, cancelTimeout: s2 } = gc(); const u2 = (t3) => { r2(() => { a2(t3); const e3 = vue.unref(n2); if (Ol(e3) && e3 > 0) { l2(() => { o2(t3); }, e3); } }, vue.unref(e2)); }; const c2 = (e3) => { s2(); r2(() => { o2(e3); }, vue.unref(t2)); }; return { onOpen: u2, onClose: c2 }; }; const Lc = Symbol("elForwardRef"); const Ic = (e2) => { const t2 = (t3) => { e2.value = t3; }; vue.provide(Lc, { setForwardRef: t2 }); }; const Tc = (e2) => ({ mounted(t2) { e2(t2); }, updated(t2) { e2(t2); }, unmounted() { e2(null); } }); const Pc = { current: 0 }; const Bc = vue.ref(0); const Rc = 2e3; const Vc = Symbol("elZIndexContextKey"); const Fc = Symbol("zIndexContextKey"); const jc = (e2) => { const t2 = vue.getCurrentInstance() ? vue.inject(Vc, Pc) : Pc; const n2 = e2 || (vue.getCurrentInstance() ? vue.inject(Fc, void 0) : void 0); const a2 = vue.computed(() => { const e3 = vue.unref(n2); return Ol(e3) ? e3 : Rc; }); const o2 = vue.computed(() => a2.value + Bc.value); const s2 = () => { t2.current++; Bc.value = t2.current; return o2.value; }; if (!ke && !vue.inject(Vc)) ; return { initialZIndex: a2, currentZIndex: o2, nextZIndex: s2 }; }; function zc(e2) { const t2 = vue.ref(); function n2() { if (e2.value == void 0) return; const { selectionStart: n3, selectionEnd: a3, value: o2 } = e2.value; if (n3 == null || a3 == null) return; const r2 = o2.slice(0, Math.max(0, n3)); const l2 = o2.slice(Math.max(0, a3)); t2.value = { selectionStart: n3, selectionEnd: a3, value: o2, beforeTxt: r2, afterTxt: l2 }; } function a2() { if (e2.value == void 0 || t2.value == void 0) return; const { value: n3 } = e2.value; const { beforeTxt: a3, afterTxt: o2, selectionStart: r2 } = t2.value; if (a3 == void 0 || o2 == void 0 || r2 == void 0) return; let l2 = n3.length; if (n3.endsWith(o2)) { l2 = n3.length - o2.length; } else if (n3.startsWith(a3)) { l2 = a3.length; } else { const e3 = a3[r2 - 1]; const t3 = n3.indexOf(e3, r2 - 1); if (t3 !== -1) { l2 = t3 + 1; } } e2.value.setSelectionRange(l2, l2); } return [n2, a2]; } const Nc = Ss({ type: String, values: Bs, required: false }); const Hc = Symbol("size"); const Yc = () => { const e2 = vue.inject(Hc, {}); return vue.computed(() => vue.unref(e2.size) || ""); }; function Wc(e2, { afterFocus: t2, beforeBlur: n2, afterBlur: a2 } = {}) { const o2 = vue.getCurrentInstance(); const { emit: r2 } = o2; const i2 = vue.shallowRef(); const u2 = vue.ref(false); const c2 = (e3) => { if (u2.value) return; u2.value = true; r2("focus", e3); t2 == null ? void 0 : t2(); }; const d2 = (e3) => { var t3; const o3 = at(n2) ? n2(e3) : false; if (o3 || e3.relatedTarget && ((t3 = i2.value) == null ? void 0 : t3.contains(e3.relatedTarget))) return; u2.value = false; r2("blur", e3); a2 == null ? void 0 : a2(); }; const f2 = () => { var t3; (t3 = e2.value) == null ? void 0 : t3.focus(); }; vue.watch(i2, (e3) => { if (e3) { e3.setAttribute("tabindex", "-1"); } }); Le(i2, "click", f2); return { wrapperRef: i2, isFocused: u2, handleFocus: c2, handleBlur: d2 }; } const Uc = ["", void 0, null]; const Kc = Cs({ emptyValues: Array, valueOnClear: { type: [String, Number, Boolean, Function], default: void 0, validator: (e2) => at(e2) ? !e2() : !e2 } }); const qc = (e2, t2) => { let n2 = Qc(); if (!n2.value) { n2 = vue.ref({}); } const a2 = vue.computed(() => e2.emptyValues || n2.value.emptyValues || Uc); const o2 = vue.computed(() => { if (at(e2.valueOnClear)) { return e2.valueOnClear(); } else if (e2.valueOnClear !== void 0) { return e2.valueOnClear; } else if (at(n2.value.valueOnClear)) { return n2.value.valueOnClear(); } else if (n2.value.valueOnClear !== void 0) { return n2.value.valueOnClear; } return t2; }); const l2 = (e3) => a2.value.includes(e3); if (!a2.value.includes(o2.value)) ; return { emptyValues: a2, valueOnClear: o2, isEmptyValue: l2 }; }; const Gc = Cs({ ariaLabel: String, ariaOrientation: { type: String, values: ["horizontal", "vertical", "undefined"] }, ariaControls: String }); const Zc = (e2) => Cl(Gc, e2); const Jc = Symbol(); const Xc = vue.ref(); function Qc(e2, t2 = void 0) { const n2 = vue.getCurrentInstance() ? vue.inject(Jc, Xc) : Xc; if (e2) { return vue.computed(() => { var a2, o2; return (o2 = (a2 = n2.value) == null ? void 0 : a2[e2]) != null ? o2 : t2; }); } else { return n2; } } function ed(e2, t2) { const n2 = Qc(); const a2 = oi(e2, vue.computed(() => { var e3; return ((e3 = n2.value) == null ? void 0 : e3.namespace) || Qs; })); const o2 = Xs(vue.computed(() => { var e3; return (e3 = n2.value) == null ? void 0 : e3.locale; })); const l2 = jc(vue.computed(() => { var e3; return ((e3 = n2.value) == null ? void 0 : e3.zIndex) || Rc; })); const s2 = vue.computed(() => { var e3; return vue.unref(t2) || ((e3 = n2.value) == null ? void 0 : e3.size) || ""; }); td(vue.computed(() => vue.unref(n2) || {})); return { ns: a2, locale: o2, zIndex: l2, size: s2 }; } const td = (e2, t2, n2 = false) => { var a2; const o2 = !!vue.getCurrentInstance(); const s2 = o2 ? Qc() : void 0; const u2 = (a2 = void 0) != null ? a2 : o2 ? vue.provide : void 0; if (!u2) { return; } const c2 = vue.computed(() => { const t3 = vue.unref(e2); if (!(s2 == null ? void 0 : s2.value)) return t3; return nd(s2.value, t3); }); u2(Jc, c2); u2(Js, vue.computed(() => c2.value.locale)); u2(ni, vue.computed(() => c2.value.namespace)); u2(Fc, vue.computed(() => c2.value.zIndex)); u2(Hc, { size: vue.computed(() => c2.value.size || "") }); if (n2 || !Xc.value) { Xc.value = c2.value; } return c2; }; const nd = (e2, t2) => { const n2 = [.../* @__PURE__ */ new Set([...Ll(e2), ...Ll(t2)])]; const a2 = {}; for (const o2 of n2) { a2[o2] = t2[o2] !== void 0 ? t2[o2] : e2[o2]; } return a2; }; var ad = (e2, t2) => { const n2 = e2.__vccOpts || e2; for (const [e3, a2] of t2) { n2[e3] = a2; } return n2; }; const od = Cs({ size: { type: ks([Number, String]) }, color: { type: String } }); const rd = vue.defineComponent({ name: "ElIcon", inheritAttrs: false }); const ld = vue.defineComponent({ ...rd, props: od, setup(e2) { const a2 = e2; const o2 = oi("icon"); const l2 = vue.computed(() => { const { size: e3, color: t2 } = a2; if (!e3 && !t2) return {}; return { fontSize: _l(e3) ? void 0 : zl(e3), "--color": t2 }; }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("i", vue.mergeProps({ class: vue.unref(o2).b(), style: vue.unref(l2) }, e3.$attrs), [vue.renderSlot(e3.$slots, "default")], 16)); } }); var sd = ad(ld, [["__file", "icon.vue"]]); const id = Ds(sd); const ud = Symbol("formContextKey"); const cd = Symbol("formItemContextKey"); const dd = (e2, t2 = {}) => { const n2 = vue.ref(void 0); const a2 = t2.prop ? n2 : ui("size"); const o2 = t2.global ? n2 : Yc(); const l2 = t2.form ? { size: void 0 } : vue.inject(ud, void 0); const s2 = t2.formItem ? { size: void 0 } : vue.inject(cd, void 0); return vue.computed(() => a2.value || vue.unref(e2) || (s2 == null ? void 0 : s2.size) || (l2 == null ? void 0 : l2.size) || o2.value || ""); }; const fd = (e2) => { const t2 = ui("disabled"); const n2 = vue.inject(ud, void 0); return vue.computed(() => t2.value || vue.unref(e2) || (n2 == null ? void 0 : n2.disabled) || false); }; const vd = () => { const e2 = vue.inject(ud, void 0); const t2 = vue.inject(cd, void 0); return { form: e2, formItem: t2 }; }; const pd = (e2, { formItemContext: t2, disableIdGeneration: n2, disableIdManagement: a2 }) => { if (!n2) { n2 = vue.ref(false); } if (!a2) { a2 = vue.ref(false); } const o2 = vue.ref(); let l2 = void 0; const i2 = vue.computed(() => { var n3; return !!(!(e2.label || e2.ariaLabel) && t2 && t2.inputIds && ((n3 = t2.inputIds) == null ? void 0 : n3.length) <= 1); }); vue.onMounted(() => { l2 = vue.watch([vue.toRef(e2, "id"), n2], ([e3, n3]) => { const r2 = e3 != null ? e3 : !n3 ? xc().value : void 0; if (r2 !== o2.value) { if (t2 == null ? void 0 : t2.removeInputId) { o2.value && t2.removeInputId(o2.value); if (!(a2 == null ? void 0 : a2.value) && !n3 && r2) { t2.addInputId(r2); } } o2.value = r2; } }, { immediate: true }); }); vue.onUnmounted(() => { l2 && l2(); if (t2 == null ? void 0 : t2.removeInputId) { o2.value && t2.removeInputId(o2.value); } }); return { isLabeledByFormItem: i2, inputId: o2 }; }; let md = void 0; const hd = ` height:0 !important; visibility:hidden !important; ${Je() ? "" : "overflow:hidden !important;"} position:absolute !important; z-index:-1000 !important; top:0 !important; right:0 !important; `; const bd = ["letter-spacing", "line-height", "padding-top", "padding-bottom", "font-family", "font-weight", "font-size", "text-rendering", "text-transform", "width", "text-indent", "padding-left", "padding-right", "border-width", "box-sizing"]; function gd(e2) { const t2 = window.getComputedStyle(e2); const n2 = t2.getPropertyValue("box-sizing"); const a2 = Number.parseFloat(t2.getPropertyValue("padding-bottom")) + Number.parseFloat(t2.getPropertyValue("padding-top")); const o2 = Number.parseFloat(t2.getPropertyValue("border-bottom-width")) + Number.parseFloat(t2.getPropertyValue("border-top-width")); const r2 = bd.map((e3) => `${e3}:${t2.getPropertyValue(e3)}`).join(";"); return { contextStyle: r2, paddingSize: a2, borderSize: o2, boxSizing: n2 }; } function yd(e2, t2 = 1, n2) { var a2; if (!md) { md = document.createElement("textarea"); document.body.appendChild(md); } const { paddingSize: o2, borderSize: r2, boxSizing: l2, contextStyle: s2 } = gd(e2); md.setAttribute("style", `${s2};${hd}`); md.value = e2.value || e2.placeholder || ""; let i2 = md.scrollHeight; const u2 = {}; if (l2 === "border-box") { i2 = i2 + r2; } else if (l2 === "content-box") { i2 = i2 - o2; } md.value = ""; const c2 = md.scrollHeight - o2; if (Ol(t2)) { let e3 = c2 * t2; if (l2 === "border-box") { e3 = e3 + o2 + r2; } i2 = Math.max(e3, i2); u2.minHeight = `${e3}px`; } if (Ol(n2)) { let e3 = c2 * n2; if (l2 === "border-box") { e3 = e3 + o2 + r2; } i2 = Math.min(e3, i2); } u2.height = `${i2}px`; (a2 = md.parentNode) == null ? void 0 : a2.removeChild(md); md = void 0; return u2; } const wd = Cs({ id: { type: String, default: void 0 }, size: Nc, disabled: Boolean, modelValue: { type: ks([String, Number, Object]), default: "" }, maxlength: { type: [String, Number] }, minlength: { type: [String, Number] }, type: { type: String, default: "text" }, resize: { type: String, values: ["none", "both", "horizontal", "vertical"] }, autosize: { type: ks([Boolean, Object]), default: false }, autocomplete: { type: String, default: "off" }, formatter: { type: Function }, parser: { type: Function }, placeholder: { type: String }, form: { type: String }, readonly: { type: Boolean, default: false }, clearable: { type: Boolean, default: false }, showPassword: { type: Boolean, default: false }, showWordLimit: { type: Boolean, default: false }, suffixIcon: { type: _s }, prefixIcon: { type: _s }, containerRole: { type: String, default: void 0 }, label: { type: String, default: void 0 }, tabindex: { type: [String, Number], default: 0 }, validateEvent: { type: Boolean, default: true }, inputStyle: { type: ks([Object, Array, String]), default: () => zs({}) }, autofocus: { type: Boolean, default: false }, ...Zc(["ariaLabel"]) }); const kd = { [Is]: (e2) => ot(e2), input: (e2) => ot(e2), change: (e2) => ot(e2), focus: (e2) => e2 instanceof FocusEvent, blur: (e2) => e2 instanceof FocusEvent, clear: () => true, mouseleave: (e2) => e2 instanceof MouseEvent, mouseenter: (e2) => e2 instanceof MouseEvent, keydown: (e2) => e2 instanceof Event, compositionstart: (e2) => e2 instanceof CompositionEvent, compositionupdate: (e2) => e2 instanceof CompositionEvent, compositionend: (e2) => e2 instanceof CompositionEvent }; const xd = ["role"]; const Sd = ["id", "minlength", "maxlength", "type", "disabled", "readonly", "autocomplete", "tabindex", "aria-label", "placeholder", "form", "autofocus"]; const Cd = ["id", "minlength", "maxlength", "tabindex", "disabled", "readonly", "autocomplete", "aria-label", "placeholder", "form", "autofocus"]; const _d = vue.defineComponent({ name: "ElInput", inheritAttrs: false }); const Md = vue.defineComponent({ ..._d, props: wd, emits: kd, setup(e2, { expose: o2, emit: l2 }) { const c2 = e2; const d2 = vue.useAttrs(); const f2 = vue.useSlots(); const p2 = vue.computed(() => { const e3 = {}; if (c2.containerRole === "combobox") { e3["aria-haspopup"] = d2["aria-haspopup"]; e3["aria-owns"] = d2["aria-owns"]; e3["aria-expanded"] = d2["aria-expanded"]; } return e3; }); const m2 = vue.computed(() => [c2.type === "textarea" ? z2.b() : j2.b(), j2.m(V2.value), j2.is("disabled", F2.value), j2.is("exceed", de2.value), { [j2.b("group")]: f2.prepend || f2.append, [j2.bm("group", "append")]: f2.append, [j2.bm("group", "prepend")]: f2.prepend, [j2.m("prefix")]: f2.prefix || c2.prefixIcon, [j2.m("suffix")]: f2.suffix || c2.suffixIcon || c2.clearable || c2.showPassword, [j2.bm("suffix", "password-clear")]: se2.value && ie2.value, [j2.b("hidden")]: c2.type === "hidden" }, d2.class]); const b2 = vue.computed(() => [j2.e("wrapper"), j2.is("focus", J2.value)]); const g2 = Ys({ excludeKeys: vue.computed(() => Object.keys(p2.value)) }); const { form: x2, formItem: B2 } = vd(); const { inputId: R2 } = pd(c2, { formItemContext: B2 }); const V2 = dd(); const F2 = fd(); const j2 = oi("input"); const z2 = oi("textarea"); const N2 = vue.shallowRef(); const H2 = vue.shallowRef(); const Y2 = vue.ref(false); const W2 = vue.ref(false); const U2 = vue.ref(false); const K2 = vue.ref(); const q2 = vue.shallowRef(c2.inputStyle); const G2 = vue.computed(() => N2.value || H2.value); const { wrapperRef: Z2, isFocused: J2, handleFocus: X2, handleBlur: Q2 } = Wc(G2, { afterBlur() { var e3; if (c2.validateEvent) { (e3 = B2 == null ? void 0 : B2.validate) == null ? void 0 : e3.call(B2, "blur").catch((e4) => Pl()); } } }); const ee2 = vue.computed(() => { var e3; return (e3 = x2 == null ? void 0 : x2.statusIcon) != null ? e3 : false; }); const te2 = vue.computed(() => (B2 == null ? void 0 : B2.validateState) || ""); const ne2 = vue.computed(() => te2.value && Os[te2.value]); const ae2 = vue.computed(() => U2.value ? ys : vs); const oe2 = vue.computed(() => [d2.style]); const re2 = vue.computed(() => [c2.inputStyle, q2.value, { resize: c2.resize }]); const le2 = vue.computed(() => yl(c2.modelValue) ? "" : String(c2.modelValue)); const se2 = vue.computed(() => c2.clearable && !F2.value && !c2.readonly && !!le2.value && (J2.value || Y2.value)); const ie2 = vue.computed(() => c2.showPassword && !F2.value && !c2.readonly && !!le2.value && (!!le2.value || J2.value)); const ue2 = vue.computed(() => c2.showWordLimit && !!c2.maxlength && (c2.type === "text" || c2.type === "textarea") && !F2.value && !c2.readonly && !c2.showPassword); const ce2 = vue.computed(() => le2.value.length); const de2 = vue.computed(() => !!ue2.value && ce2.value > Number(c2.maxlength)); const fe2 = vue.computed(() => !!f2.suffix || !!c2.suffixIcon || se2.value || c2.showPassword || ue2.value || !!te2.value && ee2.value); const [ve2, pe2] = zc(N2); Ne(H2, (e3) => { be2(); if (!ue2.value || c2.resize !== "both") return; const t2 = e3[0]; const { width: n2 } = t2.contentRect; K2.value = { right: `calc(100% - ${n2 + 15 + 6}px)` }; }); const me2 = () => { const { type: e3, autosize: t2 } = c2; if (!ke || e3 !== "textarea" || !H2.value) return; if (t2) { const e4 = rt(t2) ? t2.minRows : void 0; const n2 = rt(t2) ? t2.maxRows : void 0; const a2 = yd(H2.value, e4, n2); q2.value = { overflowY: "hidden", ...a2 }; vue.nextTick(() => { H2.value.offsetHeight; q2.value = a2; }); } else { q2.value = { minHeight: yd(H2.value).minHeight }; } }; const he2 = (e3) => { let t2 = false; return () => { var n2; if (t2 || !c2.autosize) return; const a2 = ((n2 = H2.value) == null ? void 0 : n2.offsetParent) === null; if (!a2) { e3(); t2 = true; } }; }; const be2 = he2(me2); const ge2 = () => { const e3 = G2.value; const t2 = c2.formatter ? c2.formatter(le2.value) : le2.value; if (!e3 || e3.value === t2) return; e3.value = t2; }; const ye2 = async (e3) => { ve2(); let { value: t2 } = e3.target; if (c2.formatter) { t2 = c2.parser ? c2.parser(t2) : t2; } if (W2.value) return; if (t2 === le2.value) { ge2(); return; } l2(Is, t2); l2("input", t2); await vue.nextTick(); ge2(); pe2(); }; const we2 = (e3) => { l2("change", e3.target.value); }; const xe2 = (e3) => { l2("compositionstart", e3); W2.value = true; }; const Se2 = (e3) => { var t2; l2("compositionupdate", e3); const n2 = (t2 = e3.target) == null ? void 0 : t2.value; const a2 = n2[n2.length - 1] || ""; W2.value = !js(a2); }; const Ce2 = (e3) => { l2("compositionend", e3); if (W2.value) { W2.value = false; ye2(e3); } }; const _e2 = () => { U2.value = !U2.value; Me2(); }; const Me2 = async () => { var e3; await vue.nextTick(); (e3 = G2.value) == null ? void 0 : e3.focus(); }; const Oe2 = () => { var e3; return (e3 = G2.value) == null ? void 0 : e3.blur(); }; const De2 = (e3) => { Y2.value = false; l2("mouseleave", e3); }; const Ae2 = (e3) => { Y2.value = true; l2("mouseenter", e3); }; const Ee2 = (e3) => { l2("keydown", e3); }; const $e2 = () => { var e3; (e3 = G2.value) == null ? void 0 : e3.select(); }; const Le2 = () => { l2(Is, ""); l2("change", ""); l2("clear"); l2("input", ""); }; vue.watch(() => c2.modelValue, () => { var e3; vue.nextTick(() => me2()); if (c2.validateEvent) { (e3 = B2 == null ? void 0 : B2.validate) == null ? void 0 : e3.call(B2, "change").catch((e4) => Pl()); } }); vue.watch(le2, () => ge2()); vue.watch(() => c2.type, async () => { await vue.nextTick(); ge2(); me2(); }); vue.onMounted(() => { if (!c2.formatter && c2.parser) ; ge2(); vue.nextTick(me2); }); Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-input", ref: "https://element-plus.org/en-US/component/input.html" }, vue.computed(() => !!c2.label)); o2({ input: N2, textarea: H2, ref: G2, textareaStyle: re2, autosize: vue.toRef(c2, "autosize"), focus: Me2, blur: Oe2, select: $e2, clear: Le2, resizeTextarea: me2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", vue.mergeProps(vue.unref(p2), { class: vue.unref(m2), style: vue.unref(oe2), role: e3.containerRole, onMouseenter: Ae2, onMouseleave: De2 }), [vue.createCommentVNode(" input "), e3.type !== "textarea" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createCommentVNode(" prepend slot "), e3.$slots.prepend ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(j2).be("group", "prepend")) }, [vue.renderSlot(e3.$slots, "prepend")], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { ref_key: "wrapperRef", ref: Z2, class: vue.normalizeClass(vue.unref(b2)) }, [vue.createCommentVNode(" prefix slot "), e3.$slots.prefix || e3.prefixIcon ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(j2).e("prefix")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(j2).e("prefix-inner")) }, [vue.renderSlot(e3.$slots, "prefix"), e3.prefixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(j2).e("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.prefixIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 2)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", vue.mergeProps({ id: vue.unref(R2), ref_key: "input", ref: N2, class: vue.unref(j2).e("inner") }, vue.unref(g2), { minlength: e3.minlength, maxlength: e3.maxlength, type: e3.showPassword ? U2.value ? "text" : "password" : e3.type, disabled: vue.unref(F2), readonly: e3.readonly, autocomplete: e3.autocomplete, tabindex: e3.tabindex, "aria-label": e3.label || e3.ariaLabel, placeholder: e3.placeholder, style: e3.inputStyle, form: e3.form, autofocus: e3.autofocus, onCompositionstart: xe2, onCompositionupdate: Se2, onCompositionend: Ce2, onInput: ye2, onFocus: o3[0] || (o3[0] = (...e4) => vue.unref(X2) && vue.unref(X2)(...e4)), onBlur: o3[1] || (o3[1] = (...e4) => vue.unref(Q2) && vue.unref(Q2)(...e4)), onChange: we2, onKeydown: Ee2 }), null, 16, Sd), vue.createCommentVNode(" suffix slot "), vue.unref(fe2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(j2).e("suffix")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(j2).e("suffix-inner")) }, [!vue.unref(se2) || !vue.unref(ie2) || !vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.renderSlot(e3.$slots, "suffix"), e3.suffixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(j2).e("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.suffixIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 64)) : vue.createCommentVNode("v-if", true), vue.unref(se2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 1, class: vue.normalizeClass([vue.unref(j2).e("icon"), vue.unref(j2).e("clear")]), onMousedown: vue.withModifiers(vue.unref(Xe), ["prevent"]), onClick: Le2 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(as))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.unref(ie2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 2, class: vue.normalizeClass([vue.unref(j2).e("icon"), vue.unref(j2).e("password")]), onClick: _e2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ae2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 3, class: vue.normalizeClass(vue.unref(j2).e("count")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(j2).e("count-inner")) }, vue.toDisplayString(vue.unref(ce2)) + " / " + vue.toDisplayString(e3.maxlength), 3)], 2)) : vue.createCommentVNode("v-if", true), vue.unref(te2) && vue.unref(ne2) && vue.unref(ee2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 4, class: vue.normalizeClass([vue.unref(j2).e("icon"), vue.unref(j2).e("validateIcon"), vue.unref(j2).is("loading", vue.unref(te2) === "validating")]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ne2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 2)], 2)) : vue.createCommentVNode("v-if", true)], 2), vue.createCommentVNode(" append slot "), e3.$slots.append ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass(vue.unref(j2).be("group", "append")) }, [vue.renderSlot(e3.$slots, "append")], 2)) : vue.createCommentVNode("v-if", true)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createCommentVNode(" textarea "), vue.createElementVNode("textarea", vue.mergeProps({ id: vue.unref(R2), ref_key: "textarea", ref: H2, class: [vue.unref(z2).e("inner"), vue.unref(j2).is("focus", vue.unref(J2))] }, vue.unref(g2), { minlength: e3.minlength, maxlength: e3.maxlength, tabindex: e3.tabindex, disabled: vue.unref(F2), readonly: e3.readonly, autocomplete: e3.autocomplete, style: vue.unref(re2), "aria-label": e3.label || e3.ariaLabel, placeholder: e3.placeholder, form: e3.form, autofocus: e3.autofocus, onCompositionstart: xe2, onCompositionupdate: Se2, onCompositionend: Ce2, onInput: ye2, onFocus: o3[2] || (o3[2] = (...e4) => vue.unref(X2) && vue.unref(X2)(...e4)), onBlur: o3[3] || (o3[3] = (...e4) => vue.unref(Q2) && vue.unref(Q2)(...e4)), onChange: we2, onKeydown: Ee2 }), null, 16, Cd), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, style: vue.normalizeStyle(K2.value), class: vue.normalizeClass(vue.unref(j2).e("count")) }, vue.toDisplayString(vue.unref(ce2)) + " / " + vue.toDisplayString(e3.maxlength), 7)) : vue.createCommentVNode("v-if", true)], 64))], 16, xd)); } }); var Od = ad(Md, [["__file", "input.vue"]]); const Dd = Ds(Od); const Ad = 4; const Ed = { vertical: { offset: "offsetHeight", scroll: "scrollTop", scrollSize: "scrollHeight", size: "height", key: "vertical", axis: "Y", client: "clientY", direction: "top" }, horizontal: { offset: "offsetWidth", scroll: "scrollLeft", scrollSize: "scrollWidth", size: "width", key: "horizontal", axis: "X", client: "clientX", direction: "left" } }; const $d = ({ move: e2, size: t2, bar: n2 }) => ({ [n2.size]: t2, transform: `translate${n2.axis}(${e2}%)` }); const Ld = Symbol("scrollbarContextKey"); const Id = Cs({ vertical: Boolean, size: String, move: Number, ratio: { type: Number, required: true }, always: Boolean }); const Td = "Thumb"; const Pd = vue.defineComponent({ __name: "thumb", props: Id, setup(e2) { const n2 = e2; const o2 = vue.inject(Ld); const l2 = oi("scrollbar"); if (!o2) Tl(Td, "can not inject scrollbar context"); const s2 = vue.ref(); const u2 = vue.ref(); const c2 = vue.ref({}); const p2 = vue.ref(false); let m2 = false; let h2 = false; let b2 = ke ? document.onselectstart : null; const g2 = vue.computed(() => Ed[n2.vertical ? "vertical" : "horizontal"]); const y2 = vue.computed(() => $d({ size: n2.size, move: n2.move, bar: g2.value })); const w2 = vue.computed(() => s2.value[g2.value.offset] ** 2 / o2.wrapElement[g2.value.scrollSize] / n2.ratio / u2.value[g2.value.offset]); const x2 = (e3) => { var t2; e3.stopPropagation(); if (e3.ctrlKey || [1, 2].includes(e3.button)) return; (t2 = window.getSelection()) == null ? void 0 : t2.removeAllRanges(); C2(e3); const n3 = e3.currentTarget; if (!n3) return; c2.value[g2.value.axis] = n3[g2.value.offset] - (e3[g2.value.client] - n3.getBoundingClientRect()[g2.value.direction]); }; const S2 = (e3) => { if (!u2.value || !s2.value || !o2.wrapElement) return; const t2 = Math.abs(e3.target.getBoundingClientRect()[g2.value.direction] - e3[g2.value.client]); const n3 = u2.value[g2.value.offset] / 2; const a2 = (t2 - n3) * 100 * w2.value / s2.value[g2.value.offset]; o2.wrapElement[g2.value.scroll] = a2 * o2.wrapElement[g2.value.scrollSize] / 100; }; const C2 = (e3) => { e3.stopImmediatePropagation(); m2 = true; document.addEventListener("mousemove", _2); document.addEventListener("mouseup", M2); b2 = document.onselectstart; document.onselectstart = () => false; }; const _2 = (e3) => { if (!s2.value || !u2.value) return; if (m2 === false) return; const t2 = c2.value[g2.value.axis]; if (!t2) return; const n3 = (s2.value.getBoundingClientRect()[g2.value.direction] - e3[g2.value.client]) * -1; const a2 = u2.value[g2.value.offset] - t2; const r2 = (n3 - a2) * 100 * w2.value / s2.value[g2.value.offset]; o2.wrapElement[g2.value.scroll] = r2 * o2.wrapElement[g2.value.scrollSize] / 100; }; const M2 = () => { m2 = false; c2.value[g2.value.axis] = 0; document.removeEventListener("mousemove", _2); document.removeEventListener("mouseup", M2); L2(); if (h2) p2.value = false; }; const O2 = () => { h2 = false; p2.value = !!n2.size; }; const $2 = () => { h2 = true; p2.value = m2; }; vue.onBeforeUnmount(() => { L2(); document.removeEventListener("mouseup", M2); }); const L2 = () => { if (document.onselectstart !== b2) document.onselectstart = b2; }; Le(vue.toRef(o2, "scrollbarElement"), "mousemove", O2); Le(vue.toRef(o2, "scrollbarElement"), "mouseleave", $2); return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(l2).b("fade"), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createElementVNode("div", { ref_key: "instance", ref: s2, class: vue.normalizeClass([vue.unref(l2).e("bar"), vue.unref(l2).is(vue.unref(g2).key)]), onMousedown: S2 }, [vue.createElementVNode("div", { ref_key: "thumb", ref: u2, class: vue.normalizeClass(vue.unref(l2).e("thumb")), style: vue.normalizeStyle(vue.unref(y2)), onMousedown: x2 }, null, 38)], 34), [[vue.vShow, e3.always || p2.value]])]), _: 1 }, 8, ["name"])); } }); var Bd = ad(Pd, [["__file", "thumb.vue"]]); const Rd = Cs({ always: { type: Boolean, default: true }, minSize: { type: Number, required: true } }); const Vd = vue.defineComponent({ __name: "bar", props: Rd, setup(e2, { expose: a2 }) { const o2 = e2; const r2 = vue.inject(Ld); const l2 = vue.ref(0); const s2 = vue.ref(0); const i2 = vue.ref(""); const u2 = vue.ref(""); const c2 = vue.ref(1); const d2 = vue.ref(1); const p2 = (e3) => { if (e3) { const t2 = e3.offsetHeight - Ad; const n2 = e3.offsetWidth - Ad; s2.value = e3.scrollTop * 100 / t2 * c2.value; l2.value = e3.scrollLeft * 100 / n2 * d2.value; } }; const m2 = () => { const e3 = r2 == null ? void 0 : r2.wrapElement; if (!e3) return; const t2 = e3.offsetHeight - Ad; const n2 = e3.offsetWidth - Ad; const a3 = t2 ** 2 / e3.scrollHeight; const l3 = n2 ** 2 / e3.scrollWidth; const s3 = Math.max(a3, o2.minSize); const f2 = Math.max(l3, o2.minSize); c2.value = a3 / (t2 - a3) / (s3 / (t2 - s3)); d2.value = l3 / (n2 - l3) / (f2 / (n2 - f2)); u2.value = s3 + Ad < t2 ? `${s3}px` : ""; i2.value = f2 + Ad < n2 ? `${f2}px` : ""; }; a2({ handleScroll: p2, update: m2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [vue.createVNode(Bd, { move: l2.value, ratio: d2.value, size: i2.value, always: e3.always }, null, 8, ["move", "ratio", "size", "always"]), vue.createVNode(Bd, { move: s2.value, ratio: c2.value, size: u2.value, vertical: "", always: e3.always }, null, 8, ["move", "ratio", "size", "always"])], 64)); } }); var Fd = ad(Vd, [["__file", "bar.vue"]]); const jd = Cs({ height: { type: [String, Number], default: "" }, maxHeight: { type: [String, Number], default: "" }, native: { type: Boolean, default: false }, wrapStyle: { type: ks([String, Object, Array]), default: "" }, wrapClass: { type: [String, Array], default: "" }, viewClass: { type: [String, Array], default: "" }, viewStyle: { type: [String, Array, Object], default: "" }, noresize: Boolean, tag: { type: String, default: "div" }, always: Boolean, minSize: { type: Number, default: 20 }, id: String, role: String, ...Zc(["ariaLabel", "ariaOrientation"]) }); const zd = { scroll: ({ scrollTop: e2, scrollLeft: t2 }) => [e2, t2].every(Ol) }; const Nd = "ElScrollbar"; const Hd = vue.defineComponent({ name: Nd }); const Yd = vue.defineComponent({ ...Hd, props: jd, emits: zd, setup(e2, { expose: o2, emit: l2 }) { const c2 = e2; const d2 = oi("scrollbar"); let f2 = void 0; let p2 = void 0; const m2 = vue.ref(); const h2 = vue.ref(); const b2 = vue.ref(); const y2 = vue.ref(); const k2 = vue.computed(() => { const e3 = {}; if (c2.height) e3.height = zl(c2.height); if (c2.maxHeight) e3.maxHeight = zl(c2.maxHeight); return [c2.wrapStyle, e3]; }); const x2 = vue.computed(() => [c2.wrapClass, d2.e("wrap"), { [d2.em("wrap", "hidden-default")]: !c2.native }]); const S2 = vue.computed(() => [d2.e("view"), c2.viewClass]); const C2 = () => { var e3; if (h2.value) { (e3 = y2.value) == null ? void 0 : e3.handleScroll(h2.value); l2("scroll", { scrollTop: h2.value.scrollTop, scrollLeft: h2.value.scrollLeft }); } }; function O2(e3, t2) { if (rt(e3)) { h2.value.scrollTo(e3); } else if (Ol(e3) && Ol(t2)) { h2.value.scrollTo(e3, t2); } } const L2 = (e3) => { if (!Ol(e3)) { return; } h2.value.scrollTop = e3; }; const I2 = (e3) => { if (!Ol(e3)) { return; } h2.value.scrollLeft = e3; }; const T2 = () => { var e3; (e3 = y2.value) == null ? void 0 : e3.update(); }; vue.watch(() => c2.noresize, (e3) => { if (e3) { f2 == null ? void 0 : f2(); p2 == null ? void 0 : p2(); } else { ({ stop: f2 } = Ne(b2, T2)); p2 = Le("resize", T2); } }, { immediate: true }); vue.watch(() => [c2.maxHeight, c2.height], () => { if (!c2.native) vue.nextTick(() => { var e3; T2(); if (h2.value) { (e3 = y2.value) == null ? void 0 : e3.handleScroll(h2.value); } }); }); vue.provide(Ld, vue.reactive({ scrollbarElement: m2, wrapElement: h2 })); vue.onMounted(() => { if (!c2.native) vue.nextTick(() => { T2(); }); }); vue.onUpdated(() => T2()); o2({ wrapRef: h2, update: T2, scrollTo: O2, setScrollTop: L2, setScrollLeft: I2, handleScroll: C2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { ref_key: "scrollbarRef", ref: m2, class: vue.normalizeClass(vue.unref(d2).b()) }, [vue.createElementVNode("div", { ref_key: "wrapRef", ref: h2, class: vue.normalizeClass(vue.unref(x2)), style: vue.normalizeStyle(vue.unref(k2)), onScroll: C2 }, [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), { id: e3.id, ref_key: "resizeRef", ref: b2, class: vue.normalizeClass(vue.unref(S2)), style: vue.normalizeStyle(e3.viewStyle), role: e3.role, "aria-label": e3.ariaLabel, "aria-orientation": e3.ariaOrientation }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "style", "role", "aria-label", "aria-orientation"]))], 38), !e3.native ? (vue.openBlock(), vue.createBlock(Fd, { key: 0, ref_key: "barRef", ref: y2, always: e3.always, "min-size": e3.minSize }, null, 8, ["always", "min-size"])) : vue.createCommentVNode("v-if", true)], 2)); } }); var Wd = ad(Yd, [["__file", "scrollbar.vue"]]); const Ud = Ds(Wd); const Kd = Symbol("popper"); const qd = Symbol("popperContent"); const Gd = ["dialog", "grid", "group", "listbox", "menu", "navigation", "tooltip", "tree"]; const Zd = Cs({ role: { type: String, values: Gd, default: "tooltip" } }); const Jd = vue.defineComponent({ name: "ElPopper", inheritAttrs: false }); const Xd = vue.defineComponent({ ...Jd, props: Zd, setup(e2, { expose: t2 }) { const n2 = e2; const a2 = vue.ref(); const o2 = vue.ref(); const l2 = vue.ref(); const s2 = vue.ref(); const i2 = vue.computed(() => n2.role); const u2 = { triggerRef: a2, popperInstanceRef: o2, contentRef: l2, referenceRef: s2, role: i2 }; t2(u2); vue.provide(Kd, u2); return (e3, t3) => vue.renderSlot(e3.$slots, "default"); } }); var Qd = ad(Xd, [["__file", "popper.vue"]]); const ef = Cs({ arrowOffset: { type: Number, default: 5 } }); const tf = vue.defineComponent({ name: "ElPopperArrow", inheritAttrs: false }); const nf = vue.defineComponent({ ...tf, props: ef, setup(e2, { expose: a2 }) { const o2 = e2; const r2 = oi("popper"); const { arrowOffset: l2, arrowRef: u2, arrowStyle: c2 } = vue.inject(qd, void 0); vue.watch(() => o2.arrowOffset, (e3) => { l2.value = e3; }); vue.onBeforeUnmount(() => { u2.value = void 0; }); a2({ arrowRef: u2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("span", { ref_key: "arrowRef", ref: u2, class: vue.normalizeClass(vue.unref(r2).e("arrow")), style: vue.normalizeStyle(vue.unref(c2)), "data-popper-arrow": "" }, null, 6)); } }); var af = ad(nf, [["__file", "arrow.vue"]]); const of = "ElOnlyChild"; const rf = vue.defineComponent({ name: of, setup(e2, { slots: t2, attrs: n2 }) { var a2; const o2 = vue.inject(Lc); const r2 = Tc((a2 = o2 == null ? void 0 : o2.setForwardRef) != null ? a2 : Xe); return () => { var e3; const a3 = (e3 = t2.default) == null ? void 0 : e3.call(t2, n2); if (!a3) return null; if (a3.length > 1) { return null; } const o3 = lf(a3); if (!o3) { return null; } return vue.withDirectives(vue.cloneVNode(o3, n2), [[r2]]); }; } }); function lf(e2) { if (!e2) return null; const t2 = e2; for (const e3 of t2) { if (rt(e3)) { switch (e3.type) { case vue.Comment: continue; case vue.Text: case "svg": return sf(e3); case vue.Fragment: return lf(e3.children); default: return e3; } } return sf(e3); } return null; } function sf(e2) { const t2 = oi("only-child"); return vue.createVNode("span", { class: t2.e("content") }, [e2]); } const uf = Cs({ virtualRef: { type: ks(Object) }, virtualTriggering: Boolean, onMouseenter: { type: ks(Function) }, onMouseleave: { type: ks(Function) }, onClick: { type: ks(Function) }, onKeydown: { type: ks(Function) }, onFocus: { type: ks(Function) }, onBlur: { type: ks(Function) }, onContextmenu: { type: ks(Function) }, id: String, open: Boolean }); const cf = vue.defineComponent({ name: "ElPopperTrigger", inheritAttrs: false }); const df = vue.defineComponent({ ...cf, props: uf, setup(e2, { expose: n2 }) { const a2 = e2; const { role: o2, triggerRef: l2 } = vue.inject(Kd, void 0); Ic(l2); const c2 = vue.computed(() => p2.value ? a2.id : void 0); const v2 = vue.computed(() => { if (o2 && o2.value === "tooltip") { return a2.open && a2.id ? a2.id : void 0; } return void 0; }); const p2 = vue.computed(() => { if (o2 && o2.value !== "tooltip") { return o2.value; } return void 0; }); const m2 = vue.computed(() => p2.value ? `${a2.open}` : void 0); let h2 = void 0; vue.onMounted(() => { vue.watch(() => a2.virtualRef, (e3) => { if (e3) { l2.value = Ee(e3); } }, { immediate: true }); vue.watch(l2, (e3, t2) => { h2 == null ? void 0 : h2(); h2 = void 0; if (Al(e3)) { ["onMouseenter", "onMouseleave", "onClick", "onKeydown", "onFocus", "onBlur", "onContextmenu"].forEach((n3) => { var o3; const r2 = a2[n3]; if (r2) { e3.addEventListener(n3.slice(2).toLowerCase(), r2); (o3 = t2 == null ? void 0 : t2.removeEventListener) == null ? void 0 : o3.call(t2, n3.slice(2).toLowerCase(), r2); } }); h2 = vue.watch([c2, v2, p2, m2], (t3) => { ["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((n3, a3) => { yl(t3[a3]) ? e3.removeAttribute(n3) : e3.setAttribute(n3, t3[a3]); }); }, { immediate: true }); } if (Al(t2)) { ["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((e4) => t2.removeAttribute(e4)); } }, { immediate: true }); }); vue.onBeforeUnmount(() => { h2 == null ? void 0 : h2(); h2 = void 0; }); n2({ triggerRef: l2 }); return (e3, n3) => !e3.virtualTriggering ? (vue.openBlock(), vue.createBlock(vue.unref(rf), vue.mergeProps({ key: 0 }, e3.$attrs, { "aria-controls": vue.unref(c2), "aria-describedby": vue.unref(v2), "aria-expanded": vue.unref(m2), "aria-haspopup": vue.unref(p2) }), { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 16, ["aria-controls", "aria-describedby", "aria-expanded", "aria-haspopup"])) : vue.createCommentVNode("v-if", true); } }); var ff = ad(df, [["__file", "trigger.vue"]]); const vf = "focus-trap.focus-after-trapped"; const pf = "focus-trap.focus-after-released"; const mf = "focus-trap.focusout-prevented"; const hf = { cancelable: true, bubbles: false }; const bf = { cancelable: true, bubbles: false }; const gf = "focusAfterTrapped"; const yf = "focusAfterReleased"; const wf = Symbol("elFocusTrap"); const kf = vue.ref(); const xf = vue.ref(0); const Sf = vue.ref(0); let Cf = 0; const _f = (e2) => { const t2 = []; const n2 = document.createTreeWalker(e2, NodeFilter.SHOW_ELEMENT, { acceptNode: (e3) => { const t3 = e3.tagName === "INPUT" && e3.type === "hidden"; if (e3.disabled || e3.hidden || t3) return NodeFilter.FILTER_SKIP; return e3.tabIndex >= 0 || e3 === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP; } }); while (n2.nextNode()) t2.push(n2.currentNode); return t2; }; const Mf = (e2, t2) => { for (const n2 of e2) { if (!Of(n2, t2)) return n2; } }; const Of = (e2, t2) => { if (getComputedStyle(e2).visibility === "hidden") return true; while (e2) { if (t2 && e2 === t2) return false; if (getComputedStyle(e2).display === "none") return true; e2 = e2.parentElement; } return false; }; const Df = (e2) => { const t2 = _f(e2); const n2 = Mf(t2, e2); const a2 = Mf(t2.reverse(), e2); return [n2, a2]; }; const Af = (e2) => e2 instanceof HTMLInputElement && "select" in e2; const Ef = (e2, t2) => { if (e2 && e2.focus) { const n2 = document.activeElement; e2.focus({ preventScroll: true }); Sf.value = window.performance.now(); if (e2 !== n2 && Af(e2) && t2) { e2.select(); } } }; function $f(e2, t2) { const n2 = [...e2]; const a2 = e2.indexOf(t2); if (a2 !== -1) { n2.splice(a2, 1); } return n2; } const Lf = () => { let e2 = []; const t2 = (t3) => { const n3 = e2[0]; if (n3 && t3 !== n3) { n3.pause(); } e2 = $f(e2, t3); e2.unshift(t3); }; const n2 = (t3) => { var n3, a2; e2 = $f(e2, t3); (a2 = (n3 = e2[0]) == null ? void 0 : n3.resume) == null ? void 0 : a2.call(n3); }; return { push: t2, remove: n2 }; }; const If = (e2, t2 = false) => { const n2 = document.activeElement; for (const a2 of e2) { Ef(a2, t2); if (document.activeElement !== n2) return; } }; const Tf = Lf(); const Pf = () => xf.value > Sf.value; const Bf = () => { kf.value = "pointer"; xf.value = window.performance.now(); }; const Rf = () => { kf.value = "keyboard"; xf.value = window.performance.now(); }; const Vf = () => { vue.onMounted(() => { if (Cf === 0) { document.addEventListener("mousedown", Bf); document.addEventListener("touchstart", Bf); document.addEventListener("keydown", Rf); } Cf++; }); vue.onBeforeUnmount(() => { Cf--; if (Cf <= 0) { document.removeEventListener("mousedown", Bf); document.removeEventListener("touchstart", Bf); document.removeEventListener("keydown", Rf); } }); return { focusReason: kf, lastUserFocusTimestamp: xf, lastAutomatedFocusTimestamp: Sf }; }; const Ff = (e2) => new CustomEvent(mf, { ...bf, detail: e2 }); const jf = vue.defineComponent({ name: "ElFocusTrap", inheritAttrs: false, props: { loop: Boolean, trapped: Boolean, focusTrapEl: Object, focusStartEl: { type: [Object, String], default: "first" } }, emits: [gf, yf, "focusin", "focusout", "focusout-prevented", "release-requested"], setup(e2, { emit: t2 }) { const n2 = vue.ref(); let a2; let o2; const { focusReason: r2 } = Vf(); _c((n3) => { if (e2.trapped && !l2.paused) { t2("release-requested", n3); } }); const l2 = { paused: false, pause() { this.paused = true; }, resume() { this.paused = false; } }; const c2 = (n3) => { if (!e2.loop && !e2.trapped) return; if (l2.paused) return; const { key: a3, altKey: o3, ctrlKey: s2, metaKey: i2, currentTarget: u2, shiftKey: c3 } = n3; const { loop: d2 } = e2; const f3 = a3 === $s.tab && !o3 && !s2 && !i2; const v2 = document.activeElement; if (f3 && v2) { const e3 = u2; const [a4, o4] = Df(e3); const l3 = a4 && o4; if (!l3) { if (v2 === e3) { const e4 = Ff({ focusReason: r2.value }); t2("focusout-prevented", e4); if (!e4.defaultPrevented) { n3.preventDefault(); } } } else { if (!c3 && v2 === o4) { const e4 = Ff({ focusReason: r2.value }); t2("focusout-prevented", e4); if (!e4.defaultPrevented) { n3.preventDefault(); if (d2) Ef(a4, true); } } else if (c3 && [a4, e3].includes(v2)) { const e4 = Ff({ focusReason: r2.value }); t2("focusout-prevented", e4); if (!e4.defaultPrevented) { n3.preventDefault(); if (d2) Ef(o4, true); } } } } }; vue.provide(wf, { focusTrapRef: n2, onKeydown: c2 }); vue.watch(() => e2.focusTrapEl, (e3) => { if (e3) { n2.value = e3; } }, { immediate: true }); vue.watch([n2], ([e3], [t3]) => { if (e3) { e3.addEventListener("keydown", c2); e3.addEventListener("focusin", m2); e3.addEventListener("focusout", h2); } if (t3) { t3.removeEventListener("keydown", c2); t3.removeEventListener("focusin", m2); t3.removeEventListener("focusout", h2); } }); const f2 = (e3) => { t2(gf, e3); }; const p2 = (e3) => t2(yf, e3); const m2 = (r3) => { const s2 = vue.unref(n2); if (!s2) return; const u2 = r3.target; const c3 = r3.relatedTarget; const d2 = u2 && s2.contains(u2); if (!e2.trapped) { const e3 = c3 && s2.contains(c3); if (!e3) { a2 = c3; } } if (d2) t2("focusin", r3); if (l2.paused) return; if (e2.trapped) { if (d2) { o2 = u2; } else { Ef(o2, true); } } }; const h2 = (a3) => { const s2 = vue.unref(n2); if (l2.paused || !s2) return; if (e2.trapped) { const n3 = a3.relatedTarget; if (!yl(n3) && !s2.contains(n3)) { setTimeout(() => { if (!l2.paused && e2.trapped) { const e3 = Ff({ focusReason: r2.value }); t2("focusout-prevented", e3); if (!e3.defaultPrevented) { Ef(o2, true); } } }, 0); } } else { const e3 = a3.target; const n3 = e3 && s2.contains(e3); if (!n3) t2("focusout", a3); } }; async function b2() { await vue.nextTick(); const t3 = vue.unref(n2); if (t3) { Tf.push(l2); const n3 = t3.contains(document.activeElement) ? a2 : document.activeElement; a2 = n3; const o3 = t3.contains(n3); if (!o3) { const a3 = new Event(vf, hf); t3.addEventListener(vf, f2); t3.dispatchEvent(a3); if (!a3.defaultPrevented) { vue.nextTick(() => { let a4 = e2.focusStartEl; if (!ot(a4)) { Ef(a4); if (document.activeElement !== a4) { a4 = "first"; } } if (a4 === "first") { If(_f(t3), true); } if (document.activeElement === n3 || a4 === "container") { Ef(t3); } }); } } } } function y2() { const e3 = vue.unref(n2); if (e3) { e3.removeEventListener(vf, f2); const t3 = new CustomEvent(pf, { ...hf, detail: { focusReason: r2.value } }); e3.addEventListener(pf, p2); e3.dispatchEvent(t3); if (!t3.defaultPrevented && (r2.value == "keyboard" || !Pf() || e3.contains(document.activeElement))) { Ef(a2 != null ? a2 : document.body); } e3.removeEventListener(pf, p2); Tf.remove(l2); } } vue.onMounted(() => { if (e2.trapped) { b2(); } vue.watch(() => e2.trapped, (e3) => { if (e3) { b2(); } else { y2(); } }); }); vue.onBeforeUnmount(() => { if (e2.trapped) { y2(); } }); return { onKeydown: c2 }; } }); function zf(e2, t2, n2, a2, o2, r2) { return vue.renderSlot(e2.$slots, "default", { handleKeydown: e2.onKeydown }); } var Nf = ad(jf, [["render", zf], ["__file", "focus-trap.vue"]]); const Hf = ["fixed", "absolute"]; const Yf = Cs({ boundariesPadding: { type: Number, default: 0 }, fallbackPlacements: { type: ks(Array), default: void 0 }, gpuAcceleration: { type: Boolean, default: true }, offset: { type: Number, default: 12 }, placement: { type: String, values: Si, default: "bottom" }, popperOptions: { type: ks(Object), default: () => ({}) }, strategy: { type: String, values: Hf, default: "absolute" } }); const Wf = Cs({ ...Yf, id: String, style: { type: ks([String, Array, Object]) }, className: { type: ks([String, Array, Object]) }, effect: { type: String, default: "dark" }, visible: Boolean, enterable: { type: Boolean, default: true }, pure: Boolean, focusOnShow: { type: Boolean, default: false }, trapping: { type: Boolean, default: false }, popperClass: { type: ks([String, Array, Object]) }, popperStyle: { type: ks([String, Array, Object]) }, referenceEl: { type: ks(Object) }, triggerTargetEl: { type: ks(Object) }, stopPopperMouseEvent: { type: Boolean, default: true }, virtualTriggering: Boolean, zIndex: Number, ...Zc(["ariaLabel"]) }); const Uf = { mouseenter: (e2) => e2 instanceof MouseEvent, mouseleave: (e2) => e2 instanceof MouseEvent, focus: () => true, blur: () => true, close: () => true }; const Kf = (e2, t2 = []) => { const { placement: n2, strategy: a2, popperOptions: o2 } = e2; const r2 = { placement: n2, strategy: a2, ...o2, modifiers: [...Gf(e2), ...t2] }; Zf(r2, o2 == null ? void 0 : o2.modifiers); return r2; }; const qf = (e2) => { if (!ke) return; return Ee(e2); }; function Gf(e2) { const { offset: t2, gpuAcceleration: n2, fallbackPlacements: a2 } = e2; return [{ name: "offset", options: { offset: [0, t2 != null ? t2 : 12] } }, { name: "preventOverflow", options: { padding: { top: 2, bottom: 2, left: 5, right: 5 } } }, { name: "flip", options: { padding: 5, fallbackPlacements: a2 } }, { name: "computeStyles", options: { gpuAcceleration: n2 } }]; } function Zf(e2, t2) { if (t2) { e2.modifiers = [...e2.modifiers, ...t2 != null ? t2 : []]; } } const Jf = 0; const Xf = (e2) => { const { popperInstanceRef: t2, contentRef: n2, triggerRef: a2, role: o2 } = vue.inject(Kd, void 0); const l2 = vue.ref(); const c2 = vue.ref(); const d2 = vue.computed(() => ({ name: "eventListeners", enabled: !!e2.visible })); const p2 = vue.computed(() => { var e3; const t3 = vue.unref(l2); const n3 = (e3 = vue.unref(c2)) != null ? e3 : Jf; return { name: "arrow", enabled: !wl(t3), options: { element: t3, padding: n3 } }; }); const m2 = vue.computed(() => ({ onFirstUpdate: () => { w2(); }, ...Kf(e2, [vue.unref(p2), vue.unref(d2)]) })); const h2 = vue.computed(() => qf(e2.referenceEl) || vue.unref(a2)); const { attributes: b2, state: g2, styles: y2, update: w2, forceUpdate: k2, instanceRef: x2 } = mc(h2, n2, m2); vue.watch(x2, (e3) => t2.value = e3); vue.onMounted(() => { vue.watch(() => { var e3; return (e3 = vue.unref(h2)) == null ? void 0 : e3.getBoundingClientRect(); }, () => { w2(); }); }); return { attributes: b2, arrowRef: l2, contentRef: n2, instanceRef: x2, state: g2, styles: y2, role: o2, forceUpdate: k2, update: w2 }; }; const Qf = (e2, { attributes: t2, styles: n2, role: a2 }) => { const { nextZIndex: o2 } = jc(); const l2 = oi("popper"); const s2 = vue.computed(() => vue.unref(t2).popper); const u2 = vue.ref(Ol(e2.zIndex) ? e2.zIndex : o2()); const c2 = vue.computed(() => [l2.b(), l2.is("pure", e2.pure), l2.is(e2.effect), e2.popperClass]); const d2 = vue.computed(() => [{ zIndex: vue.unref(u2) }, vue.unref(n2).popper, e2.popperStyle || {}]); const f2 = vue.computed(() => a2.value === "dialog" ? "false" : void 0); const p2 = vue.computed(() => vue.unref(n2).arrow || {}); const m2 = () => { u2.value = Ol(e2.zIndex) ? e2.zIndex : o2(); }; return { ariaModal: f2, arrowStyle: p2, contentAttrs: s2, contentClass: c2, contentStyle: d2, contentZIndex: u2, updateZIndex: m2 }; }; const ev = (e2, t2) => { const n2 = vue.ref(false); const a2 = vue.ref(); const o2 = () => { t2("focus"); }; const r2 = (e3) => { var n3; if (((n3 = e3.detail) == null ? void 0 : n3.focusReason) !== "pointer") { a2.value = "first"; t2("blur"); } }; const l2 = (t3) => { if (e2.visible && !n2.value) { if (t3.target) { a2.value = t3.target; } n2.value = true; } }; const s2 = (t3) => { if (!e2.trapping) { if (t3.detail.focusReason === "pointer") { t3.preventDefault(); } n2.value = false; } }; const i2 = () => { n2.value = false; t2("close"); }; return { focusStartRef: a2, trapped: n2, onFocusAfterReleased: r2, onFocusAfterTrapped: o2, onFocusInTrap: l2, onFocusoutPrevented: s2, onReleaseRequested: i2 }; }; const tv = vue.defineComponent({ name: "ElPopperContent" }); const nv = vue.defineComponent({ ...tv, props: Wf, emits: Uf, setup(e2, { expose: a2, emit: o2 }) { const r2 = e2; const { focusStartRef: l2, trapped: c2, onFocusAfterReleased: p2, onFocusAfterTrapped: m2, onFocusInTrap: h2, onFocusoutPrevented: b2, onReleaseRequested: k2 } = ev(r2, o2); const { attributes: x2, arrowRef: S2, contentRef: C2, styles: _2, instanceRef: M2, role: O2, update: D2 } = Xf(r2); const { ariaModal: A2, arrowStyle: $2, contentAttrs: L2, contentClass: T2, contentStyle: P2, updateZIndex: B2 } = Qf(r2, { styles: _2, attributes: x2, role: O2 }); const R2 = vue.inject(cd, void 0); const V2 = vue.ref(); vue.provide(qd, { arrowStyle: $2, arrowRef: S2, arrowOffset: V2 }); if (R2) { vue.provide(cd, { ...R2, addInputId: Xe, removeInputId: Xe }); } let F2 = void 0; const j2 = (e3 = true) => { D2(); e3 && B2(); }; const z2 = () => { j2(false); if (r2.visible && r2.focusOnShow) { c2.value = true; } else if (r2.visible === false) { c2.value = false; } }; vue.onMounted(() => { vue.watch(() => r2.triggerTargetEl, (e3, t2) => { F2 == null ? void 0 : F2(); F2 = void 0; const n2 = vue.unref(e3 || C2.value); const a3 = vue.unref(t2 || C2.value); if (Al(n2)) { F2 = vue.watch([O2, () => r2.ariaLabel, A2, () => r2.id], (e4) => { ["role", "aria-label", "aria-modal", "id"].forEach((t3, a4) => { yl(e4[a4]) ? n2.removeAttribute(t3) : n2.setAttribute(t3, e4[a4]); }); }, { immediate: true }); } if (a3 !== n2 && Al(a3)) { ["role", "aria-label", "aria-modal", "id"].forEach((e4) => { a3.removeAttribute(e4); }); } }, { immediate: true }); vue.watch(() => r2.visible, z2, { immediate: true }); }); vue.onBeforeUnmount(() => { F2 == null ? void 0 : F2(); F2 = void 0; }); a2({ popperContentRef: C2, popperInstanceRef: M2, updatePopper: j2, contentStyle: P2 }); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", vue.mergeProps({ ref_key: "contentRef", ref: C2 }, vue.unref(L2), { style: vue.unref(P2), class: vue.unref(T2), tabindex: "-1", onMouseenter: a3[0] || (a3[0] = (t2) => e3.$emit("mouseenter", t2)), onMouseleave: a3[1] || (a3[1] = (t2) => e3.$emit("mouseleave", t2)) }), [vue.createVNode(vue.unref(Nf), { trapped: vue.unref(c2), "trap-on-focus-in": true, "focus-trap-el": vue.unref(C2), "focus-start-el": vue.unref(l2), onFocusAfterTrapped: vue.unref(m2), onFocusAfterReleased: vue.unref(p2), onFocusin: vue.unref(h2), onFocusoutPrevented: vue.unref(b2), onReleaseRequested: vue.unref(k2) }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusin", "onFocusoutPrevented", "onReleaseRequested"])], 16)); } }); var av = ad(nv, [["__file", "content.vue"]]); const ov = Ds(Qd); const rv = Symbol("elTooltip"); const lv = Cs({ ...Ec, ...Wf, appendTo: { type: ks([String, Object]) }, content: { type: String, default: "" }, rawContent: { type: Boolean, default: false }, persistent: Boolean, visible: { type: ks(Boolean), default: null }, transition: String, teleported: { type: Boolean, default: true }, disabled: Boolean, ...Zc(["ariaLabel"]) }); const sv = Cs({ ...uf, disabled: Boolean, trigger: { type: ks([String, Array]), default: "hover" }, triggerKeys: { type: ks(Array), default: () => [$s.enter, $s.space] } }); const { useModelToggleProps: iv, useModelToggleEmits: uv, useModelToggle: cv } = ii("visible"); const dv = Cs({ ...Zd, ...iv, ...lv, ...sv, ...ef, showArrow: { type: Boolean, default: true } }); const fv = [...uv, "before-show", "before-hide", "show", "hide", "open", "close"]; const vv = (e2, t2) => { if (tt(e2)) { return e2.includes(t2); } return e2 === t2; }; const pv = (e2, t2, n2) => (a2) => { vv(vue.unref(e2), t2) && n2(a2); }; const mv = vue.defineComponent({ name: "ElTooltipTrigger" }); const hv = vue.defineComponent({ ...mv, props: sv, setup(e2, { expose: n2 }) { const a2 = e2; const o2 = oi("tooltip"); const { controlled: r2, id: l2, open: s2, onOpen: u2, onClose: c2, onToggle: d2 } = vue.inject(rv, void 0); const p2 = vue.ref(null); const m2 = () => { if (vue.unref(r2) || a2.disabled) { return true; } }; const h2 = vue.toRef(a2, "trigger"); const b2 = ye(m2, pv(h2, "hover", u2)); const g2 = ye(m2, pv(h2, "hover", c2)); const y2 = ye(m2, pv(h2, "click", (e3) => { if (e3.button === 0) { d2(e3); } })); const x2 = ye(m2, pv(h2, "focus", u2)); const S2 = ye(m2, pv(h2, "focus", c2)); const C2 = ye(m2, pv(h2, "contextmenu", (e3) => { e3.preventDefault(); d2(e3); })); const _2 = ye(m2, (e3) => { const { code: t2 } = e3; if (a2.triggerKeys.includes(t2)) { e3.preventDefault(); d2(e3); } }); n2({ triggerRef: p2 }); return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.unref(ff), { id: vue.unref(l2), "virtual-ref": e3.virtualRef, open: vue.unref(s2), "virtual-triggering": e3.virtualTriggering, class: vue.normalizeClass(vue.unref(o2).e("trigger")), onBlur: vue.unref(S2), onClick: vue.unref(y2), onContextmenu: vue.unref(C2), onFocus: vue.unref(x2), onMouseenter: vue.unref(b2), onMouseleave: vue.unref(g2), onKeydown: vue.unref(_2) }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "virtual-ref", "open", "virtual-triggering", "class", "onBlur", "onClick", "onContextmenu", "onFocus", "onMouseenter", "onMouseleave", "onKeydown"])); } }); var bv = ad(hv, [["__file", "trigger.vue"]]); const gv = vue.defineComponent({ name: "ElTooltipContent", inheritAttrs: false }); const yv = vue.defineComponent({ ...gv, props: lv, setup(e2, { expose: n2 }) { const a2 = e2; const { selector: o2 } = Oc(); const l2 = oi("tooltip"); const u2 = vue.ref(null); const c2 = vue.ref(false); const { controlled: p2, id: m2, open: h2, trigger: b2, onClose: g2, onOpen: k2, onShow: x2, onHide: S2, onBeforeShow: C2, onBeforeHide: _2 } = vue.inject(rv, void 0); const O2 = vue.computed(() => a2.transition || `${l2.namespace.value}-fade-in-linear`); const D2 = vue.computed(() => a2.persistent); vue.onBeforeUnmount(() => { c2.value = true; }); const $2 = vue.computed(() => vue.unref(D2) ? true : vue.unref(h2)); const L2 = vue.computed(() => a2.disabled ? false : vue.unref(h2)); const T2 = vue.computed(() => a2.appendTo || o2.value); const P2 = vue.computed(() => { var e3; return (e3 = a2.style) != null ? e3 : {}; }); const F2 = vue.computed(() => !vue.unref(h2)); const j2 = () => { S2(); }; const z2 = () => { if (vue.unref(p2)) return true; }; const N2 = ye(z2, () => { if (a2.enterable && vue.unref(b2) === "hover") { k2(); } }); const H2 = ye(z2, () => { if (vue.unref(b2) === "hover") { g2(); } }); const W2 = () => { var e3, t2; (t2 = (e3 = u2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3); C2 == null ? void 0 : C2(); }; const U2 = () => { _2 == null ? void 0 : _2(); }; const K2 = () => { x2(); G2 = Te(vue.computed(() => { var e3; return (e3 = u2.value) == null ? void 0 : e3.popperContentRef; }), () => { if (vue.unref(p2)) return; const e3 = vue.unref(b2); if (e3 !== "hover") { g2(); } }); }; const q2 = () => { if (!a2.virtualTriggering) { g2(); } }; let G2; vue.watch(() => vue.unref(h2), (e3) => { if (!e3) { G2 == null ? void 0 : G2(); } }, { flush: "post" }); vue.watch(() => a2.content, () => { var e3, t2; (t2 = (e3 = u2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3); }); n2({ contentRef: u2 }); return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { disabled: !e3.teleported, to: vue.unref(T2) }, [vue.createVNode(vue.Transition, { name: vue.unref(O2), onAfterLeave: j2, onBeforeEnter: W2, onAfterEnter: K2, onBeforeLeave: U2 }, { default: vue.withCtx(() => [vue.unref($2) ? vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(av), vue.mergeProps({ key: 0, id: vue.unref(m2), ref_key: "contentRef", ref: u2 }, e3.$attrs, { "aria-label": e3.ariaLabel, "aria-hidden": vue.unref(F2), "boundaries-padding": e3.boundariesPadding, "fallback-placements": e3.fallbackPlacements, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, placement: e3.placement, "popper-options": e3.popperOptions, strategy: e3.strategy, effect: e3.effect, enterable: e3.enterable, pure: e3.pure, "popper-class": e3.popperClass, "popper-style": [e3.popperStyle, vue.unref(P2)], "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, visible: vue.unref(L2), "z-index": e3.zIndex, onMouseenter: vue.unref(N2), onMouseleave: vue.unref(H2), onBlur: q2, onClose: vue.unref(g2) }), { default: vue.withCtx(() => [!c2.value ? vue.renderSlot(e3.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true)]), _: 3 }, 16, ["id", "aria-label", "aria-hidden", "boundaries-padding", "fallback-placements", "gpu-acceleration", "offset", "placement", "popper-options", "strategy", "effect", "enterable", "pure", "popper-class", "popper-style", "reference-el", "trigger-target-el", "visible", "z-index", "onMouseenter", "onMouseleave", "onClose"])), [[vue.vShow, vue.unref(L2)]]) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["name"])], 8, ["disabled", "to"])); } }); var wv = ad(yv, [["__file", "content.vue"]]); const kv = ["innerHTML"]; const xv = { key: 1 }; const Sv = vue.defineComponent({ name: "ElTooltip" }); const Cv = vue.defineComponent({ ...Sv, props: dv, emits: fv, setup(e2, { expose: a2, emit: o2 }) { const l2 = e2; Ac(); const u2 = xc(); const c2 = vue.ref(); const d2 = vue.ref(); const f2 = () => { var e3; const t2 = vue.unref(c2); if (t2) { (e3 = t2.popperInstanceRef) == null ? void 0 : e3.update(); } }; const p2 = vue.ref(false); const m2 = vue.ref(); const { show: h2, hide: b2, hasUpdateHandler: y2 } = cv({ indicator: p2, toggleReason: m2 }); const { onOpen: x2, onClose: S2 } = $c({ showAfter: vue.toRef(l2, "showAfter"), hideAfter: vue.toRef(l2, "hideAfter"), autoClose: vue.toRef(l2, "autoClose"), open: h2, close: b2 }); const C2 = vue.computed(() => Ml(l2.visible) && !y2.value); vue.provide(rv, { controlled: C2, id: u2, open: vue.readonly(p2), trigger: vue.toRef(l2, "trigger"), onOpen: (e3) => { x2(e3); }, onClose: (e3) => { S2(e3); }, onToggle: (e3) => { if (vue.unref(p2)) { S2(e3); } else { x2(e3); } }, onShow: () => { o2("show", m2.value); }, onHide: () => { o2("hide", m2.value); }, onBeforeShow: () => { o2("before-show", m2.value); }, onBeforeHide: () => { o2("before-hide", m2.value); }, updatePopper: f2 }); vue.watch(() => l2.disabled, (e3) => { if (e3 && p2.value) { p2.value = false; } }); const _2 = (e3) => { var t2, n2; const a3 = (n2 = (t2 = d2.value) == null ? void 0 : t2.contentRef) == null ? void 0 : n2.popperContentRef; const o3 = (e3 == null ? void 0 : e3.relatedTarget) || document.activeElement; return a3 && a3.contains(o3); }; vue.onDeactivated(() => p2.value && b2()); a2({ popperRef: c2, contentRef: d2, isFocusInsideContent: _2, updatePopper: f2, onOpen: x2, onClose: S2, hide: b2 }); return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.unref(ov), { ref_key: "popperRef", ref: c2, role: e3.role }, { default: vue.withCtx(() => [vue.createVNode(bv, { disabled: e3.disabled, trigger: e3.trigger, "trigger-keys": e3.triggerKeys, "virtual-ref": e3.virtualRef, "virtual-triggering": e3.virtualTriggering }, { default: vue.withCtx(() => [e3.$slots.default ? vue.renderSlot(e3.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["disabled", "trigger", "trigger-keys", "virtual-ref", "virtual-triggering"]), vue.createVNode(wv, { ref_key: "contentRef", ref: d2, "aria-label": e3.ariaLabel, "boundaries-padding": e3.boundariesPadding, content: e3.content, disabled: e3.disabled, effect: e3.effect, enterable: e3.enterable, "fallback-placements": e3.fallbackPlacements, "hide-after": e3.hideAfter, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, persistent: e3.persistent, "popper-class": e3.popperClass, "popper-style": e3.popperStyle, placement: e3.placement, "popper-options": e3.popperOptions, pure: e3.pure, "raw-content": e3.rawContent, "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, "show-after": e3.showAfter, strategy: e3.strategy, teleported: e3.teleported, transition: e3.transition, "virtual-triggering": e3.virtualTriggering, "z-index": e3.zIndex, "append-to": e3.appendTo }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "content", {}, () => [e3.rawContent ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, innerHTML: e3.content }, null, 8, kv)) : (vue.openBlock(), vue.createElementBlock("span", xv, vue.toDisplayString(e3.content), 1))]), e3.showArrow ? (vue.openBlock(), vue.createBlock(vue.unref(af), { key: 0, "arrow-offset": e3.arrowOffset }, null, 8, ["arrow-offset"])) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["aria-label", "boundaries-padding", "content", "disabled", "effect", "enterable", "fallback-placements", "hide-after", "gpu-acceleration", "offset", "persistent", "popper-class", "popper-style", "placement", "popper-options", "pure", "raw-content", "reference-el", "trigger-target-el", "show-after", "strategy", "teleported", "transition", "virtual-triggering", "z-index", "append-to"])]), _: 3 }, 8, ["role"])); } }); var _v = ad(Cv, [["__file", "tooltip.vue"]]); const Mv = Ds(_v); const Ov = Symbol("buttonGroupContextKey"); const Dv = (e2, t2) => { Ws({ from: "type.text", replacement: "link", version: "3.0.0", scope: "props", ref: "https://element-plus.org/en-US/component/button.html#button-attributes" }, vue.computed(() => e2.type === "text")); const n2 = vue.inject(Ov, void 0); const a2 = Qc("button"); const { form: o2 } = vd(); const l2 = dd(vue.computed(() => n2 == null ? void 0 : n2.size)); const s2 = fd(); const i2 = vue.ref(); const u2 = vue.useSlots(); const c2 = vue.computed(() => e2.type || (n2 == null ? void 0 : n2.type) || ""); const d2 = vue.computed(() => { var t3, n3, o3; return (o3 = (n3 = e2.autoInsertSpace) != null ? n3 : (t3 = a2.value) == null ? void 0 : t3.autoInsertSpace) != null ? o3 : false; }); const p2 = vue.computed(() => { if (e2.tag === "button") { return { ariaDisabled: s2.value || e2.loading, disabled: s2.value || e2.loading, autofocus: e2.autofocus, type: e2.nativeType }; } return {}; }); const m2 = vue.computed(() => { var e3; const t3 = (e3 = u2.default) == null ? void 0 : e3.call(u2); if (d2.value && (t3 == null ? void 0 : t3.length) === 1) { const e4 = t3[0]; if ((e4 == null ? void 0 : e4.type) === vue.Text) { const t4 = e4.children; return new RegExp("^\\p{Unified_Ideograph}{2}$", "u").test(t4.trim()); } } return false; }); const h2 = (n3) => { if (e2.nativeType === "reset") { o2 == null ? void 0 : o2.resetFields(); } t2("click", n3); }; return { _disabled: s2, _size: l2, _type: c2, _ref: i2, _props: p2, shouldAddSpace: m2, handleClick: h2 }; }; const Av = ["default", "primary", "success", "warning", "info", "danger", "text", ""]; const Ev = ["button", "submit", "reset"]; const $v = Cs({ size: Nc, disabled: Boolean, type: { type: String, values: Av, default: "" }, icon: { type: _s }, nativeType: { type: String, values: Ev, default: "button" }, loading: Boolean, loadingIcon: { type: _s, default: () => ms }, plain: Boolean, text: Boolean, link: Boolean, bg: Boolean, autofocus: Boolean, round: Boolean, circle: Boolean, color: String, dark: Boolean, autoInsertSpace: { type: Boolean, default: void 0 }, tag: { type: ks([String, Object]), default: "button" } }); const Lv = { click: (e2) => e2 instanceof MouseEvent }; function Iv(e2, t2) { if (Pv(e2)) { e2 = "100%"; } var n2 = Bv(e2); e2 = t2 === 360 ? e2 : Math.min(t2, Math.max(0, parseFloat(e2))); if (n2) { e2 = parseInt(String(e2 * t2), 10) / 100; } if (Math.abs(e2 - t2) < 1e-6) { return 1; } if (t2 === 360) { e2 = (e2 < 0 ? e2 % t2 + t2 : e2 % t2) / parseFloat(String(t2)); } else { e2 = e2 % t2 / parseFloat(String(t2)); } return e2; } function Tv(e2) { return Math.min(1, Math.max(0, e2)); } function Pv(e2) { return typeof e2 === "string" && e2.indexOf(".") !== -1 && parseFloat(e2) === 1; } function Bv(e2) { return typeof e2 === "string" && e2.indexOf("%") !== -1; } function Rv(e2) { e2 = parseFloat(e2); if (isNaN(e2) || e2 < 0 || e2 > 1) { e2 = 1; } return e2; } function Vv(e2) { if (e2 <= 1) { return "".concat(Number(e2) * 100, "%"); } return e2; } function Fv(e2) { return e2.length === 1 ? "0" + e2 : String(e2); } function jv(e2, t2, n2) { return { r: Iv(e2, 255) * 255, g: Iv(t2, 255) * 255, b: Iv(n2, 255) * 255 }; } function zv(e2, t2, n2) { e2 = Iv(e2, 255); t2 = Iv(t2, 255); n2 = Iv(n2, 255); var a2 = Math.max(e2, t2, n2); var o2 = Math.min(e2, t2, n2); var r2 = 0; var l2 = 0; var s2 = (a2 + o2) / 2; if (a2 === o2) { l2 = 0; r2 = 0; } else { var i2 = a2 - o2; l2 = s2 > 0.5 ? i2 / (2 - a2 - o2) : i2 / (a2 + o2); switch (a2) { case e2: r2 = (t2 - n2) / i2 + (t2 < n2 ? 6 : 0); break; case t2: r2 = (n2 - e2) / i2 + 2; break; case n2: r2 = (e2 - t2) / i2 + 4; break; } r2 /= 6; } return { h: r2, s: l2, l: s2 }; } function Nv(e2, t2, n2) { if (n2 < 0) { n2 += 1; } if (n2 > 1) { n2 -= 1; } if (n2 < 1 / 6) { return e2 + (t2 - e2) * (6 * n2); } if (n2 < 1 / 2) { return t2; } if (n2 < 2 / 3) { return e2 + (t2 - e2) * (2 / 3 - n2) * 6; } return e2; } function Hv(e2, t2, n2) { var a2; var o2; var r2; e2 = Iv(e2, 360); t2 = Iv(t2, 100); n2 = Iv(n2, 100); if (t2 === 0) { o2 = n2; r2 = n2; a2 = n2; } else { var l2 = n2 < 0.5 ? n2 * (1 + t2) : n2 + t2 - n2 * t2; var s2 = 2 * n2 - l2; a2 = Nv(s2, l2, e2 + 1 / 3); o2 = Nv(s2, l2, e2); r2 = Nv(s2, l2, e2 - 1 / 3); } return { r: a2 * 255, g: o2 * 255, b: r2 * 255 }; } function Yv(e2, t2, n2) { e2 = Iv(e2, 255); t2 = Iv(t2, 255); n2 = Iv(n2, 255); var a2 = Math.max(e2, t2, n2); var o2 = Math.min(e2, t2, n2); var r2 = 0; var l2 = a2; var s2 = a2 - o2; var i2 = a2 === 0 ? 0 : s2 / a2; if (a2 === o2) { r2 = 0; } else { switch (a2) { case e2: r2 = (t2 - n2) / s2 + (t2 < n2 ? 6 : 0); break; case t2: r2 = (n2 - e2) / s2 + 2; break; case n2: r2 = (e2 - t2) / s2 + 4; break; } r2 /= 6; } return { h: r2, s: i2, v: l2 }; } function Wv(e2, t2, n2) { e2 = Iv(e2, 360) * 6; t2 = Iv(t2, 100); n2 = Iv(n2, 100); var a2 = Math.floor(e2); var o2 = e2 - a2; var r2 = n2 * (1 - t2); var l2 = n2 * (1 - o2 * t2); var s2 = n2 * (1 - (1 - o2) * t2); var i2 = a2 % 6; var u2 = [n2, l2, r2, r2, s2, n2][i2]; var c2 = [s2, n2, n2, l2, r2, r2][i2]; var d2 = [r2, r2, s2, n2, n2, l2][i2]; return { r: u2 * 255, g: c2 * 255, b: d2 * 255 }; } function Uv(e2, t2, n2, a2) { var o2 = [Fv(Math.round(e2).toString(16)), Fv(Math.round(t2).toString(16)), Fv(Math.round(n2).toString(16))]; if (a2 && o2[0].startsWith(o2[0].charAt(1)) && o2[1].startsWith(o2[1].charAt(1)) && o2[2].startsWith(o2[2].charAt(1))) { return o2[0].charAt(0) + o2[1].charAt(0) + o2[2].charAt(0); } return o2.join(""); } function Kv(e2, t2, n2, a2, o2) { var r2 = [Fv(Math.round(e2).toString(16)), Fv(Math.round(t2).toString(16)), Fv(Math.round(n2).toString(16)), Fv(qv(a2))]; if (o2 && r2[0].startsWith(r2[0].charAt(1)) && r2[1].startsWith(r2[1].charAt(1)) && r2[2].startsWith(r2[2].charAt(1)) && r2[3].startsWith(r2[3].charAt(1))) { return r2[0].charAt(0) + r2[1].charAt(0) + r2[2].charAt(0) + r2[3].charAt(0); } return r2.join(""); } function qv(e2) { return Math.round(parseFloat(e2) * 255).toString(16); } function Gv(e2) { return Zv(e2) / 255; } function Zv(e2) { return parseInt(e2, 16); } function Jv(e2) { return { r: e2 >> 16, g: (e2 & 65280) >> 8, b: e2 & 255 }; } var Xv = { aliceblue: "#f0f8ff", antiquewhite: "#faebd7", aqua: "#00ffff", aquamarine: "#7fffd4", azure: "#f0ffff", beige: "#f5f5dc", bisque: "#ffe4c4", black: "#000000", blanchedalmond: "#ffebcd", blue: "#0000ff", blueviolet: "#8a2be2", brown: "#a52a2a", burlywood: "#deb887", cadetblue: "#5f9ea0", chartreuse: "#7fff00", chocolate: "#d2691e", coral: "#ff7f50", cornflowerblue: "#6495ed", cornsilk: "#fff8dc", crimson: "#dc143c", cyan: "#00ffff", darkblue: "#00008b", darkcyan: "#008b8b", darkgoldenrod: "#b8860b", darkgray: "#a9a9a9", darkgreen: "#006400", darkgrey: "#a9a9a9", darkkhaki: "#bdb76b", darkmagenta: "#8b008b", darkolivegreen: "#556b2f", darkorange: "#ff8c00", darkorchid: "#9932cc", darkred: "#8b0000", darksalmon: "#e9967a", darkseagreen: "#8fbc8f", darkslateblue: "#483d8b", darkslategray: "#2f4f4f", darkslategrey: "#2f4f4f", darkturquoise: "#00ced1", darkviolet: "#9400d3", deeppink: "#ff1493", deepskyblue: "#00bfff", dimgray: "#696969", dimgrey: "#696969", dodgerblue: "#1e90ff", firebrick: "#b22222", floralwhite: "#fffaf0", forestgreen: "#228b22", fuchsia: "#ff00ff", gainsboro: "#dcdcdc", ghostwhite: "#f8f8ff", goldenrod: "#daa520", gold: "#ffd700", gray: "#808080", green: "#008000", greenyellow: "#adff2f", grey: "#808080", honeydew: "#f0fff0", hotpink: "#ff69b4", indianred: "#cd5c5c", indigo: "#4b0082", ivory: "#fffff0", khaki: "#f0e68c", lavenderblush: "#fff0f5", lavender: "#e6e6fa", lawngreen: "#7cfc00", lemonchiffon: "#fffacd", lightblue: "#add8e6", lightcoral: "#f08080", lightcyan: "#e0ffff", lightgoldenrodyellow: "#fafad2", lightgray: "#d3d3d3", lightgreen: "#90ee90", lightgrey: "#d3d3d3", lightpink: "#ffb6c1", lightsalmon: "#ffa07a", lightseagreen: "#20b2aa", lightskyblue: "#87cefa", lightslategray: "#778899", lightslategrey: "#778899", lightsteelblue: "#b0c4de", lightyellow: "#ffffe0", lime: "#00ff00", limegreen: "#32cd32", linen: "#faf0e6", magenta: "#ff00ff", maroon: "#800000", mediumaquamarine: "#66cdaa", mediumblue: "#0000cd", mediumorchid: "#ba55d3", mediumpurple: "#9370db", mediumseagreen: "#3cb371", mediumslateblue: "#7b68ee", mediumspringgreen: "#00fa9a", mediumturquoise: "#48d1cc", mediumvioletred: "#c71585", midnightblue: "#191970", mintcream: "#f5fffa", mistyrose: "#ffe4e1", moccasin: "#ffe4b5", navajowhite: "#ffdead", navy: "#000080", oldlace: "#fdf5e6", olive: "#808000", olivedrab: "#6b8e23", orange: "#ffa500", orangered: "#ff4500", orchid: "#da70d6", palegoldenrod: "#eee8aa", palegreen: "#98fb98", paleturquoise: "#afeeee", palevioletred: "#db7093", papayawhip: "#ffefd5", peachpuff: "#ffdab9", peru: "#cd853f", pink: "#ffc0cb", plum: "#dda0dd", powderblue: "#b0e0e6", purple: "#800080", rebeccapurple: "#663399", red: "#ff0000", rosybrown: "#bc8f8f", royalblue: "#4169e1", saddlebrown: "#8b4513", salmon: "#fa8072", sandybrown: "#f4a460", seagreen: "#2e8b57", seashell: "#fff5ee", sienna: "#a0522d", silver: "#c0c0c0", skyblue: "#87ceeb", slateblue: "#6a5acd", slategray: "#708090", slategrey: "#708090", snow: "#fffafa", springgreen: "#00ff7f", steelblue: "#4682b4", tan: "#d2b48c", teal: "#008080", thistle: "#d8bfd8", tomato: "#ff6347", turquoise: "#40e0d0", violet: "#ee82ee", wheat: "#f5deb3", white: "#ffffff", whitesmoke: "#f5f5f5", yellow: "#ffff00", yellowgreen: "#9acd32" }; function Qv(e2) { var t2 = { r: 0, g: 0, b: 0 }; var n2 = 1; var a2 = null; var o2 = null; var r2 = null; var l2 = false; var s2 = false; if (typeof e2 === "string") { e2 = lp(e2); } if (typeof e2 === "object") { if (sp(e2.r) && sp(e2.g) && sp(e2.b)) { t2 = jv(e2.r, e2.g, e2.b); l2 = true; s2 = String(e2.r).substr(-1) === "%" ? "prgb" : "rgb"; } else if (sp(e2.h) && sp(e2.s) && sp(e2.v)) { a2 = Vv(e2.s); o2 = Vv(e2.v); t2 = Wv(e2.h, a2, o2); l2 = true; s2 = "hsv"; } else if (sp(e2.h) && sp(e2.s) && sp(e2.l)) { a2 = Vv(e2.s); r2 = Vv(e2.l); t2 = Hv(e2.h, a2, r2); l2 = true; s2 = "hsl"; } if (Object.prototype.hasOwnProperty.call(e2, "a")) { n2 = e2.a; } } n2 = Rv(n2); return { ok: l2, format: e2.format || s2, r: Math.min(255, Math.max(t2.r, 0)), g: Math.min(255, Math.max(t2.g, 0)), b: Math.min(255, Math.max(t2.b, 0)), a: n2 }; } var ep = "[-\\+]?\\d+%?"; var tp = "[-\\+]?\\d*\\.\\d+%?"; var np = "(?:".concat(tp, ")|(?:").concat(ep, ")"); var ap = "[\\s|\\(]+(".concat(np, ")[,|\\s]+(").concat(np, ")[,|\\s]+(").concat(np, ")\\s*\\)?"); var op = "[\\s|\\(]+(".concat(np, ")[,|\\s]+(").concat(np, ")[,|\\s]+(").concat(np, ")[,|\\s]+(").concat(np, ")\\s*\\)?"); var rp = { CSS_UNIT: new RegExp(np), rgb: new RegExp("rgb" + ap), rgba: new RegExp("rgba" + op), hsl: new RegExp("hsl" + ap), hsla: new RegExp("hsla" + op), hsv: new RegExp("hsv" + ap), hsva: new RegExp("hsva" + op), hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/, hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/ }; function lp(e2) { e2 = e2.trim().toLowerCase(); if (e2.length === 0) { return false; } var t2 = false; if (Xv[e2]) { e2 = Xv[e2]; t2 = true; } else if (e2 === "transparent") { return { r: 0, g: 0, b: 0, a: 0, format: "name" }; } var n2 = rp.rgb.exec(e2); if (n2) { return { r: n2[1], g: n2[2], b: n2[3] }; } n2 = rp.rgba.exec(e2); if (n2) { return { r: n2[1], g: n2[2], b: n2[3], a: n2[4] }; } n2 = rp.hsl.exec(e2); if (n2) { return { h: n2[1], s: n2[2], l: n2[3] }; } n2 = rp.hsla.exec(e2); if (n2) { return { h: n2[1], s: n2[2], l: n2[3], a: n2[4] }; } n2 = rp.hsv.exec(e2); if (n2) { return { h: n2[1], s: n2[2], v: n2[3] }; } n2 = rp.hsva.exec(e2); if (n2) { return { h: n2[1], s: n2[2], v: n2[3], a: n2[4] }; } n2 = rp.hex8.exec(e2); if (n2) { return { r: Zv(n2[1]), g: Zv(n2[2]), b: Zv(n2[3]), a: Gv(n2[4]), format: t2 ? "name" : "hex8" }; } n2 = rp.hex6.exec(e2); if (n2) { return { r: Zv(n2[1]), g: Zv(n2[2]), b: Zv(n2[3]), format: t2 ? "name" : "hex" }; } n2 = rp.hex4.exec(e2); if (n2) { return { r: Zv(n2[1] + n2[1]), g: Zv(n2[2] + n2[2]), b: Zv(n2[3] + n2[3]), a: Gv(n2[4] + n2[4]), format: t2 ? "name" : "hex8" }; } n2 = rp.hex3.exec(e2); if (n2) { return { r: Zv(n2[1] + n2[1]), g: Zv(n2[2] + n2[2]), b: Zv(n2[3] + n2[3]), format: t2 ? "name" : "hex" }; } return false; } function sp(e2) { return Boolean(rp.CSS_UNIT.exec(String(e2))); } var ip = function() { function e2(t2, n2) { if (t2 === void 0) { t2 = ""; } if (n2 === void 0) { n2 = {}; } var a2; if (t2 instanceof e2) { return t2; } if (typeof t2 === "number") { t2 = Jv(t2); } this.originalInput = t2; var o2 = Qv(t2); this.originalInput = t2; this.r = o2.r; this.g = o2.g; this.b = o2.b; this.a = o2.a; this.roundA = Math.round(100 * this.a) / 100; this.format = (a2 = n2.format) !== null && a2 !== void 0 ? a2 : o2.format; this.gradientType = n2.gradientType; if (this.r < 1) { this.r = Math.round(this.r); } if (this.g < 1) { this.g = Math.round(this.g); } if (this.b < 1) { this.b = Math.round(this.b); } this.isValid = o2.ok; } e2.prototype.isDark = function() { return this.getBrightness() < 128; }; e2.prototype.isLight = function() { return !this.isDark(); }; e2.prototype.getBrightness = function() { var e3 = this.toRgb(); return (e3.r * 299 + e3.g * 587 + e3.b * 114) / 1e3; }; e2.prototype.getLuminance = function() { var e3 = this.toRgb(); var t2; var n2; var a2; var o2 = e3.r / 255; var r2 = e3.g / 255; var l2 = e3.b / 255; if (o2 <= 0.03928) { t2 = o2 / 12.92; } else { t2 = Math.pow((o2 + 0.055) / 1.055, 2.4); } if (r2 <= 0.03928) { n2 = r2 / 12.92; } else { n2 = Math.pow((r2 + 0.055) / 1.055, 2.4); } if (l2 <= 0.03928) { a2 = l2 / 12.92; } else { a2 = Math.pow((l2 + 0.055) / 1.055, 2.4); } return 0.2126 * t2 + 0.7152 * n2 + 0.0722 * a2; }; e2.prototype.getAlpha = function() { return this.a; }; e2.prototype.setAlpha = function(e3) { this.a = Rv(e3); this.roundA = Math.round(100 * this.a) / 100; return this; }; e2.prototype.isMonochrome = function() { var e3 = this.toHsl().s; return e3 === 0; }; e2.prototype.toHsv = function() { var e3 = Yv(this.r, this.g, this.b); return { h: e3.h * 360, s: e3.s, v: e3.v, a: this.a }; }; e2.prototype.toHsvString = function() { var e3 = Yv(this.r, this.g, this.b); var t2 = Math.round(e3.h * 360); var n2 = Math.round(e3.s * 100); var a2 = Math.round(e3.v * 100); return this.a === 1 ? "hsv(".concat(t2, ", ").concat(n2, "%, ").concat(a2, "%)") : "hsva(".concat(t2, ", ").concat(n2, "%, ").concat(a2, "%, ").concat(this.roundA, ")"); }; e2.prototype.toHsl = function() { var e3 = zv(this.r, this.g, this.b); return { h: e3.h * 360, s: e3.s, l: e3.l, a: this.a }; }; e2.prototype.toHslString = function() { var e3 = zv(this.r, this.g, this.b); var t2 = Math.round(e3.h * 360); var n2 = Math.round(e3.s * 100); var a2 = Math.round(e3.l * 100); return this.a === 1 ? "hsl(".concat(t2, ", ").concat(n2, "%, ").concat(a2, "%)") : "hsla(".concat(t2, ", ").concat(n2, "%, ").concat(a2, "%, ").concat(this.roundA, ")"); }; e2.prototype.toHex = function(e3) { if (e3 === void 0) { e3 = false; } return Uv(this.r, this.g, this.b, e3); }; e2.prototype.toHexString = function(e3) { if (e3 === void 0) { e3 = false; } return "#" + this.toHex(e3); }; e2.prototype.toHex8 = function(e3) { if (e3 === void 0) { e3 = false; } return Kv(this.r, this.g, this.b, this.a, e3); }; e2.prototype.toHex8String = function(e3) { if (e3 === void 0) { e3 = false; } return "#" + this.toHex8(e3); }; e2.prototype.toHexShortString = function(e3) { if (e3 === void 0) { e3 = false; } return this.a === 1 ? this.toHexString(e3) : this.toHex8String(e3); }; e2.prototype.toRgb = function() { return { r: Math.round(this.r), g: Math.round(this.g), b: Math.round(this.b), a: this.a }; }; e2.prototype.toRgbString = function() { var e3 = Math.round(this.r); var t2 = Math.round(this.g); var n2 = Math.round(this.b); return this.a === 1 ? "rgb(".concat(e3, ", ").concat(t2, ", ").concat(n2, ")") : "rgba(".concat(e3, ", ").concat(t2, ", ").concat(n2, ", ").concat(this.roundA, ")"); }; e2.prototype.toPercentageRgb = function() { var e3 = function(e4) { return "".concat(Math.round(Iv(e4, 255) * 100), "%"); }; return { r: e3(this.r), g: e3(this.g), b: e3(this.b), a: this.a }; }; e2.prototype.toPercentageRgbString = function() { var e3 = function(e4) { return Math.round(Iv(e4, 255) * 100); }; return this.a === 1 ? "rgb(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%)") : "rgba(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%, ").concat(this.roundA, ")"); }; e2.prototype.toName = function() { if (this.a === 0) { return "transparent"; } if (this.a < 1) { return false; } var e3 = "#" + Uv(this.r, this.g, this.b, false); for (var t2 = 0, n2 = Object.entries(Xv); t2 < n2.length; t2++) { var a2 = n2[t2], o2 = a2[0], r2 = a2[1]; if (e3 === r2) { return o2; } } return false; }; e2.prototype.toString = function(e3) { var t2 = Boolean(e3); e3 = e3 !== null && e3 !== void 0 ? e3 : this.format; var n2 = false; var a2 = this.a < 1 && this.a >= 0; var o2 = !t2 && a2 && (e3.startsWith("hex") || e3 === "name"); if (o2) { if (e3 === "name" && this.a === 0) { return this.toName(); } return this.toRgbString(); } if (e3 === "rgb") { n2 = this.toRgbString(); } if (e3 === "prgb") { n2 = this.toPercentageRgbString(); } if (e3 === "hex" || e3 === "hex6") { n2 = this.toHexString(); } if (e3 === "hex3") { n2 = this.toHexString(true); } if (e3 === "hex4") { n2 = this.toHex8String(true); } if (e3 === "hex8") { n2 = this.toHex8String(); } if (e3 === "name") { n2 = this.toName(); } if (e3 === "hsl") { n2 = this.toHslString(); } if (e3 === "hsv") { n2 = this.toHsvString(); } return n2 || this.toHexString(); }; e2.prototype.toNumber = function() { return (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b); }; e2.prototype.clone = function() { return new e2(this.toString()); }; e2.prototype.lighten = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toHsl(); n2.l += t2 / 100; n2.l = Tv(n2.l); return new e2(n2); }; e2.prototype.brighten = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toRgb(); n2.r = Math.max(0, Math.min(255, n2.r - Math.round(255 * -(t2 / 100)))); n2.g = Math.max(0, Math.min(255, n2.g - Math.round(255 * -(t2 / 100)))); n2.b = Math.max(0, Math.min(255, n2.b - Math.round(255 * -(t2 / 100)))); return new e2(n2); }; e2.prototype.darken = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toHsl(); n2.l -= t2 / 100; n2.l = Tv(n2.l); return new e2(n2); }; e2.prototype.tint = function(e3) { if (e3 === void 0) { e3 = 10; } return this.mix("white", e3); }; e2.prototype.shade = function(e3) { if (e3 === void 0) { e3 = 10; } return this.mix("black", e3); }; e2.prototype.desaturate = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toHsl(); n2.s -= t2 / 100; n2.s = Tv(n2.s); return new e2(n2); }; e2.prototype.saturate = function(t2) { if (t2 === void 0) { t2 = 10; } var n2 = this.toHsl(); n2.s += t2 / 100; n2.s = Tv(n2.s); return new e2(n2); }; e2.prototype.greyscale = function() { return this.desaturate(100); }; e2.prototype.spin = function(t2) { var n2 = this.toHsl(); var a2 = (n2.h + t2) % 360; n2.h = a2 < 0 ? 360 + a2 : a2; return new e2(n2); }; e2.prototype.mix = function(t2, n2) { if (n2 === void 0) { n2 = 50; } var a2 = this.toRgb(); var o2 = new e2(t2).toRgb(); var r2 = n2 / 100; var l2 = { r: (o2.r - a2.r) * r2 + a2.r, g: (o2.g - a2.g) * r2 + a2.g, b: (o2.b - a2.b) * r2 + a2.b, a: (o2.a - a2.a) * r2 + a2.a }; return new e2(l2); }; e2.prototype.analogous = function(t2, n2) { if (t2 === void 0) { t2 = 6; } if (n2 === void 0) { n2 = 30; } var a2 = this.toHsl(); var o2 = 360 / n2; var r2 = [this]; for (a2.h = (a2.h - (o2 * t2 >> 1) + 720) % 360; --t2; ) { a2.h = (a2.h + o2) % 360; r2.push(new e2(a2)); } return r2; }; e2.prototype.complement = function() { var t2 = this.toHsl(); t2.h = (t2.h + 180) % 360; return new e2(t2); }; e2.prototype.monochromatic = function(t2) { if (t2 === void 0) { t2 = 6; } var n2 = this.toHsv(); var a2 = n2.h; var o2 = n2.s; var r2 = n2.v; var l2 = []; var s2 = 1 / t2; while (t2--) { l2.push(new e2({ h: a2, s: o2, v: r2 })); r2 = (r2 + s2) % 1; } return l2; }; e2.prototype.splitcomplement = function() { var t2 = this.toHsl(); var n2 = t2.h; return [this, new e2({ h: (n2 + 72) % 360, s: t2.s, l: t2.l }), new e2({ h: (n2 + 216) % 360, s: t2.s, l: t2.l })]; }; e2.prototype.onBackground = function(t2) { var n2 = this.toRgb(); var a2 = new e2(t2).toRgb(); var o2 = n2.a + a2.a * (1 - n2.a); return new e2({ r: (n2.r * n2.a + a2.r * a2.a * (1 - n2.a)) / o2, g: (n2.g * n2.a + a2.g * a2.a * (1 - n2.a)) / o2, b: (n2.b * n2.a + a2.b * a2.a * (1 - n2.a)) / o2, a: o2 }); }; e2.prototype.triad = function() { return this.polyad(3); }; e2.prototype.tetrad = function() { return this.polyad(4); }; e2.prototype.polyad = function(t2) { var n2 = this.toHsl(); var a2 = n2.h; var o2 = [this]; var r2 = 360 / t2; for (var l2 = 1; l2 < t2; l2++) { o2.push(new e2({ h: (a2 + l2 * r2) % 360, s: n2.s, l: n2.l })); } return o2; }; e2.prototype.equals = function(t2) { return this.toRgbString() === new e2(t2).toRgbString(); }; return e2; }(); function up(e2, t2 = 20) { return e2.mix("#141414", t2).toString(); } function cp(e2) { const t2 = fd(); const n2 = oi("button"); return vue.computed(() => { let a2 = {}; const o2 = e2.color; if (o2) { const r2 = new ip(o2); const l2 = e2.dark ? r2.tint(20).toString() : up(r2, 20); if (e2.plain) { a2 = n2.cssVarBlock({ "bg-color": e2.dark ? up(r2, 90) : r2.tint(90).toString(), "text-color": o2, "border-color": e2.dark ? up(r2, 50) : r2.tint(50).toString(), "hover-text-color": `var(${n2.cssVarName("color-white")})`, "hover-bg-color": o2, "hover-border-color": o2, "active-bg-color": l2, "active-text-color": `var(${n2.cssVarName("color-white")})`, "active-border-color": l2 }); if (t2.value) { a2[n2.cssVarBlockName("disabled-bg-color")] = e2.dark ? up(r2, 90) : r2.tint(90).toString(); a2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? up(r2, 50) : r2.tint(50).toString(); a2[n2.cssVarBlockName("disabled-border-color")] = e2.dark ? up(r2, 80) : r2.tint(80).toString(); } } else { const s2 = e2.dark ? up(r2, 30) : r2.tint(30).toString(); const i2 = r2.isDark() ? `var(${n2.cssVarName("color-white")})` : `var(${n2.cssVarName("color-black")})`; a2 = n2.cssVarBlock({ "bg-color": o2, "text-color": i2, "border-color": o2, "hover-bg-color": s2, "hover-text-color": i2, "hover-border-color": s2, "active-bg-color": l2, "active-border-color": l2 }); if (t2.value) { const t3 = e2.dark ? up(r2, 50) : r2.tint(50).toString(); a2[n2.cssVarBlockName("disabled-bg-color")] = t3; a2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? "rgba(255, 255, 255, 0.5)" : `var(${n2.cssVarName("color-white")})`; a2[n2.cssVarBlockName("disabled-border-color")] = t3; } } } return a2; }); } const dp = vue.defineComponent({ name: "ElButton" }); const fp = vue.defineComponent({ ...dp, props: $v, emits: Lv, setup(e2, { expose: a2, emit: o2 }) { const l2 = e2; const s2 = cp(l2); const u2 = oi("button"); const { _ref: c2, _size: d2, _type: f2, _disabled: v2, _props: p2, shouldAddSpace: m2, handleClick: h2 } = Dv(l2, o2); const b2 = vue.computed(() => [u2.b(), u2.m(f2.value), u2.m(d2.value), u2.is("disabled", v2.value), u2.is("loading", l2.loading), u2.is("plain", l2.plain), u2.is("round", l2.round), u2.is("circle", l2.circle), u2.is("text", l2.text), u2.is("link", l2.link), u2.is("has-bg", l2.bg)]); a2({ ref: c2, size: d2, type: f2, disabled: v2, shouldAddSpace: m2 }); return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), vue.mergeProps({ ref_key: "_ref", ref: c2 }, vue.unref(p2), { class: vue.unref(b2), style: vue.unref(s2), onClick: vue.unref(h2) }), { default: vue.withCtx(() => [e3.loading ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [e3.$slots.loading ? vue.renderSlot(e3.$slots, "loading", { key: 0 }) : (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 1, class: vue.normalizeClass(vue.unref(u2).is("loading")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.loadingIcon)))]), _: 1 }, 8, ["class"]))], 64)) : e3.icon || e3.$slots.icon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 1 }, { default: vue.withCtx(() => [e3.icon ? (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.icon), { key: 0 })) : vue.renderSlot(e3.$slots, "icon", { key: 1 })]), _: 3 })) : vue.createCommentVNode("v-if", true), e3.$slots.default ? (vue.openBlock(), vue.createElementBlock("span", { key: 2, class: vue.normalizeClass({ [vue.unref(u2).em("text", "expand")]: vue.unref(m2) }) }, [vue.renderSlot(e3.$slots, "default")], 2)) : vue.createCommentVNode("v-if", true)]), _: 3 }, 16, ["class", "style", "onClick"])); } }); var vp = ad(fp, [["__file", "button.vue"]]); const pp = { size: $v.size, type: $v.type }; const mp = vue.defineComponent({ name: "ElButtonGroup" }); const hp = vue.defineComponent({ ...mp, props: pp, setup(e2) { const a2 = e2; vue.provide(Ov, vue.reactive({ size: vue.toRef(a2, "size"), type: vue.toRef(a2, "type") })); const o2 = oi("button"); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(`${vue.unref(o2).b("group")}`) }, [vue.renderSlot(e3.$slots, "default")], 2)); } }); var bp = ad(hp, [["__file", "button-group.vue"]]); const gp = Ds(vp, { ButtonGroup: bp }); As(bp); var yp = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {}; function wp(e2) { return e2 && e2.__esModule && Object.prototype.hasOwnProperty.call(e2, "default") ? e2["default"] : e2; } var kp = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { var e3 = 1e3, t3 = 6e4, n2 = 36e5, a2 = "millisecond", o2 = "second", r2 = "minute", l2 = "hour", s2 = "day", i2 = "week", u2 = "month", c2 = "quarter", d2 = "year", f2 = "date", v2 = "Invalid Date", p2 = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, m2 = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, h2 = { name: "en", weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), ordinal: function(e4) { var t4 = ["th", "st", "nd", "rd"], n3 = e4 % 100; return "[" + e4 + (t4[(n3 - 20) % 10] || t4[n3] || t4[0]) + "]"; } }, b2 = function(e4, t4, n3) { var a3 = String(e4); return !a3 || a3.length >= t4 ? e4 : "" + Array(t4 + 1 - a3.length).join(n3) + e4; }, g2 = { s: b2, z: function(e4) { var t4 = -e4.utcOffset(), n3 = Math.abs(t4), a3 = Math.floor(n3 / 60), o3 = n3 % 60; return (t4 <= 0 ? "+" : "-") + b2(a3, 2, "0") + ":" + b2(o3, 2, "0"); }, m: function e4(t4, n3) { if (t4.date() < n3.date()) return -e4(n3, t4); var a3 = 12 * (n3.year() - t4.year()) + (n3.month() - t4.month()), o3 = t4.clone().add(a3, u2), r3 = n3 - o3 < 0, l3 = t4.clone().add(a3 + (r3 ? -1 : 1), u2); return +(-(a3 + (n3 - o3) / (r3 ? o3 - l3 : l3 - o3)) || 0); }, a: function(e4) { return e4 < 0 ? Math.ceil(e4) || 0 : Math.floor(e4); }, p: function(e4) { return { M: u2, y: d2, w: i2, d: s2, D: f2, h: l2, m: r2, s: o2, ms: a2, Q: c2 }[e4] || String(e4 || "").toLowerCase().replace(/s$/, ""); }, u: function(e4) { return void 0 === e4; } }, y2 = "en", w2 = {}; w2[y2] = h2; var k2 = "$isDayjsObject", x2 = function(e4) { return e4 instanceof M2 || !(!e4 || !e4[k2]); }, S2 = function e4(t4, n3, a3) { var o3; if (!t4) return y2; if ("string" == typeof t4) { var r3 = t4.toLowerCase(); w2[r3] && (o3 = r3), n3 && (w2[r3] = n3, o3 = r3); var l3 = t4.split("-"); if (!o3 && l3.length > 1) return e4(l3[0]); } else { var s3 = t4.name; w2[s3] = t4, o3 = s3; } return !a3 && o3 && (y2 = o3), o3 || !a3 && y2; }, C2 = function(e4, t4) { if (x2(e4)) return e4.clone(); var n3 = "object" == typeof t4 ? t4 : {}; return n3.date = e4, n3.args = arguments, new M2(n3); }, _2 = g2; _2.l = S2, _2.i = x2, _2.w = function(e4, t4) { return C2(e4, { locale: t4.$L, utc: t4.$u, x: t4.$x, $offset: t4.$offset }); }; var M2 = function() { function h3(e4) { this.$L = S2(e4.locale, null, true), this.parse(e4), this.$x = this.$x || e4.x || {}, this[k2] = true; } var b3 = h3.prototype; return b3.parse = function(e4) { this.$d = function(e5) { var t4 = e5.date, n3 = e5.utc; if (null === t4) return /* @__PURE__ */ new Date(NaN); if (_2.u(t4)) return /* @__PURE__ */ new Date(); if (t4 instanceof Date) return new Date(t4); if ("string" == typeof t4 && !/Z$/i.test(t4)) { var a3 = t4.match(p2); if (a3) { var o3 = a3[2] - 1 || 0, r3 = (a3[7] || "0").substring(0, 3); return n3 ? new Date(Date.UTC(a3[1], o3, a3[3] || 1, a3[4] || 0, a3[5] || 0, a3[6] || 0, r3)) : new Date(a3[1], o3, a3[3] || 1, a3[4] || 0, a3[5] || 0, a3[6] || 0, r3); } } return new Date(t4); }(e4), this.init(); }, b3.init = function() { var e4 = this.$d; this.$y = e4.getFullYear(), this.$M = e4.getMonth(), this.$D = e4.getDate(), this.$W = e4.getDay(), this.$H = e4.getHours(), this.$m = e4.getMinutes(), this.$s = e4.getSeconds(), this.$ms = e4.getMilliseconds(); }, b3.$utils = function() { return _2; }, b3.isValid = function() { return !(this.$d.toString() === v2); }, b3.isSame = function(e4, t4) { var n3 = C2(e4); return this.startOf(t4) <= n3 && n3 <= this.endOf(t4); }, b3.isAfter = function(e4, t4) { return C2(e4) < this.startOf(t4); }, b3.isBefore = function(e4, t4) { return this.endOf(t4) < C2(e4); }, b3.$g = function(e4, t4, n3) { return _2.u(e4) ? this[t4] : this.set(n3, e4); }, b3.unix = function() { return Math.floor(this.valueOf() / 1e3); }, b3.valueOf = function() { return this.$d.getTime(); }, b3.startOf = function(e4, t4) { var n3 = this, a3 = !!_2.u(t4) || t4, c3 = _2.p(e4), v3 = function(e5, t5) { var o3 = _2.w(n3.$u ? Date.UTC(n3.$y, t5, e5) : new Date(n3.$y, t5, e5), n3); return a3 ? o3 : o3.endOf(s2); }, p3 = function(e5, t5) { return _2.w(n3.toDate()[e5].apply(n3.toDate("s"), (a3 ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(t5)), n3); }, m3 = this.$W, h4 = this.$M, b4 = this.$D, g3 = "set" + (this.$u ? "UTC" : ""); switch (c3) { case d2: return a3 ? v3(1, 0) : v3(31, 11); case u2: return a3 ? v3(1, h4) : v3(0, h4 + 1); case i2: var y3 = this.$locale().weekStart || 0, w3 = (m3 < y3 ? m3 + 7 : m3) - y3; return v3(a3 ? b4 - w3 : b4 + (6 - w3), h4); case s2: case f2: return p3(g3 + "Hours", 0); case l2: return p3(g3 + "Minutes", 1); case r2: return p3(g3 + "Seconds", 2); case o2: return p3(g3 + "Milliseconds", 3); default: return this.clone(); } }, b3.endOf = function(e4) { return this.startOf(e4, false); }, b3.$set = function(e4, t4) { var n3, i3 = _2.p(e4), c3 = "set" + (this.$u ? "UTC" : ""), v3 = (n3 = {}, n3[s2] = c3 + "Date", n3[f2] = c3 + "Date", n3[u2] = c3 + "Month", n3[d2] = c3 + "FullYear", n3[l2] = c3 + "Hours", n3[r2] = c3 + "Minutes", n3[o2] = c3 + "Seconds", n3[a2] = c3 + "Milliseconds", n3)[i3], p3 = i3 === s2 ? this.$D + (t4 - this.$W) : t4; if (i3 === u2 || i3 === d2) { var m3 = this.clone().set(f2, 1); m3.$d[v3](p3), m3.init(), this.$d = m3.set(f2, Math.min(this.$D, m3.daysInMonth())).$d; } else v3 && this.$d[v3](p3); return this.init(), this; }, b3.set = function(e4, t4) { return this.clone().$set(e4, t4); }, b3.get = function(e4) { return this[_2.p(e4)](); }, b3.add = function(a3, c3) { var f3, v3 = this; a3 = Number(a3); var p3 = _2.p(c3), m3 = function(e4) { var t4 = C2(v3); return _2.w(t4.date(t4.date() + Math.round(e4 * a3)), v3); }; if (p3 === u2) return this.set(u2, this.$M + a3); if (p3 === d2) return this.set(d2, this.$y + a3); if (p3 === s2) return m3(1); if (p3 === i2) return m3(7); var h4 = (f3 = {}, f3[r2] = t3, f3[l2] = n2, f3[o2] = e3, f3)[p3] || 1, b4 = this.$d.getTime() + a3 * h4; return _2.w(b4, this); }, b3.subtract = function(e4, t4) { return this.add(-1 * e4, t4); }, b3.format = function(e4) { var t4 = this, n3 = this.$locale(); if (!this.isValid()) return n3.invalidDate || v2; var a3 = e4 || "YYYY-MM-DDTHH:mm:ssZ", o3 = _2.z(this), r3 = this.$H, l3 = this.$m, s3 = this.$M, i3 = n3.weekdays, u3 = n3.months, c3 = n3.meridiem, d3 = function(e5, n4, o4, r4) { return e5 && (e5[n4] || e5(t4, a3)) || o4[n4].slice(0, r4); }, f3 = function(e5) { return _2.s(r3 % 12 || 12, e5, "0"); }, p3 = c3 || function(e5, t5, n4) { var a4 = e5 < 12 ? "AM" : "PM"; return n4 ? a4.toLowerCase() : a4; }; return a3.replace(m2, function(e5, a4) { return a4 || function(e6) { switch (e6) { case "YY": return String(t4.$y).slice(-2); case "YYYY": return _2.s(t4.$y, 4, "0"); case "M": return s3 + 1; case "MM": return _2.s(s3 + 1, 2, "0"); case "MMM": return d3(n3.monthsShort, s3, u3, 3); case "MMMM": return d3(u3, s3); case "D": return t4.$D; case "DD": return _2.s(t4.$D, 2, "0"); case "d": return String(t4.$W); case "dd": return d3(n3.weekdaysMin, t4.$W, i3, 2); case "ddd": return d3(n3.weekdaysShort, t4.$W, i3, 3); case "dddd": return i3[t4.$W]; case "H": return String(r3); case "HH": return _2.s(r3, 2, "0"); case "h": return f3(1); case "hh": return f3(2); case "a": return p3(r3, l3, true); case "A": return p3(r3, l3, false); case "m": return String(l3); case "mm": return _2.s(l3, 2, "0"); case "s": return String(t4.$s); case "ss": return _2.s(t4.$s, 2, "0"); case "SSS": return _2.s(t4.$ms, 3, "0"); case "Z": return o3; } return null; }(e5) || o3.replace(":", ""); }); }, b3.utcOffset = function() { return 15 * -Math.round(this.$d.getTimezoneOffset() / 15); }, b3.diff = function(a3, f3, v3) { var p3, m3 = this, h4 = _2.p(f3), b4 = C2(a3), g3 = (b4.utcOffset() - this.utcOffset()) * t3, y3 = this - b4, w3 = function() { return _2.m(m3, b4); }; switch (h4) { case d2: p3 = w3() / 12; break; case u2: p3 = w3(); break; case c2: p3 = w3() / 3; break; case i2: p3 = (y3 - g3) / 6048e5; break; case s2: p3 = (y3 - g3) / 864e5; break; case l2: p3 = y3 / n2; break; case r2: p3 = y3 / t3; break; case o2: p3 = y3 / e3; break; default: p3 = y3; } return v3 ? p3 : _2.a(p3); }, b3.daysInMonth = function() { return this.endOf(u2).$D; }, b3.$locale = function() { return w2[this.$L]; }, b3.locale = function(e4, t4) { if (!e4) return this.$L; var n3 = this.clone(), a3 = S2(e4, t4, true); return a3 && (n3.$L = a3), n3; }, b3.clone = function() { return _2.w(this.$d, this); }, b3.toDate = function() { return new Date(this.valueOf()); }, b3.toJSON = function() { return this.isValid() ? this.toISOString() : null; }, b3.toISOString = function() { return this.$d.toISOString(); }, b3.toString = function() { return this.$d.toUTCString(); }, h3; }(), O2 = M2.prototype; return C2.prototype = O2, [["$ms", a2], ["$s", o2], ["$m", r2], ["$H", l2], ["$W", s2], ["$M", u2], ["$y", d2], ["$D", f2]].forEach(function(e4) { O2[e4[1]] = function(t4) { return this.$g(t4, e4[0], e4[1]); }; }), C2.extend = function(e4, t4) { return e4.$i || (e4(t4, M2, C2), e4.$i = true), C2; }, C2.locale = S2, C2.isDayjs = x2, C2.unix = function(e4) { return C2(1e3 * e4); }, C2.en = w2[y2], C2.Ls = w2, C2.p = {}, C2; }); })(kp); var xp = kp.exports; const Sp = wp(xp); var Cp = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { var e3 = { LTS: "h:mm:ss A", LT: "h:mm A", L: "MM/DD/YYYY", LL: "MMMM D, YYYY", LLL: "MMMM D, YYYY h:mm A", LLLL: "dddd, MMMM D, YYYY h:mm A" }, t3 = /(\[[^[]*\])|([-_:/.,()\s]+)|(A|a|YYYY|YY?|MM?M?M?|Do|DD?|hh?|HH?|mm?|ss?|S{1,3}|z|ZZ?)/g, n2 = /\d\d/, a2 = /\d\d?/, o2 = /\d*[^-_:/,()\s\d]+/, r2 = {}, l2 = function(e4) { return (e4 = +e4) + (e4 > 68 ? 1900 : 2e3); }; var s2 = function(e4) { return function(t4) { this[e4] = +t4; }; }, i2 = [/[+-]\d\d:?(\d\d)?|Z/, function(e4) { (this.zone || (this.zone = {})).offset = function(e5) { if (!e5) return 0; if ("Z" === e5) return 0; var t4 = e5.match(/([+-]|\d\d)/g), n3 = 60 * t4[1] + (+t4[2] || 0); return 0 === n3 ? 0 : "+" === t4[0] ? -n3 : n3; }(e4); }], u2 = function(e4) { var t4 = r2[e4]; return t4 && (t4.indexOf ? t4 : t4.s.concat(t4.f)); }, c2 = function(e4, t4) { var n3, a3 = r2.meridiem; if (a3) { for (var o3 = 1; o3 <= 24; o3 += 1) if (e4.indexOf(a3(o3, 0, t4)) > -1) { n3 = o3 > 12; break; } } else n3 = e4 === (t4 ? "pm" : "PM"); return n3; }, d2 = { A: [o2, function(e4) { this.afternoon = c2(e4, false); }], a: [o2, function(e4) { this.afternoon = c2(e4, true); }], S: [/\d/, function(e4) { this.milliseconds = 100 * +e4; }], SS: [n2, function(e4) { this.milliseconds = 10 * +e4; }], SSS: [/\d{3}/, function(e4) { this.milliseconds = +e4; }], s: [a2, s2("seconds")], ss: [a2, s2("seconds")], m: [a2, s2("minutes")], mm: [a2, s2("minutes")], H: [a2, s2("hours")], h: [a2, s2("hours")], HH: [a2, s2("hours")], hh: [a2, s2("hours")], D: [a2, s2("day")], DD: [n2, s2("day")], Do: [o2, function(e4) { var t4 = r2.ordinal, n3 = e4.match(/\d+/); if (this.day = n3[0], t4) for (var a3 = 1; a3 <= 31; a3 += 1) t4(a3).replace(/\[|\]/g, "") === e4 && (this.day = a3); }], M: [a2, s2("month")], MM: [n2, s2("month")], MMM: [o2, function(e4) { var t4 = u2("months"), n3 = (u2("monthsShort") || t4.map(function(e5) { return e5.slice(0, 3); })).indexOf(e4) + 1; if (n3 < 1) throw new Error(); this.month = n3 % 12 || n3; }], MMMM: [o2, function(e4) { var t4 = u2("months").indexOf(e4) + 1; if (t4 < 1) throw new Error(); this.month = t4 % 12 || t4; }], Y: [/[+-]?\d+/, s2("year")], YY: [n2, function(e4) { this.year = l2(e4); }], YYYY: [/\d{4}/, s2("year")], Z: i2, ZZ: i2 }; function f2(n3) { var a3, o3; a3 = n3, o3 = r2 && r2.formats; for (var l3 = (n3 = a3.replace(/(\[[^\]]+])|(LTS?|l{1,4}|L{1,4})/g, function(t4, n4, a4) { var r3 = a4 && a4.toUpperCase(); return n4 || o3[a4] || e3[a4] || o3[r3].replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e4, t5, n5) { return t5 || n5.slice(1); }); })).match(t3), s3 = l3.length, i3 = 0; i3 < s3; i3 += 1) { var u3 = l3[i3], c3 = d2[u3], f3 = c3 && c3[0], v2 = c3 && c3[1]; l3[i3] = v2 ? { regex: f3, parser: v2 } : u3.replace(/^\[|\]$/g, ""); } return function(e4) { for (var t4 = {}, n4 = 0, a4 = 0; n4 < s3; n4 += 1) { var o4 = l3[n4]; if ("string" == typeof o4) a4 += o4.length; else { var r3 = o4.regex, i4 = o4.parser, u4 = e4.slice(a4), c4 = r3.exec(u4)[0]; i4.call(t4, c4), e4 = e4.replace(c4, ""); } } return function(e5) { var t5 = e5.afternoon; if (void 0 !== t5) { var n5 = e5.hours; t5 ? n5 < 12 && (e5.hours += 12) : 12 === n5 && (e5.hours = 0), delete e5.afternoon; } }(t4), t4; }; } return function(e4, t4, n3) { n3.p.customParseFormat = true, e4 && e4.parseTwoDigitYear && (l2 = e4.parseTwoDigitYear); var a3 = t4.prototype, o3 = a3.parse; a3.parse = function(e5) { var t5 = e5.date, a4 = e5.utc, l3 = e5.args; this.$u = a4; var s3 = l3[1]; if ("string" == typeof s3) { var i3 = true === l3[2], u3 = true === l3[3], c3 = i3 || u3, d3 = l3[2]; u3 && (d3 = l3[2]), r2 = this.$locale(), !i3 && d3 && (r2 = n3.Ls[d3]), this.$d = function(e6, t6, n4) { try { if (["x", "X"].indexOf(t6) > -1) return new Date(("X" === t6 ? 1e3 : 1) * e6); var a5 = f2(t6)(e6), o4 = a5.year, r3 = a5.month, l4 = a5.day, s4 = a5.hours, i4 = a5.minutes, u4 = a5.seconds, c4 = a5.milliseconds, d4 = a5.zone, v3 = /* @__PURE__ */ new Date(), p3 = l4 || (o4 || r3 ? 1 : v3.getDate()), m3 = o4 || v3.getFullYear(), h2 = 0; o4 && !r3 || (h2 = r3 > 0 ? r3 - 1 : v3.getMonth()); var b2 = s4 || 0, g2 = i4 || 0, y2 = u4 || 0, w2 = c4 || 0; return d4 ? new Date(Date.UTC(m3, h2, p3, b2, g2, y2, w2 + 60 * d4.offset * 1e3)) : n4 ? new Date(Date.UTC(m3, h2, p3, b2, g2, y2, w2)) : new Date(m3, h2, p3, b2, g2, y2, w2); } catch (e7) { return /* @__PURE__ */ new Date(""); } }(t5, s3, a4), this.init(), d3 && true !== d3 && (this.$L = this.locale(d3).$L), c3 && t5 != this.format(s3) && (this.$d = /* @__PURE__ */ new Date("")), r2 = {}; } else if (s3 instanceof Array) for (var v2 = s3.length, p2 = 1; p2 <= v2; p2 += 1) { l3[1] = s3[p2 - 1]; var m2 = n3.apply(this, l3); if (m2.isValid()) { this.$d = m2.$d, this.$L = m2.$L, this.init(); break; } p2 === v2 && (this.$d = /* @__PURE__ */ new Date("")); } else o3.call(this, e5); }; }; }); })(Cp); var _p = Cp.exports; const Mp = wp(_p); const Op = ["hours", "minutes", "seconds"]; const Dp = "HH:mm:ss"; const Ap = "YYYY-MM-DD"; const Ep = { date: Ap, dates: Ap, week: "gggg[w]ww", year: "YYYY", years: "YYYY", month: "YYYY-MM", datetime: `${Ap} ${Dp}`, monthrange: "YYYY-MM", daterange: Ap, datetimerange: `${Ap} ${Dp}` }; const $p = (e2, t2) => [e2 > 0 ? e2 - 1 : void 0, e2, e2 < t2 ? e2 + 1 : void 0]; const Lp = (e2) => Array.from(Array.from({ length: e2 }).keys()); const Ip = (e2) => e2.replace(/\W?m{1,2}|\W?ZZ/g, "").replace(/\W?h{1,2}|\W?s{1,3}|\W?a/gi, "").trim(); const Tp = (e2) => e2.replace(/\W?D{1,2}|\W?Do|\W?d{1,4}|\W?M{1,4}|\W?Y{2,4}/g, "").trim(); const Pp = function(e2, t2) { const n2 = nt(e2); const a2 = nt(t2); if (n2 && a2) { return e2.getTime() === t2.getTime(); } if (!n2 && !a2) { return e2 === t2; } return false; }; const Bp = function(e2, t2) { const n2 = tt(e2); const a2 = tt(t2); if (n2 && a2) { if (e2.length !== t2.length) { return false; } return e2.every((e3, n3) => Pp(e3, t2[n3])); } if (!n2 && !a2) { return Pp(e2, t2); } return false; }; const Rp = function(e2, t2, n2) { const a2 = Dl(t2) || t2 === "x" ? Sp(e2).locale(n2) : Sp(e2, t2).locale(n2); return a2.isValid() ? a2 : void 0; }; const Vp = function(e2, t2, n2) { if (Dl(t2)) return e2; if (t2 === "x") return +e2; return Sp(e2).locale(n2).format(t2); }; const Fp = (e2, t2) => { var n2; const a2 = []; const o2 = t2 == null ? void 0 : t2(); for (let t3 = 0; t3 < e2; t3++) { a2.push((n2 = o2 == null ? void 0 : o2.includes(t3)) != null ? n2 : false); } return a2; }; const jp = Cs({ disabledHours: { type: ks(Function) }, disabledMinutes: { type: ks(Function) }, disabledSeconds: { type: ks(Function) } }); const zp = Cs({ visible: Boolean, actualVisible: { type: Boolean, default: void 0 }, format: { type: String, default: "" } }); const Np = Cs({ id: { type: ks([Array, String]) }, name: { type: ks([Array, String]), default: "" }, popperClass: { type: String, default: "" }, format: String, valueFormat: String, dateFormat: String, timeFormat: String, type: { type: String, default: "" }, clearable: { type: Boolean, default: true }, clearIcon: { type: ks([String, Object]), default: as }, editable: { type: Boolean, default: true }, prefixIcon: { type: ks([String, Object]), default: "" }, size: Nc, readonly: Boolean, disabled: Boolean, placeholder: { type: String, default: "" }, popperOptions: { type: ks(Object), default: () => ({}) }, modelValue: { type: ks([Date, Array, String, Number]), default: "" }, rangeSeparator: { type: String, default: "-" }, startPlaceholder: String, endPlaceholder: String, defaultValue: { type: ks([Date, Array]) }, defaultTime: { type: ks([Date, Array]) }, isRange: Boolean, ...jp, disabledDate: { type: Function }, cellClassName: { type: Function }, shortcuts: { type: Array, default: () => [] }, arrowControl: Boolean, label: { type: String, default: void 0 }, tabindex: { type: ks([String, Number]), default: 0 }, validateEvent: { type: Boolean, default: true }, unlinkPanels: Boolean, ...Kc, ...Zc(["ariaLabel"]) }); const Hp = ["id", "name", "placeholder", "value", "disabled", "readonly"]; const Yp = ["id", "name", "placeholder", "value", "disabled", "readonly"]; const Wp = vue.defineComponent({ name: "Picker" }); const Up = vue.defineComponent({ ...Wp, props: Np, emits: ["update:modelValue", "change", "focus", "blur", "calendar-change", "panel-change", "visible-change", "keydown"], setup(e2, { expose: o2, emit: l2 }) { const u2 = e2; const c2 = vue.useAttrs(); const { lang: d2 } = Xs(); const p2 = oi("date"); const m2 = oi("input"); const h2 = oi("range"); const { form: b2, formItem: k2 } = vd(); const x2 = vue.inject("ElPopperOptions", {}); const { valueOnClear: C2 } = qc(u2, null); const O2 = vue.ref(); const I2 = vue.ref(); const B2 = vue.ref(false); const R2 = vue.ref(false); const V2 = vue.ref(null); let F2 = false; let j2 = false; const z2 = vue.computed(() => [p2.b("editor"), p2.bm("editor", u2.type), m2.e("wrapper"), p2.is("disabled", le2.value), p2.is("active", B2.value), h2.b("editor"), xe2 ? h2.bm("editor", xe2.value) : "", c2.class]); const N2 = vue.computed(() => [m2.e("icon"), h2.e("close-icon"), !pe2.value ? h2.e("close-icon--hidden") : ""]); vue.watch(B2, (e3) => { if (!e3) { _e2.value = null; vue.nextTick(() => { H2(u2.modelValue); }); } else { vue.nextTick(() => { if (e3) { V2.value = u2.modelValue; } }); } }); const H2 = (e3, t2) => { if (t2 || !Bp(e3, V2.value)) { l2("change", e3); u2.validateEvent && (k2 == null ? void 0 : k2.validate("change").catch((e4) => Pl())); } }; const Y2 = (e3) => { if (!Bp(u2.modelValue, e3)) { let t2; if (tt(e3)) { t2 = e3.map((e4) => Vp(e4, u2.valueFormat, d2.value)); } else if (e3) { t2 = Vp(e3, u2.valueFormat, d2.value); } l2("update:modelValue", e3 ? t2 : e3, d2.value); } }; const W2 = (e3) => { l2("keydown", e3); }; const U2 = vue.computed(() => { if (I2.value) { const e3 = ke2.value ? I2.value : I2.value.$el; return Array.from(e3.querySelectorAll("input")); } return []; }); const K2 = (e3, t2, n2) => { const a2 = U2.value; if (!a2.length) return; if (!n2 || n2 === "min") { a2[0].setSelectionRange(e3, t2); a2[0].focus(); } else if (n2 === "max") { a2[1].setSelectionRange(e3, t2); a2[1].focus(); } }; const q2 = () => { ne2(true, true); vue.nextTick(() => { j2 = false; }); }; const G2 = (e3 = "", t2 = false) => { if (!t2) { j2 = true; } B2.value = t2; let n2; if (tt(e3)) { n2 = e3.map((e4) => e4.toDate()); } else { n2 = e3 ? e3.toDate() : e3; } _e2.value = null; Y2(n2); }; const Z2 = () => { R2.value = true; }; const J2 = () => { l2("visible-change", true); }; const X2 = (e3) => { if ((e3 == null ? void 0 : e3.key) === $s.esc) { ne2(true, true); } }; const Q2 = () => { R2.value = false; B2.value = false; j2 = false; l2("visible-change", false); }; const ee2 = () => { B2.value = true; }; const te2 = () => { B2.value = false; }; const ne2 = (e3 = true, t2 = false) => { j2 = t2; const [n2, a2] = vue.unref(U2); let o3 = n2; if (!e3 && ke2.value) { o3 = a2; } if (o3) { o3.focus(); } }; const ae2 = (e3) => { if (u2.readonly || le2.value || B2.value || j2) { return; } B2.value = true; l2("focus", e3); }; let oe2 = void 0; const re2 = (e3) => { const t2 = async () => { setTimeout(() => { var n2; if (oe2 === t2) { if (!(((n2 = O2.value) == null ? void 0 : n2.isFocusInsideContent()) && !F2) && U2.value.filter((e4) => e4.contains(document.activeElement)).length === 0) { Me2(); B2.value = false; l2("blur", e3); u2.validateEvent && (k2 == null ? void 0 : k2.validate("blur").catch((e4) => Pl())); } F2 = false; } }, 0); }; oe2 = t2; t2(); }; const le2 = vue.computed(() => u2.disabled || (b2 == null ? void 0 : b2.disabled)); const se2 = vue.computed(() => { let e3; if (he2.value) { if (Re2.value.getDefaultValue) { e3 = Re2.value.getDefaultValue(); } } else { if (tt(u2.modelValue)) { e3 = u2.modelValue.map((e4) => Rp(e4, u2.valueFormat, d2.value)); } else { e3 = Rp(u2.modelValue, u2.valueFormat, d2.value); } } if (Re2.value.getRangeAvailableTime) { const t2 = Re2.value.getRangeAvailableTime(e3); if (!gl(t2, e3)) { e3 = t2; Y2(tt(e3) ? e3.map((e4) => e4.toDate()) : e3.toDate()); } } if (tt(e3) && e3.some((e4) => !e4)) { e3 = []; } return e3; }); const ie2 = vue.computed(() => { if (!Re2.value.panelReady) return ""; const e3 = De2(se2.value); if (tt(_e2.value)) { return [_e2.value[0] || e3 && e3[0] || "", _e2.value[1] || e3 && e3[1] || ""]; } else if (_e2.value !== null) { return _e2.value; } if (!ce2.value && he2.value) return ""; if (!B2.value && he2.value) return ""; if (e3) { return de2.value || fe2.value ? e3.join(", ") : e3; } return ""; }); const ue2 = vue.computed(() => u2.type.includes("time")); const ce2 = vue.computed(() => u2.type.startsWith("time")); const de2 = vue.computed(() => u2.type === "dates"); const fe2 = vue.computed(() => u2.type === "years"); const ve2 = vue.computed(() => u2.prefixIcon || (ue2.value ? rs : Ql)); const pe2 = vue.ref(false); const me2 = (e3) => { if (u2.readonly || le2.value) return; if (pe2.value) { e3.stopPropagation(); q2(); Y2(C2.value); H2(C2.value, true); pe2.value = false; B2.value = false; Re2.value.handleClear && Re2.value.handleClear(); } }; const he2 = vue.computed(() => { const { modelValue: e3 } = u2; return !e3 || tt(e3) && !e3.filter(Boolean).length; }); const be2 = async (e3) => { var t2; if (u2.readonly || le2.value) return; if (((t2 = e3.target) == null ? void 0 : t2.tagName) !== "INPUT" || U2.value.includes(document.activeElement)) { B2.value = true; } }; const ge2 = () => { if (u2.readonly || le2.value) return; if (!he2.value && u2.clearable) { pe2.value = true; } }; const ye2 = () => { pe2.value = false; }; const we2 = (e3) => { var t2; if (u2.readonly || le2.value) return; if (((t2 = e3.touches[0].target) == null ? void 0 : t2.tagName) !== "INPUT" || U2.value.includes(document.activeElement)) { B2.value = true; } }; const ke2 = vue.computed(() => u2.type.includes("range")); const xe2 = dd(); const Se2 = vue.computed(() => { var e3, t2; return (t2 = (e3 = vue.unref(O2)) == null ? void 0 : e3.popperRef) == null ? void 0 : t2.contentRef; }); const Ce2 = vue.computed(() => { var e3; if (vue.unref(ke2)) { return vue.unref(I2); } return (e3 = vue.unref(I2)) == null ? void 0 : e3.$el; }); Te(Ce2, (e3) => { const t2 = vue.unref(Se2); const n2 = vue.unref(Ce2); if (t2 && (e3.target === t2 || e3.composedPath().includes(t2)) || e3.target === n2 || e3.composedPath().includes(n2)) return; B2.value = false; }); const _e2 = vue.ref(null); const Me2 = () => { if (_e2.value) { const e3 = Oe2(ie2.value); if (e3) { if (Ae2(e3)) { Y2(tt(e3) ? e3.map((e4) => e4.toDate()) : e3.toDate()); _e2.value = null; } } } if (_e2.value === "") { Y2(C2.value); H2(C2.value); _e2.value = null; } }; const Oe2 = (e3) => { if (!e3) return null; return Re2.value.parseUserInput(e3); }; const De2 = (e3) => { if (!e3) return null; return Re2.value.formatToString(e3); }; const Ae2 = (e3) => Re2.value.isValidValue(e3); const Ee2 = async (e3) => { if (u2.readonly || le2.value) return; const { code: t2 } = e3; W2(e3); if (t2 === $s.esc) { if (B2.value === true) { B2.value = false; e3.preventDefault(); e3.stopPropagation(); } return; } if (t2 === $s.down) { if (Re2.value.handleFocusPicker) { e3.preventDefault(); e3.stopPropagation(); } if (B2.value === false) { B2.value = true; await vue.nextTick(); } if (Re2.value.handleFocusPicker) { Re2.value.handleFocusPicker(); return; } } if (t2 === $s.tab) { F2 = true; return; } if (t2 === $s.enter || t2 === $s.numpadEnter) { if (_e2.value === null || _e2.value === "" || Ae2(Oe2(ie2.value))) { Me2(); B2.value = false; } e3.stopPropagation(); return; } if (_e2.value) { e3.stopPropagation(); return; } if (Re2.value.handleKeydownInput) { Re2.value.handleKeydownInput(e3); } }; const $e2 = (e3) => { _e2.value = e3; if (!B2.value) { B2.value = true; } }; const Le2 = (e3) => { const t2 = e3.target; if (_e2.value) { _e2.value = [t2.value, _e2.value[1]]; } else { _e2.value = [t2.value, null]; } }; const Ie2 = (e3) => { const t2 = e3.target; if (_e2.value) { _e2.value = [_e2.value[0], t2.value]; } else { _e2.value = [null, t2.value]; } }; const Pe2 = () => { var e3; const t2 = _e2.value; const n2 = Oe2(t2 && t2[0]); const a2 = vue.unref(se2); if (n2 && n2.isValid()) { _e2.value = [De2(n2), ((e3 = ie2.value) == null ? void 0 : e3[1]) || null]; const t3 = [n2, a2 && (a2[1] || null)]; if (Ae2(t3)) { Y2(t3); _e2.value = null; } } }; const Be2 = () => { var e3; const t2 = vue.unref(_e2); const n2 = Oe2(t2 && t2[1]); const a2 = vue.unref(se2); if (n2 && n2.isValid()) { _e2.value = [((e3 = vue.unref(ie2)) == null ? void 0 : e3[0]) || null, De2(n2)]; const t3 = [a2 && a2[0], n2]; if (Ae2(t3)) { Y2(t3); _e2.value = null; } } }; const Re2 = vue.ref({}); const Ve2 = (e3) => { Re2.value[e3[0]] = e3[1]; Re2.value.panelReady = true; }; const Fe2 = (e3) => { l2("calendar-change", e3); }; const je2 = (e3, t2, n2) => { l2("panel-change", e3, t2, n2); }; vue.provide("EP_PICKER_BASE", { props: u2 }); Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-time-picker", ref: "https://element-plus.org/en-US/component/time-picker.html" }, vue.computed(() => !!u2.label)); o2({ focus: ne2, handleFocusInput: ae2, handleBlurInput: re2, handleOpen: ee2, handleClose: te2, onPick: G2 }); return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.unref(Mv), vue.mergeProps({ ref_key: "refPopper", ref: O2, visible: B2.value, effect: "light", pure: "", trigger: "click" }, e3.$attrs, { role: "dialog", teleported: "", transition: `${vue.unref(p2).namespace.value}-zoom-in-top`, "popper-class": [`${vue.unref(p2).namespace.value}-picker__popper`, e3.popperClass], "popper-options": vue.unref(x2), "fallback-placements": ["bottom", "top", "right", "left"], "gpu-acceleration": false, "stop-popper-mouse-event": false, "hide-after": 0, persistent: "", onBeforeShow: Z2, onShow: J2, onHide: Q2 }), { default: vue.withCtx(() => [!vue.unref(ke2) ? (vue.openBlock(), vue.createBlock(vue.unref(Dd), { key: 0, id: e3.id, ref_key: "inputRef", ref: I2, "container-role": "combobox", "model-value": vue.unref(ie2), name: e3.name, size: vue.unref(xe2), disabled: vue.unref(le2), placeholder: e3.placeholder, class: vue.normalizeClass([vue.unref(p2).b("editor"), vue.unref(p2).bm("editor", e3.type), e3.$attrs.class]), style: vue.normalizeStyle(e3.$attrs.style), readonly: !e3.editable || e3.readonly || vue.unref(de2) || vue.unref(fe2) || e3.type === "week", "aria-label": e3.label || e3.ariaLabel, tabindex: e3.tabindex, "validate-event": false, onInput: $e2, onFocus: ae2, onBlur: re2, onKeydown: Ee2, onChange: Me2, onMousedown: be2, onMouseenter: ge2, onMouseleave: ye2, onTouchstartPassive: we2, onClick: o3[0] || (o3[0] = vue.withModifiers(() => { }, ["stop"])) }, { prefix: vue.withCtx(() => [vue.unref(ve2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(m2).e("icon")), onMousedown: vue.withModifiers(be2, ["prevent"]), onTouchstartPassive: we2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ve2))))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true)]), suffix: vue.withCtx(() => [pe2.value && e3.clearIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(`${vue.unref(m2).e("icon")} clear-icon`), onClick: vue.withModifiers(me2, ["stop"]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.clearIcon)))]), _: 1 }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true)]), _: 1 }, 8, ["id", "model-value", "name", "size", "disabled", "placeholder", "class", "style", "readonly", "aria-label", "tabindex", "onKeydown"])) : (vue.openBlock(), vue.createElementBlock("div", { key: 1, ref_key: "inputRef", ref: I2, class: vue.normalizeClass(vue.unref(z2)), style: vue.normalizeStyle(e3.$attrs.style), onClick: ae2, onMouseenter: ge2, onMouseleave: ye2, onTouchstartPassive: we2, onKeydown: Ee2 }, [vue.unref(ve2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass([vue.unref(m2).e("icon"), vue.unref(h2).e("icon")]), onMousedown: vue.withModifiers(be2, ["prevent"]), onTouchstartPassive: we2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ve2))))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", { id: e3.id && e3.id[0], autocomplete: "off", name: e3.name && e3.name[0], placeholder: e3.startPlaceholder, value: vue.unref(ie2) && vue.unref(ie2)[0], disabled: vue.unref(le2), readonly: !e3.editable || e3.readonly, class: vue.normalizeClass(vue.unref(h2).b("input")), onMousedown: be2, onInput: Le2, onChange: Pe2, onFocus: ae2, onBlur: re2 }, null, 42, Hp), vue.renderSlot(e3.$slots, "range-separator", {}, () => [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(h2).b("separator")) }, vue.toDisplayString(e3.rangeSeparator), 3)]), vue.createElementVNode("input", { id: e3.id && e3.id[1], autocomplete: "off", name: e3.name && e3.name[1], placeholder: e3.endPlaceholder, value: vue.unref(ie2) && vue.unref(ie2)[1], disabled: vue.unref(le2), readonly: !e3.editable || e3.readonly, class: vue.normalizeClass(vue.unref(h2).b("input")), onMousedown: be2, onFocus: ae2, onBlur: re2, onInput: Ie2, onChange: Be2 }, null, 42, Yp), e3.clearIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 1, class: vue.normalizeClass(vue.unref(N2)), onClick: me2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.clearIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 38))]), content: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default", { visible: B2.value, actualVisible: R2.value, parsedValue: vue.unref(se2), format: e3.format, dateFormat: e3.dateFormat, timeFormat: e3.timeFormat, unlinkPanels: e3.unlinkPanels, type: e3.type, defaultValue: e3.defaultValue, onPick: G2, onSelectRange: K2, onSetPickerOption: Ve2, onCalendarChange: Fe2, onPanelChange: je2, onKeydown: X2, onMousedown: o3[1] || (o3[1] = vue.withModifiers(() => { }, ["stop"])) })]), _: 3 }, 16, ["visible", "transition", "popper-class", "popper-options"])); } }); var Kp = ad(Up, [["__file", "picker.vue"]]); const qp = Cs({ ...zp, datetimeRole: String, parsedValue: { type: ks(Object) } }); const Gp = ({ getAvailableHours: e2, getAvailableMinutes: t2, getAvailableSeconds: n2 }) => { const a2 = (a3, o3, r3, l2) => { const s2 = { hour: e2, minute: t2, second: n2 }; let i2 = a3; ["hour", "minute", "second"].forEach((e3) => { if (s2[e3]) { let t3; const n3 = s2[e3]; switch (e3) { case "minute": { t3 = n3(i2.hour(), o3, l2); break; } case "second": { t3 = n3(i2.hour(), i2.minute(), o3, l2); break; } default: { t3 = n3(o3, l2); break; } } if ((t3 == null ? void 0 : t3.length) && !t3.includes(i2[e3]())) { const n4 = r3 ? 0 : t3.length - 1; i2 = i2[e3](t3[n4]); } } }); return i2; }; const o2 = {}; const r2 = ([e3, t3]) => { o2[e3] = t3; }; return { timePickerOptions: o2, getAvailableTime: a2, onSetOption: r2 }; }; const Zp = (e2) => { const t2 = (e3, t3) => e3 || t3; const n2 = (e3) => e3 !== true; return e2.map(t2).filter(n2); }; const Jp = (e2, t2, n2) => { const a2 = (t3, n3) => Fp(24, e2 && (() => e2 == null ? void 0 : e2(t3, n3))); const o2 = (e3, n3, a3) => Fp(60, t2 && (() => t2 == null ? void 0 : t2(e3, n3, a3))); const r2 = (e3, t3, a3, o3) => Fp(60, n2 && (() => n2 == null ? void 0 : n2(e3, t3, a3, o3))); return { getHoursList: a2, getMinutesList: o2, getSecondsList: r2 }; }; const Xp = (e2, t2, n2) => { const { getHoursList: a2, getMinutesList: o2, getSecondsList: r2 } = Jp(e2, t2, n2); const l2 = (e3, t3) => Zp(a2(e3, t3)); const s2 = (e3, t3, n3) => Zp(o2(e3, t3, n3)); const i2 = (e3, t3, n3, a3) => Zp(r2(e3, t3, n3, a3)); return { getAvailableHours: l2, getAvailableMinutes: s2, getAvailableSeconds: i2 }; }; const Qp = (e2) => { const t2 = vue.ref(e2.parsedValue); vue.watch(() => e2.visible, (n2) => { if (!n2) { t2.value = e2.parsedValue; } }); return t2; }; const em = /* @__PURE__ */ new Map(); let tm; if (ke) { document.addEventListener("mousedown", (e2) => tm = e2); document.addEventListener("mouseup", (e2) => { for (const t2 of em.values()) { for (const { documentHandler: n2 } of t2) { n2(e2, tm); } } }); } function nm(e2, t2) { let n2 = []; if (Array.isArray(t2.arg)) { n2 = t2.arg; } else if (Al(t2.arg)) { n2.push(t2.arg); } return function(a2, o2) { const r2 = t2.instance.popperRef; const l2 = a2.target; const s2 = o2 == null ? void 0 : o2.target; const i2 = !t2 || !t2.instance; const u2 = !l2 || !s2; const c2 = e2.contains(l2) || e2.contains(s2); const d2 = e2 === l2; const f2 = n2.length && n2.some((e3) => e3 == null ? void 0 : e3.contains(l2)) || n2.length && n2.includes(s2); const v2 = r2 && (r2.contains(l2) || r2.contains(s2)); if (i2 || u2 || c2 || d2 || f2 || v2) { return; } t2.value(a2, o2); }; } const am = { beforeMount(e2, t2) { if (!em.has(e2)) { em.set(e2, []); } em.get(e2).push({ documentHandler: nm(e2, t2), bindingFn: t2.value }); }, updated(e2, t2) { if (!em.has(e2)) { em.set(e2, []); } const n2 = em.get(e2); const a2 = n2.findIndex((e3) => e3.bindingFn === t2.oldValue); const o2 = { documentHandler: nm(e2, t2), bindingFn: t2.value }; if (a2 >= 0) { n2.splice(a2, 1, o2); } else { n2.push(o2); } }, unmounted(e2) { em.delete(e2); } }; const om = 100; const rm = 600; const lm = { beforeMount(e2, t2) { const n2 = t2.value; const { interval: a2 = om, delay: o2 = rm } = at(n2) ? {} : n2; let r2; let l2; const s2 = () => at(n2) ? n2() : n2.handler(); const i2 = () => { if (l2) { clearTimeout(l2); l2 = void 0; } if (r2) { clearInterval(r2); r2 = void 0; } }; e2.addEventListener("mousedown", (e3) => { if (e3.button !== 0) return; i2(); s2(); document.addEventListener("mouseup", () => i2(), { once: true }); l2 = setTimeout(() => { r2 = setInterval(() => { s2(); }, a2); }, o2); }); } }; const sm = Cs({ role: { type: String, required: true }, spinnerDate: { type: ks(Object), required: true }, showSeconds: { type: Boolean, default: true }, arrowControl: Boolean, amPmMode: { type: ks(String), default: "" }, ...jp }); const im = ["onClick"]; const um = ["onMouseenter"]; const cm = vue.defineComponent({ __name: "basic-time-spinner", props: sm, emits: ["change", "select-range", "set-option"], setup(e2, { emit: o2 }) { const l2 = e2; const c2 = oi("time"); const { getHoursList: d2, getMinutesList: f2, getSecondsList: p2 } = Jp(l2.disabledHours, l2.disabledMinutes, l2.disabledSeconds); let m2 = false; const h2 = vue.ref(); const b2 = vue.ref(); const g2 = vue.ref(); const y2 = vue.ref(); const w2 = { hours: b2, minutes: g2, seconds: y2 }; const k2 = vue.computed(() => l2.showSeconds ? Op : Op.slice(0, 2)); const x2 = vue.computed(() => { const { spinnerDate: e3 } = l2; const t2 = e3.hour(); const n2 = e3.minute(); const a2 = e3.second(); return { hours: t2, minutes: n2, seconds: a2 }; }); const S2 = vue.computed(() => { const { hours: e3, minutes: t2 } = vue.unref(x2); return { hours: d2(l2.role), minutes: f2(e3, l2.role), seconds: p2(e3, t2, l2.role) }; }); const C2 = vue.computed(() => { const { hours: e3, minutes: t2, seconds: n2 } = vue.unref(x2); return { hours: $p(e3, 23), minutes: $p(t2, 59), seconds: $p(n2, 59) }; }); const $2 = hl((e3) => { m2 = false; B2(e3); }, 200); const L2 = (e3) => { const t2 = !!l2.amPmMode; if (!t2) return ""; const n2 = l2.amPmMode === "A"; let a2 = e3 < 12 ? " am" : " pm"; if (n2) a2 = a2.toUpperCase(); return a2; }; const P2 = (e3) => { let t2; switch (e3) { case "hours": t2 = [0, 2]; break; case "minutes": t2 = [3, 5]; break; case "seconds": t2 = [6, 8]; break; } const [n2, a2] = t2; o2("select-range", n2, a2); h2.value = e3; }; const B2 = (e3) => { j2(e3, vue.unref(x2)[e3]); }; const V2 = () => { B2("hours"); B2("minutes"); B2("seconds"); }; const F2 = (e3) => e3.querySelector(`.${c2.namespace.value}-scrollbar__wrap`); const j2 = (e3, t2) => { if (l2.arrowControl) return; const n2 = vue.unref(w2[e3]); if (n2 && n2.$el) { F2(n2.$el).scrollTop = Math.max(0, t2 * z2(e3)); } }; const z2 = (e3) => { const t2 = vue.unref(w2[e3]); const n2 = t2 == null ? void 0 : t2.$el.querySelector("li"); if (n2) { return Number.parseFloat(jl(n2, "height")) || 0; } return 0; }; const N2 = () => { Y2(1); }; const H2 = () => { Y2(-1); }; const Y2 = (e3) => { if (!h2.value) { P2("hours"); } const t2 = h2.value; const n2 = vue.unref(x2)[t2]; const a2 = h2.value === "hours" ? 24 : 60; const o3 = W2(t2, n2, e3, a2); U2(t2, o3); j2(t2, o3); vue.nextTick(() => P2(t2)); }; const W2 = (e3, t2, n2, a2) => { let o3 = (t2 + n2 + a2) % a2; const r2 = vue.unref(S2)[e3]; while (r2[o3] && o3 !== t2) { o3 = (o3 + n2 + a2) % a2; } return o3; }; const U2 = (e3, t2) => { const n2 = vue.unref(S2)[e3]; const a2 = n2[t2]; if (a2) return; const { hours: r2, minutes: s2, seconds: u2 } = vue.unref(x2); let c3; switch (e3) { case "hours": c3 = l2.spinnerDate.hour(t2).minute(s2).second(u2); break; case "minutes": c3 = l2.spinnerDate.hour(r2).minute(t2).second(u2); break; case "seconds": c3 = l2.spinnerDate.hour(r2).minute(s2).second(t2); break; } o2("change", c3); }; const G2 = (e3, { value: t2, disabled: n2 }) => { if (!n2) { U2(e3, t2); P2(e3); j2(e3, t2); } }; const Z2 = (e3) => { m2 = true; $2(e3); const t2 = Math.min(Math.round((F2(vue.unref(w2[e3]).$el).scrollTop - (J2(e3) * 0.5 - 10) / z2(e3) + 3) / z2(e3)), e3 === "hours" ? 23 : 59); U2(e3, t2); }; const J2 = (e3) => vue.unref(w2[e3]).$el.offsetHeight; const X2 = () => { const e3 = (e4) => { const t2 = vue.unref(w2[e4]); if (t2 && t2.$el) { F2(t2.$el).onscroll = () => { Z2(e4); }; } }; e3("hours"); e3("minutes"); e3("seconds"); }; vue.onMounted(() => { vue.nextTick(() => { !l2.arrowControl && X2(); V2(); if (l2.role === "start") P2("hours"); }); }); const Q2 = (e3, t2) => { w2[t2].value = e3; }; o2("set-option", [`${l2.role}_scrollDown`, Y2]); o2("set-option", [`${l2.role}_emitSelectRange`, P2]); vue.watch(() => l2.spinnerDate, () => { if (m2) return; V2(); }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(c2).b("spinner"), { "has-seconds": e3.showSeconds }]) }, [!e3.arrowControl ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 0 }, vue.renderList(vue.unref(k2), (a2) => (vue.openBlock(), vue.createBlock(vue.unref(Ud), { key: a2, ref_for: true, ref: (e4) => Q2(e4, a2), class: vue.normalizeClass(vue.unref(c2).be("spinner", "wrapper")), "wrap-style": "max-height: inherit;", "view-class": vue.unref(c2).be("spinner", "list"), noresize: "", tag: "ul", onMouseenter: (e4) => P2(a2), onMousemove: (e4) => B2(a2) }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(S2)[a2], (o4, r2) => (vue.openBlock(), vue.createElementBlock("li", { key: r2, class: vue.normalizeClass([vue.unref(c2).be("spinner", "item"), vue.unref(c2).is("active", r2 === vue.unref(x2)[a2]), vue.unref(c2).is("disabled", o4)]), onClick: (e4) => G2(a2, { value: r2, disabled: o4 }) }, [a2 === "hours" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(("0" + (e3.amPmMode ? r2 % 12 || 12 : r2)).slice(-2)) + vue.toDisplayString(L2(r2)), 1)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createTextVNode(vue.toDisplayString(("0" + r2).slice(-2)), 1)], 64))], 10, im))), 128))]), _: 2 }, 1032, ["class", "view-class", "onMouseenter", "onMousemove"]))), 128)) : vue.createCommentVNode("v-if", true), e3.arrowControl ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 1 }, vue.renderList(vue.unref(k2), (o4) => (vue.openBlock(), vue.createElementBlock("div", { key: o4, class: vue.normalizeClass([vue.unref(c2).be("spinner", "wrapper"), vue.unref(c2).is("arrow")]), onMouseenter: (e4) => P2(o4) }, [vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(id), { class: vue.normalizeClass(["arrow-up", vue.unref(c2).be("spinner", "arrow")]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Jl))]), _: 1 }, 8, ["class"])), [[vue.unref(lm), H2]]), vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(id), { class: vue.normalizeClass(["arrow-down", vue.unref(c2).be("spinner", "arrow")]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Wl))]), _: 1 }, 8, ["class"])), [[vue.unref(lm), N2]]), vue.createElementVNode("ul", { class: vue.normalizeClass(vue.unref(c2).be("spinner", "list")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(C2)[o4], (a2, r2) => (vue.openBlock(), vue.createElementBlock("li", { key: r2, class: vue.normalizeClass([vue.unref(c2).be("spinner", "item"), vue.unref(c2).is("active", a2 === vue.unref(x2)[o4]), vue.unref(c2).is("disabled", vue.unref(S2)[o4][a2])]) }, [typeof a2 === "number" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [o4 === "hours" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(("0" + (e3.amPmMode ? a2 % 12 || 12 : a2)).slice(-2)) + vue.toDisplayString(L2(a2)), 1)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createTextVNode(vue.toDisplayString(("0" + a2).slice(-2)), 1)], 64))], 64)) : vue.createCommentVNode("v-if", true)], 2))), 128))], 2)], 42, um))), 128)) : vue.createCommentVNode("v-if", true)], 2)); } }); var dm = ad(cm, [["__file", "basic-time-spinner.vue"]]); const fm = vue.defineComponent({ __name: "panel-time-pick", props: qp, emits: ["pick", "select-range", "set-picker-option"], setup(e2, { emit: o2 }) { const l2 = e2; const s2 = vue.inject("EP_PICKER_BASE"); const { arrowControl: u2, disabledHours: c2, disabledMinutes: d2, disabledSeconds: p2, defaultValue: m2 } = s2.props; const { getAvailableHours: h2, getAvailableMinutes: b2, getAvailableSeconds: g2 } = Xp(c2, d2, p2); const y2 = oi("time"); const { t: w2, lang: k2 } = Xs(); const x2 = vue.ref([0, 2]); const S2 = Qp(l2); const C2 = vue.computed(() => _l(l2.actualVisible) ? `${y2.namespace.value}-zoom-in-top` : ""); const _2 = vue.computed(() => l2.format.includes("ss")); const O2 = vue.computed(() => { if (l2.format.includes("A")) return "A"; if (l2.format.includes("a")) return "a"; return ""; }); const $2 = (e3) => { const t2 = Sp(e3).locale(k2.value); const n2 = Y2(t2); return t2.isSame(n2); }; const L2 = () => { o2("pick", S2.value, false); }; const P2 = (e3 = false, t2 = false) => { if (t2) return; o2("pick", l2.parsedValue, e3); }; const R2 = (e3) => { if (!l2.visible) { return; } const t2 = Y2(e3).millisecond(0); o2("pick", t2, true); }; const V2 = (e3, t2) => { o2("select-range", e3, t2); x2.value = [e3, t2]; }; const F2 = (e3) => { const t2 = [0, 3].concat(_2.value ? [6] : []); const n2 = ["hours", "minutes"].concat(_2.value ? ["seconds"] : []); const a2 = t2.indexOf(x2.value[0]); const o3 = (a2 + e3 + t2.length) % t2.length; z2["start_emitSelectRange"](n2[o3]); }; const j2 = (e3) => { const t2 = e3.code; const { left: n2, right: a2, up: o3, down: r2 } = $s; if ([n2, a2].includes(t2)) { const a3 = t2 === n2 ? -1 : 1; F2(a3); e3.preventDefault(); return; } if ([o3, r2].includes(t2)) { const n3 = t2 === o3 ? -1 : 1; z2["start_scrollDown"](n3); e3.preventDefault(); return; } }; const { timePickerOptions: z2, onSetOption: N2, getAvailableTime: H2 } = Gp({ getAvailableHours: h2, getAvailableMinutes: b2, getAvailableSeconds: g2 }); const Y2 = (e3) => H2(e3, l2.datetimeRole || "", true); const W2 = (e3) => { if (!e3) return null; return Sp(e3, l2.format).locale(k2.value); }; const U2 = (e3) => { if (!e3) return null; return e3.format(l2.format); }; const K2 = () => Sp(m2).locale(k2.value); o2("set-picker-option", ["isValidValue", $2]); o2("set-picker-option", ["formatToString", U2]); o2("set-picker-option", ["parseUserInput", W2]); o2("set-picker-option", ["handleKeydownInput", j2]); o2("set-picker-option", ["getRangeAvailableTime", Y2]); o2("set-picker-option", ["getDefaultValue", K2]); return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(C2) }, { default: vue.withCtx(() => [e3.actualVisible || e3.visible ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(y2).b("panel")) }, [vue.createElementVNode("div", { class: vue.normalizeClass([vue.unref(y2).be("panel", "content"), { "has-seconds": vue.unref(_2) }]) }, [vue.createVNode(dm, { ref: "spinner", role: e3.datetimeRole || "start", "arrow-control": vue.unref(u2), "show-seconds": vue.unref(_2), "am-pm-mode": vue.unref(O2), "spinner-date": e3.parsedValue, "disabled-hours": vue.unref(c2), "disabled-minutes": vue.unref(d2), "disabled-seconds": vue.unref(p2), onChange: R2, onSetOption: vue.unref(N2), onSelectRange: V2 }, null, 8, ["role", "arrow-control", "show-seconds", "am-pm-mode", "spinner-date", "disabled-hours", "disabled-minutes", "disabled-seconds", "onSetOption"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(y2).be("panel", "footer")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(y2).be("panel", "btn"), "cancel"]), onClick: L2 }, vue.toDisplayString(vue.unref(w2)("el.datepicker.cancel")), 3), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(y2).be("panel", "btn"), "confirm"]), onClick: o3[0] || (o3[0] = (e4) => P2()) }, vue.toDisplayString(vue.unref(w2)("el.datepicker.confirm")), 3)], 2)], 2)) : vue.createCommentVNode("v-if", true)]), _: 1 }, 8, ["name"])); } }); var vm = ad(fm, [["__file", "panel-time-pick.vue"]]); var pm = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { return function(e3, t3, n2) { var a2 = t3.prototype, o2 = function(e4) { return e4 && (e4.indexOf ? e4 : e4.s); }, r2 = function(e4, t4, n3, a3, r3) { var l3 = e4.name ? e4 : e4.$locale(), s3 = o2(l3[t4]), i3 = o2(l3[n3]), u2 = s3 || i3.map(function(e5) { return e5.slice(0, a3); }); if (!r3) return u2; var c2 = l3.weekStart; return u2.map(function(e5, t5) { return u2[(t5 + (c2 || 0)) % 7]; }); }, l2 = function() { return n2.Ls[n2.locale()]; }, s2 = function(e4, t4) { return e4.formats[t4] || function(e5) { return e5.replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e6, t5, n3) { return t5 || n3.slice(1); }); }(e4.formats[t4.toUpperCase()]); }, i2 = function() { var e4 = this; return { months: function(t4) { return t4 ? t4.format("MMMM") : r2(e4, "months"); }, monthsShort: function(t4) { return t4 ? t4.format("MMM") : r2(e4, "monthsShort", "months", 3); }, firstDayOfWeek: function() { return e4.$locale().weekStart || 0; }, weekdays: function(t4) { return t4 ? t4.format("dddd") : r2(e4, "weekdays"); }, weekdaysMin: function(t4) { return t4 ? t4.format("dd") : r2(e4, "weekdaysMin", "weekdays", 2); }, weekdaysShort: function(t4) { return t4 ? t4.format("ddd") : r2(e4, "weekdaysShort", "weekdays", 3); }, longDateFormat: function(t4) { return s2(e4.$locale(), t4); }, meridiem: this.$locale().meridiem, ordinal: this.$locale().ordinal }; }; a2.localeData = function() { return i2.bind(this)(); }, n2.localeData = function() { var e4 = l2(); return { firstDayOfWeek: function() { return e4.weekStart || 0; }, weekdays: function() { return n2.weekdays(); }, weekdaysShort: function() { return n2.weekdaysShort(); }, weekdaysMin: function() { return n2.weekdaysMin(); }, months: function() { return n2.months(); }, monthsShort: function() { return n2.monthsShort(); }, longDateFormat: function(t4) { return s2(e4, t4); }, meridiem: e4.meridiem, ordinal: e4.ordinal }; }, n2.months = function() { return r2(l2(), "months"); }, n2.monthsShort = function() { return r2(l2(), "monthsShort", "months", 3); }, n2.weekdays = function(e4) { return r2(l2(), "weekdays", null, null, e4); }, n2.weekdaysShort = function(e4) { return r2(l2(), "weekdaysShort", "weekdays", 3, e4); }, n2.weekdaysMin = function(e4) { return r2(l2(), "weekdaysMin", "weekdays", 2, e4); }; }; }); })(pm); var mm = pm.exports; const hm = wp(mm); const bm = { modelValue: { type: [Number, String, Boolean], default: void 0 }, label: { type: [String, Boolean, Number, Object], default: void 0 }, value: { type: [String, Boolean, Number, Object], default: void 0 }, indeterminate: Boolean, disabled: Boolean, checked: Boolean, name: { type: String, default: void 0 }, trueValue: { type: [String, Number], default: void 0 }, falseValue: { type: [String, Number], default: void 0 }, trueLabel: { type: [String, Number], default: void 0 }, falseLabel: { type: [String, Number], default: void 0 }, id: { type: String, default: void 0 }, controls: { type: String, default: void 0 }, border: Boolean, size: Nc, tabindex: [String, Number], validateEvent: { type: Boolean, default: true }, ...Zc(["ariaControls"]) }; const gm = { [Is]: (e2) => ot(e2) || Ol(e2) || Ml(e2), change: (e2) => ot(e2) || Ol(e2) || Ml(e2) }; const ym = Symbol("checkboxGroupContextKey"); const wm = ({ model: e2, isChecked: t2 }) => { const n2 = vue.inject(ym, void 0); const a2 = vue.computed(() => { var a3, o3; const r2 = (a3 = n2 == null ? void 0 : n2.max) == null ? void 0 : a3.value; const l2 = (o3 = n2 == null ? void 0 : n2.min) == null ? void 0 : o3.value; return !_l(r2) && e2.value.length >= r2 && !t2.value || !_l(l2) && e2.value.length <= l2 && t2.value; }); const o2 = fd(vue.computed(() => (n2 == null ? void 0 : n2.disabled.value) || a2.value)); return { isDisabled: o2, isLimitDisabled: a2 }; }; const km = (e2, { model: t2, isLimitExceeded: n2, hasOwnLabel: a2, isDisabled: o2, isLabeledByFormItem: i2 }) => { const u2 = vue.inject(ym, void 0); const { formItem: c2 } = vd(); const { emit: d2 } = vue.getCurrentInstance(); function v2(t3) { var n3, a3, o3, r2; return [true, e2.trueValue, e2.trueLabel].includes(t3) ? (a3 = (n3 = e2.trueValue) != null ? n3 : e2.trueLabel) != null ? a3 : true : (r2 = (o3 = e2.falseValue) != null ? o3 : e2.falseLabel) != null ? r2 : false; } function p2(e3, t3) { d2("change", v2(e3), t3); } function m2(e3) { if (n2.value) return; const t3 = e3.target; d2("change", v2(t3.checked), e3); } async function h2(r2) { if (n2.value) return; if (!a2.value && !o2.value && i2.value) { const n3 = r2.composedPath(); const a3 = n3.some((e3) => e3.tagName === "LABEL"); if (!a3) { t2.value = v2([false, e2.falseValue, e2.falseLabel].includes(t2.value)); await vue.nextTick(); p2(t2.value, r2); } } } const b2 = vue.computed(() => (u2 == null ? void 0 : u2.validateEvent) || e2.validateEvent); vue.watch(() => e2.modelValue, () => { if (b2.value) { c2 == null ? void 0 : c2.validate("change").catch((e3) => Pl()); } }); return { handleChange: m2, onClickRoot: h2 }; }; const xm = (e2) => { const t2 = vue.ref(false); const { emit: n2 } = vue.getCurrentInstance(); const a2 = vue.inject(ym, void 0); const o2 = vue.computed(() => _l(a2) === false); const s2 = vue.ref(false); const i2 = vue.computed({ get() { var n3, r2; return o2.value ? (n3 = a2 == null ? void 0 : a2.modelValue) == null ? void 0 : n3.value : (r2 = e2.modelValue) != null ? r2 : t2.value; }, set(e3) { var r2, l2; if (o2.value && tt(e3)) { s2.value = ((r2 = a2 == null ? void 0 : a2.max) == null ? void 0 : r2.value) !== void 0 && e3.length > (a2 == null ? void 0 : a2.max.value) && e3.length > i2.value.length; s2.value === false && ((l2 = a2 == null ? void 0 : a2.changeEvent) == null ? void 0 : l2.call(a2, e3)); } else { n2(Is, e3); t2.value = e3; } } }); return { model: i2, isGroup: o2, isLimitExceeded: s2 }; }; const Sm = (e2, t2, { model: n2 }) => { const a2 = vue.inject(ym, void 0); const o2 = vue.ref(false); const l2 = vue.computed(() => { if (!El(e2.value)) { return e2.value; } return e2.label; }); const s2 = vue.computed(() => { const t3 = n2.value; if (Ml(t3)) { return t3; } else if (tt(t3)) { if (rt(l2.value)) { return t3.map(vue.toRaw).some((e3) => gl(e3, l2.value)); } else { return t3.map(vue.toRaw).includes(l2.value); } } else if (t3 !== null && t3 !== void 0) { return t3 === e2.trueValue || t3 === e2.trueLabel; } else { return !!t3; } }); const i2 = dd(vue.computed(() => { var e3; return (e3 = a2 == null ? void 0 : a2.size) == null ? void 0 : e3.value; }), { prop: true }); const u2 = dd(vue.computed(() => { var e3; return (e3 = a2 == null ? void 0 : a2.size) == null ? void 0 : e3.value; })); const c2 = vue.computed(() => !!t2.default || !El(l2.value)); return { checkboxButtonSize: i2, isChecked: s2, isFocused: o2, checkboxSize: u2, hasOwnLabel: c2, actualValue: l2 }; }; const Cm = (e2, t2) => { const { formItem: n2 } = vd(); const { model: a2, isGroup: o2, isLimitExceeded: l2 } = xm(e2); const { isFocused: s2, isChecked: i2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, actualValue: f2 } = Sm(e2, t2, { model: a2 }); const { isDisabled: v2 } = wm({ model: a2, isChecked: i2 }); const { inputId: p2, isLabeledByFormItem: m2 } = pd(e2, { formItemContext: n2, disableIdGeneration: d2, disableIdManagement: o2 }); const { handleChange: h2, onClickRoot: b2 } = km(e2, { model: a2, isLimitExceeded: l2, hasOwnLabel: d2, isDisabled: v2, isLabeledByFormItem: m2 }); const g2 = () => { function t3() { var t4, n3; if (tt(a2.value) && !a2.value.includes(f2.value)) { a2.value.push(f2.value); } else { a2.value = (n3 = (t4 = e2.trueValue) != null ? t4 : e2.trueLabel) != null ? n3 : true; } } e2.checked && t3(); }; g2(); Ws({ from: "controls", replacement: "aria-controls", version: "2.8.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.controls)); Ws({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => o2.value && El(e2.value))); Ws({ from: "true-label", replacement: "true-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.trueLabel)); Ws({ from: "false-label", replacement: "false-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.falseLabel)); return { inputId: p2, isLabeledByFormItem: m2, isChecked: i2, isDisabled: v2, isFocused: s2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, model: a2, actualValue: f2, handleChange: h2, onClickRoot: b2 }; }; const _m = ["id", "indeterminate", "name", "tabindex", "disabled", "true-value", "false-value"]; const Mm = ["id", "indeterminate", "disabled", "value", "name", "tabindex"]; const Om = vue.defineComponent({ name: "ElCheckbox" }); const Dm = vue.defineComponent({ ...Om, props: bm, emits: gm, setup(e2) { const o2 = e2; const l2 = vue.useSlots(); const { inputId: s2, isLabeledByFormItem: u2, isChecked: c2, isDisabled: d2, isFocused: f2, checkboxSize: v2, hasOwnLabel: m2, model: h2, actualValue: b2, handleChange: g2, onClickRoot: y2 } = Cm(o2, l2); const k2 = oi("checkbox"); const x2 = vue.computed(() => [k2.b(), k2.m(v2.value), k2.is("disabled", d2.value), k2.is("bordered", o2.border), k2.is("checked", c2.value)]); const S2 = vue.computed(() => [k2.e("input"), k2.is("disabled", d2.value), k2.is("checked", c2.value), k2.is("indeterminate", o2.indeterminate), k2.is("focus", f2.value)]); return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(!vue.unref(m2) && vue.unref(u2) ? "span" : "label"), { class: vue.normalizeClass(vue.unref(x2)), "aria-controls": e3.indeterminate ? e3.controls || e3.ariaControls : null, onClick: vue.unref(y2) }, { default: vue.withCtx(() => { var r2, l3; return [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(S2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 0, id: vue.unref(s2), "onUpdate:modelValue": o3[0] || (o3[0] = (e4) => vue.isRef(h2) ? h2.value = e4 : null), class: vue.normalizeClass(vue.unref(k2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(d2), "true-value": (r2 = e3.trueValue) != null ? r2 : e3.trueLabel, "false-value": (l3 = e3.falseValue) != null ? l3 : e3.falseLabel, onChange: o3[1] || (o3[1] = (...e4) => vue.unref(g2) && vue.unref(g2)(...e4)), onFocus: o3[2] || (o3[2] = (e4) => f2.value = true), onBlur: o3[3] || (o3[3] = (e4) => f2.value = false), onClick: o3[4] || (o3[4] = vue.withModifiers(() => { }, ["stop"])) }, null, 42, _m)), [[vue.vModelCheckbox, vue.unref(h2)]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 1, id: vue.unref(s2), "onUpdate:modelValue": o3[5] || (o3[5] = (e4) => vue.isRef(h2) ? h2.value = e4 : null), class: vue.normalizeClass(vue.unref(k2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, disabled: vue.unref(d2), value: vue.unref(b2), name: e3.name, tabindex: e3.tabindex, onChange: o3[6] || (o3[6] = (...e4) => vue.unref(g2) && vue.unref(g2)(...e4)), onFocus: o3[7] || (o3[7] = (e4) => f2.value = true), onBlur: o3[8] || (o3[8] = (e4) => f2.value = false), onClick: o3[9] || (o3[9] = vue.withModifiers(() => { }, ["stop"])) }, null, 42, Mm)), [[vue.vModelCheckbox, vue.unref(h2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(k2).e("inner")) }, null, 2)], 2), vue.unref(m2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(k2).e("label")) }, [vue.renderSlot(e3.$slots, "default"), !e3.$slots.default ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(e3.label), 1)], 64)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true)]; }), _: 3 }, 8, ["class", "aria-controls", "onClick"])); } }); var Am = ad(Dm, [["__file", "checkbox.vue"]]); const Em = ["name", "tabindex", "disabled", "true-value", "false-value"]; const $m = ["name", "tabindex", "disabled", "value"]; const Lm = vue.defineComponent({ name: "ElCheckboxButton" }); const Im = vue.defineComponent({ ...Lm, props: bm, emits: gm, setup(e2) { const a2 = e2; const o2 = vue.useSlots(); const { isFocused: l2, isChecked: s2, isDisabled: u2, checkboxButtonSize: c2, model: d2, actualValue: v2, handleChange: m2 } = Cm(a2, o2); const h2 = vue.inject(ym, void 0); const b2 = oi("checkbox"); const g2 = vue.computed(() => { var e3, t2, n2, a3; const o3 = (t2 = (e3 = h2 == null ? void 0 : h2.fill) == null ? void 0 : e3.value) != null ? t2 : ""; return { backgroundColor: o3, borderColor: o3, color: (a3 = (n2 = h2 == null ? void 0 : h2.textColor) == null ? void 0 : n2.value) != null ? a3 : "", boxShadow: o3 ? `-1px 0 0 0 ${o3}` : void 0 }; }); const y2 = vue.computed(() => [b2.b("button"), b2.bm("button", c2.value), b2.is("disabled", u2.value), b2.is("checked", s2.value), b2.is("focus", l2.value)]); return (e3, a3) => { var o3, r2; return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass(vue.unref(y2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 0, "onUpdate:modelValue": a3[0] || (a3[0] = (e4) => vue.isRef(d2) ? d2.value = e4 : null), class: vue.normalizeClass(vue.unref(b2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(u2), "true-value": (o3 = e3.trueValue) != null ? o3 : e3.trueLabel, "false-value": (r2 = e3.falseValue) != null ? r2 : e3.falseLabel, onChange: a3[1] || (a3[1] = (...e4) => vue.unref(m2) && vue.unref(m2)(...e4)), onFocus: a3[2] || (a3[2] = (e4) => l2.value = true), onBlur: a3[3] || (a3[3] = (e4) => l2.value = false), onClick: a3[4] || (a3[4] = vue.withModifiers(() => { }, ["stop"])) }, null, 42, Em)), [[vue.vModelCheckbox, vue.unref(d2)]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 1, "onUpdate:modelValue": a3[5] || (a3[5] = (e4) => vue.isRef(d2) ? d2.value = e4 : null), class: vue.normalizeClass(vue.unref(b2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(u2), value: vue.unref(v2), onChange: a3[6] || (a3[6] = (...e4) => vue.unref(m2) && vue.unref(m2)(...e4)), onFocus: a3[7] || (a3[7] = (e4) => l2.value = true), onBlur: a3[8] || (a3[8] = (e4) => l2.value = false), onClick: a3[9] || (a3[9] = vue.withModifiers(() => { }, ["stop"])) }, null, 42, $m)), [[vue.vModelCheckbox, vue.unref(d2)]]), e3.$slots.default || e3.label ? (vue.openBlock(), vue.createElementBlock("span", { key: 2, class: vue.normalizeClass(vue.unref(b2).be("button", "inner")), style: vue.normalizeStyle(vue.unref(s2) ? vue.unref(g2) : void 0) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 6)) : vue.createCommentVNode("v-if", true)], 2); }; } }); var Tm = ad(Im, [["__file", "checkbox-button.vue"]]); const Pm = Cs({ modelValue: { type: ks(Array), default: () => [] }, disabled: Boolean, min: Number, max: Number, size: Nc, label: String, fill: String, textColor: String, tag: { type: String, default: "div" }, validateEvent: { type: Boolean, default: true }, ...Zc(["ariaLabel"]) }); const Bm = { [Is]: (e2) => tt(e2), change: (e2) => tt(e2) }; const Rm = vue.defineComponent({ name: "ElCheckboxGroup" }); const Vm = vue.defineComponent({ ...Rm, props: Pm, emits: Bm, setup(e2, { emit: n2 }) { const a2 = e2; const o2 = oi("checkbox"); const { formItem: l2 } = vd(); const { inputId: u2, isLabeledByFormItem: c2 } = pd(a2, { formItemContext: l2 }); const d2 = async (e3) => { n2(Is, e3); await vue.nextTick(); n2("change", e3); }; const f2 = vue.computed({ get() { return a2.modelValue; }, set(e3) { d2(e3); } }); vue.provide(ym, { ...Cl(vue.toRefs(a2), ["size", "min", "max", "disabled", "validateEvent", "fill", "textColor"]), modelValue: f2, changeEvent: d2 }); Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-checkbox-group", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!a2.label)); vue.watch(() => a2.modelValue, () => { if (a2.validateEvent) { l2 == null ? void 0 : l2.validate("change").catch((e3) => Pl()); } }); return (e3, n3) => { var a3; return vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), { id: vue.unref(u2), class: vue.normalizeClass(vue.unref(o2).b("group")), role: "group", "aria-label": !vue.unref(c2) ? e3.label || e3.ariaLabel || "checkbox-group" : void 0, "aria-labelledby": vue.unref(c2) ? (a3 = vue.unref(l2)) == null ? void 0 : a3.labelId : void 0 }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "aria-label", "aria-labelledby"]); }; } }); var Fm = ad(Vm, [["__file", "checkbox-group.vue"]]); const jm = Ds(Am, { CheckboxButton: Tm, CheckboxGroup: Fm }); As(Tm); const zm = As(Fm); const Nm = Cs({ modelValue: { type: [String, Number, Boolean], default: void 0 }, size: Nc, disabled: Boolean, label: { type: [String, Number, Boolean], default: void 0 }, value: { type: [String, Number, Boolean], default: void 0 }, name: { type: String, default: void 0 } }); const Hm = Cs({ ...Nm, border: Boolean }); const Ym = { [Is]: (e2) => ot(e2) || Ol(e2) || Ml(e2), [Ts]: (e2) => ot(e2) || Ol(e2) || Ml(e2) }; const Wm = Symbol("radioGroupKey"); const Um = (e2, t2) => { const n2 = vue.ref(); const a2 = vue.inject(Wm, void 0); const o2 = vue.computed(() => !!a2); const l2 = vue.computed(() => { if (!El(e2.value)) { return e2.value; } return e2.label; }); const s2 = vue.computed({ get() { return o2.value ? a2.modelValue : e2.modelValue; }, set(r2) { if (o2.value) { a2.changeEvent(r2); } else { t2 && t2(Is, r2); } n2.value.checked = e2.modelValue === l2.value; } }); const i2 = dd(vue.computed(() => a2 == null ? void 0 : a2.size)); const u2 = fd(vue.computed(() => a2 == null ? void 0 : a2.disabled)); const c2 = vue.ref(false); const d2 = vue.computed(() => u2.value || o2.value && s2.value !== l2.value ? -1 : 0); Ws({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-radio", ref: "https://element-plus.org/en-US/component/radio.html" }, vue.computed(() => o2.value && El(e2.value))); return { radioRef: n2, isGroup: o2, radioGroup: a2, focus: c2, size: i2, disabled: u2, tabIndex: d2, modelValue: s2, actualValue: l2 }; }; const Km = ["value", "name", "disabled"]; const qm = vue.defineComponent({ name: "ElRadio" }); const Gm = vue.defineComponent({ ...qm, props: Hm, emits: Ym, setup(e2, { emit: o2 }) { const r2 = e2; const l2 = oi("radio"); const { radioRef: s2, radioGroup: u2, focus: c2, size: d2, disabled: f2, modelValue: v2, actualValue: m2 } = Um(r2, o2); function h2() { vue.nextTick(() => o2("change", v2.value)); } return (e3, o3) => { var r3; return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass([vue.unref(l2).b(), vue.unref(l2).is("disabled", vue.unref(f2)), vue.unref(l2).is("focus", vue.unref(c2)), vue.unref(l2).is("bordered", e3.border), vue.unref(l2).is("checked", vue.unref(v2) === vue.unref(m2)), vue.unref(l2).m(vue.unref(d2))]) }, [vue.createElementVNode("span", { class: vue.normalizeClass([vue.unref(l2).e("input"), vue.unref(l2).is("disabled", vue.unref(f2)), vue.unref(l2).is("checked", vue.unref(v2) === vue.unref(m2))]) }, [vue.withDirectives(vue.createElementVNode("input", { ref_key: "radioRef", ref: s2, "onUpdate:modelValue": o3[0] || (o3[0] = (e4) => vue.isRef(v2) ? v2.value = e4 : null), class: vue.normalizeClass(vue.unref(l2).e("original")), value: vue.unref(m2), name: e3.name || ((r3 = vue.unref(u2)) == null ? void 0 : r3.name), disabled: vue.unref(f2), type: "radio", onFocus: o3[1] || (o3[1] = (e4) => c2.value = true), onBlur: o3[2] || (o3[2] = (e4) => c2.value = false), onChange: h2, onClick: o3[3] || (o3[3] = vue.withModifiers(() => { }, ["stop"])) }, null, 42, Km), [[vue.vModelRadio, vue.unref(v2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).e("inner")) }, null, 2)], 2), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).e("label")), onKeydown: o3[4] || (o3[4] = vue.withModifiers(() => { }, ["stop"])) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 34)], 2); }; } }); var Zm = ad(Gm, [["__file", "radio.vue"]]); const Jm = Cs({ ...Nm }); const Xm = ["value", "name", "disabled"]; const Qm = vue.defineComponent({ name: "ElRadioButton" }); const eh = vue.defineComponent({ ...Qm, props: Jm, setup(e2) { const o2 = e2; const l2 = oi("radio"); const { radioRef: s2, focus: u2, size: c2, disabled: d2, modelValue: f2, radioGroup: v2, actualValue: m2 } = Um(o2); const h2 = vue.computed(() => ({ backgroundColor: (v2 == null ? void 0 : v2.fill) || "", borderColor: (v2 == null ? void 0 : v2.fill) || "", boxShadow: (v2 == null ? void 0 : v2.fill) ? `-1px 0 0 0 ${v2.fill}` : "", color: (v2 == null ? void 0 : v2.textColor) || "" })); return (e3, o3) => { var r2; return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass([vue.unref(l2).b("button"), vue.unref(l2).is("active", vue.unref(f2) === vue.unref(m2)), vue.unref(l2).is("disabled", vue.unref(d2)), vue.unref(l2).is("focus", vue.unref(u2)), vue.unref(l2).bm("button", vue.unref(c2))]) }, [vue.withDirectives(vue.createElementVNode("input", { ref_key: "radioRef", ref: s2, "onUpdate:modelValue": o3[0] || (o3[0] = (e4) => vue.isRef(f2) ? f2.value = e4 : null), class: vue.normalizeClass(vue.unref(l2).be("button", "original-radio")), value: vue.unref(m2), type: "radio", name: e3.name || ((r2 = vue.unref(v2)) == null ? void 0 : r2.name), disabled: vue.unref(d2), onFocus: o3[1] || (o3[1] = (e4) => u2.value = true), onBlur: o3[2] || (o3[2] = (e4) => u2.value = false), onClick: o3[3] || (o3[3] = vue.withModifiers(() => { }, ["stop"])) }, null, 42, Xm), [[vue.vModelRadio, vue.unref(f2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).be("button", "inner")), style: vue.normalizeStyle(vue.unref(f2) === vue.unref(m2) ? vue.unref(h2) : {}), onKeydown: o3[4] || (o3[4] = vue.withModifiers(() => { }, ["stop"])) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 38)], 2); }; } }); var th = ad(eh, [["__file", "radio-button.vue"]]); const nh = Cs({ id: { type: String, default: void 0 }, size: Nc, disabled: Boolean, modelValue: { type: [String, Number, Boolean], default: void 0 }, fill: { type: String, default: "" }, label: { type: String, default: void 0 }, textColor: { type: String, default: "" }, name: { type: String, default: void 0 }, validateEvent: { type: Boolean, default: true }, ...Zc(["ariaLabel"]) }); const ah = Ym; const oh = ["id", "aria-label", "aria-labelledby"]; const rh = vue.defineComponent({ name: "ElRadioGroup" }); const lh = vue.defineComponent({ ...rh, props: nh, emits: ah, setup(e2, { emit: a2 }) { const o2 = e2; const l2 = oi("radio"); const c2 = xc(); const d2 = vue.ref(); const { formItem: f2 } = vd(); const { inputId: p2, isLabeledByFormItem: m2 } = pd(o2, { formItemContext: f2 }); const h2 = (e3) => { a2(Is, e3); vue.nextTick(() => a2("change", e3)); }; vue.onMounted(() => { const e3 = d2.value.querySelectorAll("[type=radio]"); const t2 = e3[0]; if (!Array.from(e3).some((e4) => e4.checked) && t2) { t2.tabIndex = 0; } }); const b2 = vue.computed(() => o2.name || c2.value); vue.provide(Wm, vue.reactive({ ...vue.toRefs(o2), changeEvent: h2, name: b2 })); vue.watch(() => o2.modelValue, () => { if (o2.validateEvent) { f2 == null ? void 0 : f2.validate("change").catch((e3) => Pl()); } }); Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-radio-group", ref: "https://element-plus.org/en-US/component/radio.html" }, vue.computed(() => !!o2.label)); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { id: vue.unref(p2), ref_key: "radioGroupRef", ref: d2, class: vue.normalizeClass(vue.unref(l2).b("group")), role: "radiogroup", "aria-label": !vue.unref(m2) ? e3.label || e3.ariaLabel || "radio-group" : void 0, "aria-labelledby": vue.unref(m2) ? vue.unref(f2).labelId : void 0 }, [vue.renderSlot(e3.$slots, "default")], 10, oh)); } }); var sh = ad(lh, [["__file", "radio-group.vue"]]); Ds(Zm, { RadioButton: th, RadioGroup: sh }); const ih = As(sh); const uh = As(th); var ch = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { return function(e3, t3) { var n2 = t3.prototype, a2 = n2.format; n2.format = function(e4) { var t4 = this, n3 = this.$locale(); if (!this.isValid()) return a2.bind(this)(e4); var o2 = this.$utils(), r2 = (e4 || "YYYY-MM-DDTHH:mm:ssZ").replace(/\[([^\]]+)]|Q|wo|ww|w|WW|W|zzz|z|gggg|GGGG|Do|X|x|k{1,2}|S/g, function(e5) { switch (e5) { case "Q": return Math.ceil((t4.$M + 1) / 3); case "Do": return n3.ordinal(t4.$D); case "gggg": return t4.weekYear(); case "GGGG": return t4.isoWeekYear(); case "wo": return n3.ordinal(t4.week(), "W"); case "w": case "ww": return o2.s(t4.week(), "w" === e5 ? 1 : 2, "0"); case "W": case "WW": return o2.s(t4.isoWeek(), "W" === e5 ? 1 : 2, "0"); case "k": case "kk": return o2.s(String(0 === t4.$H ? 24 : t4.$H), "k" === e5 ? 1 : 2, "0"); case "X": return Math.floor(t4.$d.getTime() / 1e3); case "x": return t4.$d.getTime(); case "z": return "[" + t4.offsetName() + "]"; case "zzz": return "[" + t4.offsetName("long") + "]"; default: return e5; } }); return a2.bind(this)(r2); }; }; }); })(ch); var dh = ch.exports; const fh = wp(dh); var vh = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { var e3 = "week", t3 = "year"; return function(n2, a2, o2) { var r2 = a2.prototype; r2.week = function(n3) { if (void 0 === n3 && (n3 = null), null !== n3) return this.add(7 * (n3 - this.week()), "day"); var a3 = this.$locale().yearStart || 1; if (11 === this.month() && this.date() > 25) { var r3 = o2(this).startOf(t3).add(1, t3).date(a3), l2 = o2(this).endOf(e3); if (r3.isBefore(l2)) return 1; } var s2 = o2(this).startOf(t3).date(a3).startOf(e3).subtract(1, "millisecond"), i2 = this.diff(s2, e3, true); return i2 < 0 ? o2(this).startOf("week").week() : Math.ceil(i2); }, r2.weeks = function(e4) { return void 0 === e4 && (e4 = null), this.week(e4); }; }; }); })(vh); var ph = vh.exports; const mh = wp(ph); var hh = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { return function(e3, t3) { t3.prototype.weekYear = function() { var e4 = this.month(), t4 = this.week(), n2 = this.year(); return 1 === t4 && 11 === e4 ? n2 + 1 : 0 === e4 && t4 >= 52 ? n2 - 1 : n2; }; }; }); })(hh); var bh = hh.exports; const gh = wp(bh); var yh = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { return function(e3, t3, n2) { t3.prototype.dayOfYear = function(e4) { var t4 = Math.round((n2(this).startOf("day") - n2(this).startOf("year")) / 864e5) + 1; return null == e4 ? t4 : this.add(e4 - t4, "day"); }; }; }); })(yh); var wh = yh.exports; const kh = wp(wh); var xh = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { return function(e3, t3) { t3.prototype.isSameOrAfter = function(e4, t4) { return this.isSame(e4, t4) || this.isAfter(e4, t4); }; }; }); })(xh); var Sh = xh.exports; const Ch = wp(Sh); var _h = { exports: {} }; (function(e2, t2) { !function(t3, n2) { e2.exports = n2(); }(yp, function() { return function(e3, t3) { t3.prototype.isSameOrBefore = function(e4, t4) { return this.isSame(e4, t4) || this.isBefore(e4, t4); }; }; }); })(_h); var Mh = _h.exports; const Oh = wp(Mh); const Dh = Symbol(); const Ah = Cs({ ...Np, type: { type: ks(String), default: "date" } }); const Eh = ["date", "dates", "year", "years", "month", "week", "range"]; const $h = Cs({ disabledDate: { type: ks(Function) }, date: { type: ks(Object), required: true }, minDate: { type: ks(Object) }, maxDate: { type: ks(Object) }, parsedValue: { type: ks([Object, Array]) }, rangeState: { type: ks(Object), default: () => ({ endDate: null, selecting: false }) } }); const Lh = Cs({ type: { type: ks(String), required: true, values: Ls }, dateFormat: String, timeFormat: String }); const Ih = Cs({ unlinkPanels: Boolean, parsedValue: { type: ks(Array) } }); const Th = (e2) => ({ type: String, values: Eh, default: e2 }); const Ph = Cs({ ...Lh, parsedValue: { type: ks([Object, Array]) }, visible: { type: Boolean }, format: { type: String, default: "" } }); const Bh = Cs({ ...$h, cellClassName: { type: ks(Function) }, showWeekNumber: Boolean, selectionMode: Th("date") }); const Rh = ["changerange", "pick", "select"]; const Vh = (e2) => { if (!tt(e2)) return false; const [t2, n2] = e2; return Sp.isDayjs(t2) && Sp.isDayjs(n2) && t2.isSameOrBefore(n2); }; const Fh = (e2, { lang: t2, unit: n2, unlinkPanels: a2 }) => { let o2; if (tt(e2)) { let [o3, r2] = e2.map((e3) => Sp(e3).locale(t2)); if (!a2) { r2 = o3.add(1, n2); } return [o3, r2]; } else if (e2) { o2 = Sp(e2); } else { o2 = Sp(); } o2 = o2.locale(t2); return [o2, o2.add(1, n2)]; }; const jh = (e2, t2, { columnIndexOffset: n2, startDate: a2, nextEndDate: o2, now: r2, unit: l2, relativeDateGetter: s2, setCellMetadata: i2, setRowMetadata: u2 }) => { for (let c2 = 0; c2 < e2.row; c2++) { const d2 = t2[c2]; for (let t3 = 0; t3 < e2.column; t3++) { let u3 = d2[t3 + n2]; if (!u3) { u3 = { row: c2, column: t3, type: "normal", inRange: false, start: false, end: false }; } const f2 = c2 * e2.column + t3; const v2 = s2(f2); u3.dayjs = v2; u3.date = v2.toDate(); u3.timestamp = v2.valueOf(); u3.type = "normal"; u3.inRange = !!(a2 && v2.isSameOrAfter(a2, l2) && o2 && v2.isSameOrBefore(o2, l2)) || !!(a2 && v2.isSameOrBefore(a2, l2) && o2 && v2.isSameOrAfter(o2, l2)); if (a2 == null ? void 0 : a2.isSameOrAfter(o2)) { u3.start = !!o2 && v2.isSame(o2, l2); u3.end = a2 && v2.isSame(a2, l2); } else { u3.start = !!a2 && v2.isSame(a2, l2); u3.end = !!o2 && v2.isSame(o2, l2); } const p2 = v2.isSame(r2, l2); if (p2) { u3.type = "today"; } i2 == null ? void 0 : i2(u3, { rowIndex: c2, columnIndex: t3 }); d2[t3 + n2] = u3; } u2 == null ? void 0 : u2(d2); } }; const zh = (e2 = "") => ["normal", "today"].includes(e2); const Nh = (e2, t2) => { const { lang: n2 } = Xs(); const a2 = vue.ref(); const o2 = vue.ref(); const l2 = vue.ref(); const u2 = vue.ref(); const c2 = vue.ref([[], [], [], [], [], []]); let d2 = false; const f2 = e2.date.$locale().weekStart || 7; const p2 = e2.date.locale("en").localeData().weekdaysShort().map((e3) => e3.toLowerCase()); const m2 = vue.computed(() => f2 > 3 ? 7 - f2 : -f2); const h2 = vue.computed(() => { const t3 = e2.date.startOf("month"); return t3.subtract(t3.day() || 7, "day"); }); const b2 = vue.computed(() => p2.concat(p2).slice(f2, f2 + 7)); const g2 = vue.computed(() => Wo(vue.unref(C2)).some((e3) => e3.isCurrent)); const y2 = vue.computed(() => { const t3 = e2.date.startOf("month"); const n3 = t3.day() || 7; const a3 = t3.daysInMonth(); const o3 = t3.subtract(1, "month").daysInMonth(); return { startOfMonthDay: n3, dateCountOfMonth: a3, dateCountOfLastMonth: o3 }; }); const w2 = vue.computed(() => e2.selectionMode === "dates" ? Fs(e2.parsedValue) : []); const k2 = (e3, { count: t3, rowIndex: n3, columnIndex: a3 }) => { const { startOfMonthDay: o3, dateCountOfMonth: r2, dateCountOfLastMonth: l3 } = vue.unref(y2); const s2 = vue.unref(m2); if (n3 >= 0 && n3 <= 1) { const r3 = o3 + s2 < 0 ? 7 + o3 + s2 : o3 + s2; if (a3 + n3 * 7 >= r3) { e3.text = t3; return true; } else { e3.text = l3 - (r3 - a3 % 7) + 1 + n3 * 7; e3.type = "prev-month"; } } else { if (t3 <= r2) { e3.text = t3; } else { e3.text = t3 - r2; e3.type = "next-month"; } return true; } return false; }; const x2 = (t3, { columnIndex: n3, rowIndex: a3 }, o3) => { const { disabledDate: r2, cellClassName: l3 } = e2; const s2 = vue.unref(w2); const u3 = k2(t3, { count: o3, rowIndex: a3, columnIndex: n3 }); const c3 = t3.dayjs.toDate(); t3.selected = s2.find((e3) => e3.isSame(t3.dayjs, "day")); t3.isSelected = !!t3.selected; t3.isCurrent = O2(t3); t3.disabled = r2 == null ? void 0 : r2(c3); t3.customClass = l3 == null ? void 0 : l3(c3); return u3; }; const S2 = (t3) => { if (e2.selectionMode === "week") { const [n3, a3] = e2.showWeekNumber ? [1, 7] : [0, 6]; const o3 = F2(t3[n3 + 1]); t3[n3].inRange = o3; t3[n3].start = o3; t3[a3].inRange = o3; t3[a3].end = o3; } }; const C2 = vue.computed(() => { const { minDate: t3, maxDate: a3, rangeState: o3, showWeekNumber: r2 } = e2; const l3 = vue.unref(m2); const s2 = vue.unref(c2); const u3 = "day"; let d3 = 1; if (r2) { for (let e3 = 0; e3 < 6; e3++) { if (!s2[e3][0]) { s2[e3][0] = { type: "week", text: vue.unref(h2).add(e3 * 7 + 1, u3).week() }; } } } jh({ row: 6, column: 7 }, s2, { startDate: t3, columnIndexOffset: r2 ? 1 : 0, nextEndDate: o3.endDate || a3 || o3.selecting && t3 || null, now: Sp().locale(vue.unref(n2)).startOf(u3), unit: u3, relativeDateGetter: (e3) => vue.unref(h2).add(e3 - l3, u3), setCellMetadata: (...e3) => { if (x2(...e3, d3)) { d3 += 1; } }, setRowMetadata: S2 }); return s2; }); vue.watch(() => e2.date, async () => { var e3; if ((e3 = vue.unref(a2)) == null ? void 0 : e3.contains(document.activeElement)) { await vue.nextTick(); await M2(); } }); const M2 = async () => { var e3; return (e3 = vue.unref(o2)) == null ? void 0 : e3.focus(); }; const O2 = (t3) => e2.selectionMode === "date" && zh(t3.type) && D2(t3, e2.parsedValue); const D2 = (t3, a3) => { if (!a3) return false; return Sp(a3).locale(vue.unref(n2)).isSame(e2.date.date(Number(t3.text)), "day"); }; const A2 = (t3, n3) => { const a3 = t3 * 7 + (n3 - (e2.showWeekNumber ? 1 : 0)) - vue.unref(m2); return vue.unref(h2).add(a3, "day"); }; const E2 = (n3) => { var a3; if (!e2.rangeState.selecting) return; let o3 = n3.target; if (o3.tagName === "SPAN") { o3 = (a3 = o3.parentNode) == null ? void 0 : a3.parentNode; } if (o3.tagName === "DIV") { o3 = o3.parentNode; } if (o3.tagName !== "TD") return; const r2 = o3.parentNode.rowIndex - 1; const s2 = o3.cellIndex; if (vue.unref(C2)[r2][s2].disabled) return; if (r2 !== vue.unref(l2) || s2 !== vue.unref(u2)) { l2.value = r2; u2.value = s2; t2("changerange", { selecting: true, endDate: A2(r2, s2) }); } }; const $2 = (e3) => !vue.unref(g2) && (e3 == null ? void 0 : e3.text) === 1 && e3.type === "normal" || e3.isCurrent; const L2 = (t3) => { if (d2 || vue.unref(g2) || e2.selectionMode !== "date") return; V2(t3, true); }; const I2 = (e3) => { const t3 = e3.target.closest("td"); if (!t3) return; d2 = true; }; const T2 = (e3) => { const t3 = e3.target.closest("td"); if (!t3) return; d2 = false; }; const P2 = (n3) => { if (!e2.rangeState.selecting || !e2.minDate) { t2("pick", { minDate: n3, maxDate: null }); t2("select", true); } else { if (n3 >= e2.minDate) { t2("pick", { minDate: e2.minDate, maxDate: n3 }); } else { t2("pick", { minDate: n3, maxDate: e2.minDate }); } t2("select", false); } }; const B2 = (e3) => { const n3 = e3.week(); const a3 = `${e3.year()}w${n3}`; t2("pick", { year: e3.year(), week: n3, value: a3, date: e3.startOf("week") }); }; const R2 = (n3, a3) => { const o3 = a3 ? Fs(e2.parsedValue).filter((e3) => (e3 == null ? void 0 : e3.valueOf()) !== n3.valueOf()) : Fs(e2.parsedValue).concat([n3]); t2("pick", o3); }; const V2 = (n3, a3 = false) => { const o3 = n3.target.closest("td"); if (!o3) return; const r2 = o3.parentNode.rowIndex - 1; const l3 = o3.cellIndex; const s2 = vue.unref(C2)[r2][l3]; if (s2.disabled || s2.type === "week") return; const u3 = A2(r2, l3); switch (e2.selectionMode) { case "range": { P2(u3); break; } case "date": { t2("pick", u3, a3); break; } case "week": { B2(u3); break; } case "dates": { R2(u3, !!s2.selected); break; } } }; const F2 = (t3) => { if (e2.selectionMode !== "week") return false; let n3 = e2.date.startOf("day"); if (t3.type === "prev-month") { n3 = n3.subtract(1, "month"); } if (t3.type === "next-month") { n3 = n3.add(1, "month"); } n3 = n3.date(Number.parseInt(t3.text, 10)); if (e2.parsedValue && !Array.isArray(e2.parsedValue)) { const t4 = (e2.parsedValue.day() - f2 + 7) % 7 - 1; const a3 = e2.parsedValue.subtract(t4, "day"); return a3.isSame(n3, "day"); } return false; }; return { WEEKS: b2, rows: C2, tbodyRef: a2, currentCellRef: o2, focus: M2, isCurrent: O2, isWeekActive: F2, isSelectedCell: $2, handlePickDate: V2, handleMouseUp: T2, handleMouseDown: I2, handleMouseMove: E2, handleFocus: L2 }; }; const Hh = (e2, { isCurrent: t2, isWeekActive: n2 }) => { const a2 = oi("date-table"); const { t: o2 } = Xs(); const l2 = vue.computed(() => [a2.b(), { "is-week-mode": e2.selectionMode === "week" }]); const s2 = vue.computed(() => o2("el.datepicker.dateTablePrompt")); const i2 = vue.computed(() => o2("el.datepicker.week")); const u2 = (n3) => { const a3 = []; if (zh(n3.type) && !n3.disabled) { a3.push("available"); if (n3.type === "today") { a3.push("today"); } } else { a3.push(n3.type); } if (t2(n3)) { a3.push("current"); } if (n3.inRange && (zh(n3.type) || e2.selectionMode === "week")) { a3.push("in-range"); if (n3.start) { a3.push("start-date"); } if (n3.end) { a3.push("end-date"); } } if (n3.disabled) { a3.push("disabled"); } if (n3.selected) { a3.push("selected"); } if (n3.customClass) { a3.push(n3.customClass); } return a3.join(" "); }; const c2 = (e3) => [a2.e("row"), { current: n2(e3) }]; return { tableKls: l2, tableLabel: s2, weekLabel: i2, getCellClasses: u2, getRowKls: c2, t: o2 }; }; const Yh = Cs({ cell: { type: ks(Object) } }); var Wh = vue.defineComponent({ name: "ElDatePickerCell", props: Yh, setup(e2) { const t2 = oi("date-table-cell"); const { slots: n2 } = vue.inject(Dh); return () => { const { cell: a2 } = e2; return vue.renderSlot(n2, "default", { ...a2 }, () => [vue.createVNode("div", { class: t2.b() }, [vue.createVNode("span", { class: t2.e("text") }, [a2 == null ? void 0 : a2.text])])]); }; } }); const Uh = ["aria-label"]; const Kh = { key: 0, scope: "col" }; const qh = ["aria-label"]; const Gh = ["aria-current", "aria-selected", "tabindex"]; const Zh = vue.defineComponent({ __name: "basic-date-table", props: Bh, emits: Rh, setup(e2, { expose: o2, emit: r2 }) { const l2 = e2; const { WEEKS: s2, rows: u2, tbodyRef: c2, currentCellRef: d2, focus: f2, isCurrent: v2, isWeekActive: p2, isSelectedCell: m2, handlePickDate: h2, handleMouseUp: b2, handleMouseDown: g2, handleMouseMove: y2, handleFocus: w2 } = Nh(l2, r2); const { tableLabel: k2, tableKls: x2, weekLabel: S2, getCellClasses: C2, getRowKls: _2, t: A2 } = Hh(l2, { isCurrent: v2, isWeekActive: p2 }); o2({ focus: f2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("table", { "aria-label": vue.unref(k2), class: vue.normalizeClass(vue.unref(x2)), cellspacing: "0", cellpadding: "0", role: "grid", onClick: o3[1] || (o3[1] = (...e4) => vue.unref(h2) && vue.unref(h2)(...e4)), onMousemove: o3[2] || (o3[2] = (...e4) => vue.unref(y2) && vue.unref(y2)(...e4)), onMousedown: o3[3] || (o3[3] = vue.withModifiers((...e4) => vue.unref(g2) && vue.unref(g2)(...e4), ["prevent"])), onMouseup: o3[4] || (o3[4] = (...e4) => vue.unref(b2) && vue.unref(b2)(...e4)) }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: c2 }, [vue.createElementVNode("tr", null, [e3.showWeekNumber ? (vue.openBlock(), vue.createElementBlock("th", Kh, vue.toDisplayString(vue.unref(S2)), 1)) : vue.createCommentVNode("v-if", true), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(s2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("th", { key: a2, "aria-label": vue.unref(A2)("el.datepicker.weeksFull." + e4), scope: "col" }, vue.toDisplayString(vue.unref(A2)("el.datepicker.weeks." + e4)), 9, qh))), 128))]), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(u2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("tr", { key: a2, class: vue.normalizeClass(vue.unref(_2)(e4[1])) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, r3) => (vue.openBlock(), vue.createElementBlock("td", { key: `${a2}.${r3}`, ref_for: true, ref: (t2) => vue.unref(m2)(e5) && (d2.value = t2), class: vue.normalizeClass(vue.unref(C2)(e5)), "aria-current": e5.isCurrent ? "date" : void 0, "aria-selected": e5.isCurrent, tabindex: vue.unref(m2)(e5) ? 0 : -1, onFocus: o3[0] || (o3[0] = (...e6) => vue.unref(w2) && vue.unref(w2)(...e6)) }, [vue.createVNode(vue.unref(Wh), { cell: e5 }, null, 8, ["cell"])], 42, Gh))), 128))], 2))), 128))], 512)], 42, Uh)); } }); var Jh = ad(Zh, [["__file", "basic-date-table.vue"]]); const Xh = Cs({ ...$h, selectionMode: Th("month") }); const Qh = ["aria-label"]; const eb = ["aria-selected", "aria-label", "tabindex", "onKeydown"]; const tb = { class: "cell" }; const nb = vue.defineComponent({ __name: "basic-month-table", props: Xh, emits: ["changerange", "pick", "select"], setup(e2, { expose: o2, emit: l2 }) { const u2 = e2; const c2 = (e3, t2, n2) => { const a2 = Sp().locale(n2).startOf("month").month(t2).year(e3); const o3 = a2.daysInMonth(); return Lp(o3).map((e4) => a2.add(e4, "day").toDate()); }; const d2 = oi("month-table"); const { t: f2, lang: p2 } = Xs(); const m2 = vue.ref(); const h2 = vue.ref(); const b2 = vue.ref(u2.date.locale("en").localeData().monthsShort().map((e3) => e3.toLowerCase())); const g2 = vue.ref([[], [], []]); const y2 = vue.ref(); const w2 = vue.ref(); const k2 = vue.computed(() => { var e3, t2; const n2 = g2.value; const a2 = Sp().locale(p2.value).startOf("month"); for (let o3 = 0; o3 < 3; o3++) { const r2 = n2[o3]; for (let n3 = 0; n3 < 4; n3++) { const l3 = r2[n3] || (r2[n3] = { row: o3, column: n3, type: "normal", inRange: false, start: false, end: false, text: -1, disabled: false }); l3.type = "normal"; const s2 = o3 * 4 + n3; const i2 = u2.date.startOf("year").month(s2); const c3 = u2.rangeState.endDate || u2.maxDate || u2.rangeState.selecting && u2.minDate || null; l3.inRange = !!(u2.minDate && i2.isSameOrAfter(u2.minDate, "month") && c3 && i2.isSameOrBefore(c3, "month")) || !!(u2.minDate && i2.isSameOrBefore(u2.minDate, "month") && c3 && i2.isSameOrAfter(c3, "month")); if ((e3 = u2.minDate) == null ? void 0 : e3.isSameOrAfter(c3)) { l3.start = !!(c3 && i2.isSame(c3, "month")); l3.end = u2.minDate && i2.isSame(u2.minDate, "month"); } else { l3.start = !!(u2.minDate && i2.isSame(u2.minDate, "month")); l3.end = !!(c3 && i2.isSame(c3, "month")); } const d3 = a2.isSame(i2); if (d3) { l3.type = "today"; } l3.text = s2; l3.disabled = ((t2 = u2.disabledDate) == null ? void 0 : t2.call(u2, i2.toDate())) || false; } } return n2; }); const x2 = () => { var e3; (e3 = h2.value) == null ? void 0 : e3.focus(); }; const S2 = (e3) => { const t2 = {}; const n2 = u2.date.year(); const a2 = /* @__PURE__ */ new Date(); const o3 = e3.text; t2.disabled = u2.disabledDate ? c2(n2, o3, p2.value).every(u2.disabledDate) : false; t2.current = Fs(u2.parsedValue).findIndex((e4) => Sp.isDayjs(e4) && e4.year() === n2 && e4.month() === o3) >= 0; t2.today = a2.getFullYear() === n2 && a2.getMonth() === o3; if (e3.inRange) { t2["in-range"] = true; if (e3.start) { t2["start-date"] = true; } if (e3.end) { t2["end-date"] = true; } } return t2; }; const C2 = (e3) => { const t2 = u2.date.year(); const n2 = e3.text; return Fs(u2.date).findIndex((e4) => e4.year() === t2 && e4.month() === n2) >= 0; }; const M2 = (e3) => { var t2; if (!u2.rangeState.selecting) return; let n2 = e3.target; if (n2.tagName === "SPAN") { n2 = (t2 = n2.parentNode) == null ? void 0 : t2.parentNode; } if (n2.tagName === "DIV") { n2 = n2.parentNode; } if (n2.tagName !== "TD") return; const a2 = n2.parentNode.rowIndex; const o3 = n2.cellIndex; if (k2.value[a2][o3].disabled) return; if (a2 !== y2.value || o3 !== w2.value) { y2.value = a2; w2.value = o3; l2("changerange", { selecting: true, endDate: u2.date.startOf("year").month(a2 * 4 + o3) }); } }; const A2 = (e3) => { var t2; const n2 = (t2 = e3.target) == null ? void 0 : t2.closest("td"); if ((n2 == null ? void 0 : n2.tagName) !== "TD") return; if (Rl(n2, "disabled")) return; const a2 = n2.cellIndex; const o3 = n2.parentNode.rowIndex; const r2 = o3 * 4 + a2; const s2 = u2.date.startOf("year").month(r2); if (u2.selectionMode === "range") { if (!u2.rangeState.selecting) { l2("pick", { minDate: s2, maxDate: null }); l2("select", true); } else { if (u2.minDate && s2 >= u2.minDate) { l2("pick", { minDate: u2.minDate, maxDate: s2 }); } else { l2("pick", { minDate: s2, maxDate: u2.minDate }); } l2("select", false); } } else { l2("pick", r2); } }; vue.watch(() => u2.date, async () => { var e3, t2; if ((e3 = m2.value) == null ? void 0 : e3.contains(document.activeElement)) { await vue.nextTick(); (t2 = h2.value) == null ? void 0 : t2.focus(); } }); o2({ focus: x2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("table", { role: "grid", "aria-label": vue.unref(f2)("el.datepicker.monthTablePrompt"), class: vue.normalizeClass(vue.unref(d2).b()), onClick: A2, onMousemove: M2 }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: m2 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(k2), (e4, o4) => (vue.openBlock(), vue.createElementBlock("tr", { key: o4 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, o5) => (vue.openBlock(), vue.createElementBlock("td", { key: o5, ref_for: true, ref: (t2) => C2(e5) && (h2.value = t2), class: vue.normalizeClass(S2(e5)), "aria-selected": `${C2(e5)}`, "aria-label": vue.unref(f2)(`el.datepicker.month${+e5.text + 1}`), tabindex: C2(e5) ? 0 : -1, onKeydown: [vue.withKeys(vue.withModifiers(A2, ["prevent", "stop"]), ["space"]), vue.withKeys(vue.withModifiers(A2, ["prevent", "stop"]), ["enter"])] }, [vue.createElementVNode("div", null, [vue.createElementVNode("span", tb, vue.toDisplayString(vue.unref(f2)("el.datepicker.months." + b2.value[e5.text])), 1)])], 42, eb))), 128))]))), 128))], 512)], 42, Qh)); } }); var ab = ad(nb, [["__file", "basic-month-table.vue"]]); const { date: ob, disabledDate: rb, parsedValue: lb } = $h; const sb = Cs({ date: ob, disabledDate: rb, parsedValue: lb, selectionMode: Th("year") }); const ib = ["aria-label"]; const ub = ["aria-selected", "tabindex", "onKeydown"]; const cb = { class: "cell" }; const db = { key: 1 }; const fb = vue.defineComponent({ __name: "basic-year-table", props: sb, emits: ["pick"], setup(e2, { expose: o2, emit: l2 }) { const u2 = e2; const c2 = (e3, t2) => { const n2 = Sp(String(e3)).locale(t2).startOf("year"); const a2 = n2.endOf("year"); const o3 = a2.dayOfYear(); return Lp(o3).map((e4) => n2.add(e4, "day").toDate()); }; const d2 = oi("year-table"); const { t: f2, lang: p2 } = Xs(); const m2 = vue.ref(); const h2 = vue.ref(); const b2 = vue.computed(() => Math.floor(u2.date.year() / 10) * 10); const g2 = () => { var e3; (e3 = h2.value) == null ? void 0 : e3.focus(); }; const y2 = (e3) => { const t2 = {}; const n2 = Sp().locale(p2.value); t2.disabled = u2.disabledDate ? c2(e3, p2.value).every(u2.disabledDate) : false; t2.current = Fs(u2.parsedValue).findIndex((t3) => t3.year() === e3) >= 0; t2.today = n2.year() === e3; return t2; }; const w2 = (e3) => e3 === b2.value && u2.date.year() < b2.value && u2.date.year() > b2.value + 9 || Fs(u2.date).findIndex((t2) => t2.year() === e3) >= 0 || Fs(u2.parsedValue).findIndex((t2) => (t2 == null ? void 0 : t2.year()) === e3) >= 0; const k2 = (e3) => { const t2 = e3.target; const n2 = t2.closest("td"); if (n2 && n2.textContent) { if (Rl(n2, "disabled")) return; const t3 = n2.textContent || n2.innerText; if (u2.selectionMode === "years") { if (e3.type === "keydown") { l2("pick", Fs(u2.parsedValue), false); return; } const a2 = Rl(n2, "current") ? Fs(u2.parsedValue).filter((e4) => (e4 == null ? void 0 : e4.year()) !== Number(t3)) : Fs(u2.parsedValue).concat([Sp(t3)]); l2("pick", a2); } else { l2("pick", Number(t3)); } } }; vue.watch(() => u2.date, async () => { var e3, t2; if ((e3 = m2.value) == null ? void 0 : e3.contains(document.activeElement)) { await vue.nextTick(); (t2 = h2.value) == null ? void 0 : t2.focus(); } }); o2({ focus: g2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("table", { role: "grid", "aria-label": vue.unref(f2)("el.datepicker.yearTablePrompt"), class: vue.normalizeClass(vue.unref(d2).b()), onClick: k2 }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: m2 }, [(vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(3, (e4, o4) => vue.createElementVNode("tr", { key: o4 }, [(vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(4, (e5, r2) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: o4 + "_" + r2 }, [o4 * 4 + r2 < 10 ? (vue.openBlock(), vue.createElementBlock("td", { key: 0, ref_for: true, ref: (e6) => w2(vue.unref(b2) + o4 * 4 + r2) && (h2.value = e6), class: vue.normalizeClass(["available", y2(vue.unref(b2) + o4 * 4 + r2)]), "aria-selected": `${w2(vue.unref(b2) + o4 * 4 + r2)}`, tabindex: w2(vue.unref(b2) + o4 * 4 + r2) ? 0 : -1, onKeydown: [vue.withKeys(vue.withModifiers(k2, ["prevent", "stop"]), ["space"]), vue.withKeys(vue.withModifiers(k2, ["prevent", "stop"]), ["enter"])] }, [vue.createElementVNode("div", null, [vue.createElementVNode("span", cb, vue.toDisplayString(vue.unref(b2) + o4 * 4 + r2), 1)])], 42, ub)) : (vue.openBlock(), vue.createElementBlock("td", db))], 64))), 64))])), 64))], 512)], 10, ib)); } }); var vb = ad(fb, [["__file", "basic-year-table.vue"]]); const pb = ["onClick"]; const mb = ["aria-label"]; const hb = ["aria-label"]; const bb = ["aria-label"]; const gb = ["aria-label"]; const yb = vue.defineComponent({ __name: "panel-date-pick", props: Ph, emits: ["pick", "set-picker-option", "panel-change"], setup(e2, { emit: o2 }) { const l2 = e2; const u2 = (e3, t2, n2) => true; const c2 = oi("picker-panel"); const d2 = oi("date-picker"); const p2 = vue.useAttrs(); const m2 = vue.useSlots(); const { t: h2, lang: b2 } = Xs(); const g2 = vue.inject("EP_PICKER_BASE"); const y2 = vue.inject(rv); const { shortcuts: x2, disabledDate: $2, cellClassName: L2, defaultTime: P2 } = g2.props; const B2 = vue.toRef(g2.props, "defaultValue"); const F2 = vue.ref(); const j2 = vue.ref(Sp().locale(b2.value)); const z2 = vue.ref(false); let N2 = false; const H2 = vue.computed(() => Sp(P2).locale(b2.value)); const Y2 = vue.computed(() => j2.value.month()); const W2 = vue.computed(() => j2.value.year()); const U2 = vue.ref([]); const G2 = vue.ref(null); const Z2 = vue.ref(null); const J2 = (e3) => U2.value.length > 0 ? u2(e3, U2.value, l2.format || "HH:mm:ss") : true; const X2 = (e3) => { if (P2 && !ke2.value && !z2.value && !N2) { return H2.value.year(e3.year()).month(e3.month()).date(e3.date()); } if (ve2.value) return e3.millisecond(0); return e3.startOf("day"); }; const ee2 = (e3, ...t2) => { if (!e3) { o2("pick", e3, ...t2); } else if (tt(e3)) { const n2 = e3.map(X2); o2("pick", n2, ...t2); } else { o2("pick", X2(e3), ...t2); } G2.value = null; Z2.value = null; z2.value = false; N2 = false; }; const te2 = async (e3, t2) => { if (se2.value === "date") { e3 = e3; let n2 = l2.parsedValue ? l2.parsedValue.year(e3.year()).month(e3.month()).date(e3.date()) : e3; if (!J2(n2)) { n2 = U2.value[0][0].year(e3.year()).month(e3.month()).date(e3.date()); } j2.value = n2; ee2(n2, ve2.value || t2); if (l2.type === "datetime") { await vue.nextTick(); Te2(); } } else if (se2.value === "week") { ee2(e3.date); } else if (se2.value === "dates") { ee2(e3, true); } }; const ne2 = (e3) => { const t2 = e3 ? "add" : "subtract"; j2.value = j2.value[t2](1, "month"); Re2("month"); }; const ae2 = (e3) => { const t2 = j2.value; const n2 = e3 ? "add" : "subtract"; j2.value = oe2.value === "year" ? t2[n2](10, "year") : t2[n2](1, "year"); Re2("year"); }; const oe2 = vue.ref("date"); const re2 = vue.computed(() => { const e3 = h2("el.datepicker.year"); if (oe2.value === "year") { const t2 = Math.floor(W2.value / 10) * 10; if (e3) { return `${t2} ${e3} - ${t2 + 9} ${e3}`; } return `${t2} - ${t2 + 9}`; } return `${W2.value} ${e3}`; }); const le2 = (e3) => { const t2 = at(e3.value) ? e3.value() : e3.value; if (t2) { N2 = true; ee2(Sp(t2).locale(b2.value)); return; } if (e3.onClick) { e3.onClick({ attrs: p2, slots: m2, emit: o2 }); } }; const se2 = vue.computed(() => { const { type: e3 } = l2; if (["week", "month", "year", "years", "dates"].includes(e3)) return e3; return "date"; }); const ie2 = vue.computed(() => se2.value === "date" ? oe2.value : se2.value); const ue2 = vue.computed(() => !!x2.length); const ce2 = async (e3) => { j2.value = j2.value.startOf("month").month(e3); if (se2.value === "month") { ee2(j2.value, false); } else { oe2.value = "date"; if (["month", "year", "date", "week"].includes(se2.value)) { ee2(j2.value, true); await vue.nextTick(); Te2(); } } Re2("month"); }; const de2 = async (e3, t2) => { if (se2.value === "year") { j2.value = j2.value.startOf("year").year(e3); ee2(j2.value, false); } else if (se2.value === "years") { ee2(e3, t2 != null ? t2 : true); } else { j2.value = j2.value.year(e3); oe2.value = "month"; if (["month", "year", "date", "week"].includes(se2.value)) { ee2(j2.value, true); await vue.nextTick(); Te2(); } } Re2("year"); }; const fe2 = async (e3) => { oe2.value = e3; await vue.nextTick(); Te2(); }; const ve2 = vue.computed(() => l2.type === "datetime" || l2.type === "datetimerange"); const pe2 = vue.computed(() => { const e3 = ve2.value || se2.value === "dates"; const t2 = se2.value === "years"; const n2 = oe2.value === "date"; const a2 = oe2.value === "year"; return e3 && n2 || t2 && a2; }); const me2 = vue.computed(() => { if (!$2) return false; if (!l2.parsedValue) return true; if (tt(l2.parsedValue)) { return $2(l2.parsedValue[0].toDate()); } return $2(l2.parsedValue.toDate()); }); const he2 = () => { if (se2.value === "dates" || se2.value === "years") { ee2(l2.parsedValue); } else { let e3 = l2.parsedValue; if (!e3) { const t2 = Sp(P2).locale(b2.value); const n2 = Ie2(); e3 = t2.year(n2.year()).month(n2.month()).date(n2.date()); } j2.value = e3; ee2(e3); } }; const be2 = vue.computed(() => { if (!$2) return false; return $2(Sp().locale(b2.value).toDate()); }); const ge2 = () => { const e3 = Sp().locale(b2.value); const t2 = e3.toDate(); z2.value = true; if ((!$2 || !$2(t2)) && J2(t2)) { j2.value = Sp().locale(b2.value); ee2(j2.value); } }; const ye2 = vue.computed(() => l2.timeFormat || Tp(l2.format)); const we2 = vue.computed(() => l2.dateFormat || Ip(l2.format)); const ke2 = vue.computed(() => { if (Z2.value) return Z2.value; if (!l2.parsedValue && !B2.value) return; return (l2.parsedValue || j2.value).format(ye2.value); }); const xe2 = vue.computed(() => { if (G2.value) return G2.value; if (!l2.parsedValue && !B2.value) return; return (l2.parsedValue || j2.value).format(we2.value); }); const Se2 = vue.ref(false); const Ce2 = () => { Se2.value = true; }; const _e2 = () => { Se2.value = false; }; const Me2 = (e3) => ({ hour: e3.hour(), minute: e3.minute(), second: e3.second(), year: e3.year(), month: e3.month(), date: e3.date() }); const Oe2 = (e3, t2, n2) => { const { hour: a2, minute: o3, second: r2 } = Me2(e3); const s2 = l2.parsedValue ? l2.parsedValue.hour(a2).minute(o3).second(r2) : e3; j2.value = s2; ee2(j2.value, true); if (!n2) { Se2.value = t2; } }; const De2 = (e3) => { const t2 = Sp(e3, ye2.value).locale(b2.value); if (t2.isValid() && J2(t2)) { const { year: e4, month: n2, date: a2 } = Me2(j2.value); j2.value = t2.year(e4).month(n2).date(a2); Z2.value = null; Se2.value = false; ee2(j2.value, true); } }; const Ae2 = (e3) => { const t2 = Sp(e3, we2.value).locale(b2.value); if (t2.isValid()) { if ($2 && $2(t2.toDate())) { return; } const { hour: e4, minute: n2, second: a2 } = Me2(j2.value); j2.value = t2.hour(e4).minute(n2).second(a2); G2.value = null; ee2(j2.value, true); } }; const Ee2 = (e3) => Sp.isDayjs(e3) && e3.isValid() && ($2 ? !$2(e3.toDate()) : true); const $e2 = (e3) => tt(e3) ? e3.map((e4) => e4.format(l2.format)) : e3.format(l2.format); const Le2 = (e3) => Sp(e3, l2.format).locale(b2.value); const Ie2 = () => { const e3 = Sp(B2.value).locale(b2.value); if (!B2.value) { const e4 = H2.value; return Sp().hour(e4.hour()).minute(e4.minute()).second(e4.second()).locale(b2.value); } return e3; }; const Te2 = async () => { var e3; if (["week", "month", "year", "date"].includes(se2.value)) { (e3 = F2.value) == null ? void 0 : e3.focus(); if (se2.value === "week") { Be2($s.down); } } }; const Pe2 = (e3) => { const { code: t2 } = e3; const n2 = [$s.up, $s.down, $s.left, $s.right, $s.home, $s.end, $s.pageUp, $s.pageDown]; if (n2.includes(t2)) { Be2(t2); e3.stopPropagation(); e3.preventDefault(); } if ([$s.enter, $s.space, $s.numpadEnter].includes(t2) && G2.value === null && Z2.value === null) { e3.preventDefault(); ee2(j2.value, false); } }; const Be2 = (e3) => { var t2; const { up: n2, down: a2, left: r2, right: l3, home: s2, end: i2, pageUp: u3, pageDown: c3 } = $s; const d3 = { year: { [n2]: -4, [a2]: 4, [r2]: -1, [l3]: 1, offset: (e4, t3) => e4.setFullYear(e4.getFullYear() + t3) }, month: { [n2]: -4, [a2]: 4, [r2]: -1, [l3]: 1, offset: (e4, t3) => e4.setMonth(e4.getMonth() + t3) }, week: { [n2]: -1, [a2]: 1, [r2]: -1, [l3]: 1, offset: (e4, t3) => e4.setDate(e4.getDate() + t3 * 7) }, date: { [n2]: -7, [a2]: 7, [r2]: -1, [l3]: 1, [s2]: (e4) => -e4.getDay(), [i2]: (e4) => -e4.getDay() + 6, [u3]: (e4) => -new Date(e4.getFullYear(), e4.getMonth(), 0).getDate(), [c3]: (e4) => new Date(e4.getFullYear(), e4.getMonth() + 1, 0).getDate(), offset: (e4, t3) => e4.setDate(e4.getDate() + t3) } }; const f2 = j2.value.toDate(); while (Math.abs(j2.value.diff(f2, "year", true)) < 1) { const n3 = d3[ie2.value]; if (!n3) return; n3.offset(f2, at(n3[e3]) ? n3[e3](f2) : (t2 = n3[e3]) != null ? t2 : 0); if ($2 && $2(f2)) { break; } const a3 = Sp(f2).locale(b2.value); j2.value = a3; o2("pick", a3, true); break; } }; const Re2 = (e3) => { o2("panel-change", j2.value.toDate(), e3, oe2.value); }; vue.watch(() => se2.value, (e3) => { if (["month", "year"].includes(e3)) { oe2.value = e3; return; } else if (e3 === "years") { oe2.value = "year"; return; } oe2.value = "date"; }, { immediate: true }); vue.watch(() => oe2.value, () => { y2 == null ? void 0 : y2.updatePopper(); }); vue.watch(() => B2.value, (e3) => { if (e3) { j2.value = Ie2(); } }, { immediate: true }); vue.watch(() => l2.parsedValue, (e3) => { if (e3) { if (se2.value === "dates" || se2.value === "years") return; if (Array.isArray(e3)) return; j2.value = e3; } else { j2.value = Ie2(); } }, { immediate: true }); o2("set-picker-option", ["isValidValue", Ee2]); o2("set-picker-option", ["formatToString", $e2]); o2("set-picker-option", ["parseUserInput", Le2]); o2("set-picker-option", ["handleFocusPicker", Te2]); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(c2).b(), vue.unref(d2).b(), { "has-sidebar": e3.$slots.sidebar || vue.unref(ue2), "has-time": vue.unref(ve2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(c2).e("sidebar")) }), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(c2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(x2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("button", { key: a2, type: "button", class: vue.normalizeClass(vue.unref(c2).e("shortcut")), onClick: (t2) => le2(e4) }, vue.toDisplayString(e4.text), 11, pb))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("body")) }, [vue.unref(ve2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("time-header")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("editor-wrap")) }, [vue.createVNode(vue.unref(Dd), { placeholder: vue.unref(h2)("el.datepicker.selectDate"), "model-value": vue.unref(xe2), size: "small", "validate-event": false, onInput: o3[0] || (o3[0] = (e4) => G2.value = e4), onChange: Ae2 }, null, 8, ["placeholder", "model-value"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(d2).e("editor-wrap")) }, [vue.createVNode(vue.unref(Dd), { placeholder: vue.unref(h2)("el.datepicker.selectTime"), "model-value": vue.unref(ke2), size: "small", "validate-event": false, onFocus: Ce2, onInput: o3[1] || (o3[1] = (e4) => Z2.value = e4), onChange: De2 }, null, 8, ["placeholder", "model-value"]), vue.createVNode(vue.unref(vm), { visible: Se2.value, format: vue.unref(ye2), "parsed-value": j2.value, onPick: Oe2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(am), _e2]])], 2)) : vue.createCommentVNode("v-if", true), vue.withDirectives(vue.createElementVNode("div", { class: vue.normalizeClass([vue.unref(d2).e("header"), (oe2.value === "year" || oe2.value === "month") && vue.unref(d2).e("header--bordered")]) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("prev-btn")) }, [vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.prevYear`), class: vue.normalizeClass(["d-arrow-left", vue.unref(c2).e("icon-btn")]), onClick: o3[2] || (o3[2] = (e4) => ae2(false)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 10, mb), vue.withDirectives(vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.prevMonth`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "arrow-left"]), onClick: o3[3] || (o3[3] = (e4) => ne2(false)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Kl))]), _: 1 })], 10, hb), [[vue.vShow, oe2.value === "date"]])], 2), vue.createElementVNode("span", { role: "button", class: vue.normalizeClass(vue.unref(d2).e("header-label")), "aria-live": "polite", tabindex: "0", onKeydown: o3[4] || (o3[4] = vue.withKeys((e4) => fe2("year"), ["enter"])), onClick: o3[5] || (o3[5] = (e4) => fe2("year")) }, vue.toDisplayString(vue.unref(re2)), 35), vue.withDirectives(vue.createElementVNode("span", { role: "button", "aria-live": "polite", tabindex: "0", class: vue.normalizeClass([vue.unref(d2).e("header-label"), { active: oe2.value === "month" }]), onKeydown: o3[6] || (o3[6] = vue.withKeys((e4) => fe2("month"), ["enter"])), onClick: o3[7] || (o3[7] = (e4) => fe2("month")) }, vue.toDisplayString(vue.unref(h2)(`el.datepicker.month${vue.unref(Y2) + 1}`)), 35), [[vue.vShow, oe2.value === "date"]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("next-btn")) }, [vue.withDirectives(vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.nextMonth`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "arrow-right"]), onClick: o3[8] || (o3[8] = (e4) => ne2(true)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Gl))]), _: 1 })], 10, bb), [[vue.vShow, oe2.value === "date"]]), vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.nextYear`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "d-arrow-right"]), onClick: o3[9] || (o3[9] = (e4) => ae2(true)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 10, gb)], 2)], 2), [[vue.vShow, oe2.value !== "time"]]), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("content")), onKeydown: Pe2 }, [oe2.value === "date" ? (vue.openBlock(), vue.createBlock(Jh, { key: 0, ref_key: "currentViewRef", ref: F2, "selection-mode": vue.unref(se2), date: j2.value, "parsed-value": e3.parsedValue, "disabled-date": vue.unref($2), "cell-class-name": vue.unref(L2), onPick: te2 }, null, 8, ["selection-mode", "date", "parsed-value", "disabled-date", "cell-class-name"])) : vue.createCommentVNode("v-if", true), oe2.value === "year" ? (vue.openBlock(), vue.createBlock(vb, { key: 1, ref_key: "currentViewRef", ref: F2, "selection-mode": vue.unref(se2), date: j2.value, "disabled-date": vue.unref($2), "parsed-value": e3.parsedValue, onPick: de2 }, null, 8, ["selection-mode", "date", "disabled-date", "parsed-value"])) : vue.createCommentVNode("v-if", true), oe2.value === "month" ? (vue.openBlock(), vue.createBlock(ab, { key: 2, ref_key: "currentViewRef", ref: F2, date: j2.value, "parsed-value": e3.parsedValue, "disabled-date": vue.unref($2), onPick: ce2 }, null, 8, ["date", "parsed-value", "disabled-date"])) : vue.createCommentVNode("v-if", true)], 34)], 2)], 2), vue.withDirectives(vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("footer")) }, [vue.withDirectives(vue.createVNode(vue.unref(gp), { text: "", size: "small", class: vue.normalizeClass(vue.unref(c2).e("link-btn")), disabled: vue.unref(be2), onClick: ge2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(h2)("el.datepicker.now")), 1)]), _: 1 }, 8, ["class", "disabled"]), [[vue.vShow, vue.unref(se2) !== "dates" && vue.unref(se2) !== "years"]]), vue.createVNode(vue.unref(gp), { plain: "", size: "small", class: vue.normalizeClass(vue.unref(c2).e("link-btn")), disabled: vue.unref(me2), onClick: he2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(h2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled"])], 2), [[vue.vShow, vue.unref(pe2)]])], 2)); } }); var wb = ad(yb, [["__file", "panel-date-pick.vue"]]); const kb = Cs({ ...Lh, ...Ih }); const xb = (e2) => { const { emit: t2 } = vue.getCurrentInstance(); const n2 = vue.useAttrs(); const a2 = vue.useSlots(); const o2 = (o3) => { const r2 = at(o3.value) ? o3.value() : o3.value; if (r2) { t2("pick", [Sp(r2[0]).locale(e2.value), Sp(r2[1]).locale(e2.value)]); return; } if (o3.onClick) { o3.onClick({ attrs: n2, slots: a2, emit: t2 }); } }; return o2; }; const Sb = (e2, { defaultValue: t2, leftDate: n2, rightDate: a2, unit: o2, onParsedValueChanged: r2 }) => { const { emit: u2 } = vue.getCurrentInstance(); const { pickerNs: c2 } = vue.inject(Dh); const d2 = oi("date-range-picker"); const { t: p2, lang: m2 } = Xs(); const h2 = xb(m2); const b2 = vue.ref(); const g2 = vue.ref(); const y2 = vue.ref({ endDate: null, selecting: false }); const w2 = (e3) => { y2.value = e3; }; const k2 = (e3 = false) => { const t3 = vue.unref(b2); const n3 = vue.unref(g2); if (Vh([t3, n3])) { u2("pick", [t3, n3], e3); } }; const x2 = (e3) => { y2.value.selecting = e3; if (!e3) { y2.value.endDate = null; } }; const S2 = () => { const [r3, l2] = Fh(vue.unref(t2), { lang: vue.unref(m2), unit: o2, unlinkPanels: e2.unlinkPanels }); b2.value = void 0; g2.value = void 0; n2.value = r3; a2.value = l2; }; vue.watch(t2, (e3) => { if (e3) { S2(); } }, { immediate: true }); vue.watch(() => e2.parsedValue, (e3) => { if (tt(e3) && e3.length === 2) { const [t3, a3] = e3; b2.value = t3; n2.value = t3; g2.value = a3; r2(vue.unref(b2), vue.unref(g2)); } else { S2(); } }, { immediate: true }); return { minDate: b2, maxDate: g2, rangeState: y2, lang: m2, ppNs: c2, drpNs: d2, handleChangeRange: w2, handleRangeConfirm: k2, handleShortcutClick: h2, onSelect: x2, t: p2 }; }; const Cb = ["onClick"]; const _b = ["aria-label"]; const Mb = ["aria-label"]; const Ob = ["disabled", "aria-label"]; const Db = ["disabled", "aria-label"]; const Ab = ["disabled", "aria-label"]; const Eb = ["disabled", "aria-label"]; const $b = ["aria-label"]; const Lb = ["aria-label"]; const Ib = "month"; const Tb = vue.defineComponent({ __name: "panel-date-range", props: kb, emits: ["pick", "set-picker-option", "calendar-change", "panel-change"], setup(e2, { emit: o2 }) { const l2 = e2; const s2 = vue.inject("EP_PICKER_BASE"); const { disabledDate: u2, cellClassName: c2, format: d2, defaultTime: p2, clearable: m2 } = s2.props; const h2 = vue.toRef(s2.props, "shortcuts"); const b2 = vue.toRef(s2.props, "defaultValue"); const { lang: g2 } = Xs(); const y2 = vue.ref(Sp().locale(g2.value)); const x2 = vue.ref(Sp().locale(g2.value).add(1, Ib)); const { minDate: S2, maxDate: C2, rangeState: _2, ppNs: $2, drpNs: L2, handleChangeRange: P2, handleRangeConfirm: B2, handleShortcutClick: V2, onSelect: F2, t: j2 } = Sb(l2, { defaultValue: b2, leftDate: y2, rightDate: x2, unit: Ib, onParsedValueChanged: Ie2 }); const z2 = vue.ref({ min: null, max: null }); const N2 = vue.ref({ min: null, max: null }); const H2 = vue.computed(() => `${y2.value.year()} ${j2("el.datepicker.year")} ${j2(`el.datepicker.month${y2.value.month() + 1}`)}`); const Y2 = vue.computed(() => `${x2.value.year()} ${j2("el.datepicker.year")} ${j2(`el.datepicker.month${x2.value.month() + 1}`)}`); const W2 = vue.computed(() => y2.value.year()); const U2 = vue.computed(() => y2.value.month()); const G2 = vue.computed(() => x2.value.year()); const Z2 = vue.computed(() => x2.value.month()); const J2 = vue.computed(() => !!h2.value.length); const X2 = vue.computed(() => { if (z2.value.min !== null) return z2.value.min; if (S2.value) return S2.value.format(ae2.value); return ""; }); const Q2 = vue.computed(() => { if (z2.value.max !== null) return z2.value.max; if (C2.value || S2.value) return (C2.value || S2.value).format(ae2.value); return ""; }); const ee2 = vue.computed(() => { if (N2.value.min !== null) return N2.value.min; if (S2.value) return S2.value.format(ne2.value); return ""; }); const te2 = vue.computed(() => { if (N2.value.max !== null) return N2.value.max; if (C2.value || S2.value) return (C2.value || S2.value).format(ne2.value); return ""; }); const ne2 = vue.computed(() => l2.timeFormat || Tp(d2)); const ae2 = vue.computed(() => l2.dateFormat || Ip(d2)); const oe2 = (e3) => Vh(e3) && (u2 ? !u2(e3[0].toDate()) && !u2(e3[1].toDate()) : true); const re2 = () => { y2.value = y2.value.subtract(1, "year"); if (!l2.unlinkPanels) { x2.value = y2.value.add(1, "month"); } ve2("year"); }; const le2 = () => { y2.value = y2.value.subtract(1, "month"); if (!l2.unlinkPanels) { x2.value = y2.value.add(1, "month"); } ve2("month"); }; const se2 = () => { if (!l2.unlinkPanels) { y2.value = y2.value.add(1, "year"); x2.value = y2.value.add(1, "month"); } else { x2.value = x2.value.add(1, "year"); } ve2("year"); }; const ie2 = () => { if (!l2.unlinkPanels) { y2.value = y2.value.add(1, "month"); x2.value = y2.value.add(1, "month"); } else { x2.value = x2.value.add(1, "month"); } ve2("month"); }; const ue2 = () => { y2.value = y2.value.add(1, "year"); ve2("year"); }; const ce2 = () => { y2.value = y2.value.add(1, "month"); ve2("month"); }; const de2 = () => { x2.value = x2.value.subtract(1, "year"); ve2("year"); }; const fe2 = () => { x2.value = x2.value.subtract(1, "month"); ve2("month"); }; const ve2 = (e3) => { o2("panel-change", [y2.value.toDate(), x2.value.toDate()], e3); }; const pe2 = vue.computed(() => { const e3 = (U2.value + 1) % 12; const t2 = U2.value + 1 >= 12 ? 1 : 0; return l2.unlinkPanels && new Date(W2.value + t2, e3) < new Date(G2.value, Z2.value); }); const me2 = vue.computed(() => l2.unlinkPanels && G2.value * 12 + Z2.value - (W2.value * 12 + U2.value + 1) >= 12); const he2 = vue.computed(() => !(S2.value && C2.value && !_2.value.selecting && Vh([S2.value, C2.value]))); const be2 = vue.computed(() => l2.type === "datetime" || l2.type === "datetimerange"); const ge2 = (e3, t2) => { if (!e3) return; if (p2) { const n2 = Sp(p2[t2] || p2).locale(g2.value); return n2.year(e3.year()).month(e3.month()).date(e3.date()); } return e3; }; const ye2 = (e3, t2 = true) => { const n2 = e3.minDate; const a2 = e3.maxDate; const r2 = ge2(n2, 0); const l3 = ge2(a2, 1); if (C2.value === l3 && S2.value === r2) { return; } o2("calendar-change", [n2.toDate(), a2 && a2.toDate()]); C2.value = l3; S2.value = r2; if (!t2 || be2.value) return; B2(); }; const we2 = vue.ref(false); const ke2 = vue.ref(false); const xe2 = () => { we2.value = false; }; const Se2 = () => { ke2.value = false; }; const Ce2 = (e3, t2) => { z2.value[t2] = e3; const n2 = Sp(e3, ae2.value).locale(g2.value); if (n2.isValid()) { if (u2 && u2(n2.toDate())) { return; } if (t2 === "min") { y2.value = n2; S2.value = (S2.value || y2.value).year(n2.year()).month(n2.month()).date(n2.date()); if (!l2.unlinkPanels && (!C2.value || C2.value.isBefore(S2.value))) { x2.value = n2.add(1, "month"); C2.value = S2.value.add(1, "month"); } } else { x2.value = n2; C2.value = (C2.value || x2.value).year(n2.year()).month(n2.month()).date(n2.date()); if (!l2.unlinkPanels && (!S2.value || S2.value.isAfter(C2.value))) { y2.value = n2.subtract(1, "month"); S2.value = C2.value.subtract(1, "month"); } } } }; const _e2 = (e3, t2) => { z2.value[t2] = null; }; const Me2 = (e3, t2) => { N2.value[t2] = e3; const n2 = Sp(e3, ne2.value).locale(g2.value); if (n2.isValid()) { if (t2 === "min") { we2.value = true; S2.value = (S2.value || y2.value).hour(n2.hour()).minute(n2.minute()).second(n2.second()); if (!C2.value || C2.value.isBefore(S2.value)) { C2.value = S2.value; } } else { ke2.value = true; C2.value = (C2.value || x2.value).hour(n2.hour()).minute(n2.minute()).second(n2.second()); x2.value = C2.value; if (C2.value && C2.value.isBefore(S2.value)) { S2.value = C2.value; } } } }; const Oe2 = (e3, t2) => { N2.value[t2] = null; if (t2 === "min") { y2.value = S2.value; we2.value = false; } else { x2.value = C2.value; ke2.value = false; } }; const De2 = (e3, t2, n2) => { if (N2.value.min) return; if (e3) { y2.value = e3; S2.value = (S2.value || y2.value).hour(e3.hour()).minute(e3.minute()).second(e3.second()); } if (!n2) { we2.value = t2; } if (!C2.value || C2.value.isBefore(S2.value)) { C2.value = S2.value; x2.value = e3; } }; const Ae2 = (e3, t2, n2) => { if (N2.value.max) return; if (e3) { x2.value = e3; C2.value = (C2.value || x2.value).hour(e3.hour()).minute(e3.minute()).second(e3.second()); } if (!n2) { ke2.value = t2; } if (C2.value && C2.value.isBefore(S2.value)) { S2.value = C2.value; } }; const Ee2 = () => { y2.value = Fh(vue.unref(b2), { lang: vue.unref(g2), unit: "month", unlinkPanels: l2.unlinkPanels })[0]; x2.value = y2.value.add(1, "month"); C2.value = void 0; S2.value = void 0; o2("pick", null); }; const $e2 = (e3) => tt(e3) ? e3.map((e4) => e4.format(d2)) : e3.format(d2); const Le2 = (e3) => tt(e3) ? e3.map((e4) => Sp(e4, d2).locale(g2.value)) : Sp(e3, d2).locale(g2.value); function Ie2(e3, t2) { if (l2.unlinkPanels && t2) { const n2 = (e3 == null ? void 0 : e3.year()) || 0; const a2 = (e3 == null ? void 0 : e3.month()) || 0; const o3 = t2.year(); const r2 = t2.month(); x2.value = n2 === o3 && a2 === r2 ? t2.add(1, Ib) : t2; } else { x2.value = y2.value.add(1, Ib); if (t2) { x2.value = x2.value.hour(t2.hour()).minute(t2.minute()).second(t2.second()); } } } o2("set-picker-option", ["isValidValue", oe2]); o2("set-picker-option", ["parseUserInput", Le2]); o2("set-picker-option", ["formatToString", $e2]); o2("set-picker-option", ["handleClear", Ee2]); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref($2).b(), vue.unref(L2).b(), { "has-sidebar": e3.$slots.sidebar || vue.unref(J2), "has-time": vue.unref(be2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref($2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref($2).e("sidebar")) }), vue.unref(J2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref($2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(h2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("button", { key: a2, type: "button", class: vue.normalizeClass(vue.unref($2).e("shortcut")), onClick: (t2) => vue.unref(V2)(e4) }, vue.toDisplayString(e4.text), 11, Cb))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref($2).e("body")) }, [vue.unref(be2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(L2).e("time-header")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(L2).e("editors-wrap")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(L2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Dd), { size: "small", disabled: vue.unref(_2).selecting, placeholder: vue.unref(j2)("el.datepicker.startDate"), class: vue.normalizeClass(vue.unref(L2).e("editor")), "model-value": vue.unref(X2), "validate-event": false, onInput: o3[0] || (o3[0] = (e4) => Ce2(e4, "min")), onChange: o3[1] || (o3[1] = (e4) => _e2(e4, "min")) }, null, 8, ["disabled", "placeholder", "class", "model-value"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(L2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Dd), { size: "small", class: vue.normalizeClass(vue.unref(L2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(j2)("el.datepicker.startTime"), "model-value": vue.unref(ee2), "validate-event": false, onFocus: o3[2] || (o3[2] = (e4) => we2.value = true), onInput: o3[3] || (o3[3] = (e4) => Me2(e4, "min")), onChange: o3[4] || (o3[4] = (e4) => Oe2(e4, "min")) }, null, 8, ["class", "disabled", "placeholder", "model-value"]), vue.createVNode(vue.unref(vm), { visible: we2.value, format: vue.unref(ne2), "datetime-role": "start", "parsed-value": y2.value, onPick: De2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(am), xe2]])], 2), vue.createElementVNode("span", null, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Gl))]), _: 1 })]), vue.createElementVNode("span", { class: vue.normalizeClass([vue.unref(L2).e("editors-wrap"), "is-right"]) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(L2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Dd), { size: "small", class: vue.normalizeClass(vue.unref(L2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(j2)("el.datepicker.endDate"), "model-value": vue.unref(Q2), readonly: !vue.unref(S2), "validate-event": false, onInput: o3[5] || (o3[5] = (e4) => Ce2(e4, "max")), onChange: o3[6] || (o3[6] = (e4) => _e2(e4, "max")) }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(L2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Dd), { size: "small", class: vue.normalizeClass(vue.unref(L2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(j2)("el.datepicker.endTime"), "model-value": vue.unref(te2), readonly: !vue.unref(S2), "validate-event": false, onFocus: o3[7] || (o3[7] = (e4) => vue.unref(S2) && (ke2.value = true)), onInput: o3[8] || (o3[8] = (e4) => Me2(e4, "max")), onChange: o3[9] || (o3[9] = (e4) => Oe2(e4, "max")) }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly"]), vue.createVNode(vue.unref(vm), { "datetime-role": "end", visible: ke2.value, format: vue.unref(ne2), "parsed-value": x2.value, onPick: Ae2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(am), Se2]])], 2)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref($2).e("content"), vue.unref(L2).e("content")], "is-left"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(L2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref($2).e("icon-btn"), "d-arrow-left"]), "aria-label": vue.unref(j2)(`el.datepicker.prevYear`), onClick: re2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 10, _b), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref($2).e("icon-btn"), "arrow-left"]), "aria-label": vue.unref(j2)(`el.datepicker.prevMonth`), onClick: le2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Kl))]), _: 1 })], 10, Mb), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(me2), class: vue.normalizeClass([[vue.unref($2).e("icon-btn"), { "is-disabled": !vue.unref(me2) }], "d-arrow-right"]), "aria-label": vue.unref(j2)(`el.datepicker.nextYear`), onClick: ue2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 10, Ob)) : vue.createCommentVNode("v-if", true), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 1, type: "button", disabled: !vue.unref(pe2), class: vue.normalizeClass([[vue.unref($2).e("icon-btn"), { "is-disabled": !vue.unref(pe2) }], "arrow-right"]), "aria-label": vue.unref(j2)(`el.datepicker.nextMonth`), onClick: ce2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Gl))]), _: 1 })], 10, Db)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(H2)), 1)], 2), vue.createVNode(Jh, { "selection-mode": "range", date: y2.value, "min-date": vue.unref(S2), "max-date": vue.unref(C2), "range-state": vue.unref(_2), "disabled-date": vue.unref(u2), "cell-class-name": vue.unref(c2), onChangerange: vue.unref(P2), onPick: ye2, onSelect: vue.unref(F2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref($2).e("content"), vue.unref(L2).e("content")], "is-right"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(L2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(me2), class: vue.normalizeClass([[vue.unref($2).e("icon-btn"), { "is-disabled": !vue.unref(me2) }], "d-arrow-left"]), "aria-label": vue.unref(j2)(`el.datepicker.prevYear`), onClick: de2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 10, Ab)) : vue.createCommentVNode("v-if", true), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 1, type: "button", disabled: !vue.unref(pe2), class: vue.normalizeClass([[vue.unref($2).e("icon-btn"), { "is-disabled": !vue.unref(pe2) }], "arrow-left"]), "aria-label": vue.unref(j2)(`el.datepicker.prevMonth`), onClick: fe2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Kl))]), _: 1 })], 10, Eb)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(j2)(`el.datepicker.nextYear`), class: vue.normalizeClass([vue.unref($2).e("icon-btn"), "d-arrow-right"]), onClick: se2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 10, $b), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref($2).e("icon-btn"), "arrow-right"]), "aria-label": vue.unref(j2)(`el.datepicker.nextMonth`), onClick: ie2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Gl))]), _: 1 })], 10, Lb), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(Y2)), 1)], 2), vue.createVNode(Jh, { "selection-mode": "range", date: x2.value, "min-date": vue.unref(S2), "max-date": vue.unref(C2), "range-state": vue.unref(_2), "disabled-date": vue.unref(u2), "cell-class-name": vue.unref(c2), onChangerange: vue.unref(P2), onPick: ye2, onSelect: vue.unref(F2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2)], 2)], 2), vue.unref(be2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref($2).e("footer")) }, [vue.unref(m2) ? (vue.openBlock(), vue.createBlock(vue.unref(gp), { key: 0, text: "", size: "small", class: vue.normalizeClass(vue.unref($2).e("link-btn")), onClick: Ee2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(j2)("el.datepicker.clear")), 1)]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.createVNode(vue.unref(gp), { plain: "", size: "small", class: vue.normalizeClass(vue.unref($2).e("link-btn")), disabled: vue.unref(he2), onClick: o3[10] || (o3[10] = (e4) => vue.unref(B2)(false)) }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(j2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled"])], 2)) : vue.createCommentVNode("v-if", true)], 2)); } }); var Pb = ad(Tb, [["__file", "panel-date-range.vue"]]); const Bb = Cs({ ...Ih }); const Rb = ["pick", "set-picker-option", "calendar-change"]; const Vb = ({ unlinkPanels: e2, leftDate: t2, rightDate: n2 }) => { const { t: a2 } = Xs(); const o2 = () => { t2.value = t2.value.subtract(1, "year"); if (!e2.value) { n2.value = n2.value.subtract(1, "year"); } }; const l2 = () => { if (!e2.value) { t2.value = t2.value.add(1, "year"); } n2.value = n2.value.add(1, "year"); }; const s2 = () => { t2.value = t2.value.add(1, "year"); }; const i2 = () => { n2.value = n2.value.subtract(1, "year"); }; const u2 = vue.computed(() => `${t2.value.year()} ${a2("el.datepicker.year")}`); const c2 = vue.computed(() => `${n2.value.year()} ${a2("el.datepicker.year")}`); const d2 = vue.computed(() => t2.value.year()); const f2 = vue.computed(() => n2.value.year() === t2.value.year() ? t2.value.year() + 1 : n2.value.year()); return { leftPrevYear: o2, rightNextYear: l2, leftNextYear: s2, rightPrevYear: i2, leftLabel: u2, rightLabel: c2, leftYear: d2, rightYear: f2 }; }; const Fb = ["onClick"]; const jb = ["disabled"]; const zb = ["disabled"]; const Nb = "year"; const Hb = vue.defineComponent({ name: "DatePickerMonthRange" }); const Yb = vue.defineComponent({ ...Hb, props: Bb, emits: Rb, setup(e2, { emit: o2 }) { const l2 = e2; const { lang: s2 } = Xs(); const u2 = vue.inject("EP_PICKER_BASE"); const { shortcuts: c2, disabledDate: d2, format: p2 } = u2.props; const m2 = vue.toRef(u2.props, "defaultValue"); const h2 = vue.ref(Sp().locale(s2.value)); const b2 = vue.ref(Sp().locale(s2.value).add(1, Nb)); const { minDate: g2, maxDate: y2, rangeState: x2, ppNs: S2, drpNs: C2, handleChangeRange: _2, handleRangeConfirm: A2, handleShortcutClick: $2, onSelect: L2 } = Sb(l2, { defaultValue: m2, leftDate: h2, rightDate: b2, unit: Nb, onParsedValueChanged: q2 }); const P2 = vue.computed(() => !!c2.length); const { leftPrevYear: B2, rightNextYear: R2, leftNextYear: V2, rightPrevYear: F2, leftLabel: j2, rightLabel: z2, leftYear: N2, rightYear: H2 } = Vb({ unlinkPanels: vue.toRef(l2, "unlinkPanels"), leftDate: h2, rightDate: b2 }); const Y2 = vue.computed(() => l2.unlinkPanels && H2.value > N2.value + 1); const W2 = (e3, t2 = true) => { const n2 = e3.minDate; const a2 = e3.maxDate; if (y2.value === a2 && g2.value === n2) { return; } o2("calendar-change", [n2.toDate(), a2 && a2.toDate()]); y2.value = a2; g2.value = n2; if (!t2) return; A2(); }; const U2 = (e3) => e3.map((e4) => e4.format(p2)); function q2(e3, t2) { if (l2.unlinkPanels && t2) { const n2 = (e3 == null ? void 0 : e3.year()) || 0; const a2 = t2.year(); b2.value = n2 === a2 ? t2.add(1, Nb) : t2; } else { b2.value = h2.value.add(1, Nb); } } o2("set-picker-option", ["formatToString", U2]); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(S2).b(), vue.unref(C2).b(), { "has-sidebar": Boolean(e3.$slots.sidebar) || vue.unref(P2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(S2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(S2).e("sidebar")) }), vue.unref(P2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(S2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(c2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("button", { key: a2, type: "button", class: vue.normalizeClass(vue.unref(S2).e("shortcut")), onClick: (t2) => vue.unref($2)(e4) }, vue.toDisplayString(e4.text), 11, Fb))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(S2).e("body")) }, [vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(S2).e("content"), vue.unref(C2).e("content")], "is-left"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(C2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(S2).e("icon-btn"), "d-arrow-left"]), onClick: o3[0] || (o3[0] = (...e4) => vue.unref(B2) && vue.unref(B2)(...e4)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 2), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(Y2), class: vue.normalizeClass([[vue.unref(S2).e("icon-btn"), { [vue.unref(S2).is("disabled")]: !vue.unref(Y2) }], "d-arrow-right"]), onClick: o3[1] || (o3[1] = (...e4) => vue.unref(V2) && vue.unref(V2)(...e4)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 10, jb)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(j2)), 1)], 2), vue.createVNode(ab, { "selection-mode": "range", date: h2.value, "min-date": vue.unref(g2), "max-date": vue.unref(y2), "range-state": vue.unref(x2), "disabled-date": vue.unref(d2), onChangerange: vue.unref(_2), onPick: W2, onSelect: vue.unref(L2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(S2).e("content"), vue.unref(C2).e("content")], "is-right"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(C2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(Y2), class: vue.normalizeClass([[vue.unref(S2).e("icon-btn"), { "is-disabled": !vue.unref(Y2) }], "d-arrow-left"]), onClick: o3[2] || (o3[2] = (...e4) => vue.unref(F2) && vue.unref(F2)(...e4)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 10, zb)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(S2).e("icon-btn"), "d-arrow-right"]), onClick: o3[3] || (o3[3] = (...e4) => vue.unref(R2) && vue.unref(R2)(...e4)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 2), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(z2)), 1)], 2), vue.createVNode(ab, { "selection-mode": "range", date: b2.value, "min-date": vue.unref(g2), "max-date": vue.unref(y2), "range-state": vue.unref(x2), "disabled-date": vue.unref(d2), onChangerange: vue.unref(_2), onPick: W2, onSelect: vue.unref(L2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2)], 2)], 2)], 2)); } }); var Wb = ad(Yb, [["__file", "panel-month-range.vue"]]); const Ub = function(e2) { switch (e2) { case "daterange": case "datetimerange": { return Pb; } case "monthrange": { return Wb; } default: { return wb; } } }; Sp.extend(hm); Sp.extend(fh); Sp.extend(Mp); Sp.extend(mh); Sp.extend(gh); Sp.extend(kh); Sp.extend(Ch); Sp.extend(Oh); var Kb = vue.defineComponent({ name: "ElDatePicker", install: null, props: Ah, emits: ["update:modelValue"], setup(e2, { expose: t2, emit: n2, slots: a2 }) { const o2 = oi("picker-panel"); vue.provide("ElPopperOptions", vue.reactive(vue.toRef(e2, "popperOptions"))); vue.provide(Dh, { slots: a2, pickerNs: o2 }); const r2 = vue.ref(); const l2 = { focus: (e3 = true) => { var t3; (t3 = r2.value) == null ? void 0 : t3.focus(e3); }, handleOpen: () => { var e3; (e3 = r2.value) == null ? void 0 : e3.handleOpen(); }, handleClose: () => { var e3; (e3 = r2.value) == null ? void 0 : e3.handleClose(); } }; t2(l2); const s2 = (e3) => { n2("update:modelValue", e3); }; return () => { var t3; const n3 = (t3 = e2.format) != null ? t3 : Ep[e2.type] || Ap; const o3 = Ub(e2.type); return vue.createVNode(Kp, vue.mergeProps(e2, { format: n3, type: e2.type, ref: r2, "onUpdate:modelValue": s2 }), { default: (e3) => vue.createVNode(o3, e3, null), "range-separator": a2["range-separator"] }); }; } }); const qb = Kb; qb.install = (e2) => { e2.component(qb.name, qb); }; const Gb = qb; const Zb = Cs({ mask: { type: Boolean, default: true }, customMaskEvent: { type: Boolean, default: false }, overlayClass: { type: ks([String, Array, Object]) }, zIndex: { type: ks([String, Number]) } }); const Jb = { click: (e2) => e2 instanceof MouseEvent }; const Xb = "overlay"; var Qb = vue.defineComponent({ name: "ElOverlay", props: Zb, emits: Jb, setup(e2, { slots: t2, emit: n2 }) { const a2 = oi(Xb); const o2 = (e3) => { n2("click", e3); }; const { onClick: r2, onMousedown: l2, onMouseup: s2 } = bc(e2.customMaskEvent ? void 0 : o2); return () => e2.mask ? vue.createVNode("div", { class: [a2.b(), e2.overlayClass], style: { zIndex: e2.zIndex }, onClick: r2, onMousedown: l2, onMouseup: s2 }, [vue.renderSlot(t2, "default")], Vs.STYLE | Vs.CLASS | Vs.PROPS, ["onClick", "onMouseup", "onMousedown"]) : vue.h("div", { class: e2.overlayClass, style: { zIndex: e2.zIndex, position: "fixed", top: "0px", right: "0px", bottom: "0px", left: "0px" } }, [vue.renderSlot(t2, "default")]); } }); const eg = Qb; const tg = Symbol("dialogInjectionKey"); const ng = Cs({ center: Boolean, alignCenter: Boolean, closeIcon: { type: _s }, draggable: Boolean, overflow: Boolean, fullscreen: Boolean, showClose: { type: Boolean, default: true }, title: { type: String, default: "" }, ariaLevel: { type: String, default: "2" } }); const ag = { close: () => true }; const og = ["aria-level"]; const rg = ["aria-label"]; const lg = ["id"]; const sg = vue.defineComponent({ name: "ElDialogContent" }); const ig = vue.defineComponent({ ...sg, props: ng, emits: ag, setup(e2) { const o2 = e2; const { t: l2 } = Xs(); const { Close: s2 } = Ms; const { dialogRef: u2, headerRef: c2, bodyId: d2, ns: v2, style: p2 } = vue.inject(tg); const { focusTrapRef: m2 } = vue.inject(wf); const h2 = vue.computed(() => [v2.b(), v2.is("fullscreen", o2.fullscreen), v2.is("draggable", o2.draggable), v2.is("align-center", o2.alignCenter), { [v2.m("center")]: o2.center }]); const b2 = Es(m2, u2); const g2 = vue.computed(() => o2.draggable); const y2 = vue.computed(() => o2.overflow); Us(u2, c2, g2, y2); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { ref: vue.unref(b2), class: vue.normalizeClass(vue.unref(h2)), style: vue.normalizeStyle(vue.unref(p2)), tabindex: "-1" }, [vue.createElementVNode("header", { ref_key: "headerRef", ref: c2, class: vue.normalizeClass([vue.unref(v2).e("header"), { "show-close": e3.showClose }]) }, [vue.renderSlot(e3.$slots, "header", {}, () => [vue.createElementVNode("span", { role: "heading", "aria-level": e3.ariaLevel, class: vue.normalizeClass(vue.unref(v2).e("title")) }, vue.toDisplayString(e3.title), 11, og)]), e3.showClose ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, "aria-label": vue.unref(l2)("el.dialog.close"), class: vue.normalizeClass(vue.unref(v2).e("headerbtn")), type: "button", onClick: o3[0] || (o3[0] = (t2) => e3.$emit("close")) }, [vue.createVNode(vue.unref(id), { class: vue.normalizeClass(vue.unref(v2).e("close")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.closeIcon || vue.unref(s2))))]), _: 1 }, 8, ["class"])], 10, rg)) : vue.createCommentVNode("v-if", true)], 2), vue.createElementVNode("div", { id: vue.unref(d2), class: vue.normalizeClass(vue.unref(v2).e("body")) }, [vue.renderSlot(e3.$slots, "default")], 10, lg), e3.$slots.footer ? (vue.openBlock(), vue.createElementBlock("footer", { key: 0, class: vue.normalizeClass(vue.unref(v2).e("footer")) }, [vue.renderSlot(e3.$slots, "footer")], 2)) : vue.createCommentVNode("v-if", true)], 6)); } }); var ug = ad(ig, [["__file", "dialog-content.vue"]]); const cg = Cs({ ...ng, appendToBody: Boolean, appendTo: { type: ks(String), default: "body" }, beforeClose: { type: ks(Function) }, destroyOnClose: Boolean, closeOnClickModal: { type: Boolean, default: true }, closeOnPressEscape: { type: Boolean, default: true }, lockScroll: { type: Boolean, default: true }, modal: { type: Boolean, default: true }, openDelay: { type: Number, default: 0 }, closeDelay: { type: Number, default: 0 }, top: { type: String }, modelValue: Boolean, modalClass: String, width: { type: [String, Number] }, zIndex: { type: Number }, trapFocus: { type: Boolean, default: false }, headerAriaLevel: { type: String, default: "2" } }); const dg = { open: () => true, opened: () => true, close: () => true, closed: () => true, [Is]: (e2) => Ml(e2), openAutoFocus: () => true, closeAutoFocus: () => true }; const fg = (e2, t2) => { var n2; const a2 = vue.getCurrentInstance(); const o2 = a2.emit; const { nextZIndex: i2 } = jc(); let c2 = ""; const d2 = xc(); const f2 = xc(); const p2 = vue.ref(false); const m2 = vue.ref(false); const h2 = vue.ref(false); const b2 = vue.ref((n2 = e2.zIndex) != null ? n2 : i2()); let g2 = void 0; let y2 = void 0; const w2 = Qc("namespace", Qs); const k2 = vue.computed(() => { const t3 = {}; const n3 = `--${w2.value}-dialog`; if (!e2.fullscreen) { if (e2.top) { t3[`${n3}-margin-top`] = e2.top; } if (e2.width) { t3[`${n3}-width`] = zl(e2.width); } } return t3; }); const x2 = vue.computed(() => { if (e2.alignCenter) { return { display: "flex" }; } return {}; }); function S2() { o2("opened"); } function C2() { o2("closed"); o2(Is, false); if (e2.destroyOnClose) { h2.value = false; } } function M2() { o2("close"); } function O2() { y2 == null ? void 0 : y2(); g2 == null ? void 0 : g2(); if (e2.openDelay && e2.openDelay > 0) { ({ stop: g2 } = Ae(() => $2(), e2.openDelay)); } else { $2(); } } function D2() { g2 == null ? void 0 : g2(); y2 == null ? void 0 : y2(); if (e2.closeDelay && e2.closeDelay > 0) { ({ stop: y2 } = Ae(() => L2(), e2.closeDelay)); } else { L2(); } } function A2() { function t3(e3) { if (e3) return; m2.value = true; p2.value = false; } if (e2.beforeClose) { e2.beforeClose(t3); } else { D2(); } } function E2() { if (e2.closeOnClickModal) { A2(); } } function $2() { if (!ke) return; p2.value = true; } function L2() { p2.value = false; } function I2() { o2("openAutoFocus"); } function T2() { o2("closeAutoFocus"); } function P2(e3) { var t3; if (((t3 = e3.detail) == null ? void 0 : t3.focusReason) === "pointer") { e3.preventDefault(); } } if (e2.lockScroll) { ri(p2); } function B2() { if (e2.closeOnPressEscape) { A2(); } } vue.watch(() => e2.modelValue, (n3) => { if (n3) { m2.value = false; O2(); h2.value = true; b2.value = wl(e2.zIndex) ? i2() : b2.value++; vue.nextTick(() => { o2("open"); if (t2.value) { t2.value.scrollTop = 0; } }); } else { if (p2.value) { D2(); } } }); vue.watch(() => e2.fullscreen, (e3) => { if (!t2.value) return; if (e3) { c2 = t2.value.style.transform; t2.value.style.transform = ""; } else { t2.value.style.transform = c2; } }); vue.onMounted(() => { if (e2.modelValue) { p2.value = true; h2.value = true; O2(); } }); return { afterEnter: S2, afterLeave: C2, beforeLeave: M2, handleClose: A2, onModalClick: E2, close: D2, doClose: L2, onOpenAutoFocus: I2, onCloseAutoFocus: T2, onCloseRequested: B2, onFocusoutPrevented: P2, titleId: d2, bodyId: f2, closed: m2, style: k2, overlayDialogStyle: x2, rendered: h2, visible: p2, zIndex: b2 }; }; const vg = ["aria-label", "aria-labelledby", "aria-describedby"]; const pg = vue.defineComponent({ name: "ElDialog", inheritAttrs: false }); const mg = vue.defineComponent({ ...pg, props: cg, emits: dg, setup(e2, { expose: n2 }) { const o2 = e2; const l2 = vue.useSlots(); Ws({ scope: "el-dialog", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/dialog.html#slots" }, vue.computed(() => !!l2.title)); const s2 = oi("dialog"); const u2 = vue.ref(); const c2 = vue.ref(); const d2 = vue.ref(); const { visible: f2, titleId: p2, bodyId: m2, style: h2, overlayDialogStyle: b2, rendered: k2, zIndex: x2, afterEnter: S2, afterLeave: _2, beforeLeave: O2, handleClose: $2, onModalClick: L2, onOpenAutoFocus: T2, onCloseAutoFocus: F2, onCloseRequested: j2, onFocusoutPrevented: z2 } = fg(o2, u2); vue.provide(tg, { dialogRef: u2, headerRef: c2, bodyId: m2, ns: s2, rendered: k2, style: h2 }); const N2 = bc(L2); const H2 = vue.computed(() => o2.draggable && !o2.fullscreen); n2({ visible: f2, dialogContentRef: d2 }); return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { to: e3.appendTo, disabled: e3.appendTo !== "body" ? false : !e3.appendToBody }, [vue.createVNode(vue.Transition, { name: "dialog-fade", onAfterEnter: vue.unref(S2), onAfterLeave: vue.unref(_2), onBeforeLeave: vue.unref(O2), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode(vue.unref(eg), { "custom-mask-event": "", mask: e3.modal, "overlay-class": e3.modalClass, "z-index": vue.unref(x2) }, { default: vue.withCtx(() => [vue.createElementVNode("div", { role: "dialog", "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? vue.unref(p2) : void 0, "aria-describedby": vue.unref(m2), class: vue.normalizeClass(`${vue.unref(s2).namespace.value}-overlay-dialog`), style: vue.normalizeStyle(vue.unref(b2)), onClick: n3[0] || (n3[0] = (...e4) => vue.unref(N2).onClick && vue.unref(N2).onClick(...e4)), onMousedown: n3[1] || (n3[1] = (...e4) => vue.unref(N2).onMousedown && vue.unref(N2).onMousedown(...e4)), onMouseup: n3[2] || (n3[2] = (...e4) => vue.unref(N2).onMouseup && vue.unref(N2).onMouseup(...e4)) }, [vue.createVNode(vue.unref(Nf), { loop: "", trapped: vue.unref(f2), "focus-start-el": "container", onFocusAfterTrapped: vue.unref(T2), onFocusAfterReleased: vue.unref(F2), onFocusoutPrevented: vue.unref(z2), onReleaseRequested: vue.unref(j2) }, { default: vue.withCtx(() => [vue.unref(k2) ? (vue.openBlock(), vue.createBlock(ug, vue.mergeProps({ key: 0, ref_key: "dialogContentRef", ref: d2 }, e3.$attrs, { center: e3.center, "align-center": e3.alignCenter, "close-icon": e3.closeIcon, draggable: vue.unref(H2), overflow: e3.overflow, fullscreen: e3.fullscreen, "show-close": e3.showClose, title: e3.title, "aria-level": e3.headerAriaLevel, onClose: vue.unref($2) }), vue.createSlots({ header: vue.withCtx(() => [!e3.$slots.title ? vue.renderSlot(e3.$slots, "header", { key: 0, close: vue.unref($2), titleId: vue.unref(p2), titleClass: vue.unref(s2).e("title") }) : vue.renderSlot(e3.$slots, "title", { key: 1 })]), default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 2 }, [e3.$slots.footer ? { name: "footer", fn: vue.withCtx(() => [vue.renderSlot(e3.$slots, "footer")]) } : void 0]), 1040, ["center", "align-center", "close-icon", "draggable", "overflow", "fullscreen", "show-close", "title", "aria-level", "onClose"])) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["trapped", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])], 46, vg)]), _: 3 }, 8, ["mask", "overlay-class", "z-index"]), [[vue.vShow, vue.unref(f2)]])]), _: 3 }, 8, ["onAfterEnter", "onAfterLeave", "onBeforeLeave"])], 8, ["to", "disabled"])); } }); var hg = ad(mg, [["__file", "dialog.vue"]]); const bg = Ds(hg); const gg = Cs({ direction: { type: String, values: ["horizontal", "vertical"], default: "horizontal" }, contentPosition: { type: String, values: ["left", "center", "right"], default: "center" }, borderStyle: { type: ks(String), default: "solid" } }); const yg = vue.defineComponent({ name: "ElDivider" }); const wg = vue.defineComponent({ ...yg, props: gg, setup(e2) { const a2 = e2; const o2 = oi("divider"); const l2 = vue.computed(() => o2.cssVar({ "border-style": a2.borderStyle })); return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(o2).b(), vue.unref(o2).m(e3.direction)]), style: vue.normalizeStyle(vue.unref(l2)), role: "separator" }, [e3.$slots.default && e3.direction !== "vertical" ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass([vue.unref(o2).e("text"), vue.unref(o2).is(e3.contentPosition)]) }, [vue.renderSlot(e3.$slots, "default")], 2)) : vue.createCommentVNode("v-if", true)], 6)); } }); var kg = ad(wg, [["__file", "divider.vue"]]); const xg = Ds(kg); const Sg = Cs({ ...cg, direction: { type: String, default: "rtl", values: ["ltr", "rtl", "ttb", "btt"] }, size: { type: [String, Number], default: "30%" }, withHeader: { type: Boolean, default: true }, modalFade: { type: Boolean, default: true }, headerAriaLevel: { type: String, default: "2" } }); const Cg = dg; const _g = ["aria-label", "aria-labelledby", "aria-describedby"]; const Mg = ["id", "aria-level"]; const Og = ["aria-label"]; const Dg = ["id"]; const Ag = vue.defineComponent({ name: "ElDrawer", inheritAttrs: false }); const Eg = vue.defineComponent({ ...Ag, props: Sg, emits: Cg, setup(e2, { expose: o2 }) { const l2 = e2; const s2 = vue.useSlots(); Ws({ scope: "el-drawer", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/drawer.html#slots" }, vue.computed(() => !!s2.title)); const u2 = vue.ref(); const c2 = vue.ref(); const d2 = oi("drawer"); const { t: f2 } = Xs(); const { afterEnter: p2, afterLeave: m2, beforeLeave: h2, visible: b2, rendered: g2, titleId: k2, bodyId: x2, zIndex: S2, onModalClick: _2, onOpenAutoFocus: O2, onCloseAutoFocus: $2, onFocusoutPrevented: P2, onCloseRequested: F2, handleClose: j2 } = fg(l2, u2); const z2 = vue.computed(() => l2.direction === "rtl" || l2.direction === "ltr"); const N2 = vue.computed(() => zl(l2.size)); o2({ handleClose: j2, afterEnter: p2, afterLeave: m2 }); return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { to: "body", disabled: !e3.appendToBody }, [vue.createVNode(vue.Transition, { name: vue.unref(d2).b("fade"), onAfterEnter: vue.unref(p2), onAfterLeave: vue.unref(m2), onBeforeLeave: vue.unref(h2), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode(vue.unref(eg), { mask: e3.modal, "overlay-class": e3.modalClass, "z-index": vue.unref(S2), onClick: vue.unref(_2) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Nf), { loop: "", trapped: vue.unref(b2), "focus-trap-el": u2.value, "focus-start-el": c2.value, onFocusAfterTrapped: vue.unref(O2), onFocusAfterReleased: vue.unref($2), onFocusoutPrevented: vue.unref(P2), onReleaseRequested: vue.unref(F2) }, { default: vue.withCtx(() => [vue.createElementVNode("div", vue.mergeProps({ ref_key: "drawerRef", ref: u2, "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? vue.unref(k2) : void 0, "aria-describedby": vue.unref(x2) }, e3.$attrs, { class: [vue.unref(d2).b(), e3.direction, vue.unref(b2) && "open"], style: vue.unref(z2) ? "width: " + vue.unref(N2) : "height: " + vue.unref(N2), role: "dialog", onClick: o3[1] || (o3[1] = vue.withModifiers(() => { }, ["stop"])) }), [vue.createElementVNode("span", { ref_key: "focusStartRef", ref: c2, class: vue.normalizeClass(vue.unref(d2).e("sr-focus")), tabindex: "-1" }, null, 2), e3.withHeader ? (vue.openBlock(), vue.createElementBlock("header", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("header")) }, [!e3.$slots.title ? vue.renderSlot(e3.$slots, "header", { key: 0, close: vue.unref(j2), titleId: vue.unref(k2), titleClass: vue.unref(d2).e("title") }, () => [!e3.$slots.title ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, id: vue.unref(k2), role: "heading", "aria-level": e3.headerAriaLevel, class: vue.normalizeClass(vue.unref(d2).e("title")) }, vue.toDisplayString(e3.title), 11, Mg)) : vue.createCommentVNode("v-if", true)]) : vue.renderSlot(e3.$slots, "title", { key: 1 }, () => [vue.createCommentVNode(" DEPRECATED SLOT ")]), e3.showClose ? (vue.openBlock(), vue.createElementBlock("button", { key: 2, "aria-label": vue.unref(f2)("el.drawer.close"), class: vue.normalizeClass(vue.unref(d2).e("close-btn")), type: "button", onClick: o3[0] || (o3[0] = (...e4) => vue.unref(j2) && vue.unref(j2)(...e4)) }, [vue.createVNode(vue.unref(id), { class: vue.normalizeClass(vue.unref(d2).e("close")) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ss))]), _: 1 }, 8, ["class"])], 10, Og)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.unref(g2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, id: vue.unref(x2), class: vue.normalizeClass(vue.unref(d2).e("body")) }, [vue.renderSlot(e3.$slots, "default")], 10, Dg)) : vue.createCommentVNode("v-if", true), e3.$slots.footer ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass(vue.unref(d2).e("footer")) }, [vue.renderSlot(e3.$slots, "footer")], 2)) : vue.createCommentVNode("v-if", true)], 16, _g)]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])]), _: 3 }, 8, ["mask", "overlay-class", "z-index", "onClick"]), [[vue.vShow, vue.unref(b2)]])]), _: 3 }, 8, ["name", "onAfterEnter", "onAfterLeave", "onBeforeLeave"])], 8, ["disabled"])); } }); var $g = ad(Eg, [["__file", "drawer.vue"]]); const Lg = Ds($g); const Ig = Cs({ modelValue: { type: [Boolean, String, Number], default: false }, disabled: { type: Boolean, default: false }, loading: { type: Boolean, default: false }, size: { type: String, validator: Rs }, width: { type: [String, Number], default: "" }, inlinePrompt: { type: Boolean, default: false }, inactiveActionIcon: { type: _s }, activeActionIcon: { type: _s }, activeIcon: { type: _s }, inactiveIcon: { type: _s }, activeText: { type: String, default: "" }, inactiveText: { type: String, default: "" }, activeValue: { type: [Boolean, String, Number], default: true }, inactiveValue: { type: [Boolean, String, Number], default: false }, name: { type: String, default: "" }, validateEvent: { type: Boolean, default: true }, beforeChange: { type: ks(Function) }, id: String, tabindex: { type: [String, Number] }, label: { type: String, default: void 0 }, ...Zc(["ariaLabel"]) }); const Tg = { [Is]: (e2) => Ml(e2) || ot(e2) || Ol(e2), [Ts]: (e2) => Ml(e2) || ot(e2) || Ol(e2), [Ps]: (e2) => Ml(e2) || ot(e2) || Ol(e2) }; const Pg = ["onClick"]; const Bg = ["id", "aria-checked", "aria-disabled", "aria-label", "name", "true-value", "false-value", "disabled", "tabindex", "onKeydown"]; const Rg = ["aria-hidden"]; const Vg = ["aria-hidden"]; const Fg = ["aria-hidden"]; const jg = "ElSwitch"; const zg = vue.defineComponent({ name: jg }); const Ng = vue.defineComponent({ ...zg, props: Ig, emits: Tg, setup(e2, { expose: o2, emit: l2 }) { const c2 = e2; const { formItem: d2 } = vd(); const f2 = dd(); const p2 = oi("switch"); const { inputId: m2 } = pd(c2, { formItemContext: d2 }); const h2 = fd(vue.computed(() => c2.loading)); const b2 = vue.ref(c2.modelValue !== false); const g2 = vue.ref(); const y2 = vue.ref(); const k2 = vue.computed(() => [p2.b(), p2.m(f2.value), p2.is("disabled", h2.value), p2.is("checked", B2.value)]); const x2 = vue.computed(() => [p2.e("label"), p2.em("label", "left"), p2.is("active", !B2.value)]); const S2 = vue.computed(() => [p2.e("label"), p2.em("label", "right"), p2.is("active", B2.value)]); const C2 = vue.computed(() => ({ width: zl(c2.width) })); vue.watch(() => c2.modelValue, () => { b2.value = true; }); const O2 = vue.computed(() => b2.value ? c2.modelValue : false); const B2 = vue.computed(() => O2.value === c2.activeValue); if (![c2.activeValue, c2.inactiveValue].includes(O2.value)) { l2(Is, c2.inactiveValue); l2(Ts, c2.inactiveValue); l2(Ps, c2.inactiveValue); } vue.watch(B2, (e3) => { var t2; g2.value.checked = e3; if (c2.validateEvent) { (t2 = d2 == null ? void 0 : d2.validate) == null ? void 0 : t2.call(d2, "change").catch((e4) => Pl()); } }); const R2 = () => { const e3 = B2.value ? c2.inactiveValue : c2.activeValue; l2(Is, e3); l2(Ts, e3); l2(Ps, e3); vue.nextTick(() => { g2.value.checked = B2.value; }); }; const V2 = () => { if (h2.value) return; const { beforeChange: e3 } = c2; if (!e3) { R2(); return; } const t2 = e3(); const n2 = [lt(t2), Ml(t2)].includes(true); if (!n2) { Tl(jg, "beforeChange must return type `Promise<boolean>` or `boolean`"); } if (lt(t2)) { t2.then((e4) => { if (e4) { R2(); } }).catch((e4) => { }); } else if (t2) { R2(); } }; const F2 = () => { var e3, t2; (t2 = (e3 = g2.value) == null ? void 0 : e3.focus) == null ? void 0 : t2.call(e3); }; vue.onMounted(() => { g2.value.checked = B2.value; }); Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-switch", ref: "https://element-plus.org/en-US/component/switch.html" }, vue.computed(() => !!c2.label)); o2({ focus: F2, checked: B2 }); return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(vue.unref(k2)), onClick: vue.withModifiers(V2, ["prevent"]) }, [vue.createElementVNode("input", { id: vue.unref(m2), ref_key: "input", ref: g2, class: vue.normalizeClass(vue.unref(p2).e("input")), type: "checkbox", role: "switch", "aria-checked": vue.unref(B2), "aria-disabled": vue.unref(h2), "aria-label": e3.label || e3.ariaLabel, name: e3.name, "true-value": e3.activeValue, "false-value": e3.inactiveValue, disabled: vue.unref(h2), tabindex: e3.tabindex, onChange: R2, onKeydown: vue.withKeys(V2, ["enter"]) }, null, 42, Bg), !e3.inlinePrompt && (e3.inactiveIcon || e3.inactiveText) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(x2)) }, [e3.inactiveIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.inactiveIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true), !e3.inactiveIcon && e3.inactiveText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, "aria-hidden": vue.unref(B2) }, vue.toDisplayString(e3.inactiveText), 9, Rg)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("span", { ref_key: "core", ref: y2, class: vue.normalizeClass(vue.unref(p2).e("core")), style: vue.normalizeStyle(vue.unref(C2)) }, [e3.inlinePrompt ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(p2).e("inner")) }, [e3.activeIcon || e3.inactiveIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(p2).is("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(B2) ? e3.activeIcon : e3.inactiveIcon)))]), _: 1 }, 8, ["class"])) : e3.activeText || e3.inactiveText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(p2).is("text")), "aria-hidden": !vue.unref(B2) }, vue.toDisplayString(vue.unref(B2) ? e3.activeText : e3.inactiveText), 11, Vg)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(p2).e("action")) }, [e3.loading ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(p2).is("loading")) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ms))]), _: 1 }, 8, ["class"])) : vue.unref(B2) ? vue.renderSlot(e3.$slots, "active-action", { key: 1 }, () => [e3.activeActionIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.activeActionIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true)]) : !vue.unref(B2) ? vue.renderSlot(e3.$slots, "inactive-action", { key: 2 }, () => [e3.inactiveActionIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.inactiveActionIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true)]) : vue.createCommentVNode("v-if", true)], 2)], 6), !e3.inlinePrompt && (e3.activeIcon || e3.activeText) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(S2)) }, [e3.activeIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.activeIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true), !e3.activeIcon && e3.activeText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, "aria-hidden": !vue.unref(B2) }, vue.toDisplayString(e3.activeText), 9, Fg)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true)], 10, Pg)); } }); var Hg = ad(Ng, [["__file", "switch.vue"]]); const Yg = Ds(Hg); function Wg(t2) { let n2; const a2 = vue.ref(false); const o2 = vue.reactive({ ...t2, originalPosition: "", originalOverflow: "", visible: false }); function r2(e2) { o2.text = e2; } function l2() { const e2 = o2.parent; const t3 = f2.ns; if (!e2.vLoadingAddClassList) { let n3 = e2.getAttribute("loading-number"); n3 = Number.parseInt(n3) - 1; if (!n3) { Fl(e2, t3.bm("parent", "relative")); e2.removeAttribute("loading-number"); } else { e2.setAttribute("loading-number", n3.toString()); } Fl(e2, t3.bm("parent", "hidden")); } s2(); d2.unmount(); } function s2() { var e2, t3; (t3 = (e2 = f2.$el) == null ? void 0 : e2.parentNode) == null ? void 0 : t3.removeChild(f2.$el); } function i2() { var e2; if (t2.beforeClose && !t2.beforeClose()) return; a2.value = true; clearTimeout(n2); n2 = window.setTimeout(u2, 400); o2.visible = false; (e2 = t2.closed) == null ? void 0 : e2.call(t2); } function u2() { if (!a2.value) return; const e2 = o2.parent; a2.value = false; e2.vLoadingAddClassList = void 0; l2(); } const c2 = vue.defineComponent({ name: "ElLoading", setup(e2, { expose: t3 }) { const { ns: n3, zIndex: a3 } = ed("loading"); t3({ ns: n3, zIndex: a3 }); return () => { const e3 = o2.spinner || o2.svg; const t4 = vue.h("svg", { class: "circular", viewBox: o2.svgViewBox ? o2.svgViewBox : "0 0 50 50", ...e3 ? { innerHTML: e3 } : {} }, [vue.h("circle", { class: "path", cx: "25", cy: "25", r: "20", fill: "none" })]); const a4 = o2.text ? vue.h("p", { class: n3.b("text") }, [o2.text]) : void 0; return vue.h(vue.Transition, { name: n3.b("fade"), onAfterLeave: u2 }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode("div", { style: { backgroundColor: o2.background || "" }, class: [n3.b("mask"), o2.customClass, o2.fullscreen ? "is-fullscreen" : ""] }, [vue.h("div", { class: n3.b("spinner") }, [t4, a4])]), [[vue.vShow, o2.visible]])]) }); }; } }); const d2 = vue.createApp(c2); const f2 = d2.mount(document.createElement("div")); return { ...vue.toRefs(o2), setText: r2, removeElLoadingChild: s2, close: i2, handleAfterLeave: u2, vm: f2, get $el() { return f2.$el; } }; } let Ug = void 0; const Kg = function(e2 = {}) { if (!ke) return void 0; const t2 = qg(e2); if (t2.fullscreen && Ug) { return Ug; } const n2 = Wg({ ...t2, closed: () => { var e3; (e3 = t2.closed) == null ? void 0 : e3.call(t2); if (t2.fullscreen) Ug = void 0; } }); Gg(t2, t2.parent, n2); Zg(t2, t2.parent, n2); t2.parent.vLoadingAddClassList = () => Zg(t2, t2.parent, n2); let a2 = t2.parent.getAttribute("loading-number"); if (!a2) { a2 = "1"; } else { a2 = `${Number.parseInt(a2) + 1}`; } t2.parent.setAttribute("loading-number", a2); t2.parent.appendChild(n2.$el); vue.nextTick(() => n2.visible.value = t2.visible); if (t2.fullscreen) { Ug = n2; } return n2; }; const qg = (e2) => { var t2, n2, a2, o2; let r2; if (ot(e2.target)) { r2 = (t2 = document.querySelector(e2.target)) != null ? t2 : document.body; } else { r2 = e2.target || document.body; } return { parent: r2 === document.body || e2.body ? document.body : r2, background: e2.background || "", svg: e2.svg || "", svgViewBox: e2.svgViewBox || "", spinner: e2.spinner || false, text: e2.text || "", fullscreen: r2 === document.body && ((n2 = e2.fullscreen) != null ? n2 : true), lock: (a2 = e2.lock) != null ? a2 : false, customClass: e2.customClass || "", visible: (o2 = e2.visible) != null ? o2 : true, target: r2 }; }; const Gg = async (e2, t2, n2) => { const { nextZIndex: a2 } = n2.vm.zIndex || n2.vm._.exposed.zIndex; const o2 = {}; if (e2.fullscreen) { n2.originalPosition.value = jl(document.body, "position"); n2.originalOverflow.value = jl(document.body, "overflow"); o2.zIndex = a2(); } else if (e2.parent === document.body) { n2.originalPosition.value = jl(document.body, "position"); await vue.nextTick(); for (const t3 of ["top", "left"]) { const n3 = t3 === "top" ? "scrollTop" : "scrollLeft"; o2[t3] = `${e2.target.getBoundingClientRect()[t3] + document.body[n3] + document.documentElement[n3] - Number.parseInt(jl(document.body, `margin-${t3}`), 10)}px`; } for (const t3 of ["height", "width"]) { o2[t3] = `${e2.target.getBoundingClientRect()[t3]}px`; } } else { n2.originalPosition.value = jl(t2, "position"); } for (const [e3, t3] of Object.entries(o2)) { n2.$el.style[e3] = t3; } }; const Zg = (e2, t2, n2) => { const a2 = n2.vm.ns || n2.vm._.exposed.ns; if (!["absolute", "fixed", "sticky"].includes(n2.originalPosition.value)) { Vl(t2, a2.bm("parent", "relative")); } else { Fl(t2, a2.bm("parent", "relative")); } if (e2.fullscreen && e2.lock) { Vl(t2, a2.bm("parent", "hidden")); } else { Fl(t2, a2.bm("parent", "hidden")); } }; const Jg = Symbol("ElLoading"); const Xg = (e2, t2) => { var n2, a2, o2, r2; const l2 = t2.instance; const s2 = (e3) => rt(t2.value) ? t2.value[e3] : void 0; const i2 = (e3) => { const t3 = ot(e3) && (l2 == null ? void 0 : l2[e3]) || e3; if (t3) return vue.ref(t3); else return t3; }; const u2 = (t3) => i2(s2(t3) || e2.getAttribute(`element-loading-${vt(t3)}`)); const c2 = (n2 = s2("fullscreen")) != null ? n2 : t2.modifiers.fullscreen; const d2 = { text: u2("text"), svg: u2("svg"), svgViewBox: u2("svgViewBox"), spinner: u2("spinner"), background: u2("background"), customClass: u2("customClass"), fullscreen: c2, target: (a2 = s2("target")) != null ? a2 : c2 ? void 0 : e2, body: (o2 = s2("body")) != null ? o2 : t2.modifiers.body, lock: (r2 = s2("lock")) != null ? r2 : t2.modifiers.lock }; e2[Jg] = { options: d2, instance: Kg(d2) }; }; const Qg = (e2, t2) => { for (const n2 of Object.keys(t2)) { if (vue.isRef(t2[n2])) t2[n2].value = e2[n2]; } }; const ey = { mounted(e2, t2) { if (t2.value) { Xg(e2, t2); } }, updated(e2, t2) { const n2 = e2[Jg]; if (t2.oldValue !== t2.value) { if (t2.value && !t2.oldValue) { Xg(e2, t2); } else if (t2.value && t2.oldValue) { if (rt(t2.value)) Qg(t2.value, n2.options); } else { n2 == null ? void 0 : n2.instance.close(); } } }, unmounted(e2) { var t2; (t2 = e2[Jg]) == null ? void 0 : t2.instance.close(); e2[Jg] = null; } }; var ty = /* @__PURE__ */ (() => typeof GM_xmlhttpRequest != "undefined" ? GM_xmlhttpRequest : void 0)(); var ny = /* @__PURE__ */ (() => typeof unsafeWindow != "undefined" ? unsafeWindow : void 0)(); const ay = (e2) => { let { url: t2 } = e2; const { method: n2, params: a2, responseType: o2 } = e2; if ((n2 === "get" || n2 === "GET") && a2) { t2 += `?${oe.stringify(a2)}`; } return new Promise((e3, a3) => { ty({ method: n2, url: t2, responseType: o2 ? o2 : "json", headers: { "Content-Type": "application/x-www-form-urlencoded" }, onload(t3) { e3(t3); }, onerror(e4) { a3(e4); } }); }); }; const oy = "https://www.doseeing.com/data"; const ry = (e2) => ay({ url: `${oy}/fan/${e2}`, method: "get", responseType: "text" }); const ly = (e2) => ay({ url: `${oy}/api/user_feed`, method: "get", params: e2 }); const sy = { class: "flex justify-between mb-4" }; const iy = { class: "flex items-start" }; const uy = ["src"]; const cy = { class: "font-black text-xl ml-2" }; const dy = { class: "flex justify-between" }; const fy = { class: "flex justify-between" }; const vy = { class: "flex-1" }; const py = { class: "text-slate-400" }; const my = ["innerHTML"]; const hy = ["onClick"]; const by = ["src"]; const gy = { key: 1, class: "h-[58vh] text-center" }; const yy = 50; const wy = vue.defineComponent({ __name: "index", props: { chatUserCardData: {} }, setup(e2) { const o2 = e2; const r2 = vue.ref(false); const l2 = vue.ref(""); const s2 = vue.ref(false); const i2 = vue.ref([]); const u2 = vue.ref("1"); const c2 = vue.ref(Sp().format()); const d2 = vue.ref(0); const f2 = vue.ref(["chat"]); const p2 = vue.reactive({ chat: f2.value.includes("chat"), gift: f2.value.includes("gift") }); let m2 = true; const h2 = vue.ref(null); const b2 = (e3) => Sp.unix(e3).format("YYYY-MM-DD HH:mm:ss"); const g2 = (e3) => { navigator.clipboard.writeText(e3); elementPlus.ElMessage({ message: "复制成功", type: "success", plain: true }); }; const y2 = () => { window.open(`https://www.doseeing.com/data/fan/${o2.chatUserCardData.rel}`); }; const w2 = (e3) => { window.open(`https://www.douyu.com/${e3}`); }; const k2 = (e3) => { navigator.clipboard.writeText(`@${o2.chatUserCardData.nickName}:${e3}`); elementPlus.ElMessage({ message: "复制成功", type: "success", plain: true }); }; const x2 = () => { p2.chat = f2.value.includes("chat"); p2.gift = f2.value.includes("gift"); }; const S2 = async () => { d2.value = 0; await L2(); }; const C2 = () => { c2.value = Sp(c2.value).add(1, "day").format(); S2(); }; const _2 = () => { c2.value = Sp(c2.value).subtract(1, "day").format(); S2(); }; const D2 = ({ scrollTop: e3 }) => { if (h2.value.wrapRef.scrollHeight - e3 <= h2.value.wrapRef.clientHeight && m2) { d2.value += yy; L2(); } }; const $2 = async () => { r2.value = true; s2.value = true; d2.value = 0; try { const { finalUrl: e3, response: t2 } = await ry(o2.chatUserCardData.rel); if (e3.startsWith("https://www.doseeing.com/login")) { elementPlus.ElMessage({ message: "未登录doseeing,请先登录", type: "error", plain: true }); return; } const n2 = P2(t2, 'data-id="', '"'); if (!n2) { elementPlus.ElMessage({ message: "未获取到用户id", type: "error", plain: true }); return; } l2.value = n2; await L2(); } finally { s2.value = false; } }; const L2 = async () => { try { s2.value = true; const { response: { result: e3 } } = await ly({ uid: l2.value, dt: Sp(c2.value).format("YYYY-MM-DD"), offset: d2.value, order: u2.value }); if (d2.value === 0) { i2.value = e3; h2.value && h2.value.wrapRef && h2.value.setScrollTop(0); } else { i2.value = [...i2.value, ...e3]; } m2 = e3.length === yy; } finally { s2.value = false; } }; const P2 = (e3, t2, n2) => { const a2 = new RegExp(t2 + "(.*?)" + n2, "s"); const o3 = e3.match(a2); return o3 ? o3[1] : null; }; return (e3, l3) => { const d3 = gp; const v2 = uh; const m3 = ih; const L3 = jm; const P3 = zm; const B2 = Gb; const V2 = xg; const F2 = Ud; const j2 = bg; const z2 = ey; return vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [vue.createElementVNode("div", { onClick: $2 }, "弹幕历史"), vue.createVNode(j2, { modelValue: r2.value, "onUpdate:modelValue": l3[3] || (l3[3] = (e4) => r2.value = e4), title: "弹幕历史", width: "70%", top: "6vh", "append-to-body": "", "destroy-on-close": "" }, { default: vue.withCtx(() => [vue.createElementVNode("div", sy, [vue.createElementVNode("div", iy, [vue.createElementVNode("img", { src: o2.chatUserCardData.avatar, class: "h-20 w-20 rounded-xl" }, null, 8, uy), vue.createElementVNode("span", cy, vue.toDisplayString(o2.chatUserCardData.nickName), 1)]), vue.createVNode(d3, { type: "primary", size: "small", onClick: y2 }, { default: vue.withCtx(() => [vue.createTextVNode("详情")]), _: 1 })]), vue.createElementVNode("div", dy, [vue.createElementVNode("div", null, [vue.createVNode(m3, { modelValue: u2.value, "onUpdate:modelValue": l3[0] || (l3[0] = (e4) => u2.value = e4), onChange: S2 }, { default: vue.withCtx(() => [vue.createVNode(v2, { label: "时间正序", value: "0" }), vue.createVNode(v2, { label: "时间倒序", value: "1" })]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(P3, { modelValue: f2.value, "onUpdate:modelValue": l3[1] || (l3[1] = (e4) => f2.value = e4), onChange: x2 }, { default: vue.withCtx(() => [vue.createVNode(L3, { value: "chat" }, { default: vue.withCtx(() => [vue.createTextVNode("弹幕")]), _: 1 }), vue.createVNode(L3, { value: "gift" }, { default: vue.withCtx(() => [vue.createTextVNode("礼物")]), _: 1 })]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(d3, { type: "primary", onClick: _2 }, { default: vue.withCtx(() => [vue.createTextVNode("前一天")]), _: 1 }), vue.createVNode(B2, { modelValue: c2.value, "onUpdate:modelValue": l3[2] || (l3[2] = (e4) => c2.value = e4), onChange: S2 }, null, 8, ["modelValue"]), vue.createVNode(d3, { type: "primary", onClick: C2 }, { default: vue.withCtx(() => [vue.createTextVNode("后一天")]), _: 1 })])]), vue.createVNode(V2), i2.value.length > 0 ? vue.withDirectives((vue.openBlock(), vue.createBlock(F2, { key: 0, class: "h-[58vh] w-full", height: "58vh", onScroll: D2, ref_key: "danmuContainer", ref: h2 }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(i2.value, (e4, o3) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: `${o3}${e4.ts}` }, [p2[e4.type] ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createElementVNode("div", fy, [vue.createElementVNode("div", vy, [vue.createElementVNode("div", py, [vue.createElementVNode("span", null, vue.toDisplayString(b2(e4.ts)), 1), vue.createVNode(d3, { class: "ml-5", type: "primary", size: "small", plain: "", onClick: () => g2(e4.txt) }, { default: vue.withCtx(() => [vue.createTextVNode("复制")]), _: 2 }, 1032, ["onClick"]), vue.createVNode(d3, { class: "ml-12", type: "primary", size: "small", plain: "", onClick: () => k2(e4.txt) }, { default: vue.withCtx(() => [vue.createTextVNode("含名称复制")]), _: 2 }, 1032, ["onClick"])]), vue.createElementVNode("div", { class: "font-black text-3xl", innerHTML: e4.txt }, null, 8, my)]), vue.createElementVNode("div", { class: "flex cursor-pointer w-56 items-center flex-none", onClick: (t2) => w2(e4.rid) }, [vue.createElementVNode("img", { src: `https://apic.douyucdn.cn/upload/${e4["room.av"]}_middle.jpg`, class: "w-16 h-16 rounded-md" }, null, 8, by), vue.createElementVNode("div", null, vue.toDisplayString(e4["room.nn"]), 1)], 8, hy)]), vue.createVNode(V2)], 64)) : vue.createCommentVNode("", true)], 64))), 128))]), _: 1 })), [[z2, s2.value]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", gy, [vue.createTextVNode(" 翻来翻去还是没有记录 ")])), [[z2, s2.value]])]), _: 1 }, 8, ["modelValue"])], 64); }; } }); const _ky = class _ky { constructor() { __publicField(this, "observer", null); __publicField(this, "app", null); } init() { const e2 = document.querySelector(".layout-Player-userCard > div > div"); this.observer = new MutationObserver(() => { const e3 = document.getElementById(_ky.appId); if (e3) { return; } const t2 = document.querySelectorAll("#layout-Player-aside > div.layout-Player-userCard > div > div > div:nth-child(1) > div div"); if (t2.length === 0) { return; } let n2; for (let e4 = t2.length - 1; e4 >= 0; e4--) { const a3 = t2[e4]; if (a3.className.indexOf("-action") > -1) { n2 = a3; break; } } if (!n2) { return; } const a2 = document.querySelector(".layout-Player-userCard > div > div > div:nth-child(1)"); if (!a2) { return; } const o2 = Object.keys(a2).find((e4) => e4.startsWith("__reactInternalInstance$")); if (!o2) { return; } const r2 = a2[o2]; const l2 = n2.childNodes; const s2 = document.createElement("a"); s2.id = _ky.appId; s2.className = l2.length > 0 ? l2[0].className : "DiamondsFansCard-btn is-noble0"; n2.appendChild(s2); this.app && this.app.unmount(); setTimeout(() => { this.app = vue.createApp(wy, { chatUserCardData: r2.return.memoizedProps.chatUserCardData }); this.app.mount(`#${_ky.appId}`); }, 0); }); this.observer.observe(e2, { childList: true, subtree: true }); } disconnect() { this.observer && this.observer.disconnect(); } }; __publicField(_ky, "appId", "danmu-history-btn"); let ky = _ky; const xy = (e2, t2, n2) => { const a2 = new RegExp(`${t2}function\\s+${n2}\\s*\\([^)]*\\)\\s*{`); const o2 = e2.match(a2); if (!o2) { return null; } const r2 = o2.index + o2[0].length; let l2 = 1; let s2 = r2; while (s2 < e2.length && l2 > 0) { if (e2[s2] === "{") { l2++; } else if (e2[s2] === "}") { l2--; } s2++; } if (l2 !== 0) { return null; } return e2.substring(r2, s2 - 1); }; class Sy { } const Cy = []; function _y(e2) { Cy.push(e2); } var My = Object.defineProperty; var Oy = Object.getOwnPropertyDescriptor; var Dy = (e2, t2, n2, a2) => { var o2 = a2 > 1 ? void 0 : a2 ? Oy(t2, n2) : t2; for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) o2 = (a2 ? l2(t2, n2, o2) : l2(o2)) || o2; if (a2 && o2) My(t2, n2, o2); return o2; }; let Ay = class extends Sy { constructor() { super(...arguments); __publicField(this, "matchModuleList", ["popup", "ConstellationRomanceBanner", "DiamondsFansBanner", "GiftHallBanner", "SoundGiftBanner"]); __publicField(this, "matchContent", "BatchProp.prototype.componentWillMount"); } newModuleStr(e2) { const t2 = xy(e2, "", "componentWillReceiveProps"); if (!t2) { return null; } return e2.replace(t2, `${t2};this.state.propData.batchInfo[""+this.state.propData.count]={batchNum:this.state.propData.count,name:"暂不计算亲密度"}`); } }; Ay = Dy([_y], Ay); const _Ey = class _Ey { constructor() { __publicField(this, "modifierList", []); __publicField(this, "isDefine", false); __publicField(this, "sharkRoomJsonp"); this.initModifierList(); this.interceptDefine(); } initModifierList() { Cy.forEach((e2) => this.modifierList.push(new e2())); } interceptDefine() { const e2 = this; Object.defineProperty(ny, _Ey.TARGET_NAME, { get() { return e2.sharkRoomJsonp; }, set(t2) { e2.interceptPush(t2); }, configurable: true }); } interceptPush(e2) { var _a2; this.sharkRoomJsonp = e2; const t2 = this; if (((_a2 = this.sharkRoomJsonp) == null ? void 0 : _a2.push.name) === "webpackJsonpCallback" && !this.isDefine) { const e3 = this.sharkRoomJsonp.push; this.sharkRoomJsonp.push = function(...n2) { const { modifierList: a2 } = t2; if (a2.length > 0) { for (const e4 of n2) { if (a2.length === 0) { break; } t2.modifyModule(e4); } } return e3.apply(this, n2); }; this.isDefine = true; } } modifyModule(e2) { if (e2.length < 2) { return; } const [t2, n2] = e2; const { modifierList: a2 } = this; for (let e3 = a2.length - 1; e3 >= 0; e3--) { const o2 = a2[e3]; const { matchModuleList: r2 } = o2; if (t2.length !== r2.length) { continue; } let l2 = true; for (let e4 = 0; e4 < r2.length; e4++) { if (!t2[e4].startsWith(r2[e4])) { l2 = false; break; } } if (!l2) { continue; } const s2 = Object.keys(n2); const { matchContent: i2 } = o2; for (const t3 of s2) { const r3 = n2[t3].toString(); if (!r3.includes(i2)) { continue; } const l3 = o2.newModuleStr(r3); if (l3) { n2[t3] = new Function("return " + l3)(); } a2.splice(e3, 1); break; } } } }; __publicField(_Ey, "TARGET_NAME", "shark_room_jsonp"); let Ey = _Ey; const $y = vue.defineComponent({ __name: "SettingButton", setup(e2) { const o2 = vue.ref(false); return (e3, r2) => { const l2 = id; const s2 = Lg; return vue.openBlock(), vue.createElementBlock("div", null, [vue.createElementVNode("div", { class: "handle-button", onClick: r2[0] || (r2[0] = (e4) => o2.value = true) }, [vue.createVNode(l2, { size: 24 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(bs))]), _: 1 })]), vue.createVNode(s2, { modelValue: o2.value, "onUpdate:modelValue": r2[1] || (r2[1] = (e4) => o2.value = e4), size: "300px", "with-header": false, "z-index": 99999 }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default", {}, void 0, true)]), _: 3 }, 8, ["modelValue"])]); }; } }); const Ly = (e2, t2) => { const n2 = e2.__vccOpts || e2; for (const [e3, a2] of t2) { n2[e3] = a2; } return n2; }; const Iy = Ly($y, [["__scopeId", "data-v-dacedd06"]]); const Ty = "douyu-crx"; class Py { } __publicField(Py, "PAGE_CONFIG", `${Ty}-config-page-key`); const By = (e2) => ["hide"].includes(e2); const Ry = () => { const e2 = localStorage.getItem(Py.PAGE_CONFIG); return e2 ? JSON.parse(e2) : null; }; const Vy = (e2) => { localStorage.setItem(Py.PAGE_CONFIG, JSON.stringify(e2)); }; const Fy = { giftBtn: { title: "隐藏直播画面底部所有按钮", hide: false, have: false }, activity: { title: "隐藏右侧活动浮窗", hide: false, have: false }, rank: { title: "隐藏排行榜", hide: false, have: false }, customerService: { title: "隐藏活动客服", hide: false, have: false }, entryReminder: { title: "隐藏入场提示", hide: false, have: false }, combatStatistics: { title: "隐藏PUBG战绩统计", hide: false, have: false }, videoTopAdvertisement: { title: "隐藏顶部广告", hide: true, have: false }, videoInsideAdvertisement: { title: "隐藏直播画面右下角广告", hide: true, have: false }, rankTopAdvertisement: { title: "隐藏排行榜顶部广告", hide: true, have: false } }; const jy = Ry(); if (jy) { for (const [e2, t2] of Object.entries(jy)) { const n2 = e2; const a2 = Fy[n2]; if (a2) { Fy[n2] = { ...a2, ...t2 }; } } } const zy = { ...Fy }; const Ny = pinia.defineStore("settings", () => { const e2 = {}; for (const [n2, a2] of Object.entries(zy)) { const o2 = vue.reactive(a2); e2[n2] = o2; vue.watch(() => o2.hide, () => { const e3 = t2(); Vy(e3); }); } const t2 = () => { const t3 = {}; for (const [n2, a2] of Object.entries(e2)) { const e3 = n2; for (const [n3, o2] of Object.entries(a2)) { if (!By(n3)) { continue; } if (!t3[e3]) { t3[e3] = {}; } t3[e3][n3] = o2; } } return t3; }; return e2; }); const Hy = { class: "p-[20px]" }; const Yy = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "页面配置", -1); const Wy = { key: 0, class: "flex justify-between items-center pt-[5px] text-[14px]" }; const Uy = vue.defineComponent({ __name: "SettingPage", setup(e2) { const o2 = Ny(); const r2 = pinia.storeToRefs(o2); return (e3, o3) => { const l2 = Yg; return vue.openBlock(), vue.createElementBlock("div", Hy, [Yy, (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(r2), (e4) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [e4.value.have ? (vue.openBlock(), vue.createElementBlock("div", Wy, [vue.createElementVNode("span", null, vue.toDisplayString(e4.value.title), 1), vue.createVNode(l2, { modelValue: e4.value.hide, "onUpdate:modelValue": (t2) => e4.value.hide = t2 }, null, 8, ["modelValue", "onUpdate:modelValue"])])) : vue.createCommentVNode("", true)], 64))), 256))]); }; } }); const Ky = vue.defineComponent({ __name: "index", setup(e2) { return (e3, n2) => (vue.openBlock(), vue.createBlock(Iy, null, { default: vue.withCtx(() => [vue.createVNode(Uy)]), _: 1 })); } }); const qy = pinia.createPinia(); const _Gy = class _Gy { constructor(e2) { __publicField(this, "app", null); this.initializerList = e2; } init() { const e2 = document.querySelector("body"); const t2 = document.createElement("div"); t2.id = _Gy.appId; e2.appendChild(t2); setTimeout(() => { this.app = vue.createApp(Ky); this.app.use(qy); this.app.mount(`#${_Gy.appId}`); this.initializerList.forEach((e3) => e3.init()); }); } }; __publicField(_Gy, "appId", "setting-btn"); let Gy = _Gy; class Zy { constructor(e2, t2) { __publicField(this, "target"); __publicField(this, "oldDisplay"); this.settingName = t2; const n2 = document.querySelector(e2); this.target = n2; this.oldDisplay = n2 == null ? void 0 : n2.style.display; } init() { if (!this.target) { return; } const e2 = Ny(); const t2 = e2[this.settingName]; t2.have = true; vue.watch(() => t2.hide, (e3) => { if (e3) { this.hide(); return; } this.show(); }, { immediate: true }); } hide() { this.target.style.display = "none"; } show() { this.target.style.display = this.oldDisplay; } } class Jy extends Zy { constructor(e2, t2) { super(e2, t2); __publicField(this, "asideMain"); __publicField(this, "oldStyle"); const n2 = document.querySelector("#js-player-asideMain"); this.asideMain = n2; this.oldStyle = this.asideMain.style; } hide() { super.hide(); this.asideMain.style.top = "0"; } show() { super.show(); this.asideMain.style = this.oldStyle; } } class Xy { init() { const e2 = document.createElement("script"); e2.src = "https://hm.baidu.com/hm.js?5c04e81d1fc372b0efa06e8c1b711042"; const t2 = document.getElementsByTagName("script")[0]; t2 && t2.parentNode && t2.parentNode.insertBefore(e2, t2); } } Qy(); async function Qy() { new Ey(); await new ge().observe(); [new ky(), new Gy([new Zy(".PlayerToolbar", "giftBtn"), new Zy("#js-room-activity", "activity"), new Zy("#js-room-top-banner", "videoTopAdvertisement"), new Zy(".layout-Player-rank", "rank"), new Zy(".IconCardAdBoundsBox", "videoInsideAdvertisement"), new Zy("#webmActKefuWeidget", "customerService"), new Zy("#js-barrage-extend-container", "entryReminder"), new Zy(".PubgInfo", "combatStatistics"), new Jy("#js-player-asideTopSuspension", "rankTopAdvertisement")]), new Xy()].forEach((e2) => e2.init()); } } }); require_main_001(); })(Vue, ElementPlus, Qs, VueDemi, Pinia);