douyu-crx

斗鱼插件

As of 20.06.2024. See апошняя версія.

You will need to install an extension such as Tampermonkey, Greasemonkey or Violentmonkey to install this script.

You will need to install an extension such as Tampermonkey to install this script.

You will need to install an extension such as Tampermonkey or Violentmonkey to install this script.

You will need to install an extension such as Tampermonkey or Userscripts to install this script.

You will need to install an extension such as Tampermonkey to install this script.

You will need to install a user script manager extension to install this script.

(I already have a user script manager, let me install it!)

You will need to install an extension such as Stylus to install this style.

You will need to install an extension such as Stylus to install this style.

You will need to install an extension such as Stylus to install this style.

You will need to install a user style manager extension to install this style.

You will need to install a user style manager extension to install this style.

You will need to install a user style manager extension to install this style.

(I already have a user style manager, let me install it!)

// ==UserScript==
// @name         douyu-crx
// @namespace    npm/douyu-crx
// @version      1.2
// @author       monkey
// @description  斗鱼插件
// @icon         https://vitejs.dev/logo.svg
// @match        *://*.douyu.com/0*
// @match        *://*.douyu.com/1*
// @match        *://*.douyu.com/2*
// @match        *://*.douyu.com/3*
// @match        *://*.douyu.com/4*
// @match        *://*.douyu.com/5*
// @match        *://*.douyu.com/6*
// @match        *://*.douyu.com/7*
// @match        *://*.douyu.com/8*
// @match        *://*.douyu.com/9*
// @match        *://*.douyu.com/topic/*
// @require      https://cdn.jsdelivr.net/npm/[email protected]/dist/vue.global.prod.js
// @require      data:application/javascript,%3Bwindow.Vue%3DVue%3B
// @require      https://cdn.jsdelivr.net/npm/[email protected]/dist/index.full.min.js
// @require      https://cdn.jsdelivr.net/npm/[email protected]/dist/qs.min.js
// @require      https://cdn.jsdelivr.net/npm/[email protected]/lib/index.iife.min.js
// @require      https://cdn.jsdelivr.net/npm/[email protected]/dist/pinia.iife.min.js
// @resource     element-plus/dist/index.css  https://cdn.jsdelivr.net/npm/[email protected]/dist/index.css
// @connect      doseeing.com
// @connect      douyu.com
// @grant        GM_addStyle
// @grant        GM_getResourceText
// @grant        GM_xmlhttpRequest
// @grant        unsafeWindow
// ==/UserScript==

(e=>{if(typeof GM_addStyle=="function"){GM_addStyle(e);return}const r=document.createElement("style");r.textContent=e,document.head.append(r)})(' @charset "UTF-8";*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }.static{position:static}.fixed{position:fixed}.mb-4{margin-bottom:1rem}.ml-12{margin-left:3rem}.ml-2{margin-left:.5rem}.ml-5{margin-left:1.25rem}.flex{display:flex}.h-16{height:4rem}.h-20{height:5rem}.h-\\[58vh\\]{height:58vh}.w-16{width:4rem}.w-20{width:5rem}.w-56{width:14rem}.w-full{width:100%}.flex-1{flex:1 1 0%}.flex-none{flex:none}.cursor-pointer{cursor:pointer}.items-start{align-items:flex-start}.items-center{align-items:center}.justify-between{justify-content:space-between}.rounded-md{border-radius:.375rem}.rounded-xl{border-radius:.75rem}.p-\\[20px\\]{padding:20px}.pt-\\[5px\\]{padding-top:5px}.text-center{text-align:center}.text-3xl{font-size:1.875rem;line-height:2.25rem}.text-\\[14px\\]{font-size:14px}.text-xl{font-size:1.25rem;line-height:1.75rem}.font-black{font-weight:900}.font-bold{font-weight:700}.text-slate-400{--tw-text-opacity: 1;color:rgb(148 163 184 / var(--tw-text-opacity))}:root{--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary-rgb:64,158,255;--el-color-success-rgb:103,194,58;--el-color-warning-rgb:230,162,60;--el-color-danger-rgb:245,108,108;--el-color-error-rgb:245,108,108;--el-color-info-rgb:144,147,153;--el-font-size-extra-large:20px;--el-font-size-large:18px;--el-font-size-medium:16px;--el-font-size-base:14px;--el-font-size-small:13px;--el-font-size-extra-small:12px;--el-font-family:"Helvetica Neue",Helvetica,"PingFang SC","Hiragino Sans GB","Microsoft YaHei","\u5FAE\u8F6F\u96C5\u9ED1",Arial,sans-serif;--el-font-weight-primary:500;--el-font-line-height-primary:24px;--el-index-normal:1;--el-index-top:1000;--el-index-popper:2000;--el-border-radius-base:4px;--el-border-radius-small:2px;--el-border-radius-round:20px;--el-border-radius-circle:100%;--el-transition-duration:.3s;--el-transition-duration-fast:.2s;--el-transition-function-ease-in-out-bezier:cubic-bezier(.645,.045,.355,1);--el-transition-function-fast-bezier:cubic-bezier(.23,1,.32,1);--el-transition-all:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade:opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade:transform var(--el-transition-duration) var(--el-transition-function-fast-bezier),opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear:opacity var(--el-transition-duration-fast) linear;--el-transition-border:border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow:box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color:color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large:40px;--el-component-size:32px;--el-component-size-small:24px;color-scheme:light;--el-color-primary:#409eff;--el-color-primary-light-3:#79bbff;--el-color-primary-light-5:#a0cfff;--el-color-primary-light-7:#c6e2ff;--el-color-primary-light-8:#d9ecff;--el-color-primary-light-9:#ecf5ff;--el-color-primary-dark-2:#337ecc;--el-color-success:#67c23a;--el-color-success-light-3:#95d475;--el-color-success-light-5:#b3e19d;--el-color-success-light-7:#d1edc4;--el-color-success-light-8:#e1f3d8;--el-color-success-light-9:#f0f9eb;--el-color-success-dark-2:#529b2e;--el-color-warning:#e6a23c;--el-color-warning-light-3:#eebe77;--el-color-warning-light-5:#f3d19e;--el-color-warning-light-7:#f8e3c5;--el-color-warning-light-8:#faecd8;--el-color-warning-light-9:#fdf6ec;--el-color-warning-dark-2:#b88230;--el-color-danger:#f56c6c;--el-color-danger-light-3:#f89898;--el-color-danger-light-5:#fab6b6;--el-color-danger-light-7:#fcd3d3;--el-color-danger-light-8:#fde2e2;--el-color-danger-light-9:#fef0f0;--el-color-danger-dark-2:#c45656;--el-color-error:#f56c6c;--el-color-error-light-3:#f89898;--el-color-error-light-5:#fab6b6;--el-color-error-light-7:#fcd3d3;--el-color-error-light-8:#fde2e2;--el-color-error-light-9:#fef0f0;--el-color-error-dark-2:#c45656;--el-color-info:#909399;--el-color-info-light-3:#b1b3b8;--el-color-info-light-5:#c8c9cc;--el-color-info-light-7:#dedfe0;--el-color-info-light-8:#e9e9eb;--el-color-info-light-9:#f4f4f5;--el-color-info-dark-2:#73767a;--el-bg-color:#ffffff;--el-bg-color-page:#f2f3f5;--el-bg-color-overlay:#ffffff;--el-text-color-primary:#303133;--el-text-color-regular:#606266;--el-text-color-secondary:#909399;--el-text-color-placeholder:#a8abb2;--el-text-color-disabled:#c0c4cc;--el-border-color:#dcdfe6;--el-border-color-light:#e4e7ed;--el-border-color-lighter:#ebeef5;--el-border-color-extra-light:#f2f6fc;--el-border-color-dark:#d4d7de;--el-border-color-darker:#cdd0d6;--el-fill-color:#f0f2f5;--el-fill-color-light:#f5f7fa;--el-fill-color-lighter:#fafafa;--el-fill-color-extra-light:#fafcff;--el-fill-color-dark:#ebedf0;--el-fill-color-darker:#e6e8eb;--el-fill-color-blank:#ffffff;--el-box-shadow:0px 12px 32px 4px rgba(0,0,0,.04),0px 8px 20px rgba(0,0,0,.08);--el-box-shadow-light:0px 0px 12px rgba(0,0,0,.12);--el-box-shadow-lighter:0px 0px 6px rgba(0,0,0,.12);--el-box-shadow-dark:0px 16px 48px 16px rgba(0,0,0,.08),0px 12px 32px rgba(0,0,0,.12),0px 8px 16px -8px rgba(0,0,0,.16);--el-disabled-bg-color:var(--el-fill-color-light);--el-disabled-text-color:var(--el-text-color-placeholder);--el-disabled-border-color:var(--el-border-color-light);--el-overlay-color:rgba(0,0,0,.8);--el-overlay-color-light:rgba(0,0,0,.7);--el-overlay-color-lighter:rgba(0,0,0,.5);--el-mask-color:rgba(255,255,255,.9);--el-mask-color-extra-light:rgba(255,255,255,.3);--el-border-width:1px;--el-border-style:solid;--el-border-color-hover:var(--el-text-color-disabled);--el-border:var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey:var(--el-border-color)}.el-icon-loading{animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(1turn)}}.el-icon{--color:inherit;align-items:center;display:inline-flex;height:1em;justify-content:center;line-height:1em;position:relative;width:1em;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}:root{--el-loading-spinner-size:42px;--el-loading-fullscreen-spinner-size:50px}.el-loading-parent--relative{position:relative!important}.el-loading-parent--hidden{overflow:hidden!important}.el-loading-mask{background-color:var(--el-mask-color);bottom:0;left:0;margin:0;position:absolute;right:0;top:0;transition:opacity var(--el-transition-duration);z-index:2000}.el-loading-mask.is-fullscreen{position:fixed}.el-loading-mask.is-fullscreen .el-loading-spinner{margin-top:calc((0px - var(--el-loading-fullscreen-spinner-size))/2)}.el-loading-mask.is-fullscreen .el-loading-spinner .circular{height:var(--el-loading-fullscreen-spinner-size);width:var(--el-loading-fullscreen-spinner-size)}.el-loading-spinner{margin-top:calc((0px - var(--el-loading-spinner-size))/2);position:absolute;text-align:center;top:50%;width:100%}.el-loading-spinner .el-loading-text{color:var(--el-color-primary);font-size:14px;margin:3px 0}.el-loading-spinner .circular{animation:loading-rotate 2s linear infinite;display:inline;height:var(--el-loading-spinner-size);width:var(--el-loading-spinner-size)}.el-loading-spinner .path{animation:loading-dash 1.5s ease-in-out infinite;stroke-dasharray:90,150;stroke-dashoffset:0;stroke-width:2;stroke:var(--el-color-primary);stroke-linecap:round}.el-loading-spinner i{color:var(--el-color-primary)}.el-loading-fade-enter-from,.el-loading-fade-leave-to{opacity:0}@keyframes loading-rotate{to{transform:rotate(1turn)}}@keyframes loading-dash{0%{stroke-dasharray:1,200;stroke-dashoffset:0}50%{stroke-dasharray:90,150;stroke-dashoffset:-40px}to{stroke-dasharray:90,150;stroke-dashoffset:-120px}}:root{--el-popup-modal-bg-color:var(--el-color-black);--el-popup-modal-opacity:.5}.v-modal-enter{animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-out{to{opacity:0}}.v-modal{background:var(--el-popup-modal-bg-color);height:100%;left:0;opacity:var(--el-popup-modal-opacity);position:fixed;top:0;width:100%}.el-popup-parent--hidden{overflow:hidden}.el-dialog{--el-dialog-width:50%;--el-dialog-margin-top:15vh;--el-dialog-bg-color:var(--el-bg-color);--el-dialog-box-shadow:var(--el-box-shadow);--el-dialog-title-font-size:var(--el-font-size-large);--el-dialog-content-font-size:14px;--el-dialog-font-line-height:var(--el-font-line-height-primary);--el-dialog-padding-primary:16px;--el-dialog-border-radius:var(--el-border-radius-small);background:var(--el-dialog-bg-color);border-radius:var(--el-dialog-border-radius);box-shadow:var(--el-dialog-box-shadow);box-sizing:border-box;margin:var(--el-dialog-margin-top,15vh) auto 50px;overflow-wrap:break-word;padding:var(--el-dialog-padding-primary);position:relative;width:var(--el-dialog-width,50%)}.el-dialog:focus{outline:none!important}.el-dialog.is-align-center{margin:auto}.el-dialog.is-fullscreen{--el-dialog-width:100%;--el-dialog-margin-top:0;height:100%;margin-bottom:0;overflow:auto}.el-dialog__wrapper{bottom:0;left:0;margin:0;overflow:auto;position:fixed;right:0;top:0}.el-dialog.is-draggable .el-dialog__header{cursor:move;-webkit-user-select:none;user-select:none}.el-dialog__header{padding-bottom:var(--el-dialog-padding-primary)}.el-dialog__header.show-close{padding-right:calc(var(--el-dialog-padding-primary) + var(--el-message-close-size, 16px))}.el-dialog__headerbtn{background:transparent;border:none;cursor:pointer;font-size:var(--el-message-close-size,16px);height:48px;outline:none;padding:0;position:absolute;right:0;top:0;width:48px}.el-dialog__headerbtn .el-dialog__close{color:var(--el-color-info);font-size:inherit}.el-dialog__headerbtn:focus .el-dialog__close,.el-dialog__headerbtn:hover .el-dialog__close{color:var(--el-color-primary)}.el-dialog__title{color:var(--el-text-color-primary);font-size:var(--el-dialog-title-font-size);line-height:var(--el-dialog-font-line-height)}.el-dialog__body{color:var(--el-text-color-regular);font-size:var(--el-dialog-content-font-size)}.el-dialog__footer{box-sizing:border-box;padding-top:var(--el-dialog-padding-primary);text-align:right}.el-dialog--center{text-align:center}.el-dialog--center .el-dialog__body{text-align:initial}.el-dialog--center .el-dialog__footer{text-align:inherit}.el-overlay-dialog{bottom:0;left:0;overflow:auto;position:fixed;right:0;top:0}.dialog-fade-enter-active{animation:modal-fade-in var(--el-transition-duration)}.dialog-fade-enter-active .el-overlay-dialog{animation:dialog-fade-in var(--el-transition-duration)}.dialog-fade-leave-active{animation:modal-fade-out var(--el-transition-duration)}.dialog-fade-leave-active .el-overlay-dialog{animation:dialog-fade-out var(--el-transition-duration)}@keyframes dialog-fade-in{0%{opacity:0;transform:translate3d(0,-20px,0)}to{opacity:1;transform:translateZ(0)}}@keyframes dialog-fade-out{0%{opacity:1;transform:translateZ(0)}to{opacity:0;transform:translate3d(0,-20px,0)}}@keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}.el-overlay{background-color:var(--el-overlay-color-lighter);bottom:0;height:100%;left:0;overflow:auto;position:fixed;right:0;top:0;z-index:2000}.el-overlay .el-overlay-root{height:0}.el-scrollbar{--el-scrollbar-opacity:.3;--el-scrollbar-bg-color:var(--el-text-color-secondary);--el-scrollbar-hover-opacity:.5;--el-scrollbar-hover-bg-color:var(--el-text-color-secondary);height:100%;overflow:hidden;position:relative}.el-scrollbar__wrap{height:100%;overflow:auto}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{background-color:var(--el-scrollbar-bg-color,var(--el-text-color-secondary));border-radius:inherit;cursor:pointer;display:block;height:0;opacity:var(--el-scrollbar-opacity,.3);position:relative;transition:var(--el-transition-duration) background-color;width:0}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color,var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity,.5)}.el-scrollbar__bar{border-radius:4px;bottom:2px;position:absolute;right:2px;z-index:1}.el-scrollbar__bar.is-vertical{top:2px;width:6px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity .34s ease-out}.el-scrollbar-fade-leave-active{transition:opacity .12s ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}.el-divider{position:relative}.el-divider--horizontal{border-top:1px var(--el-border-color) var(--el-border-style);display:block;height:1px;margin:24px 0;width:100%}.el-divider--vertical{border-left:1px var(--el-border-color) var(--el-border-style);display:inline-block;height:1em;margin:0 8px;position:relative;vertical-align:middle;width:1px}.el-divider__text{background-color:var(--el-bg-color);color:var(--el-text-color-primary);font-size:14px;font-weight:500;padding:0 20px;position:absolute}.el-divider__text.is-left{left:20px;transform:translateY(-50%)}.el-divider__text.is-center{left:50%;transform:translate(-50%) translateY(-50%)}.el-divider__text.is-right{right:20px;transform:translateY(-50%)}.el-date-table{font-size:12px;-webkit-user-select:none;user-select:none}.el-date-table.is-week-mode .el-date-table__row:hover .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table.is-week-mode .el-date-table__row:hover td.available:hover{color:var(--el-datepicker-text-color)}.el-date-table.is-week-mode .el-date-table__row:hover td:first-child .el-date-table-cell{border-bottom-left-radius:15px;border-top-left-radius:15px;margin-left:5px}.el-date-table.is-week-mode .el-date-table__row:hover td:last-child .el-date-table-cell{border-bottom-right-radius:15px;border-top-right-radius:15px;margin-right:5px}.el-date-table.is-week-mode .el-date-table__row.current .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td{box-sizing:border-box;cursor:pointer;height:30px;padding:4px 0;position:relative;text-align:center;width:32px}.el-date-table td .el-date-table-cell{box-sizing:border-box;height:30px;padding:3px 0}.el-date-table td .el-date-table-cell .el-date-table-cell__text{border-radius:50%;display:block;height:24px;left:50%;line-height:24px;margin:0 auto;position:absolute;transform:translate(-50%);width:24px}.el-date-table td.next-month,.el-date-table td.prev-month{color:var(--el-datepicker-off-text-color)}.el-date-table td.today{position:relative}.el-date-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-date-table td.today.end-date .el-date-table-cell__text,.el-date-table td.today.start-date .el-date-table-cell__text{color:#fff}.el-date-table td.available:hover{color:var(--el-datepicker-hover-text-color)}.el-date-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-date-table td.current:not(.disabled) .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);color:#fff}.el-date-table td.current:not(.disabled):focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-date-table td.end-date .el-date-table-cell,.el-date-table td.start-date .el-date-table-cell{color:#fff}.el-date-table td.end-date .el-date-table-cell__text,.el-date-table td.start-date .el-date-table-cell__text{background-color:var(--el-datepicker-active-color)}.el-date-table td.start-date .el-date-table-cell{border-bottom-left-radius:15px;border-top-left-radius:15px;margin-left:5px}.el-date-table td.end-date .el-date-table-cell{border-bottom-right-radius:15px;border-top-right-radius:15px;margin-right:5px}.el-date-table td.disabled .el-date-table-cell{background-color:var(--el-fill-color-light);color:var(--el-text-color-placeholder);cursor:not-allowed;opacity:1}.el-date-table td.selected .el-date-table-cell{border-radius:15px;margin-left:5px;margin-right:5px}.el-date-table td.selected .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);border-radius:15px;color:#fff}.el-date-table td.week{color:var(--el-datepicker-header-text-color);font-size:80%}.el-date-table td:focus{outline:none}.el-date-table th{border-bottom:1px solid var(--el-border-color-lighter);color:var(--el-datepicker-header-text-color);font-weight:400;padding:5px}.el-month-table{border-collapse:collapse;font-size:12px;margin:-1px}.el-month-table td{cursor:pointer;padding:8px 0;position:relative;text-align:center;width:68px}.el-month-table td div{box-sizing:border-box;height:48px;padding:6px 0}.el-month-table td.today .cell{color:var(--el-color-primary);font-weight:700}.el-month-table td.today.end-date .cell,.el-month-table td.today.start-date .cell{color:#fff}.el-month-table td.disabled .cell{background-color:var(--el-fill-color-light);color:var(--el-text-color-placeholder);cursor:not-allowed}.el-month-table td.disabled .cell:hover{color:var(--el-text-color-placeholder)}.el-month-table td .cell{border-radius:18px;color:var(--el-datepicker-text-color);display:block;height:36px;left:50%;line-height:36px;margin:0 auto;position:absolute;transform:translate(-50%);width:54px}.el-month-table td .cell:hover{color:var(--el-datepicker-hover-text-color)}.el-month-table td.in-range div{background-color:var(--el-datepicker-inrange-bg-color)}.el-month-table td.in-range div:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-month-table td.end-date div,.el-month-table td.start-date div{color:#fff}.el-month-table td.end-date .cell,.el-month-table td.start-date .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-month-table td.start-date div{border-bottom-left-radius:24px;border-top-left-radius:24px;margin-left:3px}.el-month-table td.end-date div{border-bottom-right-radius:24px;border-top-right-radius:24px;margin-right:3px}.el-month-table td.current:not(.disabled) div{border-radius:24px;margin-left:3px;margin-right:3px}.el-month-table td.current:not(.disabled) .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-month-table td:focus-visible{outline:none}.el-month-table td:focus-visible .cell{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-year-table{border-collapse:collapse;font-size:12px;margin:-1px}.el-year-table .el-icon{color:var(--el-datepicker-icon-color)}.el-year-table td{cursor:pointer;padding:8px 0;position:relative;text-align:center;width:68px}.el-year-table td div{box-sizing:border-box;height:48px;padding:6px 0}.el-year-table td.today .cell{color:var(--el-color-primary);font-weight:700}.el-year-table td.disabled .cell{background-color:var(--el-fill-color-light);color:var(--el-text-color-placeholder);cursor:not-allowed}.el-year-table td.disabled .cell:hover{color:var(--el-text-color-placeholder)}.el-year-table td .cell{border-radius:18px;color:var(--el-datepicker-text-color);display:block;height:36px;left:50%;line-height:36px;margin:0 auto;position:absolute;transform:translate(-50%);width:54px}.el-year-table td .cell:hover{color:var(--el-datepicker-hover-text-color)}.el-year-table td.current:not(.disabled) div{border-radius:24px;margin-left:3px;margin-right:3px}.el-year-table td.current:not(.disabled) .cell{background-color:var(--el-datepicker-active-color);color:#fff}.el-year-table td:focus-visible{outline:none}.el-year-table td:focus-visible .cell{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-time-spinner.has-seconds .el-time-spinner__wrapper{width:33.3%}.el-time-spinner__wrapper{display:inline-block;max-height:192px;overflow:auto;position:relative;vertical-align:top;width:50%}.el-time-spinner__wrapper.el-scrollbar__wrap:not(.el-scrollbar__wrap--hidden-default){padding-bottom:15px}.el-time-spinner__wrapper.is-arrow{box-sizing:border-box;overflow:hidden;text-align:center}.el-time-spinner__wrapper.is-arrow .el-time-spinner__list{transform:translateY(-32px)}.el-time-spinner__wrapper.is-arrow .el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:default}.el-time-spinner__arrow{color:var(--el-text-color-secondary);cursor:pointer;font-size:12px;height:30px;left:0;line-height:30px;position:absolute;text-align:center;width:100%;z-index:var(--el-index-normal)}.el-time-spinner__arrow:hover{color:var(--el-color-primary)}.el-time-spinner__arrow.arrow-up{top:10px}.el-time-spinner__arrow.arrow-down{bottom:10px}.el-time-spinner__input.el-input{width:70%}.el-time-spinner__input.el-input .el-input__inner,.el-time-spinner__list{padding:0;text-align:center}.el-time-spinner__list{list-style:none;margin:0}.el-time-spinner__list:after,.el-time-spinner__list:before{content:"";display:block;height:80px;width:100%}.el-time-spinner__item{color:var(--el-text-color-regular);font-size:12px;height:32px;line-height:32px}.el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:pointer}.el-time-spinner__item.is-active:not(.is-disabled){color:var(--el-text-color-primary);font-weight:700}.el-time-spinner__item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transform-origin:center top;transition:var(--el-transition-md-fade)}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transform-origin:center bottom;transition:var(--el-transition-md-fade)}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transform-origin:top left;transition:var(--el-transition-md-fade)}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-picker__popper{--el-datepicker-border-color:var(--el-disabled-border-color)}.el-picker__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-datepicker-border-color);box-shadow:var(--el-box-shadow-light)}.el-picker__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-datepicker-border-color)}.el-picker__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-left-color:transparent;border-top-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-bottom-color:transparent;border-left-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-date-editor{--el-date-editor-width:220px;--el-date-editor-monthrange-width:300px;--el-date-editor-daterange-width:350px;--el-date-editor-datetimerange-width:400px;--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;position:relative;text-align:left;vertical-align:middle}.el-date-editor.el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset}.el-date-editor.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-date-editor.el-input,.el-date-editor.el-input__wrapper{height:var(--el-input-height,var(--el-component-size));width:var(--el-date-editor-width)}.el-date-editor--monthrange{--el-date-editor-width:var(--el-date-editor-monthrange-width)}.el-date-editor--daterange,.el-date-editor--timerange{--el-date-editor-width:var(--el-date-editor-daterange-width)}.el-date-editor--datetimerange{--el-date-editor-width:var(--el-date-editor-datetimerange-width)}.el-date-editor--dates .el-input__wrapper{text-overflow:ellipsis;white-space:nowrap}.el-date-editor .clear-icon,.el-date-editor .close-icon{cursor:pointer}.el-date-editor .clear-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__icon{color:var(--el-text-color-placeholder);float:left;font-size:14px;height:inherit}.el-date-editor .el-range__icon svg{vertical-align:middle}.el-date-editor .el-range-input{-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent;border:none;color:var(--el-text-color-regular);display:inline-block;font-size:var(--el-font-size-base);height:30px;line-height:30px;margin:0;outline:none;padding:0;text-align:center;width:39%}.el-date-editor .el-range-input::placeholder{color:var(--el-text-color-placeholder)}.el-date-editor .el-range-separator{align-items:center;color:var(--el-text-color-primary);display:inline-flex;flex:1;font-size:14px;height:100%;justify-content:center;margin:0;overflow-wrap:break-word;padding:0 5px}.el-date-editor .el-range__close-icon{color:var(--el-text-color-placeholder);cursor:pointer;font-size:14px;height:inherit;width:unset}.el-date-editor .el-range__close-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__close-icon svg{vertical-align:middle}.el-date-editor .el-range__close-icon--hidden{opacity:0;visibility:hidden}.el-range-editor.el-input__wrapper{align-items:center;display:inline-flex;padding:0 10px}.el-range-editor.is-active,.el-range-editor.is-active:hover{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-range-editor--large{line-height:var(--el-component-size-large)}.el-range-editor--large.el-input__wrapper{height:var(--el-component-size-large)}.el-range-editor--large .el-range-separator{font-size:14px;line-height:40px}.el-range-editor--large .el-range-input{font-size:14px;height:38px;line-height:38px}.el-range-editor--small{line-height:var(--el-component-size-small)}.el-range-editor--small.el-input__wrapper{height:var(--el-component-size-small)}.el-range-editor--small .el-range-separator{font-size:12px;line-height:24px}.el-range-editor--small .el-range-input{font-size:12px;height:22px;line-height:22px}.el-range-editor.is-disabled{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled:focus,.el-range-editor.is-disabled:hover{border-color:var(--el-disabled-border-color)}.el-range-editor.is-disabled input{background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled input::placeholder{color:var(--el-text-color-placeholder)}.el-range-editor.is-disabled .el-range-separator{color:var(--el-disabled-text-color)}.el-picker-panel{background:var(--el-bg-color-overlay);border-radius:var(--el-border-radius-base);color:var(--el-text-color-regular);line-height:30px}.el-picker-panel .el-time-panel{background-color:var(--el-bg-color-overlay);border:1px solid var(--el-datepicker-border-color);box-shadow:var(--el-box-shadow-light);margin:5px 0}.el-picker-panel__body-wrapper:after,.el-picker-panel__body:after{clear:both;content:"";display:table}.el-picker-panel__content{margin:15px;position:relative}.el-picker-panel__footer{background-color:var(--el-bg-color-overlay);border-top:1px solid var(--el-datepicker-inner-border-color);font-size:0;padding:4px 12px;position:relative;text-align:right}.el-picker-panel__shortcut{background-color:transparent;border:0;color:var(--el-datepicker-text-color);cursor:pointer;display:block;font-size:14px;line-height:28px;outline:none;padding-left:12px;text-align:left;width:100%}.el-picker-panel__shortcut:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__shortcut.active{background-color:#e6f1fe;color:var(--el-datepicker-active-color)}.el-picker-panel__btn{background-color:transparent;border:1px solid var(--el-fill-color-darker);border-radius:2px;color:var(--el-text-color-primary);cursor:pointer;font-size:12px;line-height:24px;outline:none;padding:0 20px}.el-picker-panel__btn[disabled]{color:var(--el-text-color-disabled);cursor:not-allowed}.el-picker-panel__icon-btn{background:transparent;border:0;color:var(--el-datepicker-icon-color);cursor:pointer;font-size:12px;margin-top:8px;outline:none}.el-picker-panel__icon-btn:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn:focus-visible{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn.is-disabled{color:var(--el-text-color-disabled)}.el-picker-panel__icon-btn.is-disabled:hover{cursor:not-allowed}.el-picker-panel__icon-btn .el-icon{cursor:pointer;font-size:inherit}.el-picker-panel__link-btn{vertical-align:middle}.el-picker-panel [slot=sidebar],.el-picker-panel__sidebar{background-color:var(--el-bg-color-overlay);border-right:1px solid var(--el-datepicker-inner-border-color);bottom:0;box-sizing:border-box;overflow:auto;padding-top:6px;position:absolute;top:0;width:110px}.el-picker-panel [slot=sidebar]+.el-picker-panel__body,.el-picker-panel__sidebar+.el-picker-panel__body{margin-left:110px}.el-date-picker{--el-datepicker-text-color:var(--el-text-color-regular);--el-datepicker-off-text-color:var(--el-text-color-placeholder);--el-datepicker-header-text-color:var(--el-text-color-regular);--el-datepicker-icon-color:var(--el-text-color-primary);--el-datepicker-border-color:var(--el-disabled-border-color);--el-datepicker-inner-border-color:var(--el-border-color-light);--el-datepicker-inrange-bg-color:var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color:var(--el-border-color-extra-light);--el-datepicker-active-color:var(--el-color-primary);--el-datepicker-hover-text-color:var(--el-color-primary);width:322px}.el-date-picker.has-sidebar.has-time{width:434px}.el-date-picker.has-sidebar{width:438px}.el-date-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-picker .el-picker-panel__content{width:292px}.el-date-picker table{table-layout:fixed;width:100%}.el-date-picker__editor-wrap{display:table-cell;padding:0 5px;position:relative}.el-date-picker__time-header{border-bottom:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;display:table;font-size:12px;padding:8px 5px 5px;position:relative;width:100%}.el-date-picker__header{margin:12px;text-align:center}.el-date-picker__header--bordered{border-bottom:1px solid var(--el-border-color-lighter);margin-bottom:0;padding-bottom:12px}.el-date-picker__header--bordered+.el-picker-panel__content{margin-top:0}.el-date-picker__header-label{color:var(--el-text-color-regular);cursor:pointer;font-size:16px;font-weight:500;line-height:22px;padding:0 5px;text-align:center}.el-date-picker__header-label:hover{color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label:focus-visible{color:var(--el-datepicker-hover-text-color);outline:none}.el-date-picker__header-label.active{color:var(--el-datepicker-active-color)}.el-date-picker__prev-btn{float:left}.el-date-picker__next-btn{float:right}.el-date-picker__time-wrap{padding:10px;text-align:center}.el-date-picker__time-label{cursor:pointer;float:left;line-height:30px;margin-left:10px}.el-date-picker .el-time-panel{position:absolute}.el-date-range-picker{--el-datepicker-text-color:var(--el-text-color-regular);--el-datepicker-off-text-color:var(--el-text-color-placeholder);--el-datepicker-header-text-color:var(--el-text-color-regular);--el-datepicker-icon-color:var(--el-text-color-primary);--el-datepicker-border-color:var(--el-disabled-border-color);--el-datepicker-inner-border-color:var(--el-border-color-light);--el-datepicker-inrange-bg-color:var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color:var(--el-border-color-extra-light);--el-datepicker-active-color:var(--el-color-primary);--el-datepicker-hover-text-color:var(--el-color-primary);width:646px}.el-date-range-picker.has-sidebar{width:756px}.el-date-range-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-range-picker table{table-layout:fixed;width:100%}.el-date-range-picker .el-picker-panel__body{min-width:513px}.el-date-range-picker .el-picker-panel__content{margin:0}.el-date-range-picker__header{height:28px;position:relative;text-align:center}.el-date-range-picker__header [class*=arrow-left]{float:left}.el-date-range-picker__header [class*=arrow-right]{float:right}.el-date-range-picker__header div{font-size:16px;font-weight:500;margin-right:50px}.el-date-range-picker__content{box-sizing:border-box;float:left;margin:0;padding:16px;width:50%}.el-date-range-picker__content.is-left{border-right:1px solid var(--el-datepicker-inner-border-color)}.el-date-range-picker__content .el-date-range-picker__header div{margin-left:50px;margin-right:50px}.el-date-range-picker__editors-wrap{box-sizing:border-box;display:table-cell}.el-date-range-picker__editors-wrap.is-right{text-align:right}.el-date-range-picker__time-header{border-bottom:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;display:table;font-size:12px;padding:8px 5px 5px;position:relative;width:100%}.el-date-range-picker__time-header>.el-icon-arrow-right{color:var(--el-datepicker-icon-color);display:table-cell;font-size:20px;vertical-align:middle}.el-date-range-picker__time-picker-wrap{display:table-cell;padding:0 5px;position:relative}.el-date-range-picker__time-picker-wrap .el-picker-panel{background:#fff;position:absolute;right:0;top:13px;z-index:1}.el-date-range-picker__time-picker-wrap .el-time-panel{position:absolute}.el-time-range-picker{overflow:visible;width:354px}.el-time-range-picker__content{padding:10px;position:relative;text-align:center;z-index:1}.el-time-range-picker__cell{box-sizing:border-box;display:inline-block;margin:0;padding:4px 7px 7px;width:50%}.el-time-range-picker__header{font-size:14px;margin-bottom:5px;text-align:center}.el-time-range-picker__body{border:1px solid var(--el-datepicker-border-color);border-radius:2px}.el-time-panel{border-radius:2px;box-sizing:content-box;left:0;position:relative;-webkit-user-select:none;user-select:none;width:180px;z-index:var(--el-index-top)}.el-time-panel__content{font-size:0;overflow:hidden;position:relative}.el-time-panel__content:after,.el-time-panel__content:before{box-sizing:border-box;content:"";height:32px;left:0;margin-top:-16px;padding-top:6px;position:absolute;right:0;text-align:left;top:50%;z-index:-1}.el-time-panel__content:after{left:50%;margin-left:12%;margin-right:12%}.el-time-panel__content:before{border-bottom:1px solid var(--el-border-color-light);border-top:1px solid var(--el-border-color-light);margin-left:12%;margin-right:12%;padding-left:50%}.el-time-panel__content.has-seconds:after{left:66.6666666667%}.el-time-panel__content.has-seconds:before{padding-left:33.3333333333%}.el-time-panel__footer{border-top:1px solid var(--el-timepicker-inner-border-color,var(--el-border-color-light));box-sizing:border-box;height:36px;line-height:25px;padding:4px;text-align:right}.el-time-panel__btn{background-color:transparent;border:none;color:var(--el-text-color-primary);cursor:pointer;font-size:12px;line-height:28px;margin:0 5px;outline:none;padding:0 5px}.el-time-panel__btn.confirm{color:var(--el-timepicker-active-color,var(--el-color-primary));font-weight:800}.el-textarea{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;display:inline-block;font-size:var(--el-font-size-base);position:relative;vertical-align:bottom;width:100%}.el-textarea__inner{-webkit-appearance:none;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));display:block;font-family:inherit;font-size:inherit;line-height:1.5;padding:5px 11px;position:relative;resize:vertical;transition:var(--el-transition-box-shadow);width:100%}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-textarea__inner:focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset;outline:none}.el-textarea .el-input__count{background:var(--el-fill-color-blank);bottom:5px;color:var(--el-color-info);font-size:12px;line-height:14px;position:absolute;right:10px}.el-textarea.is-disabled .el-textarea__inner{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset;color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-width:100%;--el-input-height:var(--el-component-size);box-sizing:border-box;display:inline-flex;font-size:var(--el-font-size-base);line-height:var(--el-input-height);position:relative;vertical-align:middle;width:var(--el-input-width)}.el-input::-webkit-scrollbar{width:6px;z-index:11}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{background:var(--el-text-color-disabled);border-radius:5px;width:6px}.el-input::-webkit-scrollbar-corner,.el-input::-webkit-scrollbar-track{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track-piece{background:var(--el-fill-color-blank);width:6px}.el-input .el-input__clear,.el-input .el-input__password{color:var(--el-input-icon-color);cursor:pointer;font-size:14px}.el-input .el-input__clear:hover,.el-input .el-input__password:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{align-items:center;color:var(--el-color-info);display:inline-flex;font-size:12px;height:100%}.el-input .el-input__count .el-input__count-inner{background:var(--el-fill-color-blank);display:inline-block;line-height:normal;padding-left:8px}.el-input__wrapper{align-items:center;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;cursor:text;display:inline-flex;flex-grow:1;justify-content:center;padding:1px 11px;transform:translateZ(0);transition:var(--el-transition-box-shadow)}.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 32px) - 2px);-webkit-appearance:none;background:none;border:none;box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));flex-grow:1;font-size:inherit;height:var(--el-input-inner-height);line-height:var(--el-input-inner-height);outline:none;padding:0;width:100%}.el-input__inner:focus{outline:none}.el-input__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner[type=password]::-ms-reveal{display:none}.el-input__inner[type=number]{line-height:1}.el-input__prefix{color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:inline-flex;flex-shrink:0;flex-wrap:nowrap;height:100%;pointer-events:none;text-align:center;transition:all var(--el-transition-duration);white-space:nowrap}.el-input__prefix-inner{align-items:center;display:inline-flex;justify-content:center;pointer-events:all}.el-input__prefix-inner>:last-child{margin-right:8px}.el-input__prefix-inner>:first-child,.el-input__prefix-inner>:first-child.el-input__icon{margin-left:0}.el-input__suffix{color:var(--el-input-icon-color,var(--el-text-color-placeholder));display:inline-flex;flex-shrink:0;flex-wrap:nowrap;height:100%;pointer-events:none;text-align:center;transition:all var(--el-transition-duration);white-space:nowrap}.el-input__suffix-inner{align-items:center;display:inline-flex;justify-content:center;pointer-events:all}.el-input__suffix-inner>:first-child{margin-left:8px}.el-input .el-input__icon{align-items:center;display:flex;height:inherit;justify-content:center;line-height:inherit;margin-left:8px;transition:all var(--el-transition-duration)}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-color, ) inset}.el-input.is-disabled{cursor:not-allowed}.el-input.is-disabled .el-input__wrapper{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset}.el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color);-webkit-text-fill-color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--large{--el-input-height:var(--el-component-size-large);font-size:14px}.el-input--large .el-input__wrapper{padding:1px 15px}.el-input--large .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 40px) - 2px)}.el-input--small{--el-input-height:var(--el-component-size-small);font-size:12px}.el-input--small .el-input__wrapper{padding:1px 7px}.el-input--small .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 24px) - 2px)}.el-input-group{align-items:stretch;display:inline-flex;width:100%}.el-input-group__append,.el-input-group__prepend{align-items:center;background-color:var(--el-fill-color-light);border-radius:var(--el-input-border-radius);color:var(--el-color-info);display:inline-flex;justify-content:center;min-height:100%;padding:0 20px;position:relative;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:none}.el-input-group__append .el-button,.el-input-group__append .el-select,.el-input-group__prepend .el-button,.el-input-group__prepend .el-select{display:inline-block;margin:0 -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-select__wrapper,.el-input-group__append div.el-select:hover .el-select__wrapper,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-select__wrapper,.el-input-group__prepend div.el-select:hover .el-select__wrapper{background-color:transparent;border-color:transparent;color:inherit}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-bottom-right-radius:0;border-right:0;border-top-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group__append{border-bottom-left-radius:0;border-left:0;border-top-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--prepend>.el-input__wrapper{border-bottom-left-radius:0;border-top-left-radius:0}.el-input-group--prepend .el-input-group__prepend .el-select .el-select__wrapper{border-bottom-right-radius:0;border-top-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group--append>.el-input__wrapper{border-bottom-right-radius:0;border-top-right-radius:0}.el-input-group--append .el-input-group__append .el-select .el-select__wrapper{border-bottom-left-radius:0;border-top-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-hidden{display:none!important}.el-popper{--el-popper-border-radius:var(--el-popover-border-radius,4px);border-radius:var(--el-popper-border-radius);font-size:12px;line-height:20px;min-width:10px;overflow-wrap:break-word;padding:5px 11px;position:absolute;visibility:visible;z-index:2000}.el-popper.is-dark{background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary);color:var(--el-bg-color)}.el-popper.is-dark .el-popper__arrow:before{background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary);right:0}.el-popper.is-light{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow:before{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);right:0}.el-popper.is-pure{padding:0}.el-popper__arrow{height:10px;position:absolute;width:10px;z-index:-1}.el-popper__arrow:before{background:var(--el-text-color-primary);box-sizing:border-box;content:" ";height:10px;position:absolute;transform:rotate(45deg);width:10px;z-index:-1}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow:before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow:before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow:before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow:before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-left-color:transparent!important;border-top-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-bottom-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent!important;border-top-color:transparent!important}.el-button{--el-button-font-weight:var(--el-font-weight-primary);--el-button-border-color:var(--el-border-color);--el-button-bg-color:var(--el-fill-color-blank);--el-button-text-color:var(--el-text-color-regular);--el-button-disabled-text-color:var(--el-disabled-text-color);--el-button-disabled-bg-color:var(--el-fill-color-blank);--el-button-disabled-border-color:var(--el-border-color-light);--el-button-divide-border-color:rgba(255,255,255,.5);--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-9);--el-button-hover-border-color:var(--el-color-primary-light-7);--el-button-active-text-color:var(--el-button-hover-text-color);--el-button-active-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-button-hover-bg-color);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-hover-link-text-color:var(--el-color-info);--el-button-active-color:var(--el-text-color-primary);align-items:center;-webkit-appearance:none;background-color:var(--el-button-bg-color);border:var(--el-border);border-color:var(--el-button-border-color);border-radius:var(--el-border-radius-base);box-sizing:border-box;color:var(--el-button-text-color);cursor:pointer;display:inline-flex;font-size:var(--el-font-size-base);font-weight:var(--el-button-font-weight);height:32px;justify-content:center;line-height:1;outline:none;padding:8px 15px;text-align:center;transition:.1s;-webkit-user-select:none;user-select:none;vertical-align:middle;white-space:nowrap}.el-button:hover{background-color:var(--el-button-hover-bg-color);border-color:var(--el-button-hover-border-color);color:var(--el-button-hover-text-color);outline:none}.el-button:active{background-color:var(--el-button-active-bg-color);border-color:var(--el-button-active-border-color);color:var(--el-button-active-text-color);outline:none}.el-button:focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button>span{align-items:center;display:inline-flex}.el-button+.el-button{margin-left:12px}.el-button.is-round{padding:8px 15px}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-fill-color-blank);--el-button-hover-border-color:var(--el-color-primary)}.el-button.is-active{background-color:var(--el-button-active-bg-color);border-color:var(--el-button-active-border-color);color:var(--el-button-active-text-color);outline:none}.el-button.is-disabled,.el-button.is-disabled:hover{background-color:var(--el-button-disabled-bg-color);background-image:none;border-color:var(--el-button-disabled-border-color);color:var(--el-button-disabled-text-color);cursor:not-allowed}.el-button.is-loading{pointer-events:none;position:relative}.el-button.is-loading:before{background-color:var(--el-mask-color-extra-light);border-radius:inherit;bottom:-1px;content:"";left:-1px;pointer-events:none;position:absolute;right:-1px;top:-1px;z-index:1}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{border-radius:50%;padding:8px;width:32px}.el-button.is-text{background-color:transparent;border:0 solid transparent;color:var(--el-button-text-color)}.el-button.is-text.is-disabled{background-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button.is-text:not(.is-disabled):hover{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled):focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px;transition:outline-offset 0s,outline 0s}.el-button.is-text:not(.is-disabled):active{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled).is-has-bg:hover{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg:active{background-color:var(--el-fill-color-dark)}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button.is-link{background:transparent;border-color:transparent;color:var(--el-button-text-color);height:auto;padding:2px}.el-button.is-link:hover{color:var(--el-button-hover-link-text-color)}.el-button.is-link.is-disabled{background-color:transparent!important;border-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button.is-link:not(.is-disabled):hover{background-color:transparent;border-color:transparent}.el-button.is-link:not(.is-disabled):active{background-color:transparent;border-color:transparent;color:var(--el-button-active-color)}.el-button--text{background:transparent;border-color:transparent;color:var(--el-color-primary);padding-left:0;padding-right:0}.el-button--text.is-disabled{background-color:transparent!important;border-color:transparent!important;color:var(--el-button-disabled-text-color)}.el-button--text:not(.is-disabled):hover{background-color:transparent;border-color:transparent;color:var(--el-color-primary-light-3)}.el-button--text:not(.is-disabled):active{background-color:transparent;border-color:transparent;color:var(--el-color-primary-dark-2)}.el-button__link--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--primary{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-active-color:var(--el-color-primary-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-primary-light-5);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-primary-light-5);--el-button-disabled-border-color:var(--el-color-primary-light-5)}.el-button--primary.is-link,.el-button--primary.is-plain,.el-button--primary.is-text{--el-button-text-color:var(--el-color-primary);--el-button-bg-color:var(--el-color-primary-light-9);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-text-color:var(--el-color-white)}.el-button--primary.is-link.is-disabled,.el-button--primary.is-link.is-disabled:active,.el-button--primary.is-link.is-disabled:focus,.el-button--primary.is-link.is-disabled:hover,.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:hover,.el-button--primary.is-text.is-disabled,.el-button--primary.is-text.is-disabled:active,.el-button--primary.is-text.is-disabled:focus,.el-button--primary.is-text.is-disabled:hover{background-color:var(--el-color-primary-light-9);border-color:var(--el-color-primary-light-8);color:var(--el-color-primary-light-5)}.el-button--success{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-success);--el-button-border-color:var(--el-color-success);--el-button-outline-color:var(--el-color-success-light-5);--el-button-active-color:var(--el-color-success-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-success-light-5);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-success-light-5);--el-button-disabled-border-color:var(--el-color-success-light-5)}.el-button--success.is-link,.el-button--success.is-plain,.el-button--success.is-text{--el-button-text-color:var(--el-color-success);--el-button-bg-color:var(--el-color-success-light-9);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-text-color:var(--el-color-white)}.el-button--success.is-link.is-disabled,.el-button--success.is-link.is-disabled:active,.el-button--success.is-link.is-disabled:focus,.el-button--success.is-link.is-disabled:hover,.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:hover,.el-button--success.is-text.is-disabled,.el-button--success.is-text.is-disabled:active,.el-button--success.is-text.is-disabled:focus,.el-button--success.is-text.is-disabled:hover{background-color:var(--el-color-success-light-9);border-color:var(--el-color-success-light-8);color:var(--el-color-success-light-5)}.el-button--warning{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-warning);--el-button-border-color:var(--el-color-warning);--el-button-outline-color:var(--el-color-warning-light-5);--el-button-active-color:var(--el-color-warning-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-warning-light-5);--el-button-hover-bg-color:var(--el-color-warning-light-3);--el-button-hover-border-color:var(--el-color-warning-light-3);--el-button-active-bg-color:var(--el-color-warning-dark-2);--el-button-active-border-color:var(--el-color-warning-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-warning-light-5);--el-button-disabled-border-color:var(--el-color-warning-light-5)}.el-button--warning.is-link,.el-button--warning.is-plain,.el-button--warning.is-text{--el-button-text-color:var(--el-color-warning);--el-button-bg-color:var(--el-color-warning-light-9);--el-button-border-color:var(--el-color-warning-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-warning);--el-button-hover-border-color:var(--el-color-warning);--el-button-active-text-color:var(--el-color-white)}.el-button--warning.is-link.is-disabled,.el-button--warning.is-link.is-disabled:active,.el-button--warning.is-link.is-disabled:focus,.el-button--warning.is-link.is-disabled:hover,.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:hover,.el-button--warning.is-text.is-disabled,.el-button--warning.is-text.is-disabled:active,.el-button--warning.is-text.is-disabled:focus,.el-button--warning.is-text.is-disabled:hover{background-color:var(--el-color-warning-light-9);border-color:var(--el-color-warning-light-8);color:var(--el-color-warning-light-5)}.el-button--danger{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger);--el-button-outline-color:var(--el-color-danger-light-5);--el-button-active-color:var(--el-color-danger-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-danger-light-5);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-danger-light-5);--el-button-disabled-border-color:var(--el-color-danger-light-5)}.el-button--danger.is-link,.el-button--danger.is-plain,.el-button--danger.is-text{--el-button-text-color:var(--el-color-danger);--el-button-bg-color:var(--el-color-danger-light-9);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-text-color:var(--el-color-white)}.el-button--danger.is-link.is-disabled,.el-button--danger.is-link.is-disabled:active,.el-button--danger.is-link.is-disabled:focus,.el-button--danger.is-link.is-disabled:hover,.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:hover,.el-button--danger.is-text.is-disabled,.el-button--danger.is-text.is-disabled:active,.el-button--danger.is-text.is-disabled:focus,.el-button--danger.is-text.is-disabled:hover{background-color:var(--el-color-danger-light-9);border-color:var(--el-color-danger-light-8);color:var(--el-color-danger-light-5)}.el-button--info{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-info);--el-button-border-color:var(--el-color-info);--el-button-outline-color:var(--el-color-info-light-5);--el-button-active-color:var(--el-color-info-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-info-light-5);--el-button-hover-bg-color:var(--el-color-info-light-3);--el-button-hover-border-color:var(--el-color-info-light-3);--el-button-active-bg-color:var(--el-color-info-dark-2);--el-button-active-border-color:var(--el-color-info-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-info-light-5);--el-button-disabled-border-color:var(--el-color-info-light-5)}.el-button--info.is-link,.el-button--info.is-plain,.el-button--info.is-text{--el-button-text-color:var(--el-color-info);--el-button-bg-color:var(--el-color-info-light-9);--el-button-border-color:var(--el-color-info-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-info);--el-button-hover-border-color:var(--el-color-info);--el-button-active-text-color:var(--el-color-white)}.el-button--info.is-link.is-disabled,.el-button--info.is-link.is-disabled:active,.el-button--info.is-link.is-disabled:focus,.el-button--info.is-link.is-disabled:hover,.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:hover,.el-button--info.is-text.is-disabled,.el-button--info.is-text.is-disabled:active,.el-button--info.is-text.is-disabled:focus,.el-button--info.is-text.is-disabled:hover{background-color:var(--el-color-info-light-9);border-color:var(--el-color-info-light-8);color:var(--el-color-info-light-5)}.el-button--large{--el-button-size:40px;border-radius:var(--el-border-radius-base);font-size:var(--el-font-size-base);height:var(--el-button-size);padding:12px 19px}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{padding:12px;width:var(--el-button-size)}.el-button--small{--el-button-size:24px;border-radius:calc(var(--el-border-radius-base) - 1px);font-size:12px;height:var(--el-button-size);padding:5px 11px}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{padding:5px;width:var(--el-button-size)}.el-checkbox-group{font-size:0;line-height:0}.el-checkbox{--el-checkbox-font-size:14px;--el-checkbox-font-weight:var(--el-font-weight-primary);--el-checkbox-text-color:var(--el-text-color-regular);--el-checkbox-input-height:14px;--el-checkbox-input-width:14px;--el-checkbox-border-radius:var(--el-border-radius-small);--el-checkbox-bg-color:var(--el-fill-color-blank);--el-checkbox-input-border:var(--el-border);--el-checkbox-disabled-border-color:var(--el-border-color);--el-checkbox-disabled-input-fill:var(--el-fill-color-light);--el-checkbox-disabled-icon-color:var(--el-text-color-placeholder);--el-checkbox-disabled-checked-input-fill:var(--el-border-color-extra-light);--el-checkbox-disabled-checked-input-border-color:var(--el-border-color);--el-checkbox-disabled-checked-icon-color:var(--el-text-color-placeholder);--el-checkbox-checked-text-color:var(--el-color-primary);--el-checkbox-checked-input-border-color:var(--el-color-primary);--el-checkbox-checked-bg-color:var(--el-color-primary);--el-checkbox-checked-icon-color:var(--el-color-white);--el-checkbox-input-border-color-hover:var(--el-color-primary);align-items:center;color:var(--el-checkbox-text-color);cursor:pointer;display:inline-flex;font-size:var(--el-font-size-base);font-weight:var(--el-checkbox-font-weight);height:var(--el-checkbox-height,32px);margin-right:30px;position:relative;-webkit-user-select:none;user-select:none;white-space:nowrap}.el-checkbox.is-disabled{cursor:not-allowed}.el-checkbox.is-bordered{border:var(--el-border);border-radius:var(--el-border-radius-base);box-sizing:border-box;padding:0 15px 0 9px}.el-checkbox.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-checkbox.is-bordered.is-disabled{border-color:var(--el-border-color-lighter)}.el-checkbox.is-bordered.el-checkbox--large{border-radius:var(--el-border-radius-base);padding:0 19px 0 11px}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__label{font-size:var(--el-font-size-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.is-bordered.el-checkbox--small{border-radius:calc(var(--el-border-radius-base) - 1px);padding:0 11px 0 7px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox input:focus-visible+.el-checkbox__inner{border-radius:var(--el-checkbox-border-radius);outline:2px solid var(--el-checkbox-input-border-color-hover);outline-offset:1px}.el-checkbox__input{cursor:pointer;display:inline-flex;outline:none;position:relative;white-space:nowrap}.el-checkbox__input.is-disabled .el-checkbox__inner{background-color:var(--el-checkbox-disabled-input-fill);border-color:var(--el-checkbox-disabled-border-color);cursor:not-allowed}.el-checkbox__input.is-disabled .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-icon-color);cursor:not-allowed}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-disabled-checked-icon-color);border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled+span.el-checkbox__label{color:var(--el-disabled-text-color);cursor:not-allowed}.el-checkbox__input.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-checked-icon-color);transform:rotate(45deg) scaleY(1)}.el-checkbox__input.is-checked+.el-checkbox__label{color:var(--el-checkbox-checked-text-color)}.el-checkbox__input.is-focus:not(.is-checked) .el-checkbox__original:not(:focus-visible){border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__input.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-checked-icon-color);content:"";display:block;height:2px;left:0;position:absolute;right:0;top:5px;transform:scale(.5)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:after{display:none}.el-checkbox__inner{background-color:var(--el-checkbox-bg-color);border:var(--el-checkbox-input-border);border-radius:var(--el-checkbox-border-radius);box-sizing:border-box;display:inline-block;height:var(--el-checkbox-input-height);position:relative;transition:border-color .25s cubic-bezier(.71,-.46,.29,1.46),background-color .25s cubic-bezier(.71,-.46,.29,1.46),outline .25s cubic-bezier(.71,-.46,.29,1.46);width:var(--el-checkbox-input-width);z-index:var(--el-index-normal)}.el-checkbox__inner:hover{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__inner:after{border:1px solid transparent;border-left:0;border-top:0;box-sizing:content-box;content:"";height:7px;left:4px;position:absolute;top:1px;transform:rotate(45deg) scaleY(0);transform-origin:center;transition:transform .15s ease-in .05s;width:3px}.el-checkbox__original{height:0;margin:0;opacity:0;outline:none;position:absolute;width:0;z-index:-1}.el-checkbox__label{display:inline-block;font-size:var(--el-checkbox-font-size);line-height:1;padding-left:8px}.el-checkbox.el-checkbox--large{height:40px}.el-checkbox.el-checkbox--large .el-checkbox__label{font-size:14px}.el-checkbox.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.el-checkbox--small{height:24px}.el-checkbox.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.el-checkbox--small .el-checkbox__input.is-indeterminate .el-checkbox__inner:before{top:4px}.el-checkbox.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox:last-of-type{margin-right:0}.el-radio-group{align-items:center;display:inline-flex;flex-wrap:wrap;font-size:0}.el-radio-button{--el-radio-button-checked-bg-color:var(--el-color-primary);--el-radio-button-checked-text-color:var(--el-color-white);--el-radio-button-checked-border-color:var(--el-color-primary);--el-radio-button-disabled-checked-fill:var(--el-border-color-extra-light)}.el-radio-button,.el-radio-button__inner{display:inline-block;outline:none;position:relative}.el-radio-button__inner{-webkit-appearance:none;background:var(--el-button-bg-color,var(--el-fill-color-blank));border:var(--el-border);border-left:0;border-radius:0;box-sizing:border-box;color:var(--el-button-text-color,var(--el-text-color-regular));cursor:pointer;font-size:var(--el-font-size-base);font-weight:var(--el-button-font-weight,var(--el-font-weight-primary));line-height:1;margin:0;padding:8px 15px;text-align:center;transition:var(--el-transition-all);-webkit-user-select:none;user-select:none;vertical-align:middle;white-space:nowrap}.el-radio-button__inner.is-round{padding:8px 15px}.el-radio-button__inner:hover{color:var(--el-color-primary)}.el-radio-button__inner [class*=el-icon-]{line-height:.9}.el-radio-button__inner [class*=el-icon-]+span{margin-left:5px}.el-radio-button:first-child .el-radio-button__inner{border-left:var(--el-border);border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);box-shadow:none!important}.el-radio-button__original-radio{opacity:0;outline:none;position:absolute;z-index:-1}.el-radio-button__original-radio:checked+.el-radio-button__inner{background-color:var(--el-radio-button-checked-bg-color,var(--el-color-primary));border-color:var(--el-radio-button-checked-border-color,var(--el-color-primary));box-shadow:-1px 0 0 0 var(--el-radio-button-checked-border-color,var(--el-color-primary));color:var(--el-radio-button-checked-text-color,var(--el-color-white))}.el-radio-button__original-radio:focus-visible+.el-radio-button__inner{border-left:var(--el-border);border-left-color:var(--el-radio-button-checked-border-color,var(--el-color-primary));border-radius:var(--el-border-radius-base);box-shadow:none;outline:2px solid var(--el-radio-button-checked-border-color);outline-offset:1px;z-index:2}.el-radio-button__original-radio:disabled+.el-radio-button__inner{background-color:var(--el-button-disabled-bg-color,var(--el-fill-color-blank));background-image:none;border-color:var(--el-button-disabled-border-color,var(--el-border-color-light));box-shadow:none;color:var(--el-disabled-text-color);cursor:not-allowed}.el-radio-button__original-radio:disabled:checked+.el-radio-button__inner{background-color:var(--el-radio-button-disabled-checked-fill)}.el-radio-button:last-child .el-radio-button__inner{border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0}.el-radio-button:first-child:last-child .el-radio-button__inner{border-radius:var(--el-border-radius-base)}.el-radio-button--large .el-radio-button__inner{border-radius:0;font-size:var(--el-font-size-base);padding:12px 19px}.el-radio-button--large .el-radio-button__inner.is-round{padding:12px 19px}.el-radio-button--small .el-radio-button__inner{border-radius:0;font-size:12px;padding:5px 11px}.el-radio-button--small .el-radio-button__inner.is-round{padding:5px 11px}.el-drawer{--el-drawer-bg-color:var(--el-dialog-bg-color,var(--el-bg-color));--el-drawer-padding-primary:var(--el-dialog-padding-primary,20px);background-color:var(--el-drawer-bg-color);box-shadow:var(--el-box-shadow-dark);box-sizing:border-box;display:flex;flex-direction:column;overflow:hidden;position:absolute;transition:all var(--el-transition-duration)}.el-drawer .btt,.el-drawer .ltr,.el-drawer .rtl,.el-drawer .ttb{transform:translate(0)}.el-drawer__sr-focus:focus{outline:none!important}.el-drawer__header{align-items:center;color:#72767b;display:flex;margin-bottom:32px;padding:var(--el-drawer-padding-primary);padding-bottom:0}.el-drawer__header>:first-child{flex:1}.el-drawer__title{flex:1;font-size:1rem;line-height:inherit;margin:0}.el-drawer__footer{padding:var(--el-drawer-padding-primary);padding-top:10px;text-align:right}.el-drawer__close-btn{background-color:transparent;border:none;color:inherit;cursor:pointer;display:inline-flex;font-size:var(--el-font-size-extra-large);outline:none}.el-drawer__close-btn:focus i,.el-drawer__close-btn:hover i{color:var(--el-color-primary)}.el-drawer__body{flex:1;overflow:auto;padding:var(--el-drawer-padding-primary)}.el-drawer__body>*{box-sizing:border-box}.el-drawer.ltr,.el-drawer.rtl{bottom:0;height:100%;top:0}.el-drawer.btt,.el-drawer.ttb{left:0;right:0;width:100%}.el-drawer.ltr{left:0}.el-drawer.rtl{right:0}.el-drawer.ttb{top:0}.el-drawer.btt{bottom:0}.el-drawer-fade-enter-active,.el-drawer-fade-leave-active{transition:all var(--el-transition-duration)}.el-drawer-fade-enter-active,.el-drawer-fade-enter-from,.el-drawer-fade-enter-to,.el-drawer-fade-leave-active,.el-drawer-fade-leave-from,.el-drawer-fade-leave-to{overflow:hidden!important}.el-drawer-fade-enter-from,.el-drawer-fade-leave-to{opacity:0}.el-drawer-fade-enter-to,.el-drawer-fade-leave-from{opacity:1}.el-drawer-fade-enter-from .rtl,.el-drawer-fade-leave-to .rtl{transform:translate(100%)}.el-drawer-fade-enter-from .ltr,.el-drawer-fade-leave-to .ltr{transform:translate(-100%)}.el-drawer-fade-enter-from .ttb,.el-drawer-fade-leave-to .ttb{transform:translateY(-100%)}.el-drawer-fade-enter-from .btt,.el-drawer-fade-leave-to .btt{transform:translateY(100%)}.handle-button[data-v-dacedd06]{width:48px;height:48px;background-color:var(--el-color-primary);position:fixed;top:60px;right:0;border-radius:6px 0 0 6px;z-index:1000;cursor:pointer;pointer-events:auto;color:#fff;display:flex;align-items:center;justify-content:center}.el-switch{--el-switch-on-color:var(--el-color-primary);--el-switch-off-color:var(--el-border-color);align-items:center;display:inline-flex;font-size:14px;height:32px;line-height:20px;position:relative;vertical-align:middle}.el-switch.is-disabled .el-switch__core,.el-switch.is-disabled .el-switch__label{cursor:not-allowed}.el-switch__label{color:var(--el-text-color-primary);cursor:pointer;display:inline-block;font-size:14px;font-weight:500;height:20px;transition:var(--el-transition-duration-fast);vertical-align:middle}.el-switch__label.is-active{color:var(--el-color-primary)}.el-switch__label--left{margin-right:10px}.el-switch__label--right{margin-left:10px}.el-switch__label *{display:inline-block;font-size:14px;line-height:1}.el-switch__label .el-icon{height:inherit}.el-switch__label .el-icon svg{vertical-align:middle}.el-switch__input{height:0;margin:0;opacity:0;position:absolute;width:0}.el-switch__input:focus-visible~.el-switch__core{outline:2px solid var(--el-switch-on-color);outline-offset:1px}.el-switch__core{align-items:center;background:var(--el-switch-off-color);border:1px solid var(--el-switch-border-color,var(--el-switch-off-color));border-radius:10px;box-sizing:border-box;cursor:pointer;display:inline-flex;height:20px;min-width:40px;outline:none;position:relative;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration)}.el-switch__core .el-switch__inner{align-items:center;display:flex;height:16px;justify-content:center;overflow:hidden;padding:0 4px 0 18px;transition:all var(--el-transition-duration);width:100%}.el-switch__core .el-switch__inner .is-icon,.el-switch__core .el-switch__inner .is-text{color:var(--el-color-white);font-size:12px;overflow:hidden;text-overflow:ellipsis;-webkit-user-select:none;user-select:none;white-space:nowrap}.el-switch__core .el-switch__action{align-items:center;background-color:var(--el-color-white);border-radius:var(--el-border-radius-circle);color:var(--el-switch-off-color);display:flex;height:16px;justify-content:center;left:1px;position:absolute;transition:all var(--el-transition-duration);width:16px}.el-switch.is-checked .el-switch__core{background-color:var(--el-switch-on-color);border-color:var(--el-switch-border-color,var(--el-switch-on-color))}.el-switch.is-checked .el-switch__core .el-switch__action{color:var(--el-switch-on-color);left:calc(100% - 17px)}.el-switch.is-checked .el-switch__core .el-switch__inner{padding:0 18px 0 4px}.el-switch.is-disabled{opacity:.6}.el-switch--wide .el-switch__label.el-switch__label--left span{left:10px}.el-switch--wide .el-switch__label.el-switch__label--right span{right:10px}.el-switch .label-fade-enter-from,.el-switch .label-fade-leave-active{opacity:0}.el-switch--large{font-size:14px;height:40px;line-height:24px}.el-switch--large .el-switch__label{font-size:14px;height:24px}.el-switch--large .el-switch__label *{font-size:14px}.el-switch--large .el-switch__core{border-radius:12px;height:24px;min-width:50px}.el-switch--large .el-switch__core .el-switch__inner{height:20px;padding:0 6px 0 22px}.el-switch--large .el-switch__core .el-switch__action{height:20px;width:20px}.el-switch--large.is-checked .el-switch__core .el-switch__action{left:calc(100% - 21px)}.el-switch--large.is-checked .el-switch__core .el-switch__inner{padding:0 22px 0 6px}.el-switch--small{font-size:12px;height:24px;line-height:16px}.el-switch--small .el-switch__label{font-size:12px;height:16px}.el-switch--small .el-switch__label *{font-size:12px}.el-switch--small .el-switch__core{border-radius:8px;height:16px;min-width:30px}.el-switch--small .el-switch__core .el-switch__inner{height:12px;padding:0 2px 0 14px}.el-switch--small .el-switch__core .el-switch__action{height:12px;width:12px}.el-switch--small.is-checked .el-switch__core .el-switch__action{left:calc(100% - 13px)}.el-switch--small.is-checked .el-switch__core .el-switch__inner{padding:0 14px 0 2px} ');

(function (vue, elementPlus, oe, vueDemi, pinia) {
  'use strict';

  var __defProp = Object.defineProperty;
  var __getOwnPropNames = Object.getOwnPropertyNames;
  var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
  var __commonJS = (cb, mod) => function __require() {
    return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports;
  };
  var __publicField = (obj, key, value) => __defNormalProp(obj, typeof key !== "symbol" ? key + "" : key, value);
  var require_main_001 = __commonJS({
    "main-D2SMd04l.js"(exports, module) {
      const be = (e2) => {
        const t2 = GM_getResourceText(e2);
        return GM_addStyle(t2), t2;
      };
      be("element-plus/dist/index.css");
      const _ge = class _ge {
        observe() {
          return new Promise((e2) => {
            new MutationObserver((t2, n2) => {
              const a2 = document.querySelector(_ge.pageEndSelector);
              if (a2) {
                n2.disconnect();
                e2();
              }
            }).observe(document, { childList: true, subtree: true });
          });
        }
      };
      __publicField(_ge, "pageEndSelector", ".layout-Player-userCard > div > div");
      let ge = _ge;
      const ye = (e2, t2, { checkForDefaultPrevented: n2 = true } = {}) => {
        const a2 = (a3) => {
          const o2 = e2 == null ? void 0 : e2(a3);
          if (n2 === false || !o2) {
            return t2 == null ? void 0 : t2(a3);
          }
        };
        return a2;
      };
      var we;
      const ke = typeof window !== "undefined";
      const xe = (e2) => typeof e2 === "string";
      const Se = () => {
      };
      const Ce = ke && ((we = window == null ? void 0 : window.navigator) == null ? void 0 : we.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent);
      function _e(e2) {
        return typeof e2 === "function" ? e2() : vueDemi.unref(e2);
      }
      function Me(e2) {
        return e2;
      }
      function Oe(e2) {
        if (vueDemi.getCurrentScope()) {
          vueDemi.onScopeDispose(e2);
          return true;
        }
        return false;
      }
      function De(e2, t2 = true) {
        if (vueDemi.getCurrentInstance()) vueDemi.onMounted(e2);
        else if (t2) e2();
        else vueDemi.nextTick(e2);
      }
      function Ae(e2, t2, n2 = {}) {
        const { immediate: a2 = true } = n2;
        const o2 = vueDemi.ref(false);
        let r2 = null;
        function l2() {
          if (r2) {
            clearTimeout(r2);
            r2 = null;
          }
        }
        function s2() {
          o2.value = false;
          l2();
        }
        function i2(...n3) {
          l2();
          o2.value = true;
          r2 = setTimeout(() => {
            o2.value = false;
            r2 = null;
            e2(...n3);
          }, _e(t2));
        }
        if (a2) {
          o2.value = true;
          if (ke) i2();
        }
        Oe(s2);
        return { isPending: vueDemi.readonly(o2), start: i2, stop: s2 };
      }
      function Ee(e2) {
        var t2;
        const n2 = _e(e2);
        return (t2 = n2 == null ? void 0 : n2.$el) != null ? t2 : n2;
      }
      const $e = ke ? window : void 0;
      function Le(...e2) {
        let t2;
        let n2;
        let a2;
        let o2;
        if (xe(e2[0]) || Array.isArray(e2[0])) {
          [n2, a2, o2] = e2;
          t2 = $e;
        } else {
          [t2, n2, a2, o2] = e2;
        }
        if (!t2) return Se;
        if (!Array.isArray(n2)) n2 = [n2];
        if (!Array.isArray(a2)) a2 = [a2];
        const r2 = [];
        const l2 = () => {
          r2.forEach((e3) => e3());
          r2.length = 0;
        };
        const s2 = (e3, t3, n3, a3) => {
          e3.addEventListener(t3, n3, a3);
          return () => e3.removeEventListener(t3, n3, a3);
        };
        const i2 = vueDemi.watch(() => [Ee(t2), _e(o2)], ([e3, t3]) => {
          l2();
          if (!e3) return;
          r2.push(...n2.flatMap((n3) => a2.map((a3) => s2(e3, n3, a3, t3))));
        }, { immediate: true, flush: "post" });
        const u2 = () => {
          i2();
          l2();
        };
        Oe(u2);
        return u2;
      }
      let Ie = false;
      function Te(e2, t2, n2 = {}) {
        const { window: a2 = $e, ignore: o2 = [], capture: r2 = true, detectIframe: l2 = false } = n2;
        if (!a2) return;
        if (Ce && !Ie) {
          Ie = true;
          Array.from(a2.document.body.children).forEach((e3) => e3.addEventListener("click", Se));
        }
        let s2 = true;
        const i2 = (e3) => o2.some((t3) => {
          if (typeof t3 === "string") {
            return Array.from(a2.document.querySelectorAll(t3)).some((t4) => t4 === e3.target || e3.composedPath().includes(t4));
          } else {
            const n3 = Ee(t3);
            return n3 && (e3.target === n3 || e3.composedPath().includes(n3));
          }
        });
        const u2 = (n3) => {
          const a3 = Ee(e2);
          if (!a3 || a3 === n3.target || n3.composedPath().includes(a3)) return;
          if (n3.detail === 0) s2 = !i2(n3);
          if (!s2) {
            s2 = true;
            return;
          }
          t2(n3);
        };
        const c2 = [Le(a2, "click", u2, { passive: true, capture: r2 }), Le(a2, "pointerdown", (t3) => {
          const n3 = Ee(e2);
          if (n3) s2 = !t3.composedPath().includes(n3) && !i2(t3);
        }, { passive: true }), l2 && Le(a2, "blur", (n3) => {
          var o3;
          const r3 = Ee(e2);
          if (((o3 = a2.document.activeElement) == null ? void 0 : o3.tagName) === "IFRAME" && !(r3 == null ? void 0 : r3.contains(a2.document.activeElement))) t2(n3);
        })].filter(Boolean);
        const d2 = () => c2.forEach((e3) => e3());
        return d2;
      }
      function Pe(e2, t2 = false) {
        const n2 = vueDemi.ref();
        const a2 = () => n2.value = Boolean(e2());
        a2();
        De(a2, t2);
        return n2;
      }
      const Be = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
      const Re = "__vueuse_ssr_handlers__";
      Be[Re] = Be[Re] || {};
      var Ve = Object.getOwnPropertySymbols;
      var Fe = Object.prototype.hasOwnProperty;
      var je = Object.prototype.propertyIsEnumerable;
      var ze = (e2, t2) => {
        var n2 = {};
        for (var a2 in e2) if (Fe.call(e2, a2) && t2.indexOf(a2) < 0) n2[a2] = e2[a2];
        if (e2 != null && Ve) for (var a2 of Ve(e2)) {
          if (t2.indexOf(a2) < 0 && je.call(e2, a2)) n2[a2] = e2[a2];
        }
        return n2;
      };
      function Ne(e2, t2, n2 = {}) {
        const a2 = n2, { window: o2 = $e } = a2, r2 = ze(a2, ["window"]);
        let l2;
        const s2 = Pe(() => o2 && "ResizeObserver" in o2);
        const i2 = () => {
          if (l2) {
            l2.disconnect();
            l2 = void 0;
          }
        };
        const u2 = vueDemi.watch(() => Ee(e2), (e3) => {
          i2();
          if (s2.value && o2 && e3) {
            l2 = new ResizeObserver(t2);
            l2.observe(e3, r2);
          }
        }, { immediate: true, flush: "post" });
        const c2 = () => {
          i2();
          u2();
        };
        Oe(c2);
        return { isSupported: s2, stop: c2 };
      }
      var He;
      (function(e2) {
        e2["UP"] = "UP";
        e2["RIGHT"] = "RIGHT";
        e2["DOWN"] = "DOWN";
        e2["LEFT"] = "LEFT";
        e2["NONE"] = "NONE";
      })(He || (He = {}));
      var Ye = Object.defineProperty;
      var We = Object.getOwnPropertySymbols;
      var Ue = Object.prototype.hasOwnProperty;
      var Ke = Object.prototype.propertyIsEnumerable;
      var qe = (e2, t2, n2) => t2 in e2 ? Ye(e2, t2, { enumerable: true, configurable: true, writable: true, value: n2 }) : e2[t2] = n2;
      var Ge = (e2, t2) => {
        for (var n2 in t2 || (t2 = {})) if (Ue.call(t2, n2)) qe(e2, n2, t2[n2]);
        if (We) for (var n2 of We(t2)) {
          if (Ke.call(t2, n2)) qe(e2, n2, t2[n2]);
        }
        return e2;
      };
      const Ze = { easeInSine: [0.12, 0, 0.39, 0], easeOutSine: [0.61, 1, 0.88, 1], easeInOutSine: [0.37, 0, 0.63, 1], easeInQuad: [0.11, 0, 0.5, 0], easeOutQuad: [0.5, 1, 0.89, 1], easeInOutQuad: [0.45, 0, 0.55, 1], easeInCubic: [0.32, 0, 0.67, 0], easeOutCubic: [0.33, 1, 0.68, 1], easeInOutCubic: [0.65, 0, 0.35, 1], easeInQuart: [0.5, 0, 0.75, 0], easeOutQuart: [0.25, 1, 0.5, 1], easeInOutQuart: [0.76, 0, 0.24, 1], easeInQuint: [0.64, 0, 0.78, 0], easeOutQuint: [0.22, 1, 0.36, 1], easeInOutQuint: [0.83, 0, 0.17, 1], easeInExpo: [0.7, 0, 0.84, 0], easeOutExpo: [0.16, 1, 0.3, 1], easeInOutExpo: [0.87, 0, 0.13, 1], easeInCirc: [0.55, 0, 1, 0.45], easeOutCirc: [0, 0.55, 0.45, 1], easeInOutCirc: [0.85, 0, 0.15, 1], easeInBack: [0.36, 0, 0.66, -0.56], easeOutBack: [0.34, 1.56, 0.64, 1], easeInOutBack: [0.68, -0.6, 0.32, 1.6] };
      Ge({ linear: Me }, Ze);
      const Je = () => ke && /firefox/i.test(window.navigator.userAgent);
      const Xe = () => {
      };
      const Qe = Object.prototype.hasOwnProperty;
      const et = (e2, t2) => Qe.call(e2, t2);
      const tt = Array.isArray;
      const nt = (e2) => it(e2) === "[object Date]";
      const at = (e2) => typeof e2 === "function";
      const ot = (e2) => typeof e2 === "string";
      const rt = (e2) => e2 !== null && typeof e2 === "object";
      const lt = (e2) => (rt(e2) || at(e2)) && at(e2.then) && at(e2.catch);
      const st = Object.prototype.toString;
      const it = (e2) => st.call(e2);
      const ut = (e2) => {
        const t2 = /* @__PURE__ */ Object.create(null);
        return (n2) => {
          const a2 = t2[n2];
          return a2 || (t2[n2] = e2(n2));
        };
      };
      const ct = /-(\w)/g;
      const dt = ut((e2) => e2.replace(ct, (e3, t2) => t2 ? t2.toUpperCase() : ""));
      const ft = /\B([A-Z])/g;
      const vt = ut((e2) => e2.replace(ft, "-$1").toLowerCase());
      var pt = typeof global == "object" && global && global.Object === Object && global;
      var mt = typeof self == "object" && self && self.Object === Object && self;
      var ht = pt || mt || Function("return this")();
      var bt = ht.Symbol;
      var gt = Object.prototype;
      var yt = gt.hasOwnProperty;
      var wt = gt.toString;
      var kt = bt ? bt.toStringTag : void 0;
      function xt(e2) {
        var t2 = yt.call(e2, kt), n2 = e2[kt];
        try {
          e2[kt] = void 0;
          var a2 = true;
        } catch (e3) {
        }
        var o2 = wt.call(e2);
        if (a2) {
          if (t2) {
            e2[kt] = n2;
          } else {
            delete e2[kt];
          }
        }
        return o2;
      }
      var St = Object.prototype;
      var Ct = St.toString;
      function _t(e2) {
        return Ct.call(e2);
      }
      var Mt = "[object Null]", Ot = "[object Undefined]";
      var Dt = bt ? bt.toStringTag : void 0;
      function At(e2) {
        if (e2 == null) {
          return e2 === void 0 ? Ot : Mt;
        }
        return Dt && Dt in Object(e2) ? xt(e2) : _t(e2);
      }
      function Et(e2) {
        return e2 != null && typeof e2 == "object";
      }
      var $t = "[object Symbol]";
      function Lt(e2) {
        return typeof e2 == "symbol" || Et(e2) && At(e2) == $t;
      }
      function It(e2, t2) {
        var n2 = -1, a2 = e2 == null ? 0 : e2.length, o2 = Array(a2);
        while (++n2 < a2) {
          o2[n2] = t2(e2[n2], n2, e2);
        }
        return o2;
      }
      var Tt = Array.isArray;
      var Pt = 1 / 0;
      var Bt = bt ? bt.prototype : void 0, Rt = Bt ? Bt.toString : void 0;
      function Vt(e2) {
        if (typeof e2 == "string") {
          return e2;
        }
        if (Tt(e2)) {
          return It(e2, Vt) + "";
        }
        if (Lt(e2)) {
          return Rt ? Rt.call(e2) : "";
        }
        var t2 = e2 + "";
        return t2 == "0" && 1 / e2 == -Pt ? "-0" : t2;
      }
      var Ft = /\s/;
      function jt(e2) {
        var t2 = e2.length;
        while (t2-- && Ft.test(e2.charAt(t2))) {
        }
        return t2;
      }
      var zt = /^\s+/;
      function Nt(e2) {
        return e2 ? e2.slice(0, jt(e2) + 1).replace(zt, "") : e2;
      }
      function Ht(e2) {
        var t2 = typeof e2;
        return e2 != null && (t2 == "object" || t2 == "function");
      }
      var Yt = 0 / 0;
      var Wt = /^[-+]0x[0-9a-f]+$/i;
      var Ut = /^0b[01]+$/i;
      var Kt = /^0o[0-7]+$/i;
      var qt = parseInt;
      function Gt(e2) {
        if (typeof e2 == "number") {
          return e2;
        }
        if (Lt(e2)) {
          return Yt;
        }
        if (Ht(e2)) {
          var t2 = typeof e2.valueOf == "function" ? e2.valueOf() : e2;
          e2 = Ht(t2) ? t2 + "" : t2;
        }
        if (typeof e2 != "string") {
          return e2 === 0 ? e2 : +e2;
        }
        e2 = Nt(e2);
        var n2 = Ut.test(e2);
        return n2 || Kt.test(e2) ? qt(e2.slice(2), n2 ? 2 : 8) : Wt.test(e2) ? Yt : +e2;
      }
      function Zt(e2) {
        return e2;
      }
      var Jt = "[object AsyncFunction]", Xt = "[object Function]", Qt = "[object GeneratorFunction]", en = "[object Proxy]";
      function tn(e2) {
        if (!Ht(e2)) {
          return false;
        }
        var t2 = At(e2);
        return t2 == Xt || t2 == Qt || t2 == Jt || t2 == en;
      }
      var nn = ht["__core-js_shared__"];
      var an = function() {
        var e2 = /[^.]+$/.exec(nn && nn.keys && nn.keys.IE_PROTO || "");
        return e2 ? "Symbol(src)_1." + e2 : "";
      }();
      function on(e2) {
        return !!an && an in e2;
      }
      var rn = Function.prototype;
      var ln = rn.toString;
      function sn(e2) {
        if (e2 != null) {
          try {
            return ln.call(e2);
          } catch (e3) {
          }
          try {
            return e2 + "";
          } catch (e3) {
          }
        }
        return "";
      }
      var un = /[\\^$.*+?()[\]{}|]/g;
      var cn = /^\[object .+?Constructor\]$/;
      var dn = Function.prototype, fn = Object.prototype;
      var vn = dn.toString;
      var pn = fn.hasOwnProperty;
      var mn = RegExp("^" + vn.call(pn).replace(un, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$");
      function hn(e2) {
        if (!Ht(e2) || on(e2)) {
          return false;
        }
        var t2 = tn(e2) ? mn : cn;
        return t2.test(sn(e2));
      }
      function bn(e2, t2) {
        return e2 == null ? void 0 : e2[t2];
      }
      function gn(e2, t2) {
        var n2 = bn(e2, t2);
        return hn(n2) ? n2 : void 0;
      }
      var yn = gn(ht, "WeakMap");
      function wn(e2, t2, n2) {
        switch (n2.length) {
          case 0:
            return e2.call(t2);
          case 1:
            return e2.call(t2, n2[0]);
          case 2:
            return e2.call(t2, n2[0], n2[1]);
          case 3:
            return e2.call(t2, n2[0], n2[1], n2[2]);
        }
        return e2.apply(t2, n2);
      }
      var kn = 800, xn = 16;
      var Sn = Date.now;
      function Cn(e2) {
        var t2 = 0, n2 = 0;
        return function() {
          var a2 = Sn(), o2 = xn - (a2 - n2);
          n2 = a2;
          if (o2 > 0) {
            if (++t2 >= kn) {
              return arguments[0];
            }
          } else {
            t2 = 0;
          }
          return e2.apply(void 0, arguments);
        };
      }
      function _n(e2) {
        return function() {
          return e2;
        };
      }
      var Mn = function() {
        try {
          var e2 = gn(Object, "defineProperty");
          e2({}, "", {});
          return e2;
        } catch (e3) {
        }
      }();
      var On = !Mn ? Zt : function(e2, t2) {
        return Mn(e2, "toString", { configurable: true, enumerable: false, value: _n(t2), writable: true });
      };
      var Dn = Cn(On);
      var An = 9007199254740991;
      var En = /^(?:0|[1-9]\d*)$/;
      function $n(e2, t2) {
        var n2 = typeof e2;
        t2 = t2 == null ? An : t2;
        return !!t2 && (n2 == "number" || n2 != "symbol" && En.test(e2)) && (e2 > -1 && e2 % 1 == 0 && e2 < t2);
      }
      function Ln(e2, t2, n2) {
        if (t2 == "__proto__" && Mn) {
          Mn(e2, t2, { configurable: true, enumerable: true, value: n2, writable: true });
        } else {
          e2[t2] = n2;
        }
      }
      function In(e2, t2) {
        return e2 === t2 || e2 !== e2 && t2 !== t2;
      }
      var Tn = Object.prototype;
      var Pn = Tn.hasOwnProperty;
      function Bn(e2, t2, n2) {
        var a2 = e2[t2];
        if (!(Pn.call(e2, t2) && In(a2, n2)) || n2 === void 0 && !(t2 in e2)) {
          Ln(e2, t2, n2);
        }
      }
      var Rn = Math.max;
      function Vn(e2, t2, n2) {
        t2 = Rn(t2 === void 0 ? e2.length - 1 : t2, 0);
        return function() {
          var a2 = arguments, o2 = -1, r2 = Rn(a2.length - t2, 0), l2 = Array(r2);
          while (++o2 < r2) {
            l2[o2] = a2[t2 + o2];
          }
          o2 = -1;
          var s2 = Array(t2 + 1);
          while (++o2 < t2) {
            s2[o2] = a2[o2];
          }
          s2[t2] = n2(l2);
          return wn(e2, this, s2);
        };
      }
      var Fn = 9007199254740991;
      function jn(e2) {
        return typeof e2 == "number" && e2 > -1 && e2 % 1 == 0 && e2 <= Fn;
      }
      function zn(e2) {
        return e2 != null && jn(e2.length) && !tn(e2);
      }
      var Nn = Object.prototype;
      function Hn(e2) {
        var t2 = e2 && e2.constructor, n2 = typeof t2 == "function" && t2.prototype || Nn;
        return e2 === n2;
      }
      function Yn(e2, t2) {
        var n2 = -1, a2 = Array(e2);
        while (++n2 < e2) {
          a2[n2] = t2(n2);
        }
        return a2;
      }
      var Wn = "[object Arguments]";
      function Un(e2) {
        return Et(e2) && At(e2) == Wn;
      }
      var Kn = Object.prototype;
      var qn = Kn.hasOwnProperty;
      var Gn = Kn.propertyIsEnumerable;
      var Zn = Un(/* @__PURE__ */ function() {
        return arguments;
      }()) ? Un : function(e2) {
        return Et(e2) && qn.call(e2, "callee") && !Gn.call(e2, "callee");
      };
      function Jn() {
        return false;
      }
      var Xn = typeof exports == "object" && exports && !exports.nodeType && exports;
      var Qn = Xn && typeof module == "object" && module && !module.nodeType && module;
      var ea = Qn && Qn.exports === Xn;
      var ta = ea ? ht.Buffer : void 0;
      var na = ta ? ta.isBuffer : void 0;
      var aa = na || Jn;
      var oa = "[object Arguments]", ra = "[object Array]", la = "[object Boolean]", sa = "[object Date]", ia = "[object Error]", ua = "[object Function]", ca = "[object Map]", da = "[object Number]", fa = "[object Object]", va = "[object RegExp]", pa = "[object Set]", ma = "[object String]", ha = "[object WeakMap]";
      var ba = "[object ArrayBuffer]", ga = "[object DataView]", ya = "[object Float32Array]", wa = "[object Float64Array]", ka = "[object Int8Array]", xa = "[object Int16Array]", Sa = "[object Int32Array]", Ca = "[object Uint8Array]", _a = "[object Uint8ClampedArray]", Ma = "[object Uint16Array]", Oa = "[object Uint32Array]";
      var Da = {};
      Da[ya] = Da[wa] = Da[ka] = Da[xa] = Da[Sa] = Da[Ca] = Da[_a] = Da[Ma] = Da[Oa] = true;
      Da[oa] = Da[ra] = Da[ba] = Da[la] = Da[ga] = Da[sa] = Da[ia] = Da[ua] = Da[ca] = Da[da] = Da[fa] = Da[va] = Da[pa] = Da[ma] = Da[ha] = false;
      function Aa(e2) {
        return Et(e2) && jn(e2.length) && !!Da[At(e2)];
      }
      function Ea(e2) {
        return function(t2) {
          return e2(t2);
        };
      }
      var $a = typeof exports == "object" && exports && !exports.nodeType && exports;
      var La = $a && typeof module == "object" && module && !module.nodeType && module;
      var Ia = La && La.exports === $a;
      var Ta = Ia && pt.process;
      var Pa = function() {
        try {
          var e2 = La && La.require && La.require("util").types;
          if (e2) {
            return e2;
          }
          return Ta && Ta.binding && Ta.binding("util");
        } catch (e3) {
        }
      }();
      var Ba = Pa && Pa.isTypedArray;
      var Ra = Ba ? Ea(Ba) : Aa;
      var Va = Object.prototype;
      var Fa = Va.hasOwnProperty;
      function ja(e2, t2) {
        var n2 = Tt(e2), a2 = !n2 && Zn(e2), o2 = !n2 && !a2 && aa(e2), r2 = !n2 && !a2 && !o2 && Ra(e2), l2 = n2 || a2 || o2 || r2, s2 = l2 ? Yn(e2.length, String) : [], i2 = s2.length;
        for (var u2 in e2) {
          if (Fa.call(e2, u2) && !(l2 && (u2 == "length" || o2 && (u2 == "offset" || u2 == "parent") || r2 && (u2 == "buffer" || u2 == "byteLength" || u2 == "byteOffset") || $n(u2, i2)))) {
            s2.push(u2);
          }
        }
        return s2;
      }
      function za(e2, t2) {
        return function(n2) {
          return e2(t2(n2));
        };
      }
      var Na = za(Object.keys, Object);
      var Ha = Object.prototype;
      var Ya = Ha.hasOwnProperty;
      function Wa(e2) {
        if (!Hn(e2)) {
          return Na(e2);
        }
        var t2 = [];
        for (var n2 in Object(e2)) {
          if (Ya.call(e2, n2) && n2 != "constructor") {
            t2.push(n2);
          }
        }
        return t2;
      }
      function Ua(e2) {
        return zn(e2) ? ja(e2) : Wa(e2);
      }
      var Ka = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, qa = /^\w*$/;
      function Ga(e2, t2) {
        if (Tt(e2)) {
          return false;
        }
        var n2 = typeof e2;
        if (n2 == "number" || n2 == "symbol" || n2 == "boolean" || e2 == null || Lt(e2)) {
          return true;
        }
        return qa.test(e2) || !Ka.test(e2) || t2 != null && e2 in Object(t2);
      }
      var Za = gn(Object, "create");
      function Ja() {
        this.__data__ = Za ? Za(null) : {};
        this.size = 0;
      }
      function Xa(e2) {
        var t2 = this.has(e2) && delete this.__data__[e2];
        this.size -= t2 ? 1 : 0;
        return t2;
      }
      var Qa = "__lodash_hash_undefined__";
      var eo = Object.prototype;
      var to = eo.hasOwnProperty;
      function no(e2) {
        var t2 = this.__data__;
        if (Za) {
          var n2 = t2[e2];
          return n2 === Qa ? void 0 : n2;
        }
        return to.call(t2, e2) ? t2[e2] : void 0;
      }
      var ao = Object.prototype;
      var oo = ao.hasOwnProperty;
      function ro(e2) {
        var t2 = this.__data__;
        return Za ? t2[e2] !== void 0 : oo.call(t2, e2);
      }
      var lo = "__lodash_hash_undefined__";
      function so(e2, t2) {
        var n2 = this.__data__;
        this.size += this.has(e2) ? 0 : 1;
        n2[e2] = Za && t2 === void 0 ? lo : t2;
        return this;
      }
      function io(e2) {
        var t2 = -1, n2 = e2 == null ? 0 : e2.length;
        this.clear();
        while (++t2 < n2) {
          var a2 = e2[t2];
          this.set(a2[0], a2[1]);
        }
      }
      io.prototype.clear = Ja;
      io.prototype["delete"] = Xa;
      io.prototype.get = no;
      io.prototype.has = ro;
      io.prototype.set = so;
      function uo() {
        this.__data__ = [];
        this.size = 0;
      }
      function co(e2, t2) {
        var n2 = e2.length;
        while (n2--) {
          if (In(e2[n2][0], t2)) {
            return n2;
          }
        }
        return -1;
      }
      var fo = Array.prototype;
      var vo = fo.splice;
      function po(e2) {
        var t2 = this.__data__, n2 = co(t2, e2);
        if (n2 < 0) {
          return false;
        }
        var a2 = t2.length - 1;
        if (n2 == a2) {
          t2.pop();
        } else {
          vo.call(t2, n2, 1);
        }
        --this.size;
        return true;
      }
      function mo(e2) {
        var t2 = this.__data__, n2 = co(t2, e2);
        return n2 < 0 ? void 0 : t2[n2][1];
      }
      function ho(e2) {
        return co(this.__data__, e2) > -1;
      }
      function bo(e2, t2) {
        var n2 = this.__data__, a2 = co(n2, e2);
        if (a2 < 0) {
          ++this.size;
          n2.push([e2, t2]);
        } else {
          n2[a2][1] = t2;
        }
        return this;
      }
      function go(e2) {
        var t2 = -1, n2 = e2 == null ? 0 : e2.length;
        this.clear();
        while (++t2 < n2) {
          var a2 = e2[t2];
          this.set(a2[0], a2[1]);
        }
      }
      go.prototype.clear = uo;
      go.prototype["delete"] = po;
      go.prototype.get = mo;
      go.prototype.has = ho;
      go.prototype.set = bo;
      var yo = gn(ht, "Map");
      function wo() {
        this.size = 0;
        this.__data__ = { hash: new io(), map: new (yo || go)(), string: new io() };
      }
      function ko(e2) {
        var t2 = typeof e2;
        return t2 == "string" || t2 == "number" || t2 == "symbol" || t2 == "boolean" ? e2 !== "__proto__" : e2 === null;
      }
      function xo(e2, t2) {
        var n2 = e2.__data__;
        return ko(t2) ? n2[typeof t2 == "string" ? "string" : "hash"] : n2.map;
      }
      function So(e2) {
        var t2 = xo(this, e2)["delete"](e2);
        this.size -= t2 ? 1 : 0;
        return t2;
      }
      function Co(e2) {
        return xo(this, e2).get(e2);
      }
      function _o(e2) {
        return xo(this, e2).has(e2);
      }
      function Mo(e2, t2) {
        var n2 = xo(this, e2), a2 = n2.size;
        n2.set(e2, t2);
        this.size += n2.size == a2 ? 0 : 1;
        return this;
      }
      function Oo(e2) {
        var t2 = -1, n2 = e2 == null ? 0 : e2.length;
        this.clear();
        while (++t2 < n2) {
          var a2 = e2[t2];
          this.set(a2[0], a2[1]);
        }
      }
      Oo.prototype.clear = wo;
      Oo.prototype["delete"] = So;
      Oo.prototype.get = Co;
      Oo.prototype.has = _o;
      Oo.prototype.set = Mo;
      var Do = "Expected a function";
      function Ao(e2, t2) {
        if (typeof e2 != "function" || t2 != null && typeof t2 != "function") {
          throw new TypeError(Do);
        }
        var n2 = function() {
          var a2 = arguments, o2 = t2 ? t2.apply(this, a2) : a2[0], r2 = n2.cache;
          if (r2.has(o2)) {
            return r2.get(o2);
          }
          var l2 = e2.apply(this, a2);
          n2.cache = r2.set(o2, l2) || r2;
          return l2;
        };
        n2.cache = new (Ao.Cache || Oo)();
        return n2;
      }
      Ao.Cache = Oo;
      var Eo = 500;
      function $o(e2) {
        var t2 = Ao(e2, function(e3) {
          if (n2.size === Eo) {
            n2.clear();
          }
          return e3;
        });
        var n2 = t2.cache;
        return t2;
      }
      var Lo = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
      var Io = /\\(\\)?/g;
      var To = $o(function(e2) {
        var t2 = [];
        if (e2.charCodeAt(0) === 46) {
          t2.push("");
        }
        e2.replace(Lo, function(e3, n2, a2, o2) {
          t2.push(a2 ? o2.replace(Io, "$1") : n2 || e3);
        });
        return t2;
      });
      function Po(e2) {
        return e2 == null ? "" : Vt(e2);
      }
      function Bo(e2, t2) {
        if (Tt(e2)) {
          return e2;
        }
        return Ga(e2, t2) ? [e2] : To(Po(e2));
      }
      var Ro = 1 / 0;
      function Vo(e2) {
        if (typeof e2 == "string" || Lt(e2)) {
          return e2;
        }
        var t2 = e2 + "";
        return t2 == "0" && 1 / e2 == -Ro ? "-0" : t2;
      }
      function Fo(e2, t2) {
        t2 = Bo(t2, e2);
        var n2 = 0, a2 = t2.length;
        while (e2 != null && n2 < a2) {
          e2 = e2[Vo(t2[n2++])];
        }
        return n2 && n2 == a2 ? e2 : void 0;
      }
      function jo(e2, t2, n2) {
        var a2 = e2 == null ? void 0 : Fo(e2, t2);
        return a2 === void 0 ? n2 : a2;
      }
      function zo(e2, t2) {
        var n2 = -1, a2 = t2.length, o2 = e2.length;
        while (++n2 < a2) {
          e2[o2 + n2] = t2[n2];
        }
        return e2;
      }
      var No = bt ? bt.isConcatSpreadable : void 0;
      function Ho(e2) {
        return Tt(e2) || Zn(e2) || !!(No && e2 && e2[No]);
      }
      function Yo(e2, t2, n2, a2, o2) {
        var r2 = -1, l2 = e2.length;
        n2 || (n2 = Ho);
        o2 || (o2 = []);
        while (++r2 < l2) {
          var s2 = e2[r2];
          if (n2(s2)) {
            {
              zo(o2, s2);
            }
          } else {
            o2[o2.length] = s2;
          }
        }
        return o2;
      }
      function Wo(e2) {
        var t2 = e2 == null ? 0 : e2.length;
        return t2 ? Yo(e2) : [];
      }
      function Uo(e2) {
        return Dn(Vn(e2, void 0, Wo), e2 + "");
      }
      function Ko() {
        this.__data__ = new go();
        this.size = 0;
      }
      function qo(e2) {
        var t2 = this.__data__, n2 = t2["delete"](e2);
        this.size = t2.size;
        return n2;
      }
      function Go(e2) {
        return this.__data__.get(e2);
      }
      function Zo(e2) {
        return this.__data__.has(e2);
      }
      var Jo = 200;
      function Xo(e2, t2) {
        var n2 = this.__data__;
        if (n2 instanceof go) {
          var a2 = n2.__data__;
          if (!yo || a2.length < Jo - 1) {
            a2.push([e2, t2]);
            this.size = ++n2.size;
            return this;
          }
          n2 = this.__data__ = new Oo(a2);
        }
        n2.set(e2, t2);
        this.size = n2.size;
        return this;
      }
      function Qo(e2) {
        var t2 = this.__data__ = new go(e2);
        this.size = t2.size;
      }
      Qo.prototype.clear = Ko;
      Qo.prototype["delete"] = qo;
      Qo.prototype.get = Go;
      Qo.prototype.has = Zo;
      Qo.prototype.set = Xo;
      function er(e2, t2) {
        var n2 = -1, a2 = e2 == null ? 0 : e2.length, o2 = 0, r2 = [];
        while (++n2 < a2) {
          var l2 = e2[n2];
          if (t2(l2, n2, e2)) {
            r2[o2++] = l2;
          }
        }
        return r2;
      }
      function tr() {
        return [];
      }
      var nr = Object.prototype;
      var ar = nr.propertyIsEnumerable;
      var or = Object.getOwnPropertySymbols;
      var rr = !or ? tr : function(e2) {
        if (e2 == null) {
          return [];
        }
        e2 = Object(e2);
        return er(or(e2), function(t2) {
          return ar.call(e2, t2);
        });
      };
      function lr(e2, t2, n2) {
        var a2 = t2(e2);
        return Tt(e2) ? a2 : zo(a2, n2(e2));
      }
      function sr(e2) {
        return lr(e2, Ua, rr);
      }
      var ir = gn(ht, "DataView");
      var ur = gn(ht, "Promise");
      var cr = gn(ht, "Set");
      var dr = "[object Map]", fr = "[object Object]", vr = "[object Promise]", pr = "[object Set]", mr = "[object WeakMap]";
      var hr = "[object DataView]";
      var br = sn(ir), gr = sn(yo), yr = sn(ur), wr = sn(cr), kr = sn(yn);
      var xr = At;
      if (ir && xr(new ir(new ArrayBuffer(1))) != hr || yo && xr(new yo()) != dr || ur && xr(ur.resolve()) != vr || cr && xr(new cr()) != pr || yn && xr(new yn()) != mr) {
        xr = function(e2) {
          var t2 = At(e2), n2 = t2 == fr ? e2.constructor : void 0, a2 = n2 ? sn(n2) : "";
          if (a2) {
            switch (a2) {
              case br:
                return hr;
              case gr:
                return dr;
              case yr:
                return vr;
              case wr:
                return pr;
              case kr:
                return mr;
            }
          }
          return t2;
        };
      }
      var Sr = ht.Uint8Array;
      var Cr = "__lodash_hash_undefined__";
      function _r(e2) {
        this.__data__.set(e2, Cr);
        return this;
      }
      function Mr(e2) {
        return this.__data__.has(e2);
      }
      function Or(e2) {
        var t2 = -1, n2 = e2 == null ? 0 : e2.length;
        this.__data__ = new Oo();
        while (++t2 < n2) {
          this.add(e2[t2]);
        }
      }
      Or.prototype.add = Or.prototype.push = _r;
      Or.prototype.has = Mr;
      function Dr(e2, t2) {
        var n2 = -1, a2 = e2 == null ? 0 : e2.length;
        while (++n2 < a2) {
          if (t2(e2[n2], n2, e2)) {
            return true;
          }
        }
        return false;
      }
      function Ar(e2, t2) {
        return e2.has(t2);
      }
      var Er = 1, $r = 2;
      function Lr(e2, t2, n2, a2, o2, r2) {
        var l2 = n2 & Er, s2 = e2.length, i2 = t2.length;
        if (s2 != i2 && !(l2 && i2 > s2)) {
          return false;
        }
        var u2 = r2.get(e2);
        var c2 = r2.get(t2);
        if (u2 && c2) {
          return u2 == t2 && c2 == e2;
        }
        var d2 = -1, f2 = true, v2 = n2 & $r ? new Or() : void 0;
        r2.set(e2, t2);
        r2.set(t2, e2);
        while (++d2 < s2) {
          var p2 = e2[d2], m2 = t2[d2];
          if (a2) {
            var h2 = l2 ? a2(m2, p2, d2, t2, e2, r2) : a2(p2, m2, d2, e2, t2, r2);
          }
          if (h2 !== void 0) {
            if (h2) {
              continue;
            }
            f2 = false;
            break;
          }
          if (v2) {
            if (!Dr(t2, function(e3, t3) {
              if (!Ar(v2, t3) && (p2 === e3 || o2(p2, e3, n2, a2, r2))) {
                return v2.push(t3);
              }
            })) {
              f2 = false;
              break;
            }
          } else if (!(p2 === m2 || o2(p2, m2, n2, a2, r2))) {
            f2 = false;
            break;
          }
        }
        r2["delete"](e2);
        r2["delete"](t2);
        return f2;
      }
      function Ir(e2) {
        var t2 = -1, n2 = Array(e2.size);
        e2.forEach(function(e3, a2) {
          n2[++t2] = [a2, e3];
        });
        return n2;
      }
      function Tr(e2) {
        var t2 = -1, n2 = Array(e2.size);
        e2.forEach(function(e3) {
          n2[++t2] = e3;
        });
        return n2;
      }
      var Pr = 1, Br = 2;
      var Rr = "[object Boolean]", Vr = "[object Date]", Fr = "[object Error]", jr = "[object Map]", zr = "[object Number]", Nr = "[object RegExp]", Hr = "[object Set]", Yr = "[object String]", Wr = "[object Symbol]";
      var Ur = "[object ArrayBuffer]", Kr = "[object DataView]";
      var qr = bt ? bt.prototype : void 0, Gr = qr ? qr.valueOf : void 0;
      function Zr(e2, t2, n2, a2, o2, r2, l2) {
        switch (n2) {
          case Kr:
            if (e2.byteLength != t2.byteLength || e2.byteOffset != t2.byteOffset) {
              return false;
            }
            e2 = e2.buffer;
            t2 = t2.buffer;
          case Ur:
            if (e2.byteLength != t2.byteLength || !r2(new Sr(e2), new Sr(t2))) {
              return false;
            }
            return true;
          case Rr:
          case Vr:
          case zr:
            return In(+e2, +t2);
          case Fr:
            return e2.name == t2.name && e2.message == t2.message;
          case Nr:
          case Yr:
            return e2 == t2 + "";
          case jr:
            var s2 = Ir;
          case Hr:
            var i2 = a2 & Pr;
            s2 || (s2 = Tr);
            if (e2.size != t2.size && !i2) {
              return false;
            }
            var u2 = l2.get(e2);
            if (u2) {
              return u2 == t2;
            }
            a2 |= Br;
            l2.set(e2, t2);
            var c2 = Lr(s2(e2), s2(t2), a2, o2, r2, l2);
            l2["delete"](e2);
            return c2;
          case Wr:
            if (Gr) {
              return Gr.call(e2) == Gr.call(t2);
            }
        }
        return false;
      }
      var Jr = 1;
      var Xr = Object.prototype;
      var Qr = Xr.hasOwnProperty;
      function el(e2, t2, n2, a2, o2, r2) {
        var l2 = n2 & Jr, s2 = sr(e2), i2 = s2.length, u2 = sr(t2), c2 = u2.length;
        if (i2 != c2 && !l2) {
          return false;
        }
        var d2 = i2;
        while (d2--) {
          var f2 = s2[d2];
          if (!(l2 ? f2 in t2 : Qr.call(t2, f2))) {
            return false;
          }
        }
        var v2 = r2.get(e2);
        var p2 = r2.get(t2);
        if (v2 && p2) {
          return v2 == t2 && p2 == e2;
        }
        var m2 = true;
        r2.set(e2, t2);
        r2.set(t2, e2);
        var h2 = l2;
        while (++d2 < i2) {
          f2 = s2[d2];
          var b2 = e2[f2], g2 = t2[f2];
          if (a2) {
            var y2 = l2 ? a2(g2, b2, f2, t2, e2, r2) : a2(b2, g2, f2, e2, t2, r2);
          }
          if (!(y2 === void 0 ? b2 === g2 || o2(b2, g2, n2, a2, r2) : y2)) {
            m2 = false;
            break;
          }
          h2 || (h2 = f2 == "constructor");
        }
        if (m2 && !h2) {
          var w2 = e2.constructor, k2 = t2.constructor;
          if (w2 != k2 && ("constructor" in e2 && "constructor" in t2) && !(typeof w2 == "function" && w2 instanceof w2 && typeof k2 == "function" && k2 instanceof k2)) {
            m2 = false;
          }
        }
        r2["delete"](e2);
        r2["delete"](t2);
        return m2;
      }
      var tl = 1;
      var nl = "[object Arguments]", al = "[object Array]", ol = "[object Object]";
      var rl = Object.prototype;
      var ll = rl.hasOwnProperty;
      function sl(e2, t2, n2, a2, o2, r2) {
        var l2 = Tt(e2), s2 = Tt(t2), i2 = l2 ? al : xr(e2), u2 = s2 ? al : xr(t2);
        i2 = i2 == nl ? ol : i2;
        u2 = u2 == nl ? ol : u2;
        var c2 = i2 == ol, d2 = u2 == ol, f2 = i2 == u2;
        if (f2 && aa(e2)) {
          if (!aa(t2)) {
            return false;
          }
          l2 = true;
          c2 = false;
        }
        if (f2 && !c2) {
          r2 || (r2 = new Qo());
          return l2 || Ra(e2) ? Lr(e2, t2, n2, a2, o2, r2) : Zr(e2, t2, i2, n2, a2, o2, r2);
        }
        if (!(n2 & tl)) {
          var v2 = c2 && ll.call(e2, "__wrapped__"), p2 = d2 && ll.call(t2, "__wrapped__");
          if (v2 || p2) {
            var m2 = v2 ? e2.value() : e2, h2 = p2 ? t2.value() : t2;
            r2 || (r2 = new Qo());
            return o2(m2, h2, n2, a2, r2);
          }
        }
        if (!f2) {
          return false;
        }
        r2 || (r2 = new Qo());
        return el(e2, t2, n2, a2, o2, r2);
      }
      function il(e2, t2, n2, a2, o2) {
        if (e2 === t2) {
          return true;
        }
        if (e2 == null || t2 == null || !Et(e2) && !Et(t2)) {
          return e2 !== e2 && t2 !== t2;
        }
        return sl(e2, t2, n2, a2, il, o2);
      }
      function ul(e2, t2) {
        return e2 != null && t2 in Object(e2);
      }
      function cl(e2, t2, n2) {
        t2 = Bo(t2, e2);
        var a2 = -1, o2 = t2.length, r2 = false;
        while (++a2 < o2) {
          var l2 = Vo(t2[a2]);
          if (!(r2 = e2 != null && n2(e2, l2))) {
            break;
          }
          e2 = e2[l2];
        }
        if (r2 || ++a2 != o2) {
          return r2;
        }
        o2 = e2 == null ? 0 : e2.length;
        return !!o2 && jn(o2) && $n(l2, o2) && (Tt(e2) || Zn(e2));
      }
      function dl(e2, t2) {
        return e2 != null && cl(e2, t2, ul);
      }
      var fl = function() {
        return ht.Date.now();
      };
      var vl = "Expected a function";
      var pl = Math.max, ml = Math.min;
      function hl(e2, t2, n2) {
        var a2, o2, r2, l2, s2, i2, u2 = 0, c2 = false, d2 = false, f2 = true;
        if (typeof e2 != "function") {
          throw new TypeError(vl);
        }
        t2 = Gt(t2) || 0;
        if (Ht(n2)) {
          c2 = !!n2.leading;
          d2 = "maxWait" in n2;
          r2 = d2 ? pl(Gt(n2.maxWait) || 0, t2) : r2;
          f2 = "trailing" in n2 ? !!n2.trailing : f2;
        }
        function v2(t3) {
          var n3 = a2, r3 = o2;
          a2 = o2 = void 0;
          u2 = t3;
          l2 = e2.apply(r3, n3);
          return l2;
        }
        function p2(e3) {
          u2 = e3;
          s2 = setTimeout(b2, t2);
          return c2 ? v2(e3) : l2;
        }
        function m2(e3) {
          var n3 = e3 - i2, a3 = e3 - u2, o3 = t2 - n3;
          return d2 ? ml(o3, r2 - a3) : o3;
        }
        function h2(e3) {
          var n3 = e3 - i2, a3 = e3 - u2;
          return i2 === void 0 || n3 >= t2 || n3 < 0 || d2 && a3 >= r2;
        }
        function b2() {
          var e3 = fl();
          if (h2(e3)) {
            return g2(e3);
          }
          s2 = setTimeout(b2, m2(e3));
        }
        function g2(e3) {
          s2 = void 0;
          if (f2 && a2) {
            return v2(e3);
          }
          a2 = o2 = void 0;
          return l2;
        }
        function y2() {
          if (s2 !== void 0) {
            clearTimeout(s2);
          }
          u2 = 0;
          a2 = i2 = o2 = s2 = void 0;
        }
        function w2() {
          return s2 === void 0 ? l2 : g2(fl());
        }
        function k2() {
          var e3 = fl(), n3 = h2(e3);
          a2 = arguments;
          o2 = this;
          i2 = e3;
          if (n3) {
            if (s2 === void 0) {
              return p2(i2);
            }
            if (d2) {
              clearTimeout(s2);
              s2 = setTimeout(b2, t2);
              return v2(i2);
            }
          }
          if (s2 === void 0) {
            s2 = setTimeout(b2, t2);
          }
          return l2;
        }
        k2.cancel = y2;
        k2.flush = w2;
        return k2;
      }
      function bl(e2) {
        var t2 = -1, n2 = e2 == null ? 0 : e2.length, a2 = {};
        while (++t2 < n2) {
          var o2 = e2[t2];
          a2[o2[0]] = o2[1];
        }
        return a2;
      }
      function gl(e2, t2) {
        return il(e2, t2);
      }
      function yl(e2) {
        return e2 == null;
      }
      function wl(e2) {
        return e2 === void 0;
      }
      function kl(e2, t2, n2, a2) {
        if (!Ht(e2)) {
          return e2;
        }
        t2 = Bo(t2, e2);
        var o2 = -1, r2 = t2.length, l2 = r2 - 1, s2 = e2;
        while (s2 != null && ++o2 < r2) {
          var i2 = Vo(t2[o2]), u2 = n2;
          if (i2 === "__proto__" || i2 === "constructor" || i2 === "prototype") {
            return e2;
          }
          if (o2 != l2) {
            var c2 = s2[i2];
            u2 = void 0;
            if (u2 === void 0) {
              u2 = Ht(c2) ? c2 : $n(t2[o2 + 1]) ? [] : {};
            }
          }
          Bn(s2, i2, u2);
          s2 = s2[i2];
        }
        return e2;
      }
      function xl(e2, t2, n2) {
        var a2 = -1, o2 = t2.length, r2 = {};
        while (++a2 < o2) {
          var l2 = t2[a2], s2 = Fo(e2, l2);
          if (n2(s2, l2)) {
            kl(r2, Bo(l2, e2), s2);
          }
        }
        return r2;
      }
      function Sl(e2, t2) {
        return xl(e2, t2, function(t3, n2) {
          return dl(e2, n2);
        });
      }
      var Cl = Uo(function(e2, t2) {
        return e2 == null ? {} : Sl(e2, t2);
      });
      const _l = (e2) => e2 === void 0;
      const Ml = (e2) => typeof e2 === "boolean";
      const Ol = (e2) => typeof e2 === "number";
      const Dl = (e2) => !e2 && e2 !== 0 || tt(e2) && e2.length === 0 || rt(e2) && !Object.keys(e2).length;
      const Al = (e2) => {
        if (typeof Element === "undefined") return false;
        return e2 instanceof Element;
      };
      const El = (e2) => yl(e2);
      const $l = (e2) => {
        if (!ot(e2)) {
          return false;
        }
        return !Number.isNaN(Number(e2));
      };
      const Ll = (e2) => Object.keys(e2);
      class Il extends Error {
        constructor(e2) {
          super(e2);
          this.name = "ElementPlusError";
        }
      }
      function Tl(e2, t2) {
        throw new Il(`[${e2}] ${t2}`);
      }
      function Pl(e2, t2) {
      }
      const Bl = (e2 = "") => e2.split(" ").filter((e3) => !!e3.trim());
      const Rl = (e2, t2) => {
        if (!e2 || !t2) return false;
        if (t2.includes(" ")) throw new Error("className should not contain space.");
        return e2.classList.contains(t2);
      };
      const Vl = (e2, t2) => {
        if (!e2 || !t2.trim()) return;
        e2.classList.add(...Bl(t2));
      };
      const Fl = (e2, t2) => {
        if (!e2 || !t2.trim()) return;
        e2.classList.remove(...Bl(t2));
      };
      const jl = (e2, t2) => {
        var n2;
        if (!ke || !e2 || !t2) return "";
        let a2 = dt(t2);
        if (a2 === "float") a2 = "cssFloat";
        try {
          const t3 = e2.style[a2];
          if (t3) return t3;
          const o2 = (n2 = document.defaultView) == null ? void 0 : n2.getComputedStyle(e2, "");
          return o2 ? o2[a2] : "";
        } catch (t3) {
          return e2.style[a2];
        }
      };
      function zl(e2, t2 = "px") {
        if (!e2) return "";
        if (Ol(e2) || $l(e2)) {
          return `${e2}${t2}`;
        } else if (ot(e2)) {
          return e2;
        }
      }
      let Nl;
      const Hl = (e2) => {
        var t2;
        if (!ke) return 0;
        if (Nl !== void 0) return Nl;
        const n2 = document.createElement("div");
        n2.className = `${e2}-scrollbar__wrap`;
        n2.style.visibility = "hidden";
        n2.style.width = "100px";
        n2.style.position = "absolute";
        n2.style.top = "-9999px";
        document.body.appendChild(n2);
        const a2 = n2.offsetWidth;
        n2.style.overflow = "scroll";
        const o2 = document.createElement("div");
        o2.style.width = "100%";
        n2.appendChild(o2);
        const r2 = o2.offsetWidth;
        (t2 = n2.parentNode) == null ? void 0 : t2.removeChild(n2);
        Nl = a2 - r2;
        return Nl;
      };
      /*! Element Plus Icons Vue v2.3.1 */
      var Yl = vue.defineComponent({ name: "ArrowDown", __name: "arrow-down", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M831.872 340.864 512 652.672 192.128 340.864a30.592 30.592 0 0 0-42.752 0 29.12 29.12 0 0 0 0 41.6L489.664 714.24a32 32 0 0 0 44.672 0l340.288-331.712a29.12 29.12 0 0 0 0-41.728 30.592 30.592 0 0 0-42.752 0z" })]));
      } });
      var Wl = Yl;
      var Ul = vue.defineComponent({ name: "ArrowLeft", __name: "arrow-left", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M609.408 149.376 277.76 489.6a32 32 0 0 0 0 44.672l331.648 340.352a29.12 29.12 0 0 0 41.728 0 30.592 30.592 0 0 0 0-42.752L339.264 511.936l311.872-319.872a30.592 30.592 0 0 0 0-42.688 29.12 29.12 0 0 0-41.728 0z" })]));
      } });
      var Kl = Ul;
      var ql = vue.defineComponent({ name: "ArrowRight", __name: "arrow-right", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M340.864 149.312a30.592 30.592 0 0 0 0 42.752L652.736 512 340.864 831.872a30.592 30.592 0 0 0 0 42.752 29.12 29.12 0 0 0 41.728 0L714.24 534.336a32 32 0 0 0 0-44.672L382.592 149.376a29.12 29.12 0 0 0-41.728 0z" })]));
      } });
      var Gl = ql;
      var Zl = vue.defineComponent({ name: "ArrowUp", __name: "arrow-up", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m488.832 344.32-339.84 356.672a32 32 0 0 0 0 44.16l.384.384a29.44 29.44 0 0 0 42.688 0l320-335.872 319.872 335.872a29.44 29.44 0 0 0 42.688 0l.384-.384a32 32 0 0 0 0-44.16L535.168 344.32a32 32 0 0 0-46.336 0" })]));
      } });
      var Jl = Zl;
      var Xl = vue.defineComponent({ name: "Calendar", __name: "calendar", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M128 384v512h768V192H768v32a32 32 0 1 1-64 0v-32H320v32a32 32 0 0 1-64 0v-32H128v128h768v64zm192-256h384V96a32 32 0 1 1 64 0v32h160a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h160V96a32 32 0 0 1 64 0zm-32 384h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m192-192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64m0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64" })]));
      } });
      var Ql = Xl;
      var es = vue.defineComponent({ name: "CircleCheck", __name: "circle-check", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M745.344 361.344a32 32 0 0 1 45.312 45.312l-288 288a32 32 0 0 1-45.312 0l-160-160a32 32 0 1 1 45.312-45.312L480 626.752l265.344-265.408z" })]));
      } });
      var ts = es;
      var ns = vue.defineComponent({ name: "CircleClose", __name: "circle-close", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "m466.752 512-90.496-90.496a32 32 0 0 1 45.248-45.248L512 466.752l90.496-90.496a32 32 0 1 1 45.248 45.248L557.248 512l90.496 90.496a32 32 0 1 1-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 0 1-45.248-45.248z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" })]));
      } });
      var as = ns;
      var os = vue.defineComponent({ name: "Clock", __name: "clock", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768m0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896" }), vue.createElementVNode("path", { fill: "currentColor", d: "M480 256a32 32 0 0 1 32 32v256a32 32 0 0 1-64 0V288a32 32 0 0 1 32-32" }), vue.createElementVNode("path", { fill: "currentColor", d: "M480 512h256q32 0 32 32t-32 32H480q-32 0-32-32t32-32" })]));
      } });
      var rs = os;
      var ls = vue.defineComponent({ name: "Close", __name: "close", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z" })]));
      } });
      var ss = ls;
      var is = vue.defineComponent({ name: "DArrowLeft", __name: "d-arrow-left", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M529.408 149.376a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L259.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L197.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224zm256 0a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L515.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L453.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224z" })]));
      } });
      var us = is;
      var cs = vue.defineComponent({ name: "DArrowRight", __name: "d-arrow-right", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M452.864 149.312a29.12 29.12 0 0 1 41.728.064L826.24 489.664a32 32 0 0 1 0 44.672L494.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L764.736 512 452.864 192a30.592 30.592 0 0 1 0-42.688m-256 0a29.12 29.12 0 0 1 41.728.064L570.24 489.664a32 32 0 0 1 0 44.672L238.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L508.736 512 196.864 192a30.592 30.592 0 0 1 0-42.688z" })]));
      } });
      var ds = cs;
      var fs = vue.defineComponent({ name: "Hide", __name: "hide", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M876.8 156.8c0-9.6-3.2-16-9.6-22.4-6.4-6.4-12.8-9.6-22.4-9.6-9.6 0-16 3.2-22.4 9.6L736 220.8c-64-32-137.6-51.2-224-60.8-160 16-288 73.6-377.6 176C44.8 438.4 0 496 0 512s48 73.6 134.4 176c22.4 25.6 44.8 48 73.6 67.2l-86.4 89.6c-6.4 6.4-9.6 12.8-9.6 22.4 0 9.6 3.2 16 9.6 22.4 6.4 6.4 12.8 9.6 22.4 9.6 9.6 0 16-3.2 22.4-9.6l704-710.4c3.2-6.4 6.4-12.8 6.4-22.4Zm-646.4 528c-76.8-70.4-128-128-153.6-172.8 28.8-48 80-105.6 153.6-172.8C304 272 400 230.4 512 224c64 3.2 124.8 19.2 176 44.8l-54.4 54.4C598.4 300.8 560 288 512 288c-64 0-115.2 22.4-160 64s-64 96-64 160c0 48 12.8 89.6 35.2 124.8L256 707.2c-9.6-6.4-19.2-16-25.6-22.4Zm140.8-96c-12.8-22.4-19.2-48-19.2-76.8 0-44.8 16-83.2 48-112 32-28.8 67.2-48 112-48 28.8 0 54.4 6.4 73.6 19.2zM889.599 336c-12.8-16-28.8-28.8-41.6-41.6l-48 48c73.6 67.2 124.8 124.8 150.4 169.6-28.8 48-80 105.6-153.6 172.8-73.6 67.2-172.8 108.8-284.8 115.2-51.2-3.2-99.2-12.8-140.8-28.8l-48 48c57.6 22.4 118.4 38.4 188.8 44.8 160-16 288-73.6 377.6-176C979.199 585.6 1024 528 1024 512s-48.001-73.6-134.401-176Z" }), vue.createElementVNode("path", { fill: "currentColor", d: "M511.998 672c-12.8 0-25.6-3.2-38.4-6.4l-51.2 51.2c28.8 12.8 57.6 19.2 89.6 19.2 64 0 115.2-22.4 160-64 41.6-41.6 64-96 64-160 0-32-6.4-64-19.2-89.6l-51.2 51.2c3.2 12.8 6.4 25.6 6.4 38.4 0 44.8-16 83.2-48 112-32 28.8-67.2 48-112 48Z" })]));
      } });
      var vs = fs;
      var ps = vue.defineComponent({ name: "Loading", __name: "loading", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32m0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32m448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32m-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32M195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0m-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z" })]));
      } });
      var ms = ps;
      var hs = vue.defineComponent({ name: "Setting", __name: "setting", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M600.704 64a32 32 0 0 1 30.464 22.208l35.2 109.376c14.784 7.232 28.928 15.36 42.432 24.512l112.384-24.192a32 32 0 0 1 34.432 15.36L944.32 364.8a32 32 0 0 1-4.032 37.504l-77.12 85.12a357.12 357.12 0 0 1 0 49.024l77.12 85.248a32 32 0 0 1 4.032 37.504l-88.704 153.6a32 32 0 0 1-34.432 15.296L708.8 803.904c-13.44 9.088-27.648 17.28-42.368 24.512l-35.264 109.376A32 32 0 0 1 600.704 960H423.296a32 32 0 0 1-30.464-22.208L357.696 828.48a351.616 351.616 0 0 1-42.56-24.64l-112.32 24.256a32 32 0 0 1-34.432-15.36L79.68 659.2a32 32 0 0 1 4.032-37.504l77.12-85.248a357.12 357.12 0 0 1 0-48.896l-77.12-85.248A32 32 0 0 1 79.68 364.8l88.704-153.6a32 32 0 0 1 34.432-15.296l112.32 24.256c13.568-9.152 27.776-17.408 42.56-24.64l35.2-109.312A32 32 0 0 1 423.232 64H600.64zm-23.424 64H446.72l-36.352 113.088-24.512 11.968a294.113 294.113 0 0 0-34.816 20.096l-22.656 15.36-116.224-25.088-65.28 113.152 79.68 88.192-1.92 27.136a293.12 293.12 0 0 0 0 40.192l1.92 27.136-79.808 88.192 65.344 113.152 116.224-25.024 22.656 15.296a294.113 294.113 0 0 0 34.816 20.096l24.512 11.968L446.72 896h130.688l36.48-113.152 24.448-11.904a288.282 288.282 0 0 0 34.752-20.096l22.592-15.296 116.288 25.024 65.28-113.152-79.744-88.192 1.92-27.136a293.12 293.12 0 0 0 0-40.256l-1.92-27.136 79.808-88.128-65.344-113.152-116.288 24.96-22.592-15.232a287.616 287.616 0 0 0-34.752-20.096l-24.448-11.904L577.344 128zM512 320a192 192 0 1 1 0 384 192 192 0 0 1 0-384m0 64a128 128 0 1 0 0 256 128 128 0 0 0 0-256" })]));
      } });
      var bs = hs;
      var gs = vue.defineComponent({ name: "View", __name: "view", setup(e2) {
        return (e3, o2) => (vue.openBlock(), vue.createElementBlock("svg", { xmlns: "http://www.w3.org/2000/svg", viewBox: "0 0 1024 1024" }, [vue.createElementVNode("path", { fill: "currentColor", d: "M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352m0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 1 1 0 448 224 224 0 0 1 0-448m0 64a160.192 160.192 0 0 0-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160" })]));
      } });
      var ys = gs;
      const ws = "__epPropKey";
      const ks = (e2) => e2;
      const xs = (e2) => rt(e2) && !!e2[ws];
      const Ss = (e2, t2) => {
        if (!rt(e2) || xs(e2)) return e2;
        const { values: n2, required: a2, default: r2, type: l2, validator: s2 } = e2;
        const i2 = n2 || s2 ? (a3) => {
          let l3 = false;
          let i3 = [];
          if (n2) {
            i3 = Array.from(n2);
            if (et(e2, "default")) {
              i3.push(r2);
            }
            l3 || (l3 = i3.includes(a3));
          }
          if (s2) l3 || (l3 = s2(a3));
          if (!l3 && i3.length > 0) {
            const e3 = [...new Set(i3)].map((e4) => JSON.stringify(e4)).join(", ");
            vue.warn(`Invalid prop: validation failed${t2 ? ` for prop "${t2}"` : ""}. Expected one of [${e3}], got value ${JSON.stringify(a3)}.`);
          }
          return l3;
        } : void 0;
        const u2 = { type: l2, required: !!a2, validator: i2, [ws]: true };
        if (et(e2, "default")) u2.default = r2;
        return u2;
      };
      const Cs = (e2) => bl(Object.entries(e2).map(([e3, t2]) => [e3, Ss(t2, e3)]));
      const _s = ks([String, Object, Function]);
      const Ms = { Close: ss };
      const Os = { validating: ms, success: ts, error: as };
      const Ds = (e2, t2) => {
        e2.install = (n2) => {
          for (const a2 of [e2, ...Object.values(t2 != null ? t2 : {})]) {
            n2.component(a2.name, a2);
          }
        };
        if (t2) {
          for (const [n2, a2] of Object.entries(t2)) {
            e2[n2] = a2;
          }
        }
        return e2;
      };
      const As = (e2) => {
        e2.install = Xe;
        return e2;
      };
      const Es = (...e2) => (t2) => {
        e2.forEach((e3) => {
          if (at(e3)) {
            e3(t2);
          } else {
            e3.value = t2;
          }
        });
      };
      const $s = { tab: "Tab", enter: "Enter", space: "Space", left: "ArrowLeft", up: "ArrowUp", right: "ArrowRight", down: "ArrowDown", esc: "Escape", delete: "Delete", backspace: "Backspace", numpadEnter: "NumpadEnter", pageUp: "PageUp", pageDown: "PageDown", home: "Home", end: "End" };
      const Ls = ["year", "years", "month", "date", "dates", "week", "datetime", "datetimerange", "daterange", "monthrange"];
      const Is = "update:modelValue";
      const Ts = "change";
      const Ps = "input";
      const Bs = ["", "default", "small", "large"];
      const Rs = (e2) => ["", ...Bs].includes(e2);
      var Vs = ((e2) => {
        e2[e2["TEXT"] = 1] = "TEXT";
        e2[e2["CLASS"] = 2] = "CLASS";
        e2[e2["STYLE"] = 4] = "STYLE";
        e2[e2["PROPS"] = 8] = "PROPS";
        e2[e2["FULL_PROPS"] = 16] = "FULL_PROPS";
        e2[e2["HYDRATE_EVENTS"] = 32] = "HYDRATE_EVENTS";
        e2[e2["STABLE_FRAGMENT"] = 64] = "STABLE_FRAGMENT";
        e2[e2["KEYED_FRAGMENT"] = 128] = "KEYED_FRAGMENT";
        e2[e2["UNKEYED_FRAGMENT"] = 256] = "UNKEYED_FRAGMENT";
        e2[e2["NEED_PATCH"] = 512] = "NEED_PATCH";
        e2[e2["DYNAMIC_SLOTS"] = 1024] = "DYNAMIC_SLOTS";
        e2[e2["HOISTED"] = -1] = "HOISTED";
        e2[e2["BAIL"] = -2] = "BAIL";
        return e2;
      })(Vs || {});
      const Fs = (e2) => {
        if (!e2 && e2 !== 0) return [];
        return Array.isArray(e2) ? e2 : [e2];
      };
      const js = (e2) => /([\uAC00-\uD7AF\u3130-\u318F])+/gi.test(e2);
      const zs = (e2) => e2;
      const Ns = ["class", "style"];
      const Hs = /^on[A-Z]/;
      const Ys = (e2 = {}) => {
        const { excludeListeners: t2 = false, excludeKeys: n2 } = e2;
        const a2 = vue.computed(() => ((n2 == null ? void 0 : n2.value) || []).concat(Ns));
        const o2 = vue.getCurrentInstance();
        if (!o2) {
          return vue.computed(() => ({}));
        }
        return vue.computed(() => {
          var e3;
          return bl(Object.entries((e3 = o2.proxy) == null ? void 0 : e3.$attrs).filter(([e4]) => !a2.value.includes(e4) && !(t2 && Hs.test(e4))));
        });
      };
      const Ws = ({ from: e2, replacement: t2, scope: n2, version: a2, ref: o2, type: r2 = "API" }, l2) => {
        vue.watch(() => vue.unref(l2), (e3) => {
        }, { immediate: true });
      };
      const Us = (e2, t2, n2, a2) => {
        let o2 = { offsetX: 0, offsetY: 0 };
        const r2 = (t3) => {
          const n3 = t3.clientX;
          const r3 = t3.clientY;
          const { offsetX: l3, offsetY: s3 } = o2;
          const i2 = e2.value.getBoundingClientRect();
          const u2 = i2.left;
          const c2 = i2.top;
          const d2 = i2.width;
          const f2 = i2.height;
          const v2 = document.documentElement.clientWidth;
          const p2 = document.documentElement.clientHeight;
          const m2 = -u2 + l3;
          const h2 = -c2 + s3;
          const b2 = v2 - u2 - d2 + l3;
          const g2 = p2 - c2 - f2 + s3;
          const y2 = (t4) => {
            let i3 = l3 + t4.clientX - n3;
            let u3 = s3 + t4.clientY - r3;
            if (!(a2 == null ? void 0 : a2.value)) {
              i3 = Math.min(Math.max(i3, m2), b2);
              u3 = Math.min(Math.max(u3, h2), g2);
            }
            o2 = { offsetX: i3, offsetY: u3 };
            if (e2.value) {
              e2.value.style.transform = `translate(${zl(i3)}, ${zl(u3)})`;
            }
          };
          const w2 = () => {
            document.removeEventListener("mousemove", y2);
            document.removeEventListener("mouseup", w2);
          };
          document.addEventListener("mousemove", y2);
          document.addEventListener("mouseup", w2);
        };
        const l2 = () => {
          if (t2.value && e2.value) {
            t2.value.addEventListener("mousedown", r2);
          }
        };
        const s2 = () => {
          if (t2.value && e2.value) {
            t2.value.removeEventListener("mousedown", r2);
          }
        };
        vue.onMounted(() => {
          vue.watchEffect(() => {
            if (n2.value) {
              l2();
            } else {
              s2();
            }
          });
        });
        vue.onBeforeUnmount(() => {
          s2();
        });
      };
      var Ks = { name: "en", el: { breadcrumb: { label: "Breadcrumb" }, colorpicker: { confirm: "OK", clear: "Clear", defaultLabel: "color picker", description: "current color is {color}. press enter to select a new color." }, datepicker: { now: "Now", today: "Today", cancel: "Cancel", clear: "Clear", confirm: "OK", dateTablePrompt: "Use the arrow keys and enter to select the day of the month", monthTablePrompt: "Use the arrow keys and enter to select the month", yearTablePrompt: "Use the arrow keys and enter to select the year", selectedDate: "Selected date", selectDate: "Select date", selectTime: "Select time", startDate: "Start Date", startTime: "Start Time", endDate: "End Date", endTime: "End Time", prevYear: "Previous Year", nextYear: "Next Year", prevMonth: "Previous Month", nextMonth: "Next Month", year: "", month1: "January", month2: "February", month3: "March", month4: "April", month5: "May", month6: "June", month7: "July", month8: "August", month9: "September", month10: "October", month11: "November", month12: "December", week: "week", weeks: { sun: "Sun", mon: "Mon", tue: "Tue", wed: "Wed", thu: "Thu", fri: "Fri", sat: "Sat" }, weeksFull: { sun: "Sunday", mon: "Monday", tue: "Tuesday", wed: "Wednesday", thu: "Thursday", fri: "Friday", sat: "Saturday" }, months: { jan: "Jan", feb: "Feb", mar: "Mar", apr: "Apr", may: "May", jun: "Jun", jul: "Jul", aug: "Aug", sep: "Sep", oct: "Oct", nov: "Nov", dec: "Dec" } }, inputNumber: { decrease: "decrease number", increase: "increase number" }, select: { loading: "Loading", noMatch: "No matching data", noData: "No data", placeholder: "Select" }, dropdown: { toggleDropdown: "Toggle Dropdown" }, cascader: { noMatch: "No matching data", loading: "Loading", placeholder: "Select", noData: "No data" }, pagination: { goto: "Go to", pagesize: "/page", total: "Total {total}", pageClassifier: "", page: "Page", prev: "Go to previous page", next: "Go to next page", currentPage: "page {pager}", prevPages: "Previous {pager} pages", nextPages: "Next {pager} pages", deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details" }, dialog: { close: "Close this dialog" }, drawer: { close: "Close this dialog" }, messagebox: { title: "Message", confirm: "OK", cancel: "Cancel", error: "Illegal input", close: "Close this dialog" }, upload: { deleteTip: "press delete to remove", delete: "Delete", preview: "Preview", continue: "Continue" }, slider: { defaultLabel: "slider between {min} and {max}", defaultRangeStartLabel: "pick start value", defaultRangeEndLabel: "pick end value" }, table: { emptyText: "No Data", confirmFilter: "Confirm", resetFilter: "Reset", clearFilter: "All", sumText: "Sum" }, tour: { next: "Next", previous: "Previous", finish: "Finish" }, tree: { emptyText: "No Data" }, transfer: { noMatch: "No matching data", noData: "No data", titles: ["List 1", "List 2"], filterPlaceholder: "Enter keyword", noCheckedFormat: "{total} items", hasCheckedFormat: "{checked}/{total} checked" }, image: { error: "FAILED" }, pageHeader: { title: "Back" }, popconfirm: { confirmButtonText: "Yes", cancelButtonText: "No" }, carousel: { leftArrow: "Carousel arrow left", rightArrow: "Carousel arrow right", indicator: "Carousel switch to index {index}" } } };
      const qs = (e2) => (t2, n2) => Gs(t2, n2, vue.unref(e2));
      const Gs = (e2, t2, n2) => jo(n2, e2, e2).replace(/\{(\w+)\}/g, (e3, n3) => {
        var a2;
        return `${(a2 = t2 == null ? void 0 : t2[n3]) != null ? a2 : `{${n3}}`}`;
      });
      const Zs = (e2) => {
        const t2 = vue.computed(() => vue.unref(e2).name);
        const n2 = vue.isRef(e2) ? e2 : vue.ref(e2);
        return { lang: t2, locale: n2, t: qs(e2) };
      };
      const Js = Symbol("localeContextKey");
      const Xs = (e2) => {
        const t2 = e2 || vue.inject(Js, vue.ref());
        return Zs(vue.computed(() => t2.value || Ks));
      };
      const Qs = "el";
      const ei = "is-";
      const ti = (e2, t2, n2, a2, o2) => {
        let r2 = `${e2}-${t2}`;
        if (n2) {
          r2 += `-${n2}`;
        }
        if (a2) {
          r2 += `__${a2}`;
        }
        if (o2) {
          r2 += `--${o2}`;
        }
        return r2;
      };
      const ni = Symbol("namespaceContextKey");
      const ai = (e2) => {
        const t2 = e2 || (vue.getCurrentInstance() ? vue.inject(ni, vue.ref(Qs)) : vue.ref(Qs));
        const n2 = vue.computed(() => vue.unref(t2) || Qs);
        return n2;
      };
      const oi = (e2, t2) => {
        const n2 = ai(t2);
        const a2 = (t3 = "") => ti(n2.value, e2, t3, "", "");
        const o2 = (t3) => t3 ? ti(n2.value, e2, "", t3, "") : "";
        const r2 = (t3) => t3 ? ti(n2.value, e2, "", "", t3) : "";
        const l2 = (t3, a3) => t3 && a3 ? ti(n2.value, e2, t3, a3, "") : "";
        const s2 = (t3, a3) => t3 && a3 ? ti(n2.value, e2, "", t3, a3) : "";
        const i2 = (t3, a3) => t3 && a3 ? ti(n2.value, e2, t3, "", a3) : "";
        const u2 = (t3, a3, o3) => t3 && a3 && o3 ? ti(n2.value, e2, t3, a3, o3) : "";
        const c2 = (e3, ...t3) => {
          const n3 = t3.length >= 1 ? t3[0] : true;
          return e3 && n3 ? `${ei}${e3}` : "";
        };
        const d2 = (e3) => {
          const t3 = {};
          for (const a3 in e3) {
            if (e3[a3]) {
              t3[`--${n2.value}-${a3}`] = e3[a3];
            }
          }
          return t3;
        };
        const f2 = (t3) => {
          const a3 = {};
          for (const o3 in t3) {
            if (t3[o3]) {
              a3[`--${n2.value}-${e2}-${o3}`] = t3[o3];
            }
          }
          return a3;
        };
        const v2 = (e3) => `--${n2.value}-${e3}`;
        const p2 = (t3) => `--${n2.value}-${e2}-${t3}`;
        return { namespace: n2, b: a2, e: o2, m: r2, be: l2, em: s2, bm: i2, bem: u2, is: c2, cssVar: d2, cssVarName: v2, cssVarBlock: f2, cssVarBlockName: p2 };
      };
      const ri = (e2, t2 = {}) => {
        if (!vue.isRef(e2)) {
          Tl("[useLockscreen]", "You need to pass a ref param to this function");
        }
        const n2 = t2.ns || oi("popup");
        const a2 = vue.computed(() => n2.bm("parent", "hidden"));
        if (!ke || Rl(document.body, a2.value)) {
          return;
        }
        let o2 = 0;
        let l2 = false;
        let i2 = "0";
        const u2 = () => {
          setTimeout(() => {
            Fl(document == null ? void 0 : document.body, a2.value);
            if (l2 && document) {
              document.body.style.width = i2;
            }
          }, 200);
        };
        vue.watch(e2, (e3) => {
          if (!e3) {
            u2();
            return;
          }
          l2 = !Rl(document.body, a2.value);
          if (l2) {
            i2 = document.body.style.width;
          }
          o2 = Hl(n2.namespace.value);
          const t3 = document.documentElement.clientHeight < document.body.scrollHeight;
          const r2 = jl(document.body, "overflowY");
          if (o2 > 0 && (t3 || r2 === "scroll") && l2) {
            document.body.style.width = `calc(100% - ${o2}px)`;
          }
          Vl(document.body, a2.value);
        });
        vue.onScopeDispose(() => u2());
      };
      const li = Ss({ type: ks(Boolean), default: null });
      const si = Ss({ type: ks(Function) });
      const ii = (e2) => {
        const t2 = `update:${e2}`;
        const n2 = `onUpdate:${e2}`;
        const a2 = [t2];
        const o2 = { [e2]: li, [n2]: si };
        const i2 = ({ indicator: a3, toggleReason: o3, shouldHideWhenRouteChanges: i3, shouldProceed: c2, onShow: d2, onHide: f2 }) => {
          const v2 = vue.getCurrentInstance();
          const { emit: p2 } = v2;
          const m2 = v2.props;
          const h2 = vue.computed(() => at(m2[n2]));
          const b2 = vue.computed(() => m2[e2] === null);
          const g2 = (e3) => {
            if (a3.value === true) {
              return;
            }
            a3.value = true;
            if (o3) {
              o3.value = e3;
            }
            if (at(d2)) {
              d2(e3);
            }
          };
          const y2 = (e3) => {
            if (a3.value === false) {
              return;
            }
            a3.value = false;
            if (o3) {
              o3.value = e3;
            }
            if (at(f2)) {
              f2(e3);
            }
          };
          const w2 = (e3) => {
            if (m2.disabled === true || at(c2) && !c2()) return;
            const n3 = h2.value && ke;
            if (n3) {
              p2(t2, true);
            }
            if (b2.value || !n3) {
              g2(e3);
            }
          };
          const k2 = (e3) => {
            if (m2.disabled === true || !ke) return;
            const n3 = h2.value && ke;
            if (n3) {
              p2(t2, false);
            }
            if (b2.value || !n3) {
              y2(e3);
            }
          };
          const x2 = (e3) => {
            if (!Ml(e3)) return;
            if (m2.disabled && e3) {
              if (h2.value) {
                p2(t2, false);
              }
            } else if (a3.value !== e3) {
              if (e3) {
                g2();
              } else {
                y2();
              }
            }
          };
          const S2 = () => {
            if (a3.value) {
              k2();
            } else {
              w2();
            }
          };
          vue.watch(() => m2[e2], x2);
          if (i3 && v2.appContext.config.globalProperties.$route !== void 0) {
            vue.watch(() => ({ ...v2.proxy.$route }), () => {
              if (i3.value && a3.value) {
                k2();
              }
            });
          }
          vue.onMounted(() => {
            x2(m2[e2]);
          });
          return { hide: k2, show: w2, toggle: S2, hasUpdateHandler: h2 };
        };
        return { useModelToggle: i2, useModelToggleProps: o2, useModelToggleEmits: a2 };
      };
      const ui = (e2) => {
        const t2 = vue.getCurrentInstance();
        return vue.computed(() => {
          var n2, a2;
          return (a2 = (n2 = t2 == null ? void 0 : t2.proxy) == null ? void 0 : n2.$props) == null ? void 0 : a2[e2];
        });
      };
      var ci = "top", di = "bottom", fi = "right", vi = "left", pi = "auto", mi = [ci, di, fi, vi], hi = "start", bi = "end", gi = "clippingParents", yi = "viewport", wi = "popper", ki = "reference", xi = mi.reduce(function(e2, t2) {
        return e2.concat([t2 + "-" + hi, t2 + "-" + bi]);
      }, []), Si = [].concat(mi, [pi]).reduce(function(e2, t2) {
        return e2.concat([t2, t2 + "-" + hi, t2 + "-" + bi]);
      }, []), Ci = "beforeRead", _i = "read", Mi = "afterRead", Oi = "beforeMain", Di = "main", Ai = "afterMain", Ei = "beforeWrite", $i = "write", Li = "afterWrite", Ii = [Ci, _i, Mi, Oi, Di, Ai, Ei, $i, Li];
      function Ti(e2) {
        return e2 ? (e2.nodeName || "").toLowerCase() : null;
      }
      function Pi(e2) {
        if (e2 == null) return window;
        if (e2.toString() !== "[object Window]") {
          var t2 = e2.ownerDocument;
          return t2 && t2.defaultView || window;
        }
        return e2;
      }
      function Bi(e2) {
        var t2 = Pi(e2).Element;
        return e2 instanceof t2 || e2 instanceof Element;
      }
      function Ri(e2) {
        var t2 = Pi(e2).HTMLElement;
        return e2 instanceof t2 || e2 instanceof HTMLElement;
      }
      function Vi(e2) {
        if (typeof ShadowRoot == "undefined") return false;
        var t2 = Pi(e2).ShadowRoot;
        return e2 instanceof t2 || e2 instanceof ShadowRoot;
      }
      function Fi(e2) {
        var t2 = e2.state;
        Object.keys(t2.elements).forEach(function(e3) {
          var n2 = t2.styles[e3] || {}, a2 = t2.attributes[e3] || {}, o2 = t2.elements[e3];
          !Ri(o2) || !Ti(o2) || (Object.assign(o2.style, n2), Object.keys(a2).forEach(function(e4) {
            var t3 = a2[e4];
            t3 === false ? o2.removeAttribute(e4) : o2.setAttribute(e4, t3 === true ? "" : t3);
          }));
        });
      }
      function ji(e2) {
        var t2 = e2.state, n2 = { popper: { position: t2.options.strategy, left: "0", top: "0", margin: "0" }, arrow: { position: "absolute" }, reference: {} };
        return Object.assign(t2.elements.popper.style, n2.popper), t2.styles = n2, t2.elements.arrow && Object.assign(t2.elements.arrow.style, n2.arrow), function() {
          Object.keys(t2.elements).forEach(function(e3) {
            var a2 = t2.elements[e3], o2 = t2.attributes[e3] || {}, r2 = Object.keys(t2.styles.hasOwnProperty(e3) ? t2.styles[e3] : n2[e3]), l2 = r2.reduce(function(e4, t3) {
              return e4[t3] = "", e4;
            }, {});
            !Ri(a2) || !Ti(a2) || (Object.assign(a2.style, l2), Object.keys(o2).forEach(function(e4) {
              a2.removeAttribute(e4);
            }));
          });
        };
      }
      var zi = { name: "applyStyles", enabled: true, phase: "write", fn: Fi, effect: ji, requires: ["computeStyles"] };
      function Ni(e2) {
        return e2.split("-")[0];
      }
      var Hi = Math.max, Yi = Math.min, Wi = Math.round;
      function Ui(e2, t2) {
        t2 === void 0 && (t2 = false);
        var n2 = e2.getBoundingClientRect(), a2 = 1, o2 = 1;
        if (Ri(e2) && t2) {
          var r2 = e2.offsetHeight, l2 = e2.offsetWidth;
          l2 > 0 && (a2 = Wi(n2.width) / l2 || 1), r2 > 0 && (o2 = Wi(n2.height) / r2 || 1);
        }
        return { width: n2.width / a2, height: n2.height / o2, top: n2.top / o2, right: n2.right / a2, bottom: n2.bottom / o2, left: n2.left / a2, x: n2.left / a2, y: n2.top / o2 };
      }
      function Ki(e2) {
        var t2 = Ui(e2), n2 = e2.offsetWidth, a2 = e2.offsetHeight;
        return Math.abs(t2.width - n2) <= 1 && (n2 = t2.width), Math.abs(t2.height - a2) <= 1 && (a2 = t2.height), { x: e2.offsetLeft, y: e2.offsetTop, width: n2, height: a2 };
      }
      function qi(e2, t2) {
        var n2 = t2.getRootNode && t2.getRootNode();
        if (e2.contains(t2)) return true;
        if (n2 && Vi(n2)) {
          var a2 = t2;
          do {
            if (a2 && e2.isSameNode(a2)) return true;
            a2 = a2.parentNode || a2.host;
          } while (a2);
        }
        return false;
      }
      function Gi(e2) {
        return Pi(e2).getComputedStyle(e2);
      }
      function Zi(e2) {
        return ["table", "td", "th"].indexOf(Ti(e2)) >= 0;
      }
      function Ji(e2) {
        return ((Bi(e2) ? e2.ownerDocument : e2.document) || window.document).documentElement;
      }
      function Xi(e2) {
        return Ti(e2) === "html" ? e2 : e2.assignedSlot || e2.parentNode || (Vi(e2) ? e2.host : null) || Ji(e2);
      }
      function Qi(e2) {
        return !Ri(e2) || Gi(e2).position === "fixed" ? null : e2.offsetParent;
      }
      function eu(e2) {
        var t2 = navigator.userAgent.toLowerCase().indexOf("firefox") !== -1, n2 = navigator.userAgent.indexOf("Trident") !== -1;
        if (n2 && Ri(e2)) {
          var a2 = Gi(e2);
          if (a2.position === "fixed") return null;
        }
        var o2 = Xi(e2);
        for (Vi(o2) && (o2 = o2.host); Ri(o2) && ["html", "body"].indexOf(Ti(o2)) < 0; ) {
          var r2 = Gi(o2);
          if (r2.transform !== "none" || r2.perspective !== "none" || r2.contain === "paint" || ["transform", "perspective"].indexOf(r2.willChange) !== -1 || t2 && r2.willChange === "filter" || t2 && r2.filter && r2.filter !== "none") return o2;
          o2 = o2.parentNode;
        }
        return null;
      }
      function tu(e2) {
        for (var t2 = Pi(e2), n2 = Qi(e2); n2 && Zi(n2) && Gi(n2).position === "static"; ) n2 = Qi(n2);
        return n2 && (Ti(n2) === "html" || Ti(n2) === "body" && Gi(n2).position === "static") ? t2 : n2 || eu(e2) || t2;
      }
      function nu(e2) {
        return ["top", "bottom"].indexOf(e2) >= 0 ? "x" : "y";
      }
      function au(e2, t2, n2) {
        return Hi(e2, Yi(t2, n2));
      }
      function ou(e2, t2, n2) {
        var a2 = au(e2, t2, n2);
        return a2 > n2 ? n2 : a2;
      }
      function ru() {
        return { top: 0, right: 0, bottom: 0, left: 0 };
      }
      function lu(e2) {
        return Object.assign({}, ru(), e2);
      }
      function su(e2, t2) {
        return t2.reduce(function(t3, n2) {
          return t3[n2] = e2, t3;
        }, {});
      }
      var iu = function(e2, t2) {
        return e2 = typeof e2 == "function" ? e2(Object.assign({}, t2.rects, { placement: t2.placement })) : e2, lu(typeof e2 != "number" ? e2 : su(e2, mi));
      };
      function uu(e2) {
        var t2, n2 = e2.state, a2 = e2.name, o2 = e2.options, r2 = n2.elements.arrow, l2 = n2.modifiersData.popperOffsets, s2 = Ni(n2.placement), i2 = nu(s2), u2 = [vi, fi].indexOf(s2) >= 0, c2 = u2 ? "height" : "width";
        if (!(!r2 || !l2)) {
          var d2 = iu(o2.padding, n2), f2 = Ki(r2), v2 = i2 === "y" ? ci : vi, p2 = i2 === "y" ? di : fi, m2 = n2.rects.reference[c2] + n2.rects.reference[i2] - l2[i2] - n2.rects.popper[c2], h2 = l2[i2] - n2.rects.reference[i2], b2 = tu(r2), g2 = b2 ? i2 === "y" ? b2.clientHeight || 0 : b2.clientWidth || 0 : 0, y2 = m2 / 2 - h2 / 2, w2 = d2[v2], k2 = g2 - f2[c2] - d2[p2], x2 = g2 / 2 - f2[c2] / 2 + y2, S2 = au(w2, x2, k2), C2 = i2;
          n2.modifiersData[a2] = (t2 = {}, t2[C2] = S2, t2.centerOffset = S2 - x2, t2);
        }
      }
      function cu(e2) {
        var t2 = e2.state, n2 = e2.options, a2 = n2.element, o2 = a2 === void 0 ? "[data-popper-arrow]" : a2;
        o2 != null && (typeof o2 == "string" && (o2 = t2.elements.popper.querySelector(o2), !o2) || !qi(t2.elements.popper, o2) || (t2.elements.arrow = o2));
      }
      var du = { name: "arrow", enabled: true, phase: "main", fn: uu, effect: cu, requires: ["popperOffsets"], requiresIfExists: ["preventOverflow"] };
      function fu(e2) {
        return e2.split("-")[1];
      }
      var vu = { top: "auto", right: "auto", bottom: "auto", left: "auto" };
      function pu(e2) {
        var t2 = e2.x, n2 = e2.y, a2 = window, o2 = a2.devicePixelRatio || 1;
        return { x: Wi(t2 * o2) / o2 || 0, y: Wi(n2 * o2) / o2 || 0 };
      }
      function mu(e2) {
        var t2, n2 = e2.popper, a2 = e2.popperRect, o2 = e2.placement, r2 = e2.variation, l2 = e2.offsets, s2 = e2.position, i2 = e2.gpuAcceleration, u2 = e2.adaptive, c2 = e2.roundOffsets, d2 = e2.isFixed, f2 = l2.x, v2 = f2 === void 0 ? 0 : f2, p2 = l2.y, m2 = p2 === void 0 ? 0 : p2, h2 = typeof c2 == "function" ? c2({ x: v2, y: m2 }) : { x: v2, y: m2 };
        v2 = h2.x, m2 = h2.y;
        var b2 = l2.hasOwnProperty("x"), g2 = l2.hasOwnProperty("y"), y2 = vi, w2 = ci, k2 = window;
        if (u2) {
          var x2 = tu(n2), S2 = "clientHeight", C2 = "clientWidth";
          if (x2 === Pi(n2) && (x2 = Ji(n2), Gi(x2).position !== "static" && s2 === "absolute" && (S2 = "scrollHeight", C2 = "scrollWidth")), x2 = x2, o2 === ci || (o2 === vi || o2 === fi) && r2 === bi) {
            w2 = di;
            var _2 = d2 && x2 === k2 && k2.visualViewport ? k2.visualViewport.height : x2[S2];
            m2 -= _2 - a2.height, m2 *= i2 ? 1 : -1;
          }
          if (o2 === vi || (o2 === ci || o2 === di) && r2 === bi) {
            y2 = fi;
            var M2 = d2 && x2 === k2 && k2.visualViewport ? k2.visualViewport.width : x2[C2];
            v2 -= M2 - a2.width, v2 *= i2 ? 1 : -1;
          }
        }
        var O2 = Object.assign({ position: s2 }, u2 && vu), D2 = c2 === true ? pu({ x: v2, y: m2 }) : { x: v2, y: m2 };
        if (v2 = D2.x, m2 = D2.y, i2) {
          var A2;
          return Object.assign({}, O2, (A2 = {}, A2[w2] = g2 ? "0" : "", A2[y2] = b2 ? "0" : "", A2.transform = (k2.devicePixelRatio || 1) <= 1 ? "translate(" + v2 + "px, " + m2 + "px)" : "translate3d(" + v2 + "px, " + m2 + "px, 0)", A2));
        }
        return Object.assign({}, O2, (t2 = {}, t2[w2] = g2 ? m2 + "px" : "", t2[y2] = b2 ? v2 + "px" : "", t2.transform = "", t2));
      }
      function hu(e2) {
        var t2 = e2.state, n2 = e2.options, a2 = n2.gpuAcceleration, o2 = a2 === void 0 ? true : a2, r2 = n2.adaptive, l2 = r2 === void 0 ? true : r2, s2 = n2.roundOffsets, i2 = s2 === void 0 ? true : s2, u2 = { placement: Ni(t2.placement), variation: fu(t2.placement), popper: t2.elements.popper, popperRect: t2.rects.popper, gpuAcceleration: o2, isFixed: t2.options.strategy === "fixed" };
        t2.modifiersData.popperOffsets != null && (t2.styles.popper = Object.assign({}, t2.styles.popper, mu(Object.assign({}, u2, { offsets: t2.modifiersData.popperOffsets, position: t2.options.strategy, adaptive: l2, roundOffsets: i2 })))), t2.modifiersData.arrow != null && (t2.styles.arrow = Object.assign({}, t2.styles.arrow, mu(Object.assign({}, u2, { offsets: t2.modifiersData.arrow, position: "absolute", adaptive: false, roundOffsets: i2 })))), t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-placement": t2.placement });
      }
      var bu = { name: "computeStyles", enabled: true, phase: "beforeWrite", fn: hu, data: {} }, gu = { passive: true };
      function yu(e2) {
        var t2 = e2.state, n2 = e2.instance, a2 = e2.options, o2 = a2.scroll, r2 = o2 === void 0 ? true : o2, l2 = a2.resize, s2 = l2 === void 0 ? true : l2, i2 = Pi(t2.elements.popper), u2 = [].concat(t2.scrollParents.reference, t2.scrollParents.popper);
        return r2 && u2.forEach(function(e3) {
          e3.addEventListener("scroll", n2.update, gu);
        }), s2 && i2.addEventListener("resize", n2.update, gu), function() {
          r2 && u2.forEach(function(e3) {
            e3.removeEventListener("scroll", n2.update, gu);
          }), s2 && i2.removeEventListener("resize", n2.update, gu);
        };
      }
      var wu = { name: "eventListeners", enabled: true, phase: "write", fn: function() {
      }, effect: yu, data: {} }, ku = { left: "right", right: "left", bottom: "top", top: "bottom" };
      function xu(e2) {
        return e2.replace(/left|right|bottom|top/g, function(e3) {
          return ku[e3];
        });
      }
      var Su = { start: "end", end: "start" };
      function Cu(e2) {
        return e2.replace(/start|end/g, function(e3) {
          return Su[e3];
        });
      }
      function _u(e2) {
        var t2 = Pi(e2), n2 = t2.pageXOffset, a2 = t2.pageYOffset;
        return { scrollLeft: n2, scrollTop: a2 };
      }
      function Mu(e2) {
        return Ui(Ji(e2)).left + _u(e2).scrollLeft;
      }
      function Ou(e2) {
        var t2 = Pi(e2), n2 = Ji(e2), a2 = t2.visualViewport, o2 = n2.clientWidth, r2 = n2.clientHeight, l2 = 0, s2 = 0;
        return a2 && (o2 = a2.width, r2 = a2.height, /^((?!chrome|android).)*safari/i.test(navigator.userAgent) || (l2 = a2.offsetLeft, s2 = a2.offsetTop)), { width: o2, height: r2, x: l2 + Mu(e2), y: s2 };
      }
      function Du(e2) {
        var t2, n2 = Ji(e2), a2 = _u(e2), o2 = (t2 = e2.ownerDocument) == null ? void 0 : t2.body, r2 = Hi(n2.scrollWidth, n2.clientWidth, o2 ? o2.scrollWidth : 0, o2 ? o2.clientWidth : 0), l2 = Hi(n2.scrollHeight, n2.clientHeight, o2 ? o2.scrollHeight : 0, o2 ? o2.clientHeight : 0), s2 = -a2.scrollLeft + Mu(e2), i2 = -a2.scrollTop;
        return Gi(o2 || n2).direction === "rtl" && (s2 += Hi(n2.clientWidth, o2 ? o2.clientWidth : 0) - r2), { width: r2, height: l2, x: s2, y: i2 };
      }
      function Au(e2) {
        var t2 = Gi(e2), n2 = t2.overflow, a2 = t2.overflowX, o2 = t2.overflowY;
        return /auto|scroll|overlay|hidden/.test(n2 + o2 + a2);
      }
      function Eu(e2) {
        return ["html", "body", "#document"].indexOf(Ti(e2)) >= 0 ? e2.ownerDocument.body : Ri(e2) && Au(e2) ? e2 : Eu(Xi(e2));
      }
      function $u(e2, t2) {
        var n2;
        t2 === void 0 && (t2 = []);
        var a2 = Eu(e2), o2 = a2 === ((n2 = e2.ownerDocument) == null ? void 0 : n2.body), r2 = Pi(a2), l2 = o2 ? [r2].concat(r2.visualViewport || [], Au(a2) ? a2 : []) : a2, s2 = t2.concat(l2);
        return o2 ? s2 : s2.concat($u(Xi(l2)));
      }
      function Lu(e2) {
        return Object.assign({}, e2, { left: e2.x, top: e2.y, right: e2.x + e2.width, bottom: e2.y + e2.height });
      }
      function Iu(e2) {
        var t2 = Ui(e2);
        return t2.top = t2.top + e2.clientTop, t2.left = t2.left + e2.clientLeft, t2.bottom = t2.top + e2.clientHeight, t2.right = t2.left + e2.clientWidth, t2.width = e2.clientWidth, t2.height = e2.clientHeight, t2.x = t2.left, t2.y = t2.top, t2;
      }
      function Tu(e2, t2) {
        return t2 === yi ? Lu(Ou(e2)) : Bi(t2) ? Iu(t2) : Lu(Du(Ji(e2)));
      }
      function Pu(e2) {
        var t2 = $u(Xi(e2)), n2 = ["absolute", "fixed"].indexOf(Gi(e2).position) >= 0, a2 = n2 && Ri(e2) ? tu(e2) : e2;
        return Bi(a2) ? t2.filter(function(e3) {
          return Bi(e3) && qi(e3, a2) && Ti(e3) !== "body";
        }) : [];
      }
      function Bu(e2, t2, n2) {
        var a2 = t2 === "clippingParents" ? Pu(e2) : [].concat(t2), o2 = [].concat(a2, [n2]), r2 = o2[0], l2 = o2.reduce(function(t3, n3) {
          var a3 = Tu(e2, n3);
          return t3.top = Hi(a3.top, t3.top), t3.right = Yi(a3.right, t3.right), t3.bottom = Yi(a3.bottom, t3.bottom), t3.left = Hi(a3.left, t3.left), t3;
        }, Tu(e2, r2));
        return l2.width = l2.right - l2.left, l2.height = l2.bottom - l2.top, l2.x = l2.left, l2.y = l2.top, l2;
      }
      function Ru(e2) {
        var t2 = e2.reference, n2 = e2.element, a2 = e2.placement, o2 = a2 ? Ni(a2) : null, r2 = a2 ? fu(a2) : null, l2 = t2.x + t2.width / 2 - n2.width / 2, s2 = t2.y + t2.height / 2 - n2.height / 2, i2;
        switch (o2) {
          case ci:
            i2 = { x: l2, y: t2.y - n2.height };
            break;
          case di:
            i2 = { x: l2, y: t2.y + t2.height };
            break;
          case fi:
            i2 = { x: t2.x + t2.width, y: s2 };
            break;
          case vi:
            i2 = { x: t2.x - n2.width, y: s2 };
            break;
          default:
            i2 = { x: t2.x, y: t2.y };
        }
        var u2 = o2 ? nu(o2) : null;
        if (u2 != null) {
          var c2 = u2 === "y" ? "height" : "width";
          switch (r2) {
            case hi:
              i2[u2] = i2[u2] - (t2[c2] / 2 - n2[c2] / 2);
              break;
            case bi:
              i2[u2] = i2[u2] + (t2[c2] / 2 - n2[c2] / 2);
              break;
          }
        }
        return i2;
      }
      function Vu(e2, t2) {
        t2 === void 0 && (t2 = {});
        var n2 = t2, a2 = n2.placement, o2 = a2 === void 0 ? e2.placement : a2, r2 = n2.boundary, l2 = r2 === void 0 ? gi : r2, s2 = n2.rootBoundary, i2 = s2 === void 0 ? yi : s2, u2 = n2.elementContext, c2 = u2 === void 0 ? wi : u2, d2 = n2.altBoundary, f2 = d2 === void 0 ? false : d2, v2 = n2.padding, p2 = v2 === void 0 ? 0 : v2, m2 = lu(typeof p2 != "number" ? p2 : su(p2, mi)), h2 = c2 === wi ? ki : wi, b2 = e2.rects.popper, g2 = e2.elements[f2 ? h2 : c2], y2 = Bu(Bi(g2) ? g2 : g2.contextElement || Ji(e2.elements.popper), l2, i2), w2 = Ui(e2.elements.reference), k2 = Ru({ reference: w2, element: b2, strategy: "absolute", placement: o2 }), x2 = Lu(Object.assign({}, b2, k2)), S2 = c2 === wi ? x2 : w2, C2 = { top: y2.top - S2.top + m2.top, bottom: S2.bottom - y2.bottom + m2.bottom, left: y2.left - S2.left + m2.left, right: S2.right - y2.right + m2.right }, _2 = e2.modifiersData.offset;
        if (c2 === wi && _2) {
          var M2 = _2[o2];
          Object.keys(C2).forEach(function(e3) {
            var t3 = [fi, di].indexOf(e3) >= 0 ? 1 : -1, n3 = [ci, di].indexOf(e3) >= 0 ? "y" : "x";
            C2[e3] += M2[n3] * t3;
          });
        }
        return C2;
      }
      function Fu(e2, t2) {
        t2 === void 0 && (t2 = {});
        var n2 = t2, a2 = n2.placement, o2 = n2.boundary, r2 = n2.rootBoundary, l2 = n2.padding, s2 = n2.flipVariations, i2 = n2.allowedAutoPlacements, u2 = i2 === void 0 ? Si : i2, c2 = fu(a2), d2 = c2 ? s2 ? xi : xi.filter(function(e3) {
          return fu(e3) === c2;
        }) : mi, f2 = d2.filter(function(e3) {
          return u2.indexOf(e3) >= 0;
        });
        f2.length === 0 && (f2 = d2);
        var v2 = f2.reduce(function(t3, n3) {
          return t3[n3] = Vu(e2, { placement: n3, boundary: o2, rootBoundary: r2, padding: l2 })[Ni(n3)], t3;
        }, {});
        return Object.keys(v2).sort(function(e3, t3) {
          return v2[e3] - v2[t3];
        });
      }
      function ju(e2) {
        if (Ni(e2) === pi) return [];
        var t2 = xu(e2);
        return [Cu(e2), t2, Cu(t2)];
      }
      function zu(e2) {
        var t2 = e2.state, n2 = e2.options, a2 = e2.name;
        if (!t2.modifiersData[a2]._skip) {
          for (var o2 = n2.mainAxis, r2 = o2 === void 0 ? true : o2, l2 = n2.altAxis, s2 = l2 === void 0 ? true : l2, i2 = n2.fallbackPlacements, u2 = n2.padding, c2 = n2.boundary, d2 = n2.rootBoundary, f2 = n2.altBoundary, v2 = n2.flipVariations, p2 = v2 === void 0 ? true : v2, m2 = n2.allowedAutoPlacements, h2 = t2.options.placement, b2 = Ni(h2), g2 = b2 === h2, y2 = i2 || (g2 || !p2 ? [xu(h2)] : ju(h2)), w2 = [h2].concat(y2).reduce(function(e3, n3) {
            return e3.concat(Ni(n3) === pi ? Fu(t2, { placement: n3, boundary: c2, rootBoundary: d2, padding: u2, flipVariations: p2, allowedAutoPlacements: m2 }) : n3);
          }, []), k2 = t2.rects.reference, x2 = t2.rects.popper, S2 = /* @__PURE__ */ new Map(), C2 = true, _2 = w2[0], M2 = 0; M2 < w2.length; M2++) {
            var O2 = w2[M2], D2 = Ni(O2), A2 = fu(O2) === hi, E2 = [ci, di].indexOf(D2) >= 0, $2 = E2 ? "width" : "height", L2 = Vu(t2, { placement: O2, boundary: c2, rootBoundary: d2, altBoundary: f2, padding: u2 }), I2 = E2 ? A2 ? fi : vi : A2 ? di : ci;
            k2[$2] > x2[$2] && (I2 = xu(I2));
            var T2 = xu(I2), P2 = [];
            if (r2 && P2.push(L2[D2] <= 0), s2 && P2.push(L2[I2] <= 0, L2[T2] <= 0), P2.every(function(e3) {
              return e3;
            })) {
              _2 = O2, C2 = false;
              break;
            }
            S2.set(O2, P2);
          }
          if (C2) for (var B2 = p2 ? 3 : 1, R2 = function(e3) {
            var t3 = w2.find(function(t4) {
              var n3 = S2.get(t4);
              if (n3) return n3.slice(0, e3).every(function(e4) {
                return e4;
              });
            });
            if (t3) return _2 = t3, "break";
          }, V2 = B2; V2 > 0; V2--) {
            var F2 = R2(V2);
            if (F2 === "break") break;
          }
          t2.placement !== _2 && (t2.modifiersData[a2]._skip = true, t2.placement = _2, t2.reset = true);
        }
      }
      var Nu = { name: "flip", enabled: true, phase: "main", fn: zu, requiresIfExists: ["offset"], data: { _skip: false } };
      function Hu(e2, t2, n2) {
        return n2 === void 0 && (n2 = { x: 0, y: 0 }), { top: e2.top - t2.height - n2.y, right: e2.right - t2.width + n2.x, bottom: e2.bottom - t2.height + n2.y, left: e2.left - t2.width - n2.x };
      }
      function Yu(e2) {
        return [ci, fi, di, vi].some(function(t2) {
          return e2[t2] >= 0;
        });
      }
      function Wu(e2) {
        var t2 = e2.state, n2 = e2.name, a2 = t2.rects.reference, o2 = t2.rects.popper, r2 = t2.modifiersData.preventOverflow, l2 = Vu(t2, { elementContext: "reference" }), s2 = Vu(t2, { altBoundary: true }), i2 = Hu(l2, a2), u2 = Hu(s2, o2, r2), c2 = Yu(i2), d2 = Yu(u2);
        t2.modifiersData[n2] = { referenceClippingOffsets: i2, popperEscapeOffsets: u2, isReferenceHidden: c2, hasPopperEscaped: d2 }, t2.attributes.popper = Object.assign({}, t2.attributes.popper, { "data-popper-reference-hidden": c2, "data-popper-escaped": d2 });
      }
      var Uu = { name: "hide", enabled: true, phase: "main", requiresIfExists: ["preventOverflow"], fn: Wu };
      function Ku(e2, t2, n2) {
        var a2 = Ni(e2), o2 = [vi, ci].indexOf(a2) >= 0 ? -1 : 1, r2 = typeof n2 == "function" ? n2(Object.assign({}, t2, { placement: e2 })) : n2, l2 = r2[0], s2 = r2[1];
        return l2 = l2 || 0, s2 = (s2 || 0) * o2, [vi, fi].indexOf(a2) >= 0 ? { x: s2, y: l2 } : { x: l2, y: s2 };
      }
      function qu(e2) {
        var t2 = e2.state, n2 = e2.options, a2 = e2.name, o2 = n2.offset, r2 = o2 === void 0 ? [0, 0] : o2, l2 = Si.reduce(function(e3, n3) {
          return e3[n3] = Ku(n3, t2.rects, r2), e3;
        }, {}), s2 = l2[t2.placement], i2 = s2.x, u2 = s2.y;
        t2.modifiersData.popperOffsets != null && (t2.modifiersData.popperOffsets.x += i2, t2.modifiersData.popperOffsets.y += u2), t2.modifiersData[a2] = l2;
      }
      var Gu = { name: "offset", enabled: true, phase: "main", requires: ["popperOffsets"], fn: qu };
      function Zu(e2) {
        var t2 = e2.state, n2 = e2.name;
        t2.modifiersData[n2] = Ru({ reference: t2.rects.reference, element: t2.rects.popper, strategy: "absolute", placement: t2.placement });
      }
      var Ju = { name: "popperOffsets", enabled: true, phase: "read", fn: Zu, data: {} };
      function Xu(e2) {
        return e2 === "x" ? "y" : "x";
      }
      function Qu(e2) {
        var t2 = e2.state, n2 = e2.options, a2 = e2.name, o2 = n2.mainAxis, r2 = o2 === void 0 ? true : o2, l2 = n2.altAxis, s2 = l2 === void 0 ? false : l2, i2 = n2.boundary, u2 = n2.rootBoundary, c2 = n2.altBoundary, d2 = n2.padding, f2 = n2.tether, v2 = f2 === void 0 ? true : f2, p2 = n2.tetherOffset, m2 = p2 === void 0 ? 0 : p2, h2 = Vu(t2, { boundary: i2, rootBoundary: u2, padding: d2, altBoundary: c2 }), b2 = Ni(t2.placement), g2 = fu(t2.placement), y2 = !g2, w2 = nu(b2), k2 = Xu(w2), x2 = t2.modifiersData.popperOffsets, S2 = t2.rects.reference, C2 = t2.rects.popper, _2 = typeof m2 == "function" ? m2(Object.assign({}, t2.rects, { placement: t2.placement })) : m2, M2 = typeof _2 == "number" ? { mainAxis: _2, altAxis: _2 } : Object.assign({ mainAxis: 0, altAxis: 0 }, _2), O2 = t2.modifiersData.offset ? t2.modifiersData.offset[t2.placement] : null, D2 = { x: 0, y: 0 };
        if (x2) {
          if (r2) {
            var A2, E2 = w2 === "y" ? ci : vi, $2 = w2 === "y" ? di : fi, L2 = w2 === "y" ? "height" : "width", I2 = x2[w2], T2 = I2 + h2[E2], P2 = I2 - h2[$2], B2 = v2 ? -C2[L2] / 2 : 0, R2 = g2 === hi ? S2[L2] : C2[L2], V2 = g2 === hi ? -C2[L2] : -S2[L2], F2 = t2.elements.arrow, j2 = v2 && F2 ? Ki(F2) : { width: 0, height: 0 }, z2 = t2.modifiersData["arrow#persistent"] ? t2.modifiersData["arrow#persistent"].padding : ru(), N2 = z2[E2], H2 = z2[$2], Y2 = au(0, S2[L2], j2[L2]), W2 = y2 ? S2[L2] / 2 - B2 - Y2 - N2 - M2.mainAxis : R2 - Y2 - N2 - M2.mainAxis, U2 = y2 ? -S2[L2] / 2 + B2 + Y2 + H2 + M2.mainAxis : V2 + Y2 + H2 + M2.mainAxis, K2 = t2.elements.arrow && tu(t2.elements.arrow), q2 = K2 ? w2 === "y" ? K2.clientTop || 0 : K2.clientLeft || 0 : 0, G2 = (A2 = O2 == null ? void 0 : O2[w2]) != null ? A2 : 0, Z2 = I2 + W2 - G2 - q2, J2 = I2 + U2 - G2, X2 = au(v2 ? Yi(T2, Z2) : T2, I2, v2 ? Hi(P2, J2) : P2);
            x2[w2] = X2, D2[w2] = X2 - I2;
          }
          if (s2) {
            var Q2, ee2 = w2 === "x" ? ci : vi, te2 = w2 === "x" ? di : fi, ne2 = x2[k2], ae2 = k2 === "y" ? "height" : "width", oe2 = ne2 + h2[ee2], re2 = ne2 - h2[te2], le2 = [ci, vi].indexOf(b2) !== -1, se2 = (Q2 = O2 == null ? void 0 : O2[k2]) != null ? Q2 : 0, ie2 = le2 ? oe2 : ne2 - S2[ae2] - C2[ae2] - se2 + M2.altAxis, ue2 = le2 ? ne2 + S2[ae2] + C2[ae2] - se2 - M2.altAxis : re2, ce2 = v2 && le2 ? ou(ie2, ne2, ue2) : au(v2 ? ie2 : oe2, ne2, v2 ? ue2 : re2);
            x2[k2] = ce2, D2[k2] = ce2 - ne2;
          }
          t2.modifiersData[a2] = D2;
        }
      }
      var ec = { name: "preventOverflow", enabled: true, phase: "main", fn: Qu, requiresIfExists: ["offset"] };
      function tc(e2) {
        return { scrollLeft: e2.scrollLeft, scrollTop: e2.scrollTop };
      }
      function nc(e2) {
        return e2 === Pi(e2) || !Ri(e2) ? _u(e2) : tc(e2);
      }
      function ac(e2) {
        var t2 = e2.getBoundingClientRect(), n2 = Wi(t2.width) / e2.offsetWidth || 1, a2 = Wi(t2.height) / e2.offsetHeight || 1;
        return n2 !== 1 || a2 !== 1;
      }
      function oc(e2, t2, n2) {
        n2 === void 0 && (n2 = false);
        var a2 = Ri(t2), o2 = Ri(t2) && ac(t2), r2 = Ji(t2), l2 = Ui(e2, o2), s2 = { scrollLeft: 0, scrollTop: 0 }, i2 = { x: 0, y: 0 };
        return (a2 || !a2 && !n2) && ((Ti(t2) !== "body" || Au(r2)) && (s2 = nc(t2)), Ri(t2) ? (i2 = Ui(t2, true), i2.x += t2.clientLeft, i2.y += t2.clientTop) : r2 && (i2.x = Mu(r2))), { x: l2.left + s2.scrollLeft - i2.x, y: l2.top + s2.scrollTop - i2.y, width: l2.width, height: l2.height };
      }
      function rc(e2) {
        var t2 = /* @__PURE__ */ new Map(), n2 = /* @__PURE__ */ new Set(), a2 = [];
        e2.forEach(function(e3) {
          t2.set(e3.name, e3);
        });
        function o2(e3) {
          n2.add(e3.name);
          var r2 = [].concat(e3.requires || [], e3.requiresIfExists || []);
          r2.forEach(function(e4) {
            if (!n2.has(e4)) {
              var a3 = t2.get(e4);
              a3 && o2(a3);
            }
          }), a2.push(e3);
        }
        return e2.forEach(function(e3) {
          n2.has(e3.name) || o2(e3);
        }), a2;
      }
      function lc(e2) {
        var t2 = rc(e2);
        return Ii.reduce(function(e3, n2) {
          return e3.concat(t2.filter(function(e4) {
            return e4.phase === n2;
          }));
        }, []);
      }
      function sc(e2) {
        var t2;
        return function() {
          return t2 || (t2 = new Promise(function(n2) {
            Promise.resolve().then(function() {
              t2 = void 0, n2(e2());
            });
          })), t2;
        };
      }
      function ic(e2) {
        var t2 = e2.reduce(function(e3, t3) {
          var n2 = e3[t3.name];
          return e3[t3.name] = n2 ? Object.assign({}, n2, t3, { options: Object.assign({}, n2.options, t3.options), data: Object.assign({}, n2.data, t3.data) }) : t3, e3;
        }, {});
        return Object.keys(t2).map(function(e3) {
          return t2[e3];
        });
      }
      var uc = { placement: "bottom", modifiers: [], strategy: "absolute" };
      function cc() {
        for (var e2 = arguments.length, t2 = new Array(e2), n2 = 0; n2 < e2; n2++) t2[n2] = arguments[n2];
        return !t2.some(function(e3) {
          return !(e3 && typeof e3.getBoundingClientRect == "function");
        });
      }
      function dc(e2) {
        e2 === void 0 && (e2 = {});
        var t2 = e2, n2 = t2.defaultModifiers, a2 = n2 === void 0 ? [] : n2, o2 = t2.defaultOptions, r2 = o2 === void 0 ? uc : o2;
        return function(e3, t3, n3) {
          n3 === void 0 && (n3 = r2);
          var o3 = { placement: "bottom", orderedModifiers: [], options: Object.assign({}, uc, r2), modifiersData: {}, elements: { reference: e3, popper: t3 }, attributes: {}, styles: {} }, l2 = [], s2 = false, i2 = { state: o3, setOptions: function(n4) {
            var l3 = typeof n4 == "function" ? n4(o3.options) : n4;
            c2(), o3.options = Object.assign({}, r2, o3.options, l3), o3.scrollParents = { reference: Bi(e3) ? $u(e3) : e3.contextElement ? $u(e3.contextElement) : [], popper: $u(t3) };
            var s3 = lc(ic([].concat(a2, o3.options.modifiers)));
            return o3.orderedModifiers = s3.filter(function(e4) {
              return e4.enabled;
            }), u2(), i2.update();
          }, forceUpdate: function() {
            if (!s2) {
              var e4 = o3.elements, t4 = e4.reference, n4 = e4.popper;
              if (cc(t4, n4)) {
                o3.rects = { reference: oc(t4, tu(n4), o3.options.strategy === "fixed"), popper: Ki(n4) }, o3.reset = false, o3.placement = o3.options.placement, o3.orderedModifiers.forEach(function(e5) {
                  return o3.modifiersData[e5.name] = Object.assign({}, e5.data);
                });
                for (var a3 = 0; a3 < o3.orderedModifiers.length; a3++) {
                  if (o3.reset === true) {
                    o3.reset = false, a3 = -1;
                    continue;
                  }
                  var r3 = o3.orderedModifiers[a3], l3 = r3.fn, u3 = r3.options, c3 = u3 === void 0 ? {} : u3, d2 = r3.name;
                  typeof l3 == "function" && (o3 = l3({ state: o3, options: c3, name: d2, instance: i2 }) || o3);
                }
              }
            }
          }, update: sc(function() {
            return new Promise(function(e4) {
              i2.forceUpdate(), e4(o3);
            });
          }), destroy: function() {
            c2(), s2 = true;
          } };
          if (!cc(e3, t3)) return i2;
          i2.setOptions(n3).then(function(e4) {
            !s2 && n3.onFirstUpdate && n3.onFirstUpdate(e4);
          });
          function u2() {
            o3.orderedModifiers.forEach(function(e4) {
              var t4 = e4.name, n4 = e4.options, a3 = n4 === void 0 ? {} : n4, r3 = e4.effect;
              if (typeof r3 == "function") {
                var s3 = r3({ state: o3, name: t4, instance: i2, options: a3 }), u3 = function() {
                };
                l2.push(s3 || u3);
              }
            });
          }
          function c2() {
            l2.forEach(function(e4) {
              return e4();
            }), l2 = [];
          }
          return i2;
        };
      }
      dc();
      var fc = [wu, Ju, bu, zi];
      dc({ defaultModifiers: fc });
      var vc = [wu, Ju, bu, zi, Gu, Nu, ec, du, Uu], pc = dc({ defaultModifiers: vc });
      const mc = (e2, t2, n2 = {}) => {
        const a2 = { name: "updateState", enabled: true, phase: "write", fn: ({ state: e3 }) => {
          const t3 = hc(e3);
          Object.assign(u2.value, t3);
        }, requires: ["computeStyles"] };
        const o2 = vue.computed(() => {
          const { onFirstUpdate: e3, placement: t3, strategy: o3, modifiers: r2 } = vue.unref(n2);
          return { onFirstUpdate: e3, placement: t3 || "bottom", strategy: o3 || "absolute", modifiers: [...r2 || [], a2, { name: "applyStyles", enabled: false }] };
        });
        const l2 = vue.shallowRef();
        const u2 = vue.ref({ styles: { popper: { position: vue.unref(o2).strategy, left: "0", top: "0" }, arrow: { position: "absolute" } }, attributes: {} });
        const c2 = () => {
          if (!l2.value) return;
          l2.value.destroy();
          l2.value = void 0;
        };
        vue.watch(o2, (e3) => {
          const t3 = vue.unref(l2);
          if (t3) {
            t3.setOptions(e3);
          }
        }, { deep: true });
        vue.watch([e2, t2], ([e3, t3]) => {
          c2();
          if (!e3 || !t3) return;
          l2.value = pc(e3, t3, vue.unref(o2));
        });
        vue.onBeforeUnmount(() => {
          c2();
        });
        return { state: vue.computed(() => {
          var e3;
          return { ...((e3 = vue.unref(l2)) == null ? void 0 : e3.state) || {} };
        }), styles: vue.computed(() => vue.unref(u2).styles), attributes: vue.computed(() => vue.unref(u2).attributes), update: () => {
          var e3;
          return (e3 = vue.unref(l2)) == null ? void 0 : e3.update();
        }, forceUpdate: () => {
          var e3;
          return (e3 = vue.unref(l2)) == null ? void 0 : e3.forceUpdate();
        }, instanceRef: vue.computed(() => vue.unref(l2)) };
      };
      function hc(e2) {
        const t2 = Object.keys(e2.elements);
        const n2 = bl(t2.map((t3) => [t3, e2.styles[t3] || {}]));
        const a2 = bl(t2.map((t3) => [t3, e2.attributes[t3]]));
        return { styles: n2, attributes: a2 };
      }
      const bc = (e2) => {
        if (!e2) {
          return { onClick: Xe, onMousedown: Xe, onMouseup: Xe };
        }
        let t2 = false;
        let n2 = false;
        const a2 = (a3) => {
          if (t2 && n2) {
            e2(a3);
          }
          t2 = n2 = false;
        };
        const o2 = (e3) => {
          t2 = e3.target === e3.currentTarget;
        };
        const r2 = (e3) => {
          n2 = e3.target === e3.currentTarget;
        };
        return { onClick: a2, onMousedown: o2, onMouseup: r2 };
      };
      function gc() {
        let e2;
        const t2 = (t3, a2) => {
          n2();
          e2 = window.setTimeout(t3, a2);
        };
        const n2 = () => window.clearTimeout(e2);
        Oe(() => n2());
        return { registerTimeout: t2, cancelTimeout: n2 };
      }
      const yc = { prefix: Math.floor(Math.random() * 1e4), current: 0 };
      const wc = Symbol("elIdInjection");
      const kc = () => vue.getCurrentInstance() ? vue.inject(wc, yc) : yc;
      const xc = (e2) => {
        const t2 = kc();
        const n2 = ai();
        const a2 = vue.computed(() => vue.unref(e2) || `${n2.value}-id-${t2.prefix}-${t2.current++}`);
        return a2;
      };
      let Sc = [];
      const Cc = (e2) => {
        const t2 = e2;
        if (t2.key === $s.esc) {
          Sc.forEach((e3) => e3(t2));
        }
      };
      const _c = (e2) => {
        vue.onMounted(() => {
          if (Sc.length === 0) {
            document.addEventListener("keydown", Cc);
          }
          if (ke) Sc.push(e2);
        });
        vue.onBeforeUnmount(() => {
          Sc = Sc.filter((t2) => t2 !== e2);
          if (Sc.length === 0) {
            if (ke) document.removeEventListener("keydown", Cc);
          }
        });
      };
      let Mc;
      const Oc = () => {
        const e2 = ai();
        const t2 = kc();
        const n2 = vue.computed(() => `${e2.value}-popper-container-${t2.prefix}`);
        const a2 = vue.computed(() => `#${n2.value}`);
        return { id: n2, selector: a2 };
      };
      const Dc = (e2) => {
        const t2 = document.createElement("div");
        t2.id = e2;
        document.body.appendChild(t2);
        return t2;
      };
      const Ac = () => {
        const { id: e2, selector: t2 } = Oc();
        vue.onBeforeMount(() => {
          if (!ke) return;
          if (!Mc && !document.body.querySelector(t2.value)) {
            Mc = Dc(e2.value);
          }
        });
        return { id: e2, selector: t2 };
      };
      const Ec = Cs({ showAfter: { type: Number, default: 0 }, hideAfter: { type: Number, default: 200 }, autoClose: { type: Number, default: 0 } });
      const $c = ({ showAfter: e2, hideAfter: t2, autoClose: n2, open: a2, close: o2 }) => {
        const { registerTimeout: r2 } = gc();
        const { registerTimeout: l2, cancelTimeout: s2 } = gc();
        const u2 = (t3) => {
          r2(() => {
            a2(t3);
            const e3 = vue.unref(n2);
            if (Ol(e3) && e3 > 0) {
              l2(() => {
                o2(t3);
              }, e3);
            }
          }, vue.unref(e2));
        };
        const c2 = (e3) => {
          s2();
          r2(() => {
            o2(e3);
          }, vue.unref(t2));
        };
        return { onOpen: u2, onClose: c2 };
      };
      const Lc = Symbol("elForwardRef");
      const Ic = (e2) => {
        const t2 = (t3) => {
          e2.value = t3;
        };
        vue.provide(Lc, { setForwardRef: t2 });
      };
      const Tc = (e2) => ({ mounted(t2) {
        e2(t2);
      }, updated(t2) {
        e2(t2);
      }, unmounted() {
        e2(null);
      } });
      const Pc = { current: 0 };
      const Bc = vue.ref(0);
      const Rc = 2e3;
      const Vc = Symbol("elZIndexContextKey");
      const Fc = Symbol("zIndexContextKey");
      const jc = (e2) => {
        const t2 = vue.getCurrentInstance() ? vue.inject(Vc, Pc) : Pc;
        const n2 = e2 || (vue.getCurrentInstance() ? vue.inject(Fc, void 0) : void 0);
        const a2 = vue.computed(() => {
          const e3 = vue.unref(n2);
          return Ol(e3) ? e3 : Rc;
        });
        const o2 = vue.computed(() => a2.value + Bc.value);
        const s2 = () => {
          t2.current++;
          Bc.value = t2.current;
          return o2.value;
        };
        if (!ke && !vue.inject(Vc)) ;
        return { initialZIndex: a2, currentZIndex: o2, nextZIndex: s2 };
      };
      function zc(e2) {
        const t2 = vue.ref();
        function n2() {
          if (e2.value == void 0) return;
          const { selectionStart: n3, selectionEnd: a3, value: o2 } = e2.value;
          if (n3 == null || a3 == null) return;
          const r2 = o2.slice(0, Math.max(0, n3));
          const l2 = o2.slice(Math.max(0, a3));
          t2.value = { selectionStart: n3, selectionEnd: a3, value: o2, beforeTxt: r2, afterTxt: l2 };
        }
        function a2() {
          if (e2.value == void 0 || t2.value == void 0) return;
          const { value: n3 } = e2.value;
          const { beforeTxt: a3, afterTxt: o2, selectionStart: r2 } = t2.value;
          if (a3 == void 0 || o2 == void 0 || r2 == void 0) return;
          let l2 = n3.length;
          if (n3.endsWith(o2)) {
            l2 = n3.length - o2.length;
          } else if (n3.startsWith(a3)) {
            l2 = a3.length;
          } else {
            const e3 = a3[r2 - 1];
            const t3 = n3.indexOf(e3, r2 - 1);
            if (t3 !== -1) {
              l2 = t3 + 1;
            }
          }
          e2.value.setSelectionRange(l2, l2);
        }
        return [n2, a2];
      }
      const Nc = Ss({ type: String, values: Bs, required: false });
      const Hc = Symbol("size");
      const Yc = () => {
        const e2 = vue.inject(Hc, {});
        return vue.computed(() => vue.unref(e2.size) || "");
      };
      function Wc(e2, { afterFocus: t2, beforeBlur: n2, afterBlur: a2 } = {}) {
        const o2 = vue.getCurrentInstance();
        const { emit: r2 } = o2;
        const i2 = vue.shallowRef();
        const u2 = vue.ref(false);
        const c2 = (e3) => {
          if (u2.value) return;
          u2.value = true;
          r2("focus", e3);
          t2 == null ? void 0 : t2();
        };
        const d2 = (e3) => {
          var t3;
          const o3 = at(n2) ? n2(e3) : false;
          if (o3 || e3.relatedTarget && ((t3 = i2.value) == null ? void 0 : t3.contains(e3.relatedTarget))) return;
          u2.value = false;
          r2("blur", e3);
          a2 == null ? void 0 : a2();
        };
        const f2 = () => {
          var t3;
          (t3 = e2.value) == null ? void 0 : t3.focus();
        };
        vue.watch(i2, (e3) => {
          if (e3) {
            e3.setAttribute("tabindex", "-1");
          }
        });
        Le(i2, "click", f2);
        return { wrapperRef: i2, isFocused: u2, handleFocus: c2, handleBlur: d2 };
      }
      const Uc = ["", void 0, null];
      const Kc = Cs({ emptyValues: Array, valueOnClear: { type: [String, Number, Boolean, Function], default: void 0, validator: (e2) => at(e2) ? !e2() : !e2 } });
      const qc = (e2, t2) => {
        let n2 = Qc();
        if (!n2.value) {
          n2 = vue.ref({});
        }
        const a2 = vue.computed(() => e2.emptyValues || n2.value.emptyValues || Uc);
        const o2 = vue.computed(() => {
          if (at(e2.valueOnClear)) {
            return e2.valueOnClear();
          } else if (e2.valueOnClear !== void 0) {
            return e2.valueOnClear;
          } else if (at(n2.value.valueOnClear)) {
            return n2.value.valueOnClear();
          } else if (n2.value.valueOnClear !== void 0) {
            return n2.value.valueOnClear;
          }
          return t2;
        });
        const l2 = (e3) => a2.value.includes(e3);
        if (!a2.value.includes(o2.value)) ;
        return { emptyValues: a2, valueOnClear: o2, isEmptyValue: l2 };
      };
      const Gc = Cs({ ariaLabel: String, ariaOrientation: { type: String, values: ["horizontal", "vertical", "undefined"] }, ariaControls: String });
      const Zc = (e2) => Cl(Gc, e2);
      const Jc = Symbol();
      const Xc = vue.ref();
      function Qc(e2, t2 = void 0) {
        const n2 = vue.getCurrentInstance() ? vue.inject(Jc, Xc) : Xc;
        if (e2) {
          return vue.computed(() => {
            var a2, o2;
            return (o2 = (a2 = n2.value) == null ? void 0 : a2[e2]) != null ? o2 : t2;
          });
        } else {
          return n2;
        }
      }
      function ed(e2, t2) {
        const n2 = Qc();
        const a2 = oi(e2, vue.computed(() => {
          var e3;
          return ((e3 = n2.value) == null ? void 0 : e3.namespace) || Qs;
        }));
        const o2 = Xs(vue.computed(() => {
          var e3;
          return (e3 = n2.value) == null ? void 0 : e3.locale;
        }));
        const l2 = jc(vue.computed(() => {
          var e3;
          return ((e3 = n2.value) == null ? void 0 : e3.zIndex) || Rc;
        }));
        const s2 = vue.computed(() => {
          var e3;
          return vue.unref(t2) || ((e3 = n2.value) == null ? void 0 : e3.size) || "";
        });
        td(vue.computed(() => vue.unref(n2) || {}));
        return { ns: a2, locale: o2, zIndex: l2, size: s2 };
      }
      const td = (e2, t2, n2 = false) => {
        var a2;
        const o2 = !!vue.getCurrentInstance();
        const s2 = o2 ? Qc() : void 0;
        const u2 = (a2 = void 0) != null ? a2 : o2 ? vue.provide : void 0;
        if (!u2) {
          return;
        }
        const c2 = vue.computed(() => {
          const t3 = vue.unref(e2);
          if (!(s2 == null ? void 0 : s2.value)) return t3;
          return nd(s2.value, t3);
        });
        u2(Jc, c2);
        u2(Js, vue.computed(() => c2.value.locale));
        u2(ni, vue.computed(() => c2.value.namespace));
        u2(Fc, vue.computed(() => c2.value.zIndex));
        u2(Hc, { size: vue.computed(() => c2.value.size || "") });
        if (n2 || !Xc.value) {
          Xc.value = c2.value;
        }
        return c2;
      };
      const nd = (e2, t2) => {
        const n2 = [.../* @__PURE__ */ new Set([...Ll(e2), ...Ll(t2)])];
        const a2 = {};
        for (const o2 of n2) {
          a2[o2] = t2[o2] !== void 0 ? t2[o2] : e2[o2];
        }
        return a2;
      };
      var ad = (e2, t2) => {
        const n2 = e2.__vccOpts || e2;
        for (const [e3, a2] of t2) {
          n2[e3] = a2;
        }
        return n2;
      };
      const od = Cs({ size: { type: ks([Number, String]) }, color: { type: String } });
      const rd = vue.defineComponent({ name: "ElIcon", inheritAttrs: false });
      const ld = vue.defineComponent({ ...rd, props: od, setup(e2) {
        const a2 = e2;
        const o2 = oi("icon");
        const l2 = vue.computed(() => {
          const { size: e3, color: t2 } = a2;
          if (!e3 && !t2) return {};
          return { fontSize: _l(e3) ? void 0 : zl(e3), "--color": t2 };
        });
        return (e3, a3) => (vue.openBlock(), vue.createElementBlock("i", vue.mergeProps({ class: vue.unref(o2).b(), style: vue.unref(l2) }, e3.$attrs), [vue.renderSlot(e3.$slots, "default")], 16));
      } });
      var sd = ad(ld, [["__file", "icon.vue"]]);
      const id = Ds(sd);
      const ud = Symbol("formContextKey");
      const cd = Symbol("formItemContextKey");
      const dd = (e2, t2 = {}) => {
        const n2 = vue.ref(void 0);
        const a2 = t2.prop ? n2 : ui("size");
        const o2 = t2.global ? n2 : Yc();
        const l2 = t2.form ? { size: void 0 } : vue.inject(ud, void 0);
        const s2 = t2.formItem ? { size: void 0 } : vue.inject(cd, void 0);
        return vue.computed(() => a2.value || vue.unref(e2) || (s2 == null ? void 0 : s2.size) || (l2 == null ? void 0 : l2.size) || o2.value || "");
      };
      const fd = (e2) => {
        const t2 = ui("disabled");
        const n2 = vue.inject(ud, void 0);
        return vue.computed(() => t2.value || vue.unref(e2) || (n2 == null ? void 0 : n2.disabled) || false);
      };
      const vd = () => {
        const e2 = vue.inject(ud, void 0);
        const t2 = vue.inject(cd, void 0);
        return { form: e2, formItem: t2 };
      };
      const pd = (e2, { formItemContext: t2, disableIdGeneration: n2, disableIdManagement: a2 }) => {
        if (!n2) {
          n2 = vue.ref(false);
        }
        if (!a2) {
          a2 = vue.ref(false);
        }
        const o2 = vue.ref();
        let l2 = void 0;
        const i2 = vue.computed(() => {
          var n3;
          return !!(!(e2.label || e2.ariaLabel) && t2 && t2.inputIds && ((n3 = t2.inputIds) == null ? void 0 : n3.length) <= 1);
        });
        vue.onMounted(() => {
          l2 = vue.watch([vue.toRef(e2, "id"), n2], ([e3, n3]) => {
            const r2 = e3 != null ? e3 : !n3 ? xc().value : void 0;
            if (r2 !== o2.value) {
              if (t2 == null ? void 0 : t2.removeInputId) {
                o2.value && t2.removeInputId(o2.value);
                if (!(a2 == null ? void 0 : a2.value) && !n3 && r2) {
                  t2.addInputId(r2);
                }
              }
              o2.value = r2;
            }
          }, { immediate: true });
        });
        vue.onUnmounted(() => {
          l2 && l2();
          if (t2 == null ? void 0 : t2.removeInputId) {
            o2.value && t2.removeInputId(o2.value);
          }
        });
        return { isLabeledByFormItem: i2, inputId: o2 };
      };
      let md = void 0;
      const hd = `
  height:0 !important;
  visibility:hidden !important;
  ${Je() ? "" : "overflow:hidden !important;"}
  position:absolute !important;
  z-index:-1000 !important;
  top:0 !important;
  right:0 !important;
`;
      const bd = ["letter-spacing", "line-height", "padding-top", "padding-bottom", "font-family", "font-weight", "font-size", "text-rendering", "text-transform", "width", "text-indent", "padding-left", "padding-right", "border-width", "box-sizing"];
      function gd(e2) {
        const t2 = window.getComputedStyle(e2);
        const n2 = t2.getPropertyValue("box-sizing");
        const a2 = Number.parseFloat(t2.getPropertyValue("padding-bottom")) + Number.parseFloat(t2.getPropertyValue("padding-top"));
        const o2 = Number.parseFloat(t2.getPropertyValue("border-bottom-width")) + Number.parseFloat(t2.getPropertyValue("border-top-width"));
        const r2 = bd.map((e3) => `${e3}:${t2.getPropertyValue(e3)}`).join(";");
        return { contextStyle: r2, paddingSize: a2, borderSize: o2, boxSizing: n2 };
      }
      function yd(e2, t2 = 1, n2) {
        var a2;
        if (!md) {
          md = document.createElement("textarea");
          document.body.appendChild(md);
        }
        const { paddingSize: o2, borderSize: r2, boxSizing: l2, contextStyle: s2 } = gd(e2);
        md.setAttribute("style", `${s2};${hd}`);
        md.value = e2.value || e2.placeholder || "";
        let i2 = md.scrollHeight;
        const u2 = {};
        if (l2 === "border-box") {
          i2 = i2 + r2;
        } else if (l2 === "content-box") {
          i2 = i2 - o2;
        }
        md.value = "";
        const c2 = md.scrollHeight - o2;
        if (Ol(t2)) {
          let e3 = c2 * t2;
          if (l2 === "border-box") {
            e3 = e3 + o2 + r2;
          }
          i2 = Math.max(e3, i2);
          u2.minHeight = `${e3}px`;
        }
        if (Ol(n2)) {
          let e3 = c2 * n2;
          if (l2 === "border-box") {
            e3 = e3 + o2 + r2;
          }
          i2 = Math.min(e3, i2);
        }
        u2.height = `${i2}px`;
        (a2 = md.parentNode) == null ? void 0 : a2.removeChild(md);
        md = void 0;
        return u2;
      }
      const wd = Cs({ id: { type: String, default: void 0 }, size: Nc, disabled: Boolean, modelValue: { type: ks([String, Number, Object]), default: "" }, maxlength: { type: [String, Number] }, minlength: { type: [String, Number] }, type: { type: String, default: "text" }, resize: { type: String, values: ["none", "both", "horizontal", "vertical"] }, autosize: { type: ks([Boolean, Object]), default: false }, autocomplete: { type: String, default: "off" }, formatter: { type: Function }, parser: { type: Function }, placeholder: { type: String }, form: { type: String }, readonly: { type: Boolean, default: false }, clearable: { type: Boolean, default: false }, showPassword: { type: Boolean, default: false }, showWordLimit: { type: Boolean, default: false }, suffixIcon: { type: _s }, prefixIcon: { type: _s }, containerRole: { type: String, default: void 0 }, label: { type: String, default: void 0 }, tabindex: { type: [String, Number], default: 0 }, validateEvent: { type: Boolean, default: true }, inputStyle: { type: ks([Object, Array, String]), default: () => zs({}) }, autofocus: { type: Boolean, default: false }, ...Zc(["ariaLabel"]) });
      const kd = { [Is]: (e2) => ot(e2), input: (e2) => ot(e2), change: (e2) => ot(e2), focus: (e2) => e2 instanceof FocusEvent, blur: (e2) => e2 instanceof FocusEvent, clear: () => true, mouseleave: (e2) => e2 instanceof MouseEvent, mouseenter: (e2) => e2 instanceof MouseEvent, keydown: (e2) => e2 instanceof Event, compositionstart: (e2) => e2 instanceof CompositionEvent, compositionupdate: (e2) => e2 instanceof CompositionEvent, compositionend: (e2) => e2 instanceof CompositionEvent };
      const xd = ["role"];
      const Sd = ["id", "minlength", "maxlength", "type", "disabled", "readonly", "autocomplete", "tabindex", "aria-label", "placeholder", "form", "autofocus"];
      const Cd = ["id", "minlength", "maxlength", "tabindex", "disabled", "readonly", "autocomplete", "aria-label", "placeholder", "form", "autofocus"];
      const _d = vue.defineComponent({ name: "ElInput", inheritAttrs: false });
      const Md = vue.defineComponent({ ..._d, props: wd, emits: kd, setup(e2, { expose: o2, emit: l2 }) {
        const c2 = e2;
        const d2 = vue.useAttrs();
        const f2 = vue.useSlots();
        const p2 = vue.computed(() => {
          const e3 = {};
          if (c2.containerRole === "combobox") {
            e3["aria-haspopup"] = d2["aria-haspopup"];
            e3["aria-owns"] = d2["aria-owns"];
            e3["aria-expanded"] = d2["aria-expanded"];
          }
          return e3;
        });
        const m2 = vue.computed(() => [c2.type === "textarea" ? z2.b() : j2.b(), j2.m(V2.value), j2.is("disabled", F2.value), j2.is("exceed", de2.value), { [j2.b("group")]: f2.prepend || f2.append, [j2.bm("group", "append")]: f2.append, [j2.bm("group", "prepend")]: f2.prepend, [j2.m("prefix")]: f2.prefix || c2.prefixIcon, [j2.m("suffix")]: f2.suffix || c2.suffixIcon || c2.clearable || c2.showPassword, [j2.bm("suffix", "password-clear")]: se2.value && ie2.value, [j2.b("hidden")]: c2.type === "hidden" }, d2.class]);
        const b2 = vue.computed(() => [j2.e("wrapper"), j2.is("focus", J2.value)]);
        const g2 = Ys({ excludeKeys: vue.computed(() => Object.keys(p2.value)) });
        const { form: x2, formItem: B2 } = vd();
        const { inputId: R2 } = pd(c2, { formItemContext: B2 });
        const V2 = dd();
        const F2 = fd();
        const j2 = oi("input");
        const z2 = oi("textarea");
        const N2 = vue.shallowRef();
        const H2 = vue.shallowRef();
        const Y2 = vue.ref(false);
        const W2 = vue.ref(false);
        const U2 = vue.ref(false);
        const K2 = vue.ref();
        const q2 = vue.shallowRef(c2.inputStyle);
        const G2 = vue.computed(() => N2.value || H2.value);
        const { wrapperRef: Z2, isFocused: J2, handleFocus: X2, handleBlur: Q2 } = Wc(G2, { afterBlur() {
          var e3;
          if (c2.validateEvent) {
            (e3 = B2 == null ? void 0 : B2.validate) == null ? void 0 : e3.call(B2, "blur").catch((e4) => Pl());
          }
        } });
        const ee2 = vue.computed(() => {
          var e3;
          return (e3 = x2 == null ? void 0 : x2.statusIcon) != null ? e3 : false;
        });
        const te2 = vue.computed(() => (B2 == null ? void 0 : B2.validateState) || "");
        const ne2 = vue.computed(() => te2.value && Os[te2.value]);
        const ae2 = vue.computed(() => U2.value ? ys : vs);
        const oe2 = vue.computed(() => [d2.style]);
        const re2 = vue.computed(() => [c2.inputStyle, q2.value, { resize: c2.resize }]);
        const le2 = vue.computed(() => yl(c2.modelValue) ? "" : String(c2.modelValue));
        const se2 = vue.computed(() => c2.clearable && !F2.value && !c2.readonly && !!le2.value && (J2.value || Y2.value));
        const ie2 = vue.computed(() => c2.showPassword && !F2.value && !c2.readonly && !!le2.value && (!!le2.value || J2.value));
        const ue2 = vue.computed(() => c2.showWordLimit && !!c2.maxlength && (c2.type === "text" || c2.type === "textarea") && !F2.value && !c2.readonly && !c2.showPassword);
        const ce2 = vue.computed(() => le2.value.length);
        const de2 = vue.computed(() => !!ue2.value && ce2.value > Number(c2.maxlength));
        const fe2 = vue.computed(() => !!f2.suffix || !!c2.suffixIcon || se2.value || c2.showPassword || ue2.value || !!te2.value && ee2.value);
        const [ve2, pe2] = zc(N2);
        Ne(H2, (e3) => {
          be2();
          if (!ue2.value || c2.resize !== "both") return;
          const t2 = e3[0];
          const { width: n2 } = t2.contentRect;
          K2.value = { right: `calc(100% - ${n2 + 15 + 6}px)` };
        });
        const me2 = () => {
          const { type: e3, autosize: t2 } = c2;
          if (!ke || e3 !== "textarea" || !H2.value) return;
          if (t2) {
            const e4 = rt(t2) ? t2.minRows : void 0;
            const n2 = rt(t2) ? t2.maxRows : void 0;
            const a2 = yd(H2.value, e4, n2);
            q2.value = { overflowY: "hidden", ...a2 };
            vue.nextTick(() => {
              H2.value.offsetHeight;
              q2.value = a2;
            });
          } else {
            q2.value = { minHeight: yd(H2.value).minHeight };
          }
        };
        const he2 = (e3) => {
          let t2 = false;
          return () => {
            var n2;
            if (t2 || !c2.autosize) return;
            const a2 = ((n2 = H2.value) == null ? void 0 : n2.offsetParent) === null;
            if (!a2) {
              e3();
              t2 = true;
            }
          };
        };
        const be2 = he2(me2);
        const ge2 = () => {
          const e3 = G2.value;
          const t2 = c2.formatter ? c2.formatter(le2.value) : le2.value;
          if (!e3 || e3.value === t2) return;
          e3.value = t2;
        };
        const ye2 = async (e3) => {
          ve2();
          let { value: t2 } = e3.target;
          if (c2.formatter) {
            t2 = c2.parser ? c2.parser(t2) : t2;
          }
          if (W2.value) return;
          if (t2 === le2.value) {
            ge2();
            return;
          }
          l2(Is, t2);
          l2("input", t2);
          await vue.nextTick();
          ge2();
          pe2();
        };
        const we2 = (e3) => {
          l2("change", e3.target.value);
        };
        const xe2 = (e3) => {
          l2("compositionstart", e3);
          W2.value = true;
        };
        const Se2 = (e3) => {
          var t2;
          l2("compositionupdate", e3);
          const n2 = (t2 = e3.target) == null ? void 0 : t2.value;
          const a2 = n2[n2.length - 1] || "";
          W2.value = !js(a2);
        };
        const Ce2 = (e3) => {
          l2("compositionend", e3);
          if (W2.value) {
            W2.value = false;
            ye2(e3);
          }
        };
        const _e2 = () => {
          U2.value = !U2.value;
          Me2();
        };
        const Me2 = async () => {
          var e3;
          await vue.nextTick();
          (e3 = G2.value) == null ? void 0 : e3.focus();
        };
        const Oe2 = () => {
          var e3;
          return (e3 = G2.value) == null ? void 0 : e3.blur();
        };
        const De2 = (e3) => {
          Y2.value = false;
          l2("mouseleave", e3);
        };
        const Ae2 = (e3) => {
          Y2.value = true;
          l2("mouseenter", e3);
        };
        const Ee2 = (e3) => {
          l2("keydown", e3);
        };
        const $e2 = () => {
          var e3;
          (e3 = G2.value) == null ? void 0 : e3.select();
        };
        const Le2 = () => {
          l2(Is, "");
          l2("change", "");
          l2("clear");
          l2("input", "");
        };
        vue.watch(() => c2.modelValue, () => {
          var e3;
          vue.nextTick(() => me2());
          if (c2.validateEvent) {
            (e3 = B2 == null ? void 0 : B2.validate) == null ? void 0 : e3.call(B2, "change").catch((e4) => Pl());
          }
        });
        vue.watch(le2, () => ge2());
        vue.watch(() => c2.type, async () => {
          await vue.nextTick();
          ge2();
          me2();
        });
        vue.onMounted(() => {
          if (!c2.formatter && c2.parser) ;
          ge2();
          vue.nextTick(me2);
        });
        Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-input", ref: "https://element-plus.org/en-US/component/input.html" }, vue.computed(() => !!c2.label));
        o2({ input: N2, textarea: H2, ref: G2, textareaStyle: re2, autosize: vue.toRef(c2, "autosize"), focus: Me2, blur: Oe2, select: $e2, clear: Le2, resizeTextarea: me2 });
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", vue.mergeProps(vue.unref(p2), { class: vue.unref(m2), style: vue.unref(oe2), role: e3.containerRole, onMouseenter: Ae2, onMouseleave: De2 }), [vue.createCommentVNode(" input "), e3.type !== "textarea" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createCommentVNode(" prepend slot "), e3.$slots.prepend ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(j2).be("group", "prepend")) }, [vue.renderSlot(e3.$slots, "prepend")], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { ref_key: "wrapperRef", ref: Z2, class: vue.normalizeClass(vue.unref(b2)) }, [vue.createCommentVNode(" prefix slot "), e3.$slots.prefix || e3.prefixIcon ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(j2).e("prefix")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(j2).e("prefix-inner")) }, [vue.renderSlot(e3.$slots, "prefix"), e3.prefixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(j2).e("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.prefixIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 2)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", vue.mergeProps({ id: vue.unref(R2), ref_key: "input", ref: N2, class: vue.unref(j2).e("inner") }, vue.unref(g2), { minlength: e3.minlength, maxlength: e3.maxlength, type: e3.showPassword ? U2.value ? "text" : "password" : e3.type, disabled: vue.unref(F2), readonly: e3.readonly, autocomplete: e3.autocomplete, tabindex: e3.tabindex, "aria-label": e3.label || e3.ariaLabel, placeholder: e3.placeholder, style: e3.inputStyle, form: e3.form, autofocus: e3.autofocus, onCompositionstart: xe2, onCompositionupdate: Se2, onCompositionend: Ce2, onInput: ye2, onFocus: o3[0] || (o3[0] = (...e4) => vue.unref(X2) && vue.unref(X2)(...e4)), onBlur: o3[1] || (o3[1] = (...e4) => vue.unref(Q2) && vue.unref(Q2)(...e4)), onChange: we2, onKeydown: Ee2 }), null, 16, Sd), vue.createCommentVNode(" suffix slot "), vue.unref(fe2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(j2).e("suffix")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(j2).e("suffix-inner")) }, [!vue.unref(se2) || !vue.unref(ie2) || !vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.renderSlot(e3.$slots, "suffix"), e3.suffixIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(j2).e("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.suffixIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 64)) : vue.createCommentVNode("v-if", true), vue.unref(se2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 1, class: vue.normalizeClass([vue.unref(j2).e("icon"), vue.unref(j2).e("clear")]), onMousedown: vue.withModifiers(vue.unref(Xe), ["prevent"]), onClick: Le2 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(as))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.unref(ie2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 2, class: vue.normalizeClass([vue.unref(j2).e("icon"), vue.unref(j2).e("password")]), onClick: _e2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ae2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 3, class: vue.normalizeClass(vue.unref(j2).e("count")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(j2).e("count-inner")) }, vue.toDisplayString(vue.unref(ce2)) + " / " + vue.toDisplayString(e3.maxlength), 3)], 2)) : vue.createCommentVNode("v-if", true), vue.unref(te2) && vue.unref(ne2) && vue.unref(ee2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 4, class: vue.normalizeClass([vue.unref(j2).e("icon"), vue.unref(j2).e("validateIcon"), vue.unref(j2).is("loading", vue.unref(te2) === "validating")]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ne2))))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 2)], 2)) : vue.createCommentVNode("v-if", true)], 2), vue.createCommentVNode(" append slot "), e3.$slots.append ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, class: vue.normalizeClass(vue.unref(j2).be("group", "append")) }, [vue.renderSlot(e3.$slots, "append")], 2)) : vue.createCommentVNode("v-if", true)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createCommentVNode(" textarea "), vue.createElementVNode("textarea", vue.mergeProps({ id: vue.unref(R2), ref_key: "textarea", ref: H2, class: [vue.unref(z2).e("inner"), vue.unref(j2).is("focus", vue.unref(J2))] }, vue.unref(g2), { minlength: e3.minlength, maxlength: e3.maxlength, tabindex: e3.tabindex, disabled: vue.unref(F2), readonly: e3.readonly, autocomplete: e3.autocomplete, style: vue.unref(re2), "aria-label": e3.label || e3.ariaLabel, placeholder: e3.placeholder, form: e3.form, autofocus: e3.autofocus, onCompositionstart: xe2, onCompositionupdate: Se2, onCompositionend: Ce2, onInput: ye2, onFocus: o3[2] || (o3[2] = (...e4) => vue.unref(X2) && vue.unref(X2)(...e4)), onBlur: o3[3] || (o3[3] = (...e4) => vue.unref(Q2) && vue.unref(Q2)(...e4)), onChange: we2, onKeydown: Ee2 }), null, 16, Cd), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, style: vue.normalizeStyle(K2.value), class: vue.normalizeClass(vue.unref(j2).e("count")) }, vue.toDisplayString(vue.unref(ce2)) + " / " + vue.toDisplayString(e3.maxlength), 7)) : vue.createCommentVNode("v-if", true)], 64))], 16, xd));
      } });
      var Od = ad(Md, [["__file", "input.vue"]]);
      const Dd = Ds(Od);
      const Ad = 4;
      const Ed = { vertical: { offset: "offsetHeight", scroll: "scrollTop", scrollSize: "scrollHeight", size: "height", key: "vertical", axis: "Y", client: "clientY", direction: "top" }, horizontal: { offset: "offsetWidth", scroll: "scrollLeft", scrollSize: "scrollWidth", size: "width", key: "horizontal", axis: "X", client: "clientX", direction: "left" } };
      const $d = ({ move: e2, size: t2, bar: n2 }) => ({ [n2.size]: t2, transform: `translate${n2.axis}(${e2}%)` });
      const Ld = Symbol("scrollbarContextKey");
      const Id = Cs({ vertical: Boolean, size: String, move: Number, ratio: { type: Number, required: true }, always: Boolean });
      const Td = "Thumb";
      const Pd = vue.defineComponent({ __name: "thumb", props: Id, setup(e2) {
        const n2 = e2;
        const o2 = vue.inject(Ld);
        const l2 = oi("scrollbar");
        if (!o2) Tl(Td, "can not inject scrollbar context");
        const s2 = vue.ref();
        const u2 = vue.ref();
        const c2 = vue.ref({});
        const p2 = vue.ref(false);
        let m2 = false;
        let h2 = false;
        let b2 = ke ? document.onselectstart : null;
        const g2 = vue.computed(() => Ed[n2.vertical ? "vertical" : "horizontal"]);
        const y2 = vue.computed(() => $d({ size: n2.size, move: n2.move, bar: g2.value }));
        const w2 = vue.computed(() => s2.value[g2.value.offset] ** 2 / o2.wrapElement[g2.value.scrollSize] / n2.ratio / u2.value[g2.value.offset]);
        const x2 = (e3) => {
          var t2;
          e3.stopPropagation();
          if (e3.ctrlKey || [1, 2].includes(e3.button)) return;
          (t2 = window.getSelection()) == null ? void 0 : t2.removeAllRanges();
          C2(e3);
          const n3 = e3.currentTarget;
          if (!n3) return;
          c2.value[g2.value.axis] = n3[g2.value.offset] - (e3[g2.value.client] - n3.getBoundingClientRect()[g2.value.direction]);
        };
        const S2 = (e3) => {
          if (!u2.value || !s2.value || !o2.wrapElement) return;
          const t2 = Math.abs(e3.target.getBoundingClientRect()[g2.value.direction] - e3[g2.value.client]);
          const n3 = u2.value[g2.value.offset] / 2;
          const a2 = (t2 - n3) * 100 * w2.value / s2.value[g2.value.offset];
          o2.wrapElement[g2.value.scroll] = a2 * o2.wrapElement[g2.value.scrollSize] / 100;
        };
        const C2 = (e3) => {
          e3.stopImmediatePropagation();
          m2 = true;
          document.addEventListener("mousemove", _2);
          document.addEventListener("mouseup", M2);
          b2 = document.onselectstart;
          document.onselectstart = () => false;
        };
        const _2 = (e3) => {
          if (!s2.value || !u2.value) return;
          if (m2 === false) return;
          const t2 = c2.value[g2.value.axis];
          if (!t2) return;
          const n3 = (s2.value.getBoundingClientRect()[g2.value.direction] - e3[g2.value.client]) * -1;
          const a2 = u2.value[g2.value.offset] - t2;
          const r2 = (n3 - a2) * 100 * w2.value / s2.value[g2.value.offset];
          o2.wrapElement[g2.value.scroll] = r2 * o2.wrapElement[g2.value.scrollSize] / 100;
        };
        const M2 = () => {
          m2 = false;
          c2.value[g2.value.axis] = 0;
          document.removeEventListener("mousemove", _2);
          document.removeEventListener("mouseup", M2);
          L2();
          if (h2) p2.value = false;
        };
        const O2 = () => {
          h2 = false;
          p2.value = !!n2.size;
        };
        const $2 = () => {
          h2 = true;
          p2.value = m2;
        };
        vue.onBeforeUnmount(() => {
          L2();
          document.removeEventListener("mouseup", M2);
        });
        const L2 = () => {
          if (document.onselectstart !== b2) document.onselectstart = b2;
        };
        Le(vue.toRef(o2, "scrollbarElement"), "mousemove", O2);
        Le(vue.toRef(o2, "scrollbarElement"), "mouseleave", $2);
        return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(l2).b("fade"), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createElementVNode("div", { ref_key: "instance", ref: s2, class: vue.normalizeClass([vue.unref(l2).e("bar"), vue.unref(l2).is(vue.unref(g2).key)]), onMousedown: S2 }, [vue.createElementVNode("div", { ref_key: "thumb", ref: u2, class: vue.normalizeClass(vue.unref(l2).e("thumb")), style: vue.normalizeStyle(vue.unref(y2)), onMousedown: x2 }, null, 38)], 34), [[vue.vShow, e3.always || p2.value]])]), _: 1 }, 8, ["name"]));
      } });
      var Bd = ad(Pd, [["__file", "thumb.vue"]]);
      const Rd = Cs({ always: { type: Boolean, default: true }, minSize: { type: Number, required: true } });
      const Vd = vue.defineComponent({ __name: "bar", props: Rd, setup(e2, { expose: a2 }) {
        const o2 = e2;
        const r2 = vue.inject(Ld);
        const l2 = vue.ref(0);
        const s2 = vue.ref(0);
        const i2 = vue.ref("");
        const u2 = vue.ref("");
        const c2 = vue.ref(1);
        const d2 = vue.ref(1);
        const p2 = (e3) => {
          if (e3) {
            const t2 = e3.offsetHeight - Ad;
            const n2 = e3.offsetWidth - Ad;
            s2.value = e3.scrollTop * 100 / t2 * c2.value;
            l2.value = e3.scrollLeft * 100 / n2 * d2.value;
          }
        };
        const m2 = () => {
          const e3 = r2 == null ? void 0 : r2.wrapElement;
          if (!e3) return;
          const t2 = e3.offsetHeight - Ad;
          const n2 = e3.offsetWidth - Ad;
          const a3 = t2 ** 2 / e3.scrollHeight;
          const l3 = n2 ** 2 / e3.scrollWidth;
          const s3 = Math.max(a3, o2.minSize);
          const f2 = Math.max(l3, o2.minSize);
          c2.value = a3 / (t2 - a3) / (s3 / (t2 - s3));
          d2.value = l3 / (n2 - l3) / (f2 / (n2 - f2));
          u2.value = s3 + Ad < t2 ? `${s3}px` : "";
          i2.value = f2 + Ad < n2 ? `${f2}px` : "";
        };
        a2({ handleScroll: p2, update: m2 });
        return (e3, a3) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [vue.createVNode(Bd, { move: l2.value, ratio: d2.value, size: i2.value, always: e3.always }, null, 8, ["move", "ratio", "size", "always"]), vue.createVNode(Bd, { move: s2.value, ratio: c2.value, size: u2.value, vertical: "", always: e3.always }, null, 8, ["move", "ratio", "size", "always"])], 64));
      } });
      var Fd = ad(Vd, [["__file", "bar.vue"]]);
      const jd = Cs({ height: { type: [String, Number], default: "" }, maxHeight: { type: [String, Number], default: "" }, native: { type: Boolean, default: false }, wrapStyle: { type: ks([String, Object, Array]), default: "" }, wrapClass: { type: [String, Array], default: "" }, viewClass: { type: [String, Array], default: "" }, viewStyle: { type: [String, Array, Object], default: "" }, noresize: Boolean, tag: { type: String, default: "div" }, always: Boolean, minSize: { type: Number, default: 20 }, id: String, role: String, ...Zc(["ariaLabel", "ariaOrientation"]) });
      const zd = { scroll: ({ scrollTop: e2, scrollLeft: t2 }) => [e2, t2].every(Ol) };
      const Nd = "ElScrollbar";
      const Hd = vue.defineComponent({ name: Nd });
      const Yd = vue.defineComponent({ ...Hd, props: jd, emits: zd, setup(e2, { expose: o2, emit: l2 }) {
        const c2 = e2;
        const d2 = oi("scrollbar");
        let f2 = void 0;
        let p2 = void 0;
        const m2 = vue.ref();
        const h2 = vue.ref();
        const b2 = vue.ref();
        const y2 = vue.ref();
        const k2 = vue.computed(() => {
          const e3 = {};
          if (c2.height) e3.height = zl(c2.height);
          if (c2.maxHeight) e3.maxHeight = zl(c2.maxHeight);
          return [c2.wrapStyle, e3];
        });
        const x2 = vue.computed(() => [c2.wrapClass, d2.e("wrap"), { [d2.em("wrap", "hidden-default")]: !c2.native }]);
        const S2 = vue.computed(() => [d2.e("view"), c2.viewClass]);
        const C2 = () => {
          var e3;
          if (h2.value) {
            (e3 = y2.value) == null ? void 0 : e3.handleScroll(h2.value);
            l2("scroll", { scrollTop: h2.value.scrollTop, scrollLeft: h2.value.scrollLeft });
          }
        };
        function O2(e3, t2) {
          if (rt(e3)) {
            h2.value.scrollTo(e3);
          } else if (Ol(e3) && Ol(t2)) {
            h2.value.scrollTo(e3, t2);
          }
        }
        const L2 = (e3) => {
          if (!Ol(e3)) {
            return;
          }
          h2.value.scrollTop = e3;
        };
        const I2 = (e3) => {
          if (!Ol(e3)) {
            return;
          }
          h2.value.scrollLeft = e3;
        };
        const T2 = () => {
          var e3;
          (e3 = y2.value) == null ? void 0 : e3.update();
        };
        vue.watch(() => c2.noresize, (e3) => {
          if (e3) {
            f2 == null ? void 0 : f2();
            p2 == null ? void 0 : p2();
          } else {
            ({ stop: f2 } = Ne(b2, T2));
            p2 = Le("resize", T2);
          }
        }, { immediate: true });
        vue.watch(() => [c2.maxHeight, c2.height], () => {
          if (!c2.native) vue.nextTick(() => {
            var e3;
            T2();
            if (h2.value) {
              (e3 = y2.value) == null ? void 0 : e3.handleScroll(h2.value);
            }
          });
        });
        vue.provide(Ld, vue.reactive({ scrollbarElement: m2, wrapElement: h2 }));
        vue.onMounted(() => {
          if (!c2.native) vue.nextTick(() => {
            T2();
          });
        });
        vue.onUpdated(() => T2());
        o2({ wrapRef: h2, update: T2, scrollTo: O2, setScrollTop: L2, setScrollLeft: I2, handleScroll: C2 });
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { ref_key: "scrollbarRef", ref: m2, class: vue.normalizeClass(vue.unref(d2).b()) }, [vue.createElementVNode("div", { ref_key: "wrapRef", ref: h2, class: vue.normalizeClass(vue.unref(x2)), style: vue.normalizeStyle(vue.unref(k2)), onScroll: C2 }, [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), { id: e3.id, ref_key: "resizeRef", ref: b2, class: vue.normalizeClass(vue.unref(S2)), style: vue.normalizeStyle(e3.viewStyle), role: e3.role, "aria-label": e3.ariaLabel, "aria-orientation": e3.ariaOrientation }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "style", "role", "aria-label", "aria-orientation"]))], 38), !e3.native ? (vue.openBlock(), vue.createBlock(Fd, { key: 0, ref_key: "barRef", ref: y2, always: e3.always, "min-size": e3.minSize }, null, 8, ["always", "min-size"])) : vue.createCommentVNode("v-if", true)], 2));
      } });
      var Wd = ad(Yd, [["__file", "scrollbar.vue"]]);
      const Ud = Ds(Wd);
      const Kd = Symbol("popper");
      const qd = Symbol("popperContent");
      const Gd = ["dialog", "grid", "group", "listbox", "menu", "navigation", "tooltip", "tree"];
      const Zd = Cs({ role: { type: String, values: Gd, default: "tooltip" } });
      const Jd = vue.defineComponent({ name: "ElPopper", inheritAttrs: false });
      const Xd = vue.defineComponent({ ...Jd, props: Zd, setup(e2, { expose: t2 }) {
        const n2 = e2;
        const a2 = vue.ref();
        const o2 = vue.ref();
        const l2 = vue.ref();
        const s2 = vue.ref();
        const i2 = vue.computed(() => n2.role);
        const u2 = { triggerRef: a2, popperInstanceRef: o2, contentRef: l2, referenceRef: s2, role: i2 };
        t2(u2);
        vue.provide(Kd, u2);
        return (e3, t3) => vue.renderSlot(e3.$slots, "default");
      } });
      var Qd = ad(Xd, [["__file", "popper.vue"]]);
      const ef = Cs({ arrowOffset: { type: Number, default: 5 } });
      const tf = vue.defineComponent({ name: "ElPopperArrow", inheritAttrs: false });
      const nf = vue.defineComponent({ ...tf, props: ef, setup(e2, { expose: a2 }) {
        const o2 = e2;
        const r2 = oi("popper");
        const { arrowOffset: l2, arrowRef: u2, arrowStyle: c2 } = vue.inject(qd, void 0);
        vue.watch(() => o2.arrowOffset, (e3) => {
          l2.value = e3;
        });
        vue.onBeforeUnmount(() => {
          u2.value = void 0;
        });
        a2({ arrowRef: u2 });
        return (e3, a3) => (vue.openBlock(), vue.createElementBlock("span", { ref_key: "arrowRef", ref: u2, class: vue.normalizeClass(vue.unref(r2).e("arrow")), style: vue.normalizeStyle(vue.unref(c2)), "data-popper-arrow": "" }, null, 6));
      } });
      var af = ad(nf, [["__file", "arrow.vue"]]);
      const of = "ElOnlyChild";
      const rf = vue.defineComponent({ name: of, setup(e2, { slots: t2, attrs: n2 }) {
        var a2;
        const o2 = vue.inject(Lc);
        const r2 = Tc((a2 = o2 == null ? void 0 : o2.setForwardRef) != null ? a2 : Xe);
        return () => {
          var e3;
          const a3 = (e3 = t2.default) == null ? void 0 : e3.call(t2, n2);
          if (!a3) return null;
          if (a3.length > 1) {
            return null;
          }
          const o3 = lf(a3);
          if (!o3) {
            return null;
          }
          return vue.withDirectives(vue.cloneVNode(o3, n2), [[r2]]);
        };
      } });
      function lf(e2) {
        if (!e2) return null;
        const t2 = e2;
        for (const e3 of t2) {
          if (rt(e3)) {
            switch (e3.type) {
              case vue.Comment:
                continue;
              case vue.Text:
              case "svg":
                return sf(e3);
              case vue.Fragment:
                return lf(e3.children);
              default:
                return e3;
            }
          }
          return sf(e3);
        }
        return null;
      }
      function sf(e2) {
        const t2 = oi("only-child");
        return vue.createVNode("span", { class: t2.e("content") }, [e2]);
      }
      const uf = Cs({ virtualRef: { type: ks(Object) }, virtualTriggering: Boolean, onMouseenter: { type: ks(Function) }, onMouseleave: { type: ks(Function) }, onClick: { type: ks(Function) }, onKeydown: { type: ks(Function) }, onFocus: { type: ks(Function) }, onBlur: { type: ks(Function) }, onContextmenu: { type: ks(Function) }, id: String, open: Boolean });
      const cf = vue.defineComponent({ name: "ElPopperTrigger", inheritAttrs: false });
      const df = vue.defineComponent({ ...cf, props: uf, setup(e2, { expose: n2 }) {
        const a2 = e2;
        const { role: o2, triggerRef: l2 } = vue.inject(Kd, void 0);
        Ic(l2);
        const c2 = vue.computed(() => p2.value ? a2.id : void 0);
        const v2 = vue.computed(() => {
          if (o2 && o2.value === "tooltip") {
            return a2.open && a2.id ? a2.id : void 0;
          }
          return void 0;
        });
        const p2 = vue.computed(() => {
          if (o2 && o2.value !== "tooltip") {
            return o2.value;
          }
          return void 0;
        });
        const m2 = vue.computed(() => p2.value ? `${a2.open}` : void 0);
        let h2 = void 0;
        vue.onMounted(() => {
          vue.watch(() => a2.virtualRef, (e3) => {
            if (e3) {
              l2.value = Ee(e3);
            }
          }, { immediate: true });
          vue.watch(l2, (e3, t2) => {
            h2 == null ? void 0 : h2();
            h2 = void 0;
            if (Al(e3)) {
              ["onMouseenter", "onMouseleave", "onClick", "onKeydown", "onFocus", "onBlur", "onContextmenu"].forEach((n3) => {
                var o3;
                const r2 = a2[n3];
                if (r2) {
                  e3.addEventListener(n3.slice(2).toLowerCase(), r2);
                  (o3 = t2 == null ? void 0 : t2.removeEventListener) == null ? void 0 : o3.call(t2, n3.slice(2).toLowerCase(), r2);
                }
              });
              h2 = vue.watch([c2, v2, p2, m2], (t3) => {
                ["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((n3, a3) => {
                  yl(t3[a3]) ? e3.removeAttribute(n3) : e3.setAttribute(n3, t3[a3]);
                });
              }, { immediate: true });
            }
            if (Al(t2)) {
              ["aria-controls", "aria-describedby", "aria-haspopup", "aria-expanded"].forEach((e4) => t2.removeAttribute(e4));
            }
          }, { immediate: true });
        });
        vue.onBeforeUnmount(() => {
          h2 == null ? void 0 : h2();
          h2 = void 0;
        });
        n2({ triggerRef: l2 });
        return (e3, n3) => !e3.virtualTriggering ? (vue.openBlock(), vue.createBlock(vue.unref(rf), vue.mergeProps({ key: 0 }, e3.$attrs, { "aria-controls": vue.unref(c2), "aria-describedby": vue.unref(v2), "aria-expanded": vue.unref(m2), "aria-haspopup": vue.unref(p2) }), { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 16, ["aria-controls", "aria-describedby", "aria-expanded", "aria-haspopup"])) : vue.createCommentVNode("v-if", true);
      } });
      var ff = ad(df, [["__file", "trigger.vue"]]);
      const vf = "focus-trap.focus-after-trapped";
      const pf = "focus-trap.focus-after-released";
      const mf = "focus-trap.focusout-prevented";
      const hf = { cancelable: true, bubbles: false };
      const bf = { cancelable: true, bubbles: false };
      const gf = "focusAfterTrapped";
      const yf = "focusAfterReleased";
      const wf = Symbol("elFocusTrap");
      const kf = vue.ref();
      const xf = vue.ref(0);
      const Sf = vue.ref(0);
      let Cf = 0;
      const _f = (e2) => {
        const t2 = [];
        const n2 = document.createTreeWalker(e2, NodeFilter.SHOW_ELEMENT, { acceptNode: (e3) => {
          const t3 = e3.tagName === "INPUT" && e3.type === "hidden";
          if (e3.disabled || e3.hidden || t3) return NodeFilter.FILTER_SKIP;
          return e3.tabIndex >= 0 || e3 === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP;
        } });
        while (n2.nextNode()) t2.push(n2.currentNode);
        return t2;
      };
      const Mf = (e2, t2) => {
        for (const n2 of e2) {
          if (!Of(n2, t2)) return n2;
        }
      };
      const Of = (e2, t2) => {
        if (getComputedStyle(e2).visibility === "hidden") return true;
        while (e2) {
          if (t2 && e2 === t2) return false;
          if (getComputedStyle(e2).display === "none") return true;
          e2 = e2.parentElement;
        }
        return false;
      };
      const Df = (e2) => {
        const t2 = _f(e2);
        const n2 = Mf(t2, e2);
        const a2 = Mf(t2.reverse(), e2);
        return [n2, a2];
      };
      const Af = (e2) => e2 instanceof HTMLInputElement && "select" in e2;
      const Ef = (e2, t2) => {
        if (e2 && e2.focus) {
          const n2 = document.activeElement;
          e2.focus({ preventScroll: true });
          Sf.value = window.performance.now();
          if (e2 !== n2 && Af(e2) && t2) {
            e2.select();
          }
        }
      };
      function $f(e2, t2) {
        const n2 = [...e2];
        const a2 = e2.indexOf(t2);
        if (a2 !== -1) {
          n2.splice(a2, 1);
        }
        return n2;
      }
      const Lf = () => {
        let e2 = [];
        const t2 = (t3) => {
          const n3 = e2[0];
          if (n3 && t3 !== n3) {
            n3.pause();
          }
          e2 = $f(e2, t3);
          e2.unshift(t3);
        };
        const n2 = (t3) => {
          var n3, a2;
          e2 = $f(e2, t3);
          (a2 = (n3 = e2[0]) == null ? void 0 : n3.resume) == null ? void 0 : a2.call(n3);
        };
        return { push: t2, remove: n2 };
      };
      const If = (e2, t2 = false) => {
        const n2 = document.activeElement;
        for (const a2 of e2) {
          Ef(a2, t2);
          if (document.activeElement !== n2) return;
        }
      };
      const Tf = Lf();
      const Pf = () => xf.value > Sf.value;
      const Bf = () => {
        kf.value = "pointer";
        xf.value = window.performance.now();
      };
      const Rf = () => {
        kf.value = "keyboard";
        xf.value = window.performance.now();
      };
      const Vf = () => {
        vue.onMounted(() => {
          if (Cf === 0) {
            document.addEventListener("mousedown", Bf);
            document.addEventListener("touchstart", Bf);
            document.addEventListener("keydown", Rf);
          }
          Cf++;
        });
        vue.onBeforeUnmount(() => {
          Cf--;
          if (Cf <= 0) {
            document.removeEventListener("mousedown", Bf);
            document.removeEventListener("touchstart", Bf);
            document.removeEventListener("keydown", Rf);
          }
        });
        return { focusReason: kf, lastUserFocusTimestamp: xf, lastAutomatedFocusTimestamp: Sf };
      };
      const Ff = (e2) => new CustomEvent(mf, { ...bf, detail: e2 });
      const jf = vue.defineComponent({ name: "ElFocusTrap", inheritAttrs: false, props: { loop: Boolean, trapped: Boolean, focusTrapEl: Object, focusStartEl: { type: [Object, String], default: "first" } }, emits: [gf, yf, "focusin", "focusout", "focusout-prevented", "release-requested"], setup(e2, { emit: t2 }) {
        const n2 = vue.ref();
        let a2;
        let o2;
        const { focusReason: r2 } = Vf();
        _c((n3) => {
          if (e2.trapped && !l2.paused) {
            t2("release-requested", n3);
          }
        });
        const l2 = { paused: false, pause() {
          this.paused = true;
        }, resume() {
          this.paused = false;
        } };
        const c2 = (n3) => {
          if (!e2.loop && !e2.trapped) return;
          if (l2.paused) return;
          const { key: a3, altKey: o3, ctrlKey: s2, metaKey: i2, currentTarget: u2, shiftKey: c3 } = n3;
          const { loop: d2 } = e2;
          const f3 = a3 === $s.tab && !o3 && !s2 && !i2;
          const v2 = document.activeElement;
          if (f3 && v2) {
            const e3 = u2;
            const [a4, o4] = Df(e3);
            const l3 = a4 && o4;
            if (!l3) {
              if (v2 === e3) {
                const e4 = Ff({ focusReason: r2.value });
                t2("focusout-prevented", e4);
                if (!e4.defaultPrevented) {
                  n3.preventDefault();
                }
              }
            } else {
              if (!c3 && v2 === o4) {
                const e4 = Ff({ focusReason: r2.value });
                t2("focusout-prevented", e4);
                if (!e4.defaultPrevented) {
                  n3.preventDefault();
                  if (d2) Ef(a4, true);
                }
              } else if (c3 && [a4, e3].includes(v2)) {
                const e4 = Ff({ focusReason: r2.value });
                t2("focusout-prevented", e4);
                if (!e4.defaultPrevented) {
                  n3.preventDefault();
                  if (d2) Ef(o4, true);
                }
              }
            }
          }
        };
        vue.provide(wf, { focusTrapRef: n2, onKeydown: c2 });
        vue.watch(() => e2.focusTrapEl, (e3) => {
          if (e3) {
            n2.value = e3;
          }
        }, { immediate: true });
        vue.watch([n2], ([e3], [t3]) => {
          if (e3) {
            e3.addEventListener("keydown", c2);
            e3.addEventListener("focusin", m2);
            e3.addEventListener("focusout", h2);
          }
          if (t3) {
            t3.removeEventListener("keydown", c2);
            t3.removeEventListener("focusin", m2);
            t3.removeEventListener("focusout", h2);
          }
        });
        const f2 = (e3) => {
          t2(gf, e3);
        };
        const p2 = (e3) => t2(yf, e3);
        const m2 = (r3) => {
          const s2 = vue.unref(n2);
          if (!s2) return;
          const u2 = r3.target;
          const c3 = r3.relatedTarget;
          const d2 = u2 && s2.contains(u2);
          if (!e2.trapped) {
            const e3 = c3 && s2.contains(c3);
            if (!e3) {
              a2 = c3;
            }
          }
          if (d2) t2("focusin", r3);
          if (l2.paused) return;
          if (e2.trapped) {
            if (d2) {
              o2 = u2;
            } else {
              Ef(o2, true);
            }
          }
        };
        const h2 = (a3) => {
          const s2 = vue.unref(n2);
          if (l2.paused || !s2) return;
          if (e2.trapped) {
            const n3 = a3.relatedTarget;
            if (!yl(n3) && !s2.contains(n3)) {
              setTimeout(() => {
                if (!l2.paused && e2.trapped) {
                  const e3 = Ff({ focusReason: r2.value });
                  t2("focusout-prevented", e3);
                  if (!e3.defaultPrevented) {
                    Ef(o2, true);
                  }
                }
              }, 0);
            }
          } else {
            const e3 = a3.target;
            const n3 = e3 && s2.contains(e3);
            if (!n3) t2("focusout", a3);
          }
        };
        async function b2() {
          await vue.nextTick();
          const t3 = vue.unref(n2);
          if (t3) {
            Tf.push(l2);
            const n3 = t3.contains(document.activeElement) ? a2 : document.activeElement;
            a2 = n3;
            const o3 = t3.contains(n3);
            if (!o3) {
              const a3 = new Event(vf, hf);
              t3.addEventListener(vf, f2);
              t3.dispatchEvent(a3);
              if (!a3.defaultPrevented) {
                vue.nextTick(() => {
                  let a4 = e2.focusStartEl;
                  if (!ot(a4)) {
                    Ef(a4);
                    if (document.activeElement !== a4) {
                      a4 = "first";
                    }
                  }
                  if (a4 === "first") {
                    If(_f(t3), true);
                  }
                  if (document.activeElement === n3 || a4 === "container") {
                    Ef(t3);
                  }
                });
              }
            }
          }
        }
        function y2() {
          const e3 = vue.unref(n2);
          if (e3) {
            e3.removeEventListener(vf, f2);
            const t3 = new CustomEvent(pf, { ...hf, detail: { focusReason: r2.value } });
            e3.addEventListener(pf, p2);
            e3.dispatchEvent(t3);
            if (!t3.defaultPrevented && (r2.value == "keyboard" || !Pf() || e3.contains(document.activeElement))) {
              Ef(a2 != null ? a2 : document.body);
            }
            e3.removeEventListener(pf, p2);
            Tf.remove(l2);
          }
        }
        vue.onMounted(() => {
          if (e2.trapped) {
            b2();
          }
          vue.watch(() => e2.trapped, (e3) => {
            if (e3) {
              b2();
            } else {
              y2();
            }
          });
        });
        vue.onBeforeUnmount(() => {
          if (e2.trapped) {
            y2();
          }
        });
        return { onKeydown: c2 };
      } });
      function zf(e2, t2, n2, a2, o2, r2) {
        return vue.renderSlot(e2.$slots, "default", { handleKeydown: e2.onKeydown });
      }
      var Nf = ad(jf, [["render", zf], ["__file", "focus-trap.vue"]]);
      const Hf = ["fixed", "absolute"];
      const Yf = Cs({ boundariesPadding: { type: Number, default: 0 }, fallbackPlacements: { type: ks(Array), default: void 0 }, gpuAcceleration: { type: Boolean, default: true }, offset: { type: Number, default: 12 }, placement: { type: String, values: Si, default: "bottom" }, popperOptions: { type: ks(Object), default: () => ({}) }, strategy: { type: String, values: Hf, default: "absolute" } });
      const Wf = Cs({ ...Yf, id: String, style: { type: ks([String, Array, Object]) }, className: { type: ks([String, Array, Object]) }, effect: { type: String, default: "dark" }, visible: Boolean, enterable: { type: Boolean, default: true }, pure: Boolean, focusOnShow: { type: Boolean, default: false }, trapping: { type: Boolean, default: false }, popperClass: { type: ks([String, Array, Object]) }, popperStyle: { type: ks([String, Array, Object]) }, referenceEl: { type: ks(Object) }, triggerTargetEl: { type: ks(Object) }, stopPopperMouseEvent: { type: Boolean, default: true }, virtualTriggering: Boolean, zIndex: Number, ...Zc(["ariaLabel"]) });
      const Uf = { mouseenter: (e2) => e2 instanceof MouseEvent, mouseleave: (e2) => e2 instanceof MouseEvent, focus: () => true, blur: () => true, close: () => true };
      const Kf = (e2, t2 = []) => {
        const { placement: n2, strategy: a2, popperOptions: o2 } = e2;
        const r2 = { placement: n2, strategy: a2, ...o2, modifiers: [...Gf(e2), ...t2] };
        Zf(r2, o2 == null ? void 0 : o2.modifiers);
        return r2;
      };
      const qf = (e2) => {
        if (!ke) return;
        return Ee(e2);
      };
      function Gf(e2) {
        const { offset: t2, gpuAcceleration: n2, fallbackPlacements: a2 } = e2;
        return [{ name: "offset", options: { offset: [0, t2 != null ? t2 : 12] } }, { name: "preventOverflow", options: { padding: { top: 2, bottom: 2, left: 5, right: 5 } } }, { name: "flip", options: { padding: 5, fallbackPlacements: a2 } }, { name: "computeStyles", options: { gpuAcceleration: n2 } }];
      }
      function Zf(e2, t2) {
        if (t2) {
          e2.modifiers = [...e2.modifiers, ...t2 != null ? t2 : []];
        }
      }
      const Jf = 0;
      const Xf = (e2) => {
        const { popperInstanceRef: t2, contentRef: n2, triggerRef: a2, role: o2 } = vue.inject(Kd, void 0);
        const l2 = vue.ref();
        const c2 = vue.ref();
        const d2 = vue.computed(() => ({ name: "eventListeners", enabled: !!e2.visible }));
        const p2 = vue.computed(() => {
          var e3;
          const t3 = vue.unref(l2);
          const n3 = (e3 = vue.unref(c2)) != null ? e3 : Jf;
          return { name: "arrow", enabled: !wl(t3), options: { element: t3, padding: n3 } };
        });
        const m2 = vue.computed(() => ({ onFirstUpdate: () => {
          w2();
        }, ...Kf(e2, [vue.unref(p2), vue.unref(d2)]) }));
        const h2 = vue.computed(() => qf(e2.referenceEl) || vue.unref(a2));
        const { attributes: b2, state: g2, styles: y2, update: w2, forceUpdate: k2, instanceRef: x2 } = mc(h2, n2, m2);
        vue.watch(x2, (e3) => t2.value = e3);
        vue.onMounted(() => {
          vue.watch(() => {
            var e3;
            return (e3 = vue.unref(h2)) == null ? void 0 : e3.getBoundingClientRect();
          }, () => {
            w2();
          });
        });
        return { attributes: b2, arrowRef: l2, contentRef: n2, instanceRef: x2, state: g2, styles: y2, role: o2, forceUpdate: k2, update: w2 };
      };
      const Qf = (e2, { attributes: t2, styles: n2, role: a2 }) => {
        const { nextZIndex: o2 } = jc();
        const l2 = oi("popper");
        const s2 = vue.computed(() => vue.unref(t2).popper);
        const u2 = vue.ref(Ol(e2.zIndex) ? e2.zIndex : o2());
        const c2 = vue.computed(() => [l2.b(), l2.is("pure", e2.pure), l2.is(e2.effect), e2.popperClass]);
        const d2 = vue.computed(() => [{ zIndex: vue.unref(u2) }, vue.unref(n2).popper, e2.popperStyle || {}]);
        const f2 = vue.computed(() => a2.value === "dialog" ? "false" : void 0);
        const p2 = vue.computed(() => vue.unref(n2).arrow || {});
        const m2 = () => {
          u2.value = Ol(e2.zIndex) ? e2.zIndex : o2();
        };
        return { ariaModal: f2, arrowStyle: p2, contentAttrs: s2, contentClass: c2, contentStyle: d2, contentZIndex: u2, updateZIndex: m2 };
      };
      const ev = (e2, t2) => {
        const n2 = vue.ref(false);
        const a2 = vue.ref();
        const o2 = () => {
          t2("focus");
        };
        const r2 = (e3) => {
          var n3;
          if (((n3 = e3.detail) == null ? void 0 : n3.focusReason) !== "pointer") {
            a2.value = "first";
            t2("blur");
          }
        };
        const l2 = (t3) => {
          if (e2.visible && !n2.value) {
            if (t3.target) {
              a2.value = t3.target;
            }
            n2.value = true;
          }
        };
        const s2 = (t3) => {
          if (!e2.trapping) {
            if (t3.detail.focusReason === "pointer") {
              t3.preventDefault();
            }
            n2.value = false;
          }
        };
        const i2 = () => {
          n2.value = false;
          t2("close");
        };
        return { focusStartRef: a2, trapped: n2, onFocusAfterReleased: r2, onFocusAfterTrapped: o2, onFocusInTrap: l2, onFocusoutPrevented: s2, onReleaseRequested: i2 };
      };
      const tv = vue.defineComponent({ name: "ElPopperContent" });
      const nv = vue.defineComponent({ ...tv, props: Wf, emits: Uf, setup(e2, { expose: a2, emit: o2 }) {
        const r2 = e2;
        const { focusStartRef: l2, trapped: c2, onFocusAfterReleased: p2, onFocusAfterTrapped: m2, onFocusInTrap: h2, onFocusoutPrevented: b2, onReleaseRequested: k2 } = ev(r2, o2);
        const { attributes: x2, arrowRef: S2, contentRef: C2, styles: _2, instanceRef: M2, role: O2, update: D2 } = Xf(r2);
        const { ariaModal: A2, arrowStyle: $2, contentAttrs: L2, contentClass: T2, contentStyle: P2, updateZIndex: B2 } = Qf(r2, { styles: _2, attributes: x2, role: O2 });
        const R2 = vue.inject(cd, void 0);
        const V2 = vue.ref();
        vue.provide(qd, { arrowStyle: $2, arrowRef: S2, arrowOffset: V2 });
        if (R2) {
          vue.provide(cd, { ...R2, addInputId: Xe, removeInputId: Xe });
        }
        let F2 = void 0;
        const j2 = (e3 = true) => {
          D2();
          e3 && B2();
        };
        const z2 = () => {
          j2(false);
          if (r2.visible && r2.focusOnShow) {
            c2.value = true;
          } else if (r2.visible === false) {
            c2.value = false;
          }
        };
        vue.onMounted(() => {
          vue.watch(() => r2.triggerTargetEl, (e3, t2) => {
            F2 == null ? void 0 : F2();
            F2 = void 0;
            const n2 = vue.unref(e3 || C2.value);
            const a3 = vue.unref(t2 || C2.value);
            if (Al(n2)) {
              F2 = vue.watch([O2, () => r2.ariaLabel, A2, () => r2.id], (e4) => {
                ["role", "aria-label", "aria-modal", "id"].forEach((t3, a4) => {
                  yl(e4[a4]) ? n2.removeAttribute(t3) : n2.setAttribute(t3, e4[a4]);
                });
              }, { immediate: true });
            }
            if (a3 !== n2 && Al(a3)) {
              ["role", "aria-label", "aria-modal", "id"].forEach((e4) => {
                a3.removeAttribute(e4);
              });
            }
          }, { immediate: true });
          vue.watch(() => r2.visible, z2, { immediate: true });
        });
        vue.onBeforeUnmount(() => {
          F2 == null ? void 0 : F2();
          F2 = void 0;
        });
        a2({ popperContentRef: C2, popperInstanceRef: M2, updatePopper: j2, contentStyle: P2 });
        return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", vue.mergeProps({ ref_key: "contentRef", ref: C2 }, vue.unref(L2), { style: vue.unref(P2), class: vue.unref(T2), tabindex: "-1", onMouseenter: a3[0] || (a3[0] = (t2) => e3.$emit("mouseenter", t2)), onMouseleave: a3[1] || (a3[1] = (t2) => e3.$emit("mouseleave", t2)) }), [vue.createVNode(vue.unref(Nf), { trapped: vue.unref(c2), "trap-on-focus-in": true, "focus-trap-el": vue.unref(C2), "focus-start-el": vue.unref(l2), onFocusAfterTrapped: vue.unref(m2), onFocusAfterReleased: vue.unref(p2), onFocusin: vue.unref(h2), onFocusoutPrevented: vue.unref(b2), onReleaseRequested: vue.unref(k2) }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusin", "onFocusoutPrevented", "onReleaseRequested"])], 16));
      } });
      var av = ad(nv, [["__file", "content.vue"]]);
      const ov = Ds(Qd);
      const rv = Symbol("elTooltip");
      const lv = Cs({ ...Ec, ...Wf, appendTo: { type: ks([String, Object]) }, content: { type: String, default: "" }, rawContent: { type: Boolean, default: false }, persistent: Boolean, visible: { type: ks(Boolean), default: null }, transition: String, teleported: { type: Boolean, default: true }, disabled: Boolean, ...Zc(["ariaLabel"]) });
      const sv = Cs({ ...uf, disabled: Boolean, trigger: { type: ks([String, Array]), default: "hover" }, triggerKeys: { type: ks(Array), default: () => [$s.enter, $s.space] } });
      const { useModelToggleProps: iv, useModelToggleEmits: uv, useModelToggle: cv } = ii("visible");
      const dv = Cs({ ...Zd, ...iv, ...lv, ...sv, ...ef, showArrow: { type: Boolean, default: true } });
      const fv = [...uv, "before-show", "before-hide", "show", "hide", "open", "close"];
      const vv = (e2, t2) => {
        if (tt(e2)) {
          return e2.includes(t2);
        }
        return e2 === t2;
      };
      const pv = (e2, t2, n2) => (a2) => {
        vv(vue.unref(e2), t2) && n2(a2);
      };
      const mv = vue.defineComponent({ name: "ElTooltipTrigger" });
      const hv = vue.defineComponent({ ...mv, props: sv, setup(e2, { expose: n2 }) {
        const a2 = e2;
        const o2 = oi("tooltip");
        const { controlled: r2, id: l2, open: s2, onOpen: u2, onClose: c2, onToggle: d2 } = vue.inject(rv, void 0);
        const p2 = vue.ref(null);
        const m2 = () => {
          if (vue.unref(r2) || a2.disabled) {
            return true;
          }
        };
        const h2 = vue.toRef(a2, "trigger");
        const b2 = ye(m2, pv(h2, "hover", u2));
        const g2 = ye(m2, pv(h2, "hover", c2));
        const y2 = ye(m2, pv(h2, "click", (e3) => {
          if (e3.button === 0) {
            d2(e3);
          }
        }));
        const x2 = ye(m2, pv(h2, "focus", u2));
        const S2 = ye(m2, pv(h2, "focus", c2));
        const C2 = ye(m2, pv(h2, "contextmenu", (e3) => {
          e3.preventDefault();
          d2(e3);
        }));
        const _2 = ye(m2, (e3) => {
          const { code: t2 } = e3;
          if (a2.triggerKeys.includes(t2)) {
            e3.preventDefault();
            d2(e3);
          }
        });
        n2({ triggerRef: p2 });
        return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.unref(ff), { id: vue.unref(l2), "virtual-ref": e3.virtualRef, open: vue.unref(s2), "virtual-triggering": e3.virtualTriggering, class: vue.normalizeClass(vue.unref(o2).e("trigger")), onBlur: vue.unref(S2), onClick: vue.unref(y2), onContextmenu: vue.unref(C2), onFocus: vue.unref(x2), onMouseenter: vue.unref(b2), onMouseleave: vue.unref(g2), onKeydown: vue.unref(_2) }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "virtual-ref", "open", "virtual-triggering", "class", "onBlur", "onClick", "onContextmenu", "onFocus", "onMouseenter", "onMouseleave", "onKeydown"]));
      } });
      var bv = ad(hv, [["__file", "trigger.vue"]]);
      const gv = vue.defineComponent({ name: "ElTooltipContent", inheritAttrs: false });
      const yv = vue.defineComponent({ ...gv, props: lv, setup(e2, { expose: n2 }) {
        const a2 = e2;
        const { selector: o2 } = Oc();
        const l2 = oi("tooltip");
        const u2 = vue.ref(null);
        const c2 = vue.ref(false);
        const { controlled: p2, id: m2, open: h2, trigger: b2, onClose: g2, onOpen: k2, onShow: x2, onHide: S2, onBeforeShow: C2, onBeforeHide: _2 } = vue.inject(rv, void 0);
        const O2 = vue.computed(() => a2.transition || `${l2.namespace.value}-fade-in-linear`);
        const D2 = vue.computed(() => a2.persistent);
        vue.onBeforeUnmount(() => {
          c2.value = true;
        });
        const $2 = vue.computed(() => vue.unref(D2) ? true : vue.unref(h2));
        const L2 = vue.computed(() => a2.disabled ? false : vue.unref(h2));
        const T2 = vue.computed(() => a2.appendTo || o2.value);
        const P2 = vue.computed(() => {
          var e3;
          return (e3 = a2.style) != null ? e3 : {};
        });
        const F2 = vue.computed(() => !vue.unref(h2));
        const j2 = () => {
          S2();
        };
        const z2 = () => {
          if (vue.unref(p2)) return true;
        };
        const N2 = ye(z2, () => {
          if (a2.enterable && vue.unref(b2) === "hover") {
            k2();
          }
        });
        const H2 = ye(z2, () => {
          if (vue.unref(b2) === "hover") {
            g2();
          }
        });
        const W2 = () => {
          var e3, t2;
          (t2 = (e3 = u2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3);
          C2 == null ? void 0 : C2();
        };
        const U2 = () => {
          _2 == null ? void 0 : _2();
        };
        const K2 = () => {
          x2();
          G2 = Te(vue.computed(() => {
            var e3;
            return (e3 = u2.value) == null ? void 0 : e3.popperContentRef;
          }), () => {
            if (vue.unref(p2)) return;
            const e3 = vue.unref(b2);
            if (e3 !== "hover") {
              g2();
            }
          });
        };
        const q2 = () => {
          if (!a2.virtualTriggering) {
            g2();
          }
        };
        let G2;
        vue.watch(() => vue.unref(h2), (e3) => {
          if (!e3) {
            G2 == null ? void 0 : G2();
          }
        }, { flush: "post" });
        vue.watch(() => a2.content, () => {
          var e3, t2;
          (t2 = (e3 = u2.value) == null ? void 0 : e3.updatePopper) == null ? void 0 : t2.call(e3);
        });
        n2({ contentRef: u2 });
        return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { disabled: !e3.teleported, to: vue.unref(T2) }, [vue.createVNode(vue.Transition, { name: vue.unref(O2), onAfterLeave: j2, onBeforeEnter: W2, onAfterEnter: K2, onBeforeLeave: U2 }, { default: vue.withCtx(() => [vue.unref($2) ? vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(av), vue.mergeProps({ key: 0, id: vue.unref(m2), ref_key: "contentRef", ref: u2 }, e3.$attrs, { "aria-label": e3.ariaLabel, "aria-hidden": vue.unref(F2), "boundaries-padding": e3.boundariesPadding, "fallback-placements": e3.fallbackPlacements, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, placement: e3.placement, "popper-options": e3.popperOptions, strategy: e3.strategy, effect: e3.effect, enterable: e3.enterable, pure: e3.pure, "popper-class": e3.popperClass, "popper-style": [e3.popperStyle, vue.unref(P2)], "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, visible: vue.unref(L2), "z-index": e3.zIndex, onMouseenter: vue.unref(N2), onMouseleave: vue.unref(H2), onBlur: q2, onClose: vue.unref(g2) }), { default: vue.withCtx(() => [!c2.value ? vue.renderSlot(e3.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true)]), _: 3 }, 16, ["id", "aria-label", "aria-hidden", "boundaries-padding", "fallback-placements", "gpu-acceleration", "offset", "placement", "popper-options", "strategy", "effect", "enterable", "pure", "popper-class", "popper-style", "reference-el", "trigger-target-el", "visible", "z-index", "onMouseenter", "onMouseleave", "onClose"])), [[vue.vShow, vue.unref(L2)]]) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["name"])], 8, ["disabled", "to"]));
      } });
      var wv = ad(yv, [["__file", "content.vue"]]);
      const kv = ["innerHTML"];
      const xv = { key: 1 };
      const Sv = vue.defineComponent({ name: "ElTooltip" });
      const Cv = vue.defineComponent({ ...Sv, props: dv, emits: fv, setup(e2, { expose: a2, emit: o2 }) {
        const l2 = e2;
        Ac();
        const u2 = xc();
        const c2 = vue.ref();
        const d2 = vue.ref();
        const f2 = () => {
          var e3;
          const t2 = vue.unref(c2);
          if (t2) {
            (e3 = t2.popperInstanceRef) == null ? void 0 : e3.update();
          }
        };
        const p2 = vue.ref(false);
        const m2 = vue.ref();
        const { show: h2, hide: b2, hasUpdateHandler: y2 } = cv({ indicator: p2, toggleReason: m2 });
        const { onOpen: x2, onClose: S2 } = $c({ showAfter: vue.toRef(l2, "showAfter"), hideAfter: vue.toRef(l2, "hideAfter"), autoClose: vue.toRef(l2, "autoClose"), open: h2, close: b2 });
        const C2 = vue.computed(() => Ml(l2.visible) && !y2.value);
        vue.provide(rv, { controlled: C2, id: u2, open: vue.readonly(p2), trigger: vue.toRef(l2, "trigger"), onOpen: (e3) => {
          x2(e3);
        }, onClose: (e3) => {
          S2(e3);
        }, onToggle: (e3) => {
          if (vue.unref(p2)) {
            S2(e3);
          } else {
            x2(e3);
          }
        }, onShow: () => {
          o2("show", m2.value);
        }, onHide: () => {
          o2("hide", m2.value);
        }, onBeforeShow: () => {
          o2("before-show", m2.value);
        }, onBeforeHide: () => {
          o2("before-hide", m2.value);
        }, updatePopper: f2 });
        vue.watch(() => l2.disabled, (e3) => {
          if (e3 && p2.value) {
            p2.value = false;
          }
        });
        const _2 = (e3) => {
          var t2, n2;
          const a3 = (n2 = (t2 = d2.value) == null ? void 0 : t2.contentRef) == null ? void 0 : n2.popperContentRef;
          const o3 = (e3 == null ? void 0 : e3.relatedTarget) || document.activeElement;
          return a3 && a3.contains(o3);
        };
        vue.onDeactivated(() => p2.value && b2());
        a2({ popperRef: c2, contentRef: d2, isFocusInsideContent: _2, updatePopper: f2, onOpen: x2, onClose: S2, hide: b2 });
        return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.unref(ov), { ref_key: "popperRef", ref: c2, role: e3.role }, { default: vue.withCtx(() => [vue.createVNode(bv, { disabled: e3.disabled, trigger: e3.trigger, "trigger-keys": e3.triggerKeys, "virtual-ref": e3.virtualRef, "virtual-triggering": e3.virtualTriggering }, { default: vue.withCtx(() => [e3.$slots.default ? vue.renderSlot(e3.$slots, "default", { key: 0 }) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["disabled", "trigger", "trigger-keys", "virtual-ref", "virtual-triggering"]), vue.createVNode(wv, { ref_key: "contentRef", ref: d2, "aria-label": e3.ariaLabel, "boundaries-padding": e3.boundariesPadding, content: e3.content, disabled: e3.disabled, effect: e3.effect, enterable: e3.enterable, "fallback-placements": e3.fallbackPlacements, "hide-after": e3.hideAfter, "gpu-acceleration": e3.gpuAcceleration, offset: e3.offset, persistent: e3.persistent, "popper-class": e3.popperClass, "popper-style": e3.popperStyle, placement: e3.placement, "popper-options": e3.popperOptions, pure: e3.pure, "raw-content": e3.rawContent, "reference-el": e3.referenceEl, "trigger-target-el": e3.triggerTargetEl, "show-after": e3.showAfter, strategy: e3.strategy, teleported: e3.teleported, transition: e3.transition, "virtual-triggering": e3.virtualTriggering, "z-index": e3.zIndex, "append-to": e3.appendTo }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "content", {}, () => [e3.rawContent ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, innerHTML: e3.content }, null, 8, kv)) : (vue.openBlock(), vue.createElementBlock("span", xv, vue.toDisplayString(e3.content), 1))]), e3.showArrow ? (vue.openBlock(), vue.createBlock(vue.unref(af), { key: 0, "arrow-offset": e3.arrowOffset }, null, 8, ["arrow-offset"])) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["aria-label", "boundaries-padding", "content", "disabled", "effect", "enterable", "fallback-placements", "hide-after", "gpu-acceleration", "offset", "persistent", "popper-class", "popper-style", "placement", "popper-options", "pure", "raw-content", "reference-el", "trigger-target-el", "show-after", "strategy", "teleported", "transition", "virtual-triggering", "z-index", "append-to"])]), _: 3 }, 8, ["role"]));
      } });
      var _v = ad(Cv, [["__file", "tooltip.vue"]]);
      const Mv = Ds(_v);
      const Ov = Symbol("buttonGroupContextKey");
      const Dv = (e2, t2) => {
        Ws({ from: "type.text", replacement: "link", version: "3.0.0", scope: "props", ref: "https://element-plus.org/en-US/component/button.html#button-attributes" }, vue.computed(() => e2.type === "text"));
        const n2 = vue.inject(Ov, void 0);
        const a2 = Qc("button");
        const { form: o2 } = vd();
        const l2 = dd(vue.computed(() => n2 == null ? void 0 : n2.size));
        const s2 = fd();
        const i2 = vue.ref();
        const u2 = vue.useSlots();
        const c2 = vue.computed(() => e2.type || (n2 == null ? void 0 : n2.type) || "");
        const d2 = vue.computed(() => {
          var t3, n3, o3;
          return (o3 = (n3 = e2.autoInsertSpace) != null ? n3 : (t3 = a2.value) == null ? void 0 : t3.autoInsertSpace) != null ? o3 : false;
        });
        const p2 = vue.computed(() => {
          if (e2.tag === "button") {
            return { ariaDisabled: s2.value || e2.loading, disabled: s2.value || e2.loading, autofocus: e2.autofocus, type: e2.nativeType };
          }
          return {};
        });
        const m2 = vue.computed(() => {
          var e3;
          const t3 = (e3 = u2.default) == null ? void 0 : e3.call(u2);
          if (d2.value && (t3 == null ? void 0 : t3.length) === 1) {
            const e4 = t3[0];
            if ((e4 == null ? void 0 : e4.type) === vue.Text) {
              const t4 = e4.children;
              return new RegExp("^\\p{Unified_Ideograph}{2}$", "u").test(t4.trim());
            }
          }
          return false;
        });
        const h2 = (n3) => {
          if (e2.nativeType === "reset") {
            o2 == null ? void 0 : o2.resetFields();
          }
          t2("click", n3);
        };
        return { _disabled: s2, _size: l2, _type: c2, _ref: i2, _props: p2, shouldAddSpace: m2, handleClick: h2 };
      };
      const Av = ["default", "primary", "success", "warning", "info", "danger", "text", ""];
      const Ev = ["button", "submit", "reset"];
      const $v = Cs({ size: Nc, disabled: Boolean, type: { type: String, values: Av, default: "" }, icon: { type: _s }, nativeType: { type: String, values: Ev, default: "button" }, loading: Boolean, loadingIcon: { type: _s, default: () => ms }, plain: Boolean, text: Boolean, link: Boolean, bg: Boolean, autofocus: Boolean, round: Boolean, circle: Boolean, color: String, dark: Boolean, autoInsertSpace: { type: Boolean, default: void 0 }, tag: { type: ks([String, Object]), default: "button" } });
      const Lv = { click: (e2) => e2 instanceof MouseEvent };
      function Iv(e2, t2) {
        if (Pv(e2)) {
          e2 = "100%";
        }
        var n2 = Bv(e2);
        e2 = t2 === 360 ? e2 : Math.min(t2, Math.max(0, parseFloat(e2)));
        if (n2) {
          e2 = parseInt(String(e2 * t2), 10) / 100;
        }
        if (Math.abs(e2 - t2) < 1e-6) {
          return 1;
        }
        if (t2 === 360) {
          e2 = (e2 < 0 ? e2 % t2 + t2 : e2 % t2) / parseFloat(String(t2));
        } else {
          e2 = e2 % t2 / parseFloat(String(t2));
        }
        return e2;
      }
      function Tv(e2) {
        return Math.min(1, Math.max(0, e2));
      }
      function Pv(e2) {
        return typeof e2 === "string" && e2.indexOf(".") !== -1 && parseFloat(e2) === 1;
      }
      function Bv(e2) {
        return typeof e2 === "string" && e2.indexOf("%") !== -1;
      }
      function Rv(e2) {
        e2 = parseFloat(e2);
        if (isNaN(e2) || e2 < 0 || e2 > 1) {
          e2 = 1;
        }
        return e2;
      }
      function Vv(e2) {
        if (e2 <= 1) {
          return "".concat(Number(e2) * 100, "%");
        }
        return e2;
      }
      function Fv(e2) {
        return e2.length === 1 ? "0" + e2 : String(e2);
      }
      function jv(e2, t2, n2) {
        return { r: Iv(e2, 255) * 255, g: Iv(t2, 255) * 255, b: Iv(n2, 255) * 255 };
      }
      function zv(e2, t2, n2) {
        e2 = Iv(e2, 255);
        t2 = Iv(t2, 255);
        n2 = Iv(n2, 255);
        var a2 = Math.max(e2, t2, n2);
        var o2 = Math.min(e2, t2, n2);
        var r2 = 0;
        var l2 = 0;
        var s2 = (a2 + o2) / 2;
        if (a2 === o2) {
          l2 = 0;
          r2 = 0;
        } else {
          var i2 = a2 - o2;
          l2 = s2 > 0.5 ? i2 / (2 - a2 - o2) : i2 / (a2 + o2);
          switch (a2) {
            case e2:
              r2 = (t2 - n2) / i2 + (t2 < n2 ? 6 : 0);
              break;
            case t2:
              r2 = (n2 - e2) / i2 + 2;
              break;
            case n2:
              r2 = (e2 - t2) / i2 + 4;
              break;
          }
          r2 /= 6;
        }
        return { h: r2, s: l2, l: s2 };
      }
      function Nv(e2, t2, n2) {
        if (n2 < 0) {
          n2 += 1;
        }
        if (n2 > 1) {
          n2 -= 1;
        }
        if (n2 < 1 / 6) {
          return e2 + (t2 - e2) * (6 * n2);
        }
        if (n2 < 1 / 2) {
          return t2;
        }
        if (n2 < 2 / 3) {
          return e2 + (t2 - e2) * (2 / 3 - n2) * 6;
        }
        return e2;
      }
      function Hv(e2, t2, n2) {
        var a2;
        var o2;
        var r2;
        e2 = Iv(e2, 360);
        t2 = Iv(t2, 100);
        n2 = Iv(n2, 100);
        if (t2 === 0) {
          o2 = n2;
          r2 = n2;
          a2 = n2;
        } else {
          var l2 = n2 < 0.5 ? n2 * (1 + t2) : n2 + t2 - n2 * t2;
          var s2 = 2 * n2 - l2;
          a2 = Nv(s2, l2, e2 + 1 / 3);
          o2 = Nv(s2, l2, e2);
          r2 = Nv(s2, l2, e2 - 1 / 3);
        }
        return { r: a2 * 255, g: o2 * 255, b: r2 * 255 };
      }
      function Yv(e2, t2, n2) {
        e2 = Iv(e2, 255);
        t2 = Iv(t2, 255);
        n2 = Iv(n2, 255);
        var a2 = Math.max(e2, t2, n2);
        var o2 = Math.min(e2, t2, n2);
        var r2 = 0;
        var l2 = a2;
        var s2 = a2 - o2;
        var i2 = a2 === 0 ? 0 : s2 / a2;
        if (a2 === o2) {
          r2 = 0;
        } else {
          switch (a2) {
            case e2:
              r2 = (t2 - n2) / s2 + (t2 < n2 ? 6 : 0);
              break;
            case t2:
              r2 = (n2 - e2) / s2 + 2;
              break;
            case n2:
              r2 = (e2 - t2) / s2 + 4;
              break;
          }
          r2 /= 6;
        }
        return { h: r2, s: i2, v: l2 };
      }
      function Wv(e2, t2, n2) {
        e2 = Iv(e2, 360) * 6;
        t2 = Iv(t2, 100);
        n2 = Iv(n2, 100);
        var a2 = Math.floor(e2);
        var o2 = e2 - a2;
        var r2 = n2 * (1 - t2);
        var l2 = n2 * (1 - o2 * t2);
        var s2 = n2 * (1 - (1 - o2) * t2);
        var i2 = a2 % 6;
        var u2 = [n2, l2, r2, r2, s2, n2][i2];
        var c2 = [s2, n2, n2, l2, r2, r2][i2];
        var d2 = [r2, r2, s2, n2, n2, l2][i2];
        return { r: u2 * 255, g: c2 * 255, b: d2 * 255 };
      }
      function Uv(e2, t2, n2, a2) {
        var o2 = [Fv(Math.round(e2).toString(16)), Fv(Math.round(t2).toString(16)), Fv(Math.round(n2).toString(16))];
        if (a2 && o2[0].startsWith(o2[0].charAt(1)) && o2[1].startsWith(o2[1].charAt(1)) && o2[2].startsWith(o2[2].charAt(1))) {
          return o2[0].charAt(0) + o2[1].charAt(0) + o2[2].charAt(0);
        }
        return o2.join("");
      }
      function Kv(e2, t2, n2, a2, o2) {
        var r2 = [Fv(Math.round(e2).toString(16)), Fv(Math.round(t2).toString(16)), Fv(Math.round(n2).toString(16)), Fv(qv(a2))];
        if (o2 && r2[0].startsWith(r2[0].charAt(1)) && r2[1].startsWith(r2[1].charAt(1)) && r2[2].startsWith(r2[2].charAt(1)) && r2[3].startsWith(r2[3].charAt(1))) {
          return r2[0].charAt(0) + r2[1].charAt(0) + r2[2].charAt(0) + r2[3].charAt(0);
        }
        return r2.join("");
      }
      function qv(e2) {
        return Math.round(parseFloat(e2) * 255).toString(16);
      }
      function Gv(e2) {
        return Zv(e2) / 255;
      }
      function Zv(e2) {
        return parseInt(e2, 16);
      }
      function Jv(e2) {
        return { r: e2 >> 16, g: (e2 & 65280) >> 8, b: e2 & 255 };
      }
      var Xv = { aliceblue: "#f0f8ff", antiquewhite: "#faebd7", aqua: "#00ffff", aquamarine: "#7fffd4", azure: "#f0ffff", beige: "#f5f5dc", bisque: "#ffe4c4", black: "#000000", blanchedalmond: "#ffebcd", blue: "#0000ff", blueviolet: "#8a2be2", brown: "#a52a2a", burlywood: "#deb887", cadetblue: "#5f9ea0", chartreuse: "#7fff00", chocolate: "#d2691e", coral: "#ff7f50", cornflowerblue: "#6495ed", cornsilk: "#fff8dc", crimson: "#dc143c", cyan: "#00ffff", darkblue: "#00008b", darkcyan: "#008b8b", darkgoldenrod: "#b8860b", darkgray: "#a9a9a9", darkgreen: "#006400", darkgrey: "#a9a9a9", darkkhaki: "#bdb76b", darkmagenta: "#8b008b", darkolivegreen: "#556b2f", darkorange: "#ff8c00", darkorchid: "#9932cc", darkred: "#8b0000", darksalmon: "#e9967a", darkseagreen: "#8fbc8f", darkslateblue: "#483d8b", darkslategray: "#2f4f4f", darkslategrey: "#2f4f4f", darkturquoise: "#00ced1", darkviolet: "#9400d3", deeppink: "#ff1493", deepskyblue: "#00bfff", dimgray: "#696969", dimgrey: "#696969", dodgerblue: "#1e90ff", firebrick: "#b22222", floralwhite: "#fffaf0", forestgreen: "#228b22", fuchsia: "#ff00ff", gainsboro: "#dcdcdc", ghostwhite: "#f8f8ff", goldenrod: "#daa520", gold: "#ffd700", gray: "#808080", green: "#008000", greenyellow: "#adff2f", grey: "#808080", honeydew: "#f0fff0", hotpink: "#ff69b4", indianred: "#cd5c5c", indigo: "#4b0082", ivory: "#fffff0", khaki: "#f0e68c", lavenderblush: "#fff0f5", lavender: "#e6e6fa", lawngreen: "#7cfc00", lemonchiffon: "#fffacd", lightblue: "#add8e6", lightcoral: "#f08080", lightcyan: "#e0ffff", lightgoldenrodyellow: "#fafad2", lightgray: "#d3d3d3", lightgreen: "#90ee90", lightgrey: "#d3d3d3", lightpink: "#ffb6c1", lightsalmon: "#ffa07a", lightseagreen: "#20b2aa", lightskyblue: "#87cefa", lightslategray: "#778899", lightslategrey: "#778899", lightsteelblue: "#b0c4de", lightyellow: "#ffffe0", lime: "#00ff00", limegreen: "#32cd32", linen: "#faf0e6", magenta: "#ff00ff", maroon: "#800000", mediumaquamarine: "#66cdaa", mediumblue: "#0000cd", mediumorchid: "#ba55d3", mediumpurple: "#9370db", mediumseagreen: "#3cb371", mediumslateblue: "#7b68ee", mediumspringgreen: "#00fa9a", mediumturquoise: "#48d1cc", mediumvioletred: "#c71585", midnightblue: "#191970", mintcream: "#f5fffa", mistyrose: "#ffe4e1", moccasin: "#ffe4b5", navajowhite: "#ffdead", navy: "#000080", oldlace: "#fdf5e6", olive: "#808000", olivedrab: "#6b8e23", orange: "#ffa500", orangered: "#ff4500", orchid: "#da70d6", palegoldenrod: "#eee8aa", palegreen: "#98fb98", paleturquoise: "#afeeee", palevioletred: "#db7093", papayawhip: "#ffefd5", peachpuff: "#ffdab9", peru: "#cd853f", pink: "#ffc0cb", plum: "#dda0dd", powderblue: "#b0e0e6", purple: "#800080", rebeccapurple: "#663399", red: "#ff0000", rosybrown: "#bc8f8f", royalblue: "#4169e1", saddlebrown: "#8b4513", salmon: "#fa8072", sandybrown: "#f4a460", seagreen: "#2e8b57", seashell: "#fff5ee", sienna: "#a0522d", silver: "#c0c0c0", skyblue: "#87ceeb", slateblue: "#6a5acd", slategray: "#708090", slategrey: "#708090", snow: "#fffafa", springgreen: "#00ff7f", steelblue: "#4682b4", tan: "#d2b48c", teal: "#008080", thistle: "#d8bfd8", tomato: "#ff6347", turquoise: "#40e0d0", violet: "#ee82ee", wheat: "#f5deb3", white: "#ffffff", whitesmoke: "#f5f5f5", yellow: "#ffff00", yellowgreen: "#9acd32" };
      function Qv(e2) {
        var t2 = { r: 0, g: 0, b: 0 };
        var n2 = 1;
        var a2 = null;
        var o2 = null;
        var r2 = null;
        var l2 = false;
        var s2 = false;
        if (typeof e2 === "string") {
          e2 = lp(e2);
        }
        if (typeof e2 === "object") {
          if (sp(e2.r) && sp(e2.g) && sp(e2.b)) {
            t2 = jv(e2.r, e2.g, e2.b);
            l2 = true;
            s2 = String(e2.r).substr(-1) === "%" ? "prgb" : "rgb";
          } else if (sp(e2.h) && sp(e2.s) && sp(e2.v)) {
            a2 = Vv(e2.s);
            o2 = Vv(e2.v);
            t2 = Wv(e2.h, a2, o2);
            l2 = true;
            s2 = "hsv";
          } else if (sp(e2.h) && sp(e2.s) && sp(e2.l)) {
            a2 = Vv(e2.s);
            r2 = Vv(e2.l);
            t2 = Hv(e2.h, a2, r2);
            l2 = true;
            s2 = "hsl";
          }
          if (Object.prototype.hasOwnProperty.call(e2, "a")) {
            n2 = e2.a;
          }
        }
        n2 = Rv(n2);
        return { ok: l2, format: e2.format || s2, r: Math.min(255, Math.max(t2.r, 0)), g: Math.min(255, Math.max(t2.g, 0)), b: Math.min(255, Math.max(t2.b, 0)), a: n2 };
      }
      var ep = "[-\\+]?\\d+%?";
      var tp = "[-\\+]?\\d*\\.\\d+%?";
      var np = "(?:".concat(tp, ")|(?:").concat(ep, ")");
      var ap = "[\\s|\\(]+(".concat(np, ")[,|\\s]+(").concat(np, ")[,|\\s]+(").concat(np, ")\\s*\\)?");
      var op = "[\\s|\\(]+(".concat(np, ")[,|\\s]+(").concat(np, ")[,|\\s]+(").concat(np, ")[,|\\s]+(").concat(np, ")\\s*\\)?");
      var rp = { CSS_UNIT: new RegExp(np), rgb: new RegExp("rgb" + ap), rgba: new RegExp("rgba" + op), hsl: new RegExp("hsl" + ap), hsla: new RegExp("hsla" + op), hsv: new RegExp("hsv" + ap), hsva: new RegExp("hsva" + op), hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/, hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/ };
      function lp(e2) {
        e2 = e2.trim().toLowerCase();
        if (e2.length === 0) {
          return false;
        }
        var t2 = false;
        if (Xv[e2]) {
          e2 = Xv[e2];
          t2 = true;
        } else if (e2 === "transparent") {
          return { r: 0, g: 0, b: 0, a: 0, format: "name" };
        }
        var n2 = rp.rgb.exec(e2);
        if (n2) {
          return { r: n2[1], g: n2[2], b: n2[3] };
        }
        n2 = rp.rgba.exec(e2);
        if (n2) {
          return { r: n2[1], g: n2[2], b: n2[3], a: n2[4] };
        }
        n2 = rp.hsl.exec(e2);
        if (n2) {
          return { h: n2[1], s: n2[2], l: n2[3] };
        }
        n2 = rp.hsla.exec(e2);
        if (n2) {
          return { h: n2[1], s: n2[2], l: n2[3], a: n2[4] };
        }
        n2 = rp.hsv.exec(e2);
        if (n2) {
          return { h: n2[1], s: n2[2], v: n2[3] };
        }
        n2 = rp.hsva.exec(e2);
        if (n2) {
          return { h: n2[1], s: n2[2], v: n2[3], a: n2[4] };
        }
        n2 = rp.hex8.exec(e2);
        if (n2) {
          return { r: Zv(n2[1]), g: Zv(n2[2]), b: Zv(n2[3]), a: Gv(n2[4]), format: t2 ? "name" : "hex8" };
        }
        n2 = rp.hex6.exec(e2);
        if (n2) {
          return { r: Zv(n2[1]), g: Zv(n2[2]), b: Zv(n2[3]), format: t2 ? "name" : "hex" };
        }
        n2 = rp.hex4.exec(e2);
        if (n2) {
          return { r: Zv(n2[1] + n2[1]), g: Zv(n2[2] + n2[2]), b: Zv(n2[3] + n2[3]), a: Gv(n2[4] + n2[4]), format: t2 ? "name" : "hex8" };
        }
        n2 = rp.hex3.exec(e2);
        if (n2) {
          return { r: Zv(n2[1] + n2[1]), g: Zv(n2[2] + n2[2]), b: Zv(n2[3] + n2[3]), format: t2 ? "name" : "hex" };
        }
        return false;
      }
      function sp(e2) {
        return Boolean(rp.CSS_UNIT.exec(String(e2)));
      }
      var ip = function() {
        function e2(t2, n2) {
          if (t2 === void 0) {
            t2 = "";
          }
          if (n2 === void 0) {
            n2 = {};
          }
          var a2;
          if (t2 instanceof e2) {
            return t2;
          }
          if (typeof t2 === "number") {
            t2 = Jv(t2);
          }
          this.originalInput = t2;
          var o2 = Qv(t2);
          this.originalInput = t2;
          this.r = o2.r;
          this.g = o2.g;
          this.b = o2.b;
          this.a = o2.a;
          this.roundA = Math.round(100 * this.a) / 100;
          this.format = (a2 = n2.format) !== null && a2 !== void 0 ? a2 : o2.format;
          this.gradientType = n2.gradientType;
          if (this.r < 1) {
            this.r = Math.round(this.r);
          }
          if (this.g < 1) {
            this.g = Math.round(this.g);
          }
          if (this.b < 1) {
            this.b = Math.round(this.b);
          }
          this.isValid = o2.ok;
        }
        e2.prototype.isDark = function() {
          return this.getBrightness() < 128;
        };
        e2.prototype.isLight = function() {
          return !this.isDark();
        };
        e2.prototype.getBrightness = function() {
          var e3 = this.toRgb();
          return (e3.r * 299 + e3.g * 587 + e3.b * 114) / 1e3;
        };
        e2.prototype.getLuminance = function() {
          var e3 = this.toRgb();
          var t2;
          var n2;
          var a2;
          var o2 = e3.r / 255;
          var r2 = e3.g / 255;
          var l2 = e3.b / 255;
          if (o2 <= 0.03928) {
            t2 = o2 / 12.92;
          } else {
            t2 = Math.pow((o2 + 0.055) / 1.055, 2.4);
          }
          if (r2 <= 0.03928) {
            n2 = r2 / 12.92;
          } else {
            n2 = Math.pow((r2 + 0.055) / 1.055, 2.4);
          }
          if (l2 <= 0.03928) {
            a2 = l2 / 12.92;
          } else {
            a2 = Math.pow((l2 + 0.055) / 1.055, 2.4);
          }
          return 0.2126 * t2 + 0.7152 * n2 + 0.0722 * a2;
        };
        e2.prototype.getAlpha = function() {
          return this.a;
        };
        e2.prototype.setAlpha = function(e3) {
          this.a = Rv(e3);
          this.roundA = Math.round(100 * this.a) / 100;
          return this;
        };
        e2.prototype.isMonochrome = function() {
          var e3 = this.toHsl().s;
          return e3 === 0;
        };
        e2.prototype.toHsv = function() {
          var e3 = Yv(this.r, this.g, this.b);
          return { h: e3.h * 360, s: e3.s, v: e3.v, a: this.a };
        };
        e2.prototype.toHsvString = function() {
          var e3 = Yv(this.r, this.g, this.b);
          var t2 = Math.round(e3.h * 360);
          var n2 = Math.round(e3.s * 100);
          var a2 = Math.round(e3.v * 100);
          return this.a === 1 ? "hsv(".concat(t2, ", ").concat(n2, "%, ").concat(a2, "%)") : "hsva(".concat(t2, ", ").concat(n2, "%, ").concat(a2, "%, ").concat(this.roundA, ")");
        };
        e2.prototype.toHsl = function() {
          var e3 = zv(this.r, this.g, this.b);
          return { h: e3.h * 360, s: e3.s, l: e3.l, a: this.a };
        };
        e2.prototype.toHslString = function() {
          var e3 = zv(this.r, this.g, this.b);
          var t2 = Math.round(e3.h * 360);
          var n2 = Math.round(e3.s * 100);
          var a2 = Math.round(e3.l * 100);
          return this.a === 1 ? "hsl(".concat(t2, ", ").concat(n2, "%, ").concat(a2, "%)") : "hsla(".concat(t2, ", ").concat(n2, "%, ").concat(a2, "%, ").concat(this.roundA, ")");
        };
        e2.prototype.toHex = function(e3) {
          if (e3 === void 0) {
            e3 = false;
          }
          return Uv(this.r, this.g, this.b, e3);
        };
        e2.prototype.toHexString = function(e3) {
          if (e3 === void 0) {
            e3 = false;
          }
          return "#" + this.toHex(e3);
        };
        e2.prototype.toHex8 = function(e3) {
          if (e3 === void 0) {
            e3 = false;
          }
          return Kv(this.r, this.g, this.b, this.a, e3);
        };
        e2.prototype.toHex8String = function(e3) {
          if (e3 === void 0) {
            e3 = false;
          }
          return "#" + this.toHex8(e3);
        };
        e2.prototype.toHexShortString = function(e3) {
          if (e3 === void 0) {
            e3 = false;
          }
          return this.a === 1 ? this.toHexString(e3) : this.toHex8String(e3);
        };
        e2.prototype.toRgb = function() {
          return { r: Math.round(this.r), g: Math.round(this.g), b: Math.round(this.b), a: this.a };
        };
        e2.prototype.toRgbString = function() {
          var e3 = Math.round(this.r);
          var t2 = Math.round(this.g);
          var n2 = Math.round(this.b);
          return this.a === 1 ? "rgb(".concat(e3, ", ").concat(t2, ", ").concat(n2, ")") : "rgba(".concat(e3, ", ").concat(t2, ", ").concat(n2, ", ").concat(this.roundA, ")");
        };
        e2.prototype.toPercentageRgb = function() {
          var e3 = function(e4) {
            return "".concat(Math.round(Iv(e4, 255) * 100), "%");
          };
          return { r: e3(this.r), g: e3(this.g), b: e3(this.b), a: this.a };
        };
        e2.prototype.toPercentageRgbString = function() {
          var e3 = function(e4) {
            return Math.round(Iv(e4, 255) * 100);
          };
          return this.a === 1 ? "rgb(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%)") : "rgba(".concat(e3(this.r), "%, ").concat(e3(this.g), "%, ").concat(e3(this.b), "%, ").concat(this.roundA, ")");
        };
        e2.prototype.toName = function() {
          if (this.a === 0) {
            return "transparent";
          }
          if (this.a < 1) {
            return false;
          }
          var e3 = "#" + Uv(this.r, this.g, this.b, false);
          for (var t2 = 0, n2 = Object.entries(Xv); t2 < n2.length; t2++) {
            var a2 = n2[t2], o2 = a2[0], r2 = a2[1];
            if (e3 === r2) {
              return o2;
            }
          }
          return false;
        };
        e2.prototype.toString = function(e3) {
          var t2 = Boolean(e3);
          e3 = e3 !== null && e3 !== void 0 ? e3 : this.format;
          var n2 = false;
          var a2 = this.a < 1 && this.a >= 0;
          var o2 = !t2 && a2 && (e3.startsWith("hex") || e3 === "name");
          if (o2) {
            if (e3 === "name" && this.a === 0) {
              return this.toName();
            }
            return this.toRgbString();
          }
          if (e3 === "rgb") {
            n2 = this.toRgbString();
          }
          if (e3 === "prgb") {
            n2 = this.toPercentageRgbString();
          }
          if (e3 === "hex" || e3 === "hex6") {
            n2 = this.toHexString();
          }
          if (e3 === "hex3") {
            n2 = this.toHexString(true);
          }
          if (e3 === "hex4") {
            n2 = this.toHex8String(true);
          }
          if (e3 === "hex8") {
            n2 = this.toHex8String();
          }
          if (e3 === "name") {
            n2 = this.toName();
          }
          if (e3 === "hsl") {
            n2 = this.toHslString();
          }
          if (e3 === "hsv") {
            n2 = this.toHsvString();
          }
          return n2 || this.toHexString();
        };
        e2.prototype.toNumber = function() {
          return (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b);
        };
        e2.prototype.clone = function() {
          return new e2(this.toString());
        };
        e2.prototype.lighten = function(t2) {
          if (t2 === void 0) {
            t2 = 10;
          }
          var n2 = this.toHsl();
          n2.l += t2 / 100;
          n2.l = Tv(n2.l);
          return new e2(n2);
        };
        e2.prototype.brighten = function(t2) {
          if (t2 === void 0) {
            t2 = 10;
          }
          var n2 = this.toRgb();
          n2.r = Math.max(0, Math.min(255, n2.r - Math.round(255 * -(t2 / 100))));
          n2.g = Math.max(0, Math.min(255, n2.g - Math.round(255 * -(t2 / 100))));
          n2.b = Math.max(0, Math.min(255, n2.b - Math.round(255 * -(t2 / 100))));
          return new e2(n2);
        };
        e2.prototype.darken = function(t2) {
          if (t2 === void 0) {
            t2 = 10;
          }
          var n2 = this.toHsl();
          n2.l -= t2 / 100;
          n2.l = Tv(n2.l);
          return new e2(n2);
        };
        e2.prototype.tint = function(e3) {
          if (e3 === void 0) {
            e3 = 10;
          }
          return this.mix("white", e3);
        };
        e2.prototype.shade = function(e3) {
          if (e3 === void 0) {
            e3 = 10;
          }
          return this.mix("black", e3);
        };
        e2.prototype.desaturate = function(t2) {
          if (t2 === void 0) {
            t2 = 10;
          }
          var n2 = this.toHsl();
          n2.s -= t2 / 100;
          n2.s = Tv(n2.s);
          return new e2(n2);
        };
        e2.prototype.saturate = function(t2) {
          if (t2 === void 0) {
            t2 = 10;
          }
          var n2 = this.toHsl();
          n2.s += t2 / 100;
          n2.s = Tv(n2.s);
          return new e2(n2);
        };
        e2.prototype.greyscale = function() {
          return this.desaturate(100);
        };
        e2.prototype.spin = function(t2) {
          var n2 = this.toHsl();
          var a2 = (n2.h + t2) % 360;
          n2.h = a2 < 0 ? 360 + a2 : a2;
          return new e2(n2);
        };
        e2.prototype.mix = function(t2, n2) {
          if (n2 === void 0) {
            n2 = 50;
          }
          var a2 = this.toRgb();
          var o2 = new e2(t2).toRgb();
          var r2 = n2 / 100;
          var l2 = { r: (o2.r - a2.r) * r2 + a2.r, g: (o2.g - a2.g) * r2 + a2.g, b: (o2.b - a2.b) * r2 + a2.b, a: (o2.a - a2.a) * r2 + a2.a };
          return new e2(l2);
        };
        e2.prototype.analogous = function(t2, n2) {
          if (t2 === void 0) {
            t2 = 6;
          }
          if (n2 === void 0) {
            n2 = 30;
          }
          var a2 = this.toHsl();
          var o2 = 360 / n2;
          var r2 = [this];
          for (a2.h = (a2.h - (o2 * t2 >> 1) + 720) % 360; --t2; ) {
            a2.h = (a2.h + o2) % 360;
            r2.push(new e2(a2));
          }
          return r2;
        };
        e2.prototype.complement = function() {
          var t2 = this.toHsl();
          t2.h = (t2.h + 180) % 360;
          return new e2(t2);
        };
        e2.prototype.monochromatic = function(t2) {
          if (t2 === void 0) {
            t2 = 6;
          }
          var n2 = this.toHsv();
          var a2 = n2.h;
          var o2 = n2.s;
          var r2 = n2.v;
          var l2 = [];
          var s2 = 1 / t2;
          while (t2--) {
            l2.push(new e2({ h: a2, s: o2, v: r2 }));
            r2 = (r2 + s2) % 1;
          }
          return l2;
        };
        e2.prototype.splitcomplement = function() {
          var t2 = this.toHsl();
          var n2 = t2.h;
          return [this, new e2({ h: (n2 + 72) % 360, s: t2.s, l: t2.l }), new e2({ h: (n2 + 216) % 360, s: t2.s, l: t2.l })];
        };
        e2.prototype.onBackground = function(t2) {
          var n2 = this.toRgb();
          var a2 = new e2(t2).toRgb();
          var o2 = n2.a + a2.a * (1 - n2.a);
          return new e2({ r: (n2.r * n2.a + a2.r * a2.a * (1 - n2.a)) / o2, g: (n2.g * n2.a + a2.g * a2.a * (1 - n2.a)) / o2, b: (n2.b * n2.a + a2.b * a2.a * (1 - n2.a)) / o2, a: o2 });
        };
        e2.prototype.triad = function() {
          return this.polyad(3);
        };
        e2.prototype.tetrad = function() {
          return this.polyad(4);
        };
        e2.prototype.polyad = function(t2) {
          var n2 = this.toHsl();
          var a2 = n2.h;
          var o2 = [this];
          var r2 = 360 / t2;
          for (var l2 = 1; l2 < t2; l2++) {
            o2.push(new e2({ h: (a2 + l2 * r2) % 360, s: n2.s, l: n2.l }));
          }
          return o2;
        };
        e2.prototype.equals = function(t2) {
          return this.toRgbString() === new e2(t2).toRgbString();
        };
        return e2;
      }();
      function up(e2, t2 = 20) {
        return e2.mix("#141414", t2).toString();
      }
      function cp(e2) {
        const t2 = fd();
        const n2 = oi("button");
        return vue.computed(() => {
          let a2 = {};
          const o2 = e2.color;
          if (o2) {
            const r2 = new ip(o2);
            const l2 = e2.dark ? r2.tint(20).toString() : up(r2, 20);
            if (e2.plain) {
              a2 = n2.cssVarBlock({ "bg-color": e2.dark ? up(r2, 90) : r2.tint(90).toString(), "text-color": o2, "border-color": e2.dark ? up(r2, 50) : r2.tint(50).toString(), "hover-text-color": `var(${n2.cssVarName("color-white")})`, "hover-bg-color": o2, "hover-border-color": o2, "active-bg-color": l2, "active-text-color": `var(${n2.cssVarName("color-white")})`, "active-border-color": l2 });
              if (t2.value) {
                a2[n2.cssVarBlockName("disabled-bg-color")] = e2.dark ? up(r2, 90) : r2.tint(90).toString();
                a2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? up(r2, 50) : r2.tint(50).toString();
                a2[n2.cssVarBlockName("disabled-border-color")] = e2.dark ? up(r2, 80) : r2.tint(80).toString();
              }
            } else {
              const s2 = e2.dark ? up(r2, 30) : r2.tint(30).toString();
              const i2 = r2.isDark() ? `var(${n2.cssVarName("color-white")})` : `var(${n2.cssVarName("color-black")})`;
              a2 = n2.cssVarBlock({ "bg-color": o2, "text-color": i2, "border-color": o2, "hover-bg-color": s2, "hover-text-color": i2, "hover-border-color": s2, "active-bg-color": l2, "active-border-color": l2 });
              if (t2.value) {
                const t3 = e2.dark ? up(r2, 50) : r2.tint(50).toString();
                a2[n2.cssVarBlockName("disabled-bg-color")] = t3;
                a2[n2.cssVarBlockName("disabled-text-color")] = e2.dark ? "rgba(255, 255, 255, 0.5)" : `var(${n2.cssVarName("color-white")})`;
                a2[n2.cssVarBlockName("disabled-border-color")] = t3;
              }
            }
          }
          return a2;
        });
      }
      const dp = vue.defineComponent({ name: "ElButton" });
      const fp = vue.defineComponent({ ...dp, props: $v, emits: Lv, setup(e2, { expose: a2, emit: o2 }) {
        const l2 = e2;
        const s2 = cp(l2);
        const u2 = oi("button");
        const { _ref: c2, _size: d2, _type: f2, _disabled: v2, _props: p2, shouldAddSpace: m2, handleClick: h2 } = Dv(l2, o2);
        const b2 = vue.computed(() => [u2.b(), u2.m(f2.value), u2.m(d2.value), u2.is("disabled", v2.value), u2.is("loading", l2.loading), u2.is("plain", l2.plain), u2.is("round", l2.round), u2.is("circle", l2.circle), u2.is("text", l2.text), u2.is("link", l2.link), u2.is("has-bg", l2.bg)]);
        a2({ ref: c2, size: d2, type: f2, disabled: v2, shouldAddSpace: m2 });
        return (e3, a3) => (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), vue.mergeProps({ ref_key: "_ref", ref: c2 }, vue.unref(p2), { class: vue.unref(b2), style: vue.unref(s2), onClick: vue.unref(h2) }), { default: vue.withCtx(() => [e3.loading ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [e3.$slots.loading ? vue.renderSlot(e3.$slots, "loading", { key: 0 }) : (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 1, class: vue.normalizeClass(vue.unref(u2).is("loading")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.loadingIcon)))]), _: 1 }, 8, ["class"]))], 64)) : e3.icon || e3.$slots.icon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 1 }, { default: vue.withCtx(() => [e3.icon ? (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.icon), { key: 0 })) : vue.renderSlot(e3.$slots, "icon", { key: 1 })]), _: 3 })) : vue.createCommentVNode("v-if", true), e3.$slots.default ? (vue.openBlock(), vue.createElementBlock("span", { key: 2, class: vue.normalizeClass({ [vue.unref(u2).em("text", "expand")]: vue.unref(m2) }) }, [vue.renderSlot(e3.$slots, "default")], 2)) : vue.createCommentVNode("v-if", true)]), _: 3 }, 16, ["class", "style", "onClick"]));
      } });
      var vp = ad(fp, [["__file", "button.vue"]]);
      const pp = { size: $v.size, type: $v.type };
      const mp = vue.defineComponent({ name: "ElButtonGroup" });
      const hp = vue.defineComponent({ ...mp, props: pp, setup(e2) {
        const a2 = e2;
        vue.provide(Ov, vue.reactive({ size: vue.toRef(a2, "size"), type: vue.toRef(a2, "type") }));
        const o2 = oi("button");
        return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(`${vue.unref(o2).b("group")}`) }, [vue.renderSlot(e3.$slots, "default")], 2));
      } });
      var bp = ad(hp, [["__file", "button-group.vue"]]);
      const gp = Ds(vp, { ButtonGroup: bp });
      As(bp);
      var yp = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
      function wp(e2) {
        return e2 && e2.__esModule && Object.prototype.hasOwnProperty.call(e2, "default") ? e2["default"] : e2;
      }
      var kp = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          var e3 = 1e3, t3 = 6e4, n2 = 36e5, a2 = "millisecond", o2 = "second", r2 = "minute", l2 = "hour", s2 = "day", i2 = "week", u2 = "month", c2 = "quarter", d2 = "year", f2 = "date", v2 = "Invalid Date", p2 = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, m2 = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, h2 = { name: "en", weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), ordinal: function(e4) {
            var t4 = ["th", "st", "nd", "rd"], n3 = e4 % 100;
            return "[" + e4 + (t4[(n3 - 20) % 10] || t4[n3] || t4[0]) + "]";
          } }, b2 = function(e4, t4, n3) {
            var a3 = String(e4);
            return !a3 || a3.length >= t4 ? e4 : "" + Array(t4 + 1 - a3.length).join(n3) + e4;
          }, g2 = { s: b2, z: function(e4) {
            var t4 = -e4.utcOffset(), n3 = Math.abs(t4), a3 = Math.floor(n3 / 60), o3 = n3 % 60;
            return (t4 <= 0 ? "+" : "-") + b2(a3, 2, "0") + ":" + b2(o3, 2, "0");
          }, m: function e4(t4, n3) {
            if (t4.date() < n3.date()) return -e4(n3, t4);
            var a3 = 12 * (n3.year() - t4.year()) + (n3.month() - t4.month()), o3 = t4.clone().add(a3, u2), r3 = n3 - o3 < 0, l3 = t4.clone().add(a3 + (r3 ? -1 : 1), u2);
            return +(-(a3 + (n3 - o3) / (r3 ? o3 - l3 : l3 - o3)) || 0);
          }, a: function(e4) {
            return e4 < 0 ? Math.ceil(e4) || 0 : Math.floor(e4);
          }, p: function(e4) {
            return { M: u2, y: d2, w: i2, d: s2, D: f2, h: l2, m: r2, s: o2, ms: a2, Q: c2 }[e4] || String(e4 || "").toLowerCase().replace(/s$/, "");
          }, u: function(e4) {
            return void 0 === e4;
          } }, y2 = "en", w2 = {};
          w2[y2] = h2;
          var k2 = "$isDayjsObject", x2 = function(e4) {
            return e4 instanceof M2 || !(!e4 || !e4[k2]);
          }, S2 = function e4(t4, n3, a3) {
            var o3;
            if (!t4) return y2;
            if ("string" == typeof t4) {
              var r3 = t4.toLowerCase();
              w2[r3] && (o3 = r3), n3 && (w2[r3] = n3, o3 = r3);
              var l3 = t4.split("-");
              if (!o3 && l3.length > 1) return e4(l3[0]);
            } else {
              var s3 = t4.name;
              w2[s3] = t4, o3 = s3;
            }
            return !a3 && o3 && (y2 = o3), o3 || !a3 && y2;
          }, C2 = function(e4, t4) {
            if (x2(e4)) return e4.clone();
            var n3 = "object" == typeof t4 ? t4 : {};
            return n3.date = e4, n3.args = arguments, new M2(n3);
          }, _2 = g2;
          _2.l = S2, _2.i = x2, _2.w = function(e4, t4) {
            return C2(e4, { locale: t4.$L, utc: t4.$u, x: t4.$x, $offset: t4.$offset });
          };
          var M2 = function() {
            function h3(e4) {
              this.$L = S2(e4.locale, null, true), this.parse(e4), this.$x = this.$x || e4.x || {}, this[k2] = true;
            }
            var b3 = h3.prototype;
            return b3.parse = function(e4) {
              this.$d = function(e5) {
                var t4 = e5.date, n3 = e5.utc;
                if (null === t4) return /* @__PURE__ */ new Date(NaN);
                if (_2.u(t4)) return /* @__PURE__ */ new Date();
                if (t4 instanceof Date) return new Date(t4);
                if ("string" == typeof t4 && !/Z$/i.test(t4)) {
                  var a3 = t4.match(p2);
                  if (a3) {
                    var o3 = a3[2] - 1 || 0, r3 = (a3[7] || "0").substring(0, 3);
                    return n3 ? new Date(Date.UTC(a3[1], o3, a3[3] || 1, a3[4] || 0, a3[5] || 0, a3[6] || 0, r3)) : new Date(a3[1], o3, a3[3] || 1, a3[4] || 0, a3[5] || 0, a3[6] || 0, r3);
                  }
                }
                return new Date(t4);
              }(e4), this.init();
            }, b3.init = function() {
              var e4 = this.$d;
              this.$y = e4.getFullYear(), this.$M = e4.getMonth(), this.$D = e4.getDate(), this.$W = e4.getDay(), this.$H = e4.getHours(), this.$m = e4.getMinutes(), this.$s = e4.getSeconds(), this.$ms = e4.getMilliseconds();
            }, b3.$utils = function() {
              return _2;
            }, b3.isValid = function() {
              return !(this.$d.toString() === v2);
            }, b3.isSame = function(e4, t4) {
              var n3 = C2(e4);
              return this.startOf(t4) <= n3 && n3 <= this.endOf(t4);
            }, b3.isAfter = function(e4, t4) {
              return C2(e4) < this.startOf(t4);
            }, b3.isBefore = function(e4, t4) {
              return this.endOf(t4) < C2(e4);
            }, b3.$g = function(e4, t4, n3) {
              return _2.u(e4) ? this[t4] : this.set(n3, e4);
            }, b3.unix = function() {
              return Math.floor(this.valueOf() / 1e3);
            }, b3.valueOf = function() {
              return this.$d.getTime();
            }, b3.startOf = function(e4, t4) {
              var n3 = this, a3 = !!_2.u(t4) || t4, c3 = _2.p(e4), v3 = function(e5, t5) {
                var o3 = _2.w(n3.$u ? Date.UTC(n3.$y, t5, e5) : new Date(n3.$y, t5, e5), n3);
                return a3 ? o3 : o3.endOf(s2);
              }, p3 = function(e5, t5) {
                return _2.w(n3.toDate()[e5].apply(n3.toDate("s"), (a3 ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(t5)), n3);
              }, m3 = this.$W, h4 = this.$M, b4 = this.$D, g3 = "set" + (this.$u ? "UTC" : "");
              switch (c3) {
                case d2:
                  return a3 ? v3(1, 0) : v3(31, 11);
                case u2:
                  return a3 ? v3(1, h4) : v3(0, h4 + 1);
                case i2:
                  var y3 = this.$locale().weekStart || 0, w3 = (m3 < y3 ? m3 + 7 : m3) - y3;
                  return v3(a3 ? b4 - w3 : b4 + (6 - w3), h4);
                case s2:
                case f2:
                  return p3(g3 + "Hours", 0);
                case l2:
                  return p3(g3 + "Minutes", 1);
                case r2:
                  return p3(g3 + "Seconds", 2);
                case o2:
                  return p3(g3 + "Milliseconds", 3);
                default:
                  return this.clone();
              }
            }, b3.endOf = function(e4) {
              return this.startOf(e4, false);
            }, b3.$set = function(e4, t4) {
              var n3, i3 = _2.p(e4), c3 = "set" + (this.$u ? "UTC" : ""), v3 = (n3 = {}, n3[s2] = c3 + "Date", n3[f2] = c3 + "Date", n3[u2] = c3 + "Month", n3[d2] = c3 + "FullYear", n3[l2] = c3 + "Hours", n3[r2] = c3 + "Minutes", n3[o2] = c3 + "Seconds", n3[a2] = c3 + "Milliseconds", n3)[i3], p3 = i3 === s2 ? this.$D + (t4 - this.$W) : t4;
              if (i3 === u2 || i3 === d2) {
                var m3 = this.clone().set(f2, 1);
                m3.$d[v3](p3), m3.init(), this.$d = m3.set(f2, Math.min(this.$D, m3.daysInMonth())).$d;
              } else v3 && this.$d[v3](p3);
              return this.init(), this;
            }, b3.set = function(e4, t4) {
              return this.clone().$set(e4, t4);
            }, b3.get = function(e4) {
              return this[_2.p(e4)]();
            }, b3.add = function(a3, c3) {
              var f3, v3 = this;
              a3 = Number(a3);
              var p3 = _2.p(c3), m3 = function(e4) {
                var t4 = C2(v3);
                return _2.w(t4.date(t4.date() + Math.round(e4 * a3)), v3);
              };
              if (p3 === u2) return this.set(u2, this.$M + a3);
              if (p3 === d2) return this.set(d2, this.$y + a3);
              if (p3 === s2) return m3(1);
              if (p3 === i2) return m3(7);
              var h4 = (f3 = {}, f3[r2] = t3, f3[l2] = n2, f3[o2] = e3, f3)[p3] || 1, b4 = this.$d.getTime() + a3 * h4;
              return _2.w(b4, this);
            }, b3.subtract = function(e4, t4) {
              return this.add(-1 * e4, t4);
            }, b3.format = function(e4) {
              var t4 = this, n3 = this.$locale();
              if (!this.isValid()) return n3.invalidDate || v2;
              var a3 = e4 || "YYYY-MM-DDTHH:mm:ssZ", o3 = _2.z(this), r3 = this.$H, l3 = this.$m, s3 = this.$M, i3 = n3.weekdays, u3 = n3.months, c3 = n3.meridiem, d3 = function(e5, n4, o4, r4) {
                return e5 && (e5[n4] || e5(t4, a3)) || o4[n4].slice(0, r4);
              }, f3 = function(e5) {
                return _2.s(r3 % 12 || 12, e5, "0");
              }, p3 = c3 || function(e5, t5, n4) {
                var a4 = e5 < 12 ? "AM" : "PM";
                return n4 ? a4.toLowerCase() : a4;
              };
              return a3.replace(m2, function(e5, a4) {
                return a4 || function(e6) {
                  switch (e6) {
                    case "YY":
                      return String(t4.$y).slice(-2);
                    case "YYYY":
                      return _2.s(t4.$y, 4, "0");
                    case "M":
                      return s3 + 1;
                    case "MM":
                      return _2.s(s3 + 1, 2, "0");
                    case "MMM":
                      return d3(n3.monthsShort, s3, u3, 3);
                    case "MMMM":
                      return d3(u3, s3);
                    case "D":
                      return t4.$D;
                    case "DD":
                      return _2.s(t4.$D, 2, "0");
                    case "d":
                      return String(t4.$W);
                    case "dd":
                      return d3(n3.weekdaysMin, t4.$W, i3, 2);
                    case "ddd":
                      return d3(n3.weekdaysShort, t4.$W, i3, 3);
                    case "dddd":
                      return i3[t4.$W];
                    case "H":
                      return String(r3);
                    case "HH":
                      return _2.s(r3, 2, "0");
                    case "h":
                      return f3(1);
                    case "hh":
                      return f3(2);
                    case "a":
                      return p3(r3, l3, true);
                    case "A":
                      return p3(r3, l3, false);
                    case "m":
                      return String(l3);
                    case "mm":
                      return _2.s(l3, 2, "0");
                    case "s":
                      return String(t4.$s);
                    case "ss":
                      return _2.s(t4.$s, 2, "0");
                    case "SSS":
                      return _2.s(t4.$ms, 3, "0");
                    case "Z":
                      return o3;
                  }
                  return null;
                }(e5) || o3.replace(":", "");
              });
            }, b3.utcOffset = function() {
              return 15 * -Math.round(this.$d.getTimezoneOffset() / 15);
            }, b3.diff = function(a3, f3, v3) {
              var p3, m3 = this, h4 = _2.p(f3), b4 = C2(a3), g3 = (b4.utcOffset() - this.utcOffset()) * t3, y3 = this - b4, w3 = function() {
                return _2.m(m3, b4);
              };
              switch (h4) {
                case d2:
                  p3 = w3() / 12;
                  break;
                case u2:
                  p3 = w3();
                  break;
                case c2:
                  p3 = w3() / 3;
                  break;
                case i2:
                  p3 = (y3 - g3) / 6048e5;
                  break;
                case s2:
                  p3 = (y3 - g3) / 864e5;
                  break;
                case l2:
                  p3 = y3 / n2;
                  break;
                case r2:
                  p3 = y3 / t3;
                  break;
                case o2:
                  p3 = y3 / e3;
                  break;
                default:
                  p3 = y3;
              }
              return v3 ? p3 : _2.a(p3);
            }, b3.daysInMonth = function() {
              return this.endOf(u2).$D;
            }, b3.$locale = function() {
              return w2[this.$L];
            }, b3.locale = function(e4, t4) {
              if (!e4) return this.$L;
              var n3 = this.clone(), a3 = S2(e4, t4, true);
              return a3 && (n3.$L = a3), n3;
            }, b3.clone = function() {
              return _2.w(this.$d, this);
            }, b3.toDate = function() {
              return new Date(this.valueOf());
            }, b3.toJSON = function() {
              return this.isValid() ? this.toISOString() : null;
            }, b3.toISOString = function() {
              return this.$d.toISOString();
            }, b3.toString = function() {
              return this.$d.toUTCString();
            }, h3;
          }(), O2 = M2.prototype;
          return C2.prototype = O2, [["$ms", a2], ["$s", o2], ["$m", r2], ["$H", l2], ["$W", s2], ["$M", u2], ["$y", d2], ["$D", f2]].forEach(function(e4) {
            O2[e4[1]] = function(t4) {
              return this.$g(t4, e4[0], e4[1]);
            };
          }), C2.extend = function(e4, t4) {
            return e4.$i || (e4(t4, M2, C2), e4.$i = true), C2;
          }, C2.locale = S2, C2.isDayjs = x2, C2.unix = function(e4) {
            return C2(1e3 * e4);
          }, C2.en = w2[y2], C2.Ls = w2, C2.p = {}, C2;
        });
      })(kp);
      var xp = kp.exports;
      const Sp = wp(xp);
      var Cp = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          var e3 = { LTS: "h:mm:ss A", LT: "h:mm A", L: "MM/DD/YYYY", LL: "MMMM D, YYYY", LLL: "MMMM D, YYYY h:mm A", LLLL: "dddd, MMMM D, YYYY h:mm A" }, t3 = /(\[[^[]*\])|([-_:/.,()\s]+)|(A|a|YYYY|YY?|MM?M?M?|Do|DD?|hh?|HH?|mm?|ss?|S{1,3}|z|ZZ?)/g, n2 = /\d\d/, a2 = /\d\d?/, o2 = /\d*[^-_:/,()\s\d]+/, r2 = {}, l2 = function(e4) {
            return (e4 = +e4) + (e4 > 68 ? 1900 : 2e3);
          };
          var s2 = function(e4) {
            return function(t4) {
              this[e4] = +t4;
            };
          }, i2 = [/[+-]\d\d:?(\d\d)?|Z/, function(e4) {
            (this.zone || (this.zone = {})).offset = function(e5) {
              if (!e5) return 0;
              if ("Z" === e5) return 0;
              var t4 = e5.match(/([+-]|\d\d)/g), n3 = 60 * t4[1] + (+t4[2] || 0);
              return 0 === n3 ? 0 : "+" === t4[0] ? -n3 : n3;
            }(e4);
          }], u2 = function(e4) {
            var t4 = r2[e4];
            return t4 && (t4.indexOf ? t4 : t4.s.concat(t4.f));
          }, c2 = function(e4, t4) {
            var n3, a3 = r2.meridiem;
            if (a3) {
              for (var o3 = 1; o3 <= 24; o3 += 1) if (e4.indexOf(a3(o3, 0, t4)) > -1) {
                n3 = o3 > 12;
                break;
              }
            } else n3 = e4 === (t4 ? "pm" : "PM");
            return n3;
          }, d2 = { A: [o2, function(e4) {
            this.afternoon = c2(e4, false);
          }], a: [o2, function(e4) {
            this.afternoon = c2(e4, true);
          }], S: [/\d/, function(e4) {
            this.milliseconds = 100 * +e4;
          }], SS: [n2, function(e4) {
            this.milliseconds = 10 * +e4;
          }], SSS: [/\d{3}/, function(e4) {
            this.milliseconds = +e4;
          }], s: [a2, s2("seconds")], ss: [a2, s2("seconds")], m: [a2, s2("minutes")], mm: [a2, s2("minutes")], H: [a2, s2("hours")], h: [a2, s2("hours")], HH: [a2, s2("hours")], hh: [a2, s2("hours")], D: [a2, s2("day")], DD: [n2, s2("day")], Do: [o2, function(e4) {
            var t4 = r2.ordinal, n3 = e4.match(/\d+/);
            if (this.day = n3[0], t4) for (var a3 = 1; a3 <= 31; a3 += 1) t4(a3).replace(/\[|\]/g, "") === e4 && (this.day = a3);
          }], M: [a2, s2("month")], MM: [n2, s2("month")], MMM: [o2, function(e4) {
            var t4 = u2("months"), n3 = (u2("monthsShort") || t4.map(function(e5) {
              return e5.slice(0, 3);
            })).indexOf(e4) + 1;
            if (n3 < 1) throw new Error();
            this.month = n3 % 12 || n3;
          }], MMMM: [o2, function(e4) {
            var t4 = u2("months").indexOf(e4) + 1;
            if (t4 < 1) throw new Error();
            this.month = t4 % 12 || t4;
          }], Y: [/[+-]?\d+/, s2("year")], YY: [n2, function(e4) {
            this.year = l2(e4);
          }], YYYY: [/\d{4}/, s2("year")], Z: i2, ZZ: i2 };
          function f2(n3) {
            var a3, o3;
            a3 = n3, o3 = r2 && r2.formats;
            for (var l3 = (n3 = a3.replace(/(\[[^\]]+])|(LTS?|l{1,4}|L{1,4})/g, function(t4, n4, a4) {
              var r3 = a4 && a4.toUpperCase();
              return n4 || o3[a4] || e3[a4] || o3[r3].replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e4, t5, n5) {
                return t5 || n5.slice(1);
              });
            })).match(t3), s3 = l3.length, i3 = 0; i3 < s3; i3 += 1) {
              var u3 = l3[i3], c3 = d2[u3], f3 = c3 && c3[0], v2 = c3 && c3[1];
              l3[i3] = v2 ? { regex: f3, parser: v2 } : u3.replace(/^\[|\]$/g, "");
            }
            return function(e4) {
              for (var t4 = {}, n4 = 0, a4 = 0; n4 < s3; n4 += 1) {
                var o4 = l3[n4];
                if ("string" == typeof o4) a4 += o4.length;
                else {
                  var r3 = o4.regex, i4 = o4.parser, u4 = e4.slice(a4), c4 = r3.exec(u4)[0];
                  i4.call(t4, c4), e4 = e4.replace(c4, "");
                }
              }
              return function(e5) {
                var t5 = e5.afternoon;
                if (void 0 !== t5) {
                  var n5 = e5.hours;
                  t5 ? n5 < 12 && (e5.hours += 12) : 12 === n5 && (e5.hours = 0), delete e5.afternoon;
                }
              }(t4), t4;
            };
          }
          return function(e4, t4, n3) {
            n3.p.customParseFormat = true, e4 && e4.parseTwoDigitYear && (l2 = e4.parseTwoDigitYear);
            var a3 = t4.prototype, o3 = a3.parse;
            a3.parse = function(e5) {
              var t5 = e5.date, a4 = e5.utc, l3 = e5.args;
              this.$u = a4;
              var s3 = l3[1];
              if ("string" == typeof s3) {
                var i3 = true === l3[2], u3 = true === l3[3], c3 = i3 || u3, d3 = l3[2];
                u3 && (d3 = l3[2]), r2 = this.$locale(), !i3 && d3 && (r2 = n3.Ls[d3]), this.$d = function(e6, t6, n4) {
                  try {
                    if (["x", "X"].indexOf(t6) > -1) return new Date(("X" === t6 ? 1e3 : 1) * e6);
                    var a5 = f2(t6)(e6), o4 = a5.year, r3 = a5.month, l4 = a5.day, s4 = a5.hours, i4 = a5.minutes, u4 = a5.seconds, c4 = a5.milliseconds, d4 = a5.zone, v3 = /* @__PURE__ */ new Date(), p3 = l4 || (o4 || r3 ? 1 : v3.getDate()), m3 = o4 || v3.getFullYear(), h2 = 0;
                    o4 && !r3 || (h2 = r3 > 0 ? r3 - 1 : v3.getMonth());
                    var b2 = s4 || 0, g2 = i4 || 0, y2 = u4 || 0, w2 = c4 || 0;
                    return d4 ? new Date(Date.UTC(m3, h2, p3, b2, g2, y2, w2 + 60 * d4.offset * 1e3)) : n4 ? new Date(Date.UTC(m3, h2, p3, b2, g2, y2, w2)) : new Date(m3, h2, p3, b2, g2, y2, w2);
                  } catch (e7) {
                    return /* @__PURE__ */ new Date("");
                  }
                }(t5, s3, a4), this.init(), d3 && true !== d3 && (this.$L = this.locale(d3).$L), c3 && t5 != this.format(s3) && (this.$d = /* @__PURE__ */ new Date("")), r2 = {};
              } else if (s3 instanceof Array) for (var v2 = s3.length, p2 = 1; p2 <= v2; p2 += 1) {
                l3[1] = s3[p2 - 1];
                var m2 = n3.apply(this, l3);
                if (m2.isValid()) {
                  this.$d = m2.$d, this.$L = m2.$L, this.init();
                  break;
                }
                p2 === v2 && (this.$d = /* @__PURE__ */ new Date(""));
              }
              else o3.call(this, e5);
            };
          };
        });
      })(Cp);
      var _p = Cp.exports;
      const Mp = wp(_p);
      const Op = ["hours", "minutes", "seconds"];
      const Dp = "HH:mm:ss";
      const Ap = "YYYY-MM-DD";
      const Ep = { date: Ap, dates: Ap, week: "gggg[w]ww", year: "YYYY", years: "YYYY", month: "YYYY-MM", datetime: `${Ap} ${Dp}`, monthrange: "YYYY-MM", daterange: Ap, datetimerange: `${Ap} ${Dp}` };
      const $p = (e2, t2) => [e2 > 0 ? e2 - 1 : void 0, e2, e2 < t2 ? e2 + 1 : void 0];
      const Lp = (e2) => Array.from(Array.from({ length: e2 }).keys());
      const Ip = (e2) => e2.replace(/\W?m{1,2}|\W?ZZ/g, "").replace(/\W?h{1,2}|\W?s{1,3}|\W?a/gi, "").trim();
      const Tp = (e2) => e2.replace(/\W?D{1,2}|\W?Do|\W?d{1,4}|\W?M{1,4}|\W?Y{2,4}/g, "").trim();
      const Pp = function(e2, t2) {
        const n2 = nt(e2);
        const a2 = nt(t2);
        if (n2 && a2) {
          return e2.getTime() === t2.getTime();
        }
        if (!n2 && !a2) {
          return e2 === t2;
        }
        return false;
      };
      const Bp = function(e2, t2) {
        const n2 = tt(e2);
        const a2 = tt(t2);
        if (n2 && a2) {
          if (e2.length !== t2.length) {
            return false;
          }
          return e2.every((e3, n3) => Pp(e3, t2[n3]));
        }
        if (!n2 && !a2) {
          return Pp(e2, t2);
        }
        return false;
      };
      const Rp = function(e2, t2, n2) {
        const a2 = Dl(t2) || t2 === "x" ? Sp(e2).locale(n2) : Sp(e2, t2).locale(n2);
        return a2.isValid() ? a2 : void 0;
      };
      const Vp = function(e2, t2, n2) {
        if (Dl(t2)) return e2;
        if (t2 === "x") return +e2;
        return Sp(e2).locale(n2).format(t2);
      };
      const Fp = (e2, t2) => {
        var n2;
        const a2 = [];
        const o2 = t2 == null ? void 0 : t2();
        for (let t3 = 0; t3 < e2; t3++) {
          a2.push((n2 = o2 == null ? void 0 : o2.includes(t3)) != null ? n2 : false);
        }
        return a2;
      };
      const jp = Cs({ disabledHours: { type: ks(Function) }, disabledMinutes: { type: ks(Function) }, disabledSeconds: { type: ks(Function) } });
      const zp = Cs({ visible: Boolean, actualVisible: { type: Boolean, default: void 0 }, format: { type: String, default: "" } });
      const Np = Cs({ id: { type: ks([Array, String]) }, name: { type: ks([Array, String]), default: "" }, popperClass: { type: String, default: "" }, format: String, valueFormat: String, dateFormat: String, timeFormat: String, type: { type: String, default: "" }, clearable: { type: Boolean, default: true }, clearIcon: { type: ks([String, Object]), default: as }, editable: { type: Boolean, default: true }, prefixIcon: { type: ks([String, Object]), default: "" }, size: Nc, readonly: Boolean, disabled: Boolean, placeholder: { type: String, default: "" }, popperOptions: { type: ks(Object), default: () => ({}) }, modelValue: { type: ks([Date, Array, String, Number]), default: "" }, rangeSeparator: { type: String, default: "-" }, startPlaceholder: String, endPlaceholder: String, defaultValue: { type: ks([Date, Array]) }, defaultTime: { type: ks([Date, Array]) }, isRange: Boolean, ...jp, disabledDate: { type: Function }, cellClassName: { type: Function }, shortcuts: { type: Array, default: () => [] }, arrowControl: Boolean, label: { type: String, default: void 0 }, tabindex: { type: ks([String, Number]), default: 0 }, validateEvent: { type: Boolean, default: true }, unlinkPanels: Boolean, ...Kc, ...Zc(["ariaLabel"]) });
      const Hp = ["id", "name", "placeholder", "value", "disabled", "readonly"];
      const Yp = ["id", "name", "placeholder", "value", "disabled", "readonly"];
      const Wp = vue.defineComponent({ name: "Picker" });
      const Up = vue.defineComponent({ ...Wp, props: Np, emits: ["update:modelValue", "change", "focus", "blur", "calendar-change", "panel-change", "visible-change", "keydown"], setup(e2, { expose: o2, emit: l2 }) {
        const u2 = e2;
        const c2 = vue.useAttrs();
        const { lang: d2 } = Xs();
        const p2 = oi("date");
        const m2 = oi("input");
        const h2 = oi("range");
        const { form: b2, formItem: k2 } = vd();
        const x2 = vue.inject("ElPopperOptions", {});
        const { valueOnClear: C2 } = qc(u2, null);
        const O2 = vue.ref();
        const I2 = vue.ref();
        const B2 = vue.ref(false);
        const R2 = vue.ref(false);
        const V2 = vue.ref(null);
        let F2 = false;
        let j2 = false;
        const z2 = vue.computed(() => [p2.b("editor"), p2.bm("editor", u2.type), m2.e("wrapper"), p2.is("disabled", le2.value), p2.is("active", B2.value), h2.b("editor"), xe2 ? h2.bm("editor", xe2.value) : "", c2.class]);
        const N2 = vue.computed(() => [m2.e("icon"), h2.e("close-icon"), !pe2.value ? h2.e("close-icon--hidden") : ""]);
        vue.watch(B2, (e3) => {
          if (!e3) {
            _e2.value = null;
            vue.nextTick(() => {
              H2(u2.modelValue);
            });
          } else {
            vue.nextTick(() => {
              if (e3) {
                V2.value = u2.modelValue;
              }
            });
          }
        });
        const H2 = (e3, t2) => {
          if (t2 || !Bp(e3, V2.value)) {
            l2("change", e3);
            u2.validateEvent && (k2 == null ? void 0 : k2.validate("change").catch((e4) => Pl()));
          }
        };
        const Y2 = (e3) => {
          if (!Bp(u2.modelValue, e3)) {
            let t2;
            if (tt(e3)) {
              t2 = e3.map((e4) => Vp(e4, u2.valueFormat, d2.value));
            } else if (e3) {
              t2 = Vp(e3, u2.valueFormat, d2.value);
            }
            l2("update:modelValue", e3 ? t2 : e3, d2.value);
          }
        };
        const W2 = (e3) => {
          l2("keydown", e3);
        };
        const U2 = vue.computed(() => {
          if (I2.value) {
            const e3 = ke2.value ? I2.value : I2.value.$el;
            return Array.from(e3.querySelectorAll("input"));
          }
          return [];
        });
        const K2 = (e3, t2, n2) => {
          const a2 = U2.value;
          if (!a2.length) return;
          if (!n2 || n2 === "min") {
            a2[0].setSelectionRange(e3, t2);
            a2[0].focus();
          } else if (n2 === "max") {
            a2[1].setSelectionRange(e3, t2);
            a2[1].focus();
          }
        };
        const q2 = () => {
          ne2(true, true);
          vue.nextTick(() => {
            j2 = false;
          });
        };
        const G2 = (e3 = "", t2 = false) => {
          if (!t2) {
            j2 = true;
          }
          B2.value = t2;
          let n2;
          if (tt(e3)) {
            n2 = e3.map((e4) => e4.toDate());
          } else {
            n2 = e3 ? e3.toDate() : e3;
          }
          _e2.value = null;
          Y2(n2);
        };
        const Z2 = () => {
          R2.value = true;
        };
        const J2 = () => {
          l2("visible-change", true);
        };
        const X2 = (e3) => {
          if ((e3 == null ? void 0 : e3.key) === $s.esc) {
            ne2(true, true);
          }
        };
        const Q2 = () => {
          R2.value = false;
          B2.value = false;
          j2 = false;
          l2("visible-change", false);
        };
        const ee2 = () => {
          B2.value = true;
        };
        const te2 = () => {
          B2.value = false;
        };
        const ne2 = (e3 = true, t2 = false) => {
          j2 = t2;
          const [n2, a2] = vue.unref(U2);
          let o3 = n2;
          if (!e3 && ke2.value) {
            o3 = a2;
          }
          if (o3) {
            o3.focus();
          }
        };
        const ae2 = (e3) => {
          if (u2.readonly || le2.value || B2.value || j2) {
            return;
          }
          B2.value = true;
          l2("focus", e3);
        };
        let oe2 = void 0;
        const re2 = (e3) => {
          const t2 = async () => {
            setTimeout(() => {
              var n2;
              if (oe2 === t2) {
                if (!(((n2 = O2.value) == null ? void 0 : n2.isFocusInsideContent()) && !F2) && U2.value.filter((e4) => e4.contains(document.activeElement)).length === 0) {
                  Me2();
                  B2.value = false;
                  l2("blur", e3);
                  u2.validateEvent && (k2 == null ? void 0 : k2.validate("blur").catch((e4) => Pl()));
                }
                F2 = false;
              }
            }, 0);
          };
          oe2 = t2;
          t2();
        };
        const le2 = vue.computed(() => u2.disabled || (b2 == null ? void 0 : b2.disabled));
        const se2 = vue.computed(() => {
          let e3;
          if (he2.value) {
            if (Re2.value.getDefaultValue) {
              e3 = Re2.value.getDefaultValue();
            }
          } else {
            if (tt(u2.modelValue)) {
              e3 = u2.modelValue.map((e4) => Rp(e4, u2.valueFormat, d2.value));
            } else {
              e3 = Rp(u2.modelValue, u2.valueFormat, d2.value);
            }
          }
          if (Re2.value.getRangeAvailableTime) {
            const t2 = Re2.value.getRangeAvailableTime(e3);
            if (!gl(t2, e3)) {
              e3 = t2;
              Y2(tt(e3) ? e3.map((e4) => e4.toDate()) : e3.toDate());
            }
          }
          if (tt(e3) && e3.some((e4) => !e4)) {
            e3 = [];
          }
          return e3;
        });
        const ie2 = vue.computed(() => {
          if (!Re2.value.panelReady) return "";
          const e3 = De2(se2.value);
          if (tt(_e2.value)) {
            return [_e2.value[0] || e3 && e3[0] || "", _e2.value[1] || e3 && e3[1] || ""];
          } else if (_e2.value !== null) {
            return _e2.value;
          }
          if (!ce2.value && he2.value) return "";
          if (!B2.value && he2.value) return "";
          if (e3) {
            return de2.value || fe2.value ? e3.join(", ") : e3;
          }
          return "";
        });
        const ue2 = vue.computed(() => u2.type.includes("time"));
        const ce2 = vue.computed(() => u2.type.startsWith("time"));
        const de2 = vue.computed(() => u2.type === "dates");
        const fe2 = vue.computed(() => u2.type === "years");
        const ve2 = vue.computed(() => u2.prefixIcon || (ue2.value ? rs : Ql));
        const pe2 = vue.ref(false);
        const me2 = (e3) => {
          if (u2.readonly || le2.value) return;
          if (pe2.value) {
            e3.stopPropagation();
            q2();
            Y2(C2.value);
            H2(C2.value, true);
            pe2.value = false;
            B2.value = false;
            Re2.value.handleClear && Re2.value.handleClear();
          }
        };
        const he2 = vue.computed(() => {
          const { modelValue: e3 } = u2;
          return !e3 || tt(e3) && !e3.filter(Boolean).length;
        });
        const be2 = async (e3) => {
          var t2;
          if (u2.readonly || le2.value) return;
          if (((t2 = e3.target) == null ? void 0 : t2.tagName) !== "INPUT" || U2.value.includes(document.activeElement)) {
            B2.value = true;
          }
        };
        const ge2 = () => {
          if (u2.readonly || le2.value) return;
          if (!he2.value && u2.clearable) {
            pe2.value = true;
          }
        };
        const ye2 = () => {
          pe2.value = false;
        };
        const we2 = (e3) => {
          var t2;
          if (u2.readonly || le2.value) return;
          if (((t2 = e3.touches[0].target) == null ? void 0 : t2.tagName) !== "INPUT" || U2.value.includes(document.activeElement)) {
            B2.value = true;
          }
        };
        const ke2 = vue.computed(() => u2.type.includes("range"));
        const xe2 = dd();
        const Se2 = vue.computed(() => {
          var e3, t2;
          return (t2 = (e3 = vue.unref(O2)) == null ? void 0 : e3.popperRef) == null ? void 0 : t2.contentRef;
        });
        const Ce2 = vue.computed(() => {
          var e3;
          if (vue.unref(ke2)) {
            return vue.unref(I2);
          }
          return (e3 = vue.unref(I2)) == null ? void 0 : e3.$el;
        });
        Te(Ce2, (e3) => {
          const t2 = vue.unref(Se2);
          const n2 = vue.unref(Ce2);
          if (t2 && (e3.target === t2 || e3.composedPath().includes(t2)) || e3.target === n2 || e3.composedPath().includes(n2)) return;
          B2.value = false;
        });
        const _e2 = vue.ref(null);
        const Me2 = () => {
          if (_e2.value) {
            const e3 = Oe2(ie2.value);
            if (e3) {
              if (Ae2(e3)) {
                Y2(tt(e3) ? e3.map((e4) => e4.toDate()) : e3.toDate());
                _e2.value = null;
              }
            }
          }
          if (_e2.value === "") {
            Y2(C2.value);
            H2(C2.value);
            _e2.value = null;
          }
        };
        const Oe2 = (e3) => {
          if (!e3) return null;
          return Re2.value.parseUserInput(e3);
        };
        const De2 = (e3) => {
          if (!e3) return null;
          return Re2.value.formatToString(e3);
        };
        const Ae2 = (e3) => Re2.value.isValidValue(e3);
        const Ee2 = async (e3) => {
          if (u2.readonly || le2.value) return;
          const { code: t2 } = e3;
          W2(e3);
          if (t2 === $s.esc) {
            if (B2.value === true) {
              B2.value = false;
              e3.preventDefault();
              e3.stopPropagation();
            }
            return;
          }
          if (t2 === $s.down) {
            if (Re2.value.handleFocusPicker) {
              e3.preventDefault();
              e3.stopPropagation();
            }
            if (B2.value === false) {
              B2.value = true;
              await vue.nextTick();
            }
            if (Re2.value.handleFocusPicker) {
              Re2.value.handleFocusPicker();
              return;
            }
          }
          if (t2 === $s.tab) {
            F2 = true;
            return;
          }
          if (t2 === $s.enter || t2 === $s.numpadEnter) {
            if (_e2.value === null || _e2.value === "" || Ae2(Oe2(ie2.value))) {
              Me2();
              B2.value = false;
            }
            e3.stopPropagation();
            return;
          }
          if (_e2.value) {
            e3.stopPropagation();
            return;
          }
          if (Re2.value.handleKeydownInput) {
            Re2.value.handleKeydownInput(e3);
          }
        };
        const $e2 = (e3) => {
          _e2.value = e3;
          if (!B2.value) {
            B2.value = true;
          }
        };
        const Le2 = (e3) => {
          const t2 = e3.target;
          if (_e2.value) {
            _e2.value = [t2.value, _e2.value[1]];
          } else {
            _e2.value = [t2.value, null];
          }
        };
        const Ie2 = (e3) => {
          const t2 = e3.target;
          if (_e2.value) {
            _e2.value = [_e2.value[0], t2.value];
          } else {
            _e2.value = [null, t2.value];
          }
        };
        const Pe2 = () => {
          var e3;
          const t2 = _e2.value;
          const n2 = Oe2(t2 && t2[0]);
          const a2 = vue.unref(se2);
          if (n2 && n2.isValid()) {
            _e2.value = [De2(n2), ((e3 = ie2.value) == null ? void 0 : e3[1]) || null];
            const t3 = [n2, a2 && (a2[1] || null)];
            if (Ae2(t3)) {
              Y2(t3);
              _e2.value = null;
            }
          }
        };
        const Be2 = () => {
          var e3;
          const t2 = vue.unref(_e2);
          const n2 = Oe2(t2 && t2[1]);
          const a2 = vue.unref(se2);
          if (n2 && n2.isValid()) {
            _e2.value = [((e3 = vue.unref(ie2)) == null ? void 0 : e3[0]) || null, De2(n2)];
            const t3 = [a2 && a2[0], n2];
            if (Ae2(t3)) {
              Y2(t3);
              _e2.value = null;
            }
          }
        };
        const Re2 = vue.ref({});
        const Ve2 = (e3) => {
          Re2.value[e3[0]] = e3[1];
          Re2.value.panelReady = true;
        };
        const Fe2 = (e3) => {
          l2("calendar-change", e3);
        };
        const je2 = (e3, t2, n2) => {
          l2("panel-change", e3, t2, n2);
        };
        vue.provide("EP_PICKER_BASE", { props: u2 });
        Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-time-picker", ref: "https://element-plus.org/en-US/component/time-picker.html" }, vue.computed(() => !!u2.label));
        o2({ focus: ne2, handleFocusInput: ae2, handleBlurInput: re2, handleOpen: ee2, handleClose: te2, onPick: G2 });
        return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.unref(Mv), vue.mergeProps({ ref_key: "refPopper", ref: O2, visible: B2.value, effect: "light", pure: "", trigger: "click" }, e3.$attrs, { role: "dialog", teleported: "", transition: `${vue.unref(p2).namespace.value}-zoom-in-top`, "popper-class": [`${vue.unref(p2).namespace.value}-picker__popper`, e3.popperClass], "popper-options": vue.unref(x2), "fallback-placements": ["bottom", "top", "right", "left"], "gpu-acceleration": false, "stop-popper-mouse-event": false, "hide-after": 0, persistent: "", onBeforeShow: Z2, onShow: J2, onHide: Q2 }), { default: vue.withCtx(() => [!vue.unref(ke2) ? (vue.openBlock(), vue.createBlock(vue.unref(Dd), { key: 0, id: e3.id, ref_key: "inputRef", ref: I2, "container-role": "combobox", "model-value": vue.unref(ie2), name: e3.name, size: vue.unref(xe2), disabled: vue.unref(le2), placeholder: e3.placeholder, class: vue.normalizeClass([vue.unref(p2).b("editor"), vue.unref(p2).bm("editor", e3.type), e3.$attrs.class]), style: vue.normalizeStyle(e3.$attrs.style), readonly: !e3.editable || e3.readonly || vue.unref(de2) || vue.unref(fe2) || e3.type === "week", "aria-label": e3.label || e3.ariaLabel, tabindex: e3.tabindex, "validate-event": false, onInput: $e2, onFocus: ae2, onBlur: re2, onKeydown: Ee2, onChange: Me2, onMousedown: be2, onMouseenter: ge2, onMouseleave: ye2, onTouchstartPassive: we2, onClick: o3[0] || (o3[0] = vue.withModifiers(() => {
        }, ["stop"])) }, { prefix: vue.withCtx(() => [vue.unref(ve2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(m2).e("icon")), onMousedown: vue.withModifiers(be2, ["prevent"]), onTouchstartPassive: we2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ve2))))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true)]), suffix: vue.withCtx(() => [pe2.value && e3.clearIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(`${vue.unref(m2).e("icon")} clear-icon`), onClick: vue.withModifiers(me2, ["stop"]) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.clearIcon)))]), _: 1 }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true)]), _: 1 }, 8, ["id", "model-value", "name", "size", "disabled", "placeholder", "class", "style", "readonly", "aria-label", "tabindex", "onKeydown"])) : (vue.openBlock(), vue.createElementBlock("div", { key: 1, ref_key: "inputRef", ref: I2, class: vue.normalizeClass(vue.unref(z2)), style: vue.normalizeStyle(e3.$attrs.style), onClick: ae2, onMouseenter: ge2, onMouseleave: ye2, onTouchstartPassive: we2, onKeydown: Ee2 }, [vue.unref(ve2) ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass([vue.unref(m2).e("icon"), vue.unref(h2).e("icon")]), onMousedown: vue.withModifiers(be2, ["prevent"]), onTouchstartPassive: we2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(ve2))))]), _: 1 }, 8, ["class", "onMousedown"])) : vue.createCommentVNode("v-if", true), vue.createElementVNode("input", { id: e3.id && e3.id[0], autocomplete: "off", name: e3.name && e3.name[0], placeholder: e3.startPlaceholder, value: vue.unref(ie2) && vue.unref(ie2)[0], disabled: vue.unref(le2), readonly: !e3.editable || e3.readonly, class: vue.normalizeClass(vue.unref(h2).b("input")), onMousedown: be2, onInput: Le2, onChange: Pe2, onFocus: ae2, onBlur: re2 }, null, 42, Hp), vue.renderSlot(e3.$slots, "range-separator", {}, () => [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(h2).b("separator")) }, vue.toDisplayString(e3.rangeSeparator), 3)]), vue.createElementVNode("input", { id: e3.id && e3.id[1], autocomplete: "off", name: e3.name && e3.name[1], placeholder: e3.endPlaceholder, value: vue.unref(ie2) && vue.unref(ie2)[1], disabled: vue.unref(le2), readonly: !e3.editable || e3.readonly, class: vue.normalizeClass(vue.unref(h2).b("input")), onMousedown: be2, onFocus: ae2, onBlur: re2, onInput: Ie2, onChange: Be2 }, null, 42, Yp), e3.clearIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 1, class: vue.normalizeClass(vue.unref(N2)), onClick: me2 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.clearIcon)))]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true)], 38))]), content: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default", { visible: B2.value, actualVisible: R2.value, parsedValue: vue.unref(se2), format: e3.format, dateFormat: e3.dateFormat, timeFormat: e3.timeFormat, unlinkPanels: e3.unlinkPanels, type: e3.type, defaultValue: e3.defaultValue, onPick: G2, onSelectRange: K2, onSetPickerOption: Ve2, onCalendarChange: Fe2, onPanelChange: je2, onKeydown: X2, onMousedown: o3[1] || (o3[1] = vue.withModifiers(() => {
        }, ["stop"])) })]), _: 3 }, 16, ["visible", "transition", "popper-class", "popper-options"]));
      } });
      var Kp = ad(Up, [["__file", "picker.vue"]]);
      const qp = Cs({ ...zp, datetimeRole: String, parsedValue: { type: ks(Object) } });
      const Gp = ({ getAvailableHours: e2, getAvailableMinutes: t2, getAvailableSeconds: n2 }) => {
        const a2 = (a3, o3, r3, l2) => {
          const s2 = { hour: e2, minute: t2, second: n2 };
          let i2 = a3;
          ["hour", "minute", "second"].forEach((e3) => {
            if (s2[e3]) {
              let t3;
              const n3 = s2[e3];
              switch (e3) {
                case "minute": {
                  t3 = n3(i2.hour(), o3, l2);
                  break;
                }
                case "second": {
                  t3 = n3(i2.hour(), i2.minute(), o3, l2);
                  break;
                }
                default: {
                  t3 = n3(o3, l2);
                  break;
                }
              }
              if ((t3 == null ? void 0 : t3.length) && !t3.includes(i2[e3]())) {
                const n4 = r3 ? 0 : t3.length - 1;
                i2 = i2[e3](t3[n4]);
              }
            }
          });
          return i2;
        };
        const o2 = {};
        const r2 = ([e3, t3]) => {
          o2[e3] = t3;
        };
        return { timePickerOptions: o2, getAvailableTime: a2, onSetOption: r2 };
      };
      const Zp = (e2) => {
        const t2 = (e3, t3) => e3 || t3;
        const n2 = (e3) => e3 !== true;
        return e2.map(t2).filter(n2);
      };
      const Jp = (e2, t2, n2) => {
        const a2 = (t3, n3) => Fp(24, e2 && (() => e2 == null ? void 0 : e2(t3, n3)));
        const o2 = (e3, n3, a3) => Fp(60, t2 && (() => t2 == null ? void 0 : t2(e3, n3, a3)));
        const r2 = (e3, t3, a3, o3) => Fp(60, n2 && (() => n2 == null ? void 0 : n2(e3, t3, a3, o3)));
        return { getHoursList: a2, getMinutesList: o2, getSecondsList: r2 };
      };
      const Xp = (e2, t2, n2) => {
        const { getHoursList: a2, getMinutesList: o2, getSecondsList: r2 } = Jp(e2, t2, n2);
        const l2 = (e3, t3) => Zp(a2(e3, t3));
        const s2 = (e3, t3, n3) => Zp(o2(e3, t3, n3));
        const i2 = (e3, t3, n3, a3) => Zp(r2(e3, t3, n3, a3));
        return { getAvailableHours: l2, getAvailableMinutes: s2, getAvailableSeconds: i2 };
      };
      const Qp = (e2) => {
        const t2 = vue.ref(e2.parsedValue);
        vue.watch(() => e2.visible, (n2) => {
          if (!n2) {
            t2.value = e2.parsedValue;
          }
        });
        return t2;
      };
      const em = /* @__PURE__ */ new Map();
      let tm;
      if (ke) {
        document.addEventListener("mousedown", (e2) => tm = e2);
        document.addEventListener("mouseup", (e2) => {
          for (const t2 of em.values()) {
            for (const { documentHandler: n2 } of t2) {
              n2(e2, tm);
            }
          }
        });
      }
      function nm(e2, t2) {
        let n2 = [];
        if (Array.isArray(t2.arg)) {
          n2 = t2.arg;
        } else if (Al(t2.arg)) {
          n2.push(t2.arg);
        }
        return function(a2, o2) {
          const r2 = t2.instance.popperRef;
          const l2 = a2.target;
          const s2 = o2 == null ? void 0 : o2.target;
          const i2 = !t2 || !t2.instance;
          const u2 = !l2 || !s2;
          const c2 = e2.contains(l2) || e2.contains(s2);
          const d2 = e2 === l2;
          const f2 = n2.length && n2.some((e3) => e3 == null ? void 0 : e3.contains(l2)) || n2.length && n2.includes(s2);
          const v2 = r2 && (r2.contains(l2) || r2.contains(s2));
          if (i2 || u2 || c2 || d2 || f2 || v2) {
            return;
          }
          t2.value(a2, o2);
        };
      }
      const am = { beforeMount(e2, t2) {
        if (!em.has(e2)) {
          em.set(e2, []);
        }
        em.get(e2).push({ documentHandler: nm(e2, t2), bindingFn: t2.value });
      }, updated(e2, t2) {
        if (!em.has(e2)) {
          em.set(e2, []);
        }
        const n2 = em.get(e2);
        const a2 = n2.findIndex((e3) => e3.bindingFn === t2.oldValue);
        const o2 = { documentHandler: nm(e2, t2), bindingFn: t2.value };
        if (a2 >= 0) {
          n2.splice(a2, 1, o2);
        } else {
          n2.push(o2);
        }
      }, unmounted(e2) {
        em.delete(e2);
      } };
      const om = 100;
      const rm = 600;
      const lm = { beforeMount(e2, t2) {
        const n2 = t2.value;
        const { interval: a2 = om, delay: o2 = rm } = at(n2) ? {} : n2;
        let r2;
        let l2;
        const s2 = () => at(n2) ? n2() : n2.handler();
        const i2 = () => {
          if (l2) {
            clearTimeout(l2);
            l2 = void 0;
          }
          if (r2) {
            clearInterval(r2);
            r2 = void 0;
          }
        };
        e2.addEventListener("mousedown", (e3) => {
          if (e3.button !== 0) return;
          i2();
          s2();
          document.addEventListener("mouseup", () => i2(), { once: true });
          l2 = setTimeout(() => {
            r2 = setInterval(() => {
              s2();
            }, a2);
          }, o2);
        });
      } };
      const sm = Cs({ role: { type: String, required: true }, spinnerDate: { type: ks(Object), required: true }, showSeconds: { type: Boolean, default: true }, arrowControl: Boolean, amPmMode: { type: ks(String), default: "" }, ...jp });
      const im = ["onClick"];
      const um = ["onMouseenter"];
      const cm = vue.defineComponent({ __name: "basic-time-spinner", props: sm, emits: ["change", "select-range", "set-option"], setup(e2, { emit: o2 }) {
        const l2 = e2;
        const c2 = oi("time");
        const { getHoursList: d2, getMinutesList: f2, getSecondsList: p2 } = Jp(l2.disabledHours, l2.disabledMinutes, l2.disabledSeconds);
        let m2 = false;
        const h2 = vue.ref();
        const b2 = vue.ref();
        const g2 = vue.ref();
        const y2 = vue.ref();
        const w2 = { hours: b2, minutes: g2, seconds: y2 };
        const k2 = vue.computed(() => l2.showSeconds ? Op : Op.slice(0, 2));
        const x2 = vue.computed(() => {
          const { spinnerDate: e3 } = l2;
          const t2 = e3.hour();
          const n2 = e3.minute();
          const a2 = e3.second();
          return { hours: t2, minutes: n2, seconds: a2 };
        });
        const S2 = vue.computed(() => {
          const { hours: e3, minutes: t2 } = vue.unref(x2);
          return { hours: d2(l2.role), minutes: f2(e3, l2.role), seconds: p2(e3, t2, l2.role) };
        });
        const C2 = vue.computed(() => {
          const { hours: e3, minutes: t2, seconds: n2 } = vue.unref(x2);
          return { hours: $p(e3, 23), minutes: $p(t2, 59), seconds: $p(n2, 59) };
        });
        const $2 = hl((e3) => {
          m2 = false;
          B2(e3);
        }, 200);
        const L2 = (e3) => {
          const t2 = !!l2.amPmMode;
          if (!t2) return "";
          const n2 = l2.amPmMode === "A";
          let a2 = e3 < 12 ? " am" : " pm";
          if (n2) a2 = a2.toUpperCase();
          return a2;
        };
        const P2 = (e3) => {
          let t2;
          switch (e3) {
            case "hours":
              t2 = [0, 2];
              break;
            case "minutes":
              t2 = [3, 5];
              break;
            case "seconds":
              t2 = [6, 8];
              break;
          }
          const [n2, a2] = t2;
          o2("select-range", n2, a2);
          h2.value = e3;
        };
        const B2 = (e3) => {
          j2(e3, vue.unref(x2)[e3]);
        };
        const V2 = () => {
          B2("hours");
          B2("minutes");
          B2("seconds");
        };
        const F2 = (e3) => e3.querySelector(`.${c2.namespace.value}-scrollbar__wrap`);
        const j2 = (e3, t2) => {
          if (l2.arrowControl) return;
          const n2 = vue.unref(w2[e3]);
          if (n2 && n2.$el) {
            F2(n2.$el).scrollTop = Math.max(0, t2 * z2(e3));
          }
        };
        const z2 = (e3) => {
          const t2 = vue.unref(w2[e3]);
          const n2 = t2 == null ? void 0 : t2.$el.querySelector("li");
          if (n2) {
            return Number.parseFloat(jl(n2, "height")) || 0;
          }
          return 0;
        };
        const N2 = () => {
          Y2(1);
        };
        const H2 = () => {
          Y2(-1);
        };
        const Y2 = (e3) => {
          if (!h2.value) {
            P2("hours");
          }
          const t2 = h2.value;
          const n2 = vue.unref(x2)[t2];
          const a2 = h2.value === "hours" ? 24 : 60;
          const o3 = W2(t2, n2, e3, a2);
          U2(t2, o3);
          j2(t2, o3);
          vue.nextTick(() => P2(t2));
        };
        const W2 = (e3, t2, n2, a2) => {
          let o3 = (t2 + n2 + a2) % a2;
          const r2 = vue.unref(S2)[e3];
          while (r2[o3] && o3 !== t2) {
            o3 = (o3 + n2 + a2) % a2;
          }
          return o3;
        };
        const U2 = (e3, t2) => {
          const n2 = vue.unref(S2)[e3];
          const a2 = n2[t2];
          if (a2) return;
          const { hours: r2, minutes: s2, seconds: u2 } = vue.unref(x2);
          let c3;
          switch (e3) {
            case "hours":
              c3 = l2.spinnerDate.hour(t2).minute(s2).second(u2);
              break;
            case "minutes":
              c3 = l2.spinnerDate.hour(r2).minute(t2).second(u2);
              break;
            case "seconds":
              c3 = l2.spinnerDate.hour(r2).minute(s2).second(t2);
              break;
          }
          o2("change", c3);
        };
        const G2 = (e3, { value: t2, disabled: n2 }) => {
          if (!n2) {
            U2(e3, t2);
            P2(e3);
            j2(e3, t2);
          }
        };
        const Z2 = (e3) => {
          m2 = true;
          $2(e3);
          const t2 = Math.min(Math.round((F2(vue.unref(w2[e3]).$el).scrollTop - (J2(e3) * 0.5 - 10) / z2(e3) + 3) / z2(e3)), e3 === "hours" ? 23 : 59);
          U2(e3, t2);
        };
        const J2 = (e3) => vue.unref(w2[e3]).$el.offsetHeight;
        const X2 = () => {
          const e3 = (e4) => {
            const t2 = vue.unref(w2[e4]);
            if (t2 && t2.$el) {
              F2(t2.$el).onscroll = () => {
                Z2(e4);
              };
            }
          };
          e3("hours");
          e3("minutes");
          e3("seconds");
        };
        vue.onMounted(() => {
          vue.nextTick(() => {
            !l2.arrowControl && X2();
            V2();
            if (l2.role === "start") P2("hours");
          });
        });
        const Q2 = (e3, t2) => {
          w2[t2].value = e3;
        };
        o2("set-option", [`${l2.role}_scrollDown`, Y2]);
        o2("set-option", [`${l2.role}_emitSelectRange`, P2]);
        vue.watch(() => l2.spinnerDate, () => {
          if (m2) return;
          V2();
        });
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(c2).b("spinner"), { "has-seconds": e3.showSeconds }]) }, [!e3.arrowControl ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 0 }, vue.renderList(vue.unref(k2), (a2) => (vue.openBlock(), vue.createBlock(vue.unref(Ud), { key: a2, ref_for: true, ref: (e4) => Q2(e4, a2), class: vue.normalizeClass(vue.unref(c2).be("spinner", "wrapper")), "wrap-style": "max-height: inherit;", "view-class": vue.unref(c2).be("spinner", "list"), noresize: "", tag: "ul", onMouseenter: (e4) => P2(a2), onMousemove: (e4) => B2(a2) }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(S2)[a2], (o4, r2) => (vue.openBlock(), vue.createElementBlock("li", { key: r2, class: vue.normalizeClass([vue.unref(c2).be("spinner", "item"), vue.unref(c2).is("active", r2 === vue.unref(x2)[a2]), vue.unref(c2).is("disabled", o4)]), onClick: (e4) => G2(a2, { value: r2, disabled: o4 }) }, [a2 === "hours" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(("0" + (e3.amPmMode ? r2 % 12 || 12 : r2)).slice(-2)) + vue.toDisplayString(L2(r2)), 1)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createTextVNode(vue.toDisplayString(("0" + r2).slice(-2)), 1)], 64))], 10, im))), 128))]), _: 2 }, 1032, ["class", "view-class", "onMouseenter", "onMousemove"]))), 128)) : vue.createCommentVNode("v-if", true), e3.arrowControl ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 1 }, vue.renderList(vue.unref(k2), (o4) => (vue.openBlock(), vue.createElementBlock("div", { key: o4, class: vue.normalizeClass([vue.unref(c2).be("spinner", "wrapper"), vue.unref(c2).is("arrow")]), onMouseenter: (e4) => P2(o4) }, [vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(id), { class: vue.normalizeClass(["arrow-up", vue.unref(c2).be("spinner", "arrow")]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Jl))]), _: 1 }, 8, ["class"])), [[vue.unref(lm), H2]]), vue.withDirectives((vue.openBlock(), vue.createBlock(vue.unref(id), { class: vue.normalizeClass(["arrow-down", vue.unref(c2).be("spinner", "arrow")]) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Wl))]), _: 1 }, 8, ["class"])), [[vue.unref(lm), N2]]), vue.createElementVNode("ul", { class: vue.normalizeClass(vue.unref(c2).be("spinner", "list")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(C2)[o4], (a2, r2) => (vue.openBlock(), vue.createElementBlock("li", { key: r2, class: vue.normalizeClass([vue.unref(c2).be("spinner", "item"), vue.unref(c2).is("active", a2 === vue.unref(x2)[o4]), vue.unref(c2).is("disabled", vue.unref(S2)[o4][a2])]) }, [typeof a2 === "number" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [o4 === "hours" ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(("0" + (e3.amPmMode ? a2 % 12 || 12 : a2)).slice(-2)) + vue.toDisplayString(L2(a2)), 1)], 64)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [vue.createTextVNode(vue.toDisplayString(("0" + a2).slice(-2)), 1)], 64))], 64)) : vue.createCommentVNode("v-if", true)], 2))), 128))], 2)], 42, um))), 128)) : vue.createCommentVNode("v-if", true)], 2));
      } });
      var dm = ad(cm, [["__file", "basic-time-spinner.vue"]]);
      const fm = vue.defineComponent({ __name: "panel-time-pick", props: qp, emits: ["pick", "select-range", "set-picker-option"], setup(e2, { emit: o2 }) {
        const l2 = e2;
        const s2 = vue.inject("EP_PICKER_BASE");
        const { arrowControl: u2, disabledHours: c2, disabledMinutes: d2, disabledSeconds: p2, defaultValue: m2 } = s2.props;
        const { getAvailableHours: h2, getAvailableMinutes: b2, getAvailableSeconds: g2 } = Xp(c2, d2, p2);
        const y2 = oi("time");
        const { t: w2, lang: k2 } = Xs();
        const x2 = vue.ref([0, 2]);
        const S2 = Qp(l2);
        const C2 = vue.computed(() => _l(l2.actualVisible) ? `${y2.namespace.value}-zoom-in-top` : "");
        const _2 = vue.computed(() => l2.format.includes("ss"));
        const O2 = vue.computed(() => {
          if (l2.format.includes("A")) return "A";
          if (l2.format.includes("a")) return "a";
          return "";
        });
        const $2 = (e3) => {
          const t2 = Sp(e3).locale(k2.value);
          const n2 = Y2(t2);
          return t2.isSame(n2);
        };
        const L2 = () => {
          o2("pick", S2.value, false);
        };
        const P2 = (e3 = false, t2 = false) => {
          if (t2) return;
          o2("pick", l2.parsedValue, e3);
        };
        const R2 = (e3) => {
          if (!l2.visible) {
            return;
          }
          const t2 = Y2(e3).millisecond(0);
          o2("pick", t2, true);
        };
        const V2 = (e3, t2) => {
          o2("select-range", e3, t2);
          x2.value = [e3, t2];
        };
        const F2 = (e3) => {
          const t2 = [0, 3].concat(_2.value ? [6] : []);
          const n2 = ["hours", "minutes"].concat(_2.value ? ["seconds"] : []);
          const a2 = t2.indexOf(x2.value[0]);
          const o3 = (a2 + e3 + t2.length) % t2.length;
          z2["start_emitSelectRange"](n2[o3]);
        };
        const j2 = (e3) => {
          const t2 = e3.code;
          const { left: n2, right: a2, up: o3, down: r2 } = $s;
          if ([n2, a2].includes(t2)) {
            const a3 = t2 === n2 ? -1 : 1;
            F2(a3);
            e3.preventDefault();
            return;
          }
          if ([o3, r2].includes(t2)) {
            const n3 = t2 === o3 ? -1 : 1;
            z2["start_scrollDown"](n3);
            e3.preventDefault();
            return;
          }
        };
        const { timePickerOptions: z2, onSetOption: N2, getAvailableTime: H2 } = Gp({ getAvailableHours: h2, getAvailableMinutes: b2, getAvailableSeconds: g2 });
        const Y2 = (e3) => H2(e3, l2.datetimeRole || "", true);
        const W2 = (e3) => {
          if (!e3) return null;
          return Sp(e3, l2.format).locale(k2.value);
        };
        const U2 = (e3) => {
          if (!e3) return null;
          return e3.format(l2.format);
        };
        const K2 = () => Sp(m2).locale(k2.value);
        o2("set-picker-option", ["isValidValue", $2]);
        o2("set-picker-option", ["formatToString", U2]);
        o2("set-picker-option", ["parseUserInput", W2]);
        o2("set-picker-option", ["handleKeydownInput", j2]);
        o2("set-picker-option", ["getRangeAvailableTime", Y2]);
        o2("set-picker-option", ["getDefaultValue", K2]);
        return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.Transition, { name: vue.unref(C2) }, { default: vue.withCtx(() => [e3.actualVisible || e3.visible ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(y2).b("panel")) }, [vue.createElementVNode("div", { class: vue.normalizeClass([vue.unref(y2).be("panel", "content"), { "has-seconds": vue.unref(_2) }]) }, [vue.createVNode(dm, { ref: "spinner", role: e3.datetimeRole || "start", "arrow-control": vue.unref(u2), "show-seconds": vue.unref(_2), "am-pm-mode": vue.unref(O2), "spinner-date": e3.parsedValue, "disabled-hours": vue.unref(c2), "disabled-minutes": vue.unref(d2), "disabled-seconds": vue.unref(p2), onChange: R2, onSetOption: vue.unref(N2), onSelectRange: V2 }, null, 8, ["role", "arrow-control", "show-seconds", "am-pm-mode", "spinner-date", "disabled-hours", "disabled-minutes", "disabled-seconds", "onSetOption"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(y2).be("panel", "footer")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(y2).be("panel", "btn"), "cancel"]), onClick: L2 }, vue.toDisplayString(vue.unref(w2)("el.datepicker.cancel")), 3), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(y2).be("panel", "btn"), "confirm"]), onClick: o3[0] || (o3[0] = (e4) => P2()) }, vue.toDisplayString(vue.unref(w2)("el.datepicker.confirm")), 3)], 2)], 2)) : vue.createCommentVNode("v-if", true)]), _: 1 }, 8, ["name"]));
      } });
      var vm = ad(fm, [["__file", "panel-time-pick.vue"]]);
      var pm = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          return function(e3, t3, n2) {
            var a2 = t3.prototype, o2 = function(e4) {
              return e4 && (e4.indexOf ? e4 : e4.s);
            }, r2 = function(e4, t4, n3, a3, r3) {
              var l3 = e4.name ? e4 : e4.$locale(), s3 = o2(l3[t4]), i3 = o2(l3[n3]), u2 = s3 || i3.map(function(e5) {
                return e5.slice(0, a3);
              });
              if (!r3) return u2;
              var c2 = l3.weekStart;
              return u2.map(function(e5, t5) {
                return u2[(t5 + (c2 || 0)) % 7];
              });
            }, l2 = function() {
              return n2.Ls[n2.locale()];
            }, s2 = function(e4, t4) {
              return e4.formats[t4] || function(e5) {
                return e5.replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function(e6, t5, n3) {
                  return t5 || n3.slice(1);
                });
              }(e4.formats[t4.toUpperCase()]);
            }, i2 = function() {
              var e4 = this;
              return { months: function(t4) {
                return t4 ? t4.format("MMMM") : r2(e4, "months");
              }, monthsShort: function(t4) {
                return t4 ? t4.format("MMM") : r2(e4, "monthsShort", "months", 3);
              }, firstDayOfWeek: function() {
                return e4.$locale().weekStart || 0;
              }, weekdays: function(t4) {
                return t4 ? t4.format("dddd") : r2(e4, "weekdays");
              }, weekdaysMin: function(t4) {
                return t4 ? t4.format("dd") : r2(e4, "weekdaysMin", "weekdays", 2);
              }, weekdaysShort: function(t4) {
                return t4 ? t4.format("ddd") : r2(e4, "weekdaysShort", "weekdays", 3);
              }, longDateFormat: function(t4) {
                return s2(e4.$locale(), t4);
              }, meridiem: this.$locale().meridiem, ordinal: this.$locale().ordinal };
            };
            a2.localeData = function() {
              return i2.bind(this)();
            }, n2.localeData = function() {
              var e4 = l2();
              return { firstDayOfWeek: function() {
                return e4.weekStart || 0;
              }, weekdays: function() {
                return n2.weekdays();
              }, weekdaysShort: function() {
                return n2.weekdaysShort();
              }, weekdaysMin: function() {
                return n2.weekdaysMin();
              }, months: function() {
                return n2.months();
              }, monthsShort: function() {
                return n2.monthsShort();
              }, longDateFormat: function(t4) {
                return s2(e4, t4);
              }, meridiem: e4.meridiem, ordinal: e4.ordinal };
            }, n2.months = function() {
              return r2(l2(), "months");
            }, n2.monthsShort = function() {
              return r2(l2(), "monthsShort", "months", 3);
            }, n2.weekdays = function(e4) {
              return r2(l2(), "weekdays", null, null, e4);
            }, n2.weekdaysShort = function(e4) {
              return r2(l2(), "weekdaysShort", "weekdays", 3, e4);
            }, n2.weekdaysMin = function(e4) {
              return r2(l2(), "weekdaysMin", "weekdays", 2, e4);
            };
          };
        });
      })(pm);
      var mm = pm.exports;
      const hm = wp(mm);
      const bm = { modelValue: { type: [Number, String, Boolean], default: void 0 }, label: { type: [String, Boolean, Number, Object], default: void 0 }, value: { type: [String, Boolean, Number, Object], default: void 0 }, indeterminate: Boolean, disabled: Boolean, checked: Boolean, name: { type: String, default: void 0 }, trueValue: { type: [String, Number], default: void 0 }, falseValue: { type: [String, Number], default: void 0 }, trueLabel: { type: [String, Number], default: void 0 }, falseLabel: { type: [String, Number], default: void 0 }, id: { type: String, default: void 0 }, controls: { type: String, default: void 0 }, border: Boolean, size: Nc, tabindex: [String, Number], validateEvent: { type: Boolean, default: true }, ...Zc(["ariaControls"]) };
      const gm = { [Is]: (e2) => ot(e2) || Ol(e2) || Ml(e2), change: (e2) => ot(e2) || Ol(e2) || Ml(e2) };
      const ym = Symbol("checkboxGroupContextKey");
      const wm = ({ model: e2, isChecked: t2 }) => {
        const n2 = vue.inject(ym, void 0);
        const a2 = vue.computed(() => {
          var a3, o3;
          const r2 = (a3 = n2 == null ? void 0 : n2.max) == null ? void 0 : a3.value;
          const l2 = (o3 = n2 == null ? void 0 : n2.min) == null ? void 0 : o3.value;
          return !_l(r2) && e2.value.length >= r2 && !t2.value || !_l(l2) && e2.value.length <= l2 && t2.value;
        });
        const o2 = fd(vue.computed(() => (n2 == null ? void 0 : n2.disabled.value) || a2.value));
        return { isDisabled: o2, isLimitDisabled: a2 };
      };
      const km = (e2, { model: t2, isLimitExceeded: n2, hasOwnLabel: a2, isDisabled: o2, isLabeledByFormItem: i2 }) => {
        const u2 = vue.inject(ym, void 0);
        const { formItem: c2 } = vd();
        const { emit: d2 } = vue.getCurrentInstance();
        function v2(t3) {
          var n3, a3, o3, r2;
          return [true, e2.trueValue, e2.trueLabel].includes(t3) ? (a3 = (n3 = e2.trueValue) != null ? n3 : e2.trueLabel) != null ? a3 : true : (r2 = (o3 = e2.falseValue) != null ? o3 : e2.falseLabel) != null ? r2 : false;
        }
        function p2(e3, t3) {
          d2("change", v2(e3), t3);
        }
        function m2(e3) {
          if (n2.value) return;
          const t3 = e3.target;
          d2("change", v2(t3.checked), e3);
        }
        async function h2(r2) {
          if (n2.value) return;
          if (!a2.value && !o2.value && i2.value) {
            const n3 = r2.composedPath();
            const a3 = n3.some((e3) => e3.tagName === "LABEL");
            if (!a3) {
              t2.value = v2([false, e2.falseValue, e2.falseLabel].includes(t2.value));
              await vue.nextTick();
              p2(t2.value, r2);
            }
          }
        }
        const b2 = vue.computed(() => (u2 == null ? void 0 : u2.validateEvent) || e2.validateEvent);
        vue.watch(() => e2.modelValue, () => {
          if (b2.value) {
            c2 == null ? void 0 : c2.validate("change").catch((e3) => Pl());
          }
        });
        return { handleChange: m2, onClickRoot: h2 };
      };
      const xm = (e2) => {
        const t2 = vue.ref(false);
        const { emit: n2 } = vue.getCurrentInstance();
        const a2 = vue.inject(ym, void 0);
        const o2 = vue.computed(() => _l(a2) === false);
        const s2 = vue.ref(false);
        const i2 = vue.computed({ get() {
          var n3, r2;
          return o2.value ? (n3 = a2 == null ? void 0 : a2.modelValue) == null ? void 0 : n3.value : (r2 = e2.modelValue) != null ? r2 : t2.value;
        }, set(e3) {
          var r2, l2;
          if (o2.value && tt(e3)) {
            s2.value = ((r2 = a2 == null ? void 0 : a2.max) == null ? void 0 : r2.value) !== void 0 && e3.length > (a2 == null ? void 0 : a2.max.value) && e3.length > i2.value.length;
            s2.value === false && ((l2 = a2 == null ? void 0 : a2.changeEvent) == null ? void 0 : l2.call(a2, e3));
          } else {
            n2(Is, e3);
            t2.value = e3;
          }
        } });
        return { model: i2, isGroup: o2, isLimitExceeded: s2 };
      };
      const Sm = (e2, t2, { model: n2 }) => {
        const a2 = vue.inject(ym, void 0);
        const o2 = vue.ref(false);
        const l2 = vue.computed(() => {
          if (!El(e2.value)) {
            return e2.value;
          }
          return e2.label;
        });
        const s2 = vue.computed(() => {
          const t3 = n2.value;
          if (Ml(t3)) {
            return t3;
          } else if (tt(t3)) {
            if (rt(l2.value)) {
              return t3.map(vue.toRaw).some((e3) => gl(e3, l2.value));
            } else {
              return t3.map(vue.toRaw).includes(l2.value);
            }
          } else if (t3 !== null && t3 !== void 0) {
            return t3 === e2.trueValue || t3 === e2.trueLabel;
          } else {
            return !!t3;
          }
        });
        const i2 = dd(vue.computed(() => {
          var e3;
          return (e3 = a2 == null ? void 0 : a2.size) == null ? void 0 : e3.value;
        }), { prop: true });
        const u2 = dd(vue.computed(() => {
          var e3;
          return (e3 = a2 == null ? void 0 : a2.size) == null ? void 0 : e3.value;
        }));
        const c2 = vue.computed(() => !!t2.default || !El(l2.value));
        return { checkboxButtonSize: i2, isChecked: s2, isFocused: o2, checkboxSize: u2, hasOwnLabel: c2, actualValue: l2 };
      };
      const Cm = (e2, t2) => {
        const { formItem: n2 } = vd();
        const { model: a2, isGroup: o2, isLimitExceeded: l2 } = xm(e2);
        const { isFocused: s2, isChecked: i2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, actualValue: f2 } = Sm(e2, t2, { model: a2 });
        const { isDisabled: v2 } = wm({ model: a2, isChecked: i2 });
        const { inputId: p2, isLabeledByFormItem: m2 } = pd(e2, { formItemContext: n2, disableIdGeneration: d2, disableIdManagement: o2 });
        const { handleChange: h2, onClickRoot: b2 } = km(e2, { model: a2, isLimitExceeded: l2, hasOwnLabel: d2, isDisabled: v2, isLabeledByFormItem: m2 });
        const g2 = () => {
          function t3() {
            var t4, n3;
            if (tt(a2.value) && !a2.value.includes(f2.value)) {
              a2.value.push(f2.value);
            } else {
              a2.value = (n3 = (t4 = e2.trueValue) != null ? t4 : e2.trueLabel) != null ? n3 : true;
            }
          }
          e2.checked && t3();
        };
        g2();
        Ws({ from: "controls", replacement: "aria-controls", version: "2.8.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.controls));
        Ws({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => o2.value && El(e2.value)));
        Ws({ from: "true-label", replacement: "true-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.trueLabel));
        Ws({ from: "false-label", replacement: "false-value", version: "3.0.0", scope: "el-checkbox", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!e2.falseLabel));
        return { inputId: p2, isLabeledByFormItem: m2, isChecked: i2, isDisabled: v2, isFocused: s2, checkboxButtonSize: u2, checkboxSize: c2, hasOwnLabel: d2, model: a2, actualValue: f2, handleChange: h2, onClickRoot: b2 };
      };
      const _m = ["id", "indeterminate", "name", "tabindex", "disabled", "true-value", "false-value"];
      const Mm = ["id", "indeterminate", "disabled", "value", "name", "tabindex"];
      const Om = vue.defineComponent({ name: "ElCheckbox" });
      const Dm = vue.defineComponent({ ...Om, props: bm, emits: gm, setup(e2) {
        const o2 = e2;
        const l2 = vue.useSlots();
        const { inputId: s2, isLabeledByFormItem: u2, isChecked: c2, isDisabled: d2, isFocused: f2, checkboxSize: v2, hasOwnLabel: m2, model: h2, actualValue: b2, handleChange: g2, onClickRoot: y2 } = Cm(o2, l2);
        const k2 = oi("checkbox");
        const x2 = vue.computed(() => [k2.b(), k2.m(v2.value), k2.is("disabled", d2.value), k2.is("bordered", o2.border), k2.is("checked", c2.value)]);
        const S2 = vue.computed(() => [k2.e("input"), k2.is("disabled", d2.value), k2.is("checked", c2.value), k2.is("indeterminate", o2.indeterminate), k2.is("focus", f2.value)]);
        return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(!vue.unref(m2) && vue.unref(u2) ? "span" : "label"), { class: vue.normalizeClass(vue.unref(x2)), "aria-controls": e3.indeterminate ? e3.controls || e3.ariaControls : null, onClick: vue.unref(y2) }, { default: vue.withCtx(() => {
          var r2, l3;
          return [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(S2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 0, id: vue.unref(s2), "onUpdate:modelValue": o3[0] || (o3[0] = (e4) => vue.isRef(h2) ? h2.value = e4 : null), class: vue.normalizeClass(vue.unref(k2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(d2), "true-value": (r2 = e3.trueValue) != null ? r2 : e3.trueLabel, "false-value": (l3 = e3.falseValue) != null ? l3 : e3.falseLabel, onChange: o3[1] || (o3[1] = (...e4) => vue.unref(g2) && vue.unref(g2)(...e4)), onFocus: o3[2] || (o3[2] = (e4) => f2.value = true), onBlur: o3[3] || (o3[3] = (e4) => f2.value = false), onClick: o3[4] || (o3[4] = vue.withModifiers(() => {
          }, ["stop"])) }, null, 42, _m)), [[vue.vModelCheckbox, vue.unref(h2)]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 1, id: vue.unref(s2), "onUpdate:modelValue": o3[5] || (o3[5] = (e4) => vue.isRef(h2) ? h2.value = e4 : null), class: vue.normalizeClass(vue.unref(k2).e("original")), type: "checkbox", indeterminate: e3.indeterminate, disabled: vue.unref(d2), value: vue.unref(b2), name: e3.name, tabindex: e3.tabindex, onChange: o3[6] || (o3[6] = (...e4) => vue.unref(g2) && vue.unref(g2)(...e4)), onFocus: o3[7] || (o3[7] = (e4) => f2.value = true), onBlur: o3[8] || (o3[8] = (e4) => f2.value = false), onClick: o3[9] || (o3[9] = vue.withModifiers(() => {
          }, ["stop"])) }, null, 42, Mm)), [[vue.vModelCheckbox, vue.unref(h2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(k2).e("inner")) }, null, 2)], 2), vue.unref(m2) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(k2).e("label")) }, [vue.renderSlot(e3.$slots, "default"), !e3.$slots.default ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createTextVNode(vue.toDisplayString(e3.label), 1)], 64)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true)];
        }), _: 3 }, 8, ["class", "aria-controls", "onClick"]));
      } });
      var Am = ad(Dm, [["__file", "checkbox.vue"]]);
      const Em = ["name", "tabindex", "disabled", "true-value", "false-value"];
      const $m = ["name", "tabindex", "disabled", "value"];
      const Lm = vue.defineComponent({ name: "ElCheckboxButton" });
      const Im = vue.defineComponent({ ...Lm, props: bm, emits: gm, setup(e2) {
        const a2 = e2;
        const o2 = vue.useSlots();
        const { isFocused: l2, isChecked: s2, isDisabled: u2, checkboxButtonSize: c2, model: d2, actualValue: v2, handleChange: m2 } = Cm(a2, o2);
        const h2 = vue.inject(ym, void 0);
        const b2 = oi("checkbox");
        const g2 = vue.computed(() => {
          var e3, t2, n2, a3;
          const o3 = (t2 = (e3 = h2 == null ? void 0 : h2.fill) == null ? void 0 : e3.value) != null ? t2 : "";
          return { backgroundColor: o3, borderColor: o3, color: (a3 = (n2 = h2 == null ? void 0 : h2.textColor) == null ? void 0 : n2.value) != null ? a3 : "", boxShadow: o3 ? `-1px 0 0 0 ${o3}` : void 0 };
        });
        const y2 = vue.computed(() => [b2.b("button"), b2.bm("button", c2.value), b2.is("disabled", u2.value), b2.is("checked", s2.value), b2.is("focus", l2.value)]);
        return (e3, a3) => {
          var o3, r2;
          return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass(vue.unref(y2)) }, [e3.trueValue || e3.falseValue || e3.trueLabel || e3.falseLabel ? vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 0, "onUpdate:modelValue": a3[0] || (a3[0] = (e4) => vue.isRef(d2) ? d2.value = e4 : null), class: vue.normalizeClass(vue.unref(b2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(u2), "true-value": (o3 = e3.trueValue) != null ? o3 : e3.trueLabel, "false-value": (r2 = e3.falseValue) != null ? r2 : e3.falseLabel, onChange: a3[1] || (a3[1] = (...e4) => vue.unref(m2) && vue.unref(m2)(...e4)), onFocus: a3[2] || (a3[2] = (e4) => l2.value = true), onBlur: a3[3] || (a3[3] = (e4) => l2.value = false), onClick: a3[4] || (a3[4] = vue.withModifiers(() => {
          }, ["stop"])) }, null, 42, Em)), [[vue.vModelCheckbox, vue.unref(d2)]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("input", { key: 1, "onUpdate:modelValue": a3[5] || (a3[5] = (e4) => vue.isRef(d2) ? d2.value = e4 : null), class: vue.normalizeClass(vue.unref(b2).be("button", "original")), type: "checkbox", name: e3.name, tabindex: e3.tabindex, disabled: vue.unref(u2), value: vue.unref(v2), onChange: a3[6] || (a3[6] = (...e4) => vue.unref(m2) && vue.unref(m2)(...e4)), onFocus: a3[7] || (a3[7] = (e4) => l2.value = true), onBlur: a3[8] || (a3[8] = (e4) => l2.value = false), onClick: a3[9] || (a3[9] = vue.withModifiers(() => {
          }, ["stop"])) }, null, 42, $m)), [[vue.vModelCheckbox, vue.unref(d2)]]), e3.$slots.default || e3.label ? (vue.openBlock(), vue.createElementBlock("span", { key: 2, class: vue.normalizeClass(vue.unref(b2).be("button", "inner")), style: vue.normalizeStyle(vue.unref(s2) ? vue.unref(g2) : void 0) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 6)) : vue.createCommentVNode("v-if", true)], 2);
        };
      } });
      var Tm = ad(Im, [["__file", "checkbox-button.vue"]]);
      const Pm = Cs({ modelValue: { type: ks(Array), default: () => [] }, disabled: Boolean, min: Number, max: Number, size: Nc, label: String, fill: String, textColor: String, tag: { type: String, default: "div" }, validateEvent: { type: Boolean, default: true }, ...Zc(["ariaLabel"]) });
      const Bm = { [Is]: (e2) => tt(e2), change: (e2) => tt(e2) };
      const Rm = vue.defineComponent({ name: "ElCheckboxGroup" });
      const Vm = vue.defineComponent({ ...Rm, props: Pm, emits: Bm, setup(e2, { emit: n2 }) {
        const a2 = e2;
        const o2 = oi("checkbox");
        const { formItem: l2 } = vd();
        const { inputId: u2, isLabeledByFormItem: c2 } = pd(a2, { formItemContext: l2 });
        const d2 = async (e3) => {
          n2(Is, e3);
          await vue.nextTick();
          n2("change", e3);
        };
        const f2 = vue.computed({ get() {
          return a2.modelValue;
        }, set(e3) {
          d2(e3);
        } });
        vue.provide(ym, { ...Cl(vue.toRefs(a2), ["size", "min", "max", "disabled", "validateEvent", "fill", "textColor"]), modelValue: f2, changeEvent: d2 });
        Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-checkbox-group", ref: "https://element-plus.org/en-US/component/checkbox.html" }, vue.computed(() => !!a2.label));
        vue.watch(() => a2.modelValue, () => {
          if (a2.validateEvent) {
            l2 == null ? void 0 : l2.validate("change").catch((e3) => Pl());
          }
        });
        return (e3, n3) => {
          var a3;
          return vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.tag), { id: vue.unref(u2), class: vue.normalizeClass(vue.unref(o2).b("group")), role: "group", "aria-label": !vue.unref(c2) ? e3.label || e3.ariaLabel || "checkbox-group" : void 0, "aria-labelledby": vue.unref(c2) ? (a3 = vue.unref(l2)) == null ? void 0 : a3.labelId : void 0 }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 3 }, 8, ["id", "class", "aria-label", "aria-labelledby"]);
        };
      } });
      var Fm = ad(Vm, [["__file", "checkbox-group.vue"]]);
      const jm = Ds(Am, { CheckboxButton: Tm, CheckboxGroup: Fm });
      As(Tm);
      const zm = As(Fm);
      const Nm = Cs({ modelValue: { type: [String, Number, Boolean], default: void 0 }, size: Nc, disabled: Boolean, label: { type: [String, Number, Boolean], default: void 0 }, value: { type: [String, Number, Boolean], default: void 0 }, name: { type: String, default: void 0 } });
      const Hm = Cs({ ...Nm, border: Boolean });
      const Ym = { [Is]: (e2) => ot(e2) || Ol(e2) || Ml(e2), [Ts]: (e2) => ot(e2) || Ol(e2) || Ml(e2) };
      const Wm = Symbol("radioGroupKey");
      const Um = (e2, t2) => {
        const n2 = vue.ref();
        const a2 = vue.inject(Wm, void 0);
        const o2 = vue.computed(() => !!a2);
        const l2 = vue.computed(() => {
          if (!El(e2.value)) {
            return e2.value;
          }
          return e2.label;
        });
        const s2 = vue.computed({ get() {
          return o2.value ? a2.modelValue : e2.modelValue;
        }, set(r2) {
          if (o2.value) {
            a2.changeEvent(r2);
          } else {
            t2 && t2(Is, r2);
          }
          n2.value.checked = e2.modelValue === l2.value;
        } });
        const i2 = dd(vue.computed(() => a2 == null ? void 0 : a2.size));
        const u2 = fd(vue.computed(() => a2 == null ? void 0 : a2.disabled));
        const c2 = vue.ref(false);
        const d2 = vue.computed(() => u2.value || o2.value && s2.value !== l2.value ? -1 : 0);
        Ws({ from: "label act as value", replacement: "value", version: "3.0.0", scope: "el-radio", ref: "https://element-plus.org/en-US/component/radio.html" }, vue.computed(() => o2.value && El(e2.value)));
        return { radioRef: n2, isGroup: o2, radioGroup: a2, focus: c2, size: i2, disabled: u2, tabIndex: d2, modelValue: s2, actualValue: l2 };
      };
      const Km = ["value", "name", "disabled"];
      const qm = vue.defineComponent({ name: "ElRadio" });
      const Gm = vue.defineComponent({ ...qm, props: Hm, emits: Ym, setup(e2, { emit: o2 }) {
        const r2 = e2;
        const l2 = oi("radio");
        const { radioRef: s2, radioGroup: u2, focus: c2, size: d2, disabled: f2, modelValue: v2, actualValue: m2 } = Um(r2, o2);
        function h2() {
          vue.nextTick(() => o2("change", v2.value));
        }
        return (e3, o3) => {
          var r3;
          return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass([vue.unref(l2).b(), vue.unref(l2).is("disabled", vue.unref(f2)), vue.unref(l2).is("focus", vue.unref(c2)), vue.unref(l2).is("bordered", e3.border), vue.unref(l2).is("checked", vue.unref(v2) === vue.unref(m2)), vue.unref(l2).m(vue.unref(d2))]) }, [vue.createElementVNode("span", { class: vue.normalizeClass([vue.unref(l2).e("input"), vue.unref(l2).is("disabled", vue.unref(f2)), vue.unref(l2).is("checked", vue.unref(v2) === vue.unref(m2))]) }, [vue.withDirectives(vue.createElementVNode("input", { ref_key: "radioRef", ref: s2, "onUpdate:modelValue": o3[0] || (o3[0] = (e4) => vue.isRef(v2) ? v2.value = e4 : null), class: vue.normalizeClass(vue.unref(l2).e("original")), value: vue.unref(m2), name: e3.name || ((r3 = vue.unref(u2)) == null ? void 0 : r3.name), disabled: vue.unref(f2), type: "radio", onFocus: o3[1] || (o3[1] = (e4) => c2.value = true), onBlur: o3[2] || (o3[2] = (e4) => c2.value = false), onChange: h2, onClick: o3[3] || (o3[3] = vue.withModifiers(() => {
          }, ["stop"])) }, null, 42, Km), [[vue.vModelRadio, vue.unref(v2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).e("inner")) }, null, 2)], 2), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).e("label")), onKeydown: o3[4] || (o3[4] = vue.withModifiers(() => {
          }, ["stop"])) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 34)], 2);
        };
      } });
      var Zm = ad(Gm, [["__file", "radio.vue"]]);
      const Jm = Cs({ ...Nm });
      const Xm = ["value", "name", "disabled"];
      const Qm = vue.defineComponent({ name: "ElRadioButton" });
      const eh = vue.defineComponent({ ...Qm, props: Jm, setup(e2) {
        const o2 = e2;
        const l2 = oi("radio");
        const { radioRef: s2, focus: u2, size: c2, disabled: d2, modelValue: f2, radioGroup: v2, actualValue: m2 } = Um(o2);
        const h2 = vue.computed(() => ({ backgroundColor: (v2 == null ? void 0 : v2.fill) || "", borderColor: (v2 == null ? void 0 : v2.fill) || "", boxShadow: (v2 == null ? void 0 : v2.fill) ? `-1px 0 0 0 ${v2.fill}` : "", color: (v2 == null ? void 0 : v2.textColor) || "" }));
        return (e3, o3) => {
          var r2;
          return vue.openBlock(), vue.createElementBlock("label", { class: vue.normalizeClass([vue.unref(l2).b("button"), vue.unref(l2).is("active", vue.unref(f2) === vue.unref(m2)), vue.unref(l2).is("disabled", vue.unref(d2)), vue.unref(l2).is("focus", vue.unref(u2)), vue.unref(l2).bm("button", vue.unref(c2))]) }, [vue.withDirectives(vue.createElementVNode("input", { ref_key: "radioRef", ref: s2, "onUpdate:modelValue": o3[0] || (o3[0] = (e4) => vue.isRef(f2) ? f2.value = e4 : null), class: vue.normalizeClass(vue.unref(l2).be("button", "original-radio")), value: vue.unref(m2), type: "radio", name: e3.name || ((r2 = vue.unref(v2)) == null ? void 0 : r2.name), disabled: vue.unref(d2), onFocus: o3[1] || (o3[1] = (e4) => u2.value = true), onBlur: o3[2] || (o3[2] = (e4) => u2.value = false), onClick: o3[3] || (o3[3] = vue.withModifiers(() => {
          }, ["stop"])) }, null, 42, Xm), [[vue.vModelRadio, vue.unref(f2)]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(l2).be("button", "inner")), style: vue.normalizeStyle(vue.unref(f2) === vue.unref(m2) ? vue.unref(h2) : {}), onKeydown: o3[4] || (o3[4] = vue.withModifiers(() => {
          }, ["stop"])) }, [vue.renderSlot(e3.$slots, "default", {}, () => [vue.createTextVNode(vue.toDisplayString(e3.label), 1)])], 38)], 2);
        };
      } });
      var th = ad(eh, [["__file", "radio-button.vue"]]);
      const nh = Cs({ id: { type: String, default: void 0 }, size: Nc, disabled: Boolean, modelValue: { type: [String, Number, Boolean], default: void 0 }, fill: { type: String, default: "" }, label: { type: String, default: void 0 }, textColor: { type: String, default: "" }, name: { type: String, default: void 0 }, validateEvent: { type: Boolean, default: true }, ...Zc(["ariaLabel"]) });
      const ah = Ym;
      const oh = ["id", "aria-label", "aria-labelledby"];
      const rh = vue.defineComponent({ name: "ElRadioGroup" });
      const lh = vue.defineComponent({ ...rh, props: nh, emits: ah, setup(e2, { emit: a2 }) {
        const o2 = e2;
        const l2 = oi("radio");
        const c2 = xc();
        const d2 = vue.ref();
        const { formItem: f2 } = vd();
        const { inputId: p2, isLabeledByFormItem: m2 } = pd(o2, { formItemContext: f2 });
        const h2 = (e3) => {
          a2(Is, e3);
          vue.nextTick(() => a2("change", e3));
        };
        vue.onMounted(() => {
          const e3 = d2.value.querySelectorAll("[type=radio]");
          const t2 = e3[0];
          if (!Array.from(e3).some((e4) => e4.checked) && t2) {
            t2.tabIndex = 0;
          }
        });
        const b2 = vue.computed(() => o2.name || c2.value);
        vue.provide(Wm, vue.reactive({ ...vue.toRefs(o2), changeEvent: h2, name: b2 }));
        vue.watch(() => o2.modelValue, () => {
          if (o2.validateEvent) {
            f2 == null ? void 0 : f2.validate("change").catch((e3) => Pl());
          }
        });
        Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-radio-group", ref: "https://element-plus.org/en-US/component/radio.html" }, vue.computed(() => !!o2.label));
        return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { id: vue.unref(p2), ref_key: "radioGroupRef", ref: d2, class: vue.normalizeClass(vue.unref(l2).b("group")), role: "radiogroup", "aria-label": !vue.unref(m2) ? e3.label || e3.ariaLabel || "radio-group" : void 0, "aria-labelledby": vue.unref(m2) ? vue.unref(f2).labelId : void 0 }, [vue.renderSlot(e3.$slots, "default")], 10, oh));
      } });
      var sh = ad(lh, [["__file", "radio-group.vue"]]);
      Ds(Zm, { RadioButton: th, RadioGroup: sh });
      const ih = As(sh);
      const uh = As(th);
      var ch = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          return function(e3, t3) {
            var n2 = t3.prototype, a2 = n2.format;
            n2.format = function(e4) {
              var t4 = this, n3 = this.$locale();
              if (!this.isValid()) return a2.bind(this)(e4);
              var o2 = this.$utils(), r2 = (e4 || "YYYY-MM-DDTHH:mm:ssZ").replace(/\[([^\]]+)]|Q|wo|ww|w|WW|W|zzz|z|gggg|GGGG|Do|X|x|k{1,2}|S/g, function(e5) {
                switch (e5) {
                  case "Q":
                    return Math.ceil((t4.$M + 1) / 3);
                  case "Do":
                    return n3.ordinal(t4.$D);
                  case "gggg":
                    return t4.weekYear();
                  case "GGGG":
                    return t4.isoWeekYear();
                  case "wo":
                    return n3.ordinal(t4.week(), "W");
                  case "w":
                  case "ww":
                    return o2.s(t4.week(), "w" === e5 ? 1 : 2, "0");
                  case "W":
                  case "WW":
                    return o2.s(t4.isoWeek(), "W" === e5 ? 1 : 2, "0");
                  case "k":
                  case "kk":
                    return o2.s(String(0 === t4.$H ? 24 : t4.$H), "k" === e5 ? 1 : 2, "0");
                  case "X":
                    return Math.floor(t4.$d.getTime() / 1e3);
                  case "x":
                    return t4.$d.getTime();
                  case "z":
                    return "[" + t4.offsetName() + "]";
                  case "zzz":
                    return "[" + t4.offsetName("long") + "]";
                  default:
                    return e5;
                }
              });
              return a2.bind(this)(r2);
            };
          };
        });
      })(ch);
      var dh = ch.exports;
      const fh = wp(dh);
      var vh = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          var e3 = "week", t3 = "year";
          return function(n2, a2, o2) {
            var r2 = a2.prototype;
            r2.week = function(n3) {
              if (void 0 === n3 && (n3 = null), null !== n3) return this.add(7 * (n3 - this.week()), "day");
              var a3 = this.$locale().yearStart || 1;
              if (11 === this.month() && this.date() > 25) {
                var r3 = o2(this).startOf(t3).add(1, t3).date(a3), l2 = o2(this).endOf(e3);
                if (r3.isBefore(l2)) return 1;
              }
              var s2 = o2(this).startOf(t3).date(a3).startOf(e3).subtract(1, "millisecond"), i2 = this.diff(s2, e3, true);
              return i2 < 0 ? o2(this).startOf("week").week() : Math.ceil(i2);
            }, r2.weeks = function(e4) {
              return void 0 === e4 && (e4 = null), this.week(e4);
            };
          };
        });
      })(vh);
      var ph = vh.exports;
      const mh = wp(ph);
      var hh = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          return function(e3, t3) {
            t3.prototype.weekYear = function() {
              var e4 = this.month(), t4 = this.week(), n2 = this.year();
              return 1 === t4 && 11 === e4 ? n2 + 1 : 0 === e4 && t4 >= 52 ? n2 - 1 : n2;
            };
          };
        });
      })(hh);
      var bh = hh.exports;
      const gh = wp(bh);
      var yh = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          return function(e3, t3, n2) {
            t3.prototype.dayOfYear = function(e4) {
              var t4 = Math.round((n2(this).startOf("day") - n2(this).startOf("year")) / 864e5) + 1;
              return null == e4 ? t4 : this.add(e4 - t4, "day");
            };
          };
        });
      })(yh);
      var wh = yh.exports;
      const kh = wp(wh);
      var xh = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          return function(e3, t3) {
            t3.prototype.isSameOrAfter = function(e4, t4) {
              return this.isSame(e4, t4) || this.isAfter(e4, t4);
            };
          };
        });
      })(xh);
      var Sh = xh.exports;
      const Ch = wp(Sh);
      var _h = { exports: {} };
      (function(e2, t2) {
        !function(t3, n2) {
          e2.exports = n2();
        }(yp, function() {
          return function(e3, t3) {
            t3.prototype.isSameOrBefore = function(e4, t4) {
              return this.isSame(e4, t4) || this.isBefore(e4, t4);
            };
          };
        });
      })(_h);
      var Mh = _h.exports;
      const Oh = wp(Mh);
      const Dh = Symbol();
      const Ah = Cs({ ...Np, type: { type: ks(String), default: "date" } });
      const Eh = ["date", "dates", "year", "years", "month", "week", "range"];
      const $h = Cs({ disabledDate: { type: ks(Function) }, date: { type: ks(Object), required: true }, minDate: { type: ks(Object) }, maxDate: { type: ks(Object) }, parsedValue: { type: ks([Object, Array]) }, rangeState: { type: ks(Object), default: () => ({ endDate: null, selecting: false }) } });
      const Lh = Cs({ type: { type: ks(String), required: true, values: Ls }, dateFormat: String, timeFormat: String });
      const Ih = Cs({ unlinkPanels: Boolean, parsedValue: { type: ks(Array) } });
      const Th = (e2) => ({ type: String, values: Eh, default: e2 });
      const Ph = Cs({ ...Lh, parsedValue: { type: ks([Object, Array]) }, visible: { type: Boolean }, format: { type: String, default: "" } });
      const Bh = Cs({ ...$h, cellClassName: { type: ks(Function) }, showWeekNumber: Boolean, selectionMode: Th("date") });
      const Rh = ["changerange", "pick", "select"];
      const Vh = (e2) => {
        if (!tt(e2)) return false;
        const [t2, n2] = e2;
        return Sp.isDayjs(t2) && Sp.isDayjs(n2) && t2.isSameOrBefore(n2);
      };
      const Fh = (e2, { lang: t2, unit: n2, unlinkPanels: a2 }) => {
        let o2;
        if (tt(e2)) {
          let [o3, r2] = e2.map((e3) => Sp(e3).locale(t2));
          if (!a2) {
            r2 = o3.add(1, n2);
          }
          return [o3, r2];
        } else if (e2) {
          o2 = Sp(e2);
        } else {
          o2 = Sp();
        }
        o2 = o2.locale(t2);
        return [o2, o2.add(1, n2)];
      };
      const jh = (e2, t2, { columnIndexOffset: n2, startDate: a2, nextEndDate: o2, now: r2, unit: l2, relativeDateGetter: s2, setCellMetadata: i2, setRowMetadata: u2 }) => {
        for (let c2 = 0; c2 < e2.row; c2++) {
          const d2 = t2[c2];
          for (let t3 = 0; t3 < e2.column; t3++) {
            let u3 = d2[t3 + n2];
            if (!u3) {
              u3 = { row: c2, column: t3, type: "normal", inRange: false, start: false, end: false };
            }
            const f2 = c2 * e2.column + t3;
            const v2 = s2(f2);
            u3.dayjs = v2;
            u3.date = v2.toDate();
            u3.timestamp = v2.valueOf();
            u3.type = "normal";
            u3.inRange = !!(a2 && v2.isSameOrAfter(a2, l2) && o2 && v2.isSameOrBefore(o2, l2)) || !!(a2 && v2.isSameOrBefore(a2, l2) && o2 && v2.isSameOrAfter(o2, l2));
            if (a2 == null ? void 0 : a2.isSameOrAfter(o2)) {
              u3.start = !!o2 && v2.isSame(o2, l2);
              u3.end = a2 && v2.isSame(a2, l2);
            } else {
              u3.start = !!a2 && v2.isSame(a2, l2);
              u3.end = !!o2 && v2.isSame(o2, l2);
            }
            const p2 = v2.isSame(r2, l2);
            if (p2) {
              u3.type = "today";
            }
            i2 == null ? void 0 : i2(u3, { rowIndex: c2, columnIndex: t3 });
            d2[t3 + n2] = u3;
          }
          u2 == null ? void 0 : u2(d2);
        }
      };
      const zh = (e2 = "") => ["normal", "today"].includes(e2);
      const Nh = (e2, t2) => {
        const { lang: n2 } = Xs();
        const a2 = vue.ref();
        const o2 = vue.ref();
        const l2 = vue.ref();
        const u2 = vue.ref();
        const c2 = vue.ref([[], [], [], [], [], []]);
        let d2 = false;
        const f2 = e2.date.$locale().weekStart || 7;
        const p2 = e2.date.locale("en").localeData().weekdaysShort().map((e3) => e3.toLowerCase());
        const m2 = vue.computed(() => f2 > 3 ? 7 - f2 : -f2);
        const h2 = vue.computed(() => {
          const t3 = e2.date.startOf("month");
          return t3.subtract(t3.day() || 7, "day");
        });
        const b2 = vue.computed(() => p2.concat(p2).slice(f2, f2 + 7));
        const g2 = vue.computed(() => Wo(vue.unref(C2)).some((e3) => e3.isCurrent));
        const y2 = vue.computed(() => {
          const t3 = e2.date.startOf("month");
          const n3 = t3.day() || 7;
          const a3 = t3.daysInMonth();
          const o3 = t3.subtract(1, "month").daysInMonth();
          return { startOfMonthDay: n3, dateCountOfMonth: a3, dateCountOfLastMonth: o3 };
        });
        const w2 = vue.computed(() => e2.selectionMode === "dates" ? Fs(e2.parsedValue) : []);
        const k2 = (e3, { count: t3, rowIndex: n3, columnIndex: a3 }) => {
          const { startOfMonthDay: o3, dateCountOfMonth: r2, dateCountOfLastMonth: l3 } = vue.unref(y2);
          const s2 = vue.unref(m2);
          if (n3 >= 0 && n3 <= 1) {
            const r3 = o3 + s2 < 0 ? 7 + o3 + s2 : o3 + s2;
            if (a3 + n3 * 7 >= r3) {
              e3.text = t3;
              return true;
            } else {
              e3.text = l3 - (r3 - a3 % 7) + 1 + n3 * 7;
              e3.type = "prev-month";
            }
          } else {
            if (t3 <= r2) {
              e3.text = t3;
            } else {
              e3.text = t3 - r2;
              e3.type = "next-month";
            }
            return true;
          }
          return false;
        };
        const x2 = (t3, { columnIndex: n3, rowIndex: a3 }, o3) => {
          const { disabledDate: r2, cellClassName: l3 } = e2;
          const s2 = vue.unref(w2);
          const u3 = k2(t3, { count: o3, rowIndex: a3, columnIndex: n3 });
          const c3 = t3.dayjs.toDate();
          t3.selected = s2.find((e3) => e3.isSame(t3.dayjs, "day"));
          t3.isSelected = !!t3.selected;
          t3.isCurrent = O2(t3);
          t3.disabled = r2 == null ? void 0 : r2(c3);
          t3.customClass = l3 == null ? void 0 : l3(c3);
          return u3;
        };
        const S2 = (t3) => {
          if (e2.selectionMode === "week") {
            const [n3, a3] = e2.showWeekNumber ? [1, 7] : [0, 6];
            const o3 = F2(t3[n3 + 1]);
            t3[n3].inRange = o3;
            t3[n3].start = o3;
            t3[a3].inRange = o3;
            t3[a3].end = o3;
          }
        };
        const C2 = vue.computed(() => {
          const { minDate: t3, maxDate: a3, rangeState: o3, showWeekNumber: r2 } = e2;
          const l3 = vue.unref(m2);
          const s2 = vue.unref(c2);
          const u3 = "day";
          let d3 = 1;
          if (r2) {
            for (let e3 = 0; e3 < 6; e3++) {
              if (!s2[e3][0]) {
                s2[e3][0] = { type: "week", text: vue.unref(h2).add(e3 * 7 + 1, u3).week() };
              }
            }
          }
          jh({ row: 6, column: 7 }, s2, { startDate: t3, columnIndexOffset: r2 ? 1 : 0, nextEndDate: o3.endDate || a3 || o3.selecting && t3 || null, now: Sp().locale(vue.unref(n2)).startOf(u3), unit: u3, relativeDateGetter: (e3) => vue.unref(h2).add(e3 - l3, u3), setCellMetadata: (...e3) => {
            if (x2(...e3, d3)) {
              d3 += 1;
            }
          }, setRowMetadata: S2 });
          return s2;
        });
        vue.watch(() => e2.date, async () => {
          var e3;
          if ((e3 = vue.unref(a2)) == null ? void 0 : e3.contains(document.activeElement)) {
            await vue.nextTick();
            await M2();
          }
        });
        const M2 = async () => {
          var e3;
          return (e3 = vue.unref(o2)) == null ? void 0 : e3.focus();
        };
        const O2 = (t3) => e2.selectionMode === "date" && zh(t3.type) && D2(t3, e2.parsedValue);
        const D2 = (t3, a3) => {
          if (!a3) return false;
          return Sp(a3).locale(vue.unref(n2)).isSame(e2.date.date(Number(t3.text)), "day");
        };
        const A2 = (t3, n3) => {
          const a3 = t3 * 7 + (n3 - (e2.showWeekNumber ? 1 : 0)) - vue.unref(m2);
          return vue.unref(h2).add(a3, "day");
        };
        const E2 = (n3) => {
          var a3;
          if (!e2.rangeState.selecting) return;
          let o3 = n3.target;
          if (o3.tagName === "SPAN") {
            o3 = (a3 = o3.parentNode) == null ? void 0 : a3.parentNode;
          }
          if (o3.tagName === "DIV") {
            o3 = o3.parentNode;
          }
          if (o3.tagName !== "TD") return;
          const r2 = o3.parentNode.rowIndex - 1;
          const s2 = o3.cellIndex;
          if (vue.unref(C2)[r2][s2].disabled) return;
          if (r2 !== vue.unref(l2) || s2 !== vue.unref(u2)) {
            l2.value = r2;
            u2.value = s2;
            t2("changerange", { selecting: true, endDate: A2(r2, s2) });
          }
        };
        const $2 = (e3) => !vue.unref(g2) && (e3 == null ? void 0 : e3.text) === 1 && e3.type === "normal" || e3.isCurrent;
        const L2 = (t3) => {
          if (d2 || vue.unref(g2) || e2.selectionMode !== "date") return;
          V2(t3, true);
        };
        const I2 = (e3) => {
          const t3 = e3.target.closest("td");
          if (!t3) return;
          d2 = true;
        };
        const T2 = (e3) => {
          const t3 = e3.target.closest("td");
          if (!t3) return;
          d2 = false;
        };
        const P2 = (n3) => {
          if (!e2.rangeState.selecting || !e2.minDate) {
            t2("pick", { minDate: n3, maxDate: null });
            t2("select", true);
          } else {
            if (n3 >= e2.minDate) {
              t2("pick", { minDate: e2.minDate, maxDate: n3 });
            } else {
              t2("pick", { minDate: n3, maxDate: e2.minDate });
            }
            t2("select", false);
          }
        };
        const B2 = (e3) => {
          const n3 = e3.week();
          const a3 = `${e3.year()}w${n3}`;
          t2("pick", { year: e3.year(), week: n3, value: a3, date: e3.startOf("week") });
        };
        const R2 = (n3, a3) => {
          const o3 = a3 ? Fs(e2.parsedValue).filter((e3) => (e3 == null ? void 0 : e3.valueOf()) !== n3.valueOf()) : Fs(e2.parsedValue).concat([n3]);
          t2("pick", o3);
        };
        const V2 = (n3, a3 = false) => {
          const o3 = n3.target.closest("td");
          if (!o3) return;
          const r2 = o3.parentNode.rowIndex - 1;
          const l3 = o3.cellIndex;
          const s2 = vue.unref(C2)[r2][l3];
          if (s2.disabled || s2.type === "week") return;
          const u3 = A2(r2, l3);
          switch (e2.selectionMode) {
            case "range": {
              P2(u3);
              break;
            }
            case "date": {
              t2("pick", u3, a3);
              break;
            }
            case "week": {
              B2(u3);
              break;
            }
            case "dates": {
              R2(u3, !!s2.selected);
              break;
            }
          }
        };
        const F2 = (t3) => {
          if (e2.selectionMode !== "week") return false;
          let n3 = e2.date.startOf("day");
          if (t3.type === "prev-month") {
            n3 = n3.subtract(1, "month");
          }
          if (t3.type === "next-month") {
            n3 = n3.add(1, "month");
          }
          n3 = n3.date(Number.parseInt(t3.text, 10));
          if (e2.parsedValue && !Array.isArray(e2.parsedValue)) {
            const t4 = (e2.parsedValue.day() - f2 + 7) % 7 - 1;
            const a3 = e2.parsedValue.subtract(t4, "day");
            return a3.isSame(n3, "day");
          }
          return false;
        };
        return { WEEKS: b2, rows: C2, tbodyRef: a2, currentCellRef: o2, focus: M2, isCurrent: O2, isWeekActive: F2, isSelectedCell: $2, handlePickDate: V2, handleMouseUp: T2, handleMouseDown: I2, handleMouseMove: E2, handleFocus: L2 };
      };
      const Hh = (e2, { isCurrent: t2, isWeekActive: n2 }) => {
        const a2 = oi("date-table");
        const { t: o2 } = Xs();
        const l2 = vue.computed(() => [a2.b(), { "is-week-mode": e2.selectionMode === "week" }]);
        const s2 = vue.computed(() => o2("el.datepicker.dateTablePrompt"));
        const i2 = vue.computed(() => o2("el.datepicker.week"));
        const u2 = (n3) => {
          const a3 = [];
          if (zh(n3.type) && !n3.disabled) {
            a3.push("available");
            if (n3.type === "today") {
              a3.push("today");
            }
          } else {
            a3.push(n3.type);
          }
          if (t2(n3)) {
            a3.push("current");
          }
          if (n3.inRange && (zh(n3.type) || e2.selectionMode === "week")) {
            a3.push("in-range");
            if (n3.start) {
              a3.push("start-date");
            }
            if (n3.end) {
              a3.push("end-date");
            }
          }
          if (n3.disabled) {
            a3.push("disabled");
          }
          if (n3.selected) {
            a3.push("selected");
          }
          if (n3.customClass) {
            a3.push(n3.customClass);
          }
          return a3.join(" ");
        };
        const c2 = (e3) => [a2.e("row"), { current: n2(e3) }];
        return { tableKls: l2, tableLabel: s2, weekLabel: i2, getCellClasses: u2, getRowKls: c2, t: o2 };
      };
      const Yh = Cs({ cell: { type: ks(Object) } });
      var Wh = vue.defineComponent({ name: "ElDatePickerCell", props: Yh, setup(e2) {
        const t2 = oi("date-table-cell");
        const { slots: n2 } = vue.inject(Dh);
        return () => {
          const { cell: a2 } = e2;
          return vue.renderSlot(n2, "default", { ...a2 }, () => [vue.createVNode("div", { class: t2.b() }, [vue.createVNode("span", { class: t2.e("text") }, [a2 == null ? void 0 : a2.text])])]);
        };
      } });
      const Uh = ["aria-label"];
      const Kh = { key: 0, scope: "col" };
      const qh = ["aria-label"];
      const Gh = ["aria-current", "aria-selected", "tabindex"];
      const Zh = vue.defineComponent({ __name: "basic-date-table", props: Bh, emits: Rh, setup(e2, { expose: o2, emit: r2 }) {
        const l2 = e2;
        const { WEEKS: s2, rows: u2, tbodyRef: c2, currentCellRef: d2, focus: f2, isCurrent: v2, isWeekActive: p2, isSelectedCell: m2, handlePickDate: h2, handleMouseUp: b2, handleMouseDown: g2, handleMouseMove: y2, handleFocus: w2 } = Nh(l2, r2);
        const { tableLabel: k2, tableKls: x2, weekLabel: S2, getCellClasses: C2, getRowKls: _2, t: A2 } = Hh(l2, { isCurrent: v2, isWeekActive: p2 });
        o2({ focus: f2 });
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("table", { "aria-label": vue.unref(k2), class: vue.normalizeClass(vue.unref(x2)), cellspacing: "0", cellpadding: "0", role: "grid", onClick: o3[1] || (o3[1] = (...e4) => vue.unref(h2) && vue.unref(h2)(...e4)), onMousemove: o3[2] || (o3[2] = (...e4) => vue.unref(y2) && vue.unref(y2)(...e4)), onMousedown: o3[3] || (o3[3] = vue.withModifiers((...e4) => vue.unref(g2) && vue.unref(g2)(...e4), ["prevent"])), onMouseup: o3[4] || (o3[4] = (...e4) => vue.unref(b2) && vue.unref(b2)(...e4)) }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: c2 }, [vue.createElementVNode("tr", null, [e3.showWeekNumber ? (vue.openBlock(), vue.createElementBlock("th", Kh, vue.toDisplayString(vue.unref(S2)), 1)) : vue.createCommentVNode("v-if", true), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(s2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("th", { key: a2, "aria-label": vue.unref(A2)("el.datepicker.weeksFull." + e4), scope: "col" }, vue.toDisplayString(vue.unref(A2)("el.datepicker.weeks." + e4)), 9, qh))), 128))]), (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(u2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("tr", { key: a2, class: vue.normalizeClass(vue.unref(_2)(e4[1])) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, r3) => (vue.openBlock(), vue.createElementBlock("td", { key: `${a2}.${r3}`, ref_for: true, ref: (t2) => vue.unref(m2)(e5) && (d2.value = t2), class: vue.normalizeClass(vue.unref(C2)(e5)), "aria-current": e5.isCurrent ? "date" : void 0, "aria-selected": e5.isCurrent, tabindex: vue.unref(m2)(e5) ? 0 : -1, onFocus: o3[0] || (o3[0] = (...e6) => vue.unref(w2) && vue.unref(w2)(...e6)) }, [vue.createVNode(vue.unref(Wh), { cell: e5 }, null, 8, ["cell"])], 42, Gh))), 128))], 2))), 128))], 512)], 42, Uh));
      } });
      var Jh = ad(Zh, [["__file", "basic-date-table.vue"]]);
      const Xh = Cs({ ...$h, selectionMode: Th("month") });
      const Qh = ["aria-label"];
      const eb = ["aria-selected", "aria-label", "tabindex", "onKeydown"];
      const tb = { class: "cell" };
      const nb = vue.defineComponent({ __name: "basic-month-table", props: Xh, emits: ["changerange", "pick", "select"], setup(e2, { expose: o2, emit: l2 }) {
        const u2 = e2;
        const c2 = (e3, t2, n2) => {
          const a2 = Sp().locale(n2).startOf("month").month(t2).year(e3);
          const o3 = a2.daysInMonth();
          return Lp(o3).map((e4) => a2.add(e4, "day").toDate());
        };
        const d2 = oi("month-table");
        const { t: f2, lang: p2 } = Xs();
        const m2 = vue.ref();
        const h2 = vue.ref();
        const b2 = vue.ref(u2.date.locale("en").localeData().monthsShort().map((e3) => e3.toLowerCase()));
        const g2 = vue.ref([[], [], []]);
        const y2 = vue.ref();
        const w2 = vue.ref();
        const k2 = vue.computed(() => {
          var e3, t2;
          const n2 = g2.value;
          const a2 = Sp().locale(p2.value).startOf("month");
          for (let o3 = 0; o3 < 3; o3++) {
            const r2 = n2[o3];
            for (let n3 = 0; n3 < 4; n3++) {
              const l3 = r2[n3] || (r2[n3] = { row: o3, column: n3, type: "normal", inRange: false, start: false, end: false, text: -1, disabled: false });
              l3.type = "normal";
              const s2 = o3 * 4 + n3;
              const i2 = u2.date.startOf("year").month(s2);
              const c3 = u2.rangeState.endDate || u2.maxDate || u2.rangeState.selecting && u2.minDate || null;
              l3.inRange = !!(u2.minDate && i2.isSameOrAfter(u2.minDate, "month") && c3 && i2.isSameOrBefore(c3, "month")) || !!(u2.minDate && i2.isSameOrBefore(u2.minDate, "month") && c3 && i2.isSameOrAfter(c3, "month"));
              if ((e3 = u2.minDate) == null ? void 0 : e3.isSameOrAfter(c3)) {
                l3.start = !!(c3 && i2.isSame(c3, "month"));
                l3.end = u2.minDate && i2.isSame(u2.minDate, "month");
              } else {
                l3.start = !!(u2.minDate && i2.isSame(u2.minDate, "month"));
                l3.end = !!(c3 && i2.isSame(c3, "month"));
              }
              const d3 = a2.isSame(i2);
              if (d3) {
                l3.type = "today";
              }
              l3.text = s2;
              l3.disabled = ((t2 = u2.disabledDate) == null ? void 0 : t2.call(u2, i2.toDate())) || false;
            }
          }
          return n2;
        });
        const x2 = () => {
          var e3;
          (e3 = h2.value) == null ? void 0 : e3.focus();
        };
        const S2 = (e3) => {
          const t2 = {};
          const n2 = u2.date.year();
          const a2 = /* @__PURE__ */ new Date();
          const o3 = e3.text;
          t2.disabled = u2.disabledDate ? c2(n2, o3, p2.value).every(u2.disabledDate) : false;
          t2.current = Fs(u2.parsedValue).findIndex((e4) => Sp.isDayjs(e4) && e4.year() === n2 && e4.month() === o3) >= 0;
          t2.today = a2.getFullYear() === n2 && a2.getMonth() === o3;
          if (e3.inRange) {
            t2["in-range"] = true;
            if (e3.start) {
              t2["start-date"] = true;
            }
            if (e3.end) {
              t2["end-date"] = true;
            }
          }
          return t2;
        };
        const C2 = (e3) => {
          const t2 = u2.date.year();
          const n2 = e3.text;
          return Fs(u2.date).findIndex((e4) => e4.year() === t2 && e4.month() === n2) >= 0;
        };
        const M2 = (e3) => {
          var t2;
          if (!u2.rangeState.selecting) return;
          let n2 = e3.target;
          if (n2.tagName === "SPAN") {
            n2 = (t2 = n2.parentNode) == null ? void 0 : t2.parentNode;
          }
          if (n2.tagName === "DIV") {
            n2 = n2.parentNode;
          }
          if (n2.tagName !== "TD") return;
          const a2 = n2.parentNode.rowIndex;
          const o3 = n2.cellIndex;
          if (k2.value[a2][o3].disabled) return;
          if (a2 !== y2.value || o3 !== w2.value) {
            y2.value = a2;
            w2.value = o3;
            l2("changerange", { selecting: true, endDate: u2.date.startOf("year").month(a2 * 4 + o3) });
          }
        };
        const A2 = (e3) => {
          var t2;
          const n2 = (t2 = e3.target) == null ? void 0 : t2.closest("td");
          if ((n2 == null ? void 0 : n2.tagName) !== "TD") return;
          if (Rl(n2, "disabled")) return;
          const a2 = n2.cellIndex;
          const o3 = n2.parentNode.rowIndex;
          const r2 = o3 * 4 + a2;
          const s2 = u2.date.startOf("year").month(r2);
          if (u2.selectionMode === "range") {
            if (!u2.rangeState.selecting) {
              l2("pick", { minDate: s2, maxDate: null });
              l2("select", true);
            } else {
              if (u2.minDate && s2 >= u2.minDate) {
                l2("pick", { minDate: u2.minDate, maxDate: s2 });
              } else {
                l2("pick", { minDate: s2, maxDate: u2.minDate });
              }
              l2("select", false);
            }
          } else {
            l2("pick", r2);
          }
        };
        vue.watch(() => u2.date, async () => {
          var e3, t2;
          if ((e3 = m2.value) == null ? void 0 : e3.contains(document.activeElement)) {
            await vue.nextTick();
            (t2 = h2.value) == null ? void 0 : t2.focus();
          }
        });
        o2({ focus: x2 });
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("table", { role: "grid", "aria-label": vue.unref(f2)("el.datepicker.monthTablePrompt"), class: vue.normalizeClass(vue.unref(d2).b()), onClick: A2, onMousemove: M2 }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: m2 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(k2), (e4, o4) => (vue.openBlock(), vue.createElementBlock("tr", { key: o4 }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(e4, (e5, o5) => (vue.openBlock(), vue.createElementBlock("td", { key: o5, ref_for: true, ref: (t2) => C2(e5) && (h2.value = t2), class: vue.normalizeClass(S2(e5)), "aria-selected": `${C2(e5)}`, "aria-label": vue.unref(f2)(`el.datepicker.month${+e5.text + 1}`), tabindex: C2(e5) ? 0 : -1, onKeydown: [vue.withKeys(vue.withModifiers(A2, ["prevent", "stop"]), ["space"]), vue.withKeys(vue.withModifiers(A2, ["prevent", "stop"]), ["enter"])] }, [vue.createElementVNode("div", null, [vue.createElementVNode("span", tb, vue.toDisplayString(vue.unref(f2)("el.datepicker.months." + b2.value[e5.text])), 1)])], 42, eb))), 128))]))), 128))], 512)], 42, Qh));
      } });
      var ab = ad(nb, [["__file", "basic-month-table.vue"]]);
      const { date: ob, disabledDate: rb, parsedValue: lb } = $h;
      const sb = Cs({ date: ob, disabledDate: rb, parsedValue: lb, selectionMode: Th("year") });
      const ib = ["aria-label"];
      const ub = ["aria-selected", "tabindex", "onKeydown"];
      const cb = { class: "cell" };
      const db = { key: 1 };
      const fb = vue.defineComponent({ __name: "basic-year-table", props: sb, emits: ["pick"], setup(e2, { expose: o2, emit: l2 }) {
        const u2 = e2;
        const c2 = (e3, t2) => {
          const n2 = Sp(String(e3)).locale(t2).startOf("year");
          const a2 = n2.endOf("year");
          const o3 = a2.dayOfYear();
          return Lp(o3).map((e4) => n2.add(e4, "day").toDate());
        };
        const d2 = oi("year-table");
        const { t: f2, lang: p2 } = Xs();
        const m2 = vue.ref();
        const h2 = vue.ref();
        const b2 = vue.computed(() => Math.floor(u2.date.year() / 10) * 10);
        const g2 = () => {
          var e3;
          (e3 = h2.value) == null ? void 0 : e3.focus();
        };
        const y2 = (e3) => {
          const t2 = {};
          const n2 = Sp().locale(p2.value);
          t2.disabled = u2.disabledDate ? c2(e3, p2.value).every(u2.disabledDate) : false;
          t2.current = Fs(u2.parsedValue).findIndex((t3) => t3.year() === e3) >= 0;
          t2.today = n2.year() === e3;
          return t2;
        };
        const w2 = (e3) => e3 === b2.value && u2.date.year() < b2.value && u2.date.year() > b2.value + 9 || Fs(u2.date).findIndex((t2) => t2.year() === e3) >= 0 || Fs(u2.parsedValue).findIndex((t2) => (t2 == null ? void 0 : t2.year()) === e3) >= 0;
        const k2 = (e3) => {
          const t2 = e3.target;
          const n2 = t2.closest("td");
          if (n2 && n2.textContent) {
            if (Rl(n2, "disabled")) return;
            const t3 = n2.textContent || n2.innerText;
            if (u2.selectionMode === "years") {
              if (e3.type === "keydown") {
                l2("pick", Fs(u2.parsedValue), false);
                return;
              }
              const a2 = Rl(n2, "current") ? Fs(u2.parsedValue).filter((e4) => (e4 == null ? void 0 : e4.year()) !== Number(t3)) : Fs(u2.parsedValue).concat([Sp(t3)]);
              l2("pick", a2);
            } else {
              l2("pick", Number(t3));
            }
          }
        };
        vue.watch(() => u2.date, async () => {
          var e3, t2;
          if ((e3 = m2.value) == null ? void 0 : e3.contains(document.activeElement)) {
            await vue.nextTick();
            (t2 = h2.value) == null ? void 0 : t2.focus();
          }
        });
        o2({ focus: g2 });
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("table", { role: "grid", "aria-label": vue.unref(f2)("el.datepicker.yearTablePrompt"), class: vue.normalizeClass(vue.unref(d2).b()), onClick: k2 }, [vue.createElementVNode("tbody", { ref_key: "tbodyRef", ref: m2 }, [(vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(3, (e4, o4) => vue.createElementVNode("tr", { key: o4 }, [(vue.openBlock(), vue.createElementBlock(vue.Fragment, null, vue.renderList(4, (e5, r2) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: o4 + "_" + r2 }, [o4 * 4 + r2 < 10 ? (vue.openBlock(), vue.createElementBlock("td", { key: 0, ref_for: true, ref: (e6) => w2(vue.unref(b2) + o4 * 4 + r2) && (h2.value = e6), class: vue.normalizeClass(["available", y2(vue.unref(b2) + o4 * 4 + r2)]), "aria-selected": `${w2(vue.unref(b2) + o4 * 4 + r2)}`, tabindex: w2(vue.unref(b2) + o4 * 4 + r2) ? 0 : -1, onKeydown: [vue.withKeys(vue.withModifiers(k2, ["prevent", "stop"]), ["space"]), vue.withKeys(vue.withModifiers(k2, ["prevent", "stop"]), ["enter"])] }, [vue.createElementVNode("div", null, [vue.createElementVNode("span", cb, vue.toDisplayString(vue.unref(b2) + o4 * 4 + r2), 1)])], 42, ub)) : (vue.openBlock(), vue.createElementBlock("td", db))], 64))), 64))])), 64))], 512)], 10, ib));
      } });
      var vb = ad(fb, [["__file", "basic-year-table.vue"]]);
      const pb = ["onClick"];
      const mb = ["aria-label"];
      const hb = ["aria-label"];
      const bb = ["aria-label"];
      const gb = ["aria-label"];
      const yb = vue.defineComponent({ __name: "panel-date-pick", props: Ph, emits: ["pick", "set-picker-option", "panel-change"], setup(e2, { emit: o2 }) {
        const l2 = e2;
        const u2 = (e3, t2, n2) => true;
        const c2 = oi("picker-panel");
        const d2 = oi("date-picker");
        const p2 = vue.useAttrs();
        const m2 = vue.useSlots();
        const { t: h2, lang: b2 } = Xs();
        const g2 = vue.inject("EP_PICKER_BASE");
        const y2 = vue.inject(rv);
        const { shortcuts: x2, disabledDate: $2, cellClassName: L2, defaultTime: P2 } = g2.props;
        const B2 = vue.toRef(g2.props, "defaultValue");
        const F2 = vue.ref();
        const j2 = vue.ref(Sp().locale(b2.value));
        const z2 = vue.ref(false);
        let N2 = false;
        const H2 = vue.computed(() => Sp(P2).locale(b2.value));
        const Y2 = vue.computed(() => j2.value.month());
        const W2 = vue.computed(() => j2.value.year());
        const U2 = vue.ref([]);
        const G2 = vue.ref(null);
        const Z2 = vue.ref(null);
        const J2 = (e3) => U2.value.length > 0 ? u2(e3, U2.value, l2.format || "HH:mm:ss") : true;
        const X2 = (e3) => {
          if (P2 && !ke2.value && !z2.value && !N2) {
            return H2.value.year(e3.year()).month(e3.month()).date(e3.date());
          }
          if (ve2.value) return e3.millisecond(0);
          return e3.startOf("day");
        };
        const ee2 = (e3, ...t2) => {
          if (!e3) {
            o2("pick", e3, ...t2);
          } else if (tt(e3)) {
            const n2 = e3.map(X2);
            o2("pick", n2, ...t2);
          } else {
            o2("pick", X2(e3), ...t2);
          }
          G2.value = null;
          Z2.value = null;
          z2.value = false;
          N2 = false;
        };
        const te2 = async (e3, t2) => {
          if (se2.value === "date") {
            e3 = e3;
            let n2 = l2.parsedValue ? l2.parsedValue.year(e3.year()).month(e3.month()).date(e3.date()) : e3;
            if (!J2(n2)) {
              n2 = U2.value[0][0].year(e3.year()).month(e3.month()).date(e3.date());
            }
            j2.value = n2;
            ee2(n2, ve2.value || t2);
            if (l2.type === "datetime") {
              await vue.nextTick();
              Te2();
            }
          } else if (se2.value === "week") {
            ee2(e3.date);
          } else if (se2.value === "dates") {
            ee2(e3, true);
          }
        };
        const ne2 = (e3) => {
          const t2 = e3 ? "add" : "subtract";
          j2.value = j2.value[t2](1, "month");
          Re2("month");
        };
        const ae2 = (e3) => {
          const t2 = j2.value;
          const n2 = e3 ? "add" : "subtract";
          j2.value = oe2.value === "year" ? t2[n2](10, "year") : t2[n2](1, "year");
          Re2("year");
        };
        const oe2 = vue.ref("date");
        const re2 = vue.computed(() => {
          const e3 = h2("el.datepicker.year");
          if (oe2.value === "year") {
            const t2 = Math.floor(W2.value / 10) * 10;
            if (e3) {
              return `${t2} ${e3} - ${t2 + 9} ${e3}`;
            }
            return `${t2} - ${t2 + 9}`;
          }
          return `${W2.value} ${e3}`;
        });
        const le2 = (e3) => {
          const t2 = at(e3.value) ? e3.value() : e3.value;
          if (t2) {
            N2 = true;
            ee2(Sp(t2).locale(b2.value));
            return;
          }
          if (e3.onClick) {
            e3.onClick({ attrs: p2, slots: m2, emit: o2 });
          }
        };
        const se2 = vue.computed(() => {
          const { type: e3 } = l2;
          if (["week", "month", "year", "years", "dates"].includes(e3)) return e3;
          return "date";
        });
        const ie2 = vue.computed(() => se2.value === "date" ? oe2.value : se2.value);
        const ue2 = vue.computed(() => !!x2.length);
        const ce2 = async (e3) => {
          j2.value = j2.value.startOf("month").month(e3);
          if (se2.value === "month") {
            ee2(j2.value, false);
          } else {
            oe2.value = "date";
            if (["month", "year", "date", "week"].includes(se2.value)) {
              ee2(j2.value, true);
              await vue.nextTick();
              Te2();
            }
          }
          Re2("month");
        };
        const de2 = async (e3, t2) => {
          if (se2.value === "year") {
            j2.value = j2.value.startOf("year").year(e3);
            ee2(j2.value, false);
          } else if (se2.value === "years") {
            ee2(e3, t2 != null ? t2 : true);
          } else {
            j2.value = j2.value.year(e3);
            oe2.value = "month";
            if (["month", "year", "date", "week"].includes(se2.value)) {
              ee2(j2.value, true);
              await vue.nextTick();
              Te2();
            }
          }
          Re2("year");
        };
        const fe2 = async (e3) => {
          oe2.value = e3;
          await vue.nextTick();
          Te2();
        };
        const ve2 = vue.computed(() => l2.type === "datetime" || l2.type === "datetimerange");
        const pe2 = vue.computed(() => {
          const e3 = ve2.value || se2.value === "dates";
          const t2 = se2.value === "years";
          const n2 = oe2.value === "date";
          const a2 = oe2.value === "year";
          return e3 && n2 || t2 && a2;
        });
        const me2 = vue.computed(() => {
          if (!$2) return false;
          if (!l2.parsedValue) return true;
          if (tt(l2.parsedValue)) {
            return $2(l2.parsedValue[0].toDate());
          }
          return $2(l2.parsedValue.toDate());
        });
        const he2 = () => {
          if (se2.value === "dates" || se2.value === "years") {
            ee2(l2.parsedValue);
          } else {
            let e3 = l2.parsedValue;
            if (!e3) {
              const t2 = Sp(P2).locale(b2.value);
              const n2 = Ie2();
              e3 = t2.year(n2.year()).month(n2.month()).date(n2.date());
            }
            j2.value = e3;
            ee2(e3);
          }
        };
        const be2 = vue.computed(() => {
          if (!$2) return false;
          return $2(Sp().locale(b2.value).toDate());
        });
        const ge2 = () => {
          const e3 = Sp().locale(b2.value);
          const t2 = e3.toDate();
          z2.value = true;
          if ((!$2 || !$2(t2)) && J2(t2)) {
            j2.value = Sp().locale(b2.value);
            ee2(j2.value);
          }
        };
        const ye2 = vue.computed(() => l2.timeFormat || Tp(l2.format));
        const we2 = vue.computed(() => l2.dateFormat || Ip(l2.format));
        const ke2 = vue.computed(() => {
          if (Z2.value) return Z2.value;
          if (!l2.parsedValue && !B2.value) return;
          return (l2.parsedValue || j2.value).format(ye2.value);
        });
        const xe2 = vue.computed(() => {
          if (G2.value) return G2.value;
          if (!l2.parsedValue && !B2.value) return;
          return (l2.parsedValue || j2.value).format(we2.value);
        });
        const Se2 = vue.ref(false);
        const Ce2 = () => {
          Se2.value = true;
        };
        const _e2 = () => {
          Se2.value = false;
        };
        const Me2 = (e3) => ({ hour: e3.hour(), minute: e3.minute(), second: e3.second(), year: e3.year(), month: e3.month(), date: e3.date() });
        const Oe2 = (e3, t2, n2) => {
          const { hour: a2, minute: o3, second: r2 } = Me2(e3);
          const s2 = l2.parsedValue ? l2.parsedValue.hour(a2).minute(o3).second(r2) : e3;
          j2.value = s2;
          ee2(j2.value, true);
          if (!n2) {
            Se2.value = t2;
          }
        };
        const De2 = (e3) => {
          const t2 = Sp(e3, ye2.value).locale(b2.value);
          if (t2.isValid() && J2(t2)) {
            const { year: e4, month: n2, date: a2 } = Me2(j2.value);
            j2.value = t2.year(e4).month(n2).date(a2);
            Z2.value = null;
            Se2.value = false;
            ee2(j2.value, true);
          }
        };
        const Ae2 = (e3) => {
          const t2 = Sp(e3, we2.value).locale(b2.value);
          if (t2.isValid()) {
            if ($2 && $2(t2.toDate())) {
              return;
            }
            const { hour: e4, minute: n2, second: a2 } = Me2(j2.value);
            j2.value = t2.hour(e4).minute(n2).second(a2);
            G2.value = null;
            ee2(j2.value, true);
          }
        };
        const Ee2 = (e3) => Sp.isDayjs(e3) && e3.isValid() && ($2 ? !$2(e3.toDate()) : true);
        const $e2 = (e3) => tt(e3) ? e3.map((e4) => e4.format(l2.format)) : e3.format(l2.format);
        const Le2 = (e3) => Sp(e3, l2.format).locale(b2.value);
        const Ie2 = () => {
          const e3 = Sp(B2.value).locale(b2.value);
          if (!B2.value) {
            const e4 = H2.value;
            return Sp().hour(e4.hour()).minute(e4.minute()).second(e4.second()).locale(b2.value);
          }
          return e3;
        };
        const Te2 = async () => {
          var e3;
          if (["week", "month", "year", "date"].includes(se2.value)) {
            (e3 = F2.value) == null ? void 0 : e3.focus();
            if (se2.value === "week") {
              Be2($s.down);
            }
          }
        };
        const Pe2 = (e3) => {
          const { code: t2 } = e3;
          const n2 = [$s.up, $s.down, $s.left, $s.right, $s.home, $s.end, $s.pageUp, $s.pageDown];
          if (n2.includes(t2)) {
            Be2(t2);
            e3.stopPropagation();
            e3.preventDefault();
          }
          if ([$s.enter, $s.space, $s.numpadEnter].includes(t2) && G2.value === null && Z2.value === null) {
            e3.preventDefault();
            ee2(j2.value, false);
          }
        };
        const Be2 = (e3) => {
          var t2;
          const { up: n2, down: a2, left: r2, right: l3, home: s2, end: i2, pageUp: u3, pageDown: c3 } = $s;
          const d3 = { year: { [n2]: -4, [a2]: 4, [r2]: -1, [l3]: 1, offset: (e4, t3) => e4.setFullYear(e4.getFullYear() + t3) }, month: { [n2]: -4, [a2]: 4, [r2]: -1, [l3]: 1, offset: (e4, t3) => e4.setMonth(e4.getMonth() + t3) }, week: { [n2]: -1, [a2]: 1, [r2]: -1, [l3]: 1, offset: (e4, t3) => e4.setDate(e4.getDate() + t3 * 7) }, date: { [n2]: -7, [a2]: 7, [r2]: -1, [l3]: 1, [s2]: (e4) => -e4.getDay(), [i2]: (e4) => -e4.getDay() + 6, [u3]: (e4) => -new Date(e4.getFullYear(), e4.getMonth(), 0).getDate(), [c3]: (e4) => new Date(e4.getFullYear(), e4.getMonth() + 1, 0).getDate(), offset: (e4, t3) => e4.setDate(e4.getDate() + t3) } };
          const f2 = j2.value.toDate();
          while (Math.abs(j2.value.diff(f2, "year", true)) < 1) {
            const n3 = d3[ie2.value];
            if (!n3) return;
            n3.offset(f2, at(n3[e3]) ? n3[e3](f2) : (t2 = n3[e3]) != null ? t2 : 0);
            if ($2 && $2(f2)) {
              break;
            }
            const a3 = Sp(f2).locale(b2.value);
            j2.value = a3;
            o2("pick", a3, true);
            break;
          }
        };
        const Re2 = (e3) => {
          o2("panel-change", j2.value.toDate(), e3, oe2.value);
        };
        vue.watch(() => se2.value, (e3) => {
          if (["month", "year"].includes(e3)) {
            oe2.value = e3;
            return;
          } else if (e3 === "years") {
            oe2.value = "year";
            return;
          }
          oe2.value = "date";
        }, { immediate: true });
        vue.watch(() => oe2.value, () => {
          y2 == null ? void 0 : y2.updatePopper();
        });
        vue.watch(() => B2.value, (e3) => {
          if (e3) {
            j2.value = Ie2();
          }
        }, { immediate: true });
        vue.watch(() => l2.parsedValue, (e3) => {
          if (e3) {
            if (se2.value === "dates" || se2.value === "years") return;
            if (Array.isArray(e3)) return;
            j2.value = e3;
          } else {
            j2.value = Ie2();
          }
        }, { immediate: true });
        o2("set-picker-option", ["isValidValue", Ee2]);
        o2("set-picker-option", ["formatToString", $e2]);
        o2("set-picker-option", ["parseUserInput", Le2]);
        o2("set-picker-option", ["handleFocusPicker", Te2]);
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(c2).b(), vue.unref(d2).b(), { "has-sidebar": e3.$slots.sidebar || vue.unref(ue2), "has-time": vue.unref(ve2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(c2).e("sidebar")) }), vue.unref(ue2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(c2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(x2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("button", { key: a2, type: "button", class: vue.normalizeClass(vue.unref(c2).e("shortcut")), onClick: (t2) => le2(e4) }, vue.toDisplayString(e4.text), 11, pb))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("body")) }, [vue.unref(ve2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("time-header")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("editor-wrap")) }, [vue.createVNode(vue.unref(Dd), { placeholder: vue.unref(h2)("el.datepicker.selectDate"), "model-value": vue.unref(xe2), size: "small", "validate-event": false, onInput: o3[0] || (o3[0] = (e4) => G2.value = e4), onChange: Ae2 }, null, 8, ["placeholder", "model-value"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(d2).e("editor-wrap")) }, [vue.createVNode(vue.unref(Dd), { placeholder: vue.unref(h2)("el.datepicker.selectTime"), "model-value": vue.unref(ke2), size: "small", "validate-event": false, onFocus: Ce2, onInput: o3[1] || (o3[1] = (e4) => Z2.value = e4), onChange: De2 }, null, 8, ["placeholder", "model-value"]), vue.createVNode(vue.unref(vm), { visible: Se2.value, format: vue.unref(ye2), "parsed-value": j2.value, onPick: Oe2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(am), _e2]])], 2)) : vue.createCommentVNode("v-if", true), vue.withDirectives(vue.createElementVNode("div", { class: vue.normalizeClass([vue.unref(d2).e("header"), (oe2.value === "year" || oe2.value === "month") && vue.unref(d2).e("header--bordered")]) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("prev-btn")) }, [vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.prevYear`), class: vue.normalizeClass(["d-arrow-left", vue.unref(c2).e("icon-btn")]), onClick: o3[2] || (o3[2] = (e4) => ae2(false)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 10, mb), vue.withDirectives(vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.prevMonth`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "arrow-left"]), onClick: o3[3] || (o3[3] = (e4) => ne2(false)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Kl))]), _: 1 })], 10, hb), [[vue.vShow, oe2.value === "date"]])], 2), vue.createElementVNode("span", { role: "button", class: vue.normalizeClass(vue.unref(d2).e("header-label")), "aria-live": "polite", tabindex: "0", onKeydown: o3[4] || (o3[4] = vue.withKeys((e4) => fe2("year"), ["enter"])), onClick: o3[5] || (o3[5] = (e4) => fe2("year")) }, vue.toDisplayString(vue.unref(re2)), 35), vue.withDirectives(vue.createElementVNode("span", { role: "button", "aria-live": "polite", tabindex: "0", class: vue.normalizeClass([vue.unref(d2).e("header-label"), { active: oe2.value === "month" }]), onKeydown: o3[6] || (o3[6] = vue.withKeys((e4) => fe2("month"), ["enter"])), onClick: o3[7] || (o3[7] = (e4) => fe2("month")) }, vue.toDisplayString(vue.unref(h2)(`el.datepicker.month${vue.unref(Y2) + 1}`)), 35), [[vue.vShow, oe2.value === "date"]]), vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(d2).e("next-btn")) }, [vue.withDirectives(vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.nextMonth`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "arrow-right"]), onClick: o3[8] || (o3[8] = (e4) => ne2(true)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Gl))]), _: 1 })], 10, bb), [[vue.vShow, oe2.value === "date"]]), vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(h2)(`el.datepicker.nextYear`), class: vue.normalizeClass([vue.unref(c2).e("icon-btn"), "d-arrow-right"]), onClick: o3[9] || (o3[9] = (e4) => ae2(true)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 10, gb)], 2)], 2), [[vue.vShow, oe2.value !== "time"]]), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("content")), onKeydown: Pe2 }, [oe2.value === "date" ? (vue.openBlock(), vue.createBlock(Jh, { key: 0, ref_key: "currentViewRef", ref: F2, "selection-mode": vue.unref(se2), date: j2.value, "parsed-value": e3.parsedValue, "disabled-date": vue.unref($2), "cell-class-name": vue.unref(L2), onPick: te2 }, null, 8, ["selection-mode", "date", "parsed-value", "disabled-date", "cell-class-name"])) : vue.createCommentVNode("v-if", true), oe2.value === "year" ? (vue.openBlock(), vue.createBlock(vb, { key: 1, ref_key: "currentViewRef", ref: F2, "selection-mode": vue.unref(se2), date: j2.value, "disabled-date": vue.unref($2), "parsed-value": e3.parsedValue, onPick: de2 }, null, 8, ["selection-mode", "date", "disabled-date", "parsed-value"])) : vue.createCommentVNode("v-if", true), oe2.value === "month" ? (vue.openBlock(), vue.createBlock(ab, { key: 2, ref_key: "currentViewRef", ref: F2, date: j2.value, "parsed-value": e3.parsedValue, "disabled-date": vue.unref($2), onPick: ce2 }, null, 8, ["date", "parsed-value", "disabled-date"])) : vue.createCommentVNode("v-if", true)], 34)], 2)], 2), vue.withDirectives(vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(c2).e("footer")) }, [vue.withDirectives(vue.createVNode(vue.unref(gp), { text: "", size: "small", class: vue.normalizeClass(vue.unref(c2).e("link-btn")), disabled: vue.unref(be2), onClick: ge2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(h2)("el.datepicker.now")), 1)]), _: 1 }, 8, ["class", "disabled"]), [[vue.vShow, vue.unref(se2) !== "dates" && vue.unref(se2) !== "years"]]), vue.createVNode(vue.unref(gp), { plain: "", size: "small", class: vue.normalizeClass(vue.unref(c2).e("link-btn")), disabled: vue.unref(me2), onClick: he2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(h2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled"])], 2), [[vue.vShow, vue.unref(pe2)]])], 2));
      } });
      var wb = ad(yb, [["__file", "panel-date-pick.vue"]]);
      const kb = Cs({ ...Lh, ...Ih });
      const xb = (e2) => {
        const { emit: t2 } = vue.getCurrentInstance();
        const n2 = vue.useAttrs();
        const a2 = vue.useSlots();
        const o2 = (o3) => {
          const r2 = at(o3.value) ? o3.value() : o3.value;
          if (r2) {
            t2("pick", [Sp(r2[0]).locale(e2.value), Sp(r2[1]).locale(e2.value)]);
            return;
          }
          if (o3.onClick) {
            o3.onClick({ attrs: n2, slots: a2, emit: t2 });
          }
        };
        return o2;
      };
      const Sb = (e2, { defaultValue: t2, leftDate: n2, rightDate: a2, unit: o2, onParsedValueChanged: r2 }) => {
        const { emit: u2 } = vue.getCurrentInstance();
        const { pickerNs: c2 } = vue.inject(Dh);
        const d2 = oi("date-range-picker");
        const { t: p2, lang: m2 } = Xs();
        const h2 = xb(m2);
        const b2 = vue.ref();
        const g2 = vue.ref();
        const y2 = vue.ref({ endDate: null, selecting: false });
        const w2 = (e3) => {
          y2.value = e3;
        };
        const k2 = (e3 = false) => {
          const t3 = vue.unref(b2);
          const n3 = vue.unref(g2);
          if (Vh([t3, n3])) {
            u2("pick", [t3, n3], e3);
          }
        };
        const x2 = (e3) => {
          y2.value.selecting = e3;
          if (!e3) {
            y2.value.endDate = null;
          }
        };
        const S2 = () => {
          const [r3, l2] = Fh(vue.unref(t2), { lang: vue.unref(m2), unit: o2, unlinkPanels: e2.unlinkPanels });
          b2.value = void 0;
          g2.value = void 0;
          n2.value = r3;
          a2.value = l2;
        };
        vue.watch(t2, (e3) => {
          if (e3) {
            S2();
          }
        }, { immediate: true });
        vue.watch(() => e2.parsedValue, (e3) => {
          if (tt(e3) && e3.length === 2) {
            const [t3, a3] = e3;
            b2.value = t3;
            n2.value = t3;
            g2.value = a3;
            r2(vue.unref(b2), vue.unref(g2));
          } else {
            S2();
          }
        }, { immediate: true });
        return { minDate: b2, maxDate: g2, rangeState: y2, lang: m2, ppNs: c2, drpNs: d2, handleChangeRange: w2, handleRangeConfirm: k2, handleShortcutClick: h2, onSelect: x2, t: p2 };
      };
      const Cb = ["onClick"];
      const _b = ["aria-label"];
      const Mb = ["aria-label"];
      const Ob = ["disabled", "aria-label"];
      const Db = ["disabled", "aria-label"];
      const Ab = ["disabled", "aria-label"];
      const Eb = ["disabled", "aria-label"];
      const $b = ["aria-label"];
      const Lb = ["aria-label"];
      const Ib = "month";
      const Tb = vue.defineComponent({ __name: "panel-date-range", props: kb, emits: ["pick", "set-picker-option", "calendar-change", "panel-change"], setup(e2, { emit: o2 }) {
        const l2 = e2;
        const s2 = vue.inject("EP_PICKER_BASE");
        const { disabledDate: u2, cellClassName: c2, format: d2, defaultTime: p2, clearable: m2 } = s2.props;
        const h2 = vue.toRef(s2.props, "shortcuts");
        const b2 = vue.toRef(s2.props, "defaultValue");
        const { lang: g2 } = Xs();
        const y2 = vue.ref(Sp().locale(g2.value));
        const x2 = vue.ref(Sp().locale(g2.value).add(1, Ib));
        const { minDate: S2, maxDate: C2, rangeState: _2, ppNs: $2, drpNs: L2, handleChangeRange: P2, handleRangeConfirm: B2, handleShortcutClick: V2, onSelect: F2, t: j2 } = Sb(l2, { defaultValue: b2, leftDate: y2, rightDate: x2, unit: Ib, onParsedValueChanged: Ie2 });
        const z2 = vue.ref({ min: null, max: null });
        const N2 = vue.ref({ min: null, max: null });
        const H2 = vue.computed(() => `${y2.value.year()} ${j2("el.datepicker.year")} ${j2(`el.datepicker.month${y2.value.month() + 1}`)}`);
        const Y2 = vue.computed(() => `${x2.value.year()} ${j2("el.datepicker.year")} ${j2(`el.datepicker.month${x2.value.month() + 1}`)}`);
        const W2 = vue.computed(() => y2.value.year());
        const U2 = vue.computed(() => y2.value.month());
        const G2 = vue.computed(() => x2.value.year());
        const Z2 = vue.computed(() => x2.value.month());
        const J2 = vue.computed(() => !!h2.value.length);
        const X2 = vue.computed(() => {
          if (z2.value.min !== null) return z2.value.min;
          if (S2.value) return S2.value.format(ae2.value);
          return "";
        });
        const Q2 = vue.computed(() => {
          if (z2.value.max !== null) return z2.value.max;
          if (C2.value || S2.value) return (C2.value || S2.value).format(ae2.value);
          return "";
        });
        const ee2 = vue.computed(() => {
          if (N2.value.min !== null) return N2.value.min;
          if (S2.value) return S2.value.format(ne2.value);
          return "";
        });
        const te2 = vue.computed(() => {
          if (N2.value.max !== null) return N2.value.max;
          if (C2.value || S2.value) return (C2.value || S2.value).format(ne2.value);
          return "";
        });
        const ne2 = vue.computed(() => l2.timeFormat || Tp(d2));
        const ae2 = vue.computed(() => l2.dateFormat || Ip(d2));
        const oe2 = (e3) => Vh(e3) && (u2 ? !u2(e3[0].toDate()) && !u2(e3[1].toDate()) : true);
        const re2 = () => {
          y2.value = y2.value.subtract(1, "year");
          if (!l2.unlinkPanels) {
            x2.value = y2.value.add(1, "month");
          }
          ve2("year");
        };
        const le2 = () => {
          y2.value = y2.value.subtract(1, "month");
          if (!l2.unlinkPanels) {
            x2.value = y2.value.add(1, "month");
          }
          ve2("month");
        };
        const se2 = () => {
          if (!l2.unlinkPanels) {
            y2.value = y2.value.add(1, "year");
            x2.value = y2.value.add(1, "month");
          } else {
            x2.value = x2.value.add(1, "year");
          }
          ve2("year");
        };
        const ie2 = () => {
          if (!l2.unlinkPanels) {
            y2.value = y2.value.add(1, "month");
            x2.value = y2.value.add(1, "month");
          } else {
            x2.value = x2.value.add(1, "month");
          }
          ve2("month");
        };
        const ue2 = () => {
          y2.value = y2.value.add(1, "year");
          ve2("year");
        };
        const ce2 = () => {
          y2.value = y2.value.add(1, "month");
          ve2("month");
        };
        const de2 = () => {
          x2.value = x2.value.subtract(1, "year");
          ve2("year");
        };
        const fe2 = () => {
          x2.value = x2.value.subtract(1, "month");
          ve2("month");
        };
        const ve2 = (e3) => {
          o2("panel-change", [y2.value.toDate(), x2.value.toDate()], e3);
        };
        const pe2 = vue.computed(() => {
          const e3 = (U2.value + 1) % 12;
          const t2 = U2.value + 1 >= 12 ? 1 : 0;
          return l2.unlinkPanels && new Date(W2.value + t2, e3) < new Date(G2.value, Z2.value);
        });
        const me2 = vue.computed(() => l2.unlinkPanels && G2.value * 12 + Z2.value - (W2.value * 12 + U2.value + 1) >= 12);
        const he2 = vue.computed(() => !(S2.value && C2.value && !_2.value.selecting && Vh([S2.value, C2.value])));
        const be2 = vue.computed(() => l2.type === "datetime" || l2.type === "datetimerange");
        const ge2 = (e3, t2) => {
          if (!e3) return;
          if (p2) {
            const n2 = Sp(p2[t2] || p2).locale(g2.value);
            return n2.year(e3.year()).month(e3.month()).date(e3.date());
          }
          return e3;
        };
        const ye2 = (e3, t2 = true) => {
          const n2 = e3.minDate;
          const a2 = e3.maxDate;
          const r2 = ge2(n2, 0);
          const l3 = ge2(a2, 1);
          if (C2.value === l3 && S2.value === r2) {
            return;
          }
          o2("calendar-change", [n2.toDate(), a2 && a2.toDate()]);
          C2.value = l3;
          S2.value = r2;
          if (!t2 || be2.value) return;
          B2();
        };
        const we2 = vue.ref(false);
        const ke2 = vue.ref(false);
        const xe2 = () => {
          we2.value = false;
        };
        const Se2 = () => {
          ke2.value = false;
        };
        const Ce2 = (e3, t2) => {
          z2.value[t2] = e3;
          const n2 = Sp(e3, ae2.value).locale(g2.value);
          if (n2.isValid()) {
            if (u2 && u2(n2.toDate())) {
              return;
            }
            if (t2 === "min") {
              y2.value = n2;
              S2.value = (S2.value || y2.value).year(n2.year()).month(n2.month()).date(n2.date());
              if (!l2.unlinkPanels && (!C2.value || C2.value.isBefore(S2.value))) {
                x2.value = n2.add(1, "month");
                C2.value = S2.value.add(1, "month");
              }
            } else {
              x2.value = n2;
              C2.value = (C2.value || x2.value).year(n2.year()).month(n2.month()).date(n2.date());
              if (!l2.unlinkPanels && (!S2.value || S2.value.isAfter(C2.value))) {
                y2.value = n2.subtract(1, "month");
                S2.value = C2.value.subtract(1, "month");
              }
            }
          }
        };
        const _e2 = (e3, t2) => {
          z2.value[t2] = null;
        };
        const Me2 = (e3, t2) => {
          N2.value[t2] = e3;
          const n2 = Sp(e3, ne2.value).locale(g2.value);
          if (n2.isValid()) {
            if (t2 === "min") {
              we2.value = true;
              S2.value = (S2.value || y2.value).hour(n2.hour()).minute(n2.minute()).second(n2.second());
              if (!C2.value || C2.value.isBefore(S2.value)) {
                C2.value = S2.value;
              }
            } else {
              ke2.value = true;
              C2.value = (C2.value || x2.value).hour(n2.hour()).minute(n2.minute()).second(n2.second());
              x2.value = C2.value;
              if (C2.value && C2.value.isBefore(S2.value)) {
                S2.value = C2.value;
              }
            }
          }
        };
        const Oe2 = (e3, t2) => {
          N2.value[t2] = null;
          if (t2 === "min") {
            y2.value = S2.value;
            we2.value = false;
          } else {
            x2.value = C2.value;
            ke2.value = false;
          }
        };
        const De2 = (e3, t2, n2) => {
          if (N2.value.min) return;
          if (e3) {
            y2.value = e3;
            S2.value = (S2.value || y2.value).hour(e3.hour()).minute(e3.minute()).second(e3.second());
          }
          if (!n2) {
            we2.value = t2;
          }
          if (!C2.value || C2.value.isBefore(S2.value)) {
            C2.value = S2.value;
            x2.value = e3;
          }
        };
        const Ae2 = (e3, t2, n2) => {
          if (N2.value.max) return;
          if (e3) {
            x2.value = e3;
            C2.value = (C2.value || x2.value).hour(e3.hour()).minute(e3.minute()).second(e3.second());
          }
          if (!n2) {
            ke2.value = t2;
          }
          if (C2.value && C2.value.isBefore(S2.value)) {
            S2.value = C2.value;
          }
        };
        const Ee2 = () => {
          y2.value = Fh(vue.unref(b2), { lang: vue.unref(g2), unit: "month", unlinkPanels: l2.unlinkPanels })[0];
          x2.value = y2.value.add(1, "month");
          C2.value = void 0;
          S2.value = void 0;
          o2("pick", null);
        };
        const $e2 = (e3) => tt(e3) ? e3.map((e4) => e4.format(d2)) : e3.format(d2);
        const Le2 = (e3) => tt(e3) ? e3.map((e4) => Sp(e4, d2).locale(g2.value)) : Sp(e3, d2).locale(g2.value);
        function Ie2(e3, t2) {
          if (l2.unlinkPanels && t2) {
            const n2 = (e3 == null ? void 0 : e3.year()) || 0;
            const a2 = (e3 == null ? void 0 : e3.month()) || 0;
            const o3 = t2.year();
            const r2 = t2.month();
            x2.value = n2 === o3 && a2 === r2 ? t2.add(1, Ib) : t2;
          } else {
            x2.value = y2.value.add(1, Ib);
            if (t2) {
              x2.value = x2.value.hour(t2.hour()).minute(t2.minute()).second(t2.second());
            }
          }
        }
        o2("set-picker-option", ["isValidValue", oe2]);
        o2("set-picker-option", ["parseUserInput", Le2]);
        o2("set-picker-option", ["formatToString", $e2]);
        o2("set-picker-option", ["handleClear", Ee2]);
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref($2).b(), vue.unref(L2).b(), { "has-sidebar": e3.$slots.sidebar || vue.unref(J2), "has-time": vue.unref(be2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref($2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref($2).e("sidebar")) }), vue.unref(J2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref($2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(h2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("button", { key: a2, type: "button", class: vue.normalizeClass(vue.unref($2).e("shortcut")), onClick: (t2) => vue.unref(V2)(e4) }, vue.toDisplayString(e4.text), 11, Cb))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref($2).e("body")) }, [vue.unref(be2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(L2).e("time-header")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(L2).e("editors-wrap")) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(L2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Dd), { size: "small", disabled: vue.unref(_2).selecting, placeholder: vue.unref(j2)("el.datepicker.startDate"), class: vue.normalizeClass(vue.unref(L2).e("editor")), "model-value": vue.unref(X2), "validate-event": false, onInput: o3[0] || (o3[0] = (e4) => Ce2(e4, "min")), onChange: o3[1] || (o3[1] = (e4) => _e2(e4, "min")) }, null, 8, ["disabled", "placeholder", "class", "model-value"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(L2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Dd), { size: "small", class: vue.normalizeClass(vue.unref(L2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(j2)("el.datepicker.startTime"), "model-value": vue.unref(ee2), "validate-event": false, onFocus: o3[2] || (o3[2] = (e4) => we2.value = true), onInput: o3[3] || (o3[3] = (e4) => Me2(e4, "min")), onChange: o3[4] || (o3[4] = (e4) => Oe2(e4, "min")) }, null, 8, ["class", "disabled", "placeholder", "model-value"]), vue.createVNode(vue.unref(vm), { visible: we2.value, format: vue.unref(ne2), "datetime-role": "start", "parsed-value": y2.value, onPick: De2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(am), xe2]])], 2), vue.createElementVNode("span", null, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Gl))]), _: 1 })]), vue.createElementVNode("span", { class: vue.normalizeClass([vue.unref(L2).e("editors-wrap"), "is-right"]) }, [vue.createElementVNode("span", { class: vue.normalizeClass(vue.unref(L2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Dd), { size: "small", class: vue.normalizeClass(vue.unref(L2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(j2)("el.datepicker.endDate"), "model-value": vue.unref(Q2), readonly: !vue.unref(S2), "validate-event": false, onInput: o3[5] || (o3[5] = (e4) => Ce2(e4, "max")), onChange: o3[6] || (o3[6] = (e4) => _e2(e4, "max")) }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly"])], 2), vue.withDirectives((vue.openBlock(), vue.createElementBlock("span", { class: vue.normalizeClass(vue.unref(L2).e("time-picker-wrap")) }, [vue.createVNode(vue.unref(Dd), { size: "small", class: vue.normalizeClass(vue.unref(L2).e("editor")), disabled: vue.unref(_2).selecting, placeholder: vue.unref(j2)("el.datepicker.endTime"), "model-value": vue.unref(te2), readonly: !vue.unref(S2), "validate-event": false, onFocus: o3[7] || (o3[7] = (e4) => vue.unref(S2) && (ke2.value = true)), onInput: o3[8] || (o3[8] = (e4) => Me2(e4, "max")), onChange: o3[9] || (o3[9] = (e4) => Oe2(e4, "max")) }, null, 8, ["class", "disabled", "placeholder", "model-value", "readonly"]), vue.createVNode(vue.unref(vm), { "datetime-role": "end", visible: ke2.value, format: vue.unref(ne2), "parsed-value": x2.value, onPick: Ae2 }, null, 8, ["visible", "format", "parsed-value"])], 2)), [[vue.unref(am), Se2]])], 2)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref($2).e("content"), vue.unref(L2).e("content")], "is-left"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(L2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref($2).e("icon-btn"), "d-arrow-left"]), "aria-label": vue.unref(j2)(`el.datepicker.prevYear`), onClick: re2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 10, _b), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref($2).e("icon-btn"), "arrow-left"]), "aria-label": vue.unref(j2)(`el.datepicker.prevMonth`), onClick: le2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Kl))]), _: 1 })], 10, Mb), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(me2), class: vue.normalizeClass([[vue.unref($2).e("icon-btn"), { "is-disabled": !vue.unref(me2) }], "d-arrow-right"]), "aria-label": vue.unref(j2)(`el.datepicker.nextYear`), onClick: ue2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 10, Ob)) : vue.createCommentVNode("v-if", true), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 1, type: "button", disabled: !vue.unref(pe2), class: vue.normalizeClass([[vue.unref($2).e("icon-btn"), { "is-disabled": !vue.unref(pe2) }], "arrow-right"]), "aria-label": vue.unref(j2)(`el.datepicker.nextMonth`), onClick: ce2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Gl))]), _: 1 })], 10, Db)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(H2)), 1)], 2), vue.createVNode(Jh, { "selection-mode": "range", date: y2.value, "min-date": vue.unref(S2), "max-date": vue.unref(C2), "range-state": vue.unref(_2), "disabled-date": vue.unref(u2), "cell-class-name": vue.unref(c2), onChangerange: vue.unref(P2), onPick: ye2, onSelect: vue.unref(F2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref($2).e("content"), vue.unref(L2).e("content")], "is-right"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(L2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(me2), class: vue.normalizeClass([[vue.unref($2).e("icon-btn"), { "is-disabled": !vue.unref(me2) }], "d-arrow-left"]), "aria-label": vue.unref(j2)(`el.datepicker.prevYear`), onClick: de2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 10, Ab)) : vue.createCommentVNode("v-if", true), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 1, type: "button", disabled: !vue.unref(pe2), class: vue.normalizeClass([[vue.unref($2).e("icon-btn"), { "is-disabled": !vue.unref(pe2) }], "arrow-left"]), "aria-label": vue.unref(j2)(`el.datepicker.prevMonth`), onClick: fe2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Kl))]), _: 1 })], 10, Eb)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", "aria-label": vue.unref(j2)(`el.datepicker.nextYear`), class: vue.normalizeClass([vue.unref($2).e("icon-btn"), "d-arrow-right"]), onClick: se2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 10, $b), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref($2).e("icon-btn"), "arrow-right"]), "aria-label": vue.unref(j2)(`el.datepicker.nextMonth`), onClick: ie2 }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Gl))]), _: 1 })], 10, Lb), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(Y2)), 1)], 2), vue.createVNode(Jh, { "selection-mode": "range", date: x2.value, "min-date": vue.unref(S2), "max-date": vue.unref(C2), "range-state": vue.unref(_2), "disabled-date": vue.unref(u2), "cell-class-name": vue.unref(c2), onChangerange: vue.unref(P2), onPick: ye2, onSelect: vue.unref(F2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "cell-class-name", "onChangerange", "onSelect"])], 2)], 2)], 2), vue.unref(be2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref($2).e("footer")) }, [vue.unref(m2) ? (vue.openBlock(), vue.createBlock(vue.unref(gp), { key: 0, text: "", size: "small", class: vue.normalizeClass(vue.unref($2).e("link-btn")), onClick: Ee2 }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(j2)("el.datepicker.clear")), 1)]), _: 1 }, 8, ["class"])) : vue.createCommentVNode("v-if", true), vue.createVNode(vue.unref(gp), { plain: "", size: "small", class: vue.normalizeClass(vue.unref($2).e("link-btn")), disabled: vue.unref(he2), onClick: o3[10] || (o3[10] = (e4) => vue.unref(B2)(false)) }, { default: vue.withCtx(() => [vue.createTextVNode(vue.toDisplayString(vue.unref(j2)("el.datepicker.confirm")), 1)]), _: 1 }, 8, ["class", "disabled"])], 2)) : vue.createCommentVNode("v-if", true)], 2));
      } });
      var Pb = ad(Tb, [["__file", "panel-date-range.vue"]]);
      const Bb = Cs({ ...Ih });
      const Rb = ["pick", "set-picker-option", "calendar-change"];
      const Vb = ({ unlinkPanels: e2, leftDate: t2, rightDate: n2 }) => {
        const { t: a2 } = Xs();
        const o2 = () => {
          t2.value = t2.value.subtract(1, "year");
          if (!e2.value) {
            n2.value = n2.value.subtract(1, "year");
          }
        };
        const l2 = () => {
          if (!e2.value) {
            t2.value = t2.value.add(1, "year");
          }
          n2.value = n2.value.add(1, "year");
        };
        const s2 = () => {
          t2.value = t2.value.add(1, "year");
        };
        const i2 = () => {
          n2.value = n2.value.subtract(1, "year");
        };
        const u2 = vue.computed(() => `${t2.value.year()} ${a2("el.datepicker.year")}`);
        const c2 = vue.computed(() => `${n2.value.year()} ${a2("el.datepicker.year")}`);
        const d2 = vue.computed(() => t2.value.year());
        const f2 = vue.computed(() => n2.value.year() === t2.value.year() ? t2.value.year() + 1 : n2.value.year());
        return { leftPrevYear: o2, rightNextYear: l2, leftNextYear: s2, rightPrevYear: i2, leftLabel: u2, rightLabel: c2, leftYear: d2, rightYear: f2 };
      };
      const Fb = ["onClick"];
      const jb = ["disabled"];
      const zb = ["disabled"];
      const Nb = "year";
      const Hb = vue.defineComponent({ name: "DatePickerMonthRange" });
      const Yb = vue.defineComponent({ ...Hb, props: Bb, emits: Rb, setup(e2, { emit: o2 }) {
        const l2 = e2;
        const { lang: s2 } = Xs();
        const u2 = vue.inject("EP_PICKER_BASE");
        const { shortcuts: c2, disabledDate: d2, format: p2 } = u2.props;
        const m2 = vue.toRef(u2.props, "defaultValue");
        const h2 = vue.ref(Sp().locale(s2.value));
        const b2 = vue.ref(Sp().locale(s2.value).add(1, Nb));
        const { minDate: g2, maxDate: y2, rangeState: x2, ppNs: S2, drpNs: C2, handleChangeRange: _2, handleRangeConfirm: A2, handleShortcutClick: $2, onSelect: L2 } = Sb(l2, { defaultValue: m2, leftDate: h2, rightDate: b2, unit: Nb, onParsedValueChanged: q2 });
        const P2 = vue.computed(() => !!c2.length);
        const { leftPrevYear: B2, rightNextYear: R2, leftNextYear: V2, rightPrevYear: F2, leftLabel: j2, rightLabel: z2, leftYear: N2, rightYear: H2 } = Vb({ unlinkPanels: vue.toRef(l2, "unlinkPanels"), leftDate: h2, rightDate: b2 });
        const Y2 = vue.computed(() => l2.unlinkPanels && H2.value > N2.value + 1);
        const W2 = (e3, t2 = true) => {
          const n2 = e3.minDate;
          const a2 = e3.maxDate;
          if (y2.value === a2 && g2.value === n2) {
            return;
          }
          o2("calendar-change", [n2.toDate(), a2 && a2.toDate()]);
          y2.value = a2;
          g2.value = n2;
          if (!t2) return;
          A2();
        };
        const U2 = (e3) => e3.map((e4) => e4.format(p2));
        function q2(e3, t2) {
          if (l2.unlinkPanels && t2) {
            const n2 = (e3 == null ? void 0 : e3.year()) || 0;
            const a2 = t2.year();
            b2.value = n2 === a2 ? t2.add(1, Nb) : t2;
          } else {
            b2.value = h2.value.add(1, Nb);
          }
        }
        o2("set-picker-option", ["formatToString", U2]);
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(S2).b(), vue.unref(C2).b(), { "has-sidebar": Boolean(e3.$slots.sidebar) || vue.unref(P2) }]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(S2).e("body-wrapper")) }, [vue.renderSlot(e3.$slots, "sidebar", { class: vue.normalizeClass(vue.unref(S2).e("sidebar")) }), vue.unref(P2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(S2).e("sidebar")) }, [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(c2), (e4, a2) => (vue.openBlock(), vue.createElementBlock("button", { key: a2, type: "button", class: vue.normalizeClass(vue.unref(S2).e("shortcut")), onClick: (t2) => vue.unref($2)(e4) }, vue.toDisplayString(e4.text), 11, Fb))), 128))], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(S2).e("body")) }, [vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(S2).e("content"), vue.unref(C2).e("content")], "is-left"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(C2).e("header")) }, [vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(S2).e("icon-btn"), "d-arrow-left"]), onClick: o3[0] || (o3[0] = (...e4) => vue.unref(B2) && vue.unref(B2)(...e4)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 2), e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(Y2), class: vue.normalizeClass([[vue.unref(S2).e("icon-btn"), { [vue.unref(S2).is("disabled")]: !vue.unref(Y2) }], "d-arrow-right"]), onClick: o3[1] || (o3[1] = (...e4) => vue.unref(V2) && vue.unref(V2)(...e4)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 10, jb)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(j2)), 1)], 2), vue.createVNode(ab, { "selection-mode": "range", date: h2.value, "min-date": vue.unref(g2), "max-date": vue.unref(y2), "range-state": vue.unref(x2), "disabled-date": vue.unref(d2), onChangerange: vue.unref(_2), onPick: W2, onSelect: vue.unref(L2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2), vue.createElementVNode("div", { class: vue.normalizeClass([[vue.unref(S2).e("content"), vue.unref(C2).e("content")], "is-right"]) }, [vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(C2).e("header")) }, [e3.unlinkPanels ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, type: "button", disabled: !vue.unref(Y2), class: vue.normalizeClass([[vue.unref(S2).e("icon-btn"), { "is-disabled": !vue.unref(Y2) }], "d-arrow-left"]), onClick: o3[2] || (o3[2] = (...e4) => vue.unref(F2) && vue.unref(F2)(...e4)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(us))]), _: 1 })], 10, zb)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("button", { type: "button", class: vue.normalizeClass([vue.unref(S2).e("icon-btn"), "d-arrow-right"]), onClick: o3[3] || (o3[3] = (...e4) => vue.unref(R2) && vue.unref(R2)(...e4)) }, [vue.createVNode(vue.unref(id), null, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ds))]), _: 1 })], 2), vue.createElementVNode("div", null, vue.toDisplayString(vue.unref(z2)), 1)], 2), vue.createVNode(ab, { "selection-mode": "range", date: b2.value, "min-date": vue.unref(g2), "max-date": vue.unref(y2), "range-state": vue.unref(x2), "disabled-date": vue.unref(d2), onChangerange: vue.unref(_2), onPick: W2, onSelect: vue.unref(L2) }, null, 8, ["date", "min-date", "max-date", "range-state", "disabled-date", "onChangerange", "onSelect"])], 2)], 2)], 2)], 2));
      } });
      var Wb = ad(Yb, [["__file", "panel-month-range.vue"]]);
      const Ub = function(e2) {
        switch (e2) {
          case "daterange":
          case "datetimerange": {
            return Pb;
          }
          case "monthrange": {
            return Wb;
          }
          default: {
            return wb;
          }
        }
      };
      Sp.extend(hm);
      Sp.extend(fh);
      Sp.extend(Mp);
      Sp.extend(mh);
      Sp.extend(gh);
      Sp.extend(kh);
      Sp.extend(Ch);
      Sp.extend(Oh);
      var Kb = vue.defineComponent({ name: "ElDatePicker", install: null, props: Ah, emits: ["update:modelValue"], setup(e2, { expose: t2, emit: n2, slots: a2 }) {
        const o2 = oi("picker-panel");
        vue.provide("ElPopperOptions", vue.reactive(vue.toRef(e2, "popperOptions")));
        vue.provide(Dh, { slots: a2, pickerNs: o2 });
        const r2 = vue.ref();
        const l2 = { focus: (e3 = true) => {
          var t3;
          (t3 = r2.value) == null ? void 0 : t3.focus(e3);
        }, handleOpen: () => {
          var e3;
          (e3 = r2.value) == null ? void 0 : e3.handleOpen();
        }, handleClose: () => {
          var e3;
          (e3 = r2.value) == null ? void 0 : e3.handleClose();
        } };
        t2(l2);
        const s2 = (e3) => {
          n2("update:modelValue", e3);
        };
        return () => {
          var t3;
          const n3 = (t3 = e2.format) != null ? t3 : Ep[e2.type] || Ap;
          const o3 = Ub(e2.type);
          return vue.createVNode(Kp, vue.mergeProps(e2, { format: n3, type: e2.type, ref: r2, "onUpdate:modelValue": s2 }), { default: (e3) => vue.createVNode(o3, e3, null), "range-separator": a2["range-separator"] });
        };
      } });
      const qb = Kb;
      qb.install = (e2) => {
        e2.component(qb.name, qb);
      };
      const Gb = qb;
      const Zb = Cs({ mask: { type: Boolean, default: true }, customMaskEvent: { type: Boolean, default: false }, overlayClass: { type: ks([String, Array, Object]) }, zIndex: { type: ks([String, Number]) } });
      const Jb = { click: (e2) => e2 instanceof MouseEvent };
      const Xb = "overlay";
      var Qb = vue.defineComponent({ name: "ElOverlay", props: Zb, emits: Jb, setup(e2, { slots: t2, emit: n2 }) {
        const a2 = oi(Xb);
        const o2 = (e3) => {
          n2("click", e3);
        };
        const { onClick: r2, onMousedown: l2, onMouseup: s2 } = bc(e2.customMaskEvent ? void 0 : o2);
        return () => e2.mask ? vue.createVNode("div", { class: [a2.b(), e2.overlayClass], style: { zIndex: e2.zIndex }, onClick: r2, onMousedown: l2, onMouseup: s2 }, [vue.renderSlot(t2, "default")], Vs.STYLE | Vs.CLASS | Vs.PROPS, ["onClick", "onMouseup", "onMousedown"]) : vue.h("div", { class: e2.overlayClass, style: { zIndex: e2.zIndex, position: "fixed", top: "0px", right: "0px", bottom: "0px", left: "0px" } }, [vue.renderSlot(t2, "default")]);
      } });
      const eg = Qb;
      const tg = Symbol("dialogInjectionKey");
      const ng = Cs({ center: Boolean, alignCenter: Boolean, closeIcon: { type: _s }, draggable: Boolean, overflow: Boolean, fullscreen: Boolean, showClose: { type: Boolean, default: true }, title: { type: String, default: "" }, ariaLevel: { type: String, default: "2" } });
      const ag = { close: () => true };
      const og = ["aria-level"];
      const rg = ["aria-label"];
      const lg = ["id"];
      const sg = vue.defineComponent({ name: "ElDialogContent" });
      const ig = vue.defineComponent({ ...sg, props: ng, emits: ag, setup(e2) {
        const o2 = e2;
        const { t: l2 } = Xs();
        const { Close: s2 } = Ms;
        const { dialogRef: u2, headerRef: c2, bodyId: d2, ns: v2, style: p2 } = vue.inject(tg);
        const { focusTrapRef: m2 } = vue.inject(wf);
        const h2 = vue.computed(() => [v2.b(), v2.is("fullscreen", o2.fullscreen), v2.is("draggable", o2.draggable), v2.is("align-center", o2.alignCenter), { [v2.m("center")]: o2.center }]);
        const b2 = Es(m2, u2);
        const g2 = vue.computed(() => o2.draggable);
        const y2 = vue.computed(() => o2.overflow);
        Us(u2, c2, g2, y2);
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { ref: vue.unref(b2), class: vue.normalizeClass(vue.unref(h2)), style: vue.normalizeStyle(vue.unref(p2)), tabindex: "-1" }, [vue.createElementVNode("header", { ref_key: "headerRef", ref: c2, class: vue.normalizeClass([vue.unref(v2).e("header"), { "show-close": e3.showClose }]) }, [vue.renderSlot(e3.$slots, "header", {}, () => [vue.createElementVNode("span", { role: "heading", "aria-level": e3.ariaLevel, class: vue.normalizeClass(vue.unref(v2).e("title")) }, vue.toDisplayString(e3.title), 11, og)]), e3.showClose ? (vue.openBlock(), vue.createElementBlock("button", { key: 0, "aria-label": vue.unref(l2)("el.dialog.close"), class: vue.normalizeClass(vue.unref(v2).e("headerbtn")), type: "button", onClick: o3[0] || (o3[0] = (t2) => e3.$emit("close")) }, [vue.createVNode(vue.unref(id), { class: vue.normalizeClass(vue.unref(v2).e("close")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.closeIcon || vue.unref(s2))))]), _: 1 }, 8, ["class"])], 10, rg)) : vue.createCommentVNode("v-if", true)], 2), vue.createElementVNode("div", { id: vue.unref(d2), class: vue.normalizeClass(vue.unref(v2).e("body")) }, [vue.renderSlot(e3.$slots, "default")], 10, lg), e3.$slots.footer ? (vue.openBlock(), vue.createElementBlock("footer", { key: 0, class: vue.normalizeClass(vue.unref(v2).e("footer")) }, [vue.renderSlot(e3.$slots, "footer")], 2)) : vue.createCommentVNode("v-if", true)], 6));
      } });
      var ug = ad(ig, [["__file", "dialog-content.vue"]]);
      const cg = Cs({ ...ng, appendToBody: Boolean, appendTo: { type: ks(String), default: "body" }, beforeClose: { type: ks(Function) }, destroyOnClose: Boolean, closeOnClickModal: { type: Boolean, default: true }, closeOnPressEscape: { type: Boolean, default: true }, lockScroll: { type: Boolean, default: true }, modal: { type: Boolean, default: true }, openDelay: { type: Number, default: 0 }, closeDelay: { type: Number, default: 0 }, top: { type: String }, modelValue: Boolean, modalClass: String, width: { type: [String, Number] }, zIndex: { type: Number }, trapFocus: { type: Boolean, default: false }, headerAriaLevel: { type: String, default: "2" } });
      const dg = { open: () => true, opened: () => true, close: () => true, closed: () => true, [Is]: (e2) => Ml(e2), openAutoFocus: () => true, closeAutoFocus: () => true };
      const fg = (e2, t2) => {
        var n2;
        const a2 = vue.getCurrentInstance();
        const o2 = a2.emit;
        const { nextZIndex: i2 } = jc();
        let c2 = "";
        const d2 = xc();
        const f2 = xc();
        const p2 = vue.ref(false);
        const m2 = vue.ref(false);
        const h2 = vue.ref(false);
        const b2 = vue.ref((n2 = e2.zIndex) != null ? n2 : i2());
        let g2 = void 0;
        let y2 = void 0;
        const w2 = Qc("namespace", Qs);
        const k2 = vue.computed(() => {
          const t3 = {};
          const n3 = `--${w2.value}-dialog`;
          if (!e2.fullscreen) {
            if (e2.top) {
              t3[`${n3}-margin-top`] = e2.top;
            }
            if (e2.width) {
              t3[`${n3}-width`] = zl(e2.width);
            }
          }
          return t3;
        });
        const x2 = vue.computed(() => {
          if (e2.alignCenter) {
            return { display: "flex" };
          }
          return {};
        });
        function S2() {
          o2("opened");
        }
        function C2() {
          o2("closed");
          o2(Is, false);
          if (e2.destroyOnClose) {
            h2.value = false;
          }
        }
        function M2() {
          o2("close");
        }
        function O2() {
          y2 == null ? void 0 : y2();
          g2 == null ? void 0 : g2();
          if (e2.openDelay && e2.openDelay > 0) {
            ({ stop: g2 } = Ae(() => $2(), e2.openDelay));
          } else {
            $2();
          }
        }
        function D2() {
          g2 == null ? void 0 : g2();
          y2 == null ? void 0 : y2();
          if (e2.closeDelay && e2.closeDelay > 0) {
            ({ stop: y2 } = Ae(() => L2(), e2.closeDelay));
          } else {
            L2();
          }
        }
        function A2() {
          function t3(e3) {
            if (e3) return;
            m2.value = true;
            p2.value = false;
          }
          if (e2.beforeClose) {
            e2.beforeClose(t3);
          } else {
            D2();
          }
        }
        function E2() {
          if (e2.closeOnClickModal) {
            A2();
          }
        }
        function $2() {
          if (!ke) return;
          p2.value = true;
        }
        function L2() {
          p2.value = false;
        }
        function I2() {
          o2("openAutoFocus");
        }
        function T2() {
          o2("closeAutoFocus");
        }
        function P2(e3) {
          var t3;
          if (((t3 = e3.detail) == null ? void 0 : t3.focusReason) === "pointer") {
            e3.preventDefault();
          }
        }
        if (e2.lockScroll) {
          ri(p2);
        }
        function B2() {
          if (e2.closeOnPressEscape) {
            A2();
          }
        }
        vue.watch(() => e2.modelValue, (n3) => {
          if (n3) {
            m2.value = false;
            O2();
            h2.value = true;
            b2.value = wl(e2.zIndex) ? i2() : b2.value++;
            vue.nextTick(() => {
              o2("open");
              if (t2.value) {
                t2.value.scrollTop = 0;
              }
            });
          } else {
            if (p2.value) {
              D2();
            }
          }
        });
        vue.watch(() => e2.fullscreen, (e3) => {
          if (!t2.value) return;
          if (e3) {
            c2 = t2.value.style.transform;
            t2.value.style.transform = "";
          } else {
            t2.value.style.transform = c2;
          }
        });
        vue.onMounted(() => {
          if (e2.modelValue) {
            p2.value = true;
            h2.value = true;
            O2();
          }
        });
        return { afterEnter: S2, afterLeave: C2, beforeLeave: M2, handleClose: A2, onModalClick: E2, close: D2, doClose: L2, onOpenAutoFocus: I2, onCloseAutoFocus: T2, onCloseRequested: B2, onFocusoutPrevented: P2, titleId: d2, bodyId: f2, closed: m2, style: k2, overlayDialogStyle: x2, rendered: h2, visible: p2, zIndex: b2 };
      };
      const vg = ["aria-label", "aria-labelledby", "aria-describedby"];
      const pg = vue.defineComponent({ name: "ElDialog", inheritAttrs: false });
      const mg = vue.defineComponent({ ...pg, props: cg, emits: dg, setup(e2, { expose: n2 }) {
        const o2 = e2;
        const l2 = vue.useSlots();
        Ws({ scope: "el-dialog", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/dialog.html#slots" }, vue.computed(() => !!l2.title));
        const s2 = oi("dialog");
        const u2 = vue.ref();
        const c2 = vue.ref();
        const d2 = vue.ref();
        const { visible: f2, titleId: p2, bodyId: m2, style: h2, overlayDialogStyle: b2, rendered: k2, zIndex: x2, afterEnter: S2, afterLeave: _2, beforeLeave: O2, handleClose: $2, onModalClick: L2, onOpenAutoFocus: T2, onCloseAutoFocus: F2, onCloseRequested: j2, onFocusoutPrevented: z2 } = fg(o2, u2);
        vue.provide(tg, { dialogRef: u2, headerRef: c2, bodyId: m2, ns: s2, rendered: k2, style: h2 });
        const N2 = bc(L2);
        const H2 = vue.computed(() => o2.draggable && !o2.fullscreen);
        n2({ visible: f2, dialogContentRef: d2 });
        return (e3, n3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { to: e3.appendTo, disabled: e3.appendTo !== "body" ? false : !e3.appendToBody }, [vue.createVNode(vue.Transition, { name: "dialog-fade", onAfterEnter: vue.unref(S2), onAfterLeave: vue.unref(_2), onBeforeLeave: vue.unref(O2), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode(vue.unref(eg), { "custom-mask-event": "", mask: e3.modal, "overlay-class": e3.modalClass, "z-index": vue.unref(x2) }, { default: vue.withCtx(() => [vue.createElementVNode("div", { role: "dialog", "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? vue.unref(p2) : void 0, "aria-describedby": vue.unref(m2), class: vue.normalizeClass(`${vue.unref(s2).namespace.value}-overlay-dialog`), style: vue.normalizeStyle(vue.unref(b2)), onClick: n3[0] || (n3[0] = (...e4) => vue.unref(N2).onClick && vue.unref(N2).onClick(...e4)), onMousedown: n3[1] || (n3[1] = (...e4) => vue.unref(N2).onMousedown && vue.unref(N2).onMousedown(...e4)), onMouseup: n3[2] || (n3[2] = (...e4) => vue.unref(N2).onMouseup && vue.unref(N2).onMouseup(...e4)) }, [vue.createVNode(vue.unref(Nf), { loop: "", trapped: vue.unref(f2), "focus-start-el": "container", onFocusAfterTrapped: vue.unref(T2), onFocusAfterReleased: vue.unref(F2), onFocusoutPrevented: vue.unref(z2), onReleaseRequested: vue.unref(j2) }, { default: vue.withCtx(() => [vue.unref(k2) ? (vue.openBlock(), vue.createBlock(ug, vue.mergeProps({ key: 0, ref_key: "dialogContentRef", ref: d2 }, e3.$attrs, { center: e3.center, "align-center": e3.alignCenter, "close-icon": e3.closeIcon, draggable: vue.unref(H2), overflow: e3.overflow, fullscreen: e3.fullscreen, "show-close": e3.showClose, title: e3.title, "aria-level": e3.headerAriaLevel, onClose: vue.unref($2) }), vue.createSlots({ header: vue.withCtx(() => [!e3.$slots.title ? vue.renderSlot(e3.$slots, "header", { key: 0, close: vue.unref($2), titleId: vue.unref(p2), titleClass: vue.unref(s2).e("title") }) : vue.renderSlot(e3.$slots, "title", { key: 1 })]), default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default")]), _: 2 }, [e3.$slots.footer ? { name: "footer", fn: vue.withCtx(() => [vue.renderSlot(e3.$slots, "footer")]) } : void 0]), 1040, ["center", "align-center", "close-icon", "draggable", "overflow", "fullscreen", "show-close", "title", "aria-level", "onClose"])) : vue.createCommentVNode("v-if", true)]), _: 3 }, 8, ["trapped", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])], 46, vg)]), _: 3 }, 8, ["mask", "overlay-class", "z-index"]), [[vue.vShow, vue.unref(f2)]])]), _: 3 }, 8, ["onAfterEnter", "onAfterLeave", "onBeforeLeave"])], 8, ["to", "disabled"]));
      } });
      var hg = ad(mg, [["__file", "dialog.vue"]]);
      const bg = Ds(hg);
      const gg = Cs({ direction: { type: String, values: ["horizontal", "vertical"], default: "horizontal" }, contentPosition: { type: String, values: ["left", "center", "right"], default: "center" }, borderStyle: { type: ks(String), default: "solid" } });
      const yg = vue.defineComponent({ name: "ElDivider" });
      const wg = vue.defineComponent({ ...yg, props: gg, setup(e2) {
        const a2 = e2;
        const o2 = oi("divider");
        const l2 = vue.computed(() => o2.cssVar({ "border-style": a2.borderStyle }));
        return (e3, a3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass([vue.unref(o2).b(), vue.unref(o2).m(e3.direction)]), style: vue.normalizeStyle(vue.unref(l2)), role: "separator" }, [e3.$slots.default && e3.direction !== "vertical" ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass([vue.unref(o2).e("text"), vue.unref(o2).is(e3.contentPosition)]) }, [vue.renderSlot(e3.$slots, "default")], 2)) : vue.createCommentVNode("v-if", true)], 6));
      } });
      var kg = ad(wg, [["__file", "divider.vue"]]);
      const xg = Ds(kg);
      const Sg = Cs({ ...cg, direction: { type: String, default: "rtl", values: ["ltr", "rtl", "ttb", "btt"] }, size: { type: [String, Number], default: "30%" }, withHeader: { type: Boolean, default: true }, modalFade: { type: Boolean, default: true }, headerAriaLevel: { type: String, default: "2" } });
      const Cg = dg;
      const _g = ["aria-label", "aria-labelledby", "aria-describedby"];
      const Mg = ["id", "aria-level"];
      const Og = ["aria-label"];
      const Dg = ["id"];
      const Ag = vue.defineComponent({ name: "ElDrawer", inheritAttrs: false });
      const Eg = vue.defineComponent({ ...Ag, props: Sg, emits: Cg, setup(e2, { expose: o2 }) {
        const l2 = e2;
        const s2 = vue.useSlots();
        Ws({ scope: "el-drawer", from: "the title slot", replacement: "the header slot", version: "3.0.0", ref: "https://element-plus.org/en-US/component/drawer.html#slots" }, vue.computed(() => !!s2.title));
        const u2 = vue.ref();
        const c2 = vue.ref();
        const d2 = oi("drawer");
        const { t: f2 } = Xs();
        const { afterEnter: p2, afterLeave: m2, beforeLeave: h2, visible: b2, rendered: g2, titleId: k2, bodyId: x2, zIndex: S2, onModalClick: _2, onOpenAutoFocus: O2, onCloseAutoFocus: $2, onFocusoutPrevented: P2, onCloseRequested: F2, handleClose: j2 } = fg(l2, u2);
        const z2 = vue.computed(() => l2.direction === "rtl" || l2.direction === "ltr");
        const N2 = vue.computed(() => zl(l2.size));
        o2({ handleClose: j2, afterEnter: p2, afterLeave: m2 });
        return (e3, o3) => (vue.openBlock(), vue.createBlock(vue.Teleport, { to: "body", disabled: !e3.appendToBody }, [vue.createVNode(vue.Transition, { name: vue.unref(d2).b("fade"), onAfterEnter: vue.unref(p2), onAfterLeave: vue.unref(m2), onBeforeLeave: vue.unref(h2), persisted: "" }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode(vue.unref(eg), { mask: e3.modal, "overlay-class": e3.modalClass, "z-index": vue.unref(S2), onClick: vue.unref(_2) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(Nf), { loop: "", trapped: vue.unref(b2), "focus-trap-el": u2.value, "focus-start-el": c2.value, onFocusAfterTrapped: vue.unref(O2), onFocusAfterReleased: vue.unref($2), onFocusoutPrevented: vue.unref(P2), onReleaseRequested: vue.unref(F2) }, { default: vue.withCtx(() => [vue.createElementVNode("div", vue.mergeProps({ ref_key: "drawerRef", ref: u2, "aria-modal": "true", "aria-label": e3.title || void 0, "aria-labelledby": !e3.title ? vue.unref(k2) : void 0, "aria-describedby": vue.unref(x2) }, e3.$attrs, { class: [vue.unref(d2).b(), e3.direction, vue.unref(b2) && "open"], style: vue.unref(z2) ? "width: " + vue.unref(N2) : "height: " + vue.unref(N2), role: "dialog", onClick: o3[1] || (o3[1] = vue.withModifiers(() => {
        }, ["stop"])) }), [vue.createElementVNode("span", { ref_key: "focusStartRef", ref: c2, class: vue.normalizeClass(vue.unref(d2).e("sr-focus")), tabindex: "-1" }, null, 2), e3.withHeader ? (vue.openBlock(), vue.createElementBlock("header", { key: 0, class: vue.normalizeClass(vue.unref(d2).e("header")) }, [!e3.$slots.title ? vue.renderSlot(e3.$slots, "header", { key: 0, close: vue.unref(j2), titleId: vue.unref(k2), titleClass: vue.unref(d2).e("title") }, () => [!e3.$slots.title ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, id: vue.unref(k2), role: "heading", "aria-level": e3.headerAriaLevel, class: vue.normalizeClass(vue.unref(d2).e("title")) }, vue.toDisplayString(e3.title), 11, Mg)) : vue.createCommentVNode("v-if", true)]) : vue.renderSlot(e3.$slots, "title", { key: 1 }, () => [vue.createCommentVNode(" DEPRECATED SLOT ")]), e3.showClose ? (vue.openBlock(), vue.createElementBlock("button", { key: 2, "aria-label": vue.unref(f2)("el.drawer.close"), class: vue.normalizeClass(vue.unref(d2).e("close-btn")), type: "button", onClick: o3[0] || (o3[0] = (...e4) => vue.unref(j2) && vue.unref(j2)(...e4)) }, [vue.createVNode(vue.unref(id), { class: vue.normalizeClass(vue.unref(d2).e("close")) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ss))]), _: 1 }, 8, ["class"])], 10, Og)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.unref(g2) ? (vue.openBlock(), vue.createElementBlock("div", { key: 1, id: vue.unref(x2), class: vue.normalizeClass(vue.unref(d2).e("body")) }, [vue.renderSlot(e3.$slots, "default")], 10, Dg)) : vue.createCommentVNode("v-if", true), e3.$slots.footer ? (vue.openBlock(), vue.createElementBlock("div", { key: 2, class: vue.normalizeClass(vue.unref(d2).e("footer")) }, [vue.renderSlot(e3.$slots, "footer")], 2)) : vue.createCommentVNode("v-if", true)], 16, _g)]), _: 3 }, 8, ["trapped", "focus-trap-el", "focus-start-el", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])]), _: 3 }, 8, ["mask", "overlay-class", "z-index", "onClick"]), [[vue.vShow, vue.unref(b2)]])]), _: 3 }, 8, ["name", "onAfterEnter", "onAfterLeave", "onBeforeLeave"])], 8, ["disabled"]));
      } });
      var $g = ad(Eg, [["__file", "drawer.vue"]]);
      const Lg = Ds($g);
      const Ig = Cs({ modelValue: { type: [Boolean, String, Number], default: false }, disabled: { type: Boolean, default: false }, loading: { type: Boolean, default: false }, size: { type: String, validator: Rs }, width: { type: [String, Number], default: "" }, inlinePrompt: { type: Boolean, default: false }, inactiveActionIcon: { type: _s }, activeActionIcon: { type: _s }, activeIcon: { type: _s }, inactiveIcon: { type: _s }, activeText: { type: String, default: "" }, inactiveText: { type: String, default: "" }, activeValue: { type: [Boolean, String, Number], default: true }, inactiveValue: { type: [Boolean, String, Number], default: false }, name: { type: String, default: "" }, validateEvent: { type: Boolean, default: true }, beforeChange: { type: ks(Function) }, id: String, tabindex: { type: [String, Number] }, label: { type: String, default: void 0 }, ...Zc(["ariaLabel"]) });
      const Tg = { [Is]: (e2) => Ml(e2) || ot(e2) || Ol(e2), [Ts]: (e2) => Ml(e2) || ot(e2) || Ol(e2), [Ps]: (e2) => Ml(e2) || ot(e2) || Ol(e2) };
      const Pg = ["onClick"];
      const Bg = ["id", "aria-checked", "aria-disabled", "aria-label", "name", "true-value", "false-value", "disabled", "tabindex", "onKeydown"];
      const Rg = ["aria-hidden"];
      const Vg = ["aria-hidden"];
      const Fg = ["aria-hidden"];
      const jg = "ElSwitch";
      const zg = vue.defineComponent({ name: jg });
      const Ng = vue.defineComponent({ ...zg, props: Ig, emits: Tg, setup(e2, { expose: o2, emit: l2 }) {
        const c2 = e2;
        const { formItem: d2 } = vd();
        const f2 = dd();
        const p2 = oi("switch");
        const { inputId: m2 } = pd(c2, { formItemContext: d2 });
        const h2 = fd(vue.computed(() => c2.loading));
        const b2 = vue.ref(c2.modelValue !== false);
        const g2 = vue.ref();
        const y2 = vue.ref();
        const k2 = vue.computed(() => [p2.b(), p2.m(f2.value), p2.is("disabled", h2.value), p2.is("checked", B2.value)]);
        const x2 = vue.computed(() => [p2.e("label"), p2.em("label", "left"), p2.is("active", !B2.value)]);
        const S2 = vue.computed(() => [p2.e("label"), p2.em("label", "right"), p2.is("active", B2.value)]);
        const C2 = vue.computed(() => ({ width: zl(c2.width) }));
        vue.watch(() => c2.modelValue, () => {
          b2.value = true;
        });
        const O2 = vue.computed(() => b2.value ? c2.modelValue : false);
        const B2 = vue.computed(() => O2.value === c2.activeValue);
        if (![c2.activeValue, c2.inactiveValue].includes(O2.value)) {
          l2(Is, c2.inactiveValue);
          l2(Ts, c2.inactiveValue);
          l2(Ps, c2.inactiveValue);
        }
        vue.watch(B2, (e3) => {
          var t2;
          g2.value.checked = e3;
          if (c2.validateEvent) {
            (t2 = d2 == null ? void 0 : d2.validate) == null ? void 0 : t2.call(d2, "change").catch((e4) => Pl());
          }
        });
        const R2 = () => {
          const e3 = B2.value ? c2.inactiveValue : c2.activeValue;
          l2(Is, e3);
          l2(Ts, e3);
          l2(Ps, e3);
          vue.nextTick(() => {
            g2.value.checked = B2.value;
          });
        };
        const V2 = () => {
          if (h2.value) return;
          const { beforeChange: e3 } = c2;
          if (!e3) {
            R2();
            return;
          }
          const t2 = e3();
          const n2 = [lt(t2), Ml(t2)].includes(true);
          if (!n2) {
            Tl(jg, "beforeChange must return type `Promise<boolean>` or `boolean`");
          }
          if (lt(t2)) {
            t2.then((e4) => {
              if (e4) {
                R2();
              }
            }).catch((e4) => {
            });
          } else if (t2) {
            R2();
          }
        };
        const F2 = () => {
          var e3, t2;
          (t2 = (e3 = g2.value) == null ? void 0 : e3.focus) == null ? void 0 : t2.call(e3);
        };
        vue.onMounted(() => {
          g2.value.checked = B2.value;
        });
        Ws({ from: "label", replacement: "aria-label", version: "2.8.0", scope: "el-switch", ref: "https://element-plus.org/en-US/component/switch.html" }, vue.computed(() => !!c2.label));
        o2({ focus: F2, checked: B2 });
        return (e3, o3) => (vue.openBlock(), vue.createElementBlock("div", { class: vue.normalizeClass(vue.unref(k2)), onClick: vue.withModifiers(V2, ["prevent"]) }, [vue.createElementVNode("input", { id: vue.unref(m2), ref_key: "input", ref: g2, class: vue.normalizeClass(vue.unref(p2).e("input")), type: "checkbox", role: "switch", "aria-checked": vue.unref(B2), "aria-disabled": vue.unref(h2), "aria-label": e3.label || e3.ariaLabel, name: e3.name, "true-value": e3.activeValue, "false-value": e3.inactiveValue, disabled: vue.unref(h2), tabindex: e3.tabindex, onChange: R2, onKeydown: vue.withKeys(V2, ["enter"]) }, null, 42, Bg), !e3.inlinePrompt && (e3.inactiveIcon || e3.inactiveText) ? (vue.openBlock(), vue.createElementBlock("span", { key: 0, class: vue.normalizeClass(vue.unref(x2)) }, [e3.inactiveIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.inactiveIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true), !e3.inactiveIcon && e3.inactiveText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, "aria-hidden": vue.unref(B2) }, vue.toDisplayString(e3.inactiveText), 9, Rg)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("span", { ref_key: "core", ref: y2, class: vue.normalizeClass(vue.unref(p2).e("core")), style: vue.normalizeStyle(vue.unref(C2)) }, [e3.inlinePrompt ? (vue.openBlock(), vue.createElementBlock("div", { key: 0, class: vue.normalizeClass(vue.unref(p2).e("inner")) }, [e3.activeIcon || e3.inactiveIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(p2).is("icon")) }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(B2) ? e3.activeIcon : e3.inactiveIcon)))]), _: 1 }, 8, ["class"])) : e3.activeText || e3.inactiveText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(p2).is("text")), "aria-hidden": !vue.unref(B2) }, vue.toDisplayString(vue.unref(B2) ? e3.activeText : e3.inactiveText), 11, Vg)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true), vue.createElementVNode("div", { class: vue.normalizeClass(vue.unref(p2).e("action")) }, [e3.loading ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0, class: vue.normalizeClass(vue.unref(p2).is("loading")) }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(ms))]), _: 1 }, 8, ["class"])) : vue.unref(B2) ? vue.renderSlot(e3.$slots, "active-action", { key: 1 }, () => [e3.activeActionIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.activeActionIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true)]) : !vue.unref(B2) ? vue.renderSlot(e3.$slots, "inactive-action", { key: 2 }, () => [e3.inactiveActionIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.inactiveActionIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true)]) : vue.createCommentVNode("v-if", true)], 2)], 6), !e3.inlinePrompt && (e3.activeIcon || e3.activeText) ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, class: vue.normalizeClass(vue.unref(S2)) }, [e3.activeIcon ? (vue.openBlock(), vue.createBlock(vue.unref(id), { key: 0 }, { default: vue.withCtx(() => [(vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(e3.activeIcon)))]), _: 1 })) : vue.createCommentVNode("v-if", true), !e3.activeIcon && e3.activeText ? (vue.openBlock(), vue.createElementBlock("span", { key: 1, "aria-hidden": !vue.unref(B2) }, vue.toDisplayString(e3.activeText), 9, Fg)) : vue.createCommentVNode("v-if", true)], 2)) : vue.createCommentVNode("v-if", true)], 10, Pg));
      } });
      var Hg = ad(Ng, [["__file", "switch.vue"]]);
      const Yg = Ds(Hg);
      function Wg(t2) {
        let n2;
        const a2 = vue.ref(false);
        const o2 = vue.reactive({ ...t2, originalPosition: "", originalOverflow: "", visible: false });
        function r2(e2) {
          o2.text = e2;
        }
        function l2() {
          const e2 = o2.parent;
          const t3 = f2.ns;
          if (!e2.vLoadingAddClassList) {
            let n3 = e2.getAttribute("loading-number");
            n3 = Number.parseInt(n3) - 1;
            if (!n3) {
              Fl(e2, t3.bm("parent", "relative"));
              e2.removeAttribute("loading-number");
            } else {
              e2.setAttribute("loading-number", n3.toString());
            }
            Fl(e2, t3.bm("parent", "hidden"));
          }
          s2();
          d2.unmount();
        }
        function s2() {
          var e2, t3;
          (t3 = (e2 = f2.$el) == null ? void 0 : e2.parentNode) == null ? void 0 : t3.removeChild(f2.$el);
        }
        function i2() {
          var e2;
          if (t2.beforeClose && !t2.beforeClose()) return;
          a2.value = true;
          clearTimeout(n2);
          n2 = window.setTimeout(u2, 400);
          o2.visible = false;
          (e2 = t2.closed) == null ? void 0 : e2.call(t2);
        }
        function u2() {
          if (!a2.value) return;
          const e2 = o2.parent;
          a2.value = false;
          e2.vLoadingAddClassList = void 0;
          l2();
        }
        const c2 = vue.defineComponent({ name: "ElLoading", setup(e2, { expose: t3 }) {
          const { ns: n3, zIndex: a3 } = ed("loading");
          t3({ ns: n3, zIndex: a3 });
          return () => {
            const e3 = o2.spinner || o2.svg;
            const t4 = vue.h("svg", { class: "circular", viewBox: o2.svgViewBox ? o2.svgViewBox : "0 0 50 50", ...e3 ? { innerHTML: e3 } : {} }, [vue.h("circle", { class: "path", cx: "25", cy: "25", r: "20", fill: "none" })]);
            const a4 = o2.text ? vue.h("p", { class: n3.b("text") }, [o2.text]) : void 0;
            return vue.h(vue.Transition, { name: n3.b("fade"), onAfterLeave: u2 }, { default: vue.withCtx(() => [vue.withDirectives(vue.createVNode("div", { style: { backgroundColor: o2.background || "" }, class: [n3.b("mask"), o2.customClass, o2.fullscreen ? "is-fullscreen" : ""] }, [vue.h("div", { class: n3.b("spinner") }, [t4, a4])]), [[vue.vShow, o2.visible]])]) });
          };
        } });
        const d2 = vue.createApp(c2);
        const f2 = d2.mount(document.createElement("div"));
        return { ...vue.toRefs(o2), setText: r2, removeElLoadingChild: s2, close: i2, handleAfterLeave: u2, vm: f2, get $el() {
          return f2.$el;
        } };
      }
      let Ug = void 0;
      const Kg = function(e2 = {}) {
        if (!ke) return void 0;
        const t2 = qg(e2);
        if (t2.fullscreen && Ug) {
          return Ug;
        }
        const n2 = Wg({ ...t2, closed: () => {
          var e3;
          (e3 = t2.closed) == null ? void 0 : e3.call(t2);
          if (t2.fullscreen) Ug = void 0;
        } });
        Gg(t2, t2.parent, n2);
        Zg(t2, t2.parent, n2);
        t2.parent.vLoadingAddClassList = () => Zg(t2, t2.parent, n2);
        let a2 = t2.parent.getAttribute("loading-number");
        if (!a2) {
          a2 = "1";
        } else {
          a2 = `${Number.parseInt(a2) + 1}`;
        }
        t2.parent.setAttribute("loading-number", a2);
        t2.parent.appendChild(n2.$el);
        vue.nextTick(() => n2.visible.value = t2.visible);
        if (t2.fullscreen) {
          Ug = n2;
        }
        return n2;
      };
      const qg = (e2) => {
        var t2, n2, a2, o2;
        let r2;
        if (ot(e2.target)) {
          r2 = (t2 = document.querySelector(e2.target)) != null ? t2 : document.body;
        } else {
          r2 = e2.target || document.body;
        }
        return { parent: r2 === document.body || e2.body ? document.body : r2, background: e2.background || "", svg: e2.svg || "", svgViewBox: e2.svgViewBox || "", spinner: e2.spinner || false, text: e2.text || "", fullscreen: r2 === document.body && ((n2 = e2.fullscreen) != null ? n2 : true), lock: (a2 = e2.lock) != null ? a2 : false, customClass: e2.customClass || "", visible: (o2 = e2.visible) != null ? o2 : true, target: r2 };
      };
      const Gg = async (e2, t2, n2) => {
        const { nextZIndex: a2 } = n2.vm.zIndex || n2.vm._.exposed.zIndex;
        const o2 = {};
        if (e2.fullscreen) {
          n2.originalPosition.value = jl(document.body, "position");
          n2.originalOverflow.value = jl(document.body, "overflow");
          o2.zIndex = a2();
        } else if (e2.parent === document.body) {
          n2.originalPosition.value = jl(document.body, "position");
          await vue.nextTick();
          for (const t3 of ["top", "left"]) {
            const n3 = t3 === "top" ? "scrollTop" : "scrollLeft";
            o2[t3] = `${e2.target.getBoundingClientRect()[t3] + document.body[n3] + document.documentElement[n3] - Number.parseInt(jl(document.body, `margin-${t3}`), 10)}px`;
          }
          for (const t3 of ["height", "width"]) {
            o2[t3] = `${e2.target.getBoundingClientRect()[t3]}px`;
          }
        } else {
          n2.originalPosition.value = jl(t2, "position");
        }
        for (const [e3, t3] of Object.entries(o2)) {
          n2.$el.style[e3] = t3;
        }
      };
      const Zg = (e2, t2, n2) => {
        const a2 = n2.vm.ns || n2.vm._.exposed.ns;
        if (!["absolute", "fixed", "sticky"].includes(n2.originalPosition.value)) {
          Vl(t2, a2.bm("parent", "relative"));
        } else {
          Fl(t2, a2.bm("parent", "relative"));
        }
        if (e2.fullscreen && e2.lock) {
          Vl(t2, a2.bm("parent", "hidden"));
        } else {
          Fl(t2, a2.bm("parent", "hidden"));
        }
      };
      const Jg = Symbol("ElLoading");
      const Xg = (e2, t2) => {
        var n2, a2, o2, r2;
        const l2 = t2.instance;
        const s2 = (e3) => rt(t2.value) ? t2.value[e3] : void 0;
        const i2 = (e3) => {
          const t3 = ot(e3) && (l2 == null ? void 0 : l2[e3]) || e3;
          if (t3) return vue.ref(t3);
          else return t3;
        };
        const u2 = (t3) => i2(s2(t3) || e2.getAttribute(`element-loading-${vt(t3)}`));
        const c2 = (n2 = s2("fullscreen")) != null ? n2 : t2.modifiers.fullscreen;
        const d2 = { text: u2("text"), svg: u2("svg"), svgViewBox: u2("svgViewBox"), spinner: u2("spinner"), background: u2("background"), customClass: u2("customClass"), fullscreen: c2, target: (a2 = s2("target")) != null ? a2 : c2 ? void 0 : e2, body: (o2 = s2("body")) != null ? o2 : t2.modifiers.body, lock: (r2 = s2("lock")) != null ? r2 : t2.modifiers.lock };
        e2[Jg] = { options: d2, instance: Kg(d2) };
      };
      const Qg = (e2, t2) => {
        for (const n2 of Object.keys(t2)) {
          if (vue.isRef(t2[n2])) t2[n2].value = e2[n2];
        }
      };
      const ey = { mounted(e2, t2) {
        if (t2.value) {
          Xg(e2, t2);
        }
      }, updated(e2, t2) {
        const n2 = e2[Jg];
        if (t2.oldValue !== t2.value) {
          if (t2.value && !t2.oldValue) {
            Xg(e2, t2);
          } else if (t2.value && t2.oldValue) {
            if (rt(t2.value)) Qg(t2.value, n2.options);
          } else {
            n2 == null ? void 0 : n2.instance.close();
          }
        }
      }, unmounted(e2) {
        var t2;
        (t2 = e2[Jg]) == null ? void 0 : t2.instance.close();
        e2[Jg] = null;
      } };
      var ty = /* @__PURE__ */ (() => typeof GM_xmlhttpRequest != "undefined" ? GM_xmlhttpRequest : void 0)();
      var ny = /* @__PURE__ */ (() => typeof unsafeWindow != "undefined" ? unsafeWindow : void 0)();
      const ay = (e2) => {
        let { url: t2 } = e2;
        const { method: n2, params: a2, responseType: o2 } = e2;
        if ((n2 === "get" || n2 === "GET") && a2) {
          t2 += `?${oe.stringify(a2)}`;
        }
        return new Promise((e3, a3) => {
          ty({ method: n2, url: t2, responseType: o2 ? o2 : "json", headers: { "Content-Type": "application/x-www-form-urlencoded" }, onload(t3) {
            e3(t3);
          }, onerror(e4) {
            a3(e4);
          } });
        });
      };
      const oy = "https://www.doseeing.com/data";
      const ry = (e2) => ay({ url: `${oy}/fan/${e2}`, method: "get", responseType: "text" });
      const ly = (e2) => ay({ url: `${oy}/api/user_feed`, method: "get", params: e2 });
      const sy = { class: "flex justify-between mb-4" };
      const iy = { class: "flex items-start" };
      const uy = ["src"];
      const cy = { class: "font-black text-xl ml-2" };
      const dy = { class: "flex justify-between" };
      const fy = { class: "flex justify-between" };
      const vy = { class: "flex-1" };
      const py = { class: "text-slate-400" };
      const my = ["innerHTML"];
      const hy = ["onClick"];
      const by = ["src"];
      const gy = { key: 1, class: "h-[58vh] text-center" };
      const yy = 50;
      const wy = vue.defineComponent({ __name: "index", props: { chatUserCardData: {} }, setup(e2) {
        const o2 = e2;
        const r2 = vue.ref(false);
        const l2 = vue.ref("");
        const s2 = vue.ref(false);
        const i2 = vue.ref([]);
        const u2 = vue.ref("1");
        const c2 = vue.ref(Sp().format());
        const d2 = vue.ref(0);
        const f2 = vue.ref(["chat"]);
        const p2 = vue.reactive({ chat: f2.value.includes("chat"), gift: f2.value.includes("gift") });
        let m2 = true;
        const h2 = vue.ref(null);
        const b2 = (e3) => Sp.unix(e3).format("YYYY-MM-DD HH:mm:ss");
        const g2 = (e3) => {
          navigator.clipboard.writeText(e3);
          elementPlus.ElMessage({ message: "复制成功", type: "success", plain: true });
        };
        const y2 = () => {
          window.open(`https://www.doseeing.com/data/fan/${o2.chatUserCardData.rel}`);
        };
        const w2 = (e3) => {
          window.open(`https://www.douyu.com/${e3}`);
        };
        const k2 = (e3) => {
          navigator.clipboard.writeText(`@${o2.chatUserCardData.nickName}:${e3}`);
          elementPlus.ElMessage({ message: "复制成功", type: "success", plain: true });
        };
        const x2 = () => {
          p2.chat = f2.value.includes("chat");
          p2.gift = f2.value.includes("gift");
        };
        const S2 = async () => {
          d2.value = 0;
          await L2();
        };
        const C2 = () => {
          c2.value = Sp(c2.value).add(1, "day").format();
          S2();
        };
        const _2 = () => {
          c2.value = Sp(c2.value).subtract(1, "day").format();
          S2();
        };
        const D2 = ({ scrollTop: e3 }) => {
          if (h2.value.wrapRef.scrollHeight - e3 <= h2.value.wrapRef.clientHeight && m2) {
            d2.value += yy;
            L2();
          }
        };
        const $2 = async () => {
          r2.value = true;
          s2.value = true;
          d2.value = 0;
          try {
            const { finalUrl: e3, response: t2 } = await ry(o2.chatUserCardData.rel);
            if (e3.startsWith("https://www.doseeing.com/login")) {
              elementPlus.ElMessage({ message: "未登录doseeing,请先登录", type: "error", plain: true });
              return;
            }
            const n2 = P2(t2, 'data-id="', '"');
            if (!n2) {
              elementPlus.ElMessage({ message: "未获取到用户id", type: "error", plain: true });
              return;
            }
            l2.value = n2;
            await L2();
          } finally {
            s2.value = false;
          }
        };
        const L2 = async () => {
          try {
            s2.value = true;
            const { response: { result: e3 } } = await ly({ uid: l2.value, dt: Sp(c2.value).format("YYYY-MM-DD"), offset: d2.value, order: u2.value });
            if (d2.value === 0) {
              i2.value = e3;
              h2.value && h2.value.wrapRef && h2.value.setScrollTop(0);
            } else {
              i2.value = [...i2.value, ...e3];
            }
            m2 = e3.length === yy;
          } finally {
            s2.value = false;
          }
        };
        const P2 = (e3, t2, n2) => {
          const a2 = new RegExp(t2 + "(.*?)" + n2, "s");
          const o3 = e3.match(a2);
          return o3 ? o3[1] : null;
        };
        return (e3, l3) => {
          const d3 = gp;
          const v2 = uh;
          const m3 = ih;
          const L3 = jm;
          const P3 = zm;
          const B2 = Gb;
          const V2 = xg;
          const F2 = Ud;
          const j2 = bg;
          const z2 = ey;
          return vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [vue.createElementVNode("div", { onClick: $2 }, "弹幕历史"), vue.createVNode(j2, { modelValue: r2.value, "onUpdate:modelValue": l3[3] || (l3[3] = (e4) => r2.value = e4), title: "弹幕历史", width: "70%", top: "6vh", "append-to-body": "", "destroy-on-close": "" }, { default: vue.withCtx(() => [vue.createElementVNode("div", sy, [vue.createElementVNode("div", iy, [vue.createElementVNode("img", { src: o2.chatUserCardData.avatar, class: "h-20 w-20 rounded-xl" }, null, 8, uy), vue.createElementVNode("span", cy, vue.toDisplayString(o2.chatUserCardData.nickName), 1)]), vue.createVNode(d3, { type: "primary", size: "small", onClick: y2 }, { default: vue.withCtx(() => [vue.createTextVNode("详情")]), _: 1 })]), vue.createElementVNode("div", dy, [vue.createElementVNode("div", null, [vue.createVNode(m3, { modelValue: u2.value, "onUpdate:modelValue": l3[0] || (l3[0] = (e4) => u2.value = e4), onChange: S2 }, { default: vue.withCtx(() => [vue.createVNode(v2, { label: "时间正序", value: "0" }), vue.createVNode(v2, { label: "时间倒序", value: "1" })]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(P3, { modelValue: f2.value, "onUpdate:modelValue": l3[1] || (l3[1] = (e4) => f2.value = e4), onChange: x2 }, { default: vue.withCtx(() => [vue.createVNode(L3, { value: "chat" }, { default: vue.withCtx(() => [vue.createTextVNode("弹幕")]), _: 1 }), vue.createVNode(L3, { value: "gift" }, { default: vue.withCtx(() => [vue.createTextVNode("礼物")]), _: 1 })]), _: 1 }, 8, ["modelValue"])]), vue.createElementVNode("div", null, [vue.createVNode(d3, { type: "primary", onClick: _2 }, { default: vue.withCtx(() => [vue.createTextVNode("前一天")]), _: 1 }), vue.createVNode(B2, { modelValue: c2.value, "onUpdate:modelValue": l3[2] || (l3[2] = (e4) => c2.value = e4), onChange: S2 }, null, 8, ["modelValue"]), vue.createVNode(d3, { type: "primary", onClick: C2 }, { default: vue.withCtx(() => [vue.createTextVNode("后一天")]), _: 1 })])]), vue.createVNode(V2), i2.value.length > 0 ? vue.withDirectives((vue.openBlock(), vue.createBlock(F2, { key: 0, class: "h-[58vh] w-full", height: "58vh", onScroll: D2, ref_key: "danmuContainer", ref: h2 }, { default: vue.withCtx(() => [(vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(i2.value, (e4, o3) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: `${o3}${e4.ts}` }, [p2[e4.type] ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [vue.createElementVNode("div", fy, [vue.createElementVNode("div", vy, [vue.createElementVNode("div", py, [vue.createElementVNode("span", null, vue.toDisplayString(b2(e4.ts)), 1), vue.createVNode(d3, { class: "ml-5", type: "primary", size: "small", plain: "", onClick: () => g2(e4.txt) }, { default: vue.withCtx(() => [vue.createTextVNode("复制")]), _: 2 }, 1032, ["onClick"]), vue.createVNode(d3, { class: "ml-12", type: "primary", size: "small", plain: "", onClick: () => k2(e4.txt) }, { default: vue.withCtx(() => [vue.createTextVNode("含名称复制")]), _: 2 }, 1032, ["onClick"])]), vue.createElementVNode("div", { class: "font-black text-3xl", innerHTML: e4.txt }, null, 8, my)]), vue.createElementVNode("div", { class: "flex cursor-pointer w-56 items-center flex-none", onClick: (t2) => w2(e4.rid) }, [vue.createElementVNode("img", { src: `https://apic.douyucdn.cn/upload/${e4["room.av"]}_middle.jpg`, class: "w-16 h-16 rounded-md" }, null, 8, by), vue.createElementVNode("div", null, vue.toDisplayString(e4["room.nn"]), 1)], 8, hy)]), vue.createVNode(V2)], 64)) : vue.createCommentVNode("", true)], 64))), 128))]), _: 1 })), [[z2, s2.value]]) : vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", gy, [vue.createTextVNode(" 翻来翻去还是没有记录 ")])), [[z2, s2.value]])]), _: 1 }, 8, ["modelValue"])], 64);
        };
      } });
      const _ky = class _ky {
        constructor() {
          __publicField(this, "observer", null);
          __publicField(this, "app", null);
        }
        init() {
          const e2 = document.querySelector(".layout-Player-userCard > div > div");
          this.observer = new MutationObserver(() => {
            const e3 = document.getElementById(_ky.appId);
            if (e3) {
              return;
            }
            const t2 = document.querySelectorAll("#layout-Player-aside > div.layout-Player-userCard > div > div > div:nth-child(1) > div div");
            if (t2.length === 0) {
              return;
            }
            let n2;
            for (let e4 = t2.length - 1; e4 >= 0; e4--) {
              const a3 = t2[e4];
              if (a3.className.indexOf("-action") > -1) {
                n2 = a3;
                break;
              }
            }
            if (!n2) {
              return;
            }
            const a2 = document.querySelector(".layout-Player-userCard > div > div > div:nth-child(1)");
            if (!a2) {
              return;
            }
            const o2 = Object.keys(a2).find((e4) => e4.startsWith("__reactInternalInstance$"));
            if (!o2) {
              return;
            }
            const r2 = a2[o2];
            const l2 = n2.childNodes;
            const s2 = document.createElement("a");
            s2.id = _ky.appId;
            s2.className = l2.length > 0 ? l2[0].className : "DiamondsFansCard-btn is-noble0";
            n2.appendChild(s2);
            this.app && this.app.unmount();
            setTimeout(() => {
              this.app = vue.createApp(wy, { chatUserCardData: r2.return.memoizedProps.chatUserCardData });
              this.app.mount(`#${_ky.appId}`);
            }, 0);
          });
          this.observer.observe(e2, { childList: true, subtree: true });
        }
        disconnect() {
          this.observer && this.observer.disconnect();
        }
      };
      __publicField(_ky, "appId", "danmu-history-btn");
      let ky = _ky;
      const xy = (e2, t2, n2) => {
        const a2 = new RegExp(`${t2}function\\s+${n2}\\s*\\([^)]*\\)\\s*{`);
        const o2 = e2.match(a2);
        if (!o2) {
          return null;
        }
        const r2 = o2.index + o2[0].length;
        let l2 = 1;
        let s2 = r2;
        while (s2 < e2.length && l2 > 0) {
          if (e2[s2] === "{") {
            l2++;
          } else if (e2[s2] === "}") {
            l2--;
          }
          s2++;
        }
        if (l2 !== 0) {
          return null;
        }
        return e2.substring(r2, s2 - 1);
      };
      class Sy {
      }
      const Cy = [];
      function _y(e2) {
        Cy.push(e2);
      }
      var My = Object.defineProperty;
      var Oy = Object.getOwnPropertyDescriptor;
      var Dy = (e2, t2, n2, a2) => {
        var o2 = a2 > 1 ? void 0 : a2 ? Oy(t2, n2) : t2;
        for (var r2 = e2.length - 1, l2; r2 >= 0; r2--) if (l2 = e2[r2]) o2 = (a2 ? l2(t2, n2, o2) : l2(o2)) || o2;
        if (a2 && o2) My(t2, n2, o2);
        return o2;
      };
      let Ay = class extends Sy {
        constructor() {
          super(...arguments);
          __publicField(this, "matchModuleList", ["popup", "ConstellationRomanceBanner", "DiamondsFansBanner", "GiftHallBanner", "SoundGiftBanner"]);
          __publicField(this, "matchContent", "BatchProp.prototype.componentWillMount");
        }
        newModuleStr(e2) {
          const t2 = xy(e2, "", "componentWillReceiveProps");
          if (!t2) {
            return null;
          }
          return e2.replace(t2, `${t2};this.state.propData.batchInfo[""+this.state.propData.count]={batchNum:this.state.propData.count,name:"暂不计算亲密度"}`);
        }
      };
      Ay = Dy([_y], Ay);
      const _Ey = class _Ey {
        constructor() {
          __publicField(this, "modifierList", []);
          __publicField(this, "isDefine", false);
          __publicField(this, "sharkRoomJsonp");
          this.initModifierList();
          this.interceptDefine();
        }
        initModifierList() {
          Cy.forEach((e2) => this.modifierList.push(new e2()));
        }
        interceptDefine() {
          const e2 = this;
          Object.defineProperty(ny, _Ey.TARGET_NAME, { get() {
            return e2.sharkRoomJsonp;
          }, set(t2) {
            e2.interceptPush(t2);
          }, configurable: true });
        }
        interceptPush(e2) {
          var _a2;
          this.sharkRoomJsonp = e2;
          const t2 = this;
          if (((_a2 = this.sharkRoomJsonp) == null ? void 0 : _a2.push.name) === "webpackJsonpCallback" && !this.isDefine) {
            const e3 = this.sharkRoomJsonp.push;
            this.sharkRoomJsonp.push = function(...n2) {
              const { modifierList: a2 } = t2;
              if (a2.length > 0) {
                for (const e4 of n2) {
                  if (a2.length === 0) {
                    break;
                  }
                  t2.modifyModule(e4);
                }
              }
              return e3.apply(this, n2);
            };
            this.isDefine = true;
          }
        }
        modifyModule(e2) {
          if (e2.length < 2) {
            return;
          }
          const [t2, n2] = e2;
          const { modifierList: a2 } = this;
          for (let e3 = a2.length - 1; e3 >= 0; e3--) {
            const o2 = a2[e3];
            const { matchModuleList: r2 } = o2;
            if (t2.length !== r2.length) {
              continue;
            }
            let l2 = true;
            for (let e4 = 0; e4 < r2.length; e4++) {
              if (!t2[e4].startsWith(r2[e4])) {
                l2 = false;
                break;
              }
            }
            if (!l2) {
              continue;
            }
            const s2 = Object.keys(n2);
            const { matchContent: i2 } = o2;
            for (const t3 of s2) {
              const r3 = n2[t3].toString();
              if (!r3.includes(i2)) {
                continue;
              }
              const l3 = o2.newModuleStr(r3);
              if (l3) {
                n2[t3] = new Function("return " + l3)();
              }
              a2.splice(e3, 1);
              break;
            }
          }
        }
      };
      __publicField(_Ey, "TARGET_NAME", "shark_room_jsonp");
      let Ey = _Ey;
      const $y = vue.defineComponent({ __name: "SettingButton", setup(e2) {
        const o2 = vue.ref(false);
        return (e3, r2) => {
          const l2 = id;
          const s2 = Lg;
          return vue.openBlock(), vue.createElementBlock("div", null, [vue.createElementVNode("div", { class: "handle-button", onClick: r2[0] || (r2[0] = (e4) => o2.value = true) }, [vue.createVNode(l2, { size: 24 }, { default: vue.withCtx(() => [vue.createVNode(vue.unref(bs))]), _: 1 })]), vue.createVNode(s2, { modelValue: o2.value, "onUpdate:modelValue": r2[1] || (r2[1] = (e4) => o2.value = e4), size: "300px", "with-header": false, "z-index": 99999 }, { default: vue.withCtx(() => [vue.renderSlot(e3.$slots, "default", {}, void 0, true)]), _: 3 }, 8, ["modelValue"])]);
        };
      } });
      const Ly = (e2, t2) => {
        const n2 = e2.__vccOpts || e2;
        for (const [e3, a2] of t2) {
          n2[e3] = a2;
        }
        return n2;
      };
      const Iy = Ly($y, [["__scopeId", "data-v-dacedd06"]]);
      const Ty = "douyu-crx";
      class Py {
      }
      __publicField(Py, "PAGE_CONFIG", `${Ty}-config-page-key`);
      const By = (e2) => ["hide"].includes(e2);
      const Ry = () => {
        const e2 = localStorage.getItem(Py.PAGE_CONFIG);
        return e2 ? JSON.parse(e2) : null;
      };
      const Vy = (e2) => {
        localStorage.setItem(Py.PAGE_CONFIG, JSON.stringify(e2));
      };
      const Fy = { giftBtn: { title: "隐藏直播画面底部所有按钮", hide: false, have: false }, activity: { title: "隐藏右侧活动浮窗", hide: false, have: false }, rank: { title: "隐藏排行榜", hide: false, have: false }, customerService: { title: "隐藏活动客服", hide: false, have: false }, entryReminder: { title: "隐藏入场提示", hide: false, have: false }, combatStatistics: { title: "隐藏PUBG战绩统计", hide: false, have: false }, videoTopAdvertisement: { title: "隐藏顶部广告", hide: true, have: false }, videoInsideAdvertisement: { title: "隐藏直播画面右下角广告", hide: true, have: false }, rankTopAdvertisement: { title: "隐藏排行榜顶部广告", hide: true, have: false } };
      const jy = Ry();
      if (jy) {
        for (const [e2, t2] of Object.entries(jy)) {
          const n2 = e2;
          const a2 = Fy[n2];
          if (a2) {
            Fy[n2] = { ...a2, ...t2 };
          }
        }
      }
      const zy = { ...Fy };
      const Ny = pinia.defineStore("settings", () => {
        const e2 = {};
        for (const [n2, a2] of Object.entries(zy)) {
          const o2 = vue.reactive(a2);
          e2[n2] = o2;
          vue.watch(() => o2.hide, () => {
            const e3 = t2();
            Vy(e3);
          });
        }
        const t2 = () => {
          const t3 = {};
          for (const [n2, a2] of Object.entries(e2)) {
            const e3 = n2;
            for (const [n3, o2] of Object.entries(a2)) {
              if (!By(n3)) {
                continue;
              }
              if (!t3[e3]) {
                t3[e3] = {};
              }
              t3[e3][n3] = o2;
            }
          }
          return t3;
        };
        return e2;
      });
      const Hy = { class: "p-[20px]" };
      const Yy = vue.createElementVNode("h4", { class: "font-bold text-xl" }, "页面配置", -1);
      const Wy = { key: 0, class: "flex justify-between items-center pt-[5px] text-[14px]" };
      const Uy = vue.defineComponent({ __name: "SettingPage", setup(e2) {
        const o2 = Ny();
        const r2 = pinia.storeToRefs(o2);
        return (e3, o3) => {
          const l2 = Yg;
          return vue.openBlock(), vue.createElementBlock("div", Hy, [Yy, (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(vue.unref(r2), (e4) => (vue.openBlock(), vue.createElementBlock(vue.Fragment, null, [e4.value.have ? (vue.openBlock(), vue.createElementBlock("div", Wy, [vue.createElementVNode("span", null, vue.toDisplayString(e4.value.title), 1), vue.createVNode(l2, { modelValue: e4.value.hide, "onUpdate:modelValue": (t2) => e4.value.hide = t2 }, null, 8, ["modelValue", "onUpdate:modelValue"])])) : vue.createCommentVNode("", true)], 64))), 256))]);
        };
      } });
      const Ky = vue.defineComponent({ __name: "index", setup(e2) {
        return (e3, n2) => (vue.openBlock(), vue.createBlock(Iy, null, { default: vue.withCtx(() => [vue.createVNode(Uy)]), _: 1 }));
      } });
      const qy = pinia.createPinia();
      const _Gy = class _Gy {
        constructor(e2) {
          __publicField(this, "app", null);
          this.initializerList = e2;
        }
        init() {
          const e2 = document.querySelector("body");
          const t2 = document.createElement("div");
          t2.id = _Gy.appId;
          e2.appendChild(t2);
          setTimeout(() => {
            this.app = vue.createApp(Ky);
            this.app.use(qy);
            this.app.mount(`#${_Gy.appId}`);
            this.initializerList.forEach((e3) => e3.init());
          });
        }
      };
      __publicField(_Gy, "appId", "setting-btn");
      let Gy = _Gy;
      class Zy {
        constructor(e2, t2) {
          __publicField(this, "target");
          __publicField(this, "oldDisplay");
          this.settingName = t2;
          const n2 = document.querySelector(e2);
          this.target = n2;
          this.oldDisplay = n2 == null ? void 0 : n2.style.display;
        }
        init() {
          if (!this.target) {
            return;
          }
          const e2 = Ny();
          const t2 = e2[this.settingName];
          t2.have = true;
          vue.watch(() => t2.hide, (e3) => {
            if (e3) {
              this.hide();
              return;
            }
            this.show();
          }, { immediate: true });
        }
        hide() {
          this.target.style.display = "none";
        }
        show() {
          this.target.style.display = this.oldDisplay;
        }
      }
      class Jy extends Zy {
        constructor(e2, t2) {
          super(e2, t2);
          __publicField(this, "asideMain");
          __publicField(this, "oldStyle");
          const n2 = document.querySelector("#js-player-asideMain");
          this.asideMain = n2;
          this.oldStyle = this.asideMain.style;
        }
        hide() {
          super.hide();
          this.asideMain.style.top = "0";
        }
        show() {
          super.show();
          this.asideMain.style = this.oldStyle;
        }
      }
      class Xy {
        init() {
          const e2 = document.createElement("script");
          e2.src = "https://hm.baidu.com/hm.js?5c04e81d1fc372b0efa06e8c1b711042";
          const t2 = document.getElementsByTagName("script")[0];
          t2 && t2.parentNode && t2.parentNode.insertBefore(e2, t2);
        }
      }
      Qy();
      async function Qy() {
        new Ey();
        await new ge().observe();
        [new ky(), new Gy([new Zy(".PlayerToolbar", "giftBtn"), new Zy("#js-room-activity", "activity"), new Zy("#js-room-top-banner", "videoTopAdvertisement"), new Zy(".layout-Player-rank", "rank"), new Zy(".IconCardAdBoundsBox", "videoInsideAdvertisement"), new Zy("#webmActKefuWeidget", "customerService"), new Zy("#js-barrage-extend-container", "entryReminder"), new Zy(".PubgInfo", "combatStatistics"), new Jy("#js-player-asideTopSuspension", "rankTopAdvertisement")]), new Xy()].forEach((e2) => e2.init());
      }
    }
  });
  require_main_001();

})(Vue, ElementPlus, Qs, VueDemi, Pinia);